62237 lines
1.9 MiB
62237 lines
1.9 MiB
/*!
|
|
* TOAST UI ImageEditor
|
|
* @version 3.15.3
|
|
* @license MIT
|
|
*/
|
|
(function webpackUniversalModuleDefinition(root, factory) {
|
|
if(typeof exports === 'object' && typeof module === 'object')
|
|
module.exports = factory(require("tui-color-picker"));
|
|
else if(typeof define === 'function' && define.amd)
|
|
define(["tui-color-picker"], factory);
|
|
else if(typeof exports === 'object')
|
|
exports["tui"] = factory(require("tui-color-picker"));
|
|
else
|
|
root["tui"] = root["tui"] || {}, root["tui"]["ImageEditor"] = factory(root["tui"]["colorPicker"]);
|
|
})(self, function(__WEBPACK_EXTERNAL_MODULE__4858__) {
|
|
return /******/ (function() { // webpackBootstrap
|
|
/******/ var __webpack_modules__ = ({
|
|
|
|
/***/ 2777:
|
|
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {
|
|
|
|
/* build: `node build.js modules=ALL exclude=gestures,accessors,erasing requirejs minifier=uglifyjs` */
|
|
/*! Fabric.js Copyright 2008-2015, Printio (Juriy Zaytsev, Maxim Chernyak) */
|
|
|
|
var fabric = fabric || { version: '4.6.0' };
|
|
if (true) {
|
|
exports.fabric = fabric;
|
|
}
|
|
/* _AMD_START_ */
|
|
else {}
|
|
/* _AMD_END_ */
|
|
if (typeof document !== 'undefined' && typeof window !== 'undefined') {
|
|
if (document instanceof (typeof HTMLDocument !== 'undefined' ? HTMLDocument : Document)) {
|
|
fabric.document = document;
|
|
}
|
|
else {
|
|
fabric.document = document.implementation.createHTMLDocument('');
|
|
}
|
|
fabric.window = window;
|
|
}
|
|
else {
|
|
// assume we're running under node.js when document/window are not present
|
|
var jsdom = __webpack_require__(4960);
|
|
var virtualWindow = new jsdom.JSDOM(
|
|
decodeURIComponent('%3C!DOCTYPE%20html%3E%3Chtml%3E%3Chead%3E%3C%2Fhead%3E%3Cbody%3E%3C%2Fbody%3E%3C%2Fhtml%3E'),
|
|
{
|
|
features: {
|
|
FetchExternalResources: ['img']
|
|
},
|
|
resources: 'usable'
|
|
}).window;
|
|
fabric.document = virtualWindow.document;
|
|
fabric.jsdomImplForWrapper = __webpack_require__(6759).implForWrapper;
|
|
fabric.nodeCanvas = __webpack_require__(6272).Canvas;
|
|
fabric.window = virtualWindow;
|
|
DOMParser = fabric.window.DOMParser;
|
|
}
|
|
|
|
/**
|
|
* True when in environment that supports touch events
|
|
* @type boolean
|
|
*/
|
|
fabric.isTouchSupported = 'ontouchstart' in fabric.window || 'ontouchstart' in fabric.document ||
|
|
(fabric.window && fabric.window.navigator && fabric.window.navigator.maxTouchPoints > 0);
|
|
|
|
/**
|
|
* True when in environment that's probably Node.js
|
|
* @type boolean
|
|
*/
|
|
fabric.isLikelyNode = typeof Buffer !== 'undefined' &&
|
|
typeof window === 'undefined';
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* Attributes parsed from all SVG elements
|
|
* @type array
|
|
*/
|
|
fabric.SHARED_ATTRIBUTES = [
|
|
'display',
|
|
'transform',
|
|
'fill', 'fill-opacity', 'fill-rule',
|
|
'opacity',
|
|
'stroke', 'stroke-dasharray', 'stroke-linecap', 'stroke-dashoffset',
|
|
'stroke-linejoin', 'stroke-miterlimit',
|
|
'stroke-opacity', 'stroke-width',
|
|
'id', 'paint-order', 'vector-effect',
|
|
'instantiated_by_use', 'clip-path',
|
|
];
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Pixel per Inch as a default value set to 96. Can be changed for more realistic conversion.
|
|
*/
|
|
fabric.DPI = 96;
|
|
fabric.reNum = '(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:[eE][-+]?\\d+)?)';
|
|
fabric.commaWsp = '(?:\\s+,?\\s*|,\\s*)';
|
|
fabric.rePathCommand = /([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:[eE][-+]?\d+)?)/ig;
|
|
fabric.reNonWord = /[ \n\.,;!\?\-]/;
|
|
fabric.fontPaths = { };
|
|
fabric.iMatrix = [1, 0, 0, 1, 0, 0];
|
|
fabric.svgNS = 'http://www.w3.org/2000/svg';
|
|
|
|
/**
|
|
* Pixel limit for cache canvases. 1Mpx , 4Mpx should be fine.
|
|
* @since 1.7.14
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
fabric.perfLimitSizeTotal = 2097152;
|
|
|
|
/**
|
|
* Pixel limit for cache canvases width or height. IE fixes the maximum at 5000
|
|
* @since 1.7.14
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
fabric.maxCacheSideLimit = 4096;
|
|
|
|
/**
|
|
* Lowest pixel limit for cache canvases, set at 256PX
|
|
* @since 1.7.14
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
fabric.minCacheSideLimit = 256;
|
|
|
|
/**
|
|
* Cache Object for widths of chars in text rendering.
|
|
*/
|
|
fabric.charWidthsCache = { };
|
|
|
|
/**
|
|
* if webgl is enabled and available, textureSize will determine the size
|
|
* of the canvas backend
|
|
* @since 2.0.0
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
fabric.textureSize = 2048;
|
|
|
|
/**
|
|
* When 'true', style information is not retained when copy/pasting text, making
|
|
* pasted text use destination style.
|
|
* Defaults to 'false'.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
fabric.disableStyleCopyPaste = false;
|
|
|
|
/**
|
|
* Enable webgl for filtering picture is available
|
|
* A filtering backend will be initialized, this will both take memory and
|
|
* time since a default 2048x2048 canvas will be created for the gl context
|
|
* @since 2.0.0
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
fabric.enableGLFiltering = true;
|
|
|
|
/**
|
|
* Device Pixel Ratio
|
|
* @see https://developer.apple.com/library/safari/documentation/AudioVideo/Conceptual/HTML-canvas-guide/SettingUptheCanvas/SettingUptheCanvas.html
|
|
*/
|
|
fabric.devicePixelRatio = fabric.window.devicePixelRatio ||
|
|
fabric.window.webkitDevicePixelRatio ||
|
|
fabric.window.mozDevicePixelRatio ||
|
|
1;
|
|
/**
|
|
* Browser-specific constant to adjust CanvasRenderingContext2D.shadowBlur value,
|
|
* which is unitless and not rendered equally across browsers.
|
|
*
|
|
* Values that work quite well (as of October 2017) are:
|
|
* - Chrome: 1.5
|
|
* - Edge: 1.75
|
|
* - Firefox: 0.9
|
|
* - Safari: 0.95
|
|
*
|
|
* @since 2.0.0
|
|
* @type Number
|
|
* @default 1
|
|
*/
|
|
fabric.browserShadowBlurConstant = 1;
|
|
|
|
/**
|
|
* This object contains the result of arc to bezier conversion for faster retrieving if the same arc needs to be converted again.
|
|
* It was an internal variable, is accessible since version 2.3.4
|
|
*/
|
|
fabric.arcToSegmentsCache = { };
|
|
|
|
/**
|
|
* This object keeps the results of the boundsOfCurve calculation mapped by the joined arguments necessary to calculate it.
|
|
* It does speed up calculation, if you parse and add always the same paths, but in case of heavy usage of freedrawing
|
|
* you do not get any speed benefit and you get a big object in memory.
|
|
* The object was a private variable before, while now is appended to the lib so that you have access to it and you
|
|
* can eventually clear it.
|
|
* It was an internal variable, is accessible since version 2.3.4
|
|
*/
|
|
fabric.boundsOfCurveCache = { };
|
|
|
|
/**
|
|
* If disabled boundsOfCurveCache is not used. For apps that make heavy usage of pencil drawing probably disabling it is better
|
|
* @default true
|
|
*/
|
|
fabric.cachesBoundsOfCurve = true;
|
|
|
|
/**
|
|
* Skip performance testing of setupGLContext and force the use of putImageData that seems to be the one that works best on
|
|
* Chrome + old hardware. if your users are experiencing empty images after filtering you may try to force this to true
|
|
* this has to be set before instantiating the filtering backend ( before filtering the first image )
|
|
* @type Boolean
|
|
* @default false
|
|
*/
|
|
fabric.forceGLPutImageData = false;
|
|
|
|
fabric.initFilterBackend = function() {
|
|
if (fabric.enableGLFiltering && fabric.isWebglSupported && fabric.isWebglSupported(fabric.textureSize)) {
|
|
console.log('max texture size: ' + fabric.maxTextureSize);
|
|
return (new fabric.WebglFilterBackend({ tileSize: fabric.textureSize }));
|
|
}
|
|
else if (fabric.Canvas2dFilterBackend) {
|
|
return (new fabric.Canvas2dFilterBackend());
|
|
}
|
|
};
|
|
|
|
|
|
if (typeof document !== 'undefined' && typeof window !== 'undefined') {
|
|
// ensure globality even if entire library were function wrapped (as in Meteor.js packaging system)
|
|
window.fabric = fabric;
|
|
}
|
|
|
|
|
|
(function() {
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} eventName
|
|
* @param {Function} handler
|
|
*/
|
|
function _removeEventListener(eventName, handler) {
|
|
if (!this.__eventListeners[eventName]) {
|
|
return;
|
|
}
|
|
var eventListener = this.__eventListeners[eventName];
|
|
if (handler) {
|
|
eventListener[eventListener.indexOf(handler)] = false;
|
|
}
|
|
else {
|
|
fabric.util.array.fill(eventListener, false);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Observes specified event
|
|
* @memberOf fabric.Observable
|
|
* @alias on
|
|
* @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler})
|
|
* @param {Function} handler Function that receives a notification when an event of the specified type occurs
|
|
* @return {Self} thisArg
|
|
* @chainable
|
|
*/
|
|
function on(eventName, handler) {
|
|
if (!this.__eventListeners) {
|
|
this.__eventListeners = { };
|
|
}
|
|
// one object with key/value pairs was passed
|
|
if (arguments.length === 1) {
|
|
for (var prop in eventName) {
|
|
this.on(prop, eventName[prop]);
|
|
}
|
|
}
|
|
else {
|
|
if (!this.__eventListeners[eventName]) {
|
|
this.__eventListeners[eventName] = [];
|
|
}
|
|
this.__eventListeners[eventName].push(handler);
|
|
}
|
|
return this;
|
|
}
|
|
|
|
function _once(eventName, handler) {
|
|
var _handler = function () {
|
|
handler.apply(this, arguments);
|
|
this.off(eventName, _handler);
|
|
}.bind(this);
|
|
this.on(eventName, _handler);
|
|
}
|
|
|
|
function once(eventName, handler) {
|
|
// one object with key/value pairs was passed
|
|
if (arguments.length === 1) {
|
|
for (var prop in eventName) {
|
|
_once.call(this, prop, eventName[prop]);
|
|
}
|
|
}
|
|
else {
|
|
_once.call(this, eventName, handler);
|
|
}
|
|
return this;
|
|
}
|
|
|
|
/**
|
|
* Stops event observing for a particular event handler. Calling this method
|
|
* without arguments removes all handlers for all events
|
|
* @memberOf fabric.Observable
|
|
* @alias off
|
|
* @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler})
|
|
* @param {Function} handler Function to be deleted from EventListeners
|
|
* @return {Self} thisArg
|
|
* @chainable
|
|
*/
|
|
function off(eventName, handler) {
|
|
if (!this.__eventListeners) {
|
|
return this;
|
|
}
|
|
|
|
// remove all key/value pairs (event name -> event handler)
|
|
if (arguments.length === 0) {
|
|
for (eventName in this.__eventListeners) {
|
|
_removeEventListener.call(this, eventName);
|
|
}
|
|
}
|
|
// one object with key/value pairs was passed
|
|
else if (arguments.length === 1 && typeof arguments[0] === 'object') {
|
|
for (var prop in eventName) {
|
|
_removeEventListener.call(this, prop, eventName[prop]);
|
|
}
|
|
}
|
|
else {
|
|
_removeEventListener.call(this, eventName, handler);
|
|
}
|
|
return this;
|
|
}
|
|
|
|
/**
|
|
* Fires event with an optional options object
|
|
* @memberOf fabric.Observable
|
|
* @param {String} eventName Event name to fire
|
|
* @param {Object} [options] Options object
|
|
* @return {Self} thisArg
|
|
* @chainable
|
|
*/
|
|
function fire(eventName, options) {
|
|
if (!this.__eventListeners) {
|
|
return this;
|
|
}
|
|
|
|
var listenersForEvent = this.__eventListeners[eventName];
|
|
if (!listenersForEvent) {
|
|
return this;
|
|
}
|
|
|
|
for (var i = 0, len = listenersForEvent.length; i < len; i++) {
|
|
listenersForEvent[i] && listenersForEvent[i].call(this, options || { });
|
|
}
|
|
this.__eventListeners[eventName] = listenersForEvent.filter(function(value) {
|
|
return value !== false;
|
|
});
|
|
return this;
|
|
}
|
|
|
|
/**
|
|
* @namespace fabric.Observable
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-2#events}
|
|
* @see {@link http://fabricjs.com/events|Events demo}
|
|
*/
|
|
fabric.Observable = {
|
|
fire: fire,
|
|
on: on,
|
|
once: once,
|
|
off: off,
|
|
};
|
|
})();
|
|
|
|
|
|
/**
|
|
* @namespace fabric.Collection
|
|
*/
|
|
fabric.Collection = {
|
|
|
|
_objects: [],
|
|
|
|
/**
|
|
* Adds objects to collection, Canvas or Group, then renders canvas
|
|
* (if `renderOnAddRemove` is not `false`).
|
|
* in case of Group no changes to bounding box are made.
|
|
* Objects should be instances of (or inherit from) fabric.Object
|
|
* Use of this function is highly discouraged for groups.
|
|
* you can add a bunch of objects with the add method but then you NEED
|
|
* to run a addWithUpdate call for the Group class or position/bbox will be wrong.
|
|
* @param {...fabric.Object} object Zero or more fabric instances
|
|
* @return {Self} thisArg
|
|
* @chainable
|
|
*/
|
|
add: function () {
|
|
this._objects.push.apply(this._objects, arguments);
|
|
if (this._onObjectAdded) {
|
|
for (var i = 0, length = arguments.length; i < length; i++) {
|
|
this._onObjectAdded(arguments[i]);
|
|
}
|
|
}
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Inserts an object into collection at specified index, then renders canvas (if `renderOnAddRemove` is not `false`)
|
|
* An object should be an instance of (or inherit from) fabric.Object
|
|
* Use of this function is highly discouraged for groups.
|
|
* you can add a bunch of objects with the insertAt method but then you NEED
|
|
* to run a addWithUpdate call for the Group class or position/bbox will be wrong.
|
|
* @param {Object} object Object to insert
|
|
* @param {Number} index Index to insert object at
|
|
* @param {Boolean} nonSplicing When `true`, no splicing (shifting) of objects occurs
|
|
* @return {Self} thisArg
|
|
* @chainable
|
|
*/
|
|
insertAt: function (object, index, nonSplicing) {
|
|
var objects = this._objects;
|
|
if (nonSplicing) {
|
|
objects[index] = object;
|
|
}
|
|
else {
|
|
objects.splice(index, 0, object);
|
|
}
|
|
this._onObjectAdded && this._onObjectAdded(object);
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Removes objects from a collection, then renders canvas (if `renderOnAddRemove` is not `false`)
|
|
* @param {...fabric.Object} object Zero or more fabric instances
|
|
* @return {Self} thisArg
|
|
* @chainable
|
|
*/
|
|
remove: function() {
|
|
var objects = this._objects,
|
|
index, somethingRemoved = false;
|
|
|
|
for (var i = 0, length = arguments.length; i < length; i++) {
|
|
index = objects.indexOf(arguments[i]);
|
|
|
|
// only call onObjectRemoved if an object was actually removed
|
|
if (index !== -1) {
|
|
somethingRemoved = true;
|
|
objects.splice(index, 1);
|
|
this._onObjectRemoved && this._onObjectRemoved(arguments[i]);
|
|
}
|
|
}
|
|
|
|
this.renderOnAddRemove && somethingRemoved && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Executes given function for each object in this group
|
|
* @param {Function} callback
|
|
* Callback invoked with current object as first argument,
|
|
* index - as second and an array of all objects - as third.
|
|
* Callback is invoked in a context of Global Object (e.g. `window`)
|
|
* when no `context` argument is given
|
|
*
|
|
* @param {Object} context Context (aka thisObject)
|
|
* @return {Self} thisArg
|
|
* @chainable
|
|
*/
|
|
forEachObject: function(callback, context) {
|
|
var objects = this.getObjects();
|
|
for (var i = 0, len = objects.length; i < len; i++) {
|
|
callback.call(context, objects[i], i, objects);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns an array of children objects of this instance
|
|
* Type parameter introduced in 1.3.10
|
|
* since 2.3.5 this method return always a COPY of the array;
|
|
* @param {String} [type] When specified, only objects of this type are returned
|
|
* @return {Array}
|
|
*/
|
|
getObjects: function(type) {
|
|
if (typeof type === 'undefined') {
|
|
return this._objects.concat();
|
|
}
|
|
return this._objects.filter(function(o) {
|
|
return o.type === type;
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Returns object at specified index
|
|
* @param {Number} index
|
|
* @return {Self} thisArg
|
|
*/
|
|
item: function (index) {
|
|
return this._objects[index];
|
|
},
|
|
|
|
/**
|
|
* Returns true if collection contains no objects
|
|
* @return {Boolean} true if collection is empty
|
|
*/
|
|
isEmpty: function () {
|
|
return this._objects.length === 0;
|
|
},
|
|
|
|
/**
|
|
* Returns a size of a collection (i.e: length of an array containing its objects)
|
|
* @return {Number} Collection size
|
|
*/
|
|
size: function() {
|
|
return this._objects.length;
|
|
},
|
|
|
|
/**
|
|
* Returns true if collection contains an object
|
|
* @param {Object} object Object to check against
|
|
* @param {Boolean} [deep=false] `true` to check all descendants, `false` to check only `_objects`
|
|
* @return {Boolean} `true` if collection contains an object
|
|
*/
|
|
contains: function (object, deep) {
|
|
if (this._objects.indexOf(object) > -1) {
|
|
return true;
|
|
}
|
|
else if (deep) {
|
|
return this._objects.some(function (obj) {
|
|
return typeof obj.contains === 'function' && obj.contains(object, true);
|
|
});
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Returns number representation of a collection complexity
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function () {
|
|
return this._objects.reduce(function (memo, current) {
|
|
memo += current.complexity ? current.complexity() : 0;
|
|
return memo;
|
|
}, 0);
|
|
}
|
|
};
|
|
|
|
|
|
/**
|
|
* @namespace fabric.CommonMethods
|
|
*/
|
|
fabric.CommonMethods = {
|
|
|
|
/**
|
|
* Sets object's properties from options
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
_setOptions: function(options) {
|
|
for (var prop in options) {
|
|
this.set(prop, options[prop]);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [filler] Options object
|
|
* @param {String} [property] property to set the Gradient to
|
|
*/
|
|
_initGradient: function(filler, property) {
|
|
if (filler && filler.colorStops && !(filler instanceof fabric.Gradient)) {
|
|
this.set(property, new fabric.Gradient(filler));
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [filler] Options object
|
|
* @param {String} [property] property to set the Pattern to
|
|
* @param {Function} [callback] callback to invoke after pattern load
|
|
*/
|
|
_initPattern: function(filler, property, callback) {
|
|
if (filler && filler.source && !(filler instanceof fabric.Pattern)) {
|
|
this.set(property, new fabric.Pattern(filler, callback));
|
|
}
|
|
else {
|
|
callback && callback();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setObject: function(obj) {
|
|
for (var prop in obj) {
|
|
this._set(prop, obj[prop]);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`.
|
|
* @param {String|Object} key Property name or object (if object, iterate over the object properties)
|
|
* @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one)
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
set: function(key, value) {
|
|
if (typeof key === 'object') {
|
|
this._setObject(key);
|
|
}
|
|
else {
|
|
this._set(key, value);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
_set: function(key, value) {
|
|
this[key] = value;
|
|
},
|
|
|
|
/**
|
|
* Toggles specified property from `true` to `false` or from `false` to `true`
|
|
* @param {String} property Property to toggle
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
toggle: function(property) {
|
|
var value = this.get(property);
|
|
if (typeof value === 'boolean') {
|
|
this.set(property, !value);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Basic getter
|
|
* @param {String} property Property name
|
|
* @return {*} value of a property
|
|
*/
|
|
get: function(property) {
|
|
return this[property];
|
|
}
|
|
};
|
|
|
|
|
|
(function(global) {
|
|
|
|
var sqrt = Math.sqrt,
|
|
atan2 = Math.atan2,
|
|
pow = Math.pow,
|
|
PiBy180 = Math.PI / 180,
|
|
PiBy2 = Math.PI / 2;
|
|
|
|
/**
|
|
* @namespace fabric.util
|
|
*/
|
|
fabric.util = {
|
|
|
|
/**
|
|
* Calculate the cos of an angle, avoiding returning floats for known results
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} angle the angle in radians or in degree
|
|
* @return {Number}
|
|
*/
|
|
cos: function(angle) {
|
|
if (angle === 0) { return 1; }
|
|
if (angle < 0) {
|
|
// cos(a) = cos(-a)
|
|
angle = -angle;
|
|
}
|
|
var angleSlice = angle / PiBy2;
|
|
switch (angleSlice) {
|
|
case 1: case 3: return 0;
|
|
case 2: return -1;
|
|
}
|
|
return Math.cos(angle);
|
|
},
|
|
|
|
/**
|
|
* Calculate the sin of an angle, avoiding returning floats for known results
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} angle the angle in radians or in degree
|
|
* @return {Number}
|
|
*/
|
|
sin: function(angle) {
|
|
if (angle === 0) { return 0; }
|
|
var angleSlice = angle / PiBy2, sign = 1;
|
|
if (angle < 0) {
|
|
// sin(-a) = -sin(a)
|
|
sign = -1;
|
|
}
|
|
switch (angleSlice) {
|
|
case 1: return sign;
|
|
case 2: return 0;
|
|
case 3: return -sign;
|
|
}
|
|
return Math.sin(angle);
|
|
},
|
|
|
|
/**
|
|
* Removes value from an array.
|
|
* Presence of value (and its position in an array) is determined via `Array.prototype.indexOf`
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} array
|
|
* @param {*} value
|
|
* @return {Array} original array
|
|
*/
|
|
removeFromArray: function(array, value) {
|
|
var idx = array.indexOf(value);
|
|
if (idx !== -1) {
|
|
array.splice(idx, 1);
|
|
}
|
|
return array;
|
|
},
|
|
|
|
/**
|
|
* Returns random number between 2 specified ones.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} min lower limit
|
|
* @param {Number} max upper limit
|
|
* @return {Number} random value (between min and max)
|
|
*/
|
|
getRandomInt: function(min, max) {
|
|
return Math.floor(Math.random() * (max - min + 1)) + min;
|
|
},
|
|
|
|
/**
|
|
* Transforms degrees to radians.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} degrees value in degrees
|
|
* @return {Number} value in radians
|
|
*/
|
|
degreesToRadians: function(degrees) {
|
|
return degrees * PiBy180;
|
|
},
|
|
|
|
/**
|
|
* Transforms radians to degrees.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number} radians value in radians
|
|
* @return {Number} value in degrees
|
|
*/
|
|
radiansToDegrees: function(radians) {
|
|
return radians / PiBy180;
|
|
},
|
|
|
|
/**
|
|
* Rotates `point` around `origin` with `radians`
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Point} point The point to rotate
|
|
* @param {fabric.Point} origin The origin of the rotation
|
|
* @param {Number} radians The radians of the angle for the rotation
|
|
* @return {fabric.Point} The new rotated point
|
|
*/
|
|
rotatePoint: function(point, origin, radians) {
|
|
var newPoint = new fabric.Point(point.x - origin.x, point.y - origin.y),
|
|
v = fabric.util.rotateVector(newPoint, radians);
|
|
return new fabric.Point(v.x, v.y).addEquals(origin);
|
|
},
|
|
|
|
/**
|
|
* Rotates `vector` with `radians`
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Object} vector The vector to rotate (x and y)
|
|
* @param {Number} radians The radians of the angle for the rotation
|
|
* @return {Object} The new rotated point
|
|
*/
|
|
rotateVector: function(vector, radians) {
|
|
var sin = fabric.util.sin(radians),
|
|
cos = fabric.util.cos(radians),
|
|
rx = vector.x * cos - vector.y * sin,
|
|
ry = vector.x * sin + vector.y * cos;
|
|
return {
|
|
x: rx,
|
|
y: ry
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Apply transform t to point p
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Point} p The point to transform
|
|
* @param {Array} t The transform
|
|
* @param {Boolean} [ignoreOffset] Indicates that the offset should not be applied
|
|
* @return {fabric.Point} The transformed point
|
|
*/
|
|
transformPoint: function(p, t, ignoreOffset) {
|
|
if (ignoreOffset) {
|
|
return new fabric.Point(
|
|
t[0] * p.x + t[2] * p.y,
|
|
t[1] * p.x + t[3] * p.y
|
|
);
|
|
}
|
|
return new fabric.Point(
|
|
t[0] * p.x + t[2] * p.y + t[4],
|
|
t[1] * p.x + t[3] * p.y + t[5]
|
|
);
|
|
},
|
|
|
|
/**
|
|
* Returns coordinates of points's bounding rectangle (left, top, width, height)
|
|
* @param {Array} points 4 points array
|
|
* @param {Array} [transform] an array of 6 numbers representing a 2x3 transform matrix
|
|
* @return {Object} Object with left, top, width, height properties
|
|
*/
|
|
makeBoundingBoxFromPoints: function(points, transform) {
|
|
if (transform) {
|
|
for (var i = 0; i < points.length; i++) {
|
|
points[i] = fabric.util.transformPoint(points[i], transform);
|
|
}
|
|
}
|
|
var xPoints = [points[0].x, points[1].x, points[2].x, points[3].x],
|
|
minX = fabric.util.array.min(xPoints),
|
|
maxX = fabric.util.array.max(xPoints),
|
|
width = maxX - minX,
|
|
yPoints = [points[0].y, points[1].y, points[2].y, points[3].y],
|
|
minY = fabric.util.array.min(yPoints),
|
|
maxY = fabric.util.array.max(yPoints),
|
|
height = maxY - minY;
|
|
|
|
return {
|
|
left: minX,
|
|
top: minY,
|
|
width: width,
|
|
height: height
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Invert transformation t
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} t The transform
|
|
* @return {Array} The inverted transform
|
|
*/
|
|
invertTransform: function(t) {
|
|
var a = 1 / (t[0] * t[3] - t[1] * t[2]),
|
|
r = [a * t[3], -a * t[1], -a * t[2], a * t[0]],
|
|
o = fabric.util.transformPoint({ x: t[4], y: t[5] }, r, true);
|
|
r[4] = -o.x;
|
|
r[5] = -o.y;
|
|
return r;
|
|
},
|
|
|
|
/**
|
|
* A wrapper around Number#toFixed, which contrary to native method returns number, not string.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Number|String} number number to operate on
|
|
* @param {Number} fractionDigits number of fraction digits to "leave"
|
|
* @return {Number}
|
|
*/
|
|
toFixed: function(number, fractionDigits) {
|
|
return parseFloat(Number(number).toFixed(fractionDigits));
|
|
},
|
|
|
|
/**
|
|
* Converts from attribute value to pixel value if applicable.
|
|
* Returns converted pixels or original value not converted.
|
|
* @param {Number|String} value number to operate on
|
|
* @param {Number} fontSize
|
|
* @return {Number|String}
|
|
*/
|
|
parseUnit: function(value, fontSize) {
|
|
var unit = /\D{0,2}$/.exec(value),
|
|
number = parseFloat(value);
|
|
if (!fontSize) {
|
|
fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE;
|
|
}
|
|
switch (unit[0]) {
|
|
case 'mm':
|
|
return number * fabric.DPI / 25.4;
|
|
|
|
case 'cm':
|
|
return number * fabric.DPI / 2.54;
|
|
|
|
case 'in':
|
|
return number * fabric.DPI;
|
|
|
|
case 'pt':
|
|
return number * fabric.DPI / 72; // or * 4 / 3
|
|
|
|
case 'pc':
|
|
return number * fabric.DPI / 72 * 12; // or * 16
|
|
|
|
case 'em':
|
|
return number * fontSize;
|
|
|
|
default:
|
|
return number;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Function which always returns `false`.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @return {Boolean}
|
|
*/
|
|
falseFunction: function() {
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Returns klass "Class" object of given namespace
|
|
* @memberOf fabric.util
|
|
* @param {String} type Type of object (eg. 'circle')
|
|
* @param {String} namespace Namespace to get klass "Class" object from
|
|
* @return {Object} klass "Class"
|
|
*/
|
|
getKlass: function(type, namespace) {
|
|
// capitalize first letter only
|
|
type = fabric.util.string.camelize(type.charAt(0).toUpperCase() + type.slice(1));
|
|
return fabric.util.resolveNamespace(namespace)[type];
|
|
},
|
|
|
|
/**
|
|
* Returns array of attributes for given svg that fabric parses
|
|
* @memberOf fabric.util
|
|
* @param {String} type Type of svg element (eg. 'circle')
|
|
* @return {Array} string names of supported attributes
|
|
*/
|
|
getSvgAttributes: function(type) {
|
|
var attributes = [
|
|
'instantiated_by_use',
|
|
'style',
|
|
'id',
|
|
'class'
|
|
];
|
|
switch (type) {
|
|
case 'linearGradient':
|
|
attributes = attributes.concat(['x1', 'y1', 'x2', 'y2', 'gradientUnits', 'gradientTransform']);
|
|
break;
|
|
case 'radialGradient':
|
|
attributes = attributes.concat(['gradientUnits', 'gradientTransform', 'cx', 'cy', 'r', 'fx', 'fy', 'fr']);
|
|
break;
|
|
case 'stop':
|
|
attributes = attributes.concat(['offset', 'stop-color', 'stop-opacity']);
|
|
break;
|
|
}
|
|
return attributes;
|
|
},
|
|
|
|
/**
|
|
* Returns object of given namespace
|
|
* @memberOf fabric.util
|
|
* @param {String} namespace Namespace string e.g. 'fabric.Image.filter' or 'fabric'
|
|
* @return {Object} Object for given namespace (default fabric)
|
|
*/
|
|
resolveNamespace: function(namespace) {
|
|
if (!namespace) {
|
|
return fabric;
|
|
}
|
|
|
|
var parts = namespace.split('.'),
|
|
len = parts.length, i,
|
|
obj = global || fabric.window;
|
|
|
|
for (i = 0; i < len; ++i) {
|
|
obj = obj[parts[i]];
|
|
}
|
|
|
|
return obj;
|
|
},
|
|
|
|
/**
|
|
* Loads image element from given url and passes it to a callback
|
|
* @memberOf fabric.util
|
|
* @param {String} url URL representing an image
|
|
* @param {Function} callback Callback; invoked with loaded image
|
|
* @param {*} [context] Context to invoke callback in
|
|
* @param {Object} [crossOrigin] crossOrigin value to set image element to
|
|
*/
|
|
loadImage: function(url, callback, context, crossOrigin) {
|
|
if (!url) {
|
|
callback && callback.call(context, url);
|
|
return;
|
|
}
|
|
|
|
var img = fabric.util.createImage();
|
|
|
|
/** @ignore */
|
|
var onLoadCallback = function () {
|
|
callback && callback.call(context, img, false);
|
|
img = img.onload = img.onerror = null;
|
|
};
|
|
|
|
img.onload = onLoadCallback;
|
|
/** @ignore */
|
|
img.onerror = function() {
|
|
fabric.log('Error loading ' + img.src);
|
|
callback && callback.call(context, null, true);
|
|
img = img.onload = img.onerror = null;
|
|
};
|
|
|
|
// data-urls appear to be buggy with crossOrigin
|
|
// https://github.com/kangax/fabric.js/commit/d0abb90f1cd5c5ef9d2a94d3fb21a22330da3e0a#commitcomment-4513767
|
|
// see https://code.google.com/p/chromium/issues/detail?id=315152
|
|
// https://bugzilla.mozilla.org/show_bug.cgi?id=935069
|
|
// crossOrigin null is the same as not set.
|
|
if (url.indexOf('data') !== 0 &&
|
|
crossOrigin !== undefined &&
|
|
crossOrigin !== null) {
|
|
img.crossOrigin = crossOrigin;
|
|
}
|
|
|
|
// IE10 / IE11-Fix: SVG contents from data: URI
|
|
// will only be available if the IMG is present
|
|
// in the DOM (and visible)
|
|
if (url.substring(0,14) === 'data:image/svg') {
|
|
img.onload = null;
|
|
fabric.util.loadImageInDom(img, onLoadCallback);
|
|
}
|
|
|
|
img.src = url;
|
|
},
|
|
|
|
/**
|
|
* Attaches SVG image with data: URL to the dom
|
|
* @memberOf fabric.util
|
|
* @param {Object} img Image object with data:image/svg src
|
|
* @param {Function} callback Callback; invoked with loaded image
|
|
* @return {Object} DOM element (div containing the SVG image)
|
|
*/
|
|
loadImageInDom: function(img, onLoadCallback) {
|
|
var div = fabric.document.createElement('div');
|
|
div.style.width = div.style.height = '1px';
|
|
div.style.left = div.style.top = '-100%';
|
|
div.style.position = 'absolute';
|
|
div.appendChild(img);
|
|
fabric.document.querySelector('body').appendChild(div);
|
|
/**
|
|
* Wrap in function to:
|
|
* 1. Call existing callback
|
|
* 2. Cleanup DOM
|
|
*/
|
|
img.onload = function () {
|
|
onLoadCallback();
|
|
div.parentNode.removeChild(div);
|
|
div = null;
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Creates corresponding fabric instances from their object representations
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} objects Objects to enliven
|
|
* @param {Function} callback Callback to invoke when all objects are created
|
|
* @param {String} namespace Namespace to get klass "Class" object from
|
|
* @param {Function} reviver Method for further parsing of object elements,
|
|
* called after each fabric object created.
|
|
*/
|
|
enlivenObjects: function(objects, callback, namespace, reviver) {
|
|
objects = objects || [];
|
|
|
|
var enlivenedObjects = [],
|
|
numLoadedObjects = 0,
|
|
numTotalObjects = objects.length;
|
|
|
|
function onLoaded() {
|
|
if (++numLoadedObjects === numTotalObjects) {
|
|
callback && callback(enlivenedObjects.filter(function(obj) {
|
|
// filter out undefined objects (objects that gave error)
|
|
return obj;
|
|
}));
|
|
}
|
|
}
|
|
|
|
if (!numTotalObjects) {
|
|
callback && callback(enlivenedObjects);
|
|
return;
|
|
}
|
|
|
|
objects.forEach(function (o, index) {
|
|
// if sparse array
|
|
if (!o || !o.type) {
|
|
onLoaded();
|
|
return;
|
|
}
|
|
var klass = fabric.util.getKlass(o.type, namespace);
|
|
klass.fromObject(o, function (obj, error) {
|
|
error || (enlivenedObjects[index] = obj);
|
|
reviver && reviver(o, obj, error);
|
|
onLoaded();
|
|
});
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Create and wait for loading of patterns
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} patterns Objects to enliven
|
|
* @param {Function} callback Callback to invoke when all objects are created
|
|
* called after each fabric object created.
|
|
*/
|
|
enlivenPatterns: function(patterns, callback) {
|
|
patterns = patterns || [];
|
|
|
|
function onLoaded() {
|
|
if (++numLoadedPatterns === numPatterns) {
|
|
callback && callback(enlivenedPatterns);
|
|
}
|
|
}
|
|
|
|
var enlivenedPatterns = [],
|
|
numLoadedPatterns = 0,
|
|
numPatterns = patterns.length;
|
|
|
|
if (!numPatterns) {
|
|
callback && callback(enlivenedPatterns);
|
|
return;
|
|
}
|
|
|
|
patterns.forEach(function (p, index) {
|
|
if (p && p.source) {
|
|
new fabric.Pattern(p, function(pattern) {
|
|
enlivenedPatterns[index] = pattern;
|
|
onLoaded();
|
|
});
|
|
}
|
|
else {
|
|
enlivenedPatterns[index] = p;
|
|
onLoaded();
|
|
}
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Groups SVG elements (usually those retrieved from SVG document)
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} elements SVG elements to group
|
|
* @param {Object} [options] Options object
|
|
* @param {String} path Value to set sourcePath to
|
|
* @return {fabric.Object|fabric.Group}
|
|
*/
|
|
groupSVGElements: function(elements, options, path) {
|
|
var object;
|
|
if (elements && elements.length === 1) {
|
|
return elements[0];
|
|
}
|
|
if (options) {
|
|
if (options.width && options.height) {
|
|
options.centerPoint = {
|
|
x: options.width / 2,
|
|
y: options.height / 2
|
|
};
|
|
}
|
|
else {
|
|
delete options.width;
|
|
delete options.height;
|
|
}
|
|
}
|
|
object = new fabric.Group(elements, options);
|
|
if (typeof path !== 'undefined') {
|
|
object.sourcePath = path;
|
|
}
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Populates an object with properties of another object
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Object} source Source object
|
|
* @param {Object} destination Destination object
|
|
* @return {Array} properties Properties names to include
|
|
*/
|
|
populateWithProperties: function(source, destination, properties) {
|
|
if (properties && Object.prototype.toString.call(properties) === '[object Array]') {
|
|
for (var i = 0, len = properties.length; i < len; i++) {
|
|
if (properties[i] in source) {
|
|
destination[properties[i]] = source[properties[i]];
|
|
}
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* WARNING: THIS WAS TO SUPPORT OLD BROWSERS. deprecated.
|
|
* WILL BE REMOVED IN FABRIC 5.0
|
|
* Draws a dashed line between two points
|
|
*
|
|
* This method is used to draw dashed line around selection area.
|
|
* See <a href="http://stackoverflow.com/questions/4576724/dotted-stroke-in-canvas">dotted stroke in canvas</a>
|
|
*
|
|
* @param {CanvasRenderingContext2D} ctx context
|
|
* @param {Number} x start x coordinate
|
|
* @param {Number} y start y coordinate
|
|
* @param {Number} x2 end x coordinate
|
|
* @param {Number} y2 end y coordinate
|
|
* @param {Array} da dash array pattern
|
|
* @deprecated
|
|
*/
|
|
drawDashedLine: function(ctx, x, y, x2, y2, da) {
|
|
var dx = x2 - x,
|
|
dy = y2 - y,
|
|
len = sqrt(dx * dx + dy * dy),
|
|
rot = atan2(dy, dx),
|
|
dc = da.length,
|
|
di = 0,
|
|
draw = true;
|
|
|
|
ctx.save();
|
|
ctx.translate(x, y);
|
|
ctx.moveTo(0, 0);
|
|
ctx.rotate(rot);
|
|
|
|
x = 0;
|
|
while (len > x) {
|
|
x += da[di++ % dc];
|
|
if (x > len) {
|
|
x = len;
|
|
}
|
|
ctx[draw ? 'lineTo' : 'moveTo'](x, 0);
|
|
draw = !draw;
|
|
}
|
|
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Creates canvas element
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @return {CanvasElement} initialized canvas element
|
|
*/
|
|
createCanvasElement: function() {
|
|
return fabric.document.createElement('canvas');
|
|
},
|
|
|
|
/**
|
|
* Creates a canvas element that is a copy of another and is also painted
|
|
* @param {CanvasElement} canvas to copy size and content of
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @return {CanvasElement} initialized canvas element
|
|
*/
|
|
copyCanvasElement: function(canvas) {
|
|
var newCanvas = fabric.util.createCanvasElement();
|
|
newCanvas.width = canvas.width;
|
|
newCanvas.height = canvas.height;
|
|
newCanvas.getContext('2d').drawImage(canvas, 0, 0);
|
|
return newCanvas;
|
|
},
|
|
|
|
/**
|
|
* since 2.6.0 moved from canvas instance to utility.
|
|
* @param {CanvasElement} canvasEl to copy size and content of
|
|
* @param {String} format 'jpeg' or 'png', in some browsers 'webp' is ok too
|
|
* @param {Number} quality <= 1 and > 0
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @return {String} data url
|
|
*/
|
|
toDataURL: function(canvasEl, format, quality) {
|
|
return canvasEl.toDataURL('image/' + format, quality);
|
|
},
|
|
|
|
/**
|
|
* Creates image element (works on client and node)
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @return {HTMLImageElement} HTML image element
|
|
*/
|
|
createImage: function() {
|
|
return fabric.document.createElement('img');
|
|
},
|
|
|
|
/**
|
|
* Multiply matrix A by matrix B to nest transformations
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} a First transformMatrix
|
|
* @param {Array} b Second transformMatrix
|
|
* @param {Boolean} is2x2 flag to multiply matrices as 2x2 matrices
|
|
* @return {Array} The product of the two transform matrices
|
|
*/
|
|
multiplyTransformMatrices: function(a, b, is2x2) {
|
|
// Matrix multiply a * b
|
|
return [
|
|
a[0] * b[0] + a[2] * b[1],
|
|
a[1] * b[0] + a[3] * b[1],
|
|
a[0] * b[2] + a[2] * b[3],
|
|
a[1] * b[2] + a[3] * b[3],
|
|
is2x2 ? 0 : a[0] * b[4] + a[2] * b[5] + a[4],
|
|
is2x2 ? 0 : a[1] * b[4] + a[3] * b[5] + a[5]
|
|
];
|
|
},
|
|
|
|
/**
|
|
* Decomposes standard 2x3 matrix into transform components
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Array} a transformMatrix
|
|
* @return {Object} Components of transform
|
|
*/
|
|
qrDecompose: function(a) {
|
|
var angle = atan2(a[1], a[0]),
|
|
denom = pow(a[0], 2) + pow(a[1], 2),
|
|
scaleX = sqrt(denom),
|
|
scaleY = (a[0] * a[3] - a[2] * a[1]) / scaleX,
|
|
skewX = atan2(a[0] * a[2] + a[1] * a [3], denom);
|
|
return {
|
|
angle: angle / PiBy180,
|
|
scaleX: scaleX,
|
|
scaleY: scaleY,
|
|
skewX: skewX / PiBy180,
|
|
skewY: 0,
|
|
translateX: a[4],
|
|
translateY: a[5]
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns a transform matrix starting from an object of the same kind of
|
|
* the one returned from qrDecompose, useful also if you want to calculate some
|
|
* transformations from an object that is not enlived yet
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Object} options
|
|
* @param {Number} [options.angle] angle in degrees
|
|
* @return {Number[]} transform matrix
|
|
*/
|
|
calcRotateMatrix: function(options) {
|
|
if (!options.angle) {
|
|
return fabric.iMatrix.concat();
|
|
}
|
|
var theta = fabric.util.degreesToRadians(options.angle),
|
|
cos = fabric.util.cos(theta),
|
|
sin = fabric.util.sin(theta);
|
|
return [cos, sin, -sin, cos, 0, 0];
|
|
},
|
|
|
|
/**
|
|
* Returns a transform matrix starting from an object of the same kind of
|
|
* the one returned from qrDecompose, useful also if you want to calculate some
|
|
* transformations from an object that is not enlived yet.
|
|
* is called DimensionsTransformMatrix because those properties are the one that influence
|
|
* the size of the resulting box of the object.
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Object} options
|
|
* @param {Number} [options.scaleX]
|
|
* @param {Number} [options.scaleY]
|
|
* @param {Boolean} [options.flipX]
|
|
* @param {Boolean} [options.flipY]
|
|
* @param {Number} [options.skewX]
|
|
* @param {Number} [options.skewX]
|
|
* @return {Number[]} transform matrix
|
|
*/
|
|
calcDimensionsMatrix: function(options) {
|
|
var scaleX = typeof options.scaleX === 'undefined' ? 1 : options.scaleX,
|
|
scaleY = typeof options.scaleY === 'undefined' ? 1 : options.scaleY,
|
|
scaleMatrix = [
|
|
options.flipX ? -scaleX : scaleX,
|
|
0,
|
|
0,
|
|
options.flipY ? -scaleY : scaleY,
|
|
0,
|
|
0],
|
|
multiply = fabric.util.multiplyTransformMatrices,
|
|
degreesToRadians = fabric.util.degreesToRadians;
|
|
if (options.skewX) {
|
|
scaleMatrix = multiply(
|
|
scaleMatrix,
|
|
[1, 0, Math.tan(degreesToRadians(options.skewX)), 1],
|
|
true);
|
|
}
|
|
if (options.skewY) {
|
|
scaleMatrix = multiply(
|
|
scaleMatrix,
|
|
[1, Math.tan(degreesToRadians(options.skewY)), 0, 1],
|
|
true);
|
|
}
|
|
return scaleMatrix;
|
|
},
|
|
|
|
/**
|
|
* Returns a transform matrix starting from an object of the same kind of
|
|
* the one returned from qrDecompose, useful also if you want to calculate some
|
|
* transformations from an object that is not enlived yet
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {Object} options
|
|
* @param {Number} [options.angle]
|
|
* @param {Number} [options.scaleX]
|
|
* @param {Number} [options.scaleY]
|
|
* @param {Boolean} [options.flipX]
|
|
* @param {Boolean} [options.flipY]
|
|
* @param {Number} [options.skewX]
|
|
* @param {Number} [options.skewX]
|
|
* @param {Number} [options.translateX]
|
|
* @param {Number} [options.translateY]
|
|
* @return {Number[]} transform matrix
|
|
*/
|
|
composeMatrix: function(options) {
|
|
var matrix = [1, 0, 0, 1, options.translateX || 0, options.translateY || 0],
|
|
multiply = fabric.util.multiplyTransformMatrices;
|
|
if (options.angle) {
|
|
matrix = multiply(matrix, fabric.util.calcRotateMatrix(options));
|
|
}
|
|
if (options.scaleX !== 1 || options.scaleY !== 1 ||
|
|
options.skewX || options.skewY || options.flipX || options.flipY) {
|
|
matrix = multiply(matrix, fabric.util.calcDimensionsMatrix(options));
|
|
}
|
|
return matrix;
|
|
},
|
|
|
|
/**
|
|
* reset an object transform state to neutral. Top and left are not accounted for
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Object} target object to transform
|
|
*/
|
|
resetObjectTransform: function (target) {
|
|
target.scaleX = 1;
|
|
target.scaleY = 1;
|
|
target.skewX = 0;
|
|
target.skewY = 0;
|
|
target.flipX = false;
|
|
target.flipY = false;
|
|
target.rotate(0);
|
|
},
|
|
|
|
/**
|
|
* Extract Object transform values
|
|
* @static
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Object} target object to read from
|
|
* @return {Object} Components of transform
|
|
*/
|
|
saveObjectTransform: function (target) {
|
|
return {
|
|
scaleX: target.scaleX,
|
|
scaleY: target.scaleY,
|
|
skewX: target.skewX,
|
|
skewY: target.skewY,
|
|
angle: target.angle,
|
|
left: target.left,
|
|
flipX: target.flipX,
|
|
flipY: target.flipY,
|
|
top: target.top
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns true if context has transparent pixel
|
|
* at specified location (taking tolerance into account)
|
|
* @param {CanvasRenderingContext2D} ctx context
|
|
* @param {Number} x x coordinate
|
|
* @param {Number} y y coordinate
|
|
* @param {Number} tolerance Tolerance
|
|
*/
|
|
isTransparent: function(ctx, x, y, tolerance) {
|
|
|
|
// If tolerance is > 0 adjust start coords to take into account.
|
|
// If moves off Canvas fix to 0
|
|
if (tolerance > 0) {
|
|
if (x > tolerance) {
|
|
x -= tolerance;
|
|
}
|
|
else {
|
|
x = 0;
|
|
}
|
|
if (y > tolerance) {
|
|
y -= tolerance;
|
|
}
|
|
else {
|
|
y = 0;
|
|
}
|
|
}
|
|
|
|
var _isTransparent = true, i, temp,
|
|
imageData = ctx.getImageData(x, y, (tolerance * 2) || 1, (tolerance * 2) || 1),
|
|
l = imageData.data.length;
|
|
|
|
// Split image data - for tolerance > 1, pixelDataSize = 4;
|
|
for (i = 3; i < l; i += 4) {
|
|
temp = imageData.data[i];
|
|
_isTransparent = temp <= 0;
|
|
if (_isTransparent === false) {
|
|
break; // Stop if colour found
|
|
}
|
|
}
|
|
|
|
imageData = null;
|
|
|
|
return _isTransparent;
|
|
},
|
|
|
|
/**
|
|
* Parse preserveAspectRatio attribute from element
|
|
* @param {string} attribute to be parsed
|
|
* @return {Object} an object containing align and meetOrSlice attribute
|
|
*/
|
|
parsePreserveAspectRatioAttribute: function(attribute) {
|
|
var meetOrSlice = 'meet', alignX = 'Mid', alignY = 'Mid',
|
|
aspectRatioAttrs = attribute.split(' '), align;
|
|
|
|
if (aspectRatioAttrs && aspectRatioAttrs.length) {
|
|
meetOrSlice = aspectRatioAttrs.pop();
|
|
if (meetOrSlice !== 'meet' && meetOrSlice !== 'slice') {
|
|
align = meetOrSlice;
|
|
meetOrSlice = 'meet';
|
|
}
|
|
else if (aspectRatioAttrs.length) {
|
|
align = aspectRatioAttrs.pop();
|
|
}
|
|
}
|
|
//divide align in alignX and alignY
|
|
alignX = align !== 'none' ? align.slice(1, 4) : 'none';
|
|
alignY = align !== 'none' ? align.slice(5, 8) : 'none';
|
|
return {
|
|
meetOrSlice: meetOrSlice,
|
|
alignX: alignX,
|
|
alignY: alignY
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Clear char widths cache for the given font family or all the cache if no
|
|
* fontFamily is specified.
|
|
* Use it if you know you are loading fonts in a lazy way and you are not waiting
|
|
* for custom fonts to load properly when adding text objects to the canvas.
|
|
* If a text object is added when its own font is not loaded yet, you will get wrong
|
|
* measurement and so wrong bounding boxes.
|
|
* After the font cache is cleared, either change the textObject text content or call
|
|
* initDimensions() to trigger a recalculation
|
|
* @memberOf fabric.util
|
|
* @param {String} [fontFamily] font family to clear
|
|
*/
|
|
clearFabricFontCache: function(fontFamily) {
|
|
fontFamily = (fontFamily || '').toLowerCase();
|
|
if (!fontFamily) {
|
|
fabric.charWidthsCache = { };
|
|
}
|
|
else if (fabric.charWidthsCache[fontFamily]) {
|
|
delete fabric.charWidthsCache[fontFamily];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Given current aspect ratio, determines the max width and height that can
|
|
* respect the total allowed area for the cache.
|
|
* @memberOf fabric.util
|
|
* @param {Number} ar aspect ratio
|
|
* @param {Number} maximumArea Maximum area you want to achieve
|
|
* @return {Object.x} Limited dimensions by X
|
|
* @return {Object.y} Limited dimensions by Y
|
|
*/
|
|
limitDimsByArea: function(ar, maximumArea) {
|
|
var roughWidth = Math.sqrt(maximumArea * ar),
|
|
perfLimitSizeY = Math.floor(maximumArea / roughWidth);
|
|
return { x: Math.floor(roughWidth), y: perfLimitSizeY };
|
|
},
|
|
|
|
capValue: function(min, value, max) {
|
|
return Math.max(min, Math.min(value, max));
|
|
},
|
|
|
|
/**
|
|
* Finds the scale for the object source to fit inside the object destination,
|
|
* keeping aspect ratio intact.
|
|
* respect the total allowed area for the cache.
|
|
* @memberOf fabric.util
|
|
* @param {Object | fabric.Object} source
|
|
* @param {Number} source.height natural unscaled height of the object
|
|
* @param {Number} source.width natural unscaled width of the object
|
|
* @param {Object | fabric.Object} destination
|
|
* @param {Number} destination.height natural unscaled height of the object
|
|
* @param {Number} destination.width natural unscaled width of the object
|
|
* @return {Number} scale factor to apply to source to fit into destination
|
|
*/
|
|
findScaleToFit: function(source, destination) {
|
|
return Math.min(destination.width / source.width, destination.height / source.height);
|
|
},
|
|
|
|
/**
|
|
* Finds the scale for the object source to cover entirely the object destination,
|
|
* keeping aspect ratio intact.
|
|
* respect the total allowed area for the cache.
|
|
* @memberOf fabric.util
|
|
* @param {Object | fabric.Object} source
|
|
* @param {Number} source.height natural unscaled height of the object
|
|
* @param {Number} source.width natural unscaled width of the object
|
|
* @param {Object | fabric.Object} destination
|
|
* @param {Number} destination.height natural unscaled height of the object
|
|
* @param {Number} destination.width natural unscaled width of the object
|
|
* @return {Number} scale factor to apply to source to cover destination
|
|
*/
|
|
findScaleToCover: function(source, destination) {
|
|
return Math.max(destination.width / source.width, destination.height / source.height);
|
|
},
|
|
|
|
/**
|
|
* given an array of 6 number returns something like `"matrix(...numbers)"`
|
|
* @memberOf fabric.util
|
|
* @param {Array} transform an array with 6 numbers
|
|
* @return {String} transform matrix for svg
|
|
* @return {Object.y} Limited dimensions by Y
|
|
*/
|
|
matrixToSVG: function(transform) {
|
|
return 'matrix(' + transform.map(function(value) {
|
|
return fabric.util.toFixed(value, fabric.Object.NUM_FRACTION_DIGITS);
|
|
}).join(' ') + ')';
|
|
},
|
|
|
|
/**
|
|
* given an object and a transform, apply the inverse transform to the object,
|
|
* this is equivalent to remove from that object that transformation, so that
|
|
* added in a space with the removed transform, the object will be the same as before.
|
|
* Removing from an object a transform that scale by 2 is like scaling it by 1/2.
|
|
* Removing from an object a transfrom that rotate by 30deg is like rotating by 30deg
|
|
* in the opposite direction.
|
|
* This util is used to add objects inside transformed groups or nested groups.
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Object} object the object you want to transform
|
|
* @param {Array} transform the destination transform
|
|
*/
|
|
removeTransformFromObject: function(object, transform) {
|
|
var inverted = fabric.util.invertTransform(transform),
|
|
finalTransform = fabric.util.multiplyTransformMatrices(inverted, object.calcOwnMatrix());
|
|
fabric.util.applyTransformToObject(object, finalTransform);
|
|
},
|
|
|
|
/**
|
|
* given an object and a transform, apply the transform to the object.
|
|
* this is equivalent to change the space where the object is drawn.
|
|
* Adding to an object a transform that scale by 2 is like scaling it by 2.
|
|
* This is used when removing an object from an active selection for example.
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Object} object the object you want to transform
|
|
* @param {Array} transform the destination transform
|
|
*/
|
|
addTransformToObject: function(object, transform) {
|
|
fabric.util.applyTransformToObject(
|
|
object,
|
|
fabric.util.multiplyTransformMatrices(transform, object.calcOwnMatrix())
|
|
);
|
|
},
|
|
|
|
/**
|
|
* discard an object transform state and apply the one from the matrix.
|
|
* @memberOf fabric.util
|
|
* @param {fabric.Object} object the object you want to transform
|
|
* @param {Array} transform the destination transform
|
|
*/
|
|
applyTransformToObject: function(object, transform) {
|
|
var options = fabric.util.qrDecompose(transform),
|
|
center = new fabric.Point(options.translateX, options.translateY);
|
|
object.flipX = false;
|
|
object.flipY = false;
|
|
object.set('scaleX', options.scaleX);
|
|
object.set('scaleY', options.scaleY);
|
|
object.skewX = options.skewX;
|
|
object.skewY = options.skewY;
|
|
object.angle = options.angle;
|
|
object.setPositionByOrigin(center, 'center', 'center');
|
|
},
|
|
|
|
/**
|
|
* given a width and height, return the size of the bounding box
|
|
* that can contains the box with width/height with applied transform
|
|
* described in options.
|
|
* Use to calculate the boxes around objects for controls.
|
|
* @memberOf fabric.util
|
|
* @param {Number} width
|
|
* @param {Number} height
|
|
* @param {Object} options
|
|
* @param {Number} options.scaleX
|
|
* @param {Number} options.scaleY
|
|
* @param {Number} options.skewX
|
|
* @param {Number} options.skewY
|
|
* @return {Object.x} width of containing
|
|
* @return {Object.y} height of containing
|
|
*/
|
|
sizeAfterTransform: function(width, height, options) {
|
|
var dimX = width / 2, dimY = height / 2,
|
|
points = [
|
|
{
|
|
x: -dimX,
|
|
y: -dimY
|
|
},
|
|
{
|
|
x: dimX,
|
|
y: -dimY
|
|
},
|
|
{
|
|
x: -dimX,
|
|
y: dimY
|
|
},
|
|
{
|
|
x: dimX,
|
|
y: dimY
|
|
}],
|
|
transformMatrix = fabric.util.calcDimensionsMatrix(options),
|
|
bbox = fabric.util.makeBoundingBoxFromPoints(points, transformMatrix);
|
|
return {
|
|
x: bbox.width,
|
|
y: bbox.height,
|
|
};
|
|
}
|
|
};
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function() {
|
|
var _join = Array.prototype.join,
|
|
commandLengths = {
|
|
m: 2,
|
|
l: 2,
|
|
h: 1,
|
|
v: 1,
|
|
c: 6,
|
|
s: 4,
|
|
q: 4,
|
|
t: 2,
|
|
a: 7
|
|
},
|
|
repeatedCommands = {
|
|
m: 'l',
|
|
M: 'L'
|
|
};
|
|
function segmentToBezier(th2, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY) {
|
|
var costh2 = fabric.util.cos(th2),
|
|
sinth2 = fabric.util.sin(th2),
|
|
costh3 = fabric.util.cos(th3),
|
|
sinth3 = fabric.util.sin(th3),
|
|
toX = cosTh * rx * costh3 - sinTh * ry * sinth3 + cx1,
|
|
toY = sinTh * rx * costh3 + cosTh * ry * sinth3 + cy1,
|
|
cp1X = fromX + mT * ( -cosTh * rx * sinth2 - sinTh * ry * costh2),
|
|
cp1Y = fromY + mT * ( -sinTh * rx * sinth2 + cosTh * ry * costh2),
|
|
cp2X = toX + mT * ( cosTh * rx * sinth3 + sinTh * ry * costh3),
|
|
cp2Y = toY + mT * ( sinTh * rx * sinth3 - cosTh * ry * costh3);
|
|
|
|
return ['C',
|
|
cp1X, cp1Y,
|
|
cp2X, cp2Y,
|
|
toX, toY
|
|
];
|
|
}
|
|
|
|
/* Adapted from http://dxr.mozilla.org/mozilla-central/source/content/svg/content/src/nsSVGPathDataParser.cpp
|
|
* by Andrea Bogazzi code is under MPL. if you don't have a copy of the license you can take it here
|
|
* http://mozilla.org/MPL/2.0/
|
|
*/
|
|
function arcToSegments(toX, toY, rx, ry, large, sweep, rotateX) {
|
|
var PI = Math.PI, th = rotateX * PI / 180,
|
|
sinTh = fabric.util.sin(th),
|
|
cosTh = fabric.util.cos(th),
|
|
fromX = 0, fromY = 0;
|
|
|
|
rx = Math.abs(rx);
|
|
ry = Math.abs(ry);
|
|
|
|
var px = -cosTh * toX * 0.5 - sinTh * toY * 0.5,
|
|
py = -cosTh * toY * 0.5 + sinTh * toX * 0.5,
|
|
rx2 = rx * rx, ry2 = ry * ry, py2 = py * py, px2 = px * px,
|
|
pl = rx2 * ry2 - rx2 * py2 - ry2 * px2,
|
|
root = 0;
|
|
|
|
if (pl < 0) {
|
|
var s = Math.sqrt(1 - pl / (rx2 * ry2));
|
|
rx *= s;
|
|
ry *= s;
|
|
}
|
|
else {
|
|
root = (large === sweep ? -1.0 : 1.0) *
|
|
Math.sqrt( pl / (rx2 * py2 + ry2 * px2));
|
|
}
|
|
|
|
var cx = root * rx * py / ry,
|
|
cy = -root * ry * px / rx,
|
|
cx1 = cosTh * cx - sinTh * cy + toX * 0.5,
|
|
cy1 = sinTh * cx + cosTh * cy + toY * 0.5,
|
|
mTheta = calcVectorAngle(1, 0, (px - cx) / rx, (py - cy) / ry),
|
|
dtheta = calcVectorAngle((px - cx) / rx, (py - cy) / ry, (-px - cx) / rx, (-py - cy) / ry);
|
|
|
|
if (sweep === 0 && dtheta > 0) {
|
|
dtheta -= 2 * PI;
|
|
}
|
|
else if (sweep === 1 && dtheta < 0) {
|
|
dtheta += 2 * PI;
|
|
}
|
|
|
|
// Convert into cubic bezier segments <= 90deg
|
|
var segments = Math.ceil(Math.abs(dtheta / PI * 2)),
|
|
result = [], mDelta = dtheta / segments,
|
|
mT = 8 / 3 * Math.sin(mDelta / 4) * Math.sin(mDelta / 4) / Math.sin(mDelta / 2),
|
|
th3 = mTheta + mDelta;
|
|
|
|
for (var i = 0; i < segments; i++) {
|
|
result[i] = segmentToBezier(mTheta, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY);
|
|
fromX = result[i][5];
|
|
fromY = result[i][6];
|
|
mTheta = th3;
|
|
th3 += mDelta;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/*
|
|
* Private
|
|
*/
|
|
function calcVectorAngle(ux, uy, vx, vy) {
|
|
var ta = Math.atan2(uy, ux),
|
|
tb = Math.atan2(vy, vx);
|
|
if (tb >= ta) {
|
|
return tb - ta;
|
|
}
|
|
else {
|
|
return 2 * Math.PI - (ta - tb);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Calculate bounding box of a beziercurve
|
|
* @param {Number} x0 starting point
|
|
* @param {Number} y0
|
|
* @param {Number} x1 first control point
|
|
* @param {Number} y1
|
|
* @param {Number} x2 secondo control point
|
|
* @param {Number} y2
|
|
* @param {Number} x3 end of bezier
|
|
* @param {Number} y3
|
|
*/
|
|
// taken from http://jsbin.com/ivomiq/56/edit no credits available for that.
|
|
// TODO: can we normalize this with the starting points set at 0 and then translated the bbox?
|
|
function getBoundsOfCurve(x0, y0, x1, y1, x2, y2, x3, y3) {
|
|
var argsString;
|
|
if (fabric.cachesBoundsOfCurve) {
|
|
argsString = _join.call(arguments);
|
|
if (fabric.boundsOfCurveCache[argsString]) {
|
|
return fabric.boundsOfCurveCache[argsString];
|
|
}
|
|
}
|
|
|
|
var sqrt = Math.sqrt,
|
|
min = Math.min, max = Math.max,
|
|
abs = Math.abs, tvalues = [],
|
|
bounds = [[], []],
|
|
a, b, c, t, t1, t2, b2ac, sqrtb2ac;
|
|
|
|
b = 6 * x0 - 12 * x1 + 6 * x2;
|
|
a = -3 * x0 + 9 * x1 - 9 * x2 + 3 * x3;
|
|
c = 3 * x1 - 3 * x0;
|
|
|
|
for (var i = 0; i < 2; ++i) {
|
|
if (i > 0) {
|
|
b = 6 * y0 - 12 * y1 + 6 * y2;
|
|
a = -3 * y0 + 9 * y1 - 9 * y2 + 3 * y3;
|
|
c = 3 * y1 - 3 * y0;
|
|
}
|
|
|
|
if (abs(a) < 1e-12) {
|
|
if (abs(b) < 1e-12) {
|
|
continue;
|
|
}
|
|
t = -c / b;
|
|
if (0 < t && t < 1) {
|
|
tvalues.push(t);
|
|
}
|
|
continue;
|
|
}
|
|
b2ac = b * b - 4 * c * a;
|
|
if (b2ac < 0) {
|
|
continue;
|
|
}
|
|
sqrtb2ac = sqrt(b2ac);
|
|
t1 = (-b + sqrtb2ac) / (2 * a);
|
|
if (0 < t1 && t1 < 1) {
|
|
tvalues.push(t1);
|
|
}
|
|
t2 = (-b - sqrtb2ac) / (2 * a);
|
|
if (0 < t2 && t2 < 1) {
|
|
tvalues.push(t2);
|
|
}
|
|
}
|
|
|
|
var x, y, j = tvalues.length, jlen = j, mt;
|
|
while (j--) {
|
|
t = tvalues[j];
|
|
mt = 1 - t;
|
|
x = (mt * mt * mt * x0) + (3 * mt * mt * t * x1) + (3 * mt * t * t * x2) + (t * t * t * x3);
|
|
bounds[0][j] = x;
|
|
|
|
y = (mt * mt * mt * y0) + (3 * mt * mt * t * y1) + (3 * mt * t * t * y2) + (t * t * t * y3);
|
|
bounds[1][j] = y;
|
|
}
|
|
|
|
bounds[0][jlen] = x0;
|
|
bounds[1][jlen] = y0;
|
|
bounds[0][jlen + 1] = x3;
|
|
bounds[1][jlen + 1] = y3;
|
|
var result = [
|
|
{
|
|
x: min.apply(null, bounds[0]),
|
|
y: min.apply(null, bounds[1])
|
|
},
|
|
{
|
|
x: max.apply(null, bounds[0]),
|
|
y: max.apply(null, bounds[1])
|
|
}
|
|
];
|
|
if (fabric.cachesBoundsOfCurve) {
|
|
fabric.boundsOfCurveCache[argsString] = result;
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Converts arc to a bunch of bezier curves
|
|
* @param {Number} fx starting point x
|
|
* @param {Number} fy starting point y
|
|
* @param {Array} coords Arc command
|
|
*/
|
|
function fromArcToBeziers(fx, fy, coords) {
|
|
var rx = coords[1],
|
|
ry = coords[2],
|
|
rot = coords[3],
|
|
large = coords[4],
|
|
sweep = coords[5],
|
|
tx = coords[6],
|
|
ty = coords[7],
|
|
segsNorm = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot);
|
|
|
|
for (var i = 0, len = segsNorm.length; i < len; i++) {
|
|
segsNorm[i][1] += fx;
|
|
segsNorm[i][2] += fy;
|
|
segsNorm[i][3] += fx;
|
|
segsNorm[i][4] += fy;
|
|
segsNorm[i][5] += fx;
|
|
segsNorm[i][6] += fy;
|
|
}
|
|
return segsNorm;
|
|
};
|
|
|
|
/**
|
|
* This function take a parsed SVG path and make it simpler for fabricJS logic.
|
|
* simplification consist of: only UPPERCASE absolute commands ( relative converted to absolute )
|
|
* S converted in C, T converted in Q, A converted in C.
|
|
* @param {Array} path the array of commands of a parsed svg path for fabric.Path
|
|
* @return {Array} the simplified array of commands of a parsed svg path for fabric.Path
|
|
*/
|
|
function makePathSimpler(path) {
|
|
// x and y represent the last point of the path. the previous command point.
|
|
// we add them to each relative command to make it an absolute comment.
|
|
// we also swap the v V h H with L, because are easier to transform.
|
|
var x = 0, y = 0, len = path.length,
|
|
// x1 and y1 represent the last point of the subpath. the subpath is started with
|
|
// m or M command. When a z or Z command is drawn, x and y need to be resetted to
|
|
// the last x1 and y1.
|
|
x1 = 0, y1 = 0, current, i, converted,
|
|
// previous will host the letter of the previous command, to handle S and T.
|
|
// controlX and controlY will host the previous reflected control point
|
|
destinationPath = [], previous, controlX, controlY;
|
|
for (i = 0; i < len; ++i) {
|
|
converted = false;
|
|
current = path[i].slice(0);
|
|
switch (current[0]) { // first letter
|
|
case 'l': // lineto, relative
|
|
current[0] = 'L';
|
|
current[1] += x;
|
|
current[2] += y;
|
|
// falls through
|
|
case 'L':
|
|
x = current[1];
|
|
y = current[2];
|
|
break;
|
|
case 'h': // horizontal lineto, relative
|
|
current[1] += x;
|
|
// falls through
|
|
case 'H':
|
|
current[0] = 'L';
|
|
current[2] = y;
|
|
x = current[1];
|
|
break;
|
|
case 'v': // vertical lineto, relative
|
|
current[1] += y;
|
|
// falls through
|
|
case 'V':
|
|
current[0] = 'L';
|
|
y = current[1];
|
|
current[1] = x;
|
|
current[2] = y;
|
|
break;
|
|
case 'm': // moveTo, relative
|
|
current[0] = 'M';
|
|
current[1] += x;
|
|
current[2] += y;
|
|
// falls through
|
|
case 'M':
|
|
x = current[1];
|
|
y = current[2];
|
|
x1 = current[1];
|
|
y1 = current[2];
|
|
break;
|
|
case 'c': // bezierCurveTo, relative
|
|
current[0] = 'C';
|
|
current[1] += x;
|
|
current[2] += y;
|
|
current[3] += x;
|
|
current[4] += y;
|
|
current[5] += x;
|
|
current[6] += y;
|
|
// falls through
|
|
case 'C':
|
|
controlX = current[3];
|
|
controlY = current[4];
|
|
x = current[5];
|
|
y = current[6];
|
|
break;
|
|
case 's': // shorthand cubic bezierCurveTo, relative
|
|
current[0] = 'S';
|
|
current[1] += x;
|
|
current[2] += y;
|
|
current[3] += x;
|
|
current[4] += y;
|
|
// falls through
|
|
case 'S':
|
|
// would be sScC but since we are swapping sSc for C, we check just that.
|
|
if (previous === 'C') {
|
|
// calculate reflection of previous control points
|
|
controlX = 2 * x - controlX;
|
|
controlY = 2 * y - controlY;
|
|
}
|
|
else {
|
|
// If there is no previous command or if the previous command was not a C, c, S, or s,
|
|
// the control point is coincident with the current point
|
|
controlX = x;
|
|
controlY = y;
|
|
}
|
|
x = current[3];
|
|
y = current[4];
|
|
current[0] = 'C';
|
|
current[5] = current[3];
|
|
current[6] = current[4];
|
|
current[3] = current[1];
|
|
current[4] = current[2];
|
|
current[1] = controlX;
|
|
current[2] = controlY;
|
|
// current[3] and current[4] are NOW the second control point.
|
|
// we keep it for the next reflection.
|
|
controlX = current[3];
|
|
controlY = current[4];
|
|
break;
|
|
case 'q': // quadraticCurveTo, relative
|
|
current[0] = 'Q';
|
|
current[1] += x;
|
|
current[2] += y;
|
|
current[3] += x;
|
|
current[4] += y;
|
|
// falls through
|
|
case 'Q':
|
|
controlX = current[1];
|
|
controlY = current[2];
|
|
x = current[3];
|
|
y = current[4];
|
|
break;
|
|
case 't': // shorthand quadraticCurveTo, relative
|
|
current[0] = 'T';
|
|
current[1] += x;
|
|
current[2] += y;
|
|
// falls through
|
|
case 'T':
|
|
if (previous === 'Q') {
|
|
// calculate reflection of previous control point
|
|
controlX = 2 * x - controlX;
|
|
controlY = 2 * y - controlY;
|
|
}
|
|
else {
|
|
// If there is no previous command or if the previous command was not a Q, q, T or t,
|
|
// assume the control point is coincident with the current point
|
|
controlX = x;
|
|
controlY = y;
|
|
}
|
|
current[0] = 'Q';
|
|
x = current[1];
|
|
y = current[2];
|
|
current[1] = controlX;
|
|
current[2] = controlY;
|
|
current[3] = x;
|
|
current[4] = y;
|
|
break;
|
|
case 'a':
|
|
current[0] = 'A';
|
|
current[6] += x;
|
|
current[7] += y;
|
|
// falls through
|
|
case 'A':
|
|
converted = true;
|
|
destinationPath = destinationPath.concat(fromArcToBeziers(x, y, current));
|
|
x = current[6];
|
|
y = current[7];
|
|
break;
|
|
case 'z':
|
|
case 'Z':
|
|
x = x1;
|
|
y = y1;
|
|
break;
|
|
default:
|
|
}
|
|
if (!converted) {
|
|
destinationPath.push(current);
|
|
}
|
|
previous = current[0];
|
|
}
|
|
return destinationPath;
|
|
};
|
|
|
|
/**
|
|
* Calc length from point x1,y1 to x2,y2
|
|
* @param {Number} x1 starting point x
|
|
* @param {Number} y1 starting point y
|
|
* @param {Number} x2 starting point x
|
|
* @param {Number} y2 starting point y
|
|
* @return {Number} length of segment
|
|
*/
|
|
function calcLineLength(x1, y1, x2, y2) {
|
|
return Math.sqrt((x2 - x1) * (x2 - x1) + (y2 - y1) * (y2 - y1));
|
|
}
|
|
|
|
// functions for the Cubic beizer
|
|
// taken from: https://github.com/konvajs/konva/blob/7.0.5/src/shapes/Path.ts#L350
|
|
function CB1(t) {
|
|
return t * t * t;
|
|
}
|
|
function CB2(t) {
|
|
return 3 * t * t * (1 - t);
|
|
}
|
|
function CB3(t) {
|
|
return 3 * t * (1 - t) * (1 - t);
|
|
}
|
|
function CB4(t) {
|
|
return (1 - t) * (1 - t) * (1 - t);
|
|
}
|
|
|
|
function getPointOnCubicBezierIterator(p1x, p1y, p2x, p2y, p3x, p3y, p4x, p4y) {
|
|
return function(pct) {
|
|
var c1 = CB1(pct), c2 = CB2(pct), c3 = CB3(pct), c4 = CB4(pct);
|
|
return {
|
|
x: p4x * c1 + p3x * c2 + p2x * c3 + p1x * c4,
|
|
y: p4y * c1 + p3y * c2 + p2y * c3 + p1y * c4
|
|
};
|
|
};
|
|
}
|
|
|
|
function getTangentCubicIterator(p1x, p1y, p2x, p2y, p3x, p3y, p4x, p4y) {
|
|
return function (pct) {
|
|
var invT = 1 - pct,
|
|
tangentX = (3 * invT * invT * (p2x - p1x)) + (6 * invT * pct * (p3x - p2x)) +
|
|
(3 * pct * pct * (p4x - p3x)),
|
|
tangentY = (3 * invT * invT * (p2y - p1y)) + (6 * invT * pct * (p3y - p2y)) +
|
|
(3 * pct * pct * (p4y - p3y));
|
|
return Math.atan2(tangentY, tangentX);
|
|
};
|
|
}
|
|
|
|
function QB1(t) {
|
|
return t * t;
|
|
}
|
|
|
|
function QB2(t) {
|
|
return 2 * t * (1 - t);
|
|
}
|
|
|
|
function QB3(t) {
|
|
return (1 - t) * (1 - t);
|
|
}
|
|
|
|
function getPointOnQuadraticBezierIterator(p1x, p1y, p2x, p2y, p3x, p3y) {
|
|
return function(pct) {
|
|
var c1 = QB1(pct), c2 = QB2(pct), c3 = QB3(pct);
|
|
return {
|
|
x: p3x * c1 + p2x * c2 + p1x * c3,
|
|
y: p3y * c1 + p2y * c2 + p1y * c3
|
|
};
|
|
};
|
|
}
|
|
|
|
function getTangentQuadraticIterator(p1x, p1y, p2x, p2y, p3x, p3y) {
|
|
return function (pct) {
|
|
var invT = 1 - pct,
|
|
tangentX = (2 * invT * (p2x - p1x)) + (2 * pct * (p3x - p2x)),
|
|
tangentY = (2 * invT * (p2y - p1y)) + (2 * pct * (p3y - p2y));
|
|
return Math.atan2(tangentY, tangentX);
|
|
};
|
|
}
|
|
|
|
|
|
// this will run over a path segment ( a cubic or quadratic segment) and approximate it
|
|
// with 100 segemnts. This will good enough to calculate the length of the curve
|
|
function pathIterator(iterator, x1, y1) {
|
|
var tempP = { x: x1, y: y1 }, p, tmpLen = 0, perc;
|
|
for (perc = 1; perc <= 100; perc += 1) {
|
|
p = iterator(perc / 100);
|
|
tmpLen += calcLineLength(tempP.x, tempP.y, p.x, p.y);
|
|
tempP = p;
|
|
}
|
|
return tmpLen;
|
|
}
|
|
|
|
/**
|
|
* Given a pathInfo, and a distance in pixels, find the percentage from 0 to 1
|
|
* that correspond to that pixels run over the path.
|
|
* The percentage will be then used to find the correct point on the canvas for the path.
|
|
* @param {Array} segInfo fabricJS collection of information on a parsed path
|
|
* @param {Number} distance from starting point, in pixels.
|
|
* @return {Object} info object with x and y ( the point on canvas ) and angle, the tangent on that point;
|
|
*/
|
|
function findPercentageForDistance(segInfo, distance) {
|
|
var perc = 0, tmpLen = 0, iterator = segInfo.iterator, tempP = { x: segInfo.x, y: segInfo.y },
|
|
p, nextLen, nextStep = 0.01, angleFinder = segInfo.angleFinder, lastPerc;
|
|
// nextStep > 0.0001 covers 0.00015625 that 1/64th of 1/100
|
|
// the path
|
|
while (tmpLen < distance && perc <= 1 && nextStep > 0.0001) {
|
|
p = iterator(perc);
|
|
lastPerc = perc;
|
|
nextLen = calcLineLength(tempP.x, tempP.y, p.x, p.y);
|
|
// compare tmpLen each cycle with distance, decide next perc to test.
|
|
if ((nextLen + tmpLen) > distance) {
|
|
// we discard this step and we make smaller steps.
|
|
nextStep /= 2;
|
|
perc -= nextStep;
|
|
}
|
|
else {
|
|
tempP = p;
|
|
perc += nextStep;
|
|
tmpLen += nextLen;
|
|
}
|
|
}
|
|
p.angle = angleFinder(lastPerc);
|
|
return p;
|
|
}
|
|
|
|
/**
|
|
* Run over a parsed and simplifed path and extrac some informations.
|
|
* informations are length of each command and starting point
|
|
* @param {Array} path fabricJS parsed path commands
|
|
* @return {Array} path commands informations
|
|
*/
|
|
function getPathSegmentsInfo(path) {
|
|
var totalLength = 0, len = path.length, current,
|
|
//x2 and y2 are the coords of segment start
|
|
//x1 and y1 are the coords of the current point
|
|
x1 = 0, y1 = 0, x2 = 0, y2 = 0, info = [], iterator, tempInfo, angleFinder;
|
|
for (var i = 0; i < len; i++) {
|
|
current = path[i];
|
|
tempInfo = {
|
|
x: x1,
|
|
y: y1,
|
|
command: current[0],
|
|
};
|
|
switch (current[0]) { //first letter
|
|
case 'M':
|
|
tempInfo.length = 0;
|
|
x2 = x1 = current[1];
|
|
y2 = y1 = current[2];
|
|
break;
|
|
case 'L':
|
|
tempInfo.length = calcLineLength(x1, y1, current[1], current[2]);
|
|
x1 = current[1];
|
|
y1 = current[2];
|
|
break;
|
|
case 'C':
|
|
iterator = getPointOnCubicBezierIterator(
|
|
x1,
|
|
y1,
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4],
|
|
current[5],
|
|
current[6]
|
|
);
|
|
angleFinder = getTangentCubicIterator(
|
|
x1,
|
|
y1,
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4],
|
|
current[5],
|
|
current[6]
|
|
);
|
|
tempInfo.iterator = iterator;
|
|
tempInfo.angleFinder = angleFinder;
|
|
tempInfo.length = pathIterator(iterator, x1, y1);
|
|
x1 = current[5];
|
|
y1 = current[6];
|
|
break;
|
|
case 'Q':
|
|
iterator = getPointOnQuadraticBezierIterator(
|
|
x1,
|
|
y1,
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4]
|
|
);
|
|
angleFinder = getTangentQuadraticIterator(
|
|
x1,
|
|
y1,
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4]
|
|
);
|
|
tempInfo.iterator = iterator;
|
|
tempInfo.angleFinder = angleFinder;
|
|
tempInfo.length = pathIterator(iterator, x1, y1);
|
|
x1 = current[3];
|
|
y1 = current[4];
|
|
break;
|
|
case 'Z':
|
|
case 'z':
|
|
// we add those in order to ease calculations later
|
|
tempInfo.destX = x2;
|
|
tempInfo.destY = y2;
|
|
tempInfo.length = calcLineLength(x1, y1, x2, y2);
|
|
x1 = x2;
|
|
y1 = y2;
|
|
break;
|
|
}
|
|
totalLength += tempInfo.length;
|
|
info.push(tempInfo);
|
|
}
|
|
info.push({ length: totalLength, x: x1, y: y1 });
|
|
return info;
|
|
}
|
|
|
|
function getPointOnPath(path, distance, infos) {
|
|
if (!infos) {
|
|
infos = getPathSegmentsInfo(path);
|
|
}
|
|
var i = 0;
|
|
while ((distance - infos[i].length > 0) && i < (infos.length - 2)) {
|
|
distance -= infos[i].length;
|
|
i++;
|
|
}
|
|
// var distance = infos[infos.length - 1] * perc;
|
|
var segInfo = infos[i], segPercent = distance / segInfo.length,
|
|
command = segInfo.command, segment = path[i], info;
|
|
|
|
switch (command) {
|
|
case 'M':
|
|
return { x: segInfo.x, y: segInfo.y, angle: 0 };
|
|
case 'Z':
|
|
case 'z':
|
|
info = new fabric.Point(segInfo.x, segInfo.y).lerp(
|
|
new fabric.Point(segInfo.destX, segInfo.destY),
|
|
segPercent
|
|
);
|
|
info.angle = Math.atan2(segInfo.destY - segInfo.y, segInfo.destX - segInfo.x);
|
|
return info;
|
|
case 'L':
|
|
info = new fabric.Point(segInfo.x, segInfo.y).lerp(
|
|
new fabric.Point(segment[1], segment[2]),
|
|
segPercent
|
|
);
|
|
info.angle = Math.atan2(segment[2] - segInfo.y, segment[1] - segInfo.x);
|
|
return info;
|
|
case 'C':
|
|
return findPercentageForDistance(segInfo, distance);
|
|
case 'Q':
|
|
return findPercentageForDistance(segInfo, distance);
|
|
}
|
|
}
|
|
|
|
/**
|
|
*
|
|
* @param {string} pathString
|
|
* @return {(string|number)[][]} An array of SVG path commands
|
|
* @example <caption>Usage</caption>
|
|
* parsePath('M 3 4 Q 3 5 2 1 4 0 Q 9 12 2 1 4 0') === [
|
|
* ['M', 3, 4],
|
|
* ['Q', 3, 5, 2, 1, 4, 0],
|
|
* ['Q', 9, 12, 2, 1, 4, 0],
|
|
* ];
|
|
*
|
|
*/
|
|
function parsePath(pathString) {
|
|
var result = [],
|
|
coords = [],
|
|
currentPath,
|
|
parsed,
|
|
re = fabric.rePathCommand,
|
|
rNumber = '[-+]?(?:\\d*\\.\\d+|\\d+\\.?)(?:[eE][-+]?\\d+)?\\s*',
|
|
rNumberCommaWsp = '(' + rNumber + ')' + fabric.commaWsp,
|
|
rFlagCommaWsp = '([01])' + fabric.commaWsp + '?',
|
|
rArcSeq = rNumberCommaWsp + '?' + rNumberCommaWsp + '?' + rNumberCommaWsp + rFlagCommaWsp + rFlagCommaWsp +
|
|
rNumberCommaWsp + '?(' + rNumber + ')',
|
|
regArcArgumentSequence = new RegExp(rArcSeq, 'g'),
|
|
match,
|
|
coordsStr,
|
|
// one of commands (m,M,l,L,q,Q,c,C,etc.) followed by non-command characters (i.e. command values)
|
|
path;
|
|
if (!pathString || !pathString.match) {
|
|
return result;
|
|
}
|
|
path = pathString.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi);
|
|
|
|
for (var i = 0, coordsParsed, len = path.length; i < len; i++) {
|
|
currentPath = path[i];
|
|
|
|
coordsStr = currentPath.slice(1).trim();
|
|
coords.length = 0;
|
|
|
|
var command = currentPath.charAt(0);
|
|
coordsParsed = [command];
|
|
|
|
if (command.toLowerCase() === 'a') {
|
|
// arcs have special flags that apparently don't require spaces so handle special
|
|
for (var args; (args = regArcArgumentSequence.exec(coordsStr));) {
|
|
for (var j = 1; j < args.length; j++) {
|
|
coords.push(args[j]);
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
while ((match = re.exec(coordsStr))) {
|
|
coords.push(match[0]);
|
|
}
|
|
}
|
|
|
|
for (var j = 0, jlen = coords.length; j < jlen; j++) {
|
|
parsed = parseFloat(coords[j]);
|
|
if (!isNaN(parsed)) {
|
|
coordsParsed.push(parsed);
|
|
}
|
|
}
|
|
|
|
var commandLength = commandLengths[command.toLowerCase()],
|
|
repeatedCommand = repeatedCommands[command] || command;
|
|
|
|
if (coordsParsed.length - 1 > commandLength) {
|
|
for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) {
|
|
result.push([command].concat(coordsParsed.slice(k, k + commandLength)));
|
|
command = repeatedCommand;
|
|
}
|
|
}
|
|
else {
|
|
result.push(coordsParsed);
|
|
}
|
|
}
|
|
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
*
|
|
* Converts points to a smooth SVG path
|
|
* @param {{ x: number,y: number }[]} points Array of points
|
|
* @param {number} [correction] Apply a correction to the path (usually we use `width / 1000`). If value is undefined 0 is used as the correction value.
|
|
* @return {(string|number)[][]} An array of SVG path commands
|
|
*/
|
|
function getSmoothPathFromPoints(points, correction) {
|
|
var path = [], i,
|
|
p1 = new fabric.Point(points[0].x, points[0].y),
|
|
p2 = new fabric.Point(points[1].x, points[1].y),
|
|
len = points.length, multSignX = 1, multSignY = 0, manyPoints = len > 2;
|
|
correction = correction || 0;
|
|
|
|
if (manyPoints) {
|
|
multSignX = points[2].x < p2.x ? -1 : points[2].x === p2.x ? 0 : 1;
|
|
multSignY = points[2].y < p2.y ? -1 : points[2].y === p2.y ? 0 : 1;
|
|
}
|
|
path.push(['M', p1.x - multSignX * correction, p1.y - multSignY * correction]);
|
|
for (i = 1; i < len; i++) {
|
|
if (!p1.eq(p2)) {
|
|
var midPoint = p1.midPointFrom(p2);
|
|
// p1 is our bezier control point
|
|
// midpoint is our endpoint
|
|
// start point is p(i-1) value.
|
|
path.push(['Q', p1.x, p1.y, midPoint.x, midPoint.y]);
|
|
}
|
|
p1 = points[i];
|
|
if ((i + 1) < points.length) {
|
|
p2 = points[i + 1];
|
|
}
|
|
}
|
|
if (manyPoints) {
|
|
multSignX = p1.x > points[i - 2].x ? 1 : p1.x === points[i - 2].x ? 0 : -1;
|
|
multSignY = p1.y > points[i - 2].y ? 1 : p1.y === points[i - 2].y ? 0 : -1;
|
|
}
|
|
path.push(['L', p1.x + multSignX * correction, p1.y + multSignY * correction]);
|
|
return path;
|
|
}
|
|
/**
|
|
* Transform a path by transforming each segment.
|
|
* it has to be a simplified path or it won't work.
|
|
* WARNING: this depends from pathOffset for correct operation
|
|
* @param {Array} path fabricJS parsed and simplified path commands
|
|
* @param {Array} transform matrix that represent the transformation
|
|
* @param {Object} [pathOffset] the fabric.Path pathOffset
|
|
* @param {Number} pathOffset.x
|
|
* @param {Number} pathOffset.y
|
|
* @returns {Array} the transformed path
|
|
*/
|
|
function transformPath(path, transform, pathOffset) {
|
|
if (pathOffset) {
|
|
transform = fabric.util.multiplyTransformMatrices(
|
|
transform,
|
|
[1, 0, 0, 1, -pathOffset.x, -pathOffset.y]
|
|
);
|
|
}
|
|
return path.map(function(pathSegment) {
|
|
var newSegment = pathSegment.slice(0), point = {};
|
|
for (var i = 1; i < pathSegment.length - 1; i += 2) {
|
|
point.x = pathSegment[i];
|
|
point.y = pathSegment[i + 1];
|
|
point = fabric.util.transformPoint(point, transform);
|
|
newSegment[i] = point.x;
|
|
newSegment[i + 1] = point.y;
|
|
}
|
|
return newSegment;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Calculate bounding box of a elliptic-arc
|
|
* @deprecated
|
|
* @param {Number} fx start point of arc
|
|
* @param {Number} fy
|
|
* @param {Number} rx horizontal radius
|
|
* @param {Number} ry vertical radius
|
|
* @param {Number} rot angle of horizontal axis
|
|
* @param {Number} large 1 or 0, whatever the arc is the big or the small on the 2 points
|
|
* @param {Number} sweep 1 or 0, 1 clockwise or counterclockwise direction
|
|
* @param {Number} tx end point of arc
|
|
* @param {Number} ty
|
|
*/
|
|
function getBoundsOfArc(fx, fy, rx, ry, rot, large, sweep, tx, ty) {
|
|
|
|
var fromX = 0, fromY = 0, bound, bounds = [],
|
|
segs = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot);
|
|
|
|
for (var i = 0, len = segs.length; i < len; i++) {
|
|
bound = getBoundsOfCurve(fromX, fromY, segs[i][1], segs[i][2], segs[i][3], segs[i][4], segs[i][5], segs[i][6]);
|
|
bounds.push({ x: bound[0].x + fx, y: bound[0].y + fy });
|
|
bounds.push({ x: bound[1].x + fx, y: bound[1].y + fy });
|
|
fromX = segs[i][5];
|
|
fromY = segs[i][6];
|
|
}
|
|
return bounds;
|
|
};
|
|
|
|
/**
|
|
* Draws arc
|
|
* @deprecated
|
|
* @param {CanvasRenderingContext2D} ctx
|
|
* @param {Number} fx
|
|
* @param {Number} fy
|
|
* @param {Array} coords coords of the arc, without the front 'A/a'
|
|
*/
|
|
function drawArc(ctx, fx, fy, coords) {
|
|
coords = coords.slice(0).unshift('X'); // command A or a does not matter
|
|
var beziers = fromArcToBeziers(fx, fy, coords);
|
|
beziers.forEach(function(bezier) {
|
|
ctx.bezierCurveTo.apply(ctx, bezier.slice(1));
|
|
});
|
|
};
|
|
|
|
/**
|
|
* Join path commands to go back to svg format
|
|
* @param {Array} pathData fabricJS parsed path commands
|
|
* @return {String} joined path 'M 0 0 L 20 30'
|
|
*/
|
|
fabric.util.joinPath = function(pathData) {
|
|
return pathData.map(function (segment) { return segment.join(' '); }).join(' ');
|
|
};
|
|
fabric.util.parsePath = parsePath;
|
|
fabric.util.makePathSimpler = makePathSimpler;
|
|
fabric.util.getSmoothPathFromPoints = getSmoothPathFromPoints;
|
|
fabric.util.getPathSegmentsInfo = getPathSegmentsInfo;
|
|
fabric.util.getBoundsOfCurve = getBoundsOfCurve;
|
|
fabric.util.getPointOnPath = getPointOnPath;
|
|
fabric.util.transformPath = transformPath;
|
|
/**
|
|
* Typo of `fromArcToBeziers` kept for not breaking the api once corrected.
|
|
* Will be removed in fabric 5.0
|
|
* @deprecated
|
|
*/
|
|
fabric.util.fromArcToBeizers = fromArcToBeziers;
|
|
// kept because we do not want to make breaking changes.
|
|
// but useless and deprecated.
|
|
fabric.util.getBoundsOfArc = getBoundsOfArc;
|
|
fabric.util.drawArc = drawArc;
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
var slice = Array.prototype.slice;
|
|
|
|
/**
|
|
* Invokes method on all items in a given array
|
|
* @memberOf fabric.util.array
|
|
* @param {Array} array Array to iterate over
|
|
* @param {String} method Name of a method to invoke
|
|
* @return {Array}
|
|
*/
|
|
function invoke(array, method) {
|
|
var args = slice.call(arguments, 2), result = [];
|
|
for (var i = 0, len = array.length; i < len; i++) {
|
|
result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]);
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* Finds maximum value in array (not necessarily "first" one)
|
|
* @memberOf fabric.util.array
|
|
* @param {Array} array Array to iterate over
|
|
* @param {String} byProperty
|
|
* @return {*}
|
|
*/
|
|
function max(array, byProperty) {
|
|
return find(array, byProperty, function(value1, value2) {
|
|
return value1 >= value2;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Finds minimum value in array (not necessarily "first" one)
|
|
* @memberOf fabric.util.array
|
|
* @param {Array} array Array to iterate over
|
|
* @param {String} byProperty
|
|
* @return {*}
|
|
*/
|
|
function min(array, byProperty) {
|
|
return find(array, byProperty, function(value1, value2) {
|
|
return value1 < value2;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function fill(array, value) {
|
|
var k = array.length;
|
|
while (k--) {
|
|
array[k] = value;
|
|
}
|
|
return array;
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function find(array, byProperty, condition) {
|
|
if (!array || array.length === 0) {
|
|
return;
|
|
}
|
|
|
|
var i = array.length - 1,
|
|
result = byProperty ? array[i][byProperty] : array[i];
|
|
if (byProperty) {
|
|
while (i--) {
|
|
if (condition(array[i][byProperty], result)) {
|
|
result = array[i][byProperty];
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
while (i--) {
|
|
if (condition(array[i], result)) {
|
|
result = array[i];
|
|
}
|
|
}
|
|
}
|
|
return result;
|
|
}
|
|
|
|
/**
|
|
* @namespace fabric.util.array
|
|
*/
|
|
fabric.util.array = {
|
|
fill: fill,
|
|
invoke: invoke,
|
|
min: min,
|
|
max: max
|
|
};
|
|
|
|
})();
|
|
|
|
|
|
(function() {
|
|
/**
|
|
* Copies all enumerable properties of one js object to another
|
|
* this does not and cannot compete with generic utils.
|
|
* Does not clone or extend fabric.Object subclasses.
|
|
* This is mostly for internal use and has extra handling for fabricJS objects
|
|
* it skips the canvas and group properties in deep cloning.
|
|
* @memberOf fabric.util.object
|
|
* @param {Object} destination Where to copy to
|
|
* @param {Object} source Where to copy from
|
|
* @param {Boolean} [deep] Whether to extend nested objects
|
|
* @return {Object}
|
|
*/
|
|
|
|
function extend(destination, source, deep) {
|
|
// JScript DontEnum bug is not taken care of
|
|
// the deep clone is for internal use, is not meant to avoid
|
|
// javascript traps or cloning html element or self referenced objects.
|
|
if (deep) {
|
|
if (!fabric.isLikelyNode && source instanceof Element) {
|
|
// avoid cloning deep images, canvases,
|
|
destination = source;
|
|
}
|
|
else if (source instanceof Array) {
|
|
destination = [];
|
|
for (var i = 0, len = source.length; i < len; i++) {
|
|
destination[i] = extend({ }, source[i], deep);
|
|
}
|
|
}
|
|
else if (source && typeof source === 'object') {
|
|
for (var property in source) {
|
|
if (property === 'canvas' || property === 'group') {
|
|
// we do not want to clone this props at all.
|
|
// we want to keep the keys in the copy
|
|
destination[property] = null;
|
|
}
|
|
else if (source.hasOwnProperty(property)) {
|
|
destination[property] = extend({ }, source[property], deep);
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
// this sounds odd for an extend but is ok for recursive use
|
|
destination = source;
|
|
}
|
|
}
|
|
else {
|
|
for (var property in source) {
|
|
destination[property] = source[property];
|
|
}
|
|
}
|
|
return destination;
|
|
}
|
|
|
|
/**
|
|
* Creates an empty object and copies all enumerable properties of another object to it
|
|
* This method is mostly for internal use, and not intended for duplicating shapes in canvas.
|
|
* @memberOf fabric.util.object
|
|
* @param {Object} object Object to clone
|
|
* @param {Boolean} [deep] Whether to clone nested objects
|
|
* @return {Object}
|
|
*/
|
|
|
|
//TODO: this function return an empty object if you try to clone null
|
|
function clone(object, deep) {
|
|
return extend({ }, object, deep);
|
|
}
|
|
|
|
/** @namespace fabric.util.object */
|
|
fabric.util.object = {
|
|
extend: extend,
|
|
clone: clone
|
|
};
|
|
fabric.util.object.extend(fabric.util, fabric.Observable);
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
/**
|
|
* Camelizes a string
|
|
* @memberOf fabric.util.string
|
|
* @param {String} string String to camelize
|
|
* @return {String} Camelized version of a string
|
|
*/
|
|
function camelize(string) {
|
|
return string.replace(/-+(.)?/g, function(match, character) {
|
|
return character ? character.toUpperCase() : '';
|
|
});
|
|
}
|
|
|
|
/**
|
|
* Capitalizes a string
|
|
* @memberOf fabric.util.string
|
|
* @param {String} string String to capitalize
|
|
* @param {Boolean} [firstLetterOnly] If true only first letter is capitalized
|
|
* and other letters stay untouched, if false first letter is capitalized
|
|
* and other letters are converted to lowercase.
|
|
* @return {String} Capitalized version of a string
|
|
*/
|
|
function capitalize(string, firstLetterOnly) {
|
|
return string.charAt(0).toUpperCase() +
|
|
(firstLetterOnly ? string.slice(1) : string.slice(1).toLowerCase());
|
|
}
|
|
|
|
/**
|
|
* Escapes XML in a string
|
|
* @memberOf fabric.util.string
|
|
* @param {String} string String to escape
|
|
* @return {String} Escaped version of a string
|
|
*/
|
|
function escapeXml(string) {
|
|
return string.replace(/&/g, '&')
|
|
.replace(/"/g, '"')
|
|
.replace(/'/g, ''')
|
|
.replace(/</g, '<')
|
|
.replace(/>/g, '>');
|
|
}
|
|
|
|
/**
|
|
* Divide a string in the user perceived single units
|
|
* @memberOf fabric.util.string
|
|
* @param {String} textstring String to escape
|
|
* @return {Array} array containing the graphemes
|
|
*/
|
|
function graphemeSplit(textstring) {
|
|
var i = 0, chr, graphemes = [];
|
|
for (i = 0, chr; i < textstring.length; i++) {
|
|
if ((chr = getWholeChar(textstring, i)) === false) {
|
|
continue;
|
|
}
|
|
graphemes.push(chr);
|
|
}
|
|
return graphemes;
|
|
}
|
|
|
|
// taken from mdn in the charAt doc page.
|
|
function getWholeChar(str, i) {
|
|
var code = str.charCodeAt(i);
|
|
|
|
if (isNaN(code)) {
|
|
return ''; // Position not found
|
|
}
|
|
if (code < 0xD800 || code > 0xDFFF) {
|
|
return str.charAt(i);
|
|
}
|
|
|
|
// High surrogate (could change last hex to 0xDB7F to treat high private
|
|
// surrogates as single characters)
|
|
if (0xD800 <= code && code <= 0xDBFF) {
|
|
if (str.length <= (i + 1)) {
|
|
throw 'High surrogate without following low surrogate';
|
|
}
|
|
var next = str.charCodeAt(i + 1);
|
|
if (0xDC00 > next || next > 0xDFFF) {
|
|
throw 'High surrogate without following low surrogate';
|
|
}
|
|
return str.charAt(i) + str.charAt(i + 1);
|
|
}
|
|
// Low surrogate (0xDC00 <= code && code <= 0xDFFF)
|
|
if (i === 0) {
|
|
throw 'Low surrogate without preceding high surrogate';
|
|
}
|
|
var prev = str.charCodeAt(i - 1);
|
|
|
|
// (could change last hex to 0xDB7F to treat high private
|
|
// surrogates as single characters)
|
|
if (0xD800 > prev || prev > 0xDBFF) {
|
|
throw 'Low surrogate without preceding high surrogate';
|
|
}
|
|
// We can pass over low surrogates now as the second component
|
|
// in a pair which we have already processed
|
|
return false;
|
|
}
|
|
|
|
|
|
/**
|
|
* String utilities
|
|
* @namespace fabric.util.string
|
|
*/
|
|
fabric.util.string = {
|
|
camelize: camelize,
|
|
capitalize: capitalize,
|
|
escapeXml: escapeXml,
|
|
graphemeSplit: graphemeSplit
|
|
};
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
var slice = Array.prototype.slice, emptyFunction = function() { },
|
|
|
|
IS_DONTENUM_BUGGY = (function() {
|
|
for (var p in { toString: 1 }) {
|
|
if (p === 'toString') {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
})(),
|
|
|
|
/** @ignore */
|
|
addMethods = function(klass, source, parent) {
|
|
for (var property in source) {
|
|
|
|
if (property in klass.prototype &&
|
|
typeof klass.prototype[property] === 'function' &&
|
|
(source[property] + '').indexOf('callSuper') > -1) {
|
|
|
|
klass.prototype[property] = (function(property) {
|
|
return function() {
|
|
|
|
var superclass = this.constructor.superclass;
|
|
this.constructor.superclass = parent;
|
|
var returnValue = source[property].apply(this, arguments);
|
|
this.constructor.superclass = superclass;
|
|
|
|
if (property !== 'initialize') {
|
|
return returnValue;
|
|
}
|
|
};
|
|
})(property);
|
|
}
|
|
else {
|
|
klass.prototype[property] = source[property];
|
|
}
|
|
|
|
if (IS_DONTENUM_BUGGY) {
|
|
if (source.toString !== Object.prototype.toString) {
|
|
klass.prototype.toString = source.toString;
|
|
}
|
|
if (source.valueOf !== Object.prototype.valueOf) {
|
|
klass.prototype.valueOf = source.valueOf;
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
function Subclass() { }
|
|
|
|
function callSuper(methodName) {
|
|
var parentMethod = null,
|
|
_this = this;
|
|
|
|
// climb prototype chain to find method not equal to callee's method
|
|
while (_this.constructor.superclass) {
|
|
var superClassMethod = _this.constructor.superclass.prototype[methodName];
|
|
if (_this[methodName] !== superClassMethod) {
|
|
parentMethod = superClassMethod;
|
|
break;
|
|
}
|
|
// eslint-disable-next-line
|
|
_this = _this.constructor.superclass.prototype;
|
|
}
|
|
|
|
if (!parentMethod) {
|
|
return console.log('tried to callSuper ' + methodName + ', method not found in prototype chain', this);
|
|
}
|
|
|
|
return (arguments.length > 1)
|
|
? parentMethod.apply(this, slice.call(arguments, 1))
|
|
: parentMethod.call(this);
|
|
}
|
|
|
|
/**
|
|
* Helper for creation of "classes".
|
|
* @memberOf fabric.util
|
|
* @param {Function} [parent] optional "Class" to inherit from
|
|
* @param {Object} [properties] Properties shared by all instances of this class
|
|
* (be careful modifying objects defined here as this would affect all instances)
|
|
*/
|
|
function createClass() {
|
|
var parent = null,
|
|
properties = slice.call(arguments, 0);
|
|
|
|
if (typeof properties[0] === 'function') {
|
|
parent = properties.shift();
|
|
}
|
|
function klass() {
|
|
this.initialize.apply(this, arguments);
|
|
}
|
|
|
|
klass.superclass = parent;
|
|
klass.subclasses = [];
|
|
|
|
if (parent) {
|
|
Subclass.prototype = parent.prototype;
|
|
klass.prototype = new Subclass();
|
|
parent.subclasses.push(klass);
|
|
}
|
|
for (var i = 0, length = properties.length; i < length; i++) {
|
|
addMethods(klass, properties[i], parent);
|
|
}
|
|
if (!klass.prototype.initialize) {
|
|
klass.prototype.initialize = emptyFunction;
|
|
}
|
|
klass.prototype.constructor = klass;
|
|
klass.prototype.callSuper = callSuper;
|
|
return klass;
|
|
}
|
|
|
|
fabric.util.createClass = createClass;
|
|
})();
|
|
|
|
|
|
(function () {
|
|
// since ie11 can use addEventListener but they do not support options, i need to check
|
|
var couldUseAttachEvent = !!fabric.document.createElement('div').attachEvent,
|
|
touchEvents = ['touchstart', 'touchmove', 'touchend'];
|
|
/**
|
|
* Adds an event listener to an element
|
|
* @function
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element
|
|
* @param {String} eventName
|
|
* @param {Function} handler
|
|
*/
|
|
fabric.util.addListener = function(element, eventName, handler, options) {
|
|
element && element.addEventListener(eventName, handler, couldUseAttachEvent ? false : options);
|
|
};
|
|
|
|
/**
|
|
* Removes an event listener from an element
|
|
* @function
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element
|
|
* @param {String} eventName
|
|
* @param {Function} handler
|
|
*/
|
|
fabric.util.removeListener = function(element, eventName, handler, options) {
|
|
element && element.removeEventListener(eventName, handler, couldUseAttachEvent ? false : options);
|
|
};
|
|
|
|
function getTouchInfo(event) {
|
|
var touchProp = event.changedTouches;
|
|
if (touchProp && touchProp[0]) {
|
|
return touchProp[0];
|
|
}
|
|
return event;
|
|
}
|
|
|
|
fabric.util.getPointer = function(event) {
|
|
var element = event.target,
|
|
scroll = fabric.util.getScrollLeftTop(element),
|
|
_evt = getTouchInfo(event);
|
|
return {
|
|
x: _evt.clientX + scroll.left,
|
|
y: _evt.clientY + scroll.top
|
|
};
|
|
};
|
|
|
|
fabric.util.isTouchEvent = function(event) {
|
|
return touchEvents.indexOf(event.type) > -1 || event.pointerType === 'touch';
|
|
};
|
|
})();
|
|
|
|
|
|
(function () {
|
|
|
|
/**
|
|
* Cross-browser wrapper for setting element's style
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element
|
|
* @param {Object} styles
|
|
* @return {HTMLElement} Element that was passed as a first argument
|
|
*/
|
|
function setStyle(element, styles) {
|
|
var elementStyle = element.style;
|
|
if (!elementStyle) {
|
|
return element;
|
|
}
|
|
if (typeof styles === 'string') {
|
|
element.style.cssText += ';' + styles;
|
|
return styles.indexOf('opacity') > -1
|
|
? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1])
|
|
: element;
|
|
}
|
|
for (var property in styles) {
|
|
if (property === 'opacity') {
|
|
setOpacity(element, styles[property]);
|
|
}
|
|
else {
|
|
var normalizedProperty = (property === 'float' || property === 'cssFloat')
|
|
? (typeof elementStyle.styleFloat === 'undefined' ? 'cssFloat' : 'styleFloat')
|
|
: property;
|
|
elementStyle[normalizedProperty] = styles[property];
|
|
}
|
|
}
|
|
return element;
|
|
}
|
|
|
|
var parseEl = fabric.document.createElement('div'),
|
|
supportsOpacity = typeof parseEl.style.opacity === 'string',
|
|
supportsFilters = typeof parseEl.style.filter === 'string',
|
|
reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/,
|
|
|
|
/** @ignore */
|
|
setOpacity = function (element) { return element; };
|
|
|
|
if (supportsOpacity) {
|
|
/** @ignore */
|
|
setOpacity = function(element, value) {
|
|
element.style.opacity = value;
|
|
return element;
|
|
};
|
|
}
|
|
else if (supportsFilters) {
|
|
/** @ignore */
|
|
setOpacity = function(element, value) {
|
|
var es = element.style;
|
|
if (element.currentStyle && !element.currentStyle.hasLayout) {
|
|
es.zoom = 1;
|
|
}
|
|
if (reOpacity.test(es.filter)) {
|
|
value = value >= 0.9999 ? '' : ('alpha(opacity=' + (value * 100) + ')');
|
|
es.filter = es.filter.replace(reOpacity, value);
|
|
}
|
|
else {
|
|
es.filter += ' alpha(opacity=' + (value * 100) + ')';
|
|
}
|
|
return element;
|
|
};
|
|
}
|
|
|
|
fabric.util.setStyle = setStyle;
|
|
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
var _slice = Array.prototype.slice;
|
|
|
|
/**
|
|
* Takes id and returns an element with that id (if one exists in a document)
|
|
* @memberOf fabric.util
|
|
* @param {String|HTMLElement} id
|
|
* @return {HTMLElement|null}
|
|
*/
|
|
function getById(id) {
|
|
return typeof id === 'string' ? fabric.document.getElementById(id) : id;
|
|
}
|
|
|
|
var sliceCanConvertNodelists,
|
|
/**
|
|
* Converts an array-like object (e.g. arguments or NodeList) to an array
|
|
* @memberOf fabric.util
|
|
* @param {Object} arrayLike
|
|
* @return {Array}
|
|
*/
|
|
toArray = function(arrayLike) {
|
|
return _slice.call(arrayLike, 0);
|
|
};
|
|
|
|
try {
|
|
sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array;
|
|
}
|
|
catch (err) { }
|
|
|
|
if (!sliceCanConvertNodelists) {
|
|
toArray = function(arrayLike) {
|
|
var arr = new Array(arrayLike.length), i = arrayLike.length;
|
|
while (i--) {
|
|
arr[i] = arrayLike[i];
|
|
}
|
|
return arr;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Creates specified element with specified attributes
|
|
* @memberOf fabric.util
|
|
* @param {String} tagName Type of an element to create
|
|
* @param {Object} [attributes] Attributes to set on an element
|
|
* @return {HTMLElement} Newly created element
|
|
*/
|
|
function makeElement(tagName, attributes) {
|
|
var el = fabric.document.createElement(tagName);
|
|
for (var prop in attributes) {
|
|
if (prop === 'class') {
|
|
el.className = attributes[prop];
|
|
}
|
|
else if (prop === 'for') {
|
|
el.htmlFor = attributes[prop];
|
|
}
|
|
else {
|
|
el.setAttribute(prop, attributes[prop]);
|
|
}
|
|
}
|
|
return el;
|
|
}
|
|
|
|
/**
|
|
* Adds class to an element
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to add class to
|
|
* @param {String} className Class to add to an element
|
|
*/
|
|
function addClass(element, className) {
|
|
if (element && (' ' + element.className + ' ').indexOf(' ' + className + ' ') === -1) {
|
|
element.className += (element.className ? ' ' : '') + className;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Wraps element with another element
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to wrap
|
|
* @param {HTMLElement|String} wrapper Element to wrap with
|
|
* @param {Object} [attributes] Attributes to set on a wrapper
|
|
* @return {HTMLElement} wrapper
|
|
*/
|
|
function wrapElement(element, wrapper, attributes) {
|
|
if (typeof wrapper === 'string') {
|
|
wrapper = makeElement(wrapper, attributes);
|
|
}
|
|
if (element.parentNode) {
|
|
element.parentNode.replaceChild(wrapper, element);
|
|
}
|
|
wrapper.appendChild(element);
|
|
return wrapper;
|
|
}
|
|
|
|
/**
|
|
* Returns element scroll offsets
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to operate on
|
|
* @return {Object} Object with left/top values
|
|
*/
|
|
function getScrollLeftTop(element) {
|
|
|
|
var left = 0,
|
|
top = 0,
|
|
docElement = fabric.document.documentElement,
|
|
body = fabric.document.body || {
|
|
scrollLeft: 0, scrollTop: 0
|
|
};
|
|
|
|
// While loop checks (and then sets element to) .parentNode OR .host
|
|
// to account for ShadowDOM. We still want to traverse up out of ShadowDOM,
|
|
// but the .parentNode of a root ShadowDOM node will always be null, instead
|
|
// it should be accessed through .host. See http://stackoverflow.com/a/24765528/4383938
|
|
while (element && (element.parentNode || element.host)) {
|
|
|
|
// Set element to element parent, or 'host' in case of ShadowDOM
|
|
element = element.parentNode || element.host;
|
|
|
|
if (element === fabric.document) {
|
|
left = body.scrollLeft || docElement.scrollLeft || 0;
|
|
top = body.scrollTop || docElement.scrollTop || 0;
|
|
}
|
|
else {
|
|
left += element.scrollLeft || 0;
|
|
top += element.scrollTop || 0;
|
|
}
|
|
|
|
if (element.nodeType === 1 && element.style.position === 'fixed') {
|
|
break;
|
|
}
|
|
}
|
|
|
|
return { left: left, top: top };
|
|
}
|
|
|
|
/**
|
|
* Returns offset for a given element
|
|
* @function
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to get offset for
|
|
* @return {Object} Object with "left" and "top" properties
|
|
*/
|
|
function getElementOffset(element) {
|
|
var docElem,
|
|
doc = element && element.ownerDocument,
|
|
box = { left: 0, top: 0 },
|
|
offset = { left: 0, top: 0 },
|
|
scrollLeftTop,
|
|
offsetAttributes = {
|
|
borderLeftWidth: 'left',
|
|
borderTopWidth: 'top',
|
|
paddingLeft: 'left',
|
|
paddingTop: 'top'
|
|
};
|
|
|
|
if (!doc) {
|
|
return offset;
|
|
}
|
|
|
|
for (var attr in offsetAttributes) {
|
|
offset[offsetAttributes[attr]] += parseInt(getElementStyle(element, attr), 10) || 0;
|
|
}
|
|
|
|
docElem = doc.documentElement;
|
|
if ( typeof element.getBoundingClientRect !== 'undefined' ) {
|
|
box = element.getBoundingClientRect();
|
|
}
|
|
|
|
scrollLeftTop = getScrollLeftTop(element);
|
|
|
|
return {
|
|
left: box.left + scrollLeftTop.left - (docElem.clientLeft || 0) + offset.left,
|
|
top: box.top + scrollLeftTop.top - (docElem.clientTop || 0) + offset.top
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Returns style attribute value of a given element
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to get style attribute for
|
|
* @param {String} attr Style attribute to get for element
|
|
* @return {String} Style attribute value of the given element.
|
|
*/
|
|
var getElementStyle;
|
|
if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) {
|
|
getElementStyle = function(element, attr) {
|
|
var style = fabric.document.defaultView.getComputedStyle(element, null);
|
|
return style ? style[attr] : undefined;
|
|
};
|
|
}
|
|
else {
|
|
getElementStyle = function(element, attr) {
|
|
var value = element.style[attr];
|
|
if (!value && element.currentStyle) {
|
|
value = element.currentStyle[attr];
|
|
}
|
|
return value;
|
|
};
|
|
}
|
|
|
|
(function () {
|
|
var style = fabric.document.documentElement.style,
|
|
selectProp = 'userSelect' in style
|
|
? 'userSelect'
|
|
: 'MozUserSelect' in style
|
|
? 'MozUserSelect'
|
|
: 'WebkitUserSelect' in style
|
|
? 'WebkitUserSelect'
|
|
: 'KhtmlUserSelect' in style
|
|
? 'KhtmlUserSelect'
|
|
: '';
|
|
|
|
/**
|
|
* Makes element unselectable
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to make unselectable
|
|
* @return {HTMLElement} Element that was passed in
|
|
*/
|
|
function makeElementUnselectable(element) {
|
|
if (typeof element.onselectstart !== 'undefined') {
|
|
element.onselectstart = fabric.util.falseFunction;
|
|
}
|
|
if (selectProp) {
|
|
element.style[selectProp] = 'none';
|
|
}
|
|
else if (typeof element.unselectable === 'string') {
|
|
element.unselectable = 'on';
|
|
}
|
|
return element;
|
|
}
|
|
|
|
/**
|
|
* Makes element selectable
|
|
* @memberOf fabric.util
|
|
* @param {HTMLElement} element Element to make selectable
|
|
* @return {HTMLElement} Element that was passed in
|
|
*/
|
|
function makeElementSelectable(element) {
|
|
if (typeof element.onselectstart !== 'undefined') {
|
|
element.onselectstart = null;
|
|
}
|
|
if (selectProp) {
|
|
element.style[selectProp] = '';
|
|
}
|
|
else if (typeof element.unselectable === 'string') {
|
|
element.unselectable = '';
|
|
}
|
|
return element;
|
|
}
|
|
|
|
fabric.util.makeElementUnselectable = makeElementUnselectable;
|
|
fabric.util.makeElementSelectable = makeElementSelectable;
|
|
})();
|
|
|
|
function getNodeCanvas(element) {
|
|
var impl = fabric.jsdomImplForWrapper(element);
|
|
return impl._canvas || impl._image;
|
|
};
|
|
|
|
function cleanUpJsdomNode(element) {
|
|
if (!fabric.isLikelyNode) {
|
|
return;
|
|
}
|
|
var impl = fabric.jsdomImplForWrapper(element);
|
|
if (impl) {
|
|
impl._image = null;
|
|
impl._canvas = null;
|
|
// unsure if necessary
|
|
impl._currentSrc = null;
|
|
impl._attributes = null;
|
|
impl._classList = null;
|
|
}
|
|
}
|
|
|
|
function setImageSmoothing(ctx, value) {
|
|
ctx.imageSmoothingEnabled = ctx.imageSmoothingEnabled || ctx.webkitImageSmoothingEnabled
|
|
|| ctx.mozImageSmoothingEnabled || ctx.msImageSmoothingEnabled || ctx.oImageSmoothingEnabled;
|
|
ctx.imageSmoothingEnabled = value;
|
|
}
|
|
|
|
/**
|
|
* setImageSmoothing sets the context imageSmoothingEnabled property.
|
|
* Used by canvas and by ImageObject.
|
|
* @memberOf fabric.util
|
|
* @since 4.0.0
|
|
* @param {HTMLRenderingContext2D} ctx to set on
|
|
* @param {Boolean} value true or false
|
|
*/
|
|
fabric.util.setImageSmoothing = setImageSmoothing;
|
|
fabric.util.getById = getById;
|
|
fabric.util.toArray = toArray;
|
|
fabric.util.addClass = addClass;
|
|
fabric.util.makeElement = makeElement;
|
|
fabric.util.wrapElement = wrapElement;
|
|
fabric.util.getScrollLeftTop = getScrollLeftTop;
|
|
fabric.util.getElementOffset = getElementOffset;
|
|
fabric.util.getNodeCanvas = getNodeCanvas;
|
|
fabric.util.cleanUpJsdomNode = cleanUpJsdomNode;
|
|
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
function addParamToUrl(url, param) {
|
|
return url + (/\?/.test(url) ? '&' : '?') + param;
|
|
}
|
|
|
|
function emptyFn() { }
|
|
|
|
/**
|
|
* Cross-browser abstraction for sending XMLHttpRequest
|
|
* @memberOf fabric.util
|
|
* @param {String} url URL to send XMLHttpRequest to
|
|
* @param {Object} [options] Options object
|
|
* @param {String} [options.method="GET"]
|
|
* @param {String} [options.parameters] parameters to append to url in GET or in body
|
|
* @param {String} [options.body] body to send with POST or PUT request
|
|
* @param {Function} options.onComplete Callback to invoke when request is completed
|
|
* @return {XMLHttpRequest} request
|
|
*/
|
|
function request(url, options) {
|
|
options || (options = { });
|
|
|
|
var method = options.method ? options.method.toUpperCase() : 'GET',
|
|
onComplete = options.onComplete || function() { },
|
|
xhr = new fabric.window.XMLHttpRequest(),
|
|
body = options.body || options.parameters;
|
|
|
|
/** @ignore */
|
|
xhr.onreadystatechange = function() {
|
|
if (xhr.readyState === 4) {
|
|
onComplete(xhr);
|
|
xhr.onreadystatechange = emptyFn;
|
|
}
|
|
};
|
|
|
|
if (method === 'GET') {
|
|
body = null;
|
|
if (typeof options.parameters === 'string') {
|
|
url = addParamToUrl(url, options.parameters);
|
|
}
|
|
}
|
|
|
|
xhr.open(method, url, true);
|
|
|
|
if (method === 'POST' || method === 'PUT') {
|
|
xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded');
|
|
}
|
|
|
|
xhr.send(body);
|
|
return xhr;
|
|
}
|
|
|
|
fabric.util.request = request;
|
|
})();
|
|
|
|
|
|
/**
|
|
* Wrapper around `console.log` (when available)
|
|
* @param {*} [values] Values to log
|
|
*/
|
|
fabric.log = console.log;
|
|
|
|
/**
|
|
* Wrapper around `console.warn` (when available)
|
|
* @param {*} [values] Values to log as a warning
|
|
*/
|
|
fabric.warn = console.warn;
|
|
|
|
|
|
(function() {
|
|
|
|
function noop() {
|
|
return false;
|
|
}
|
|
|
|
function defaultEasing(t, b, c, d) {
|
|
return -c * Math.cos(t / d * (Math.PI / 2)) + c + b;
|
|
}
|
|
|
|
/**
|
|
* Changes value from one to another within certain period of time, invoking callbacks as value is being changed.
|
|
* @memberOf fabric.util
|
|
* @param {Object} [options] Animation options
|
|
* @param {Function} [options.onChange] Callback; invoked on every value change
|
|
* @param {Function} [options.onComplete] Callback; invoked when value change is completed
|
|
* @param {Number} [options.startValue=0] Starting value
|
|
* @param {Number} [options.endValue=100] Ending value
|
|
* @param {Number} [options.byValue=100] Value to modify the property by
|
|
* @param {Function} [options.easing] Easing function
|
|
* @param {Number} [options.duration=500] Duration of change (in ms)
|
|
* @param {Function} [options.abort] Additional function with logic. If returns true, onComplete is called.
|
|
* @returns {Function} abort function
|
|
*/
|
|
function animate(options) {
|
|
var cancel = false;
|
|
requestAnimFrame(function(timestamp) {
|
|
options || (options = { });
|
|
|
|
var start = timestamp || +new Date(),
|
|
duration = options.duration || 500,
|
|
finish = start + duration, time,
|
|
onChange = options.onChange || noop,
|
|
abort = options.abort || noop,
|
|
onComplete = options.onComplete || noop,
|
|
easing = options.easing || defaultEasing,
|
|
startValue = 'startValue' in options ? options.startValue : 0,
|
|
endValue = 'endValue' in options ? options.endValue : 100,
|
|
byValue = options.byValue || endValue - startValue;
|
|
|
|
options.onStart && options.onStart();
|
|
|
|
(function tick(ticktime) {
|
|
// TODO: move abort call after calculation
|
|
// and pass (current,valuePerc, timePerc) as arguments
|
|
time = ticktime || +new Date();
|
|
var currentTime = time > finish ? duration : (time - start),
|
|
timePerc = currentTime / duration,
|
|
current = easing(currentTime, startValue, byValue, duration),
|
|
valuePerc = Math.abs((current - startValue) / byValue);
|
|
if (cancel) {
|
|
return;
|
|
}
|
|
if (abort(current, valuePerc, timePerc)) {
|
|
// remove this in 4.0
|
|
// does to even make sense to abort and run onComplete?
|
|
onComplete(endValue, 1, 1);
|
|
return;
|
|
}
|
|
if (time > finish) {
|
|
onChange(endValue, 1, 1);
|
|
onComplete(endValue, 1, 1);
|
|
return;
|
|
}
|
|
else {
|
|
onChange(current, valuePerc, timePerc);
|
|
requestAnimFrame(tick);
|
|
}
|
|
})(start);
|
|
});
|
|
return function() {
|
|
cancel = true;
|
|
};
|
|
}
|
|
|
|
var _requestAnimFrame = fabric.window.requestAnimationFrame ||
|
|
fabric.window.webkitRequestAnimationFrame ||
|
|
fabric.window.mozRequestAnimationFrame ||
|
|
fabric.window.oRequestAnimationFrame ||
|
|
fabric.window.msRequestAnimationFrame ||
|
|
function(callback) {
|
|
return fabric.window.setTimeout(callback, 1000 / 60);
|
|
};
|
|
|
|
var _cancelAnimFrame = fabric.window.cancelAnimationFrame || fabric.window.clearTimeout;
|
|
|
|
/**
|
|
* requestAnimationFrame polyfill based on http://paulirish.com/2011/requestanimationframe-for-smart-animating/
|
|
* In order to get a precise start time, `requestAnimFrame` should be called as an entry into the method
|
|
* @memberOf fabric.util
|
|
* @param {Function} callback Callback to invoke
|
|
* @param {DOMElement} element optional Element to associate with animation
|
|
*/
|
|
function requestAnimFrame() {
|
|
return _requestAnimFrame.apply(fabric.window, arguments);
|
|
}
|
|
|
|
function cancelAnimFrame() {
|
|
return _cancelAnimFrame.apply(fabric.window, arguments);
|
|
}
|
|
|
|
fabric.util.animate = animate;
|
|
fabric.util.requestAnimFrame = requestAnimFrame;
|
|
fabric.util.cancelAnimFrame = cancelAnimFrame;
|
|
})();
|
|
|
|
|
|
(function() {
|
|
// Calculate an in-between color. Returns a "rgba()" string.
|
|
// Credit: Edwin Martin <edwin@bitstorm.org>
|
|
// http://www.bitstorm.org/jquery/color-animation/jquery.animate-colors.js
|
|
function calculateColor(begin, end, pos) {
|
|
var color = 'rgba('
|
|
+ parseInt((begin[0] + pos * (end[0] - begin[0])), 10) + ','
|
|
+ parseInt((begin[1] + pos * (end[1] - begin[1])), 10) + ','
|
|
+ parseInt((begin[2] + pos * (end[2] - begin[2])), 10);
|
|
|
|
color += ',' + (begin && end ? parseFloat(begin[3] + pos * (end[3] - begin[3])) : 1);
|
|
color += ')';
|
|
return color;
|
|
}
|
|
|
|
/**
|
|
* Changes the color from one to another within certain period of time, invoking callbacks as value is being changed.
|
|
* @memberOf fabric.util
|
|
* @param {String} fromColor The starting color in hex or rgb(a) format.
|
|
* @param {String} toColor The starting color in hex or rgb(a) format.
|
|
* @param {Number} [duration] Duration of change (in ms).
|
|
* @param {Object} [options] Animation options
|
|
* @param {Function} [options.onChange] Callback; invoked on every value change
|
|
* @param {Function} [options.onComplete] Callback; invoked when value change is completed
|
|
* @param {Function} [options.colorEasing] Easing function. Note that this function only take two arguments (currentTime, duration). Thus the regular animation easing functions cannot be used.
|
|
* @param {Function} [options.abort] Additional function with logic. If returns true, onComplete is called.
|
|
* @returns {Function} abort function
|
|
*/
|
|
function animateColor(fromColor, toColor, duration, options) {
|
|
var startColor = new fabric.Color(fromColor).getSource(),
|
|
endColor = new fabric.Color(toColor).getSource(),
|
|
originalOnComplete = options.onComplete,
|
|
originalOnChange = options.onChange;
|
|
options = options || {};
|
|
|
|
return fabric.util.animate(fabric.util.object.extend(options, {
|
|
duration: duration || 500,
|
|
startValue: startColor,
|
|
endValue: endColor,
|
|
byValue: endColor,
|
|
easing: function (currentTime, startValue, byValue, duration) {
|
|
var posValue = options.colorEasing
|
|
? options.colorEasing(currentTime, duration)
|
|
: 1 - Math.cos(currentTime / duration * (Math.PI / 2));
|
|
return calculateColor(startValue, byValue, posValue);
|
|
},
|
|
// has to take in account for color restoring;
|
|
onComplete: function(current, valuePerc, timePerc) {
|
|
if (originalOnComplete) {
|
|
return originalOnComplete(
|
|
calculateColor(endColor, endColor, 0),
|
|
valuePerc,
|
|
timePerc
|
|
);
|
|
}
|
|
},
|
|
onChange: function(current, valuePerc, timePerc) {
|
|
if (originalOnChange) {
|
|
if (Array.isArray(current)) {
|
|
return originalOnChange(
|
|
calculateColor(current, current, 0),
|
|
valuePerc,
|
|
timePerc
|
|
);
|
|
}
|
|
originalOnChange(current, valuePerc, timePerc);
|
|
}
|
|
}
|
|
}));
|
|
}
|
|
|
|
fabric.util.animateColor = animateColor;
|
|
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
function normalize(a, c, p, s) {
|
|
if (a < Math.abs(c)) {
|
|
a = c;
|
|
s = p / 4;
|
|
}
|
|
else {
|
|
//handle the 0/0 case:
|
|
if (c === 0 && a === 0) {
|
|
s = p / (2 * Math.PI) * Math.asin(1);
|
|
}
|
|
else {
|
|
s = p / (2 * Math.PI) * Math.asin(c / a);
|
|
}
|
|
}
|
|
return { a: a, c: c, p: p, s: s };
|
|
}
|
|
|
|
function elastic(opts, t, d) {
|
|
return opts.a *
|
|
Math.pow(2, 10 * (t -= 1)) *
|
|
Math.sin( (t * d - opts.s) * (2 * Math.PI) / opts.p );
|
|
}
|
|
|
|
/**
|
|
* Cubic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutCubic(t, b, c, d) {
|
|
return c * ((t = t / d - 1) * t * t + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Cubic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutCubic(t, b, c, d) {
|
|
t /= d / 2;
|
|
if (t < 1) {
|
|
return c / 2 * t * t * t + b;
|
|
}
|
|
return c / 2 * ((t -= 2) * t * t + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Quartic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInQuart(t, b, c, d) {
|
|
return c * (t /= d) * t * t * t + b;
|
|
}
|
|
|
|
/**
|
|
* Quartic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutQuart(t, b, c, d) {
|
|
return -c * ((t = t / d - 1) * t * t * t - 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Quartic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutQuart(t, b, c, d) {
|
|
t /= d / 2;
|
|
if (t < 1) {
|
|
return c / 2 * t * t * t * t + b;
|
|
}
|
|
return -c / 2 * ((t -= 2) * t * t * t - 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Quintic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInQuint(t, b, c, d) {
|
|
return c * (t /= d) * t * t * t * t + b;
|
|
}
|
|
|
|
/**
|
|
* Quintic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutQuint(t, b, c, d) {
|
|
return c * ((t = t / d - 1) * t * t * t * t + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Quintic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutQuint(t, b, c, d) {
|
|
t /= d / 2;
|
|
if (t < 1) {
|
|
return c / 2 * t * t * t * t * t + b;
|
|
}
|
|
return c / 2 * ((t -= 2) * t * t * t * t + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Sinusoidal easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInSine(t, b, c, d) {
|
|
return -c * Math.cos(t / d * (Math.PI / 2)) + c + b;
|
|
}
|
|
|
|
/**
|
|
* Sinusoidal easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutSine(t, b, c, d) {
|
|
return c * Math.sin(t / d * (Math.PI / 2)) + b;
|
|
}
|
|
|
|
/**
|
|
* Sinusoidal easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutSine(t, b, c, d) {
|
|
return -c / 2 * (Math.cos(Math.PI * t / d) - 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Exponential easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInExpo(t, b, c, d) {
|
|
return (t === 0) ? b : c * Math.pow(2, 10 * (t / d - 1)) + b;
|
|
}
|
|
|
|
/**
|
|
* Exponential easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutExpo(t, b, c, d) {
|
|
return (t === d) ? b + c : c * (-Math.pow(2, -10 * t / d) + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Exponential easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutExpo(t, b, c, d) {
|
|
if (t === 0) {
|
|
return b;
|
|
}
|
|
if (t === d) {
|
|
return b + c;
|
|
}
|
|
t /= d / 2;
|
|
if (t < 1) {
|
|
return c / 2 * Math.pow(2, 10 * (t - 1)) + b;
|
|
}
|
|
return c / 2 * (-Math.pow(2, -10 * --t) + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Circular easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInCirc(t, b, c, d) {
|
|
return -c * (Math.sqrt(1 - (t /= d) * t) - 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Circular easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutCirc(t, b, c, d) {
|
|
return c * Math.sqrt(1 - (t = t / d - 1) * t) + b;
|
|
}
|
|
|
|
/**
|
|
* Circular easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutCirc(t, b, c, d) {
|
|
t /= d / 2;
|
|
if (t < 1) {
|
|
return -c / 2 * (Math.sqrt(1 - t * t) - 1) + b;
|
|
}
|
|
return c / 2 * (Math.sqrt(1 - (t -= 2) * t) + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Elastic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInElastic(t, b, c, d) {
|
|
var s = 1.70158, p = 0, a = c;
|
|
if (t === 0) {
|
|
return b;
|
|
}
|
|
t /= d;
|
|
if (t === 1) {
|
|
return b + c;
|
|
}
|
|
if (!p) {
|
|
p = d * 0.3;
|
|
}
|
|
var opts = normalize(a, c, p, s);
|
|
return -elastic(opts, t, d) + b;
|
|
}
|
|
|
|
/**
|
|
* Elastic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutElastic(t, b, c, d) {
|
|
var s = 1.70158, p = 0, a = c;
|
|
if (t === 0) {
|
|
return b;
|
|
}
|
|
t /= d;
|
|
if (t === 1) {
|
|
return b + c;
|
|
}
|
|
if (!p) {
|
|
p = d * 0.3;
|
|
}
|
|
var opts = normalize(a, c, p, s);
|
|
return opts.a * Math.pow(2, -10 * t) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) + opts.c + b;
|
|
}
|
|
|
|
/**
|
|
* Elastic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutElastic(t, b, c, d) {
|
|
var s = 1.70158, p = 0, a = c;
|
|
if (t === 0) {
|
|
return b;
|
|
}
|
|
t /= d / 2;
|
|
if (t === 2) {
|
|
return b + c;
|
|
}
|
|
if (!p) {
|
|
p = d * (0.3 * 1.5);
|
|
}
|
|
var opts = normalize(a, c, p, s);
|
|
if (t < 1) {
|
|
return -0.5 * elastic(opts, t, d) + b;
|
|
}
|
|
return opts.a * Math.pow(2, -10 * (t -= 1)) *
|
|
Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) * 0.5 + opts.c + b;
|
|
}
|
|
|
|
/**
|
|
* Backwards easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInBack(t, b, c, d, s) {
|
|
if (s === undefined) {
|
|
s = 1.70158;
|
|
}
|
|
return c * (t /= d) * t * ((s + 1) * t - s) + b;
|
|
}
|
|
|
|
/**
|
|
* Backwards easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutBack(t, b, c, d, s) {
|
|
if (s === undefined) {
|
|
s = 1.70158;
|
|
}
|
|
return c * ((t = t / d - 1) * t * ((s + 1) * t + s) + 1) + b;
|
|
}
|
|
|
|
/**
|
|
* Backwards easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutBack(t, b, c, d, s) {
|
|
if (s === undefined) {
|
|
s = 1.70158;
|
|
}
|
|
t /= d / 2;
|
|
if (t < 1) {
|
|
return c / 2 * (t * t * (((s *= (1.525)) + 1) * t - s)) + b;
|
|
}
|
|
return c / 2 * ((t -= 2) * t * (((s *= (1.525)) + 1) * t + s) + 2) + b;
|
|
}
|
|
|
|
/**
|
|
* Bouncing easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInBounce(t, b, c, d) {
|
|
return c - easeOutBounce (d - t, 0, c, d) + b;
|
|
}
|
|
|
|
/**
|
|
* Bouncing easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeOutBounce(t, b, c, d) {
|
|
if ((t /= d) < (1 / 2.75)) {
|
|
return c * (7.5625 * t * t) + b;
|
|
}
|
|
else if (t < (2 / 2.75)) {
|
|
return c * (7.5625 * (t -= (1.5 / 2.75)) * t + 0.75) + b;
|
|
}
|
|
else if (t < (2.5 / 2.75)) {
|
|
return c * (7.5625 * (t -= (2.25 / 2.75)) * t + 0.9375) + b;
|
|
}
|
|
else {
|
|
return c * (7.5625 * (t -= (2.625 / 2.75)) * t + 0.984375) + b;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Bouncing easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
function easeInOutBounce(t, b, c, d) {
|
|
if (t < d / 2) {
|
|
return easeInBounce (t * 2, 0, c, d) * 0.5 + b;
|
|
}
|
|
return easeOutBounce(t * 2 - d, 0, c, d) * 0.5 + c * 0.5 + b;
|
|
}
|
|
|
|
/**
|
|
* Easing functions
|
|
* See <a href="http://gizma.com/easing/">Easing Equations by Robert Penner</a>
|
|
* @namespace fabric.util.ease
|
|
*/
|
|
fabric.util.ease = {
|
|
|
|
/**
|
|
* Quadratic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
easeInQuad: function(t, b, c, d) {
|
|
return c * (t /= d) * t + b;
|
|
},
|
|
|
|
/**
|
|
* Quadratic easing out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
easeOutQuad: function(t, b, c, d) {
|
|
return -c * (t /= d) * (t - 2) + b;
|
|
},
|
|
|
|
/**
|
|
* Quadratic easing in and out
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
easeInOutQuad: function(t, b, c, d) {
|
|
t /= (d / 2);
|
|
if (t < 1) {
|
|
return c / 2 * t * t + b;
|
|
}
|
|
return -c / 2 * ((--t) * (t - 2) - 1) + b;
|
|
},
|
|
|
|
/**
|
|
* Cubic easing in
|
|
* @memberOf fabric.util.ease
|
|
*/
|
|
easeInCubic: function(t, b, c, d) {
|
|
return c * (t /= d) * t * t + b;
|
|
},
|
|
|
|
easeOutCubic: easeOutCubic,
|
|
easeInOutCubic: easeInOutCubic,
|
|
easeInQuart: easeInQuart,
|
|
easeOutQuart: easeOutQuart,
|
|
easeInOutQuart: easeInOutQuart,
|
|
easeInQuint: easeInQuint,
|
|
easeOutQuint: easeOutQuint,
|
|
easeInOutQuint: easeInOutQuint,
|
|
easeInSine: easeInSine,
|
|
easeOutSine: easeOutSine,
|
|
easeInOutSine: easeInOutSine,
|
|
easeInExpo: easeInExpo,
|
|
easeOutExpo: easeOutExpo,
|
|
easeInOutExpo: easeInOutExpo,
|
|
easeInCirc: easeInCirc,
|
|
easeOutCirc: easeOutCirc,
|
|
easeInOutCirc: easeInOutCirc,
|
|
easeInElastic: easeInElastic,
|
|
easeOutElastic: easeOutElastic,
|
|
easeInOutElastic: easeInOutElastic,
|
|
easeInBack: easeInBack,
|
|
easeOutBack: easeOutBack,
|
|
easeInOutBack: easeInOutBack,
|
|
easeInBounce: easeInBounce,
|
|
easeOutBounce: easeOutBounce,
|
|
easeInOutBounce: easeInOutBounce
|
|
};
|
|
|
|
})();
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
/**
|
|
* @name fabric
|
|
* @namespace
|
|
*/
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
clone = fabric.util.object.clone,
|
|
toFixed = fabric.util.toFixed,
|
|
parseUnit = fabric.util.parseUnit,
|
|
multiplyTransformMatrices = fabric.util.multiplyTransformMatrices,
|
|
|
|
svgValidTagNames = ['path', 'circle', 'polygon', 'polyline', 'ellipse', 'rect', 'line',
|
|
'image', 'text'],
|
|
svgViewBoxElements = ['symbol', 'image', 'marker', 'pattern', 'view', 'svg'],
|
|
svgInvalidAncestors = ['pattern', 'defs', 'symbol', 'metadata', 'clipPath', 'mask', 'desc'],
|
|
svgValidParents = ['symbol', 'g', 'a', 'svg', 'clipPath', 'defs'],
|
|
|
|
attributesMap = {
|
|
cx: 'left',
|
|
x: 'left',
|
|
r: 'radius',
|
|
cy: 'top',
|
|
y: 'top',
|
|
display: 'visible',
|
|
visibility: 'visible',
|
|
transform: 'transformMatrix',
|
|
'fill-opacity': 'fillOpacity',
|
|
'fill-rule': 'fillRule',
|
|
'font-family': 'fontFamily',
|
|
'font-size': 'fontSize',
|
|
'font-style': 'fontStyle',
|
|
'font-weight': 'fontWeight',
|
|
'letter-spacing': 'charSpacing',
|
|
'paint-order': 'paintFirst',
|
|
'stroke-dasharray': 'strokeDashArray',
|
|
'stroke-dashoffset': 'strokeDashOffset',
|
|
'stroke-linecap': 'strokeLineCap',
|
|
'stroke-linejoin': 'strokeLineJoin',
|
|
'stroke-miterlimit': 'strokeMiterLimit',
|
|
'stroke-opacity': 'strokeOpacity',
|
|
'stroke-width': 'strokeWidth',
|
|
'text-decoration': 'textDecoration',
|
|
'text-anchor': 'textAnchor',
|
|
opacity: 'opacity',
|
|
'clip-path': 'clipPath',
|
|
'clip-rule': 'clipRule',
|
|
'vector-effect': 'strokeUniform',
|
|
'image-rendering': 'imageSmoothing',
|
|
},
|
|
|
|
colorAttributes = {
|
|
stroke: 'strokeOpacity',
|
|
fill: 'fillOpacity'
|
|
},
|
|
|
|
fSize = 'font-size', cPath = 'clip-path';
|
|
|
|
fabric.svgValidTagNamesRegEx = getSvgRegex(svgValidTagNames);
|
|
fabric.svgViewBoxElementsRegEx = getSvgRegex(svgViewBoxElements);
|
|
fabric.svgInvalidAncestorsRegEx = getSvgRegex(svgInvalidAncestors);
|
|
fabric.svgValidParentsRegEx = getSvgRegex(svgValidParents);
|
|
|
|
fabric.cssRules = { };
|
|
fabric.gradientDefs = { };
|
|
fabric.clipPaths = { };
|
|
|
|
function normalizeAttr(attr) {
|
|
// transform attribute names
|
|
if (attr in attributesMap) {
|
|
return attributesMap[attr];
|
|
}
|
|
return attr;
|
|
}
|
|
|
|
function normalizeValue(attr, value, parentAttributes, fontSize) {
|
|
var isArray = Object.prototype.toString.call(value) === '[object Array]',
|
|
parsed;
|
|
|
|
if ((attr === 'fill' || attr === 'stroke') && value === 'none') {
|
|
value = '';
|
|
}
|
|
else if (attr === 'strokeUniform') {
|
|
return (value === 'non-scaling-stroke');
|
|
}
|
|
else if (attr === 'strokeDashArray') {
|
|
if (value === 'none') {
|
|
value = null;
|
|
}
|
|
else {
|
|
value = value.replace(/,/g, ' ').split(/\s+/).map(parseFloat);
|
|
}
|
|
}
|
|
else if (attr === 'transformMatrix') {
|
|
if (parentAttributes && parentAttributes.transformMatrix) {
|
|
value = multiplyTransformMatrices(
|
|
parentAttributes.transformMatrix, fabric.parseTransformAttribute(value));
|
|
}
|
|
else {
|
|
value = fabric.parseTransformAttribute(value);
|
|
}
|
|
}
|
|
else if (attr === 'visible') {
|
|
value = value !== 'none' && value !== 'hidden';
|
|
// display=none on parent element always takes precedence over child element
|
|
if (parentAttributes && parentAttributes.visible === false) {
|
|
value = false;
|
|
}
|
|
}
|
|
else if (attr === 'opacity') {
|
|
value = parseFloat(value);
|
|
if (parentAttributes && typeof parentAttributes.opacity !== 'undefined') {
|
|
value *= parentAttributes.opacity;
|
|
}
|
|
}
|
|
else if (attr === 'textAnchor' /* text-anchor */) {
|
|
value = value === 'start' ? 'left' : value === 'end' ? 'right' : 'center';
|
|
}
|
|
else if (attr === 'charSpacing') {
|
|
// parseUnit returns px and we convert it to em
|
|
parsed = parseUnit(value, fontSize) / fontSize * 1000;
|
|
}
|
|
else if (attr === 'paintFirst') {
|
|
var fillIndex = value.indexOf('fill');
|
|
var strokeIndex = value.indexOf('stroke');
|
|
var value = 'fill';
|
|
if (fillIndex > -1 && strokeIndex > -1 && strokeIndex < fillIndex) {
|
|
value = 'stroke';
|
|
}
|
|
else if (fillIndex === -1 && strokeIndex > -1) {
|
|
value = 'stroke';
|
|
}
|
|
}
|
|
else if (attr === 'href' || attr === 'xlink:href' || attr === 'font') {
|
|
return value;
|
|
}
|
|
else if (attr === 'imageSmoothing') {
|
|
return (value === 'optimizeQuality');
|
|
}
|
|
else {
|
|
parsed = isArray ? value.map(parseUnit) : parseUnit(value, fontSize);
|
|
}
|
|
|
|
return (!isArray && isNaN(parsed) ? value : parsed);
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function getSvgRegex(arr) {
|
|
return new RegExp('^(' + arr.join('|') + ')\\b', 'i');
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} attributes Array of attributes to parse
|
|
*/
|
|
function _setStrokeFillOpacity(attributes) {
|
|
for (var attr in colorAttributes) {
|
|
|
|
if (typeof attributes[colorAttributes[attr]] === 'undefined' || attributes[attr] === '') {
|
|
continue;
|
|
}
|
|
|
|
if (typeof attributes[attr] === 'undefined') {
|
|
if (!fabric.Object.prototype[attr]) {
|
|
continue;
|
|
}
|
|
attributes[attr] = fabric.Object.prototype[attr];
|
|
}
|
|
|
|
if (attributes[attr].indexOf('url(') === 0) {
|
|
continue;
|
|
}
|
|
|
|
var color = new fabric.Color(attributes[attr]);
|
|
attributes[attr] = color.setAlpha(toFixed(color.getAlpha() * attributes[colorAttributes[attr]], 2)).toRgba();
|
|
}
|
|
return attributes;
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function _getMultipleNodes(doc, nodeNames) {
|
|
var nodeName, nodeArray = [], nodeList, i, len;
|
|
for (i = 0, len = nodeNames.length; i < len; i++) {
|
|
nodeName = nodeNames[i];
|
|
nodeList = doc.getElementsByTagName(nodeName);
|
|
nodeArray = nodeArray.concat(Array.prototype.slice.call(nodeList));
|
|
}
|
|
return nodeArray;
|
|
}
|
|
|
|
/**
|
|
* Parses "transform" attribute, returning an array of values
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {String} attributeValue String containing attribute value
|
|
* @return {Array} Array of 6 elements representing transformation matrix
|
|
*/
|
|
fabric.parseTransformAttribute = (function() {
|
|
function rotateMatrix(matrix, args) {
|
|
var cos = fabric.util.cos(args[0]), sin = fabric.util.sin(args[0]),
|
|
x = 0, y = 0;
|
|
if (args.length === 3) {
|
|
x = args[1];
|
|
y = args[2];
|
|
}
|
|
|
|
matrix[0] = cos;
|
|
matrix[1] = sin;
|
|
matrix[2] = -sin;
|
|
matrix[3] = cos;
|
|
matrix[4] = x - (cos * x - sin * y);
|
|
matrix[5] = y - (sin * x + cos * y);
|
|
}
|
|
|
|
function scaleMatrix(matrix, args) {
|
|
var multiplierX = args[0],
|
|
multiplierY = (args.length === 2) ? args[1] : args[0];
|
|
|
|
matrix[0] = multiplierX;
|
|
matrix[3] = multiplierY;
|
|
}
|
|
|
|
function skewMatrix(matrix, args, pos) {
|
|
matrix[pos] = Math.tan(fabric.util.degreesToRadians(args[0]));
|
|
}
|
|
|
|
function translateMatrix(matrix, args) {
|
|
matrix[4] = args[0];
|
|
if (args.length === 2) {
|
|
matrix[5] = args[1];
|
|
}
|
|
}
|
|
|
|
// identity matrix
|
|
var iMatrix = fabric.iMatrix,
|
|
|
|
// == begin transform regexp
|
|
number = fabric.reNum,
|
|
|
|
commaWsp = fabric.commaWsp,
|
|
|
|
skewX = '(?:(skewX)\\s*\\(\\s*(' + number + ')\\s*\\))',
|
|
|
|
skewY = '(?:(skewY)\\s*\\(\\s*(' + number + ')\\s*\\))',
|
|
|
|
rotate = '(?:(rotate)\\s*\\(\\s*(' + number + ')(?:' +
|
|
commaWsp + '(' + number + ')' +
|
|
commaWsp + '(' + number + '))?\\s*\\))',
|
|
|
|
scale = '(?:(scale)\\s*\\(\\s*(' + number + ')(?:' +
|
|
commaWsp + '(' + number + '))?\\s*\\))',
|
|
|
|
translate = '(?:(translate)\\s*\\(\\s*(' + number + ')(?:' +
|
|
commaWsp + '(' + number + '))?\\s*\\))',
|
|
|
|
matrix = '(?:(matrix)\\s*\\(\\s*' +
|
|
'(' + number + ')' + commaWsp +
|
|
'(' + number + ')' + commaWsp +
|
|
'(' + number + ')' + commaWsp +
|
|
'(' + number + ')' + commaWsp +
|
|
'(' + number + ')' + commaWsp +
|
|
'(' + number + ')' +
|
|
'\\s*\\))',
|
|
|
|
transform = '(?:' +
|
|
matrix + '|' +
|
|
translate + '|' +
|
|
scale + '|' +
|
|
rotate + '|' +
|
|
skewX + '|' +
|
|
skewY +
|
|
')',
|
|
|
|
transforms = '(?:' + transform + '(?:' + commaWsp + '*' + transform + ')*' + ')',
|
|
|
|
transformList = '^\\s*(?:' + transforms + '?)\\s*$',
|
|
|
|
// http://www.w3.org/TR/SVG/coords.html#TransformAttribute
|
|
reTransformList = new RegExp(transformList),
|
|
// == end transform regexp
|
|
|
|
reTransform = new RegExp(transform, 'g');
|
|
|
|
return function(attributeValue) {
|
|
|
|
// start with identity matrix
|
|
var matrix = iMatrix.concat(),
|
|
matrices = [];
|
|
|
|
// return if no argument was given or
|
|
// an argument does not match transform attribute regexp
|
|
if (!attributeValue || (attributeValue && !reTransformList.test(attributeValue))) {
|
|
return matrix;
|
|
}
|
|
|
|
attributeValue.replace(reTransform, function(match) {
|
|
|
|
var m = new RegExp(transform).exec(match).filter(function (match) {
|
|
// match !== '' && match != null
|
|
return (!!match);
|
|
}),
|
|
operation = m[1],
|
|
args = m.slice(2).map(parseFloat);
|
|
|
|
switch (operation) {
|
|
case 'translate':
|
|
translateMatrix(matrix, args);
|
|
break;
|
|
case 'rotate':
|
|
args[0] = fabric.util.degreesToRadians(args[0]);
|
|
rotateMatrix(matrix, args);
|
|
break;
|
|
case 'scale':
|
|
scaleMatrix(matrix, args);
|
|
break;
|
|
case 'skewX':
|
|
skewMatrix(matrix, args, 2);
|
|
break;
|
|
case 'skewY':
|
|
skewMatrix(matrix, args, 1);
|
|
break;
|
|
case 'matrix':
|
|
matrix = args;
|
|
break;
|
|
}
|
|
|
|
// snapshot current matrix into matrices array
|
|
matrices.push(matrix.concat());
|
|
// reset
|
|
matrix = iMatrix.concat();
|
|
});
|
|
|
|
var combinedMatrix = matrices[0];
|
|
while (matrices.length > 1) {
|
|
matrices.shift();
|
|
combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]);
|
|
}
|
|
return combinedMatrix;
|
|
};
|
|
})();
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function parseStyleString(style, oStyle) {
|
|
var attr, value;
|
|
style.replace(/;\s*$/, '').split(';').forEach(function (chunk) {
|
|
var pair = chunk.split(':');
|
|
|
|
attr = pair[0].trim().toLowerCase();
|
|
value = pair[1].trim();
|
|
|
|
oStyle[attr] = value;
|
|
});
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function parseStyleObject(style, oStyle) {
|
|
var attr, value;
|
|
for (var prop in style) {
|
|
if (typeof style[prop] === 'undefined') {
|
|
continue;
|
|
}
|
|
|
|
attr = prop.toLowerCase();
|
|
value = style[prop];
|
|
|
|
oStyle[attr] = value;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function getGlobalStylesForElement(element, svgUid) {
|
|
var styles = { };
|
|
for (var rule in fabric.cssRules[svgUid]) {
|
|
if (elementMatchesRule(element, rule.split(' '))) {
|
|
for (var property in fabric.cssRules[svgUid][rule]) {
|
|
styles[property] = fabric.cssRules[svgUid][rule][property];
|
|
}
|
|
}
|
|
}
|
|
return styles;
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function elementMatchesRule(element, selectors) {
|
|
var firstMatching, parentMatching = true;
|
|
//start from rightmost selector.
|
|
firstMatching = selectorMatches(element, selectors.pop());
|
|
if (firstMatching && selectors.length) {
|
|
parentMatching = doesSomeParentMatch(element, selectors);
|
|
}
|
|
return firstMatching && parentMatching && (selectors.length === 0);
|
|
}
|
|
|
|
function doesSomeParentMatch(element, selectors) {
|
|
var selector, parentMatching = true;
|
|
while (element.parentNode && element.parentNode.nodeType === 1 && selectors.length) {
|
|
if (parentMatching) {
|
|
selector = selectors.pop();
|
|
}
|
|
element = element.parentNode;
|
|
parentMatching = selectorMatches(element, selector);
|
|
}
|
|
return selectors.length === 0;
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function selectorMatches(element, selector) {
|
|
var nodeName = element.nodeName,
|
|
classNames = element.getAttribute('class'),
|
|
id = element.getAttribute('id'), matcher, i;
|
|
// i check if a selector matches slicing away part from it.
|
|
// if i get empty string i should match
|
|
matcher = new RegExp('^' + nodeName, 'i');
|
|
selector = selector.replace(matcher, '');
|
|
if (id && selector.length) {
|
|
matcher = new RegExp('#' + id + '(?![a-zA-Z\\-]+)', 'i');
|
|
selector = selector.replace(matcher, '');
|
|
}
|
|
if (classNames && selector.length) {
|
|
classNames = classNames.split(' ');
|
|
for (i = classNames.length; i--;) {
|
|
matcher = new RegExp('\\.' + classNames[i] + '(?![a-zA-Z\\-]+)', 'i');
|
|
selector = selector.replace(matcher, '');
|
|
}
|
|
}
|
|
return selector.length === 0;
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
* to support IE8 missing getElementById on SVGdocument and on node xmlDOM
|
|
*/
|
|
function elementById(doc, id) {
|
|
var el;
|
|
doc.getElementById && (el = doc.getElementById(id));
|
|
if (el) {
|
|
return el;
|
|
}
|
|
var node, i, len, nodelist = doc.getElementsByTagName('*');
|
|
for (i = 0, len = nodelist.length; i < len; i++) {
|
|
node = nodelist[i];
|
|
if (id === node.getAttribute('id')) {
|
|
return node;
|
|
}
|
|
}
|
|
}
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function parseUseDirectives(doc) {
|
|
var nodelist = _getMultipleNodes(doc, ['use', 'svg:use']), i = 0;
|
|
while (nodelist.length && i < nodelist.length) {
|
|
var el = nodelist[i],
|
|
xlinkAttribute = el.getAttribute('xlink:href') || el.getAttribute('href');
|
|
|
|
if (xlinkAttribute === null) {
|
|
return;
|
|
}
|
|
|
|
var xlink = xlinkAttribute.substr(1),
|
|
x = el.getAttribute('x') || 0,
|
|
y = el.getAttribute('y') || 0,
|
|
el2 = elementById(doc, xlink).cloneNode(true),
|
|
currentTrans = (el2.getAttribute('transform') || '') + ' translate(' + x + ', ' + y + ')',
|
|
parentNode,
|
|
oldLength = nodelist.length, attr,
|
|
j,
|
|
attrs,
|
|
len,
|
|
namespace = fabric.svgNS;
|
|
|
|
applyViewboxTransform(el2);
|
|
if (/^svg$/i.test(el2.nodeName)) {
|
|
var el3 = el2.ownerDocument.createElementNS(namespace, 'g');
|
|
for (j = 0, attrs = el2.attributes, len = attrs.length; j < len; j++) {
|
|
attr = attrs.item(j);
|
|
el3.setAttributeNS(namespace, attr.nodeName, attr.nodeValue);
|
|
}
|
|
// el2.firstChild != null
|
|
while (el2.firstChild) {
|
|
el3.appendChild(el2.firstChild);
|
|
}
|
|
el2 = el3;
|
|
}
|
|
|
|
for (j = 0, attrs = el.attributes, len = attrs.length; j < len; j++) {
|
|
attr = attrs.item(j);
|
|
if (attr.nodeName === 'x' || attr.nodeName === 'y' ||
|
|
attr.nodeName === 'xlink:href' || attr.nodeName === 'href') {
|
|
continue;
|
|
}
|
|
|
|
if (attr.nodeName === 'transform') {
|
|
currentTrans = attr.nodeValue + ' ' + currentTrans;
|
|
}
|
|
else {
|
|
el2.setAttribute(attr.nodeName, attr.nodeValue);
|
|
}
|
|
}
|
|
|
|
el2.setAttribute('transform', currentTrans);
|
|
el2.setAttribute('instantiated_by_use', '1');
|
|
el2.removeAttribute('id');
|
|
parentNode = el.parentNode;
|
|
parentNode.replaceChild(el2, el);
|
|
// some browsers do not shorten nodelist after replaceChild (IE8)
|
|
if (nodelist.length === oldLength) {
|
|
i++;
|
|
}
|
|
}
|
|
}
|
|
|
|
// http://www.w3.org/TR/SVG/coords.html#ViewBoxAttribute
|
|
// matches, e.g.: +14.56e-12, etc.
|
|
var reViewBoxAttrValue = new RegExp(
|
|
'^' +
|
|
'\\s*(' + fabric.reNum + '+)\\s*,?' +
|
|
'\\s*(' + fabric.reNum + '+)\\s*,?' +
|
|
'\\s*(' + fabric.reNum + '+)\\s*,?' +
|
|
'\\s*(' + fabric.reNum + '+)\\s*' +
|
|
'$'
|
|
);
|
|
|
|
/**
|
|
* Add a <g> element that envelop all child elements and makes the viewbox transformMatrix descend on all elements
|
|
*/
|
|
function applyViewboxTransform(element) {
|
|
if (!fabric.svgViewBoxElementsRegEx.test(element.nodeName)) {
|
|
return {};
|
|
}
|
|
var viewBoxAttr = element.getAttribute('viewBox'),
|
|
scaleX = 1,
|
|
scaleY = 1,
|
|
minX = 0,
|
|
minY = 0,
|
|
viewBoxWidth, viewBoxHeight, matrix, el,
|
|
widthAttr = element.getAttribute('width'),
|
|
heightAttr = element.getAttribute('height'),
|
|
x = element.getAttribute('x') || 0,
|
|
y = element.getAttribute('y') || 0,
|
|
preserveAspectRatio = element.getAttribute('preserveAspectRatio') || '',
|
|
missingViewBox = (!viewBoxAttr || !(viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))),
|
|
missingDimAttr = (!widthAttr || !heightAttr || widthAttr === '100%' || heightAttr === '100%'),
|
|
toBeParsed = missingViewBox && missingDimAttr,
|
|
parsedDim = { }, translateMatrix = '', widthDiff = 0, heightDiff = 0;
|
|
|
|
parsedDim.width = 0;
|
|
parsedDim.height = 0;
|
|
parsedDim.toBeParsed = toBeParsed;
|
|
|
|
if (missingViewBox) {
|
|
if (((x || y) && element.parentNode && element.parentNode.nodeName !== '#document')) {
|
|
translateMatrix = ' translate(' + parseUnit(x) + ' ' + parseUnit(y) + ') ';
|
|
matrix = (element.getAttribute('transform') || '') + translateMatrix;
|
|
element.setAttribute('transform', matrix);
|
|
element.removeAttribute('x');
|
|
element.removeAttribute('y');
|
|
}
|
|
}
|
|
|
|
if (toBeParsed) {
|
|
return parsedDim;
|
|
}
|
|
|
|
if (missingViewBox) {
|
|
parsedDim.width = parseUnit(widthAttr);
|
|
parsedDim.height = parseUnit(heightAttr);
|
|
// set a transform for elements that have x y and are inner(only) SVGs
|
|
return parsedDim;
|
|
}
|
|
minX = -parseFloat(viewBoxAttr[1]);
|
|
minY = -parseFloat(viewBoxAttr[2]);
|
|
viewBoxWidth = parseFloat(viewBoxAttr[3]);
|
|
viewBoxHeight = parseFloat(viewBoxAttr[4]);
|
|
parsedDim.minX = minX;
|
|
parsedDim.minY = minY;
|
|
parsedDim.viewBoxWidth = viewBoxWidth;
|
|
parsedDim.viewBoxHeight = viewBoxHeight;
|
|
if (!missingDimAttr) {
|
|
parsedDim.width = parseUnit(widthAttr);
|
|
parsedDim.height = parseUnit(heightAttr);
|
|
scaleX = parsedDim.width / viewBoxWidth;
|
|
scaleY = parsedDim.height / viewBoxHeight;
|
|
}
|
|
else {
|
|
parsedDim.width = viewBoxWidth;
|
|
parsedDim.height = viewBoxHeight;
|
|
}
|
|
|
|
// default is to preserve aspect ratio
|
|
preserveAspectRatio = fabric.util.parsePreserveAspectRatioAttribute(preserveAspectRatio);
|
|
if (preserveAspectRatio.alignX !== 'none') {
|
|
//translate all container for the effect of Mid, Min, Max
|
|
if (preserveAspectRatio.meetOrSlice === 'meet') {
|
|
scaleY = scaleX = (scaleX > scaleY ? scaleY : scaleX);
|
|
// calculate additional translation to move the viewbox
|
|
}
|
|
if (preserveAspectRatio.meetOrSlice === 'slice') {
|
|
scaleY = scaleX = (scaleX > scaleY ? scaleX : scaleY);
|
|
// calculate additional translation to move the viewbox
|
|
}
|
|
widthDiff = parsedDim.width - viewBoxWidth * scaleX;
|
|
heightDiff = parsedDim.height - viewBoxHeight * scaleX;
|
|
if (preserveAspectRatio.alignX === 'Mid') {
|
|
widthDiff /= 2;
|
|
}
|
|
if (preserveAspectRatio.alignY === 'Mid') {
|
|
heightDiff /= 2;
|
|
}
|
|
if (preserveAspectRatio.alignX === 'Min') {
|
|
widthDiff = 0;
|
|
}
|
|
if (preserveAspectRatio.alignY === 'Min') {
|
|
heightDiff = 0;
|
|
}
|
|
}
|
|
|
|
if (scaleX === 1 && scaleY === 1 && minX === 0 && minY === 0 && x === 0 && y === 0) {
|
|
return parsedDim;
|
|
}
|
|
if ((x || y) && element.parentNode.nodeName !== '#document') {
|
|
translateMatrix = ' translate(' + parseUnit(x) + ' ' + parseUnit(y) + ') ';
|
|
}
|
|
|
|
matrix = translateMatrix + ' matrix(' + scaleX +
|
|
' 0' +
|
|
' 0 ' +
|
|
scaleY + ' ' +
|
|
(minX * scaleX + widthDiff) + ' ' +
|
|
(minY * scaleY + heightDiff) + ') ';
|
|
// seems unused.
|
|
// parsedDim.viewboxTransform = fabric.parseTransformAttribute(matrix);
|
|
if (element.nodeName === 'svg') {
|
|
el = element.ownerDocument.createElementNS(fabric.svgNS, 'g');
|
|
// element.firstChild != null
|
|
while (element.firstChild) {
|
|
el.appendChild(element.firstChild);
|
|
}
|
|
element.appendChild(el);
|
|
}
|
|
else {
|
|
el = element;
|
|
el.removeAttribute('x');
|
|
el.removeAttribute('y');
|
|
matrix = el.getAttribute('transform') + matrix;
|
|
}
|
|
el.setAttribute('transform', matrix);
|
|
return parsedDim;
|
|
}
|
|
|
|
function hasAncestorWithNodeName(element, nodeName) {
|
|
while (element && (element = element.parentNode)) {
|
|
if (element.nodeName && nodeName.test(element.nodeName.replace('svg:', ''))
|
|
&& !element.getAttribute('instantiated_by_use')) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* Parses an SVG document, converts it to an array of corresponding fabric.* instances and passes them to a callback
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {SVGDocument} doc SVG document to parse
|
|
* @param {Function} callback Callback to call when parsing is finished;
|
|
* It's being passed an array of elements (parsed from a document).
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
* @param {Object} [parsingOptions] options for parsing document
|
|
* @param {String} [parsingOptions.crossOrigin] crossOrigin settings
|
|
*/
|
|
fabric.parseSVGDocument = function(doc, callback, reviver, parsingOptions) {
|
|
if (!doc) {
|
|
return;
|
|
}
|
|
|
|
parseUseDirectives(doc);
|
|
|
|
var svgUid = fabric.Object.__uid++, i, len,
|
|
options = applyViewboxTransform(doc),
|
|
descendants = fabric.util.toArray(doc.getElementsByTagName('*'));
|
|
options.crossOrigin = parsingOptions && parsingOptions.crossOrigin;
|
|
options.svgUid = svgUid;
|
|
|
|
if (descendants.length === 0 && fabric.isLikelyNode) {
|
|
// we're likely in node, where "o3-xml" library fails to gEBTN("*")
|
|
// https://github.com/ajaxorg/node-o3-xml/issues/21
|
|
descendants = doc.selectNodes('//*[name(.)!="svg"]');
|
|
var arr = [];
|
|
for (i = 0, len = descendants.length; i < len; i++) {
|
|
arr[i] = descendants[i];
|
|
}
|
|
descendants = arr;
|
|
}
|
|
|
|
var elements = descendants.filter(function(el) {
|
|
applyViewboxTransform(el);
|
|
return fabric.svgValidTagNamesRegEx.test(el.nodeName.replace('svg:', '')) &&
|
|
!hasAncestorWithNodeName(el, fabric.svgInvalidAncestorsRegEx); // http://www.w3.org/TR/SVG/struct.html#DefsElement
|
|
});
|
|
if (!elements || (elements && !elements.length)) {
|
|
callback && callback([], {});
|
|
return;
|
|
}
|
|
var clipPaths = { };
|
|
descendants.filter(function(el) {
|
|
return el.nodeName.replace('svg:', '') === 'clipPath';
|
|
}).forEach(function(el) {
|
|
var id = el.getAttribute('id');
|
|
clipPaths[id] = fabric.util.toArray(el.getElementsByTagName('*')).filter(function(el) {
|
|
return fabric.svgValidTagNamesRegEx.test(el.nodeName.replace('svg:', ''));
|
|
});
|
|
});
|
|
fabric.gradientDefs[svgUid] = fabric.getGradientDefs(doc);
|
|
fabric.cssRules[svgUid] = fabric.getCSSRules(doc);
|
|
fabric.clipPaths[svgUid] = clipPaths;
|
|
// Precedence of rules: style > class > attribute
|
|
fabric.parseElements(elements, function(instances, elements) {
|
|
if (callback) {
|
|
callback(instances, options, elements, descendants);
|
|
delete fabric.gradientDefs[svgUid];
|
|
delete fabric.cssRules[svgUid];
|
|
delete fabric.clipPaths[svgUid];
|
|
}
|
|
}, clone(options), reviver, parsingOptions);
|
|
};
|
|
|
|
function recursivelyParseGradientsXlink(doc, gradient) {
|
|
var gradientsAttrs = ['gradientTransform', 'x1', 'x2', 'y1', 'y2', 'gradientUnits', 'cx', 'cy', 'r', 'fx', 'fy'],
|
|
xlinkAttr = 'xlink:href',
|
|
xLink = gradient.getAttribute(xlinkAttr).substr(1),
|
|
referencedGradient = elementById(doc, xLink);
|
|
if (referencedGradient && referencedGradient.getAttribute(xlinkAttr)) {
|
|
recursivelyParseGradientsXlink(doc, referencedGradient);
|
|
}
|
|
gradientsAttrs.forEach(function(attr) {
|
|
if (referencedGradient && !gradient.hasAttribute(attr) && referencedGradient.hasAttribute(attr)) {
|
|
gradient.setAttribute(attr, referencedGradient.getAttribute(attr));
|
|
}
|
|
});
|
|
if (!gradient.children.length) {
|
|
var referenceClone = referencedGradient.cloneNode(true);
|
|
while (referenceClone.firstChild) {
|
|
gradient.appendChild(referenceClone.firstChild);
|
|
}
|
|
}
|
|
gradient.removeAttribute(xlinkAttr);
|
|
}
|
|
|
|
var reFontDeclaration = new RegExp(
|
|
'(normal|italic)?\\s*(normal|small-caps)?\\s*' +
|
|
'(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\\s*(' +
|
|
fabric.reNum +
|
|
'(?:px|cm|mm|em|pt|pc|in)*)(?:\\/(normal|' + fabric.reNum + '))?\\s+(.*)');
|
|
|
|
extend(fabric, {
|
|
/**
|
|
* Parses a short font declaration, building adding its properties to a style object
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {String} value font declaration
|
|
* @param {Object} oStyle definition
|
|
*/
|
|
parseFontDeclaration: function(value, oStyle) {
|
|
var match = value.match(reFontDeclaration);
|
|
|
|
if (!match) {
|
|
return;
|
|
}
|
|
var fontStyle = match[1],
|
|
// font variant is not used
|
|
// fontVariant = match[2],
|
|
fontWeight = match[3],
|
|
fontSize = match[4],
|
|
lineHeight = match[5],
|
|
fontFamily = match[6];
|
|
|
|
if (fontStyle) {
|
|
oStyle.fontStyle = fontStyle;
|
|
}
|
|
if (fontWeight) {
|
|
oStyle.fontWeight = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight);
|
|
}
|
|
if (fontSize) {
|
|
oStyle.fontSize = parseUnit(fontSize);
|
|
}
|
|
if (fontFamily) {
|
|
oStyle.fontFamily = fontFamily;
|
|
}
|
|
if (lineHeight) {
|
|
oStyle.lineHeight = lineHeight === 'normal' ? 1 : lineHeight;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Parses an SVG document, returning all of the gradient declarations found in it
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {SVGDocument} doc SVG document to parse
|
|
* @return {Object} Gradient definitions; key corresponds to element id, value -- to gradient definition element
|
|
*/
|
|
getGradientDefs: function(doc) {
|
|
var tagArray = [
|
|
'linearGradient',
|
|
'radialGradient',
|
|
'svg:linearGradient',
|
|
'svg:radialGradient'],
|
|
elList = _getMultipleNodes(doc, tagArray),
|
|
el, j = 0, gradientDefs = { };
|
|
j = elList.length;
|
|
while (j--) {
|
|
el = elList[j];
|
|
if (el.getAttribute('xlink:href')) {
|
|
recursivelyParseGradientsXlink(doc, el);
|
|
}
|
|
gradientDefs[el.getAttribute('id')] = el;
|
|
}
|
|
return gradientDefs;
|
|
},
|
|
|
|
/**
|
|
* Returns an object of attributes' name/value, given element and an array of attribute names;
|
|
* Parses parent "g" nodes recursively upwards.
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param {DOMElement} element Element to parse
|
|
* @param {Array} attributes Array of attributes to parse
|
|
* @return {Object} object containing parsed attributes' names/values
|
|
*/
|
|
parseAttributes: function(element, attributes, svgUid) {
|
|
|
|
if (!element) {
|
|
return;
|
|
}
|
|
|
|
var value,
|
|
parentAttributes = { },
|
|
fontSize, parentFontSize;
|
|
|
|
if (typeof svgUid === 'undefined') {
|
|
svgUid = element.getAttribute('svgUid');
|
|
}
|
|
// if there's a parent container (`g` or `a` or `symbol` node), parse its attributes recursively upwards
|
|
if (element.parentNode && fabric.svgValidParentsRegEx.test(element.parentNode.nodeName)) {
|
|
parentAttributes = fabric.parseAttributes(element.parentNode, attributes, svgUid);
|
|
}
|
|
|
|
var ownAttributes = attributes.reduce(function(memo, attr) {
|
|
value = element.getAttribute(attr);
|
|
if (value) { // eslint-disable-line
|
|
memo[attr] = value;
|
|
}
|
|
return memo;
|
|
}, { });
|
|
// add values parsed from style, which take precedence over attributes
|
|
// (see: http://www.w3.org/TR/SVG/styling.html#UsingPresentationAttributes)
|
|
var cssAttrs = extend(
|
|
getGlobalStylesForElement(element, svgUid),
|
|
fabric.parseStyleAttribute(element)
|
|
);
|
|
ownAttributes = extend(
|
|
ownAttributes,
|
|
cssAttrs
|
|
);
|
|
if (cssAttrs[cPath]) {
|
|
element.setAttribute(cPath, cssAttrs[cPath]);
|
|
}
|
|
fontSize = parentFontSize = parentAttributes.fontSize || fabric.Text.DEFAULT_SVG_FONT_SIZE;
|
|
if (ownAttributes[fSize]) {
|
|
// looks like the minimum should be 9px when dealing with ems. this is what looks like in browsers.
|
|
ownAttributes[fSize] = fontSize = parseUnit(ownAttributes[fSize], parentFontSize);
|
|
}
|
|
|
|
var normalizedAttr, normalizedValue, normalizedStyle = {};
|
|
for (var attr in ownAttributes) {
|
|
normalizedAttr = normalizeAttr(attr);
|
|
normalizedValue = normalizeValue(normalizedAttr, ownAttributes[attr], parentAttributes, fontSize);
|
|
normalizedStyle[normalizedAttr] = normalizedValue;
|
|
}
|
|
if (normalizedStyle && normalizedStyle.font) {
|
|
fabric.parseFontDeclaration(normalizedStyle.font, normalizedStyle);
|
|
}
|
|
var mergedAttrs = extend(parentAttributes, normalizedStyle);
|
|
return fabric.svgValidParentsRegEx.test(element.nodeName) ? mergedAttrs : _setStrokeFillOpacity(mergedAttrs);
|
|
},
|
|
|
|
/**
|
|
* Transforms an array of svg elements to corresponding fabric.* instances
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param {Array} elements Array of elements to parse
|
|
* @param {Function} callback Being passed an array of fabric instances (transformed from SVG elements)
|
|
* @param {Object} [options] Options object
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
*/
|
|
parseElements: function(elements, callback, options, reviver, parsingOptions) {
|
|
new fabric.ElementsParser(elements, callback, options, reviver, parsingOptions).parse();
|
|
},
|
|
|
|
/**
|
|
* Parses "style" attribute, retuning an object with values
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param {SVGElement} element Element to parse
|
|
* @return {Object} Objects with values parsed from style attribute of an element
|
|
*/
|
|
parseStyleAttribute: function(element) {
|
|
var oStyle = { },
|
|
style = element.getAttribute('style');
|
|
|
|
if (!style) {
|
|
return oStyle;
|
|
}
|
|
|
|
if (typeof style === 'string') {
|
|
parseStyleString(style, oStyle);
|
|
}
|
|
else {
|
|
parseStyleObject(style, oStyle);
|
|
}
|
|
|
|
return oStyle;
|
|
},
|
|
|
|
/**
|
|
* Parses "points" attribute, returning an array of values
|
|
* @static
|
|
* @memberOf fabric
|
|
* @param {String} points points attribute string
|
|
* @return {Array} array of points
|
|
*/
|
|
parsePointsAttribute: function(points) {
|
|
|
|
// points attribute is required and must not be empty
|
|
if (!points) {
|
|
return null;
|
|
}
|
|
|
|
// replace commas with whitespace and remove bookending whitespace
|
|
points = points.replace(/,/g, ' ').trim();
|
|
|
|
points = points.split(/\s+/);
|
|
var parsedPoints = [], i, len;
|
|
|
|
for (i = 0, len = points.length; i < len; i += 2) {
|
|
parsedPoints.push({
|
|
x: parseFloat(points[i]),
|
|
y: parseFloat(points[i + 1])
|
|
});
|
|
}
|
|
|
|
// odd number of points is an error
|
|
// if (parsedPoints.length % 2 !== 0) {
|
|
// return null;
|
|
// }
|
|
|
|
return parsedPoints;
|
|
},
|
|
|
|
/**
|
|
* Returns CSS rules for a given SVG document
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric
|
|
* @param {SVGDocument} doc SVG document to parse
|
|
* @return {Object} CSS rules of this document
|
|
*/
|
|
getCSSRules: function(doc) {
|
|
var styles = doc.getElementsByTagName('style'), i, len,
|
|
allRules = { }, rules;
|
|
|
|
// very crude parsing of style contents
|
|
for (i = 0, len = styles.length; i < len; i++) {
|
|
var styleContents = styles[i].textContent;
|
|
|
|
// remove comments
|
|
styleContents = styleContents.replace(/\/\*[\s\S]*?\*\//g, '');
|
|
if (styleContents.trim() === '') {
|
|
continue;
|
|
}
|
|
rules = styleContents.match(/[^{]*\{[\s\S]*?\}/g);
|
|
rules = rules.map(function(rule) { return rule.trim(); });
|
|
// eslint-disable-next-line no-loop-func
|
|
rules.forEach(function(rule) {
|
|
|
|
var match = rule.match(/([\s\S]*?)\s*\{([^}]*)\}/),
|
|
ruleObj = { }, declaration = match[2].trim(),
|
|
propertyValuePairs = declaration.replace(/;$/, '').split(/\s*;\s*/);
|
|
|
|
for (i = 0, len = propertyValuePairs.length; i < len; i++) {
|
|
var pair = propertyValuePairs[i].split(/\s*:\s*/),
|
|
property = pair[0],
|
|
value = pair[1];
|
|
ruleObj[property] = value;
|
|
}
|
|
rule = match[1];
|
|
rule.split(',').forEach(function(_rule) {
|
|
_rule = _rule.replace(/^svg/i, '').trim();
|
|
if (_rule === '') {
|
|
return;
|
|
}
|
|
if (allRules[_rule]) {
|
|
fabric.util.object.extend(allRules[_rule], ruleObj);
|
|
}
|
|
else {
|
|
allRules[_rule] = fabric.util.object.clone(ruleObj);
|
|
}
|
|
});
|
|
});
|
|
}
|
|
return allRules;
|
|
},
|
|
|
|
/**
|
|
* Takes url corresponding to an SVG document, and parses it into a set of fabric objects.
|
|
* Note that SVG is fetched via XMLHttpRequest, so it needs to conform to SOP (Same Origin Policy)
|
|
* @memberOf fabric
|
|
* @param {String} url
|
|
* @param {Function} callback
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
* @param {Object} [options] Object containing options for parsing
|
|
* @param {String} [options.crossOrigin] crossOrigin crossOrigin setting to use for external resources
|
|
*/
|
|
loadSVGFromURL: function(url, callback, reviver, options) {
|
|
|
|
url = url.replace(/^\n\s*/, '').trim();
|
|
new fabric.util.request(url, {
|
|
method: 'get',
|
|
onComplete: onComplete
|
|
});
|
|
|
|
function onComplete(r) {
|
|
|
|
var xml = r.responseXML;
|
|
if (!xml || !xml.documentElement) {
|
|
callback && callback(null);
|
|
return false;
|
|
}
|
|
|
|
fabric.parseSVGDocument(xml.documentElement, function (results, _options, elements, allElements) {
|
|
callback && callback(results, _options, elements, allElements);
|
|
}, reviver, options);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Takes string corresponding to an SVG document, and parses it into a set of fabric objects
|
|
* @memberOf fabric
|
|
* @param {String} string
|
|
* @param {Function} callback
|
|
* @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created.
|
|
* @param {Object} [options] Object containing options for parsing
|
|
* @param {String} [options.crossOrigin] crossOrigin crossOrigin setting to use for external resources
|
|
*/
|
|
loadSVGFromString: function(string, callback, reviver, options) {
|
|
var parser = new fabric.window.DOMParser(),
|
|
doc = parser.parseFromString(string.trim(), 'text/xml');
|
|
fabric.parseSVGDocument(doc.documentElement, function (results, _options, elements, allElements) {
|
|
callback(results, _options, elements, allElements);
|
|
}, reviver, options);
|
|
}
|
|
});
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
fabric.ElementsParser = function(elements, callback, options, reviver, parsingOptions, doc) {
|
|
this.elements = elements;
|
|
this.callback = callback;
|
|
this.options = options;
|
|
this.reviver = reviver;
|
|
this.svgUid = (options && options.svgUid) || 0;
|
|
this.parsingOptions = parsingOptions;
|
|
this.regexUrl = /^url\(['"]?#([^'"]+)['"]?\)/g;
|
|
this.doc = doc;
|
|
};
|
|
|
|
(function(proto) {
|
|
proto.parse = function() {
|
|
this.instances = new Array(this.elements.length);
|
|
this.numElements = this.elements.length;
|
|
this.createObjects();
|
|
};
|
|
|
|
proto.createObjects = function() {
|
|
var _this = this;
|
|
this.elements.forEach(function(element, i) {
|
|
element.setAttribute('svgUid', _this.svgUid);
|
|
_this.createObject(element, i);
|
|
});
|
|
};
|
|
|
|
proto.findTag = function(el) {
|
|
return fabric[fabric.util.string.capitalize(el.tagName.replace('svg:', ''))];
|
|
};
|
|
|
|
proto.createObject = function(el, index) {
|
|
var klass = this.findTag(el);
|
|
if (klass && klass.fromElement) {
|
|
try {
|
|
klass.fromElement(el, this.createCallback(index, el), this.options);
|
|
}
|
|
catch (err) {
|
|
fabric.log(err);
|
|
}
|
|
}
|
|
else {
|
|
this.checkIfDone();
|
|
}
|
|
};
|
|
|
|
proto.createCallback = function(index, el) {
|
|
var _this = this;
|
|
return function(obj) {
|
|
var _options;
|
|
_this.resolveGradient(obj, el, 'fill');
|
|
_this.resolveGradient(obj, el, 'stroke');
|
|
if (obj instanceof fabric.Image && obj._originalElement) {
|
|
_options = obj.parsePreserveAspectRatioAttribute(el);
|
|
}
|
|
obj._removeTransformMatrix(_options);
|
|
_this.resolveClipPath(obj, el);
|
|
_this.reviver && _this.reviver(el, obj);
|
|
_this.instances[index] = obj;
|
|
_this.checkIfDone();
|
|
};
|
|
};
|
|
|
|
proto.extractPropertyDefinition = function(obj, property, storage) {
|
|
var value = obj[property], regex = this.regexUrl;
|
|
if (!regex.test(value)) {
|
|
return;
|
|
}
|
|
regex.lastIndex = 0;
|
|
var id = regex.exec(value)[1];
|
|
regex.lastIndex = 0;
|
|
return fabric[storage][this.svgUid][id];
|
|
};
|
|
|
|
proto.resolveGradient = function(obj, el, property) {
|
|
var gradientDef = this.extractPropertyDefinition(obj, property, 'gradientDefs');
|
|
if (gradientDef) {
|
|
var opacityAttr = el.getAttribute(property + '-opacity');
|
|
var gradient = fabric.Gradient.fromElement(gradientDef, obj, opacityAttr, this.options);
|
|
obj.set(property, gradient);
|
|
}
|
|
};
|
|
|
|
proto.createClipPathCallback = function(obj, container) {
|
|
return function(_newObj) {
|
|
_newObj._removeTransformMatrix();
|
|
_newObj.fillRule = _newObj.clipRule;
|
|
container.push(_newObj);
|
|
};
|
|
};
|
|
|
|
proto.resolveClipPath = function(obj, usingElement) {
|
|
var clipPath = this.extractPropertyDefinition(obj, 'clipPath', 'clipPaths'),
|
|
element, klass, objTransformInv, container, gTransform, options;
|
|
if (clipPath) {
|
|
container = [];
|
|
objTransformInv = fabric.util.invertTransform(obj.calcTransformMatrix());
|
|
// move the clipPath tag as sibling to the real element that is using it
|
|
var clipPathTag = clipPath[0].parentNode;
|
|
var clipPathOwner = usingElement;
|
|
while (clipPathOwner.parentNode && clipPathOwner.getAttribute('clip-path') !== obj.clipPath) {
|
|
clipPathOwner = clipPathOwner.parentNode;
|
|
}
|
|
clipPathOwner.parentNode.appendChild(clipPathTag);
|
|
for (var i = 0; i < clipPath.length; i++) {
|
|
element = clipPath[i];
|
|
klass = this.findTag(element);
|
|
klass.fromElement(
|
|
element,
|
|
this.createClipPathCallback(obj, container),
|
|
this.options
|
|
);
|
|
}
|
|
if (container.length === 1) {
|
|
clipPath = container[0];
|
|
}
|
|
else {
|
|
clipPath = new fabric.Group(container);
|
|
}
|
|
gTransform = fabric.util.multiplyTransformMatrices(
|
|
objTransformInv,
|
|
clipPath.calcTransformMatrix()
|
|
);
|
|
if (clipPath.clipPath) {
|
|
this.resolveClipPath(clipPath, clipPathOwner);
|
|
}
|
|
var options = fabric.util.qrDecompose(gTransform);
|
|
clipPath.flipX = false;
|
|
clipPath.flipY = false;
|
|
clipPath.set('scaleX', options.scaleX);
|
|
clipPath.set('scaleY', options.scaleY);
|
|
clipPath.angle = options.angle;
|
|
clipPath.skewX = options.skewX;
|
|
clipPath.skewY = 0;
|
|
clipPath.setPositionByOrigin({ x: options.translateX, y: options.translateY }, 'center', 'center');
|
|
obj.clipPath = clipPath;
|
|
}
|
|
else {
|
|
// if clip-path does not resolve to any element, delete the property.
|
|
delete obj.clipPath;
|
|
}
|
|
};
|
|
|
|
proto.checkIfDone = function() {
|
|
if (--this.numElements === 0) {
|
|
this.instances = this.instances.filter(function(el) {
|
|
// eslint-disable-next-line no-eq-null, eqeqeq
|
|
return el != null;
|
|
});
|
|
this.callback(this.instances, this.elements);
|
|
}
|
|
};
|
|
})(fabric.ElementsParser.prototype);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
/* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Point) {
|
|
fabric.warn('fabric.Point is already defined');
|
|
return;
|
|
}
|
|
|
|
fabric.Point = Point;
|
|
|
|
/**
|
|
* Point class
|
|
* @class fabric.Point
|
|
* @memberOf fabric
|
|
* @constructor
|
|
* @param {Number} x
|
|
* @param {Number} y
|
|
* @return {fabric.Point} thisArg
|
|
*/
|
|
function Point(x, y) {
|
|
this.x = x;
|
|
this.y = y;
|
|
}
|
|
|
|
Point.prototype = /** @lends fabric.Point.prototype */ {
|
|
|
|
type: 'point',
|
|
|
|
constructor: Point,
|
|
|
|
/**
|
|
* Adds another point to this one and returns another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} new Point instance with added values
|
|
*/
|
|
add: function (that) {
|
|
return new Point(this.x + that.x, this.y + that.y);
|
|
},
|
|
|
|
/**
|
|
* Adds another point to this one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} thisArg
|
|
* @chainable
|
|
*/
|
|
addEquals: function (that) {
|
|
this.x += that.x;
|
|
this.y += that.y;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Adds value to this point and returns a new one
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} new Point with added value
|
|
*/
|
|
scalarAdd: function (scalar) {
|
|
return new Point(this.x + scalar, this.y + scalar);
|
|
},
|
|
|
|
/**
|
|
* Adds value to this point
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} thisArg
|
|
* @chainable
|
|
*/
|
|
scalarAddEquals: function (scalar) {
|
|
this.x += scalar;
|
|
this.y += scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Subtracts another point from this point and returns a new one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} new Point object with subtracted values
|
|
*/
|
|
subtract: function (that) {
|
|
return new Point(this.x - that.x, this.y - that.y);
|
|
},
|
|
|
|
/**
|
|
* Subtracts another point from this point
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point} thisArg
|
|
* @chainable
|
|
*/
|
|
subtractEquals: function (that) {
|
|
this.x -= that.x;
|
|
this.y -= that.y;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Subtracts value from this point and returns a new one
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point}
|
|
*/
|
|
scalarSubtract: function (scalar) {
|
|
return new Point(this.x - scalar, this.y - scalar);
|
|
},
|
|
|
|
/**
|
|
* Subtracts value from this point
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} thisArg
|
|
* @chainable
|
|
*/
|
|
scalarSubtractEquals: function (scalar) {
|
|
this.x -= scalar;
|
|
this.y -= scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Multiplies this point by a value and returns a new one
|
|
* TODO: rename in scalarMultiply in 2.0
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point}
|
|
*/
|
|
multiply: function (scalar) {
|
|
return new Point(this.x * scalar, this.y * scalar);
|
|
},
|
|
|
|
/**
|
|
* Multiplies this point by a value
|
|
* TODO: rename in scalarMultiplyEquals in 2.0
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} thisArg
|
|
* @chainable
|
|
*/
|
|
multiplyEquals: function (scalar) {
|
|
this.x *= scalar;
|
|
this.y *= scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Divides this point by a value and returns a new one
|
|
* TODO: rename in scalarDivide in 2.0
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point}
|
|
*/
|
|
divide: function (scalar) {
|
|
return new Point(this.x / scalar, this.y / scalar);
|
|
},
|
|
|
|
/**
|
|
* Divides this point by a value
|
|
* TODO: rename in scalarDivideEquals in 2.0
|
|
* @param {Number} scalar
|
|
* @return {fabric.Point} thisArg
|
|
* @chainable
|
|
*/
|
|
divideEquals: function (scalar) {
|
|
this.x /= scalar;
|
|
this.y /= scalar;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is equal to another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
eq: function (that) {
|
|
return (this.x === that.x && this.y === that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is less than another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
lt: function (that) {
|
|
return (this.x < that.x && this.y < that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is less than or equal to another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
lte: function (that) {
|
|
return (this.x <= that.x && this.y <= that.y);
|
|
},
|
|
|
|
/**
|
|
|
|
* Returns true if this point is greater another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
gt: function (that) {
|
|
return (this.x > that.x && this.y > that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns true if this point is greater than or equal to another one
|
|
* @param {fabric.Point} that
|
|
* @return {Boolean}
|
|
*/
|
|
gte: function (that) {
|
|
return (this.x >= that.x && this.y >= that.y);
|
|
},
|
|
|
|
/**
|
|
* Returns new point which is the result of linear interpolation with this one and another one
|
|
* @param {fabric.Point} that
|
|
* @param {Number} t , position of interpolation, between 0 and 1 default 0.5
|
|
* @return {fabric.Point}
|
|
*/
|
|
lerp: function (that, t) {
|
|
if (typeof t === 'undefined') {
|
|
t = 0.5;
|
|
}
|
|
t = Math.max(Math.min(1, t), 0);
|
|
return new Point(this.x + (that.x - this.x) * t, this.y + (that.y - this.y) * t);
|
|
},
|
|
|
|
/**
|
|
* Returns distance from this point and another one
|
|
* @param {fabric.Point} that
|
|
* @return {Number}
|
|
*/
|
|
distanceFrom: function (that) {
|
|
var dx = this.x - that.x,
|
|
dy = this.y - that.y;
|
|
return Math.sqrt(dx * dx + dy * dy);
|
|
},
|
|
|
|
/**
|
|
* Returns the point between this point and another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point}
|
|
*/
|
|
midPointFrom: function (that) {
|
|
return this.lerp(that);
|
|
},
|
|
|
|
/**
|
|
* Returns a new point which is the min of this and another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point}
|
|
*/
|
|
min: function (that) {
|
|
return new Point(Math.min(this.x, that.x), Math.min(this.y, that.y));
|
|
},
|
|
|
|
/**
|
|
* Returns a new point which is the max of this and another one
|
|
* @param {fabric.Point} that
|
|
* @return {fabric.Point}
|
|
*/
|
|
max: function (that) {
|
|
return new Point(Math.max(this.x, that.x), Math.max(this.y, that.y));
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of this point
|
|
* @return {String}
|
|
*/
|
|
toString: function () {
|
|
return this.x + ',' + this.y;
|
|
},
|
|
|
|
/**
|
|
* Sets x/y of this point
|
|
* @param {Number} x
|
|
* @param {Number} y
|
|
* @chainable
|
|
*/
|
|
setXY: function (x, y) {
|
|
this.x = x;
|
|
this.y = y;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets x of this point
|
|
* @param {Number} x
|
|
* @chainable
|
|
*/
|
|
setX: function (x) {
|
|
this.x = x;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets y of this point
|
|
* @param {Number} y
|
|
* @chainable
|
|
*/
|
|
setY: function (y) {
|
|
this.y = y;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets x/y of this point from another point
|
|
* @param {fabric.Point} that
|
|
* @chainable
|
|
*/
|
|
setFromPoint: function (that) {
|
|
this.x = that.x;
|
|
this.y = that.y;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Swaps x/y of this point and another point
|
|
* @param {fabric.Point} that
|
|
*/
|
|
swap: function (that) {
|
|
var x = this.x,
|
|
y = this.y;
|
|
this.x = that.x;
|
|
this.y = that.y;
|
|
that.x = x;
|
|
that.y = y;
|
|
},
|
|
|
|
/**
|
|
* return a cloned instance of the point
|
|
* @return {fabric.Point}
|
|
*/
|
|
clone: function () {
|
|
return new Point(this.x, this.y);
|
|
}
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
/* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Intersection) {
|
|
fabric.warn('fabric.Intersection is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Intersection class
|
|
* @class fabric.Intersection
|
|
* @memberOf fabric
|
|
* @constructor
|
|
*/
|
|
function Intersection(status) {
|
|
this.status = status;
|
|
this.points = [];
|
|
}
|
|
|
|
fabric.Intersection = Intersection;
|
|
|
|
fabric.Intersection.prototype = /** @lends fabric.Intersection.prototype */ {
|
|
|
|
constructor: Intersection,
|
|
|
|
/**
|
|
* Appends a point to intersection
|
|
* @param {fabric.Point} point
|
|
* @return {fabric.Intersection} thisArg
|
|
* @chainable
|
|
*/
|
|
appendPoint: function (point) {
|
|
this.points.push(point);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Appends points to intersection
|
|
* @param {Array} points
|
|
* @return {fabric.Intersection} thisArg
|
|
* @chainable
|
|
*/
|
|
appendPoints: function (points) {
|
|
this.points = this.points.concat(points);
|
|
return this;
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Checks if one line intersects another
|
|
* TODO: rename in intersectSegmentSegment
|
|
* @static
|
|
* @param {fabric.Point} a1
|
|
* @param {fabric.Point} a2
|
|
* @param {fabric.Point} b1
|
|
* @param {fabric.Point} b2
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectLineLine = function (a1, a2, b1, b2) {
|
|
var result,
|
|
uaT = (b2.x - b1.x) * (a1.y - b1.y) - (b2.y - b1.y) * (a1.x - b1.x),
|
|
ubT = (a2.x - a1.x) * (a1.y - b1.y) - (a2.y - a1.y) * (a1.x - b1.x),
|
|
uB = (b2.y - b1.y) * (a2.x - a1.x) - (b2.x - b1.x) * (a2.y - a1.y);
|
|
if (uB !== 0) {
|
|
var ua = uaT / uB,
|
|
ub = ubT / uB;
|
|
if (0 <= ua && ua <= 1 && 0 <= ub && ub <= 1) {
|
|
result = new Intersection('Intersection');
|
|
result.appendPoint(new fabric.Point(a1.x + ua * (a2.x - a1.x), a1.y + ua * (a2.y - a1.y)));
|
|
}
|
|
else {
|
|
result = new Intersection();
|
|
}
|
|
}
|
|
else {
|
|
if (uaT === 0 || ubT === 0) {
|
|
result = new Intersection('Coincident');
|
|
}
|
|
else {
|
|
result = new Intersection('Parallel');
|
|
}
|
|
}
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
* Checks if line intersects polygon
|
|
* TODO: rename in intersectSegmentPolygon
|
|
* fix detection of coincident
|
|
* @static
|
|
* @param {fabric.Point} a1
|
|
* @param {fabric.Point} a2
|
|
* @param {Array} points
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectLinePolygon = function(a1, a2, points) {
|
|
var result = new Intersection(),
|
|
length = points.length,
|
|
b1, b2, inter, i;
|
|
|
|
for (i = 0; i < length; i++) {
|
|
b1 = points[i];
|
|
b2 = points[(i + 1) % length];
|
|
inter = Intersection.intersectLineLine(a1, a2, b1, b2);
|
|
|
|
result.appendPoints(inter.points);
|
|
}
|
|
if (result.points.length > 0) {
|
|
result.status = 'Intersection';
|
|
}
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
* Checks if polygon intersects another polygon
|
|
* @static
|
|
* @param {Array} points1
|
|
* @param {Array} points2
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectPolygonPolygon = function (points1, points2) {
|
|
var result = new Intersection(),
|
|
length = points1.length, i;
|
|
|
|
for (i = 0; i < length; i++) {
|
|
var a1 = points1[i],
|
|
a2 = points1[(i + 1) % length],
|
|
inter = Intersection.intersectLinePolygon(a1, a2, points2);
|
|
|
|
result.appendPoints(inter.points);
|
|
}
|
|
if (result.points.length > 0) {
|
|
result.status = 'Intersection';
|
|
}
|
|
return result;
|
|
};
|
|
|
|
/**
|
|
* Checks if polygon intersects rectangle
|
|
* @static
|
|
* @param {Array} points
|
|
* @param {fabric.Point} r1
|
|
* @param {fabric.Point} r2
|
|
* @return {fabric.Intersection}
|
|
*/
|
|
fabric.Intersection.intersectPolygonRectangle = function (points, r1, r2) {
|
|
var min = r1.min(r2),
|
|
max = r1.max(r2),
|
|
topRight = new fabric.Point(max.x, min.y),
|
|
bottomLeft = new fabric.Point(min.x, max.y),
|
|
inter1 = Intersection.intersectLinePolygon(min, topRight, points),
|
|
inter2 = Intersection.intersectLinePolygon(topRight, max, points),
|
|
inter3 = Intersection.intersectLinePolygon(max, bottomLeft, points),
|
|
inter4 = Intersection.intersectLinePolygon(bottomLeft, min, points),
|
|
result = new Intersection();
|
|
|
|
result.appendPoints(inter1.points);
|
|
result.appendPoints(inter2.points);
|
|
result.appendPoints(inter3.points);
|
|
result.appendPoints(inter4.points);
|
|
|
|
if (result.points.length > 0) {
|
|
result.status = 'Intersection';
|
|
}
|
|
return result;
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Color) {
|
|
fabric.warn('fabric.Color is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Color class
|
|
* The purpose of {@link fabric.Color} is to abstract and encapsulate common color operations;
|
|
* {@link fabric.Color} is a constructor and creates instances of {@link fabric.Color} objects.
|
|
*
|
|
* @class fabric.Color
|
|
* @param {String} color optional in hex or rgb(a) or hsl format or from known color list
|
|
* @return {fabric.Color} thisArg
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#colors}
|
|
*/
|
|
function Color(color) {
|
|
if (!color) {
|
|
this.setSource([0, 0, 0, 1]);
|
|
}
|
|
else {
|
|
this._tryParsingColor(color);
|
|
}
|
|
}
|
|
|
|
fabric.Color = Color;
|
|
|
|
fabric.Color.prototype = /** @lends fabric.Color.prototype */ {
|
|
|
|
/**
|
|
* @private
|
|
* @param {String|Array} color Color value to parse
|
|
*/
|
|
_tryParsingColor: function(color) {
|
|
var source;
|
|
|
|
if (color in Color.colorNameMap) {
|
|
color = Color.colorNameMap[color];
|
|
}
|
|
|
|
if (color === 'transparent') {
|
|
source = [255, 255, 255, 0];
|
|
}
|
|
|
|
if (!source) {
|
|
source = Color.sourceFromHex(color);
|
|
}
|
|
if (!source) {
|
|
source = Color.sourceFromRgb(color);
|
|
}
|
|
if (!source) {
|
|
source = Color.sourceFromHsl(color);
|
|
}
|
|
if (!source) {
|
|
//if color is not recognize let's make black as canvas does
|
|
source = [0, 0, 0, 1];
|
|
}
|
|
if (source) {
|
|
this.setSource(source);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Adapted from <a href="https://rawgithub.com/mjijackson/mjijackson.github.com/master/2008/02/rgb-to-hsl-and-rgb-to-hsv-color-model-conversion-algorithms-in-javascript.html">https://github.com/mjijackson</a>
|
|
* @private
|
|
* @param {Number} r Red color value
|
|
* @param {Number} g Green color value
|
|
* @param {Number} b Blue color value
|
|
* @return {Array} Hsl color
|
|
*/
|
|
_rgbToHsl: function(r, g, b) {
|
|
r /= 255; g /= 255; b /= 255;
|
|
|
|
var h, s, l,
|
|
max = fabric.util.array.max([r, g, b]),
|
|
min = fabric.util.array.min([r, g, b]);
|
|
|
|
l = (max + min) / 2;
|
|
|
|
if (max === min) {
|
|
h = s = 0; // achromatic
|
|
}
|
|
else {
|
|
var d = max - min;
|
|
s = l > 0.5 ? d / (2 - max - min) : d / (max + min);
|
|
switch (max) {
|
|
case r:
|
|
h = (g - b) / d + (g < b ? 6 : 0);
|
|
break;
|
|
case g:
|
|
h = (b - r) / d + 2;
|
|
break;
|
|
case b:
|
|
h = (r - g) / d + 4;
|
|
break;
|
|
}
|
|
h /= 6;
|
|
}
|
|
|
|
return [
|
|
Math.round(h * 360),
|
|
Math.round(s * 100),
|
|
Math.round(l * 100)
|
|
];
|
|
},
|
|
|
|
/**
|
|
* Returns source of this color (where source is an array representation; ex: [200, 200, 100, 1])
|
|
* @return {Array}
|
|
*/
|
|
getSource: function() {
|
|
return this._source;
|
|
},
|
|
|
|
/**
|
|
* Sets source of this color (where source is an array representation; ex: [200, 200, 100, 1])
|
|
* @param {Array} source
|
|
*/
|
|
setSource: function(source) {
|
|
this._source = source;
|
|
},
|
|
|
|
/**
|
|
* Returns color representation in RGB format
|
|
* @return {String} ex: rgb(0-255,0-255,0-255)
|
|
*/
|
|
toRgb: function() {
|
|
var source = this.getSource();
|
|
return 'rgb(' + source[0] + ',' + source[1] + ',' + source[2] + ')';
|
|
},
|
|
|
|
/**
|
|
* Returns color representation in RGBA format
|
|
* @return {String} ex: rgba(0-255,0-255,0-255,0-1)
|
|
*/
|
|
toRgba: function() {
|
|
var source = this.getSource();
|
|
return 'rgba(' + source[0] + ',' + source[1] + ',' + source[2] + ',' + source[3] + ')';
|
|
},
|
|
|
|
/**
|
|
* Returns color representation in HSL format
|
|
* @return {String} ex: hsl(0-360,0%-100%,0%-100%)
|
|
*/
|
|
toHsl: function() {
|
|
var source = this.getSource(),
|
|
hsl = this._rgbToHsl(source[0], source[1], source[2]);
|
|
|
|
return 'hsl(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%)';
|
|
},
|
|
|
|
/**
|
|
* Returns color representation in HSLA format
|
|
* @return {String} ex: hsla(0-360,0%-100%,0%-100%,0-1)
|
|
*/
|
|
toHsla: function() {
|
|
var source = this.getSource(),
|
|
hsl = this._rgbToHsl(source[0], source[1], source[2]);
|
|
|
|
return 'hsla(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%,' + source[3] + ')';
|
|
},
|
|
|
|
/**
|
|
* Returns color representation in HEX format
|
|
* @return {String} ex: FF5555
|
|
*/
|
|
toHex: function() {
|
|
var source = this.getSource(), r, g, b;
|
|
|
|
r = source[0].toString(16);
|
|
r = (r.length === 1) ? ('0' + r) : r;
|
|
|
|
g = source[1].toString(16);
|
|
g = (g.length === 1) ? ('0' + g) : g;
|
|
|
|
b = source[2].toString(16);
|
|
b = (b.length === 1) ? ('0' + b) : b;
|
|
|
|
return r.toUpperCase() + g.toUpperCase() + b.toUpperCase();
|
|
},
|
|
|
|
/**
|
|
* Returns color representation in HEXA format
|
|
* @return {String} ex: FF5555CC
|
|
*/
|
|
toHexa: function() {
|
|
var source = this.getSource(), a;
|
|
|
|
a = Math.round(source[3] * 255);
|
|
a = a.toString(16);
|
|
a = (a.length === 1) ? ('0' + a) : a;
|
|
|
|
return this.toHex() + a.toUpperCase();
|
|
},
|
|
|
|
/**
|
|
* Gets value of alpha channel for this color
|
|
* @return {Number} 0-1
|
|
*/
|
|
getAlpha: function() {
|
|
return this.getSource()[3];
|
|
},
|
|
|
|
/**
|
|
* Sets value of alpha channel for this color
|
|
* @param {Number} alpha Alpha value 0-1
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
setAlpha: function(alpha) {
|
|
var source = this.getSource();
|
|
source[3] = alpha;
|
|
this.setSource(source);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Transforms color to its grayscale representation
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
toGrayscale: function() {
|
|
var source = this.getSource(),
|
|
average = parseInt((source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), 10),
|
|
currentAlpha = source[3];
|
|
this.setSource([average, average, average, currentAlpha]);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Transforms color to its black and white representation
|
|
* @param {Number} threshold
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
toBlackWhite: function(threshold) {
|
|
var source = this.getSource(),
|
|
average = (source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0),
|
|
currentAlpha = source[3];
|
|
|
|
threshold = threshold || 127;
|
|
|
|
average = (Number(average) < Number(threshold)) ? 0 : 255;
|
|
this.setSource([average, average, average, currentAlpha]);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Overlays color with another color
|
|
* @param {String|fabric.Color} otherColor
|
|
* @return {fabric.Color} thisArg
|
|
*/
|
|
overlayWith: function(otherColor) {
|
|
if (!(otherColor instanceof Color)) {
|
|
otherColor = new Color(otherColor);
|
|
}
|
|
|
|
var result = [],
|
|
alpha = this.getAlpha(),
|
|
otherAlpha = 0.5,
|
|
source = this.getSource(),
|
|
otherSource = otherColor.getSource(), i;
|
|
|
|
for (i = 0; i < 3; i++) {
|
|
result.push(Math.round((source[i] * (1 - otherAlpha)) + (otherSource[i] * otherAlpha)));
|
|
}
|
|
|
|
result[3] = alpha;
|
|
this.setSource(result);
|
|
return this;
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Regex matching color in RGB or RGBA formats (ex: rgb(0, 0, 0), rgba(255, 100, 10, 0.5), rgba( 255 , 100 , 10 , 0.5 ), rgb(1,1,1), rgba(100%, 60%, 10%, 0.5))
|
|
* @static
|
|
* @field
|
|
* @memberOf fabric.Color
|
|
*/
|
|
// eslint-disable-next-line max-len
|
|
fabric.Color.reRGBa = /^rgba?\(\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*(?:\s*,\s*((?:\d*\.?\d+)?)\s*)?\)$/i;
|
|
|
|
/**
|
|
* Regex matching color in HSL or HSLA formats (ex: hsl(200, 80%, 10%), hsla(300, 50%, 80%, 0.5), hsla( 300 , 50% , 80% , 0.5 ))
|
|
* @static
|
|
* @field
|
|
* @memberOf fabric.Color
|
|
*/
|
|
fabric.Color.reHSLa = /^hsla?\(\s*(\d{1,3})\s*,\s*(\d{1,3}\%)\s*,\s*(\d{1,3}\%)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/i;
|
|
|
|
/**
|
|
* Regex matching color in HEX format (ex: #FF5544CC, #FF5555, 010155, aff)
|
|
* @static
|
|
* @field
|
|
* @memberOf fabric.Color
|
|
*/
|
|
fabric.Color.reHex = /^#?([0-9a-f]{8}|[0-9a-f]{6}|[0-9a-f]{4}|[0-9a-f]{3})$/i;
|
|
|
|
/**
|
|
* Map of the 148 color names with HEX code
|
|
* @static
|
|
* @field
|
|
* @memberOf fabric.Color
|
|
* @see: https://www.w3.org/TR/css3-color/#svg-color
|
|
*/
|
|
fabric.Color.colorNameMap = {
|
|
aliceblue: '#F0F8FF',
|
|
antiquewhite: '#FAEBD7',
|
|
aqua: '#00FFFF',
|
|
aquamarine: '#7FFFD4',
|
|
azure: '#F0FFFF',
|
|
beige: '#F5F5DC',
|
|
bisque: '#FFE4C4',
|
|
black: '#000000',
|
|
blanchedalmond: '#FFEBCD',
|
|
blue: '#0000FF',
|
|
blueviolet: '#8A2BE2',
|
|
brown: '#A52A2A',
|
|
burlywood: '#DEB887',
|
|
cadetblue: '#5F9EA0',
|
|
chartreuse: '#7FFF00',
|
|
chocolate: '#D2691E',
|
|
coral: '#FF7F50',
|
|
cornflowerblue: '#6495ED',
|
|
cornsilk: '#FFF8DC',
|
|
crimson: '#DC143C',
|
|
cyan: '#00FFFF',
|
|
darkblue: '#00008B',
|
|
darkcyan: '#008B8B',
|
|
darkgoldenrod: '#B8860B',
|
|
darkgray: '#A9A9A9',
|
|
darkgrey: '#A9A9A9',
|
|
darkgreen: '#006400',
|
|
darkkhaki: '#BDB76B',
|
|
darkmagenta: '#8B008B',
|
|
darkolivegreen: '#556B2F',
|
|
darkorange: '#FF8C00',
|
|
darkorchid: '#9932CC',
|
|
darkred: '#8B0000',
|
|
darksalmon: '#E9967A',
|
|
darkseagreen: '#8FBC8F',
|
|
darkslateblue: '#483D8B',
|
|
darkslategray: '#2F4F4F',
|
|
darkslategrey: '#2F4F4F',
|
|
darkturquoise: '#00CED1',
|
|
darkviolet: '#9400D3',
|
|
deeppink: '#FF1493',
|
|
deepskyblue: '#00BFFF',
|
|
dimgray: '#696969',
|
|
dimgrey: '#696969',
|
|
dodgerblue: '#1E90FF',
|
|
firebrick: '#B22222',
|
|
floralwhite: '#FFFAF0',
|
|
forestgreen: '#228B22',
|
|
fuchsia: '#FF00FF',
|
|
gainsboro: '#DCDCDC',
|
|
ghostwhite: '#F8F8FF',
|
|
gold: '#FFD700',
|
|
goldenrod: '#DAA520',
|
|
gray: '#808080',
|
|
grey: '#808080',
|
|
green: '#008000',
|
|
greenyellow: '#ADFF2F',
|
|
honeydew: '#F0FFF0',
|
|
hotpink: '#FF69B4',
|
|
indianred: '#CD5C5C',
|
|
indigo: '#4B0082',
|
|
ivory: '#FFFFF0',
|
|
khaki: '#F0E68C',
|
|
lavender: '#E6E6FA',
|
|
lavenderblush: '#FFF0F5',
|
|
lawngreen: '#7CFC00',
|
|
lemonchiffon: '#FFFACD',
|
|
lightblue: '#ADD8E6',
|
|
lightcoral: '#F08080',
|
|
lightcyan: '#E0FFFF',
|
|
lightgoldenrodyellow: '#FAFAD2',
|
|
lightgray: '#D3D3D3',
|
|
lightgrey: '#D3D3D3',
|
|
lightgreen: '#90EE90',
|
|
lightpink: '#FFB6C1',
|
|
lightsalmon: '#FFA07A',
|
|
lightseagreen: '#20B2AA',
|
|
lightskyblue: '#87CEFA',
|
|
lightslategray: '#778899',
|
|
lightslategrey: '#778899',
|
|
lightsteelblue: '#B0C4DE',
|
|
lightyellow: '#FFFFE0',
|
|
lime: '#00FF00',
|
|
limegreen: '#32CD32',
|
|
linen: '#FAF0E6',
|
|
magenta: '#FF00FF',
|
|
maroon: '#800000',
|
|
mediumaquamarine: '#66CDAA',
|
|
mediumblue: '#0000CD',
|
|
mediumorchid: '#BA55D3',
|
|
mediumpurple: '#9370DB',
|
|
mediumseagreen: '#3CB371',
|
|
mediumslateblue: '#7B68EE',
|
|
mediumspringgreen: '#00FA9A',
|
|
mediumturquoise: '#48D1CC',
|
|
mediumvioletred: '#C71585',
|
|
midnightblue: '#191970',
|
|
mintcream: '#F5FFFA',
|
|
mistyrose: '#FFE4E1',
|
|
moccasin: '#FFE4B5',
|
|
navajowhite: '#FFDEAD',
|
|
navy: '#000080',
|
|
oldlace: '#FDF5E6',
|
|
olive: '#808000',
|
|
olivedrab: '#6B8E23',
|
|
orange: '#FFA500',
|
|
orangered: '#FF4500',
|
|
orchid: '#DA70D6',
|
|
palegoldenrod: '#EEE8AA',
|
|
palegreen: '#98FB98',
|
|
paleturquoise: '#AFEEEE',
|
|
palevioletred: '#DB7093',
|
|
papayawhip: '#FFEFD5',
|
|
peachpuff: '#FFDAB9',
|
|
peru: '#CD853F',
|
|
pink: '#FFC0CB',
|
|
plum: '#DDA0DD',
|
|
powderblue: '#B0E0E6',
|
|
purple: '#800080',
|
|
rebeccapurple: '#663399',
|
|
red: '#FF0000',
|
|
rosybrown: '#BC8F8F',
|
|
royalblue: '#4169E1',
|
|
saddlebrown: '#8B4513',
|
|
salmon: '#FA8072',
|
|
sandybrown: '#F4A460',
|
|
seagreen: '#2E8B57',
|
|
seashell: '#FFF5EE',
|
|
sienna: '#A0522D',
|
|
silver: '#C0C0C0',
|
|
skyblue: '#87CEEB',
|
|
slateblue: '#6A5ACD',
|
|
slategray: '#708090',
|
|
slategrey: '#708090',
|
|
snow: '#FFFAFA',
|
|
springgreen: '#00FF7F',
|
|
steelblue: '#4682B4',
|
|
tan: '#D2B48C',
|
|
teal: '#008080',
|
|
thistle: '#D8BFD8',
|
|
tomato: '#FF6347',
|
|
turquoise: '#40E0D0',
|
|
violet: '#EE82EE',
|
|
wheat: '#F5DEB3',
|
|
white: '#FFFFFF',
|
|
whitesmoke: '#F5F5F5',
|
|
yellow: '#FFFF00',
|
|
yellowgreen: '#9ACD32'
|
|
};
|
|
|
|
/**
|
|
* @private
|
|
* @param {Number} p
|
|
* @param {Number} q
|
|
* @param {Number} t
|
|
* @return {Number}
|
|
*/
|
|
function hue2rgb(p, q, t) {
|
|
if (t < 0) {
|
|
t += 1;
|
|
}
|
|
if (t > 1) {
|
|
t -= 1;
|
|
}
|
|
if (t < 1 / 6) {
|
|
return p + (q - p) * 6 * t;
|
|
}
|
|
if (t < 1 / 2) {
|
|
return q;
|
|
}
|
|
if (t < 2 / 3) {
|
|
return p + (q - p) * (2 / 3 - t) * 6;
|
|
}
|
|
return p;
|
|
}
|
|
|
|
/**
|
|
* Returns new color object, when given a color in RGB format
|
|
* @memberOf fabric.Color
|
|
* @param {String} color Color value ex: rgb(0-255,0-255,0-255)
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromRgb = function(color) {
|
|
return Color.fromSource(Color.sourceFromRgb(color));
|
|
};
|
|
|
|
/**
|
|
* Returns array representation (ex: [100, 100, 200, 1]) of a color that's in RGB or RGBA format
|
|
* @memberOf fabric.Color
|
|
* @param {String} color Color value ex: rgb(0-255,0-255,0-255), rgb(0%-100%,0%-100%,0%-100%)
|
|
* @return {Array} source
|
|
*/
|
|
fabric.Color.sourceFromRgb = function(color) {
|
|
var match = color.match(Color.reRGBa);
|
|
if (match) {
|
|
var r = parseInt(match[1], 10) / (/%$/.test(match[1]) ? 100 : 1) * (/%$/.test(match[1]) ? 255 : 1),
|
|
g = parseInt(match[2], 10) / (/%$/.test(match[2]) ? 100 : 1) * (/%$/.test(match[2]) ? 255 : 1),
|
|
b = parseInt(match[3], 10) / (/%$/.test(match[3]) ? 100 : 1) * (/%$/.test(match[3]) ? 255 : 1);
|
|
|
|
return [
|
|
parseInt(r, 10),
|
|
parseInt(g, 10),
|
|
parseInt(b, 10),
|
|
match[4] ? parseFloat(match[4]) : 1
|
|
];
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Returns new color object, when given a color in RGBA format
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric.Color
|
|
* @param {String} color
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromRgba = Color.fromRgb;
|
|
|
|
/**
|
|
* Returns new color object, when given a color in HSL format
|
|
* @param {String} color Color value ex: hsl(0-260,0%-100%,0%-100%)
|
|
* @memberOf fabric.Color
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromHsl = function(color) {
|
|
return Color.fromSource(Color.sourceFromHsl(color));
|
|
};
|
|
|
|
/**
|
|
* Returns array representation (ex: [100, 100, 200, 1]) of a color that's in HSL or HSLA format.
|
|
* Adapted from <a href="https://rawgithub.com/mjijackson/mjijackson.github.com/master/2008/02/rgb-to-hsl-and-rgb-to-hsv-color-model-conversion-algorithms-in-javascript.html">https://github.com/mjijackson</a>
|
|
* @memberOf fabric.Color
|
|
* @param {String} color Color value ex: hsl(0-360,0%-100%,0%-100%) or hsla(0-360,0%-100%,0%-100%, 0-1)
|
|
* @return {Array} source
|
|
* @see http://http://www.w3.org/TR/css3-color/#hsl-color
|
|
*/
|
|
fabric.Color.sourceFromHsl = function(color) {
|
|
var match = color.match(Color.reHSLa);
|
|
if (!match) {
|
|
return;
|
|
}
|
|
|
|
var h = (((parseFloat(match[1]) % 360) + 360) % 360) / 360,
|
|
s = parseFloat(match[2]) / (/%$/.test(match[2]) ? 100 : 1),
|
|
l = parseFloat(match[3]) / (/%$/.test(match[3]) ? 100 : 1),
|
|
r, g, b;
|
|
|
|
if (s === 0) {
|
|
r = g = b = l;
|
|
}
|
|
else {
|
|
var q = l <= 0.5 ? l * (s + 1) : l + s - l * s,
|
|
p = l * 2 - q;
|
|
|
|
r = hue2rgb(p, q, h + 1 / 3);
|
|
g = hue2rgb(p, q, h);
|
|
b = hue2rgb(p, q, h - 1 / 3);
|
|
}
|
|
|
|
return [
|
|
Math.round(r * 255),
|
|
Math.round(g * 255),
|
|
Math.round(b * 255),
|
|
match[4] ? parseFloat(match[4]) : 1
|
|
];
|
|
};
|
|
|
|
/**
|
|
* Returns new color object, when given a color in HSLA format
|
|
* @static
|
|
* @function
|
|
* @memberOf fabric.Color
|
|
* @param {String} color
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromHsla = Color.fromHsl;
|
|
|
|
/**
|
|
* Returns new color object, when given a color in HEX format
|
|
* @static
|
|
* @memberOf fabric.Color
|
|
* @param {String} color Color value ex: FF5555
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromHex = function(color) {
|
|
return Color.fromSource(Color.sourceFromHex(color));
|
|
};
|
|
|
|
/**
|
|
* Returns array representation (ex: [100, 100, 200, 1]) of a color that's in HEX format
|
|
* @static
|
|
* @memberOf fabric.Color
|
|
* @param {String} color ex: FF5555 or FF5544CC (RGBa)
|
|
* @return {Array} source
|
|
*/
|
|
fabric.Color.sourceFromHex = function(color) {
|
|
if (color.match(Color.reHex)) {
|
|
var value = color.slice(color.indexOf('#') + 1),
|
|
isShortNotation = (value.length === 3 || value.length === 4),
|
|
isRGBa = (value.length === 8 || value.length === 4),
|
|
r = isShortNotation ? (value.charAt(0) + value.charAt(0)) : value.substring(0, 2),
|
|
g = isShortNotation ? (value.charAt(1) + value.charAt(1)) : value.substring(2, 4),
|
|
b = isShortNotation ? (value.charAt(2) + value.charAt(2)) : value.substring(4, 6),
|
|
a = isRGBa ? (isShortNotation ? (value.charAt(3) + value.charAt(3)) : value.substring(6, 8)) : 'FF';
|
|
|
|
return [
|
|
parseInt(r, 16),
|
|
parseInt(g, 16),
|
|
parseInt(b, 16),
|
|
parseFloat((parseInt(a, 16) / 255).toFixed(2))
|
|
];
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Returns new color object, when given color in array representation (ex: [200, 100, 100, 0.5])
|
|
* @static
|
|
* @memberOf fabric.Color
|
|
* @param {Array} source
|
|
* @return {fabric.Color}
|
|
*/
|
|
fabric.Color.fromSource = function(source) {
|
|
var oColor = new Color();
|
|
oColor.setSource(source);
|
|
return oColor;
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
scaleMap = ['e', 'se', 's', 'sw', 'w', 'nw', 'n', 'ne', 'e'],
|
|
skewMap = ['ns', 'nesw', 'ew', 'nwse'],
|
|
controls = {},
|
|
LEFT = 'left', TOP = 'top', RIGHT = 'right', BOTTOM = 'bottom', CENTER = 'center',
|
|
opposite = {
|
|
top: BOTTOM,
|
|
bottom: TOP,
|
|
left: RIGHT,
|
|
right: LEFT,
|
|
center: CENTER,
|
|
}, radiansToDegrees = fabric.util.radiansToDegrees,
|
|
sign = (Math.sign || function(x) { return ((x > 0) - (x < 0)) || +x; });
|
|
|
|
/**
|
|
* Combine control position and object angle to find the control direction compared
|
|
* to the object center.
|
|
* @param {fabric.Object} fabricObject the fabric object for which we are rendering controls
|
|
* @param {fabric.Control} control the control class
|
|
* @return {Number} 0 - 7 a quadrant number
|
|
*/
|
|
function findCornerQuadrant(fabricObject, control) {
|
|
var cornerAngle = fabricObject.angle + radiansToDegrees(Math.atan2(control.y, control.x)) + 360;
|
|
return Math.round((cornerAngle % 360) / 45);
|
|
}
|
|
|
|
function fireEvent(eventName, options) {
|
|
var target = options.transform.target,
|
|
canvas = target.canvas,
|
|
canvasOptions = fabric.util.object.clone(options);
|
|
canvasOptions.target = target;
|
|
canvas && canvas.fire('object:' + eventName, canvasOptions);
|
|
target.fire(eventName, options);
|
|
}
|
|
|
|
/**
|
|
* Inspect event and fabricObject properties to understand if the scaling action
|
|
* @param {Event} eventData from the user action
|
|
* @param {fabric.Object} fabricObject the fabric object about to scale
|
|
* @return {Boolean} true if scale is proportional
|
|
*/
|
|
function scaleIsProportional(eventData, fabricObject) {
|
|
var canvas = fabricObject.canvas, uniScaleKey = canvas.uniScaleKey,
|
|
uniformIsToggled = eventData[uniScaleKey];
|
|
return (canvas.uniformScaling && !uniformIsToggled) ||
|
|
(!canvas.uniformScaling && uniformIsToggled);
|
|
}
|
|
|
|
/**
|
|
* Checks if transform is centered
|
|
* @param {Object} transform transform data
|
|
* @return {Boolean} true if transform is centered
|
|
*/
|
|
function isTransformCentered(transform) {
|
|
return transform.originX === CENTER && transform.originY === CENTER;
|
|
}
|
|
|
|
/**
|
|
* Inspect fabricObject to understand if the current scaling action is allowed
|
|
* @param {fabric.Object} fabricObject the fabric object about to scale
|
|
* @param {String} by 'x' or 'y' or ''
|
|
* @param {Boolean} scaleProportionally true if we are trying to scale proportionally
|
|
* @return {Boolean} true if scaling is not allowed at current conditions
|
|
*/
|
|
function scalingIsForbidden(fabricObject, by, scaleProportionally) {
|
|
var lockX = fabricObject.lockScalingX, lockY = fabricObject.lockScalingY;
|
|
if (lockX && lockY) {
|
|
return true;
|
|
}
|
|
if (!by && (lockX || lockY) && scaleProportionally) {
|
|
return true;
|
|
}
|
|
if (lockX && by === 'x') {
|
|
return true;
|
|
}
|
|
if (lockY && by === 'y') {
|
|
return true;
|
|
}
|
|
return false;
|
|
}
|
|
|
|
/**
|
|
* return the correct cursor style for the scale action
|
|
* @param {Event} eventData the javascript event that is causing the scale
|
|
* @param {fabric.Control} control the control that is interested in the action
|
|
* @param {fabric.Object} fabricObject the fabric object that is interested in the action
|
|
* @return {String} a valid css string for the cursor
|
|
*/
|
|
function scaleCursorStyleHandler(eventData, control, fabricObject) {
|
|
var notAllowed = 'not-allowed',
|
|
scaleProportionally = scaleIsProportional(eventData, fabricObject),
|
|
by = '';
|
|
if (control.x !== 0 && control.y === 0) {
|
|
by = 'x';
|
|
}
|
|
else if (control.x === 0 && control.y !== 0) {
|
|
by = 'y';
|
|
}
|
|
if (scalingIsForbidden(fabricObject, by, scaleProportionally)) {
|
|
return notAllowed;
|
|
}
|
|
var n = findCornerQuadrant(fabricObject, control);
|
|
return scaleMap[n] + '-resize';
|
|
}
|
|
|
|
/**
|
|
* return the correct cursor style for the skew action
|
|
* @param {Event} eventData the javascript event that is causing the scale
|
|
* @param {fabric.Control} control the control that is interested in the action
|
|
* @param {fabric.Object} fabricObject the fabric object that is interested in the action
|
|
* @return {String} a valid css string for the cursor
|
|
*/
|
|
function skewCursorStyleHandler(eventData, control, fabricObject) {
|
|
var notAllowed = 'not-allowed';
|
|
if (control.x !== 0 && fabricObject.lockSkewingY) {
|
|
return notAllowed;
|
|
}
|
|
if (control.y !== 0 && fabricObject.lockSkewingX) {
|
|
return notAllowed;
|
|
}
|
|
var n = findCornerQuadrant(fabricObject, control) % 4;
|
|
return skewMap[n] + '-resize';
|
|
}
|
|
|
|
/**
|
|
* Combine skew and scale style handlers to cover fabric standard use case
|
|
* @param {Event} eventData the javascript event that is causing the scale
|
|
* @param {fabric.Control} control the control that is interested in the action
|
|
* @param {fabric.Object} fabricObject the fabric object that is interested in the action
|
|
* @return {String} a valid css string for the cursor
|
|
*/
|
|
function scaleSkewCursorStyleHandler(eventData, control, fabricObject) {
|
|
if (eventData[fabricObject.canvas.altActionKey]) {
|
|
return controls.skewCursorStyleHandler(eventData, control, fabricObject);
|
|
}
|
|
return controls.scaleCursorStyleHandler(eventData, control, fabricObject);
|
|
}
|
|
|
|
/**
|
|
* Inspect event, control and fabricObject to return the correct action name
|
|
* @param {Event} eventData the javascript event that is causing the scale
|
|
* @param {fabric.Control} control the control that is interested in the action
|
|
* @param {fabric.Object} fabricObject the fabric object that is interested in the action
|
|
* @return {String} an action name
|
|
*/
|
|
function scaleOrSkewActionName(eventData, control, fabricObject) {
|
|
var isAlternative = eventData[fabricObject.canvas.altActionKey];
|
|
if (control.x === 0) {
|
|
// then is scaleY or skewX
|
|
return isAlternative ? 'skewX' : 'scaleY';
|
|
}
|
|
if (control.y === 0) {
|
|
// then is scaleY or skewX
|
|
return isAlternative ? 'skewY' : 'scaleX';
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Find the correct style for the control that is used for rotation.
|
|
* this function is very simple and it just take care of not-allowed or standard cursor
|
|
* @param {Event} eventData the javascript event that is causing the scale
|
|
* @param {fabric.Control} control the control that is interested in the action
|
|
* @param {fabric.Object} fabricObject the fabric object that is interested in the action
|
|
* @return {String} a valid css string for the cursor
|
|
*/
|
|
function rotationStyleHandler(eventData, control, fabricObject) {
|
|
if (fabricObject.lockRotation) {
|
|
return 'not-allowed';
|
|
}
|
|
return control.cursorStyle;
|
|
}
|
|
|
|
function commonEventInfo(eventData, transform, x, y) {
|
|
return {
|
|
e: eventData,
|
|
transform: transform,
|
|
pointer: {
|
|
x: x,
|
|
y: y,
|
|
}
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Wrap an action handler with saving/restoring object position on the transform.
|
|
* this is the code that permits to objects to keep their position while transforming.
|
|
* @param {Function} actionHandler the function to wrap
|
|
* @return {Function} a function with an action handler signature
|
|
*/
|
|
function wrapWithFixedAnchor(actionHandler) {
|
|
return function(eventData, transform, x, y) {
|
|
var target = transform.target, centerPoint = target.getCenterPoint(),
|
|
constraint = target.translateToOriginPoint(centerPoint, transform.originX, transform.originY),
|
|
actionPerformed = actionHandler(eventData, transform, x, y);
|
|
target.setPositionByOrigin(constraint, transform.originX, transform.originY);
|
|
return actionPerformed;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Wrap an action handler with firing an event if the action is performed
|
|
* @param {Function} actionHandler the function to wrap
|
|
* @return {Function} a function with an action handler signature
|
|
*/
|
|
function wrapWithFireEvent(eventName, actionHandler) {
|
|
return function(eventData, transform, x, y) {
|
|
var actionPerformed = actionHandler(eventData, transform, x, y);
|
|
if (actionPerformed) {
|
|
fireEvent(eventName, commonEventInfo(eventData, transform, x, y));
|
|
}
|
|
return actionPerformed;
|
|
};
|
|
}
|
|
|
|
/**
|
|
* Transforms a point described by x and y in a distance from the top left corner of the object
|
|
* bounding box.
|
|
* @param {Object} transform
|
|
* @param {String} originX
|
|
* @param {String} originY
|
|
* @param {number} x
|
|
* @param {number} y
|
|
* @return {Fabric.Point} the normalized point
|
|
*/
|
|
function getLocalPoint(transform, originX, originY, x, y) {
|
|
var target = transform.target,
|
|
control = target.controls[transform.corner],
|
|
zoom = target.canvas.getZoom(),
|
|
padding = target.padding / zoom,
|
|
localPoint = target.toLocalPoint(new fabric.Point(x, y), originX, originY);
|
|
if (localPoint.x >= padding) {
|
|
localPoint.x -= padding;
|
|
}
|
|
if (localPoint.x <= -padding) {
|
|
localPoint.x += padding;
|
|
}
|
|
if (localPoint.y >= padding) {
|
|
localPoint.y -= padding;
|
|
}
|
|
if (localPoint.y <= padding) {
|
|
localPoint.y += padding;
|
|
}
|
|
localPoint.x -= control.offsetX;
|
|
localPoint.y -= control.offsetY;
|
|
return localPoint;
|
|
}
|
|
|
|
/**
|
|
* Detect if the fabric object is flipped on one side.
|
|
* @param {fabric.Object} target
|
|
* @return {Boolean} true if one flip, but not two.
|
|
*/
|
|
function targetHasOneFlip(target) {
|
|
return target.flipX !== target.flipY;
|
|
}
|
|
|
|
/**
|
|
* Utility function to compensate the scale factor when skew is applied on both axes
|
|
* @private
|
|
*/
|
|
function compensateScaleForSkew(target, oppositeSkew, scaleToCompensate, axis, reference) {
|
|
if (target[oppositeSkew] !== 0) {
|
|
var newDim = target._getTransformedDimensions()[axis];
|
|
var newValue = reference / newDim * target[scaleToCompensate];
|
|
target.set(scaleToCompensate, newValue);
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Action handler for skewing on the X axis
|
|
* @private
|
|
*/
|
|
function skewObjectX(eventData, transform, x, y) {
|
|
var target = transform.target,
|
|
// find how big the object would be, if there was no skewX. takes in account scaling
|
|
dimNoSkew = target._getTransformedDimensions(0, target.skewY),
|
|
localPoint = getLocalPoint(transform, transform.originX, transform.originY, x, y),
|
|
// the mouse is in the center of the object, and we want it to stay there.
|
|
// so the object will grow twice as much as the mouse.
|
|
// this makes the skew growth to localPoint * 2 - dimNoSkew.
|
|
totalSkewSize = Math.abs(localPoint.x * 2) - dimNoSkew.x,
|
|
currentSkew = target.skewX, newSkew;
|
|
if (totalSkewSize < 2) {
|
|
// let's make it easy to go back to position 0.
|
|
newSkew = 0;
|
|
}
|
|
else {
|
|
newSkew = radiansToDegrees(
|
|
Math.atan2((totalSkewSize / target.scaleX), (dimNoSkew.y / target.scaleY))
|
|
);
|
|
// now we have to find the sign of the skew.
|
|
// it mostly depend on the origin of transformation.
|
|
if (transform.originX === LEFT && transform.originY === BOTTOM) {
|
|
newSkew = -newSkew;
|
|
}
|
|
if (transform.originX === RIGHT && transform.originY === TOP) {
|
|
newSkew = -newSkew;
|
|
}
|
|
if (targetHasOneFlip(target)) {
|
|
newSkew = -newSkew;
|
|
}
|
|
}
|
|
var hasSkewed = currentSkew !== newSkew;
|
|
if (hasSkewed) {
|
|
var dimBeforeSkewing = target._getTransformedDimensions().y;
|
|
target.set('skewX', newSkew);
|
|
compensateScaleForSkew(target, 'skewY', 'scaleY', 'y', dimBeforeSkewing);
|
|
}
|
|
return hasSkewed;
|
|
}
|
|
|
|
/**
|
|
* Action handler for skewing on the Y axis
|
|
* @private
|
|
*/
|
|
function skewObjectY(eventData, transform, x, y) {
|
|
var target = transform.target,
|
|
// find how big the object would be, if there was no skewX. takes in account scaling
|
|
dimNoSkew = target._getTransformedDimensions(target.skewX, 0),
|
|
localPoint = getLocalPoint(transform, transform.originX, transform.originY, x, y),
|
|
// the mouse is in the center of the object, and we want it to stay there.
|
|
// so the object will grow twice as much as the mouse.
|
|
// this makes the skew growth to localPoint * 2 - dimNoSkew.
|
|
totalSkewSize = Math.abs(localPoint.y * 2) - dimNoSkew.y,
|
|
currentSkew = target.skewY, newSkew;
|
|
if (totalSkewSize < 2) {
|
|
// let's make it easy to go back to position 0.
|
|
newSkew = 0;
|
|
}
|
|
else {
|
|
newSkew = radiansToDegrees(
|
|
Math.atan2((totalSkewSize / target.scaleY), (dimNoSkew.x / target.scaleX))
|
|
);
|
|
// now we have to find the sign of the skew.
|
|
// it mostly depend on the origin of transformation.
|
|
if (transform.originX === LEFT && transform.originY === BOTTOM) {
|
|
newSkew = -newSkew;
|
|
}
|
|
if (transform.originX === RIGHT && transform.originY === TOP) {
|
|
newSkew = -newSkew;
|
|
}
|
|
if (targetHasOneFlip(target)) {
|
|
newSkew = -newSkew;
|
|
}
|
|
}
|
|
var hasSkewed = currentSkew !== newSkew;
|
|
if (hasSkewed) {
|
|
var dimBeforeSkewing = target._getTransformedDimensions().x;
|
|
target.set('skewY', newSkew);
|
|
compensateScaleForSkew(target, 'skewX', 'scaleX', 'x', dimBeforeSkewing);
|
|
}
|
|
return hasSkewed;
|
|
}
|
|
|
|
/**
|
|
* Wrapped Action handler for skewing on the Y axis, takes care of the
|
|
* skew direction and determine the correct transform origin for the anchor point
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function skewHandlerX(eventData, transform, x, y) {
|
|
// step1 figure out and change transform origin.
|
|
// if skewX > 0 and originY bottom we anchor on right
|
|
// if skewX > 0 and originY top we anchor on left
|
|
// if skewX < 0 and originY bottom we anchor on left
|
|
// if skewX < 0 and originY top we anchor on right
|
|
// if skewX is 0, we look for mouse position to understand where are we going.
|
|
var target = transform.target, currentSkew = target.skewX, originX, originY = transform.originY;
|
|
if (target.lockSkewingX) {
|
|
return false;
|
|
}
|
|
if (currentSkew === 0) {
|
|
var localPointFromCenter = getLocalPoint(transform, CENTER, CENTER, x, y);
|
|
if (localPointFromCenter.x > 0) {
|
|
// we are pulling right, anchor left;
|
|
originX = LEFT;
|
|
}
|
|
else {
|
|
// we are pulling right, anchor right
|
|
originX = RIGHT;
|
|
}
|
|
}
|
|
else {
|
|
if (currentSkew > 0) {
|
|
originX = originY === TOP ? LEFT : RIGHT;
|
|
}
|
|
if (currentSkew < 0) {
|
|
originX = originY === TOP ? RIGHT : LEFT;
|
|
}
|
|
// is the object flipped on one side only? swap the origin.
|
|
if (targetHasOneFlip(target)) {
|
|
originX = originX === LEFT ? RIGHT : LEFT;
|
|
}
|
|
}
|
|
|
|
// once we have the origin, we find the anchor point
|
|
transform.originX = originX;
|
|
var finalHandler = wrapWithFireEvent('skewing', wrapWithFixedAnchor(skewObjectX));
|
|
return finalHandler(eventData, transform, x, y);
|
|
}
|
|
|
|
/**
|
|
* Wrapped Action handler for skewing on the Y axis, takes care of the
|
|
* skew direction and determine the correct transform origin for the anchor point
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function skewHandlerY(eventData, transform, x, y) {
|
|
// step1 figure out and change transform origin.
|
|
// if skewY > 0 and originX left we anchor on top
|
|
// if skewY > 0 and originX right we anchor on bottom
|
|
// if skewY < 0 and originX left we anchor on bottom
|
|
// if skewY < 0 and originX right we anchor on top
|
|
// if skewY is 0, we look for mouse position to understand where are we going.
|
|
var target = transform.target, currentSkew = target.skewY, originY, originX = transform.originX;
|
|
if (target.lockSkewingY) {
|
|
return false;
|
|
}
|
|
if (currentSkew === 0) {
|
|
var localPointFromCenter = getLocalPoint(transform, CENTER, CENTER, x, y);
|
|
if (localPointFromCenter.y > 0) {
|
|
// we are pulling down, anchor up;
|
|
originY = TOP;
|
|
}
|
|
else {
|
|
// we are pulling up, anchor down
|
|
originY = BOTTOM;
|
|
}
|
|
}
|
|
else {
|
|
if (currentSkew > 0) {
|
|
originY = originX === LEFT ? TOP : BOTTOM;
|
|
}
|
|
if (currentSkew < 0) {
|
|
originY = originX === LEFT ? BOTTOM : TOP;
|
|
}
|
|
// is the object flipped on one side only? swap the origin.
|
|
if (targetHasOneFlip(target)) {
|
|
originY = originY === TOP ? BOTTOM : TOP;
|
|
}
|
|
}
|
|
|
|
// once we have the origin, we find the anchor point
|
|
transform.originY = originY;
|
|
var finalHandler = wrapWithFireEvent('skewing', wrapWithFixedAnchor(skewObjectY));
|
|
return finalHandler(eventData, transform, x, y);
|
|
}
|
|
|
|
/**
|
|
* Action handler for rotation and snapping, without anchor point.
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
* @private
|
|
*/
|
|
function rotationWithSnapping(eventData, transform, x, y) {
|
|
var t = transform,
|
|
target = t.target,
|
|
pivotPoint = target.translateToOriginPoint(target.getCenterPoint(), t.originX, t.originY);
|
|
|
|
if (target.lockRotation) {
|
|
return false;
|
|
}
|
|
|
|
var lastAngle = Math.atan2(t.ey - pivotPoint.y, t.ex - pivotPoint.x),
|
|
curAngle = Math.atan2(y - pivotPoint.y, x - pivotPoint.x),
|
|
angle = radiansToDegrees(curAngle - lastAngle + t.theta),
|
|
hasRotated = true;
|
|
|
|
if (target.snapAngle > 0) {
|
|
var snapAngle = target.snapAngle,
|
|
snapThreshold = target.snapThreshold || snapAngle,
|
|
rightAngleLocked = Math.ceil(angle / snapAngle) * snapAngle,
|
|
leftAngleLocked = Math.floor(angle / snapAngle) * snapAngle;
|
|
|
|
if (Math.abs(angle - leftAngleLocked) < snapThreshold) {
|
|
angle = leftAngleLocked;
|
|
}
|
|
else if (Math.abs(angle - rightAngleLocked) < snapThreshold) {
|
|
angle = rightAngleLocked;
|
|
}
|
|
}
|
|
|
|
// normalize angle to positive value
|
|
if (angle < 0) {
|
|
angle = 360 + angle;
|
|
}
|
|
angle %= 360;
|
|
|
|
hasRotated = target.angle !== angle;
|
|
target.angle = angle;
|
|
return hasRotated;
|
|
}
|
|
|
|
/**
|
|
* Basic scaling logic, reused with different constrain for scaling X,Y, freely or equally.
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @param {Object} options additional information for scaling
|
|
* @param {String} options.by 'x', 'y', 'equally' or '' to indicate type of scaling
|
|
* @return {Boolean} true if some change happened
|
|
* @private
|
|
*/
|
|
function scaleObject(eventData, transform, x, y, options) {
|
|
options = options || {};
|
|
var target = transform.target,
|
|
lockScalingX = target.lockScalingX, lockScalingY = target.lockScalingY,
|
|
by = options.by, newPoint, scaleX, scaleY, dim,
|
|
scaleProportionally = scaleIsProportional(eventData, target),
|
|
forbidScaling = scalingIsForbidden(target, by, scaleProportionally),
|
|
signX, signY, gestureScale = transform.gestureScale;
|
|
|
|
if (forbidScaling) {
|
|
return false;
|
|
}
|
|
if (gestureScale) {
|
|
scaleX = transform.scaleX * gestureScale;
|
|
scaleY = transform.scaleY * gestureScale;
|
|
}
|
|
else {
|
|
newPoint = getLocalPoint(transform, transform.originX, transform.originY, x, y);
|
|
// use of sign: We use sign to detect change of direction of an action. sign usually change when
|
|
// we cross the origin point with the mouse. So a scale flip for example. There is an issue when scaling
|
|
// by center and scaling using one middle control ( default: mr, mt, ml, mb), the mouse movement can easily
|
|
// cross many time the origin point and flip the object. so we need a way to filter out the noise.
|
|
// This ternary here should be ok to filter out X scaling when we want Y only and vice versa.
|
|
signX = by !== 'y' ? sign(newPoint.x) : 1;
|
|
signY = by !== 'x' ? sign(newPoint.y) : 1;
|
|
if (!transform.signX) {
|
|
transform.signX = signX;
|
|
}
|
|
if (!transform.signY) {
|
|
transform.signY = signY;
|
|
}
|
|
|
|
if (target.lockScalingFlip &&
|
|
(transform.signX !== signX || transform.signY !== signY)
|
|
) {
|
|
return false;
|
|
}
|
|
|
|
dim = target._getTransformedDimensions();
|
|
// missing detection of flip and logic to switch the origin
|
|
if (scaleProportionally && !by) {
|
|
// uniform scaling
|
|
var distance = Math.abs(newPoint.x) + Math.abs(newPoint.y),
|
|
original = transform.original,
|
|
originalDistance = Math.abs(dim.x * original.scaleX / target.scaleX) +
|
|
Math.abs(dim.y * original.scaleY / target.scaleY),
|
|
scale = distance / originalDistance;
|
|
scaleX = original.scaleX * scale;
|
|
scaleY = original.scaleY * scale;
|
|
}
|
|
else {
|
|
scaleX = Math.abs(newPoint.x * target.scaleX / dim.x);
|
|
scaleY = Math.abs(newPoint.y * target.scaleY / dim.y);
|
|
}
|
|
// if we are scaling by center, we need to double the scale
|
|
if (isTransformCentered(transform)) {
|
|
scaleX *= 2;
|
|
scaleY *= 2;
|
|
}
|
|
if (transform.signX !== signX && by !== 'y') {
|
|
transform.originX = opposite[transform.originX];
|
|
scaleX *= -1;
|
|
transform.signX = signX;
|
|
}
|
|
if (transform.signY !== signY && by !== 'x') {
|
|
transform.originY = opposite[transform.originY];
|
|
scaleY *= -1;
|
|
transform.signY = signY;
|
|
}
|
|
}
|
|
// minScale is taken are in the setter.
|
|
var oldScaleX = target.scaleX, oldScaleY = target.scaleY;
|
|
if (!by) {
|
|
!lockScalingX && target.set('scaleX', scaleX);
|
|
!lockScalingY && target.set('scaleY', scaleY);
|
|
}
|
|
else {
|
|
// forbidden cases already handled on top here.
|
|
by === 'x' && target.set('scaleX', scaleX);
|
|
by === 'y' && target.set('scaleY', scaleY);
|
|
}
|
|
return oldScaleX !== target.scaleX || oldScaleY !== target.scaleY;
|
|
}
|
|
|
|
/**
|
|
* Generic scaling logic, to scale from corners either equally or freely.
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function scaleObjectFromCorner(eventData, transform, x, y) {
|
|
return scaleObject(eventData, transform, x, y);
|
|
}
|
|
|
|
/**
|
|
* Scaling logic for the X axis.
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function scaleObjectX(eventData, transform, x, y) {
|
|
return scaleObject(eventData, transform, x, y , { by: 'x' });
|
|
}
|
|
|
|
/**
|
|
* Scaling logic for the Y axis.
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function scaleObjectY(eventData, transform, x, y) {
|
|
return scaleObject(eventData, transform, x, y , { by: 'y' });
|
|
}
|
|
|
|
/**
|
|
* Composed action handler to either scale Y or skew X
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function scalingYOrSkewingX(eventData, transform, x, y) {
|
|
// ok some safety needed here.
|
|
if (eventData[transform.target.canvas.altActionKey]) {
|
|
return controls.skewHandlerX(eventData, transform, x, y);
|
|
}
|
|
return controls.scalingY(eventData, transform, x, y);
|
|
}
|
|
|
|
/**
|
|
* Composed action handler to either scale X or skew Y
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function scalingXOrSkewingY(eventData, transform, x, y) {
|
|
// ok some safety needed here.
|
|
if (eventData[transform.target.canvas.altActionKey]) {
|
|
return controls.skewHandlerY(eventData, transform, x, y);
|
|
}
|
|
return controls.scalingX(eventData, transform, x, y);
|
|
}
|
|
|
|
/**
|
|
* Action handler to change textbox width
|
|
* Needs to be wrapped with `wrapWithFixedAnchor` to be effective
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if some change happened
|
|
*/
|
|
function changeWidth(eventData, transform, x, y) {
|
|
var target = transform.target, localPoint = getLocalPoint(transform, transform.originX, transform.originY, x, y),
|
|
strokePadding = target.strokeWidth / (target.strokeUniform ? target.scaleX : 1),
|
|
multiplier = isTransformCentered(transform) ? 2 : 1,
|
|
oldWidth = target.width,
|
|
newWidth = Math.abs(localPoint.x * multiplier / target.scaleX) - strokePadding;
|
|
target.set('width', Math.max(newWidth, 0));
|
|
return oldWidth !== newWidth;
|
|
}
|
|
|
|
/**
|
|
* Action handler
|
|
* @private
|
|
* @param {Event} eventData javascript event that is doing the transform
|
|
* @param {Object} transform javascript object containing a series of information around the current transform
|
|
* @param {number} x current mouse x position, canvas normalized
|
|
* @param {number} y current mouse y position, canvas normalized
|
|
* @return {Boolean} true if the translation occurred
|
|
*/
|
|
function dragHandler(eventData, transform, x, y) {
|
|
var target = transform.target,
|
|
newLeft = x - transform.offsetX,
|
|
newTop = y - transform.offsetY,
|
|
moveX = !target.get('lockMovementX') && target.left !== newLeft,
|
|
moveY = !target.get('lockMovementY') && target.top !== newTop;
|
|
moveX && target.set('left', newLeft);
|
|
moveY && target.set('top', newTop);
|
|
if (moveX || moveY) {
|
|
fireEvent('moving', commonEventInfo(eventData, transform, x, y));
|
|
}
|
|
return moveX || moveY;
|
|
}
|
|
|
|
controls.scaleCursorStyleHandler = scaleCursorStyleHandler;
|
|
controls.skewCursorStyleHandler = skewCursorStyleHandler;
|
|
controls.scaleSkewCursorStyleHandler = scaleSkewCursorStyleHandler;
|
|
controls.rotationWithSnapping = wrapWithFireEvent('rotating', wrapWithFixedAnchor(rotationWithSnapping));
|
|
controls.scalingEqually = wrapWithFireEvent('scaling', wrapWithFixedAnchor( scaleObjectFromCorner));
|
|
controls.scalingX = wrapWithFireEvent('scaling', wrapWithFixedAnchor(scaleObjectX));
|
|
controls.scalingY = wrapWithFireEvent('scaling', wrapWithFixedAnchor(scaleObjectY));
|
|
controls.scalingYOrSkewingX = scalingYOrSkewingX;
|
|
controls.scalingXOrSkewingY = scalingXOrSkewingY;
|
|
controls.changeWidth = wrapWithFireEvent('resizing', wrapWithFixedAnchor(changeWidth));
|
|
controls.skewHandlerX = skewHandlerX;
|
|
controls.skewHandlerY = skewHandlerY;
|
|
controls.dragHandler = dragHandler;
|
|
controls.scaleOrSkewActionName = scaleOrSkewActionName;
|
|
controls.rotationStyleHandler = rotationStyleHandler;
|
|
controls.fireEvent = fireEvent;
|
|
controls.wrapWithFixedAnchor = wrapWithFixedAnchor;
|
|
controls.wrapWithFireEvent = wrapWithFireEvent;
|
|
controls.getLocalPoint = getLocalPoint;
|
|
fabric.controlsUtils = controls;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
degreesToRadians = fabric.util.degreesToRadians,
|
|
controls = fabric.controlsUtils;
|
|
|
|
/**
|
|
* Render a round control, as per fabric features.
|
|
* This function is written to respect object properties like transparentCorners, cornerSize
|
|
* cornerColor, cornerStrokeColor
|
|
* plus the addition of offsetY and offsetX.
|
|
* @param {CanvasRenderingContext2D} ctx context to render on
|
|
* @param {Number} left x coordinate where the control center should be
|
|
* @param {Number} top y coordinate where the control center should be
|
|
* @param {Object} styleOverride override for fabric.Object controls style
|
|
* @param {fabric.Object} fabricObject the fabric object for which we are rendering controls
|
|
*/
|
|
function renderCircleControl (ctx, left, top, styleOverride, fabricObject) {
|
|
styleOverride = styleOverride || {};
|
|
var xSize = this.sizeX || styleOverride.cornerSize || fabricObject.cornerSize,
|
|
ySize = this.sizeY || styleOverride.cornerSize || fabricObject.cornerSize,
|
|
transparentCorners = typeof styleOverride.transparentCorners !== 'undefined' ?
|
|
styleOverride.transparentCorners : fabricObject.transparentCorners,
|
|
methodName = transparentCorners ? 'stroke' : 'fill',
|
|
stroke = !transparentCorners && (styleOverride.cornerStrokeColor || fabricObject.cornerStrokeColor),
|
|
myLeft = left,
|
|
myTop = top, size;
|
|
ctx.save();
|
|
ctx.fillStyle = styleOverride.cornerColor || fabricObject.cornerColor;
|
|
ctx.strokeStyle = styleOverride.cornerStrokeColor || fabricObject.cornerStrokeColor;
|
|
// as soon as fabric react v5, remove ie11, use proper ellipse code.
|
|
if (xSize > ySize) {
|
|
size = xSize;
|
|
ctx.scale(1.0, ySize / xSize);
|
|
myTop = top * xSize / ySize;
|
|
}
|
|
else if (ySize > xSize) {
|
|
size = ySize;
|
|
ctx.scale(xSize / ySize, 1.0);
|
|
myLeft = left * ySize / xSize;
|
|
}
|
|
else {
|
|
size = xSize;
|
|
}
|
|
// this is still wrong
|
|
ctx.lineWidth = 1;
|
|
ctx.beginPath();
|
|
ctx.arc(myLeft, myTop, size / 2, 0, 2 * Math.PI, false);
|
|
ctx[methodName]();
|
|
if (stroke) {
|
|
ctx.stroke();
|
|
}
|
|
ctx.restore();
|
|
}
|
|
|
|
/**
|
|
* Render a square control, as per fabric features.
|
|
* This function is written to respect object properties like transparentCorners, cornerSize
|
|
* cornerColor, cornerStrokeColor
|
|
* plus the addition of offsetY and offsetX.
|
|
* @param {CanvasRenderingContext2D} ctx context to render on
|
|
* @param {Number} left x coordinate where the control center should be
|
|
* @param {Number} top y coordinate where the control center should be
|
|
* @param {Object} styleOverride override for fabric.Object controls style
|
|
* @param {fabric.Object} fabricObject the fabric object for which we are rendering controls
|
|
*/
|
|
function renderSquareControl(ctx, left, top, styleOverride, fabricObject) {
|
|
styleOverride = styleOverride || {};
|
|
var xSize = this.sizeX || styleOverride.cornerSize || fabricObject.cornerSize,
|
|
ySize = this.sizeY || styleOverride.cornerSize || fabricObject.cornerSize,
|
|
transparentCorners = typeof styleOverride.transparentCorners !== 'undefined' ?
|
|
styleOverride.transparentCorners : fabricObject.transparentCorners,
|
|
methodName = transparentCorners ? 'stroke' : 'fill',
|
|
stroke = !transparentCorners && (
|
|
styleOverride.cornerStrokeColor || fabricObject.cornerStrokeColor
|
|
), xSizeBy2 = xSize / 2, ySizeBy2 = ySize / 2;
|
|
ctx.save();
|
|
ctx.fillStyle = styleOverride.cornerColor || fabricObject.cornerColor;
|
|
ctx.strokeStyle = styleOverride.cornerStrokeColor || fabricObject.cornerStrokeColor;
|
|
// this is still wrong
|
|
ctx.lineWidth = 1;
|
|
ctx.translate(left, top);
|
|
ctx.rotate(degreesToRadians(fabricObject.angle));
|
|
// this does not work, and fixed with ( && ) does not make sense.
|
|
// to have real transparent corners we need the controls on upperCanvas
|
|
// transparentCorners || ctx.clearRect(-xSizeBy2, -ySizeBy2, xSize, ySize);
|
|
ctx[methodName + 'Rect'](-xSizeBy2, -ySizeBy2, xSize, ySize);
|
|
if (stroke) {
|
|
ctx.strokeRect(-xSizeBy2, -ySizeBy2, xSize, ySize);
|
|
}
|
|
ctx.restore();
|
|
}
|
|
|
|
controls.renderCircleControl = renderCircleControl;
|
|
controls.renderSquareControl = renderSquareControl;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
function Control(options) {
|
|
for (var i in options) {
|
|
this[i] = options[i];
|
|
}
|
|
}
|
|
|
|
fabric.Control = Control;
|
|
|
|
fabric.Control.prototype = /** @lends fabric.Control.prototype */ {
|
|
|
|
/**
|
|
* keep track of control visibility.
|
|
* mainly for backward compatibility.
|
|
* if you do not want to see a control, you can remove it
|
|
* from the controlset.
|
|
* @type {Boolean}
|
|
* @default true
|
|
*/
|
|
visible: true,
|
|
|
|
/**
|
|
* Name of the action that the control will likely execute.
|
|
* This is optional. FabricJS uses to identify what the user is doing for some
|
|
* extra optimizations. If you are writing a custom control and you want to know
|
|
* somewhere else in the code what is going on, you can use this string here.
|
|
* you can also provide a custom getActionName if your control run multiple actions
|
|
* depending on some external state.
|
|
* default to scale since is the most common, used on 4 corners by default
|
|
* @type {String}
|
|
* @default 'scale'
|
|
*/
|
|
actionName: 'scale',
|
|
|
|
/**
|
|
* Drawing angle of the control.
|
|
* NOT used for now, but name marked as needed for internal logic
|
|
* example: to reuse the same drawing function for different rotated controls
|
|
* @type {Number}
|
|
* @default 0
|
|
*/
|
|
angle: 0,
|
|
|
|
/**
|
|
* Relative position of the control. X
|
|
* 0,0 is the center of the Object, while -0.5 (left) or 0.5 (right) are the extremities
|
|
* of the bounding box.
|
|
* @type {Number}
|
|
* @default 0
|
|
*/
|
|
x: 0,
|
|
|
|
/**
|
|
* Relative position of the control. Y
|
|
* 0,0 is the center of the Object, while -0.5 (top) or 0.5 (bottom) are the extremities
|
|
* of the bounding box.
|
|
* @type {Number}
|
|
* @default 0
|
|
*/
|
|
y: 0,
|
|
|
|
/**
|
|
* Horizontal offset of the control from the defined position. In pixels
|
|
* Positive offset moves the control to the right, negative to the left.
|
|
* It used when you want to have position of control that does not scale with
|
|
* the bounding box. Example: rotation control is placed at x:0, y: 0.5 on
|
|
* the boundindbox, with an offset of 30 pixels vertically. Those 30 pixels will
|
|
* stay 30 pixels no matter how the object is big. Another example is having 2
|
|
* controls in the corner, that stay in the same position when the object scale.
|
|
* of the bounding box.
|
|
* @type {Number}
|
|
* @default 0
|
|
*/
|
|
offsetX: 0,
|
|
|
|
/**
|
|
* Vertical offset of the control from the defined position. In pixels
|
|
* Positive offset moves the control to the bottom, negative to the top.
|
|
* @type {Number}
|
|
* @default 0
|
|
*/
|
|
offsetY: 0,
|
|
|
|
/**
|
|
* Sets the length of the control. If null, defaults to object's cornerSize.
|
|
* Expects both sizeX and sizeY to be set when set.
|
|
* @type {?Number}
|
|
* @default null
|
|
*/
|
|
sizeX: null,
|
|
|
|
/**
|
|
* Sets the height of the control. If null, defaults to object's cornerSize.
|
|
* Expects both sizeX and sizeY to be set when set.
|
|
* @type {?Number}
|
|
* @default null
|
|
*/
|
|
sizeY: null,
|
|
|
|
/**
|
|
* Sets the length of the touch area of the control. If null, defaults to object's touchCornerSize.
|
|
* Expects both touchSizeX and touchSizeY to be set when set.
|
|
* @type {?Number}
|
|
* @default null
|
|
*/
|
|
touchSizeX: null,
|
|
|
|
/**
|
|
* Sets the height of the touch area of the control. If null, defaults to object's touchCornerSize.
|
|
* Expects both touchSizeX and touchSizeY to be set when set.
|
|
* @type {?Number}
|
|
* @default null
|
|
*/
|
|
touchSizeY: null,
|
|
|
|
/**
|
|
* Css cursor style to display when the control is hovered.
|
|
* if the method `cursorStyleHandler` is provided, this property is ignored.
|
|
* @type {String}
|
|
* @default 'crosshair'
|
|
*/
|
|
cursorStyle: 'crosshair',
|
|
|
|
/**
|
|
* If controls has an offsetY or offsetX, draw a line that connects
|
|
* the control to the bounding box
|
|
* @type {Boolean}
|
|
* @default false
|
|
*/
|
|
withConnection: false,
|
|
|
|
/**
|
|
* The control actionHandler, provide one to handle action ( control being moved )
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {Object} transformData properties of the current transform
|
|
* @param {Number} x x position of the cursor
|
|
* @param {Number} y y position of the cursor
|
|
* @return {Boolean} true if the action/event modified the object
|
|
*/
|
|
actionHandler: function(/* eventData, transformData, x, y */) { },
|
|
|
|
/**
|
|
* The control handler for mouse down, provide one to handle mouse down on control
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {Object} transformData properties of the current transform
|
|
* @param {Number} x x position of the cursor
|
|
* @param {Number} y y position of the cursor
|
|
* @return {Boolean} true if the action/event modified the object
|
|
*/
|
|
mouseDownHandler: function(/* eventData, transformData, x, y */) { },
|
|
|
|
/**
|
|
* The control mouseUpHandler, provide one to handle an effect on mouse up.
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {Object} transformData properties of the current transform
|
|
* @param {Number} x x position of the cursor
|
|
* @param {Number} y y position of the cursor
|
|
* @return {Boolean} true if the action/event modified the object
|
|
*/
|
|
mouseUpHandler: function(/* eventData, transformData, x, y */) { },
|
|
|
|
/**
|
|
* Returns control actionHandler
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {fabric.Object} fabricObject on which the control is displayed
|
|
* @param {fabric.Control} control control for which the action handler is being asked
|
|
* @return {Function} the action handler
|
|
*/
|
|
getActionHandler: function(/* eventData, fabricObject, control */) {
|
|
return this.actionHandler;
|
|
},
|
|
|
|
/**
|
|
* Returns control mouseDown handler
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {fabric.Object} fabricObject on which the control is displayed
|
|
* @param {fabric.Control} control control for which the action handler is being asked
|
|
* @return {Function} the action handler
|
|
*/
|
|
getMouseDownHandler: function(/* eventData, fabricObject, control */) {
|
|
return this.mouseDownHandler;
|
|
},
|
|
|
|
/**
|
|
* Returns control mouseUp handler
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {fabric.Object} fabricObject on which the control is displayed
|
|
* @param {fabric.Control} control control for which the action handler is being asked
|
|
* @return {Function} the action handler
|
|
*/
|
|
getMouseUpHandler: function(/* eventData, fabricObject, control */) {
|
|
return this.mouseUpHandler;
|
|
},
|
|
|
|
/**
|
|
* Returns control cursorStyle for css using cursorStyle. If you need a more elaborate
|
|
* function you can pass one in the constructor
|
|
* the cursorStyle property
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {fabric.Control} control the current control ( likely this)
|
|
* @param {fabric.Object} object on which the control is displayed
|
|
* @return {String}
|
|
*/
|
|
cursorStyleHandler: function(eventData, control /* fabricObject */) {
|
|
return control.cursorStyle;
|
|
},
|
|
|
|
/**
|
|
* Returns the action name. The basic implementation just return the actionName property.
|
|
* @param {Event} eventData the native mouse event
|
|
* @param {fabric.Control} control the current control ( likely this)
|
|
* @param {fabric.Object} object on which the control is displayed
|
|
* @return {String}
|
|
*/
|
|
getActionName: function(eventData, control /* fabricObject */) {
|
|
return control.actionName;
|
|
},
|
|
|
|
/**
|
|
* Returns controls visibility
|
|
* @param {fabric.Object} object on which the control is displayed
|
|
* @param {String} controlKey key where the control is memorized on the
|
|
* @return {Boolean}
|
|
*/
|
|
getVisibility: function(fabricObject, controlKey) {
|
|
var objectVisibility = fabricObject._controlsVisibility;
|
|
if (objectVisibility && typeof objectVisibility[controlKey] !== 'undefined') {
|
|
return objectVisibility[controlKey];
|
|
}
|
|
return this.visible;
|
|
},
|
|
|
|
/**
|
|
* Sets controls visibility
|
|
* @param {Boolean} visibility for the object
|
|
* @return {Void}
|
|
*/
|
|
setVisibility: function(visibility /* name, fabricObject */) {
|
|
this.visible = visibility;
|
|
},
|
|
|
|
|
|
positionHandler: function(dim, finalMatrix /*, fabricObject, currentControl */) {
|
|
var point = fabric.util.transformPoint({
|
|
x: this.x * dim.x + this.offsetX,
|
|
y: this.y * dim.y + this.offsetY }, finalMatrix);
|
|
return point;
|
|
},
|
|
|
|
/**
|
|
* Returns the coords for this control based on object values.
|
|
* @param {Number} objectAngle angle from the fabric object holding the control
|
|
* @param {Number} objectCornerSize cornerSize from the fabric object holding the control (or touchCornerSize if
|
|
* isTouch is true)
|
|
* @param {Number} centerX x coordinate where the control center should be
|
|
* @param {Number} centerY y coordinate where the control center should be
|
|
* @param {boolean} isTouch true if touch corner, false if normal corner
|
|
*/
|
|
calcCornerCoords: function(objectAngle, objectCornerSize, centerX, centerY, isTouch) {
|
|
var cosHalfOffset,
|
|
sinHalfOffset,
|
|
cosHalfOffsetComp,
|
|
sinHalfOffsetComp,
|
|
xSize = (isTouch) ? this.touchSizeX : this.sizeX,
|
|
ySize = (isTouch) ? this.touchSizeY : this.sizeY;
|
|
if (xSize && ySize && xSize !== ySize) {
|
|
// handle rectangular corners
|
|
var controlTriangleAngle = Math.atan2(ySize, xSize);
|
|
var cornerHypotenuse = Math.sqrt(xSize * xSize + ySize * ySize) / 2;
|
|
var newTheta = controlTriangleAngle - fabric.util.degreesToRadians(objectAngle);
|
|
var newThetaComp = Math.PI / 2 - controlTriangleAngle - fabric.util.degreesToRadians(objectAngle);
|
|
cosHalfOffset = cornerHypotenuse * fabric.util.cos(newTheta);
|
|
sinHalfOffset = cornerHypotenuse * fabric.util.sin(newTheta);
|
|
// use complementary angle for two corners
|
|
cosHalfOffsetComp = cornerHypotenuse * fabric.util.cos(newThetaComp);
|
|
sinHalfOffsetComp = cornerHypotenuse * fabric.util.sin(newThetaComp);
|
|
}
|
|
else {
|
|
// handle square corners
|
|
// use default object corner size unless size is defined
|
|
var cornerSize = (xSize && ySize) ? xSize : objectCornerSize;
|
|
/* 0.7071067812 stands for sqrt(2)/2 */
|
|
cornerHypotenuse = cornerSize * 0.7071067812;
|
|
// complementary angles are equal since they're both 45 degrees
|
|
var newTheta = fabric.util.degreesToRadians(45 - objectAngle);
|
|
cosHalfOffset = cosHalfOffsetComp = cornerHypotenuse * fabric.util.cos(newTheta);
|
|
sinHalfOffset = sinHalfOffsetComp = cornerHypotenuse * fabric.util.sin(newTheta);
|
|
}
|
|
|
|
return {
|
|
tl: {
|
|
x: centerX - sinHalfOffsetComp,
|
|
y: centerY - cosHalfOffsetComp,
|
|
},
|
|
tr: {
|
|
x: centerX + cosHalfOffset,
|
|
y: centerY - sinHalfOffset,
|
|
},
|
|
bl: {
|
|
x: centerX - cosHalfOffset,
|
|
y: centerY + sinHalfOffset,
|
|
},
|
|
br: {
|
|
x: centerX + sinHalfOffsetComp,
|
|
y: centerY + cosHalfOffsetComp,
|
|
},
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Render function for the control.
|
|
* When this function runs the context is unscaled. unrotate. Just retina scaled.
|
|
* all the functions will have to translate to the point left,top before starting Drawing
|
|
* if they want to draw a control where the position is detected.
|
|
* left and top are the result of the positionHandler function
|
|
* @param {RenderingContext2D} ctx the context where the control will be drawn
|
|
* @param {Number} left position of the canvas where we are about to render the control.
|
|
* @param {Number} top position of the canvas where we are about to render the control.
|
|
* @param {Object} styleOverride
|
|
* @param {fabric.Object} fabricObject the object where the control is about to be rendered
|
|
*/
|
|
render: function(ctx, left, top, styleOverride, fabricObject) {
|
|
styleOverride = styleOverride || {};
|
|
switch (styleOverride.cornerStyle || fabricObject.cornerStyle) {
|
|
case 'circle':
|
|
fabric.controlsUtils.renderCircleControl.call(this, ctx, left, top, styleOverride, fabricObject);
|
|
break;
|
|
default:
|
|
fabric.controlsUtils.renderSquareControl.call(this, ctx, left, top, styleOverride, fabricObject);
|
|
}
|
|
},
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function() {
|
|
|
|
/* _FROM_SVG_START_ */
|
|
function getColorStop(el, multiplier) {
|
|
var style = el.getAttribute('style'),
|
|
offset = el.getAttribute('offset') || 0,
|
|
color, colorAlpha, opacity, i;
|
|
|
|
// convert percents to absolute values
|
|
offset = parseFloat(offset) / (/%$/.test(offset) ? 100 : 1);
|
|
offset = offset < 0 ? 0 : offset > 1 ? 1 : offset;
|
|
if (style) {
|
|
var keyValuePairs = style.split(/\s*;\s*/);
|
|
|
|
if (keyValuePairs[keyValuePairs.length - 1] === '') {
|
|
keyValuePairs.pop();
|
|
}
|
|
|
|
for (i = keyValuePairs.length; i--; ) {
|
|
|
|
var split = keyValuePairs[i].split(/\s*:\s*/),
|
|
key = split[0].trim(),
|
|
value = split[1].trim();
|
|
|
|
if (key === 'stop-color') {
|
|
color = value;
|
|
}
|
|
else if (key === 'stop-opacity') {
|
|
opacity = value;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (!color) {
|
|
color = el.getAttribute('stop-color') || 'rgb(0,0,0)';
|
|
}
|
|
if (!opacity) {
|
|
opacity = el.getAttribute('stop-opacity');
|
|
}
|
|
|
|
color = new fabric.Color(color);
|
|
colorAlpha = color.getAlpha();
|
|
opacity = isNaN(parseFloat(opacity)) ? 1 : parseFloat(opacity);
|
|
opacity *= colorAlpha * multiplier;
|
|
|
|
return {
|
|
offset: offset,
|
|
color: color.toRgb(),
|
|
opacity: opacity
|
|
};
|
|
}
|
|
|
|
function getLinearCoords(el) {
|
|
return {
|
|
x1: el.getAttribute('x1') || 0,
|
|
y1: el.getAttribute('y1') || 0,
|
|
x2: el.getAttribute('x2') || '100%',
|
|
y2: el.getAttribute('y2') || 0
|
|
};
|
|
}
|
|
|
|
function getRadialCoords(el) {
|
|
return {
|
|
x1: el.getAttribute('fx') || el.getAttribute('cx') || '50%',
|
|
y1: el.getAttribute('fy') || el.getAttribute('cy') || '50%',
|
|
r1: 0,
|
|
x2: el.getAttribute('cx') || '50%',
|
|
y2: el.getAttribute('cy') || '50%',
|
|
r2: el.getAttribute('r') || '50%'
|
|
};
|
|
}
|
|
/* _FROM_SVG_END_ */
|
|
|
|
var clone = fabric.util.object.clone;
|
|
|
|
/**
|
|
* Gradient class
|
|
* @class fabric.Gradient
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-2#gradients}
|
|
* @see {@link fabric.Gradient#initialize} for constructor definition
|
|
*/
|
|
fabric.Gradient = fabric.util.createClass(/** @lends fabric.Gradient.prototype */ {
|
|
|
|
/**
|
|
* Horizontal offset for aligning gradients coming from SVG when outside pathgroups
|
|
* @type Number
|
|
* @default 0
|
|
*/
|
|
offsetX: 0,
|
|
|
|
/**
|
|
* Vertical offset for aligning gradients coming from SVG when outside pathgroups
|
|
* @type Number
|
|
* @default 0
|
|
*/
|
|
offsetY: 0,
|
|
|
|
/**
|
|
* A transform matrix to apply to the gradient before painting.
|
|
* Imported from svg gradients, is not applied with the current transform in the center.
|
|
* Before this transform is applied, the origin point is at the top left corner of the object
|
|
* plus the addition of offsetY and offsetX.
|
|
* @type Number[]
|
|
* @default null
|
|
*/
|
|
gradientTransform: null,
|
|
|
|
/**
|
|
* coordinates units for coords.
|
|
* If `pixels`, the number of coords are in the same unit of width / height.
|
|
* If set as `percentage` the coords are still a number, but 1 means 100% of width
|
|
* for the X and 100% of the height for the y. It can be bigger than 1 and negative.
|
|
* allowed values pixels or percentage.
|
|
* @type String
|
|
* @default 'pixels'
|
|
*/
|
|
gradientUnits: 'pixels',
|
|
|
|
/**
|
|
* Gradient type linear or radial
|
|
* @type String
|
|
* @default 'pixels'
|
|
*/
|
|
type: 'linear',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} options Options object with type, coords, gradientUnits and colorStops
|
|
* @param {Object} [options.type] gradient type linear or radial
|
|
* @param {Object} [options.gradientUnits] gradient units
|
|
* @param {Object} [options.offsetX] SVG import compatibility
|
|
* @param {Object} [options.offsetY] SVG import compatibility
|
|
* @param {Object[]} options.colorStops contains the colorstops.
|
|
* @param {Object} options.coords contains the coords of the gradient
|
|
* @param {Number} [options.coords.x1] X coordiante of the first point for linear or of the focal point for radial
|
|
* @param {Number} [options.coords.y1] Y coordiante of the first point for linear or of the focal point for radial
|
|
* @param {Number} [options.coords.x2] X coordiante of the second point for linear or of the center point for radial
|
|
* @param {Number} [options.coords.y2] Y coordiante of the second point for linear or of the center point for radial
|
|
* @param {Number} [options.coords.r1] only for radial gradient, radius of the inner circle
|
|
* @param {Number} [options.coords.r2] only for radial gradient, radius of the external circle
|
|
* @return {fabric.Gradient} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
options || (options = { });
|
|
options.coords || (options.coords = { });
|
|
|
|
var coords, _this = this;
|
|
|
|
// sets everything, then coords and colorstops get sets again
|
|
Object.keys(options).forEach(function(option) {
|
|
_this[option] = options[option];
|
|
});
|
|
|
|
if (this.id) {
|
|
this.id += '_' + fabric.Object.__uid++;
|
|
}
|
|
else {
|
|
this.id = fabric.Object.__uid++;
|
|
}
|
|
|
|
coords = {
|
|
x1: options.coords.x1 || 0,
|
|
y1: options.coords.y1 || 0,
|
|
x2: options.coords.x2 || 0,
|
|
y2: options.coords.y2 || 0
|
|
};
|
|
|
|
if (this.type === 'radial') {
|
|
coords.r1 = options.coords.r1 || 0;
|
|
coords.r2 = options.coords.r2 || 0;
|
|
}
|
|
|
|
this.coords = coords;
|
|
this.colorStops = options.colorStops.slice();
|
|
},
|
|
|
|
/**
|
|
* Adds another colorStop
|
|
* @param {Object} colorStop Object with offset and color
|
|
* @return {fabric.Gradient} thisArg
|
|
*/
|
|
addColorStop: function(colorStops) {
|
|
for (var position in colorStops) {
|
|
var color = new fabric.Color(colorStops[position]);
|
|
this.colorStops.push({
|
|
offset: parseFloat(position),
|
|
color: color.toRgb(),
|
|
opacity: color.getAlpha()
|
|
});
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of a gradient
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object}
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
var object = {
|
|
type: this.type,
|
|
coords: this.coords,
|
|
colorStops: this.colorStops,
|
|
offsetX: this.offsetX,
|
|
offsetY: this.offsetY,
|
|
gradientUnits: this.gradientUnits,
|
|
gradientTransform: this.gradientTransform ? this.gradientTransform.concat() : this.gradientTransform
|
|
};
|
|
fabric.util.populateWithProperties(this, object, propertiesToInclude);
|
|
|
|
return object;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of an gradient
|
|
* @param {Object} object Object to create a gradient for
|
|
* @return {String} SVG representation of an gradient (linear/radial)
|
|
*/
|
|
toSVG: function(object, options) {
|
|
var coords = clone(this.coords, true), i, len, options = options || {},
|
|
markup, commonAttributes, colorStops = clone(this.colorStops, true),
|
|
needsSwap = coords.r1 > coords.r2,
|
|
transform = this.gradientTransform ? this.gradientTransform.concat() : fabric.iMatrix.concat(),
|
|
offsetX = -this.offsetX, offsetY = -this.offsetY,
|
|
withViewport = !!options.additionalTransform,
|
|
gradientUnits = this.gradientUnits === 'pixels' ? 'userSpaceOnUse' : 'objectBoundingBox';
|
|
// colorStops must be sorted ascending
|
|
colorStops.sort(function(a, b) {
|
|
return a.offset - b.offset;
|
|
});
|
|
|
|
if (gradientUnits === 'objectBoundingBox') {
|
|
offsetX /= object.width;
|
|
offsetY /= object.height;
|
|
}
|
|
else {
|
|
offsetX += object.width / 2;
|
|
offsetY += object.height / 2;
|
|
}
|
|
if (object.type === 'path' && this.gradientUnits !== 'percentage') {
|
|
offsetX -= object.pathOffset.x;
|
|
offsetY -= object.pathOffset.y;
|
|
}
|
|
|
|
|
|
transform[4] -= offsetX;
|
|
transform[5] -= offsetY;
|
|
|
|
commonAttributes = 'id="SVGID_' + this.id +
|
|
'" gradientUnits="' + gradientUnits + '"';
|
|
commonAttributes += ' gradientTransform="' + (withViewport ?
|
|
options.additionalTransform + ' ' : '') + fabric.util.matrixToSVG(transform) + '" ';
|
|
|
|
if (this.type === 'linear') {
|
|
markup = [
|
|
'<linearGradient ',
|
|
commonAttributes,
|
|
' x1="', coords.x1,
|
|
'" y1="', coords.y1,
|
|
'" x2="', coords.x2,
|
|
'" y2="', coords.y2,
|
|
'">\n'
|
|
];
|
|
}
|
|
else if (this.type === 'radial') {
|
|
// svg radial gradient has just 1 radius. the biggest.
|
|
markup = [
|
|
'<radialGradient ',
|
|
commonAttributes,
|
|
' cx="', needsSwap ? coords.x1 : coords.x2,
|
|
'" cy="', needsSwap ? coords.y1 : coords.y2,
|
|
'" r="', needsSwap ? coords.r1 : coords.r2,
|
|
'" fx="', needsSwap ? coords.x2 : coords.x1,
|
|
'" fy="', needsSwap ? coords.y2 : coords.y1,
|
|
'">\n'
|
|
];
|
|
}
|
|
|
|
if (this.type === 'radial') {
|
|
if (needsSwap) {
|
|
// svg goes from internal to external radius. if radius are inverted, swap color stops.
|
|
colorStops = colorStops.concat();
|
|
colorStops.reverse();
|
|
for (i = 0, len = colorStops.length; i < len; i++) {
|
|
colorStops[i].offset = 1 - colorStops[i].offset;
|
|
}
|
|
}
|
|
var minRadius = Math.min(coords.r1, coords.r2);
|
|
if (minRadius > 0) {
|
|
// i have to shift all colorStops and add new one in 0.
|
|
var maxRadius = Math.max(coords.r1, coords.r2),
|
|
percentageShift = minRadius / maxRadius;
|
|
for (i = 0, len = colorStops.length; i < len; i++) {
|
|
colorStops[i].offset += percentageShift * (1 - colorStops[i].offset);
|
|
}
|
|
}
|
|
}
|
|
|
|
for (i = 0, len = colorStops.length; i < len; i++) {
|
|
var colorStop = colorStops[i];
|
|
markup.push(
|
|
'<stop ',
|
|
'offset="', (colorStop.offset * 100) + '%',
|
|
'" style="stop-color:', colorStop.color,
|
|
(typeof colorStop.opacity !== 'undefined' ? ';stop-opacity: ' + colorStop.opacity : ';'),
|
|
'"/>\n'
|
|
);
|
|
}
|
|
|
|
markup.push((this.type === 'linear' ? '</linearGradient>\n' : '</radialGradient>\n'));
|
|
|
|
return markup.join('');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns an instance of CanvasGradient
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @return {CanvasGradient}
|
|
*/
|
|
toLive: function(ctx) {
|
|
var gradient, coords = fabric.util.object.clone(this.coords), i, len;
|
|
|
|
if (!this.type) {
|
|
return;
|
|
}
|
|
|
|
if (this.type === 'linear') {
|
|
gradient = ctx.createLinearGradient(
|
|
coords.x1, coords.y1, coords.x2, coords.y2);
|
|
}
|
|
else if (this.type === 'radial') {
|
|
gradient = ctx.createRadialGradient(
|
|
coords.x1, coords.y1, coords.r1, coords.x2, coords.y2, coords.r2);
|
|
}
|
|
|
|
for (i = 0, len = this.colorStops.length; i < len; i++) {
|
|
var color = this.colorStops[i].color,
|
|
opacity = this.colorStops[i].opacity,
|
|
offset = this.colorStops[i].offset;
|
|
|
|
if (typeof opacity !== 'undefined') {
|
|
color = new fabric.Color(color).setAlpha(opacity).toRgba();
|
|
}
|
|
gradient.addColorStop(offset, color);
|
|
}
|
|
|
|
return gradient;
|
|
}
|
|
});
|
|
|
|
fabric.util.object.extend(fabric.Gradient, {
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* Returns {@link fabric.Gradient} instance from an SVG element
|
|
* @static
|
|
* @memberOf fabric.Gradient
|
|
* @param {SVGGradientElement} el SVG gradient element
|
|
* @param {fabric.Object} instance
|
|
* @param {String} opacityAttr A fill-opacity or stroke-opacity attribute to multiply to each stop's opacity.
|
|
* @param {Object} svgOptions an object containing the size of the SVG in order to parse correctly gradients
|
|
* that uses gradientUnits as 'userSpaceOnUse' and percentages.
|
|
* @param {Object.number} viewBoxWidth width part of the viewBox attribute on svg
|
|
* @param {Object.number} viewBoxHeight height part of the viewBox attribute on svg
|
|
* @param {Object.number} width width part of the svg tag if viewBox is not specified
|
|
* @param {Object.number} height height part of the svg tag if viewBox is not specified
|
|
* @return {fabric.Gradient} Gradient instance
|
|
* @see http://www.w3.org/TR/SVG/pservers.html#LinearGradientElement
|
|
* @see http://www.w3.org/TR/SVG/pservers.html#RadialGradientElement
|
|
*/
|
|
fromElement: function(el, instance, opacityAttr, svgOptions) {
|
|
/**
|
|
* @example:
|
|
*
|
|
* <linearGradient id="linearGrad1">
|
|
* <stop offset="0%" stop-color="white"/>
|
|
* <stop offset="100%" stop-color="black"/>
|
|
* </linearGradient>
|
|
*
|
|
* OR
|
|
*
|
|
* <linearGradient id="linearGrad2">
|
|
* <stop offset="0" style="stop-color:rgb(255,255,255)"/>
|
|
* <stop offset="1" style="stop-color:rgb(0,0,0)"/>
|
|
* </linearGradient>
|
|
*
|
|
* OR
|
|
*
|
|
* <radialGradient id="radialGrad1">
|
|
* <stop offset="0%" stop-color="white" stop-opacity="1" />
|
|
* <stop offset="50%" stop-color="black" stop-opacity="0.5" />
|
|
* <stop offset="100%" stop-color="white" stop-opacity="1" />
|
|
* </radialGradient>
|
|
*
|
|
* OR
|
|
*
|
|
* <radialGradient id="radialGrad2">
|
|
* <stop offset="0" stop-color="rgb(255,255,255)" />
|
|
* <stop offset="0.5" stop-color="rgb(0,0,0)" />
|
|
* <stop offset="1" stop-color="rgb(255,255,255)" />
|
|
* </radialGradient>
|
|
*
|
|
*/
|
|
|
|
var multiplier = parseFloat(opacityAttr) / (/%$/.test(opacityAttr) ? 100 : 1);
|
|
multiplier = multiplier < 0 ? 0 : multiplier > 1 ? 1 : multiplier;
|
|
if (isNaN(multiplier)) {
|
|
multiplier = 1;
|
|
}
|
|
|
|
var colorStopEls = el.getElementsByTagName('stop'),
|
|
type,
|
|
gradientUnits = el.getAttribute('gradientUnits') === 'userSpaceOnUse' ?
|
|
'pixels' : 'percentage',
|
|
gradientTransform = el.getAttribute('gradientTransform') || '',
|
|
colorStops = [],
|
|
coords, i, offsetX = 0, offsetY = 0,
|
|
transformMatrix;
|
|
if (el.nodeName === 'linearGradient' || el.nodeName === 'LINEARGRADIENT') {
|
|
type = 'linear';
|
|
coords = getLinearCoords(el);
|
|
}
|
|
else {
|
|
type = 'radial';
|
|
coords = getRadialCoords(el);
|
|
}
|
|
|
|
for (i = colorStopEls.length; i--; ) {
|
|
colorStops.push(getColorStop(colorStopEls[i], multiplier));
|
|
}
|
|
|
|
transformMatrix = fabric.parseTransformAttribute(gradientTransform);
|
|
|
|
__convertPercentUnitsToValues(instance, coords, svgOptions, gradientUnits);
|
|
|
|
if (gradientUnits === 'pixels') {
|
|
offsetX = -instance.left;
|
|
offsetY = -instance.top;
|
|
}
|
|
|
|
var gradient = new fabric.Gradient({
|
|
id: el.getAttribute('id'),
|
|
type: type,
|
|
coords: coords,
|
|
colorStops: colorStops,
|
|
gradientUnits: gradientUnits,
|
|
gradientTransform: transformMatrix,
|
|
offsetX: offsetX,
|
|
offsetY: offsetY,
|
|
});
|
|
|
|
return gradient;
|
|
}
|
|
/* _FROM_SVG_END_ */
|
|
});
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function __convertPercentUnitsToValues(instance, options, svgOptions, gradientUnits) {
|
|
var propValue, finalValue;
|
|
Object.keys(options).forEach(function(prop) {
|
|
propValue = options[prop];
|
|
if (propValue === 'Infinity') {
|
|
finalValue = 1;
|
|
}
|
|
else if (propValue === '-Infinity') {
|
|
finalValue = 0;
|
|
}
|
|
else {
|
|
finalValue = parseFloat(options[prop], 10);
|
|
if (typeof propValue === 'string' && /^(\d+\.\d+)%|(\d+)%$/.test(propValue)) {
|
|
finalValue *= 0.01;
|
|
if (gradientUnits === 'pixels') {
|
|
// then we need to fix those percentages here in svg parsing
|
|
if (prop === 'x1' || prop === 'x2' || prop === 'r2') {
|
|
finalValue *= svgOptions.viewBoxWidth || svgOptions.width;
|
|
}
|
|
if (prop === 'y1' || prop === 'y2') {
|
|
finalValue *= svgOptions.viewBoxHeight || svgOptions.height;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
options[prop] = finalValue;
|
|
});
|
|
}
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
'use strict';
|
|
|
|
var toFixed = fabric.util.toFixed;
|
|
|
|
/**
|
|
* Pattern class
|
|
* @class fabric.Pattern
|
|
* @see {@link http://fabricjs.com/patterns|Pattern demo}
|
|
* @see {@link http://fabricjs.com/dynamic-patterns|DynamicPattern demo}
|
|
* @see {@link fabric.Pattern#initialize} for constructor definition
|
|
*/
|
|
|
|
|
|
fabric.Pattern = fabric.util.createClass(/** @lends fabric.Pattern.prototype */ {
|
|
|
|
/**
|
|
* Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
repeat: 'repeat',
|
|
|
|
/**
|
|
* Pattern horizontal offset from object's left/top corner
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
offsetX: 0,
|
|
|
|
/**
|
|
* Pattern vertical offset from object's left/top corner
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
offsetY: 0,
|
|
|
|
/**
|
|
* crossOrigin value (one of "", "anonymous", "use-credentials")
|
|
* @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes
|
|
* @type String
|
|
* @default
|
|
*/
|
|
crossOrigin: '',
|
|
|
|
/**
|
|
* transform matrix to change the pattern, imported from svgs.
|
|
* @type Array
|
|
* @default
|
|
*/
|
|
patternTransform: null,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
* @param {Function} [callback] function to invoke after callback init.
|
|
* @return {fabric.Pattern} thisArg
|
|
*/
|
|
initialize: function(options, callback) {
|
|
options || (options = { });
|
|
|
|
this.id = fabric.Object.__uid++;
|
|
this.setOptions(options);
|
|
if (!options.source || (options.source && typeof options.source !== 'string')) {
|
|
callback && callback(this);
|
|
return;
|
|
}
|
|
else {
|
|
// img src string
|
|
var _this = this;
|
|
this.source = fabric.util.createImage();
|
|
fabric.util.loadImage(options.source, function(img, isError) {
|
|
_this.source = img;
|
|
callback && callback(_this, isError);
|
|
}, null, this.crossOrigin);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of a pattern
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} Object representation of a pattern instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS,
|
|
source, object;
|
|
|
|
// <img> element
|
|
if (typeof this.source.src === 'string') {
|
|
source = this.source.src;
|
|
}
|
|
// <canvas> element
|
|
else if (typeof this.source === 'object' && this.source.toDataURL) {
|
|
source = this.source.toDataURL();
|
|
}
|
|
|
|
object = {
|
|
type: 'pattern',
|
|
source: source,
|
|
repeat: this.repeat,
|
|
crossOrigin: this.crossOrigin,
|
|
offsetX: toFixed(this.offsetX, NUM_FRACTION_DIGITS),
|
|
offsetY: toFixed(this.offsetY, NUM_FRACTION_DIGITS),
|
|
patternTransform: this.patternTransform ? this.patternTransform.concat() : null
|
|
};
|
|
fabric.util.populateWithProperties(this, object, propertiesToInclude);
|
|
|
|
return object;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of a pattern
|
|
* @param {fabric.Object} object
|
|
* @return {String} SVG representation of a pattern
|
|
*/
|
|
toSVG: function(object) {
|
|
var patternSource = typeof this.source === 'function' ? this.source() : this.source,
|
|
patternWidth = patternSource.width / object.width,
|
|
patternHeight = patternSource.height / object.height,
|
|
patternOffsetX = this.offsetX / object.width,
|
|
patternOffsetY = this.offsetY / object.height,
|
|
patternImgSrc = '';
|
|
if (this.repeat === 'repeat-x' || this.repeat === 'no-repeat') {
|
|
patternHeight = 1;
|
|
if (patternOffsetY) {
|
|
patternHeight += Math.abs(patternOffsetY);
|
|
}
|
|
}
|
|
if (this.repeat === 'repeat-y' || this.repeat === 'no-repeat') {
|
|
patternWidth = 1;
|
|
if (patternOffsetX) {
|
|
patternWidth += Math.abs(patternOffsetX);
|
|
}
|
|
|
|
}
|
|
if (patternSource.src) {
|
|
patternImgSrc = patternSource.src;
|
|
}
|
|
else if (patternSource.toDataURL) {
|
|
patternImgSrc = patternSource.toDataURL();
|
|
}
|
|
|
|
return '<pattern id="SVGID_' + this.id +
|
|
'" x="' + patternOffsetX +
|
|
'" y="' + patternOffsetY +
|
|
'" width="' + patternWidth +
|
|
'" height="' + patternHeight + '">\n' +
|
|
'<image x="0" y="0"' +
|
|
' width="' + patternSource.width +
|
|
'" height="' + patternSource.height +
|
|
'" xlink:href="' + patternImgSrc +
|
|
'"></image>\n' +
|
|
'</pattern>\n';
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
setOptions: function(options) {
|
|
for (var prop in options) {
|
|
this[prop] = options[prop];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns an instance of CanvasPattern
|
|
* @param {CanvasRenderingContext2D} ctx Context to create pattern
|
|
* @return {CanvasPattern}
|
|
*/
|
|
toLive: function(ctx) {
|
|
var source = this.source;
|
|
// if the image failed to load, return, and allow rest to continue loading
|
|
if (!source) {
|
|
return '';
|
|
}
|
|
|
|
// if an image
|
|
if (typeof source.src !== 'undefined') {
|
|
if (!source.complete) {
|
|
return '';
|
|
}
|
|
if (source.naturalWidth === 0 || source.naturalHeight === 0) {
|
|
return '';
|
|
}
|
|
}
|
|
return ctx.createPattern(source, this.repeat);
|
|
}
|
|
});
|
|
})();
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
toFixed = fabric.util.toFixed;
|
|
|
|
if (fabric.Shadow) {
|
|
fabric.warn('fabric.Shadow is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Shadow class
|
|
* @class fabric.Shadow
|
|
* @see {@link http://fabricjs.com/shadows|Shadow demo}
|
|
* @see {@link fabric.Shadow#initialize} for constructor definition
|
|
*/
|
|
fabric.Shadow = fabric.util.createClass(/** @lends fabric.Shadow.prototype */ {
|
|
|
|
/**
|
|
* Shadow color
|
|
* @type String
|
|
* @default
|
|
*/
|
|
color: 'rgb(0,0,0)',
|
|
|
|
/**
|
|
* Shadow blur
|
|
* @type Number
|
|
*/
|
|
blur: 0,
|
|
|
|
/**
|
|
* Shadow horizontal offset
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
offsetX: 0,
|
|
|
|
/**
|
|
* Shadow vertical offset
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
offsetY: 0,
|
|
|
|
/**
|
|
* Whether the shadow should affect stroke operations
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
affectStroke: false,
|
|
|
|
/**
|
|
* Indicates whether toObject should include default values
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
includeDefaultValues: true,
|
|
|
|
/**
|
|
* When `false`, the shadow will scale with the object.
|
|
* When `true`, the shadow's offsetX, offsetY, and blur will not be affected by the object's scale.
|
|
* default to false
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
nonScaling: false,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object|String} [options] Options object with any of color, blur, offsetX, offsetY properties or string (e.g. "rgba(0,0,0,0.2) 2px 2px 10px")
|
|
* @return {fabric.Shadow} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
|
|
if (typeof options === 'string') {
|
|
options = this._parseShadow(options);
|
|
}
|
|
|
|
for (var prop in options) {
|
|
this[prop] = options[prop];
|
|
}
|
|
|
|
this.id = fabric.Object.__uid++;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} shadow Shadow value to parse
|
|
* @return {Object} Shadow object with color, offsetX, offsetY and blur
|
|
*/
|
|
_parseShadow: function(shadow) {
|
|
var shadowStr = shadow.trim(),
|
|
offsetsAndBlur = fabric.Shadow.reOffsetsAndBlur.exec(shadowStr) || [],
|
|
color = shadowStr.replace(fabric.Shadow.reOffsetsAndBlur, '') || 'rgb(0,0,0)';
|
|
|
|
return {
|
|
color: color.trim(),
|
|
offsetX: parseFloat(offsetsAndBlur[1], 10) || 0,
|
|
offsetY: parseFloat(offsetsAndBlur[2], 10) || 0,
|
|
blur: parseFloat(offsetsAndBlur[3], 10) || 0
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns a string representation of an instance
|
|
* @see http://www.w3.org/TR/css-text-decor-3/#text-shadow
|
|
* @return {String} Returns CSS3 text-shadow declaration
|
|
*/
|
|
toString: function() {
|
|
return [this.offsetX, this.offsetY, this.blur, this.color].join('px ');
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns SVG representation of a shadow
|
|
* @param {fabric.Object} object
|
|
* @return {String} SVG representation of a shadow
|
|
*/
|
|
toSVG: function(object) {
|
|
var fBoxX = 40, fBoxY = 40, NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS,
|
|
offset = fabric.util.rotateVector(
|
|
{ x: this.offsetX, y: this.offsetY },
|
|
fabric.util.degreesToRadians(-object.angle)),
|
|
BLUR_BOX = 20, color = new fabric.Color(this.color);
|
|
|
|
if (object.width && object.height) {
|
|
//http://www.w3.org/TR/SVG/filters.html#FilterEffectsRegion
|
|
// we add some extra space to filter box to contain the blur ( 20 )
|
|
fBoxX = toFixed((Math.abs(offset.x) + this.blur) / object.width, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX;
|
|
fBoxY = toFixed((Math.abs(offset.y) + this.blur) / object.height, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX;
|
|
}
|
|
if (object.flipX) {
|
|
offset.x *= -1;
|
|
}
|
|
if (object.flipY) {
|
|
offset.y *= -1;
|
|
}
|
|
|
|
return (
|
|
'<filter id="SVGID_' + this.id + '" y="-' + fBoxY + '%" height="' + (100 + 2 * fBoxY) + '%" ' +
|
|
'x="-' + fBoxX + '%" width="' + (100 + 2 * fBoxX) + '%" ' + '>\n' +
|
|
'\t<feGaussianBlur in="SourceAlpha" stdDeviation="' +
|
|
toFixed(this.blur ? this.blur / 2 : 0, NUM_FRACTION_DIGITS) + '"></feGaussianBlur>\n' +
|
|
'\t<feOffset dx="' + toFixed(offset.x, NUM_FRACTION_DIGITS) +
|
|
'" dy="' + toFixed(offset.y, NUM_FRACTION_DIGITS) + '" result="oBlur" ></feOffset>\n' +
|
|
'\t<feFlood flood-color="' + color.toRgb() + '" flood-opacity="' + color.getAlpha() + '"/>\n' +
|
|
'\t<feComposite in2="oBlur" operator="in" />\n' +
|
|
'\t<feMerge>\n' +
|
|
'\t\t<feMergeNode></feMergeNode>\n' +
|
|
'\t\t<feMergeNode in="SourceGraphic"></feMergeNode>\n' +
|
|
'\t</feMerge>\n' +
|
|
'</filter>\n');
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns object representation of a shadow
|
|
* @return {Object} Object representation of a shadow instance
|
|
*/
|
|
toObject: function() {
|
|
if (this.includeDefaultValues) {
|
|
return {
|
|
color: this.color,
|
|
blur: this.blur,
|
|
offsetX: this.offsetX,
|
|
offsetY: this.offsetY,
|
|
affectStroke: this.affectStroke,
|
|
nonScaling: this.nonScaling
|
|
};
|
|
}
|
|
var obj = { }, proto = fabric.Shadow.prototype;
|
|
|
|
['color', 'blur', 'offsetX', 'offsetY', 'affectStroke', 'nonScaling'].forEach(function(prop) {
|
|
if (this[prop] !== proto[prop]) {
|
|
obj[prop] = this[prop];
|
|
}
|
|
}, this);
|
|
|
|
return obj;
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Regex matching shadow offsetX, offsetY and blur (ex: "2px 2px 10px rgba(0,0,0,0.2)", "rgb(0,255,0) 2px 2px")
|
|
* @static
|
|
* @field
|
|
* @memberOf fabric.Shadow
|
|
*/
|
|
// eslint-disable-next-line max-len
|
|
fabric.Shadow.reOffsetsAndBlur = /(?:\s|^)(-?\d+(?:\.\d*)?(?:px)?(?:\s?|$))?(-?\d+(?:\.\d*)?(?:px)?(?:\s?|$))?(\d+(?:\.\d*)?(?:px)?)?(?:\s?|$)(?:$|\s)/;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function () {
|
|
|
|
'use strict';
|
|
|
|
if (fabric.StaticCanvas) {
|
|
fabric.warn('fabric.StaticCanvas is already defined.');
|
|
return;
|
|
}
|
|
|
|
// aliases for faster resolution
|
|
var extend = fabric.util.object.extend,
|
|
getElementOffset = fabric.util.getElementOffset,
|
|
removeFromArray = fabric.util.removeFromArray,
|
|
toFixed = fabric.util.toFixed,
|
|
transformPoint = fabric.util.transformPoint,
|
|
invertTransform = fabric.util.invertTransform,
|
|
getNodeCanvas = fabric.util.getNodeCanvas,
|
|
createCanvasElement = fabric.util.createCanvasElement,
|
|
|
|
CANVAS_INIT_ERROR = new Error('Could not initialize `canvas` element');
|
|
|
|
/**
|
|
* Static canvas class
|
|
* @class fabric.StaticCanvas
|
|
* @mixes fabric.Collection
|
|
* @mixes fabric.Observable
|
|
* @see {@link http://fabricjs.com/static_canvas|StaticCanvas demo}
|
|
* @see {@link fabric.StaticCanvas#initialize} for constructor definition
|
|
* @fires before:render
|
|
* @fires after:render
|
|
* @fires canvas:cleared
|
|
* @fires object:added
|
|
* @fires object:removed
|
|
*/
|
|
fabric.StaticCanvas = fabric.util.createClass(fabric.CommonMethods, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {HTMLElement | String} el <canvas> element to initialize instance on
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(el, options) {
|
|
options || (options = { });
|
|
this.renderAndResetBound = this.renderAndReset.bind(this);
|
|
this.requestRenderAllBound = this.requestRenderAll.bind(this);
|
|
this._initStatic(el, options);
|
|
},
|
|
|
|
/**
|
|
* Background color of canvas instance.
|
|
* Should be set via {@link fabric.StaticCanvas#setBackgroundColor}.
|
|
* @type {(String|fabric.Pattern)}
|
|
* @default
|
|
*/
|
|
backgroundColor: '',
|
|
|
|
/**
|
|
* Background image of canvas instance.
|
|
* since 2.4.0 image caching is active, please when putting an image as background, add to the
|
|
* canvas property a reference to the canvas it is on. Otherwise the image cannot detect the zoom
|
|
* vale. As an alternative you can disable image objectCaching
|
|
* @type fabric.Image
|
|
* @default
|
|
*/
|
|
backgroundImage: null,
|
|
|
|
/**
|
|
* Overlay color of canvas instance.
|
|
* Should be set via {@link fabric.StaticCanvas#setOverlayColor}
|
|
* @since 1.3.9
|
|
* @type {(String|fabric.Pattern)}
|
|
* @default
|
|
*/
|
|
overlayColor: '',
|
|
|
|
/**
|
|
* Overlay image of canvas instance.
|
|
* since 2.4.0 image caching is active, please when putting an image as overlay, add to the
|
|
* canvas property a reference to the canvas it is on. Otherwise the image cannot detect the zoom
|
|
* vale. As an alternative you can disable image objectCaching
|
|
* @type fabric.Image
|
|
* @default
|
|
*/
|
|
overlayImage: null,
|
|
|
|
/**
|
|
* Indicates whether toObject/toDatalessObject should include default values
|
|
* if set to false, takes precedence over the object value.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
includeDefaultValues: true,
|
|
|
|
/**
|
|
* Indicates whether objects' state should be saved
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
stateful: false,
|
|
|
|
/**
|
|
* Indicates whether {@link fabric.Collection.add}, {@link fabric.Collection.insertAt} and {@link fabric.Collection.remove},
|
|
* {@link fabric.StaticCanvas.moveTo}, {@link fabric.StaticCanvas.clear} and many more, should also re-render canvas.
|
|
* Disabling this option will not give a performance boost when adding/removing a lot of objects to/from canvas at once
|
|
* since the renders are quequed and executed one per frame.
|
|
* Disabling is suggested anyway and managing the renders of the app manually is not a big effort ( canvas.requestRenderAll() )
|
|
* Left default to true to do not break documentation and old app, fiddles.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
renderOnAddRemove: true,
|
|
|
|
/**
|
|
* Indicates whether object controls (borders/controls) are rendered above overlay image
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
controlsAboveOverlay: false,
|
|
|
|
/**
|
|
* Indicates whether the browser can be scrolled when using a touchscreen and dragging on the canvas
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
allowTouchScrolling: false,
|
|
|
|
/**
|
|
* Indicates whether this canvas will use image smoothing, this is on by default in browsers
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
imageSmoothingEnabled: true,
|
|
|
|
/**
|
|
* The transformation (in the format of Canvas transform) which focuses the viewport
|
|
* @type Array
|
|
* @default
|
|
*/
|
|
viewportTransform: fabric.iMatrix.concat(),
|
|
|
|
/**
|
|
* if set to false background image is not affected by viewport transform
|
|
* @since 1.6.3
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
backgroundVpt: true,
|
|
|
|
/**
|
|
* if set to false overlya image is not affected by viewport transform
|
|
* @since 1.6.3
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
overlayVpt: true,
|
|
|
|
/**
|
|
* When true, canvas is scaled by devicePixelRatio for better rendering on retina screens
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
enableRetinaScaling: true,
|
|
|
|
/**
|
|
* Describe canvas element extension over design
|
|
* properties are tl,tr,bl,br.
|
|
* if canvas is not zoomed/panned those points are the four corner of canvas
|
|
* if canvas is viewportTransformed you those points indicate the extension
|
|
* of canvas element in plain untrasformed coordinates
|
|
* The coordinates get updated with @method calcViewportBoundaries.
|
|
* @memberOf fabric.StaticCanvas.prototype
|
|
*/
|
|
vptCoords: { },
|
|
|
|
/**
|
|
* Based on vptCoords and object.aCoords, skip rendering of objects that
|
|
* are not included in current viewport.
|
|
* May greatly help in applications with crowded canvas and use of zoom/pan
|
|
* If One of the corner of the bounding box of the object is on the canvas
|
|
* the objects get rendered.
|
|
* @memberOf fabric.StaticCanvas.prototype
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
skipOffscreen: true,
|
|
|
|
/**
|
|
* a fabricObject that, without stroke define a clipping area with their shape. filled in black
|
|
* the clipPath object gets used when the canvas has rendered, and the context is placed in the
|
|
* top left corner of the canvas.
|
|
* clipPath will clip away controls, if you do not want this to happen use controlsAboveOverlay = true
|
|
* @type fabric.Object
|
|
*/
|
|
clipPath: undefined,
|
|
|
|
/**
|
|
* @private
|
|
* @param {HTMLElement | String} el <canvas> element to initialize instance on
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
_initStatic: function(el, options) {
|
|
var cb = this.requestRenderAllBound;
|
|
this._objects = [];
|
|
this._createLowerCanvas(el);
|
|
this._initOptions(options);
|
|
// only initialize retina scaling once
|
|
if (!this.interactive) {
|
|
this._initRetinaScaling();
|
|
}
|
|
|
|
if (options.overlayImage) {
|
|
this.setOverlayImage(options.overlayImage, cb);
|
|
}
|
|
if (options.backgroundImage) {
|
|
this.setBackgroundImage(options.backgroundImage, cb);
|
|
}
|
|
if (options.backgroundColor) {
|
|
this.setBackgroundColor(options.backgroundColor, cb);
|
|
}
|
|
if (options.overlayColor) {
|
|
this.setOverlayColor(options.overlayColor, cb);
|
|
}
|
|
this.calcOffset();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_isRetinaScaling: function() {
|
|
return (fabric.devicePixelRatio !== 1 && this.enableRetinaScaling);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @return {Number} retinaScaling if applied, otherwise 1;
|
|
*/
|
|
getRetinaScaling: function() {
|
|
return this._isRetinaScaling() ? fabric.devicePixelRatio : 1;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initRetinaScaling: function() {
|
|
if (!this._isRetinaScaling()) {
|
|
return;
|
|
}
|
|
var scaleRatio = fabric.devicePixelRatio;
|
|
this.__initRetinaScaling(scaleRatio, this.lowerCanvasEl, this.contextContainer);
|
|
if (this.upperCanvasEl) {
|
|
this.__initRetinaScaling(scaleRatio, this.upperCanvasEl, this.contextTop);
|
|
}
|
|
},
|
|
|
|
__initRetinaScaling: function(scaleRatio, canvas, context) {
|
|
canvas.setAttribute('width', this.width * scaleRatio);
|
|
canvas.setAttribute('height', this.height * scaleRatio);
|
|
context.scale(scaleRatio, scaleRatio);
|
|
},
|
|
|
|
|
|
/**
|
|
* Calculates canvas element offset relative to the document
|
|
* This method is also attached as "resize" event handler of window
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
calcOffset: function () {
|
|
this._offset = getElementOffset(this.lowerCanvasEl);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets {@link fabric.StaticCanvas#overlayImage|overlay image} for this canvas
|
|
* @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set overlay to
|
|
* @param {Function} callback callback to invoke when image is loaded and set as an overlay
|
|
* @param {Object} [options] Optional options to set for the {@link fabric.Image|overlay image}.
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
* @see {@link http://jsfiddle.net/fabricjs/MnzHT/|jsFiddle demo}
|
|
* @example <caption>Normal overlayImage with left/top = 0</caption>
|
|
* canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), {
|
|
* // Needed to position overlayImage at 0/0
|
|
* originX: 'left',
|
|
* originY: 'top'
|
|
* });
|
|
* @example <caption>overlayImage with different properties</caption>
|
|
* canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), {
|
|
* opacity: 0.5,
|
|
* angle: 45,
|
|
* left: 400,
|
|
* top: 400,
|
|
* originX: 'left',
|
|
* originY: 'top'
|
|
* });
|
|
* @example <caption>Stretched overlayImage #1 - width/height correspond to canvas width/height</caption>
|
|
* fabric.Image.fromURL('http://fabricjs.com/assets/jail_cell_bars.png', function(img, isError) {
|
|
* img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'});
|
|
* canvas.setOverlayImage(img, canvas.renderAll.bind(canvas));
|
|
* });
|
|
* @example <caption>Stretched overlayImage #2 - width/height correspond to canvas width/height</caption>
|
|
* canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), {
|
|
* width: canvas.width,
|
|
* height: canvas.height,
|
|
* // Needed to position overlayImage at 0/0
|
|
* originX: 'left',
|
|
* originY: 'top'
|
|
* });
|
|
* @example <caption>overlayImage loaded from cross-origin</caption>
|
|
* canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), {
|
|
* opacity: 0.5,
|
|
* angle: 45,
|
|
* left: 400,
|
|
* top: 400,
|
|
* originX: 'left',
|
|
* originY: 'top',
|
|
* crossOrigin: 'anonymous'
|
|
* });
|
|
*/
|
|
setOverlayImage: function (image, callback, options) {
|
|
return this.__setBgOverlayImage('overlayImage', image, callback, options);
|
|
},
|
|
|
|
/**
|
|
* Sets {@link fabric.StaticCanvas#backgroundImage|background image} for this canvas
|
|
* @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set background to
|
|
* @param {Function} callback Callback to invoke when image is loaded and set as background
|
|
* @param {Object} [options] Optional options to set for the {@link fabric.Image|background image}.
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
* @see {@link http://jsfiddle.net/djnr8o7a/28/|jsFiddle demo}
|
|
* @example <caption>Normal backgroundImage with left/top = 0</caption>
|
|
* canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), {
|
|
* // Needed to position backgroundImage at 0/0
|
|
* originX: 'left',
|
|
* originY: 'top'
|
|
* });
|
|
* @example <caption>backgroundImage with different properties</caption>
|
|
* canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), {
|
|
* opacity: 0.5,
|
|
* angle: 45,
|
|
* left: 400,
|
|
* top: 400,
|
|
* originX: 'left',
|
|
* originY: 'top'
|
|
* });
|
|
* @example <caption>Stretched backgroundImage #1 - width/height correspond to canvas width/height</caption>
|
|
* fabric.Image.fromURL('http://fabricjs.com/assets/honey_im_subtle.png', function(img, isError) {
|
|
* img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'});
|
|
* canvas.setBackgroundImage(img, canvas.renderAll.bind(canvas));
|
|
* });
|
|
* @example <caption>Stretched backgroundImage #2 - width/height correspond to canvas width/height</caption>
|
|
* canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), {
|
|
* width: canvas.width,
|
|
* height: canvas.height,
|
|
* // Needed to position backgroundImage at 0/0
|
|
* originX: 'left',
|
|
* originY: 'top'
|
|
* });
|
|
* @example <caption>backgroundImage loaded from cross-origin</caption>
|
|
* canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), {
|
|
* opacity: 0.5,
|
|
* angle: 45,
|
|
* left: 400,
|
|
* top: 400,
|
|
* originX: 'left',
|
|
* originY: 'top',
|
|
* crossOrigin: 'anonymous'
|
|
* });
|
|
*/
|
|
// TODO: fix stretched examples
|
|
setBackgroundImage: function (image, callback, options) {
|
|
return this.__setBgOverlayImage('backgroundImage', image, callback, options);
|
|
},
|
|
|
|
/**
|
|
* Sets {@link fabric.StaticCanvas#overlayColor|foreground color} for this canvas
|
|
* @param {(String|fabric.Pattern)} overlayColor Color or pattern to set foreground color to
|
|
* @param {Function} callback Callback to invoke when foreground color is set
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
* @see {@link http://jsfiddle.net/fabricjs/pB55h/|jsFiddle demo}
|
|
* @example <caption>Normal overlayColor - color value</caption>
|
|
* canvas.setOverlayColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas));
|
|
* @example <caption>fabric.Pattern used as overlayColor</caption>
|
|
* canvas.setOverlayColor({
|
|
* source: 'http://fabricjs.com/assets/escheresque_ste.png'
|
|
* }, canvas.renderAll.bind(canvas));
|
|
* @example <caption>fabric.Pattern used as overlayColor with repeat and offset</caption>
|
|
* canvas.setOverlayColor({
|
|
* source: 'http://fabricjs.com/assets/escheresque_ste.png',
|
|
* repeat: 'repeat',
|
|
* offsetX: 200,
|
|
* offsetY: 100
|
|
* }, canvas.renderAll.bind(canvas));
|
|
*/
|
|
setOverlayColor: function(overlayColor, callback) {
|
|
return this.__setBgOverlayColor('overlayColor', overlayColor, callback);
|
|
},
|
|
|
|
/**
|
|
* Sets {@link fabric.StaticCanvas#backgroundColor|background color} for this canvas
|
|
* @param {(String|fabric.Pattern)} backgroundColor Color or pattern to set background color to
|
|
* @param {Function} callback Callback to invoke when background color is set
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
* @see {@link http://jsfiddle.net/fabricjs/hXzvk/|jsFiddle demo}
|
|
* @example <caption>Normal backgroundColor - color value</caption>
|
|
* canvas.setBackgroundColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas));
|
|
* @example <caption>fabric.Pattern used as backgroundColor</caption>
|
|
* canvas.setBackgroundColor({
|
|
* source: 'http://fabricjs.com/assets/escheresque_ste.png'
|
|
* }, canvas.renderAll.bind(canvas));
|
|
* @example <caption>fabric.Pattern used as backgroundColor with repeat and offset</caption>
|
|
* canvas.setBackgroundColor({
|
|
* source: 'http://fabricjs.com/assets/escheresque_ste.png',
|
|
* repeat: 'repeat',
|
|
* offsetX: 200,
|
|
* offsetY: 100
|
|
* }, canvas.renderAll.bind(canvas));
|
|
*/
|
|
setBackgroundColor: function(backgroundColor, callback) {
|
|
return this.__setBgOverlayColor('backgroundColor', backgroundColor, callback);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundImage|backgroundImage}
|
|
* or {@link fabric.StaticCanvas#overlayImage|overlayImage})
|
|
* @param {(fabric.Image|String|null)} image fabric.Image instance, URL of an image or null to set background or overlay to
|
|
* @param {Function} callback Callback to invoke when image is loaded and set as background or overlay. The first argument is the created image, the second argument is a flag indicating whether an error occurred or not.
|
|
* @param {Object} [options] Optional options to set for the {@link fabric.Image|image}.
|
|
*/
|
|
__setBgOverlayImage: function(property, image, callback, options) {
|
|
if (typeof image === 'string') {
|
|
fabric.util.loadImage(image, function(img, isError) {
|
|
if (img) {
|
|
var instance = new fabric.Image(img, options);
|
|
this[property] = instance;
|
|
instance.canvas = this;
|
|
}
|
|
callback && callback(img, isError);
|
|
}, this, options && options.crossOrigin);
|
|
}
|
|
else {
|
|
options && image.setOptions(options);
|
|
this[property] = image;
|
|
image && (image.canvas = this);
|
|
callback && callback(image, false);
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundColor|backgroundColor}
|
|
* or {@link fabric.StaticCanvas#overlayColor|overlayColor})
|
|
* @param {(Object|String|null)} color Object with pattern information, color value or null
|
|
* @param {Function} [callback] Callback is invoked when color is set
|
|
*/
|
|
__setBgOverlayColor: function(property, color, callback) {
|
|
this[property] = color;
|
|
this._initGradient(color, property);
|
|
this._initPattern(color, property, callback);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createCanvasElement: function() {
|
|
var element = createCanvasElement();
|
|
if (!element) {
|
|
throw CANVAS_INIT_ERROR;
|
|
}
|
|
if (!element.style) {
|
|
element.style = { };
|
|
}
|
|
if (typeof element.getContext === 'undefined') {
|
|
throw CANVAS_INIT_ERROR;
|
|
}
|
|
return element;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
_initOptions: function (options) {
|
|
var lowerCanvasEl = this.lowerCanvasEl;
|
|
this._setOptions(options);
|
|
|
|
this.width = this.width || parseInt(lowerCanvasEl.width, 10) || 0;
|
|
this.height = this.height || parseInt(lowerCanvasEl.height, 10) || 0;
|
|
|
|
if (!this.lowerCanvasEl.style) {
|
|
return;
|
|
}
|
|
|
|
lowerCanvasEl.width = this.width;
|
|
lowerCanvasEl.height = this.height;
|
|
|
|
lowerCanvasEl.style.width = this.width + 'px';
|
|
lowerCanvasEl.style.height = this.height + 'px';
|
|
|
|
this.viewportTransform = this.viewportTransform.slice();
|
|
},
|
|
|
|
/**
|
|
* Creates a bottom canvas
|
|
* @private
|
|
* @param {HTMLElement} [canvasEl]
|
|
*/
|
|
_createLowerCanvas: function (canvasEl) {
|
|
// canvasEl === 'HTMLCanvasElement' does not work on jsdom/node
|
|
if (canvasEl && canvasEl.getContext) {
|
|
this.lowerCanvasEl = canvasEl;
|
|
}
|
|
else {
|
|
this.lowerCanvasEl = fabric.util.getById(canvasEl) || this._createCanvasElement();
|
|
}
|
|
|
|
fabric.util.addClass(this.lowerCanvasEl, 'lower-canvas');
|
|
this._originalCanvasStyle = this.lowerCanvasEl.style;
|
|
if (this.interactive) {
|
|
this._applyCanvasStyle(this.lowerCanvasEl);
|
|
}
|
|
|
|
this.contextContainer = this.lowerCanvasEl.getContext('2d');
|
|
},
|
|
|
|
/**
|
|
* Returns canvas width (in px)
|
|
* @return {Number}
|
|
*/
|
|
getWidth: function () {
|
|
return this.width;
|
|
},
|
|
|
|
/**
|
|
* Returns canvas height (in px)
|
|
* @return {Number}
|
|
*/
|
|
getHeight: function () {
|
|
return this.height;
|
|
},
|
|
|
|
/**
|
|
* Sets width of this canvas instance
|
|
* @param {Number|String} value Value to set width to
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions
|
|
* @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
setWidth: function (value, options) {
|
|
return this.setDimensions({ width: value }, options);
|
|
},
|
|
|
|
/**
|
|
* Sets height of this canvas instance
|
|
* @param {Number|String} value Value to set height to
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions
|
|
* @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
setHeight: function (value, options) {
|
|
return this.setDimensions({ height: value }, options);
|
|
},
|
|
|
|
/**
|
|
* Sets dimensions (width, height) of this canvas instance. when options.cssOnly flag active you should also supply the unit of measure (px/%/em)
|
|
* @param {Object} dimensions Object with width/height properties
|
|
* @param {Number|String} [dimensions.width] Width of canvas element
|
|
* @param {Number|String} [dimensions.height] Height of canvas element
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions
|
|
* @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setDimensions: function (dimensions, options) {
|
|
var cssValue;
|
|
|
|
options = options || {};
|
|
|
|
for (var prop in dimensions) {
|
|
cssValue = dimensions[prop];
|
|
|
|
if (!options.cssOnly) {
|
|
this._setBackstoreDimension(prop, dimensions[prop]);
|
|
cssValue += 'px';
|
|
this.hasLostContext = true;
|
|
}
|
|
|
|
if (!options.backstoreOnly) {
|
|
this._setCssDimension(prop, cssValue);
|
|
}
|
|
}
|
|
if (this._isCurrentlyDrawing) {
|
|
this.freeDrawingBrush && this.freeDrawingBrush._setBrushStyles();
|
|
}
|
|
this._initRetinaScaling();
|
|
this.calcOffset();
|
|
|
|
if (!options.cssOnly) {
|
|
this.requestRenderAll();
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Helper for setting width/height
|
|
* @private
|
|
* @param {String} prop property (width|height)
|
|
* @param {Number} value value to set property to
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
_setBackstoreDimension: function (prop, value) {
|
|
this.lowerCanvasEl[prop] = value;
|
|
|
|
if (this.upperCanvasEl) {
|
|
this.upperCanvasEl[prop] = value;
|
|
}
|
|
|
|
if (this.cacheCanvasEl) {
|
|
this.cacheCanvasEl[prop] = value;
|
|
}
|
|
|
|
this[prop] = value;
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Helper for setting css width/height
|
|
* @private
|
|
* @param {String} prop property (width|height)
|
|
* @param {String} value value to set property to
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
_setCssDimension: function (prop, value) {
|
|
this.lowerCanvasEl.style[prop] = value;
|
|
|
|
if (this.upperCanvasEl) {
|
|
this.upperCanvasEl.style[prop] = value;
|
|
}
|
|
|
|
if (this.wrapperEl) {
|
|
this.wrapperEl.style[prop] = value;
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns canvas zoom level
|
|
* @return {Number}
|
|
*/
|
|
getZoom: function () {
|
|
return this.viewportTransform[0];
|
|
},
|
|
|
|
/**
|
|
* Sets viewport transform of this canvas instance
|
|
* @param {Array} vpt the transform in the form of context.transform
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
setViewportTransform: function (vpt) {
|
|
var activeObject = this._activeObject,
|
|
backgroundObject = this.backgroundImage,
|
|
overlayObject = this.overlayImage,
|
|
object, i, len;
|
|
this.viewportTransform = vpt;
|
|
for (i = 0, len = this._objects.length; i < len; i++) {
|
|
object = this._objects[i];
|
|
object.group || object.setCoords(true);
|
|
}
|
|
if (activeObject) {
|
|
activeObject.setCoords();
|
|
}
|
|
if (backgroundObject) {
|
|
backgroundObject.setCoords(true);
|
|
}
|
|
if (overlayObject) {
|
|
overlayObject.setCoords(true);
|
|
}
|
|
this.calcViewportBoundaries();
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets zoom level of this canvas instance, the zoom centered around point
|
|
* meaning that following zoom to point with the same point will have the visual
|
|
* effect of the zoom originating from that point. The point won't move.
|
|
* It has nothing to do with canvas center or visual center of the viewport.
|
|
* @param {fabric.Point} point to zoom with respect to
|
|
* @param {Number} value to set zoom to, less than 1 zooms out
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
zoomToPoint: function (point, value) {
|
|
// TODO: just change the scale, preserve other transformations
|
|
var before = point, vpt = this.viewportTransform.slice(0);
|
|
point = transformPoint(point, invertTransform(this.viewportTransform));
|
|
vpt[0] = value;
|
|
vpt[3] = value;
|
|
var after = transformPoint(point, vpt);
|
|
vpt[4] += before.x - after.x;
|
|
vpt[5] += before.y - after.y;
|
|
return this.setViewportTransform(vpt);
|
|
},
|
|
|
|
/**
|
|
* Sets zoom level of this canvas instance
|
|
* @param {Number} value to set zoom to, less than 1 zooms out
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
setZoom: function (value) {
|
|
this.zoomToPoint(new fabric.Point(0, 0), value);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Pan viewport so as to place point at top left corner of canvas
|
|
* @param {fabric.Point} point to move to
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
absolutePan: function (point) {
|
|
var vpt = this.viewportTransform.slice(0);
|
|
vpt[4] = -point.x;
|
|
vpt[5] = -point.y;
|
|
return this.setViewportTransform(vpt);
|
|
},
|
|
|
|
/**
|
|
* Pans viewpoint relatively
|
|
* @param {fabric.Point} point (position vector) to move by
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable true
|
|
*/
|
|
relativePan: function (point) {
|
|
return this.absolutePan(new fabric.Point(
|
|
-point.x - this.viewportTransform[4],
|
|
-point.y - this.viewportTransform[5]
|
|
));
|
|
},
|
|
|
|
/**
|
|
* Returns <canvas> element corresponding to this instance
|
|
* @return {HTMLCanvasElement}
|
|
*/
|
|
getElement: function () {
|
|
return this.lowerCanvasEl;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {fabric.Object} obj Object that was added
|
|
*/
|
|
_onObjectAdded: function(obj) {
|
|
this.stateful && obj.setupState();
|
|
obj._set('canvas', this);
|
|
obj.setCoords();
|
|
this.fire('object:added', { target: obj });
|
|
obj.fire('added');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {fabric.Object} obj Object that was removed
|
|
*/
|
|
_onObjectRemoved: function(obj) {
|
|
this.fire('object:removed', { target: obj });
|
|
obj.fire('removed');
|
|
delete obj.canvas;
|
|
},
|
|
|
|
/**
|
|
* Clears specified context of canvas element
|
|
* @param {CanvasRenderingContext2D} ctx Context to clear
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
clearContext: function(ctx) {
|
|
ctx.clearRect(0, 0, this.width, this.height);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns context of canvas where objects are drawn
|
|
* @return {CanvasRenderingContext2D}
|
|
*/
|
|
getContext: function () {
|
|
return this.contextContainer;
|
|
},
|
|
|
|
/**
|
|
* Clears all contexts (background, main, top) of an instance
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
clear: function () {
|
|
this.remove.apply(this, this.getObjects());
|
|
this.backgroundImage = null;
|
|
this.overlayImage = null;
|
|
this.backgroundColor = '';
|
|
this.overlayColor = '';
|
|
if (this._hasITextHandlers) {
|
|
this.off('mouse:up', this._mouseUpITextHandler);
|
|
this._iTextInstances = null;
|
|
this._hasITextHandlers = false;
|
|
}
|
|
this.clearContext(this.contextContainer);
|
|
this.fire('canvas:cleared');
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Renders the canvas
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
renderAll: function () {
|
|
var canvasToDrawOn = this.contextContainer;
|
|
this.renderCanvas(canvasToDrawOn, this._objects);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Function created to be instance bound at initialization
|
|
* used in requestAnimationFrame rendering
|
|
* Let the fabricJS call it. If you call it manually you could have more
|
|
* animationFrame stacking on to of each other
|
|
* for an imperative rendering, use canvas.renderAll
|
|
* @private
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
renderAndReset: function() {
|
|
this.isRendering = 0;
|
|
this.renderAll();
|
|
},
|
|
|
|
/**
|
|
* Append a renderAll request to next animation frame.
|
|
* unless one is already in progress, in that case nothing is done
|
|
* a boolean flag will avoid appending more.
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
requestRenderAll: function () {
|
|
if (!this.isRendering) {
|
|
this.isRendering = fabric.util.requestAnimFrame(this.renderAndResetBound);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Calculate the position of the 4 corner of canvas with current viewportTransform.
|
|
* helps to determinate when an object is in the current rendering viewport using
|
|
* object absolute coordinates ( aCoords )
|
|
* @return {Object} points.tl
|
|
* @chainable
|
|
*/
|
|
calcViewportBoundaries: function() {
|
|
var points = { }, width = this.width, height = this.height,
|
|
iVpt = invertTransform(this.viewportTransform);
|
|
points.tl = transformPoint({ x: 0, y: 0 }, iVpt);
|
|
points.br = transformPoint({ x: width, y: height }, iVpt);
|
|
points.tr = new fabric.Point(points.br.x, points.tl.y);
|
|
points.bl = new fabric.Point(points.tl.x, points.br.y);
|
|
this.vptCoords = points;
|
|
return points;
|
|
},
|
|
|
|
cancelRequestedRender: function() {
|
|
if (this.isRendering) {
|
|
fabric.util.cancelAnimFrame(this.isRendering);
|
|
this.isRendering = 0;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Renders background, objects, overlay and controls.
|
|
* @param {CanvasRenderingContext2D} ctx
|
|
* @param {Array} objects to render
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
renderCanvas: function(ctx, objects) {
|
|
var v = this.viewportTransform, path = this.clipPath;
|
|
this.cancelRequestedRender();
|
|
this.calcViewportBoundaries();
|
|
this.clearContext(ctx);
|
|
fabric.util.setImageSmoothing(ctx, this.imageSmoothingEnabled);
|
|
this.fire('before:render', { ctx: ctx, });
|
|
this._renderBackground(ctx);
|
|
|
|
ctx.save();
|
|
//apply viewport transform once for all rendering process
|
|
ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]);
|
|
this._renderObjects(ctx, objects);
|
|
ctx.restore();
|
|
if (!this.controlsAboveOverlay && this.interactive) {
|
|
this.drawControls(ctx);
|
|
}
|
|
if (path) {
|
|
path.canvas = this;
|
|
// needed to setup a couple of variables
|
|
path.shouldCache();
|
|
path._transformDone = true;
|
|
path.renderCache({ forClipping: true });
|
|
this.drawClipPathOnCanvas(ctx);
|
|
}
|
|
this._renderOverlay(ctx);
|
|
if (this.controlsAboveOverlay && this.interactive) {
|
|
this.drawControls(ctx);
|
|
}
|
|
this.fire('after:render', { ctx: ctx, });
|
|
},
|
|
|
|
/**
|
|
* Paint the cached clipPath on the lowerCanvasEl
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
drawClipPathOnCanvas: function(ctx) {
|
|
var v = this.viewportTransform, path = this.clipPath;
|
|
ctx.save();
|
|
ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]);
|
|
// DEBUG: uncomment this line, comment the following
|
|
// ctx.globalAlpha = 0.4;
|
|
ctx.globalCompositeOperation = 'destination-in';
|
|
path.transform(ctx);
|
|
ctx.scale(1 / path.zoomX, 1 / path.zoomY);
|
|
ctx.drawImage(path._cacheCanvas, -path.cacheTranslationX, -path.cacheTranslationY);
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Array} objects to render
|
|
*/
|
|
_renderObjects: function(ctx, objects) {
|
|
var i, len;
|
|
for (i = 0, len = objects.length; i < len; ++i) {
|
|
objects[i] && objects[i].render(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {string} property 'background' or 'overlay'
|
|
*/
|
|
_renderBackgroundOrOverlay: function(ctx, property) {
|
|
var fill = this[property + 'Color'], object = this[property + 'Image'],
|
|
v = this.viewportTransform, needsVpt = this[property + 'Vpt'];
|
|
if (!fill && !object) {
|
|
return;
|
|
}
|
|
if (fill) {
|
|
ctx.save();
|
|
ctx.beginPath();
|
|
ctx.moveTo(0, 0);
|
|
ctx.lineTo(this.width, 0);
|
|
ctx.lineTo(this.width, this.height);
|
|
ctx.lineTo(0, this.height);
|
|
ctx.closePath();
|
|
ctx.fillStyle = fill.toLive
|
|
? fill.toLive(ctx, this)
|
|
: fill;
|
|
if (needsVpt) {
|
|
ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]);
|
|
}
|
|
ctx.transform(1, 0, 0, 1, fill.offsetX || 0, fill.offsetY || 0);
|
|
var m = fill.gradientTransform || fill.patternTransform;
|
|
m && ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
ctx.fill();
|
|
ctx.restore();
|
|
}
|
|
if (object) {
|
|
ctx.save();
|
|
if (needsVpt) {
|
|
ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]);
|
|
}
|
|
object.render(ctx);
|
|
ctx.restore();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderBackground: function(ctx) {
|
|
this._renderBackgroundOrOverlay(ctx, 'background');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderOverlay: function(ctx) {
|
|
this._renderBackgroundOrOverlay(ctx, 'overlay');
|
|
},
|
|
|
|
/**
|
|
* Returns coordinates of a center of canvas.
|
|
* Returned value is an object with top and left properties
|
|
* @return {Object} object with "top" and "left" number values
|
|
*/
|
|
getCenter: function () {
|
|
return {
|
|
top: this.height / 2,
|
|
left: this.width / 2
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Centers object horizontally in the canvas
|
|
* @param {fabric.Object} object Object to center horizontally
|
|
* @return {fabric.Canvas} thisArg
|
|
*/
|
|
centerObjectH: function (object) {
|
|
return this._centerObject(object, new fabric.Point(this.getCenter().left, object.getCenterPoint().y));
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically in the canvas
|
|
* @param {fabric.Object} object Object to center vertically
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
centerObjectV: function (object) {
|
|
return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, this.getCenter().top));
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically and horizontally in the canvas
|
|
* @param {fabric.Object} object Object to center vertically and horizontally
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
centerObject: function(object) {
|
|
var center = this.getCenter();
|
|
|
|
return this._centerObject(object, new fabric.Point(center.left, center.top));
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically and horizontally in the viewport
|
|
* @param {fabric.Object} object Object to center vertically and horizontally
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
viewportCenterObject: function(object) {
|
|
var vpCenter = this.getVpCenter();
|
|
|
|
return this._centerObject(object, vpCenter);
|
|
},
|
|
|
|
/**
|
|
* Centers object horizontally in the viewport, object.top is unchanged
|
|
* @param {fabric.Object} object Object to center vertically and horizontally
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
viewportCenterObjectH: function(object) {
|
|
var vpCenter = this.getVpCenter();
|
|
this._centerObject(object, new fabric.Point(vpCenter.x, object.getCenterPoint().y));
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object Vertically in the viewport, object.top is unchanged
|
|
* @param {fabric.Object} object Object to center vertically and horizontally
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
viewportCenterObjectV: function(object) {
|
|
var vpCenter = this.getVpCenter();
|
|
|
|
return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, vpCenter.y));
|
|
},
|
|
|
|
/**
|
|
* Calculate the point in canvas that correspond to the center of actual viewport.
|
|
* @return {fabric.Point} vpCenter, viewport center
|
|
* @chainable
|
|
*/
|
|
getVpCenter: function() {
|
|
var center = this.getCenter(),
|
|
iVpt = invertTransform(this.viewportTransform);
|
|
return transformPoint({ x: center.left, y: center.top }, iVpt);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {fabric.Object} object Object to center
|
|
* @param {fabric.Point} center Center point
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
_centerObject: function(object, center) {
|
|
object.setPositionByOrigin(center, 'center', 'center');
|
|
object.setCoords();
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns dataless JSON representation of canvas
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {String} json string
|
|
*/
|
|
toDatalessJSON: function (propertiesToInclude) {
|
|
return this.toDatalessObject(propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of canvas
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function (propertiesToInclude) {
|
|
return this._toObjectMethod('toObject', propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* Returns dataless object representation of canvas
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toDatalessObject: function (propertiesToInclude) {
|
|
return this._toObjectMethod('toDatalessObject', propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_toObjectMethod: function (methodName, propertiesToInclude) {
|
|
|
|
var clipPath = this.clipPath, data = {
|
|
version: fabric.version,
|
|
objects: this._toObjects(methodName, propertiesToInclude),
|
|
};
|
|
if (clipPath && !clipPath.excludeFromExport) {
|
|
data.clipPath = this._toObject(this.clipPath, methodName, propertiesToInclude);
|
|
}
|
|
extend(data, this.__serializeBgOverlay(methodName, propertiesToInclude));
|
|
|
|
fabric.util.populateWithProperties(this, data, propertiesToInclude);
|
|
|
|
return data;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_toObjects: function(methodName, propertiesToInclude) {
|
|
return this._objects.filter(function(object) {
|
|
return !object.excludeFromExport;
|
|
}).map(function(instance) {
|
|
return this._toObject(instance, methodName, propertiesToInclude);
|
|
}, this);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_toObject: function(instance, methodName, propertiesToInclude) {
|
|
var originalValue;
|
|
|
|
if (!this.includeDefaultValues) {
|
|
originalValue = instance.includeDefaultValues;
|
|
instance.includeDefaultValues = false;
|
|
}
|
|
|
|
var object = instance[methodName](propertiesToInclude);
|
|
if (!this.includeDefaultValues) {
|
|
instance.includeDefaultValues = originalValue;
|
|
}
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
__serializeBgOverlay: function(methodName, propertiesToInclude) {
|
|
var data = {}, bgImage = this.backgroundImage, overlayImage = this.overlayImage,
|
|
bgColor = this.backgroundColor, overlayColor = this.overlayColor;
|
|
|
|
if (bgColor && bgColor.toObject) {
|
|
if (!bgColor.excludeFromExport) {
|
|
data.background = bgColor.toObject(propertiesToInclude);
|
|
}
|
|
}
|
|
else if (bgColor) {
|
|
data.background = bgColor;
|
|
}
|
|
|
|
if (overlayColor && overlayColor.toObject) {
|
|
if (!overlayColor.excludeFromExport) {
|
|
data.overlay = overlayColor.toObject(propertiesToInclude);
|
|
}
|
|
}
|
|
else if (overlayColor) {
|
|
data.overlay = overlayColor;
|
|
}
|
|
|
|
if (bgImage && !bgImage.excludeFromExport) {
|
|
data.backgroundImage = this._toObject(bgImage, methodName, propertiesToInclude);
|
|
}
|
|
if (overlayImage && !overlayImage.excludeFromExport) {
|
|
data.overlayImage = this._toObject(overlayImage, methodName, propertiesToInclude);
|
|
}
|
|
|
|
return data;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* When true, getSvgTransform() will apply the StaticCanvas.viewportTransform to the SVG transformation. When true,
|
|
* a zoomed canvas will then produce zoomed SVG output.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
svgViewportTransformation: true,
|
|
|
|
/**
|
|
* Returns SVG representation of canvas
|
|
* @function
|
|
* @param {Object} [options] Options object for SVG output
|
|
* @param {Boolean} [options.suppressPreamble=false] If true xml tag is not included
|
|
* @param {Object} [options.viewBox] SVG viewbox object
|
|
* @param {Number} [options.viewBox.x] x-coordinate of viewbox
|
|
* @param {Number} [options.viewBox.y] y-coordinate of viewbox
|
|
* @param {Number} [options.viewBox.width] Width of viewbox
|
|
* @param {Number} [options.viewBox.height] Height of viewbox
|
|
* @param {String} [options.encoding=UTF-8] Encoding of SVG output
|
|
* @param {String} [options.width] desired width of svg with or without units
|
|
* @param {String} [options.height] desired height of svg with or without units
|
|
* @param {Function} [reviver] Method for further parsing of svg elements, called after each fabric object converted into svg representation.
|
|
* @return {String} SVG string
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-3#serialization}
|
|
* @see {@link http://jsfiddle.net/fabricjs/jQ3ZZ/|jsFiddle demo}
|
|
* @example <caption>Normal SVG output</caption>
|
|
* var svg = canvas.toSVG();
|
|
* @example <caption>SVG output without preamble (without <?xml ../>)</caption>
|
|
* var svg = canvas.toSVG({suppressPreamble: true});
|
|
* @example <caption>SVG output with viewBox attribute</caption>
|
|
* var svg = canvas.toSVG({
|
|
* viewBox: {
|
|
* x: 100,
|
|
* y: 100,
|
|
* width: 200,
|
|
* height: 300
|
|
* }
|
|
* });
|
|
* @example <caption>SVG output with different encoding (default: UTF-8)</caption>
|
|
* var svg = canvas.toSVG({encoding: 'ISO-8859-1'});
|
|
* @example <caption>Modify SVG output with reviver function</caption>
|
|
* var svg = canvas.toSVG(null, function(svg) {
|
|
* return svg.replace('stroke-dasharray: ; stroke-linecap: butt; stroke-linejoin: miter; stroke-miterlimit: 10; ', '');
|
|
* });
|
|
*/
|
|
toSVG: function(options, reviver) {
|
|
options || (options = { });
|
|
options.reviver = reviver;
|
|
var markup = [];
|
|
|
|
this._setSVGPreamble(markup, options);
|
|
this._setSVGHeader(markup, options);
|
|
if (this.clipPath) {
|
|
markup.push('<g clip-path="url(#' + this.clipPath.clipPathId + ')" >\n');
|
|
}
|
|
this._setSVGBgOverlayColor(markup, 'background');
|
|
this._setSVGBgOverlayImage(markup, 'backgroundImage', reviver);
|
|
this._setSVGObjects(markup, reviver);
|
|
if (this.clipPath) {
|
|
markup.push('</g>\n');
|
|
}
|
|
this._setSVGBgOverlayColor(markup, 'overlay');
|
|
this._setSVGBgOverlayImage(markup, 'overlayImage', reviver);
|
|
|
|
markup.push('</svg>');
|
|
|
|
return markup.join('');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setSVGPreamble: function(markup, options) {
|
|
if (options.suppressPreamble) {
|
|
return;
|
|
}
|
|
markup.push(
|
|
'<?xml version="1.0" encoding="', (options.encoding || 'UTF-8'), '" standalone="no" ?>\n',
|
|
'<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ',
|
|
'"http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd">\n'
|
|
);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setSVGHeader: function(markup, options) {
|
|
var width = options.width || this.width,
|
|
height = options.height || this.height,
|
|
vpt, viewBox = 'viewBox="0 0 ' + this.width + ' ' + this.height + '" ',
|
|
NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS;
|
|
|
|
if (options.viewBox) {
|
|
viewBox = 'viewBox="' +
|
|
options.viewBox.x + ' ' +
|
|
options.viewBox.y + ' ' +
|
|
options.viewBox.width + ' ' +
|
|
options.viewBox.height + '" ';
|
|
}
|
|
else {
|
|
if (this.svgViewportTransformation) {
|
|
vpt = this.viewportTransform;
|
|
viewBox = 'viewBox="' +
|
|
toFixed(-vpt[4] / vpt[0], NUM_FRACTION_DIGITS) + ' ' +
|
|
toFixed(-vpt[5] / vpt[3], NUM_FRACTION_DIGITS) + ' ' +
|
|
toFixed(this.width / vpt[0], NUM_FRACTION_DIGITS) + ' ' +
|
|
toFixed(this.height / vpt[3], NUM_FRACTION_DIGITS) + '" ';
|
|
}
|
|
}
|
|
|
|
markup.push(
|
|
'<svg ',
|
|
'xmlns="http://www.w3.org/2000/svg" ',
|
|
'xmlns:xlink="http://www.w3.org/1999/xlink" ',
|
|
'version="1.1" ',
|
|
'width="', width, '" ',
|
|
'height="', height, '" ',
|
|
viewBox,
|
|
'xml:space="preserve">\n',
|
|
'<desc>Created with Fabric.js ', fabric.version, '</desc>\n',
|
|
'<defs>\n',
|
|
this.createSVGFontFacesMarkup(),
|
|
this.createSVGRefElementsMarkup(),
|
|
this.createSVGClipPathMarkup(options),
|
|
'</defs>\n'
|
|
);
|
|
},
|
|
|
|
createSVGClipPathMarkup: function(options) {
|
|
var clipPath = this.clipPath;
|
|
if (clipPath) {
|
|
clipPath.clipPathId = 'CLIPPATH_' + fabric.Object.__uid++;
|
|
return '<clipPath id="' + clipPath.clipPathId + '" >\n' +
|
|
this.clipPath.toClipPathSVG(options.reviver) +
|
|
'</clipPath>\n';
|
|
}
|
|
return '';
|
|
},
|
|
|
|
/**
|
|
* Creates markup containing SVG referenced elements like patterns, gradients etc.
|
|
* @return {String}
|
|
*/
|
|
createSVGRefElementsMarkup: function() {
|
|
var _this = this,
|
|
markup = ['background', 'overlay'].map(function(prop) {
|
|
var fill = _this[prop + 'Color'];
|
|
if (fill && fill.toLive) {
|
|
var shouldTransform = _this[prop + 'Vpt'], vpt = _this.viewportTransform,
|
|
object = {
|
|
width: _this.width / (shouldTransform ? vpt[0] : 1),
|
|
height: _this.height / (shouldTransform ? vpt[3] : 1)
|
|
};
|
|
return fill.toSVG(
|
|
object,
|
|
{ additionalTransform: shouldTransform ? fabric.util.matrixToSVG(vpt) : '' }
|
|
);
|
|
}
|
|
});
|
|
return markup.join('');
|
|
},
|
|
|
|
/**
|
|
* Creates markup containing SVG font faces,
|
|
* font URLs for font faces must be collected by developers
|
|
* and are not extracted from the DOM by fabricjs
|
|
* @param {Array} objects Array of fabric objects
|
|
* @return {String}
|
|
*/
|
|
createSVGFontFacesMarkup: function() {
|
|
var markup = '', fontList = { }, obj, fontFamily,
|
|
style, row, rowIndex, _char, charIndex, i, len,
|
|
fontPaths = fabric.fontPaths, objects = [];
|
|
|
|
this._objects.forEach(function add(object) {
|
|
objects.push(object);
|
|
if (object._objects) {
|
|
object._objects.forEach(add);
|
|
}
|
|
});
|
|
|
|
for (i = 0, len = objects.length; i < len; i++) {
|
|
obj = objects[i];
|
|
fontFamily = obj.fontFamily;
|
|
if (obj.type.indexOf('text') === -1 || fontList[fontFamily] || !fontPaths[fontFamily]) {
|
|
continue;
|
|
}
|
|
fontList[fontFamily] = true;
|
|
if (!obj.styles) {
|
|
continue;
|
|
}
|
|
style = obj.styles;
|
|
for (rowIndex in style) {
|
|
row = style[rowIndex];
|
|
for (charIndex in row) {
|
|
_char = row[charIndex];
|
|
fontFamily = _char.fontFamily;
|
|
if (!fontList[fontFamily] && fontPaths[fontFamily]) {
|
|
fontList[fontFamily] = true;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
for (var j in fontList) {
|
|
markup += [
|
|
'\t\t@font-face {\n',
|
|
'\t\t\tfont-family: \'', j, '\';\n',
|
|
'\t\t\tsrc: url(\'', fontPaths[j], '\');\n',
|
|
'\t\t}\n'
|
|
].join('');
|
|
}
|
|
|
|
if (markup) {
|
|
markup = [
|
|
'\t<style type="text/css">',
|
|
'<![CDATA[\n',
|
|
markup,
|
|
']]>',
|
|
'</style>\n'
|
|
].join('');
|
|
}
|
|
|
|
return markup;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setSVGObjects: function(markup, reviver) {
|
|
var instance, i, len, objects = this._objects;
|
|
for (i = 0, len = objects.length; i < len; i++) {
|
|
instance = objects[i];
|
|
if (instance.excludeFromExport) {
|
|
continue;
|
|
}
|
|
this._setSVGObject(markup, instance, reviver);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setSVGObject: function(markup, instance, reviver) {
|
|
markup.push(instance.toSVG(reviver));
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setSVGBgOverlayImage: function(markup, property, reviver) {
|
|
if (this[property] && !this[property].excludeFromExport && this[property].toSVG) {
|
|
markup.push(this[property].toSVG(reviver));
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setSVGBgOverlayColor: function(markup, property) {
|
|
var filler = this[property + 'Color'], vpt = this.viewportTransform, finalWidth = this.width,
|
|
finalHeight = this.height;
|
|
if (!filler) {
|
|
return;
|
|
}
|
|
if (filler.toLive) {
|
|
var repeat = filler.repeat, iVpt = fabric.util.invertTransform(vpt), shouldInvert = this[property + 'Vpt'],
|
|
additionalTransform = shouldInvert ? fabric.util.matrixToSVG(iVpt) : '';
|
|
markup.push(
|
|
'<rect transform="' + additionalTransform + ' translate(', finalWidth / 2, ',', finalHeight / 2, ')"',
|
|
' x="', filler.offsetX - finalWidth / 2,
|
|
'" y="', filler.offsetY - finalHeight / 2, '" ',
|
|
'width="',
|
|
(repeat === 'repeat-y' || repeat === 'no-repeat'
|
|
? filler.source.width
|
|
: finalWidth ),
|
|
'" height="',
|
|
(repeat === 'repeat-x' || repeat === 'no-repeat'
|
|
? filler.source.height
|
|
: finalHeight),
|
|
'" fill="url(#SVGID_' + filler.id + ')"',
|
|
'></rect>\n'
|
|
);
|
|
}
|
|
else {
|
|
markup.push(
|
|
'<rect x="0" y="0" width="100%" height="100%" ',
|
|
'fill="', filler, '"',
|
|
'></rect>\n'
|
|
);
|
|
}
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Moves an object or the objects of a multiple selection
|
|
* to the bottom of the stack of drawn objects
|
|
* @param {fabric.Object} object Object to send to back
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
sendToBack: function (object) {
|
|
if (!object) {
|
|
return this;
|
|
}
|
|
var activeSelection = this._activeObject,
|
|
i, obj, objs;
|
|
if (object === activeSelection && object.type === 'activeSelection') {
|
|
objs = activeSelection._objects;
|
|
for (i = objs.length; i--;) {
|
|
obj = objs[i];
|
|
removeFromArray(this._objects, obj);
|
|
this._objects.unshift(obj);
|
|
}
|
|
}
|
|
else {
|
|
removeFromArray(this._objects, object);
|
|
this._objects.unshift(object);
|
|
}
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object or the objects of a multiple selection
|
|
* to the top of the stack of drawn objects
|
|
* @param {fabric.Object} object Object to send
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
bringToFront: function (object) {
|
|
if (!object) {
|
|
return this;
|
|
}
|
|
var activeSelection = this._activeObject,
|
|
i, obj, objs;
|
|
if (object === activeSelection && object.type === 'activeSelection') {
|
|
objs = activeSelection._objects;
|
|
for (i = 0; i < objs.length; i++) {
|
|
obj = objs[i];
|
|
removeFromArray(this._objects, obj);
|
|
this._objects.push(obj);
|
|
}
|
|
}
|
|
else {
|
|
removeFromArray(this._objects, object);
|
|
this._objects.push(object);
|
|
}
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object or a selection down in stack of drawn objects
|
|
* An optional parameter, intersecting allows to move the object in behind
|
|
* the first intersecting object. Where intersection is calculated with
|
|
* bounding box. If no intersection is found, there will not be change in the
|
|
* stack.
|
|
* @param {fabric.Object} object Object to send
|
|
* @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
sendBackwards: function (object, intersecting) {
|
|
if (!object) {
|
|
return this;
|
|
}
|
|
var activeSelection = this._activeObject,
|
|
i, obj, idx, newIdx, objs, objsMoved = 0;
|
|
|
|
if (object === activeSelection && object.type === 'activeSelection') {
|
|
objs = activeSelection._objects;
|
|
for (i = 0; i < objs.length; i++) {
|
|
obj = objs[i];
|
|
idx = this._objects.indexOf(obj);
|
|
if (idx > 0 + objsMoved) {
|
|
newIdx = idx - 1;
|
|
removeFromArray(this._objects, obj);
|
|
this._objects.splice(newIdx, 0, obj);
|
|
}
|
|
objsMoved++;
|
|
}
|
|
}
|
|
else {
|
|
idx = this._objects.indexOf(object);
|
|
if (idx !== 0) {
|
|
// if object is not on the bottom of stack
|
|
newIdx = this._findNewLowerIndex(object, idx, intersecting);
|
|
removeFromArray(this._objects, object);
|
|
this._objects.splice(newIdx, 0, object);
|
|
}
|
|
}
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_findNewLowerIndex: function(object, idx, intersecting) {
|
|
var newIdx, i;
|
|
|
|
if (intersecting) {
|
|
newIdx = idx;
|
|
|
|
// traverse down the stack looking for the nearest intersecting object
|
|
for (i = idx - 1; i >= 0; --i) {
|
|
|
|
var isIntersecting = object.intersectsWithObject(this._objects[i]) ||
|
|
object.isContainedWithinObject(this._objects[i]) ||
|
|
this._objects[i].isContainedWithinObject(object);
|
|
|
|
if (isIntersecting) {
|
|
newIdx = i;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
newIdx = idx - 1;
|
|
}
|
|
|
|
return newIdx;
|
|
},
|
|
|
|
/**
|
|
* Moves an object or a selection up in stack of drawn objects
|
|
* An optional parameter, intersecting allows to move the object in front
|
|
* of the first intersecting object. Where intersection is calculated with
|
|
* bounding box. If no intersection is found, there will not be change in the
|
|
* stack.
|
|
* @param {fabric.Object} object Object to send
|
|
* @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
bringForward: function (object, intersecting) {
|
|
if (!object) {
|
|
return this;
|
|
}
|
|
var activeSelection = this._activeObject,
|
|
i, obj, idx, newIdx, objs, objsMoved = 0;
|
|
|
|
if (object === activeSelection && object.type === 'activeSelection') {
|
|
objs = activeSelection._objects;
|
|
for (i = objs.length; i--;) {
|
|
obj = objs[i];
|
|
idx = this._objects.indexOf(obj);
|
|
if (idx < this._objects.length - 1 - objsMoved) {
|
|
newIdx = idx + 1;
|
|
removeFromArray(this._objects, obj);
|
|
this._objects.splice(newIdx, 0, obj);
|
|
}
|
|
objsMoved++;
|
|
}
|
|
}
|
|
else {
|
|
idx = this._objects.indexOf(object);
|
|
if (idx !== this._objects.length - 1) {
|
|
// if object is not on top of stack (last item in an array)
|
|
newIdx = this._findNewUpperIndex(object, idx, intersecting);
|
|
removeFromArray(this._objects, object);
|
|
this._objects.splice(newIdx, 0, object);
|
|
}
|
|
}
|
|
this.renderOnAddRemove && this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_findNewUpperIndex: function(object, idx, intersecting) {
|
|
var newIdx, i, len;
|
|
|
|
if (intersecting) {
|
|
newIdx = idx;
|
|
|
|
// traverse up the stack looking for the nearest intersecting object
|
|
for (i = idx + 1, len = this._objects.length; i < len; ++i) {
|
|
|
|
var isIntersecting = object.intersectsWithObject(this._objects[i]) ||
|
|
object.isContainedWithinObject(this._objects[i]) ||
|
|
this._objects[i].isContainedWithinObject(object);
|
|
|
|
if (isIntersecting) {
|
|
newIdx = i;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
newIdx = idx + 1;
|
|
}
|
|
|
|
return newIdx;
|
|
},
|
|
|
|
/**
|
|
* Moves an object to specified level in stack of drawn objects
|
|
* @param {fabric.Object} object Object to send
|
|
* @param {Number} index Position to move to
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
moveTo: function (object, index) {
|
|
removeFromArray(this._objects, object);
|
|
this._objects.splice(index, 0, object);
|
|
return this.renderOnAddRemove && this.requestRenderAll();
|
|
},
|
|
|
|
/**
|
|
* Clears a canvas element and dispose objects
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
dispose: function () {
|
|
// cancel eventually ongoing renders
|
|
if (this.isRendering) {
|
|
fabric.util.cancelAnimFrame(this.isRendering);
|
|
this.isRendering = 0;
|
|
}
|
|
this.forEachObject(function(object) {
|
|
object.dispose && object.dispose();
|
|
});
|
|
this._objects = [];
|
|
if (this.backgroundImage && this.backgroundImage.dispose) {
|
|
this.backgroundImage.dispose();
|
|
}
|
|
this.backgroundImage = null;
|
|
if (this.overlayImage && this.overlayImage.dispose) {
|
|
this.overlayImage.dispose();
|
|
}
|
|
this.overlayImage = null;
|
|
this._iTextInstances = null;
|
|
this.contextContainer = null;
|
|
// restore canvas style
|
|
this.lowerCanvasEl.classList.remove('lower-canvas');
|
|
this.lowerCanvasEl.style = this._originalCanvasStyle;
|
|
delete this._originalCanvasStyle;
|
|
// restore canvas size to original size in case retina scaling was applied
|
|
this.lowerCanvasEl.setAttribute('width', this.width);
|
|
this.lowerCanvasEl.setAttribute('height', this.height);
|
|
fabric.util.cleanUpJsdomNode(this.lowerCanvasEl);
|
|
this.lowerCanvasEl = undefined;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns a string representation of an instance
|
|
* @return {String} string representation of an instance
|
|
*/
|
|
toString: function () {
|
|
return '#<fabric.Canvas (' + this.complexity() + '): ' +
|
|
'{ objects: ' + this._objects.length + ' }>';
|
|
}
|
|
});
|
|
|
|
extend(fabric.StaticCanvas.prototype, fabric.Observable);
|
|
extend(fabric.StaticCanvas.prototype, fabric.Collection);
|
|
extend(fabric.StaticCanvas.prototype, fabric.DataURLExporter);
|
|
|
|
extend(fabric.StaticCanvas, /** @lends fabric.StaticCanvas */ {
|
|
|
|
/**
|
|
* @static
|
|
* @type String
|
|
* @default
|
|
*/
|
|
EMPTY_JSON: '{"objects": [], "background": "white"}',
|
|
|
|
/**
|
|
* Provides a way to check support of some of the canvas methods
|
|
* (either those of HTMLCanvasElement itself, or rendering context)
|
|
*
|
|
* @param {String} methodName Method to check support for;
|
|
* Could be one of "setLineDash"
|
|
* @return {Boolean | null} `true` if method is supported (or at least exists),
|
|
* `null` if canvas element or context can not be initialized
|
|
*/
|
|
supports: function (methodName) {
|
|
var el = createCanvasElement();
|
|
|
|
if (!el || !el.getContext) {
|
|
return null;
|
|
}
|
|
|
|
var ctx = el.getContext('2d');
|
|
if (!ctx) {
|
|
return null;
|
|
}
|
|
|
|
switch (methodName) {
|
|
|
|
case 'setLineDash':
|
|
return typeof ctx.setLineDash !== 'undefined';
|
|
|
|
default:
|
|
return null;
|
|
}
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns Object representation of canvas
|
|
* this alias is provided because if you call JSON.stringify on an instance,
|
|
* the toJSON object will be invoked if it exists.
|
|
* Having a toJSON method means you can do JSON.stringify(myCanvas)
|
|
* @function
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} JSON compatible object
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-3#serialization}
|
|
* @see {@link http://jsfiddle.net/fabricjs/pec86/|jsFiddle demo}
|
|
* @example <caption>JSON without additional properties</caption>
|
|
* var json = canvas.toJSON();
|
|
* @example <caption>JSON with additional properties included</caption>
|
|
* var json = canvas.toJSON(['lockMovementX', 'lockMovementY', 'lockRotation', 'lockScalingX', 'lockScalingY']);
|
|
* @example <caption>JSON without default values</caption>
|
|
* canvas.includeDefaultValues = false;
|
|
* var json = canvas.toJSON();
|
|
*/
|
|
fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject;
|
|
|
|
if (fabric.isLikelyNode) {
|
|
fabric.StaticCanvas.prototype.createPNGStream = function() {
|
|
var impl = getNodeCanvas(this.lowerCanvasEl);
|
|
return impl && impl.createPNGStream();
|
|
};
|
|
fabric.StaticCanvas.prototype.createJPEGStream = function(opts) {
|
|
var impl = getNodeCanvas(this.lowerCanvasEl);
|
|
return impl && impl.createJPEGStream(opts);
|
|
};
|
|
}
|
|
})();
|
|
|
|
|
|
/**
|
|
* BaseBrush class
|
|
* @class fabric.BaseBrush
|
|
* @see {@link http://fabricjs.com/freedrawing|Freedrawing demo}
|
|
*/
|
|
fabric.BaseBrush = fabric.util.createClass(/** @lends fabric.BaseBrush.prototype */ {
|
|
|
|
/**
|
|
* Color of a brush
|
|
* @type String
|
|
* @default
|
|
*/
|
|
color: 'rgb(0, 0, 0)',
|
|
|
|
/**
|
|
* Width of a brush, has to be a Number, no string literals
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
width: 1,
|
|
|
|
/**
|
|
* Shadow object representing shadow of this shape.
|
|
* <b>Backwards incompatibility note:</b> This property replaces "shadowColor" (String), "shadowOffsetX" (Number),
|
|
* "shadowOffsetY" (Number) and "shadowBlur" (Number) since v1.2.12
|
|
* @type fabric.Shadow
|
|
* @default
|
|
*/
|
|
shadow: null,
|
|
|
|
/**
|
|
* Line endings style of a brush (one of "butt", "round", "square")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineCap: 'round',
|
|
|
|
/**
|
|
* Corner style of a brush (one of "bevel", "round", "miter")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineJoin: 'round',
|
|
|
|
/**
|
|
* Maximum miter length (used for strokeLineJoin = "miter") of a brush's
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeMiterLimit: 10,
|
|
|
|
/**
|
|
* Stroke Dash Array.
|
|
* @type Array
|
|
* @default
|
|
*/
|
|
strokeDashArray: null,
|
|
|
|
/**
|
|
* When `true`, the free drawing is limited to the whiteboard size. Default to false.
|
|
* @type Boolean
|
|
* @default false
|
|
*/
|
|
|
|
limitedToCanvasSize: false,
|
|
|
|
|
|
/**
|
|
* Sets brush styles
|
|
* @private
|
|
*/
|
|
_setBrushStyles: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
ctx.strokeStyle = this.color;
|
|
ctx.lineWidth = this.width;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.miterLimit = this.strokeMiterLimit;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
ctx.setLineDash(this.strokeDashArray || []);
|
|
},
|
|
|
|
/**
|
|
* Sets the transformation on given context
|
|
* @param {RenderingContext2d} ctx context to render on
|
|
* @private
|
|
*/
|
|
_saveAndTransform: function(ctx) {
|
|
var v = this.canvas.viewportTransform;
|
|
ctx.save();
|
|
ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]);
|
|
},
|
|
|
|
/**
|
|
* Sets brush shadow styles
|
|
* @private
|
|
*/
|
|
_setShadow: function() {
|
|
if (!this.shadow) {
|
|
return;
|
|
}
|
|
|
|
var canvas = this.canvas,
|
|
shadow = this.shadow,
|
|
ctx = canvas.contextTop,
|
|
zoom = canvas.getZoom();
|
|
if (canvas && canvas._isRetinaScaling()) {
|
|
zoom *= fabric.devicePixelRatio;
|
|
}
|
|
|
|
ctx.shadowColor = shadow.color;
|
|
ctx.shadowBlur = shadow.blur * zoom;
|
|
ctx.shadowOffsetX = shadow.offsetX * zoom;
|
|
ctx.shadowOffsetY = shadow.offsetY * zoom;
|
|
},
|
|
|
|
needsFullRender: function() {
|
|
var color = new fabric.Color(this.color);
|
|
return color.getAlpha() < 1 || !!this.shadow;
|
|
},
|
|
|
|
/**
|
|
* Removes brush shadow styles
|
|
* @private
|
|
*/
|
|
_resetShadow: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
|
|
ctx.shadowColor = '';
|
|
ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0;
|
|
},
|
|
|
|
/**
|
|
* Check is pointer is outside canvas boundaries
|
|
* @param {Object} pointer
|
|
* @private
|
|
*/
|
|
_isOutSideCanvas: function(pointer) {
|
|
return pointer.x < 0 || pointer.x > this.canvas.getWidth() || pointer.y < 0 || pointer.y > this.canvas.getHeight();
|
|
}
|
|
});
|
|
|
|
|
|
(function() {
|
|
/**
|
|
* PencilBrush class
|
|
* @class fabric.PencilBrush
|
|
* @extends fabric.BaseBrush
|
|
*/
|
|
fabric.PencilBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.PencilBrush.prototype */ {
|
|
|
|
/**
|
|
* Discard points that are less than `decimate` pixel distant from each other
|
|
* @type Number
|
|
* @default 0.4
|
|
*/
|
|
decimate: 0.4,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {fabric.Canvas} canvas
|
|
* @return {fabric.PencilBrush} Instance of a pencil brush
|
|
*/
|
|
initialize: function(canvas) {
|
|
this.canvas = canvas;
|
|
this._points = [];
|
|
},
|
|
|
|
/**
|
|
* Invoked inside on mouse down and mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
_drawSegment: function (ctx, p1, p2) {
|
|
var midPoint = p1.midPointFrom(p2);
|
|
ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y);
|
|
return midPoint;
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse down
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseDown: function(pointer, options) {
|
|
if (!this.canvas._isMainEvent(options.e)) {
|
|
return;
|
|
}
|
|
this._prepareForDrawing(pointer);
|
|
// capture coordinates immediately
|
|
// this allows to draw dots (when movement never occurs)
|
|
this._captureDrawingPath(pointer);
|
|
this._render();
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseMove: function(pointer, options) {
|
|
if (!this.canvas._isMainEvent(options.e)) {
|
|
return;
|
|
}
|
|
if (this.limitedToCanvasSize === true && this._isOutSideCanvas(pointer)) {
|
|
return;
|
|
}
|
|
if (this._captureDrawingPath(pointer) && this._points.length > 1) {
|
|
if (this.needsFullRender()) {
|
|
// redraw curve
|
|
// clear top canvas
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this._render();
|
|
}
|
|
else {
|
|
var points = this._points, length = points.length, ctx = this.canvas.contextTop;
|
|
// draw the curve update
|
|
this._saveAndTransform(ctx);
|
|
if (this.oldEnd) {
|
|
ctx.beginPath();
|
|
ctx.moveTo(this.oldEnd.x, this.oldEnd.y);
|
|
}
|
|
this.oldEnd = this._drawSegment(ctx, points[length - 2], points[length - 1], true);
|
|
ctx.stroke();
|
|
ctx.restore();
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse up
|
|
*/
|
|
onMouseUp: function(options) {
|
|
if (!this.canvas._isMainEvent(options.e)) {
|
|
return true;
|
|
}
|
|
this.oldEnd = undefined;
|
|
this._finalizeAndAddPath();
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} pointer Actual mouse position related to the canvas.
|
|
*/
|
|
_prepareForDrawing: function(pointer) {
|
|
|
|
var p = new fabric.Point(pointer.x, pointer.y);
|
|
|
|
this._reset();
|
|
this._addPoint(p);
|
|
this.canvas.contextTop.moveTo(p.x, p.y);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {fabric.Point} point Point to be added to points array
|
|
*/
|
|
_addPoint: function(point) {
|
|
if (this._points.length > 1 && point.eq(this._points[this._points.length - 1])) {
|
|
return false;
|
|
}
|
|
this._points.push(point);
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* Clear points array and set contextTop canvas style.
|
|
* @private
|
|
*/
|
|
_reset: function() {
|
|
this._points = [];
|
|
this._setBrushStyles();
|
|
this._setShadow();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} pointer Actual mouse position related to the canvas.
|
|
*/
|
|
_captureDrawingPath: function(pointer) {
|
|
var pointerPoint = new fabric.Point(pointer.x, pointer.y);
|
|
return this._addPoint(pointerPoint);
|
|
},
|
|
|
|
/**
|
|
* Draw a smooth path on the topCanvas using quadraticCurveTo
|
|
* @private
|
|
*/
|
|
_render: function() {
|
|
var ctx = this.canvas.contextTop, i, len,
|
|
p1 = this._points[0],
|
|
p2 = this._points[1];
|
|
|
|
this._saveAndTransform(ctx);
|
|
ctx.beginPath();
|
|
//if we only have 2 points in the path and they are the same
|
|
//it means that the user only clicked the canvas without moving the mouse
|
|
//then we should be drawing a dot. A path isn't drawn between two identical dots
|
|
//that's why we set them apart a bit
|
|
if (this._points.length === 2 && p1.x === p2.x && p1.y === p2.y) {
|
|
var width = this.width / 1000;
|
|
p1 = new fabric.Point(p1.x, p1.y);
|
|
p2 = new fabric.Point(p2.x, p2.y);
|
|
p1.x -= width;
|
|
p2.x += width;
|
|
}
|
|
ctx.moveTo(p1.x, p1.y);
|
|
|
|
for (i = 1, len = this._points.length; i < len; i++) {
|
|
// we pick the point between pi + 1 & pi + 2 as the
|
|
// end point and p1 as our control point.
|
|
this._drawSegment(ctx, p1, p2);
|
|
p1 = this._points[i];
|
|
p2 = this._points[i + 1];
|
|
}
|
|
// Draw last line as a straight line while
|
|
// we wait for the next point to be able to calculate
|
|
// the bezier control point
|
|
ctx.lineTo(p1.x, p1.y);
|
|
ctx.stroke();
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Converts points to SVG path
|
|
* @param {Array} points Array of points
|
|
* @return {(string|number)[][]} SVG path commands
|
|
*/
|
|
convertPointsToSVGPath: function (points) {
|
|
var correction = this.width / 1000;
|
|
return fabric.util.getSmoothPathFromPoints(points, correction);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {(string|number)[][]} pathData SVG path commands
|
|
* @returns {boolean}
|
|
*/
|
|
_isEmptySVGPath: function (pathData) {
|
|
var pathString = fabric.util.joinPath(pathData);
|
|
return pathString === 'M 0 0 Q 0 0 0 0 L 0 0';
|
|
},
|
|
|
|
/**
|
|
* Creates fabric.Path object to add on canvas
|
|
* @param {(string|number)[][]} pathData Path data
|
|
* @return {fabric.Path} Path to add on canvas
|
|
*/
|
|
createPath: function(pathData) {
|
|
var path = new fabric.Path(pathData, {
|
|
fill: null,
|
|
stroke: this.color,
|
|
strokeWidth: this.width,
|
|
strokeLineCap: this.strokeLineCap,
|
|
strokeMiterLimit: this.strokeMiterLimit,
|
|
strokeLineJoin: this.strokeLineJoin,
|
|
strokeDashArray: this.strokeDashArray,
|
|
});
|
|
if (this.shadow) {
|
|
this.shadow.affectStroke = true;
|
|
path.shadow = new fabric.Shadow(this.shadow);
|
|
}
|
|
|
|
return path;
|
|
},
|
|
|
|
/**
|
|
* Decimate points array with the decimate value
|
|
*/
|
|
decimatePoints: function(points, distance) {
|
|
if (points.length <= 2) {
|
|
return points;
|
|
}
|
|
var zoom = this.canvas.getZoom(), adjustedDistance = Math.pow(distance / zoom, 2),
|
|
i, l = points.length - 1, lastPoint = points[0], newPoints = [lastPoint],
|
|
cDistance;
|
|
for (i = 1; i < l - 1; i++) {
|
|
cDistance = Math.pow(lastPoint.x - points[i].x, 2) + Math.pow(lastPoint.y - points[i].y, 2);
|
|
if (cDistance >= adjustedDistance) {
|
|
lastPoint = points[i];
|
|
newPoints.push(lastPoint);
|
|
}
|
|
}
|
|
/**
|
|
* Add the last point from the original line to the end of the array.
|
|
* This ensures decimate doesn't delete the last point on the line, and ensures the line is > 1 point.
|
|
*/
|
|
newPoints.push(points[l]);
|
|
return newPoints;
|
|
},
|
|
|
|
/**
|
|
* On mouseup after drawing the path on contextTop canvas
|
|
* we use the points captured to create an new fabric path object
|
|
* and add it to the fabric canvas.
|
|
*/
|
|
_finalizeAndAddPath: function() {
|
|
var ctx = this.canvas.contextTop;
|
|
ctx.closePath();
|
|
if (this.decimate) {
|
|
this._points = this.decimatePoints(this._points, this.decimate);
|
|
}
|
|
var pathData = this.convertPointsToSVGPath(this._points);
|
|
if (this._isEmptySVGPath(pathData)) {
|
|
// do not create 0 width/height paths, as they are
|
|
// rendered inconsistently across browsers
|
|
// Firefox 4, for example, renders a dot,
|
|
// whereas Chrome 10 renders nothing
|
|
this.canvas.requestRenderAll();
|
|
return;
|
|
}
|
|
|
|
var path = this.createPath(pathData);
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this.canvas.fire('before:path:created', { path: path });
|
|
this.canvas.add(path);
|
|
this.canvas.requestRenderAll();
|
|
path.setCoords();
|
|
this._resetShadow();
|
|
|
|
|
|
// fire event 'path' created
|
|
this.canvas.fire('path:created', { path: path });
|
|
}
|
|
});
|
|
})();
|
|
|
|
|
|
/**
|
|
* CircleBrush class
|
|
* @class fabric.CircleBrush
|
|
*/
|
|
fabric.CircleBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.CircleBrush.prototype */ {
|
|
|
|
/**
|
|
* Width of a brush
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
width: 10,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {fabric.Canvas} canvas
|
|
* @return {fabric.CircleBrush} Instance of a circle brush
|
|
*/
|
|
initialize: function(canvas) {
|
|
this.canvas = canvas;
|
|
this.points = [];
|
|
},
|
|
|
|
/**
|
|
* Invoked inside on mouse down and mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
drawDot: function(pointer) {
|
|
var point = this.addPoint(pointer),
|
|
ctx = this.canvas.contextTop;
|
|
this._saveAndTransform(ctx);
|
|
this.dot(ctx, point);
|
|
ctx.restore();
|
|
},
|
|
|
|
dot: function(ctx, point) {
|
|
ctx.fillStyle = point.fill;
|
|
ctx.beginPath();
|
|
ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false);
|
|
ctx.closePath();
|
|
ctx.fill();
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse down
|
|
*/
|
|
onMouseDown: function(pointer) {
|
|
this.points.length = 0;
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this._setShadow();
|
|
this.drawDot(pointer);
|
|
},
|
|
|
|
/**
|
|
* Render the full state of the brush
|
|
* @private
|
|
*/
|
|
_render: function() {
|
|
var ctx = this.canvas.contextTop, i, len,
|
|
points = this.points;
|
|
this._saveAndTransform(ctx);
|
|
for (i = 0, len = points.length; i < len; i++) {
|
|
this.dot(ctx, points[i]);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseMove: function(pointer) {
|
|
if (this.limitedToCanvasSize === true && this._isOutSideCanvas(pointer)) {
|
|
return;
|
|
}
|
|
if (this.needsFullRender()) {
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this.addPoint(pointer);
|
|
this._render();
|
|
}
|
|
else {
|
|
this.drawDot(pointer);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse up
|
|
*/
|
|
onMouseUp: function() {
|
|
var originalRenderOnAddRemove = this.canvas.renderOnAddRemove, i, len;
|
|
this.canvas.renderOnAddRemove = false;
|
|
|
|
var circles = [];
|
|
|
|
for (i = 0, len = this.points.length; i < len; i++) {
|
|
var point = this.points[i],
|
|
circle = new fabric.Circle({
|
|
radius: point.radius,
|
|
left: point.x,
|
|
top: point.y,
|
|
originX: 'center',
|
|
originY: 'center',
|
|
fill: point.fill
|
|
});
|
|
|
|
this.shadow && (circle.shadow = new fabric.Shadow(this.shadow));
|
|
|
|
circles.push(circle);
|
|
}
|
|
var group = new fabric.Group(circles);
|
|
group.canvas = this.canvas;
|
|
|
|
this.canvas.fire('before:path:created', { path: group });
|
|
this.canvas.add(group);
|
|
this.canvas.fire('path:created', { path: group });
|
|
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this._resetShadow();
|
|
this.canvas.renderOnAddRemove = originalRenderOnAddRemove;
|
|
this.canvas.requestRenderAll();
|
|
},
|
|
|
|
/**
|
|
* @param {Object} pointer
|
|
* @return {fabric.Point} Just added pointer point
|
|
*/
|
|
addPoint: function(pointer) {
|
|
var pointerPoint = new fabric.Point(pointer.x, pointer.y),
|
|
|
|
circleRadius = fabric.util.getRandomInt(
|
|
Math.max(0, this.width - 20), this.width + 20) / 2,
|
|
|
|
circleColor = new fabric.Color(this.color)
|
|
.setAlpha(fabric.util.getRandomInt(0, 100) / 100)
|
|
.toRgba();
|
|
|
|
pointerPoint.radius = circleRadius;
|
|
pointerPoint.fill = circleColor;
|
|
|
|
this.points.push(pointerPoint);
|
|
|
|
return pointerPoint;
|
|
}
|
|
});
|
|
|
|
|
|
/**
|
|
* SprayBrush class
|
|
* @class fabric.SprayBrush
|
|
*/
|
|
fabric.SprayBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.SprayBrush.prototype */ {
|
|
|
|
/**
|
|
* Width of a spray
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
width: 10,
|
|
|
|
/**
|
|
* Density of a spray (number of dots per chunk)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
density: 20,
|
|
|
|
/**
|
|
* Width of spray dots
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
dotWidth: 1,
|
|
|
|
/**
|
|
* Width variance of spray dots
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
dotWidthVariance: 1,
|
|
|
|
/**
|
|
* Whether opacity of a dot should be random
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
randomOpacity: false,
|
|
|
|
/**
|
|
* Whether overlapping dots (rectangles) should be removed (for performance reasons)
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
optimizeOverlapping: true,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {fabric.Canvas} canvas
|
|
* @return {fabric.SprayBrush} Instance of a spray brush
|
|
*/
|
|
initialize: function(canvas) {
|
|
this.canvas = canvas;
|
|
this.sprayChunks = [];
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse down
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseDown: function(pointer) {
|
|
this.sprayChunks.length = 0;
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this._setShadow();
|
|
|
|
this.addSprayChunk(pointer);
|
|
this.render(this.sprayChunkPoints);
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse move
|
|
* @param {Object} pointer
|
|
*/
|
|
onMouseMove: function(pointer) {
|
|
if (this.limitedToCanvasSize === true && this._isOutSideCanvas(pointer)) {
|
|
return;
|
|
}
|
|
this.addSprayChunk(pointer);
|
|
this.render(this.sprayChunkPoints);
|
|
},
|
|
|
|
/**
|
|
* Invoked on mouse up
|
|
*/
|
|
onMouseUp: function() {
|
|
var originalRenderOnAddRemove = this.canvas.renderOnAddRemove;
|
|
this.canvas.renderOnAddRemove = false;
|
|
|
|
var rects = [];
|
|
|
|
for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) {
|
|
var sprayChunk = this.sprayChunks[i];
|
|
|
|
for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) {
|
|
|
|
var rect = new fabric.Rect({
|
|
width: sprayChunk[j].width,
|
|
height: sprayChunk[j].width,
|
|
left: sprayChunk[j].x + 1,
|
|
top: sprayChunk[j].y + 1,
|
|
originX: 'center',
|
|
originY: 'center',
|
|
fill: this.color
|
|
});
|
|
rects.push(rect);
|
|
}
|
|
}
|
|
|
|
if (this.optimizeOverlapping) {
|
|
rects = this._getOptimizedRects(rects);
|
|
}
|
|
|
|
var group = new fabric.Group(rects);
|
|
this.shadow && group.set('shadow', new fabric.Shadow(this.shadow));
|
|
this.canvas.fire('before:path:created', { path: group });
|
|
this.canvas.add(group);
|
|
this.canvas.fire('path:created', { path: group });
|
|
|
|
this.canvas.clearContext(this.canvas.contextTop);
|
|
this._resetShadow();
|
|
this.canvas.renderOnAddRemove = originalRenderOnAddRemove;
|
|
this.canvas.requestRenderAll();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Array} rects
|
|
*/
|
|
_getOptimizedRects: function(rects) {
|
|
|
|
// avoid creating duplicate rects at the same coordinates
|
|
var uniqueRects = { }, key, i, len;
|
|
|
|
for (i = 0, len = rects.length; i < len; i++) {
|
|
key = rects[i].left + '' + rects[i].top;
|
|
if (!uniqueRects[key]) {
|
|
uniqueRects[key] = rects[i];
|
|
}
|
|
}
|
|
var uniqueRectsArray = [];
|
|
for (key in uniqueRects) {
|
|
uniqueRectsArray.push(uniqueRects[key]);
|
|
}
|
|
|
|
return uniqueRectsArray;
|
|
},
|
|
|
|
/**
|
|
* Render new chunk of spray brush
|
|
*/
|
|
render: function(sprayChunk) {
|
|
var ctx = this.canvas.contextTop, i, len;
|
|
ctx.fillStyle = this.color;
|
|
|
|
this._saveAndTransform(ctx);
|
|
|
|
for (i = 0, len = sprayChunk.length; i < len; i++) {
|
|
var point = sprayChunk[i];
|
|
if (typeof point.opacity !== 'undefined') {
|
|
ctx.globalAlpha = point.opacity;
|
|
}
|
|
ctx.fillRect(point.x, point.y, point.width, point.width);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Render all spray chunks
|
|
*/
|
|
_render: function() {
|
|
var ctx = this.canvas.contextTop, i, ilen;
|
|
ctx.fillStyle = this.color;
|
|
|
|
this._saveAndTransform(ctx);
|
|
|
|
for (i = 0, ilen = this.sprayChunks.length; i < ilen; i++) {
|
|
this.render(this.sprayChunks[i]);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @param {Object} pointer
|
|
*/
|
|
addSprayChunk: function(pointer) {
|
|
this.sprayChunkPoints = [];
|
|
|
|
var x, y, width, radius = this.width / 2, i;
|
|
|
|
for (i = 0; i < this.density; i++) {
|
|
|
|
x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius);
|
|
y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius);
|
|
|
|
if (this.dotWidthVariance) {
|
|
width = fabric.util.getRandomInt(
|
|
// bottom clamp width to 1
|
|
Math.max(1, this.dotWidth - this.dotWidthVariance),
|
|
this.dotWidth + this.dotWidthVariance);
|
|
}
|
|
else {
|
|
width = this.dotWidth;
|
|
}
|
|
|
|
var point = new fabric.Point(x, y);
|
|
point.width = width;
|
|
|
|
if (this.randomOpacity) {
|
|
point.opacity = fabric.util.getRandomInt(0, 100) / 100;
|
|
}
|
|
|
|
this.sprayChunkPoints.push(point);
|
|
}
|
|
|
|
this.sprayChunks.push(this.sprayChunkPoints);
|
|
}
|
|
});
|
|
|
|
|
|
/**
|
|
* PatternBrush class
|
|
* @class fabric.PatternBrush
|
|
* @extends fabric.BaseBrush
|
|
*/
|
|
fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, /** @lends fabric.PatternBrush.prototype */ {
|
|
|
|
getPatternSrc: function() {
|
|
|
|
var dotWidth = 20,
|
|
dotDistance = 5,
|
|
patternCanvas = fabric.util.createCanvasElement(),
|
|
patternCtx = patternCanvas.getContext('2d');
|
|
|
|
patternCanvas.width = patternCanvas.height = dotWidth + dotDistance;
|
|
|
|
patternCtx.fillStyle = this.color;
|
|
patternCtx.beginPath();
|
|
patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false);
|
|
patternCtx.closePath();
|
|
patternCtx.fill();
|
|
|
|
return patternCanvas;
|
|
},
|
|
|
|
getPatternSrcFunction: function() {
|
|
return String(this.getPatternSrc).replace('this.color', '"' + this.color + '"');
|
|
},
|
|
|
|
/**
|
|
* Creates "pattern" instance property
|
|
*/
|
|
getPattern: function() {
|
|
return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), 'repeat');
|
|
},
|
|
|
|
/**
|
|
* Sets brush styles
|
|
*/
|
|
_setBrushStyles: function() {
|
|
this.callSuper('_setBrushStyles');
|
|
this.canvas.contextTop.strokeStyle = this.getPattern();
|
|
},
|
|
|
|
/**
|
|
* Creates path
|
|
*/
|
|
createPath: function(pathData) {
|
|
var path = this.callSuper('createPath', pathData),
|
|
topLeft = path._getLeftTopCoords().scalarAdd(path.strokeWidth / 2);
|
|
|
|
path.stroke = new fabric.Pattern({
|
|
source: this.source || this.getPatternSrcFunction(),
|
|
offsetX: -topLeft.x,
|
|
offsetY: -topLeft.y
|
|
});
|
|
return path;
|
|
}
|
|
});
|
|
|
|
|
|
(function() {
|
|
|
|
var getPointer = fabric.util.getPointer,
|
|
degreesToRadians = fabric.util.degreesToRadians,
|
|
isTouchEvent = fabric.util.isTouchEvent;
|
|
|
|
/**
|
|
* Canvas class
|
|
* @class fabric.Canvas
|
|
* @extends fabric.StaticCanvas
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-1#canvas}
|
|
* @see {@link fabric.Canvas#initialize} for constructor definition
|
|
*
|
|
* @fires object:modified at the end of a transform or any change when statefull is true
|
|
* @fires object:rotating while an object is being rotated from the control
|
|
* @fires object:scaling while an object is being scaled by controls
|
|
* @fires object:moving while an object is being dragged
|
|
* @fires object:skewing while an object is being skewed from the controls
|
|
*
|
|
* @fires before:transform before a transform is is started
|
|
* @fires before:selection:cleared
|
|
* @fires selection:cleared
|
|
* @fires selection:updated
|
|
* @fires selection:created
|
|
*
|
|
* @fires path:created after a drawing operation ends and the path is added
|
|
* @fires mouse:down
|
|
* @fires mouse:move
|
|
* @fires mouse:up
|
|
* @fires mouse:down:before on mouse down, before the inner fabric logic runs
|
|
* @fires mouse:move:before on mouse move, before the inner fabric logic runs
|
|
* @fires mouse:up:before on mouse up, before the inner fabric logic runs
|
|
* @fires mouse:over
|
|
* @fires mouse:out
|
|
* @fires mouse:dblclick whenever a native dbl click event fires on the canvas.
|
|
*
|
|
* @fires dragover
|
|
* @fires dragenter
|
|
* @fires dragleave
|
|
* @fires drop
|
|
* @fires after:render at the end of the render process, receives the context in the callback
|
|
* @fires before:render at start the render process, receives the context in the callback
|
|
*
|
|
* the following events are deprecated:
|
|
* @fires object:rotated at the end of a rotation transform
|
|
* @fires object:scaled at the end of a scale transform
|
|
* @fires object:moved at the end of translation transform
|
|
* @fires object:skewed at the end of a skew transform
|
|
*/
|
|
fabric.Canvas = fabric.util.createClass(fabric.StaticCanvas, /** @lends fabric.Canvas.prototype */ {
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {HTMLElement | String} el <canvas> element to initialize instance on
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(el, options) {
|
|
options || (options = { });
|
|
this.renderAndResetBound = this.renderAndReset.bind(this);
|
|
this.requestRenderAllBound = this.requestRenderAll.bind(this);
|
|
this._initStatic(el, options);
|
|
this._initInteractive();
|
|
this._createCacheCanvas();
|
|
},
|
|
|
|
/**
|
|
* When true, objects can be transformed by one side (unproportionally)
|
|
* when dragged on the corners that normally would not do that.
|
|
* @type Boolean
|
|
* @default
|
|
* @since fabric 4.0 // changed name and default value
|
|
*/
|
|
uniformScaling: true,
|
|
|
|
/**
|
|
* Indicates which key switches uniform scaling.
|
|
* values: 'altKey', 'shiftKey', 'ctrlKey'.
|
|
* If `null` or 'none' or any other string that is not a modifier key
|
|
* feature is disabled.
|
|
* totally wrong named. this sounds like `uniform scaling`
|
|
* if Canvas.uniformScaling is true, pressing this will set it to false
|
|
* and viceversa.
|
|
* @since 1.6.2
|
|
* @type String
|
|
* @default
|
|
*/
|
|
uniScaleKey: 'shiftKey',
|
|
|
|
/**
|
|
* When true, objects use center point as the origin of scale transformation.
|
|
* <b>Backwards incompatibility note:</b> This property replaces "centerTransform" (Boolean).
|
|
* @since 1.3.4
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
centeredScaling: false,
|
|
|
|
/**
|
|
* When true, objects use center point as the origin of rotate transformation.
|
|
* <b>Backwards incompatibility note:</b> This property replaces "centerTransform" (Boolean).
|
|
* @since 1.3.4
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
centeredRotation: false,
|
|
|
|
/**
|
|
* Indicates which key enable centered Transform
|
|
* values: 'altKey', 'shiftKey', 'ctrlKey'.
|
|
* If `null` or 'none' or any other string that is not a modifier key
|
|
* feature is disabled feature disabled.
|
|
* @since 1.6.2
|
|
* @type String
|
|
* @default
|
|
*/
|
|
centeredKey: 'altKey',
|
|
|
|
/**
|
|
* Indicates which key enable alternate action on corner
|
|
* values: 'altKey', 'shiftKey', 'ctrlKey'.
|
|
* If `null` or 'none' or any other string that is not a modifier key
|
|
* feature is disabled feature disabled.
|
|
* @since 1.6.2
|
|
* @type String
|
|
* @default
|
|
*/
|
|
altActionKey: 'shiftKey',
|
|
|
|
/**
|
|
* Indicates that canvas is interactive. This property should not be changed.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
interactive: true,
|
|
|
|
/**
|
|
* Indicates whether group selection should be enabled
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
selection: true,
|
|
|
|
/**
|
|
* Indicates which key or keys enable multiple click selection
|
|
* Pass value as a string or array of strings
|
|
* values: 'altKey', 'shiftKey', 'ctrlKey'.
|
|
* If `null` or empty or containing any other string that is not a modifier key
|
|
* feature is disabled.
|
|
* @since 1.6.2
|
|
* @type String|Array
|
|
* @default
|
|
*/
|
|
selectionKey: 'shiftKey',
|
|
|
|
/**
|
|
* Indicates which key enable alternative selection
|
|
* in case of target overlapping with active object
|
|
* values: 'altKey', 'shiftKey', 'ctrlKey'.
|
|
* For a series of reason that come from the general expectations on how
|
|
* things should work, this feature works only for preserveObjectStacking true.
|
|
* If `null` or 'none' or any other string that is not a modifier key
|
|
* feature is disabled.
|
|
* @since 1.6.5
|
|
* @type null|String
|
|
* @default
|
|
*/
|
|
altSelectionKey: null,
|
|
|
|
/**
|
|
* Color of selection
|
|
* @type String
|
|
* @default
|
|
*/
|
|
selectionColor: 'rgba(100, 100, 255, 0.3)', // blue
|
|
|
|
/**
|
|
* Default dash array pattern
|
|
* If not empty the selection border is dashed
|
|
* @type Array
|
|
*/
|
|
selectionDashArray: [],
|
|
|
|
/**
|
|
* Color of the border of selection (usually slightly darker than color of selection itself)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
selectionBorderColor: 'rgba(255, 255, 255, 0.3)',
|
|
|
|
/**
|
|
* Width of a line used in object/group selection
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
selectionLineWidth: 1,
|
|
|
|
/**
|
|
* Select only shapes that are fully contained in the dragged selection rectangle.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
selectionFullyContained: false,
|
|
|
|
/**
|
|
* Default cursor value used when hovering over an object on canvas
|
|
* @type String
|
|
* @default
|
|
*/
|
|
hoverCursor: 'move',
|
|
|
|
/**
|
|
* Default cursor value used when moving an object on canvas
|
|
* @type String
|
|
* @default
|
|
*/
|
|
moveCursor: 'move',
|
|
|
|
/**
|
|
* Default cursor value used for the entire canvas
|
|
* @type String
|
|
* @default
|
|
*/
|
|
defaultCursor: 'default',
|
|
|
|
/**
|
|
* Cursor value used during free drawing
|
|
* @type String
|
|
* @default
|
|
*/
|
|
freeDrawingCursor: 'crosshair',
|
|
|
|
/**
|
|
* Cursor value used for rotation point
|
|
* @type String
|
|
* @default
|
|
*/
|
|
rotationCursor: 'crosshair',
|
|
|
|
/**
|
|
* Cursor value used for disabled elements ( corners with disabled action )
|
|
* @type String
|
|
* @since 2.0.0
|
|
* @default
|
|
*/
|
|
notAllowedCursor: 'not-allowed',
|
|
|
|
/**
|
|
* Default element class that's given to wrapper (div) element of canvas
|
|
* @type String
|
|
* @default
|
|
*/
|
|
containerClass: 'canvas-container',
|
|
|
|
/**
|
|
* When true, object detection happens on per-pixel basis rather than on per-bounding-box
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
perPixelTargetFind: false,
|
|
|
|
/**
|
|
* Number of pixels around target pixel to tolerate (consider active) during object detection
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
targetFindTolerance: 0,
|
|
|
|
/**
|
|
* When true, target detection is skipped. Target detection will return always undefined.
|
|
* click selection won't work anymore, events will fire with no targets.
|
|
* if something is selected before setting it to true, it will be deselected at the first click.
|
|
* area selection will still work. check the `selection` property too.
|
|
* if you deactivate both, you should look into staticCanvas.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
skipTargetFind: false,
|
|
|
|
/**
|
|
* When true, mouse events on canvas (mousedown/mousemove/mouseup) result in free drawing.
|
|
* After mousedown, mousemove creates a shape,
|
|
* and then mouseup finalizes it and adds an instance of `fabric.Path` onto canvas.
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-4#free_drawing}
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
isDrawingMode: false,
|
|
|
|
/**
|
|
* Indicates whether objects should remain in current stack position when selected.
|
|
* When false objects are brought to top and rendered as part of the selection group
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
preserveObjectStacking: false,
|
|
|
|
/**
|
|
* Indicates the angle that an object will lock to while rotating.
|
|
* @type Number
|
|
* @since 1.6.7
|
|
* @default
|
|
*/
|
|
snapAngle: 0,
|
|
|
|
/**
|
|
* Indicates the distance from the snapAngle the rotation will lock to the snapAngle.
|
|
* When `null`, the snapThreshold will default to the snapAngle.
|
|
* @type null|Number
|
|
* @since 1.6.7
|
|
* @default
|
|
*/
|
|
snapThreshold: null,
|
|
|
|
/**
|
|
* Indicates if the right click on canvas can output the context menu or not
|
|
* @type Boolean
|
|
* @since 1.6.5
|
|
* @default
|
|
*/
|
|
stopContextMenu: false,
|
|
|
|
/**
|
|
* Indicates if the canvas can fire right click events
|
|
* @type Boolean
|
|
* @since 1.6.5
|
|
* @default
|
|
*/
|
|
fireRightClick: false,
|
|
|
|
/**
|
|
* Indicates if the canvas can fire middle click events
|
|
* @type Boolean
|
|
* @since 1.7.8
|
|
* @default
|
|
*/
|
|
fireMiddleClick: false,
|
|
|
|
/**
|
|
* Keep track of the subTargets for Mouse Events
|
|
* @type fabric.Object[]
|
|
*/
|
|
targets: [],
|
|
|
|
/**
|
|
* Keep track of the hovered target
|
|
* @type fabric.Object
|
|
* @private
|
|
*/
|
|
_hoveredTarget: null,
|
|
|
|
/**
|
|
* hold the list of nested targets hovered
|
|
* @type fabric.Object[]
|
|
* @private
|
|
*/
|
|
_hoveredTargets: [],
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initInteractive: function() {
|
|
this._currentTransform = null;
|
|
this._groupSelector = null;
|
|
this._initWrapperElement();
|
|
this._createUpperCanvas();
|
|
this._initEventListeners();
|
|
|
|
this._initRetinaScaling();
|
|
|
|
this.freeDrawingBrush = fabric.PencilBrush && new fabric.PencilBrush(this);
|
|
|
|
this.calcOffset();
|
|
},
|
|
|
|
/**
|
|
* Divides objects in two groups, one to render immediately
|
|
* and one to render as activeGroup.
|
|
* @return {Array} objects to render immediately and pushes the other in the activeGroup.
|
|
*/
|
|
_chooseObjectsToRender: function() {
|
|
var activeObjects = this.getActiveObjects(),
|
|
object, objsToRender, activeGroupObjects;
|
|
|
|
if (activeObjects.length > 0 && !this.preserveObjectStacking) {
|
|
objsToRender = [];
|
|
activeGroupObjects = [];
|
|
for (var i = 0, length = this._objects.length; i < length; i++) {
|
|
object = this._objects[i];
|
|
if (activeObjects.indexOf(object) === -1 ) {
|
|
objsToRender.push(object);
|
|
}
|
|
else {
|
|
activeGroupObjects.push(object);
|
|
}
|
|
}
|
|
if (activeObjects.length > 1) {
|
|
this._activeObject._objects = activeGroupObjects;
|
|
}
|
|
objsToRender.push.apply(objsToRender, activeGroupObjects);
|
|
}
|
|
else {
|
|
objsToRender = this._objects;
|
|
}
|
|
return objsToRender;
|
|
},
|
|
|
|
/**
|
|
* Renders both the top canvas and the secondary container canvas.
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
*/
|
|
renderAll: function () {
|
|
if (this.contextTopDirty && !this._groupSelector && !this.isDrawingMode) {
|
|
this.clearContext(this.contextTop);
|
|
this.contextTopDirty = false;
|
|
}
|
|
if (this.hasLostContext) {
|
|
this.renderTopLayer(this.contextTop);
|
|
}
|
|
var canvasToDrawOn = this.contextContainer;
|
|
this.renderCanvas(canvasToDrawOn, this._chooseObjectsToRender());
|
|
return this;
|
|
},
|
|
|
|
renderTopLayer: function(ctx) {
|
|
ctx.save();
|
|
if (this.isDrawingMode && this._isCurrentlyDrawing) {
|
|
this.freeDrawingBrush && this.freeDrawingBrush._render();
|
|
this.contextTopDirty = true;
|
|
}
|
|
// we render the top context - last object
|
|
if (this.selection && this._groupSelector) {
|
|
this._drawSelection(ctx);
|
|
this.contextTopDirty = true;
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Method to render only the top canvas.
|
|
* Also used to render the group selection box.
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
renderTop: function () {
|
|
var ctx = this.contextTop;
|
|
this.clearContext(ctx);
|
|
this.renderTopLayer(ctx);
|
|
this.fire('after:render');
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_normalizePointer: function (object, pointer) {
|
|
var m = object.calcTransformMatrix(),
|
|
invertedM = fabric.util.invertTransform(m),
|
|
vptPointer = this.restorePointerVpt(pointer);
|
|
return fabric.util.transformPoint(vptPointer, invertedM);
|
|
},
|
|
|
|
/**
|
|
* Returns true if object is transparent at a certain location
|
|
* @param {fabric.Object} target Object to check
|
|
* @param {Number} x Left coordinate
|
|
* @param {Number} y Top coordinate
|
|
* @return {Boolean}
|
|
*/
|
|
isTargetTransparent: function (target, x, y) {
|
|
// in case the target is the activeObject, we cannot execute this optimization
|
|
// because we need to draw controls too.
|
|
if (target.shouldCache() && target._cacheCanvas && target !== this._activeObject) {
|
|
var normalizedPointer = this._normalizePointer(target, {x: x, y: y}),
|
|
targetRelativeX = Math.max(target.cacheTranslationX + (normalizedPointer.x * target.zoomX), 0),
|
|
targetRelativeY = Math.max(target.cacheTranslationY + (normalizedPointer.y * target.zoomY), 0);
|
|
|
|
var isTransparent = fabric.util.isTransparent(
|
|
target._cacheContext, Math.round(targetRelativeX), Math.round(targetRelativeY), this.targetFindTolerance);
|
|
|
|
return isTransparent;
|
|
}
|
|
|
|
var ctx = this.contextCache,
|
|
originalColor = target.selectionBackgroundColor, v = this.viewportTransform;
|
|
|
|
target.selectionBackgroundColor = '';
|
|
|
|
this.clearContext(ctx);
|
|
|
|
ctx.save();
|
|
ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]);
|
|
target.render(ctx);
|
|
ctx.restore();
|
|
|
|
target.selectionBackgroundColor = originalColor;
|
|
|
|
var isTransparent = fabric.util.isTransparent(
|
|
ctx, x, y, this.targetFindTolerance);
|
|
|
|
return isTransparent;
|
|
},
|
|
|
|
/**
|
|
* takes an event and determines if selection key has been pressed
|
|
* @private
|
|
* @param {Event} e Event object
|
|
*/
|
|
_isSelectionKeyPressed: function(e) {
|
|
var selectionKeyPressed = false;
|
|
|
|
if (Object.prototype.toString.call(this.selectionKey) === '[object Array]') {
|
|
selectionKeyPressed = !!this.selectionKey.find(function(key) { return e[key] === true; });
|
|
}
|
|
else {
|
|
selectionKeyPressed = e[this.selectionKey];
|
|
}
|
|
|
|
return selectionKeyPressed;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object
|
|
* @param {fabric.Object} target
|
|
*/
|
|
_shouldClearSelection: function (e, target) {
|
|
var activeObjects = this.getActiveObjects(),
|
|
activeObject = this._activeObject;
|
|
|
|
return (
|
|
!target
|
|
||
|
|
(target &&
|
|
activeObject &&
|
|
activeObjects.length > 1 &&
|
|
activeObjects.indexOf(target) === -1 &&
|
|
activeObject !== target &&
|
|
!this._isSelectionKeyPressed(e))
|
|
||
|
|
(target && !target.evented)
|
|
||
|
|
(target &&
|
|
!target.selectable &&
|
|
activeObject &&
|
|
activeObject !== target)
|
|
);
|
|
},
|
|
|
|
/**
|
|
* centeredScaling from object can't override centeredScaling from canvas.
|
|
* this should be fixed, since object setting should take precedence over canvas.
|
|
* also this should be something that will be migrated in the control properties.
|
|
* as ability to define the origin of the transformation that the control provide.
|
|
* @private
|
|
* @param {fabric.Object} target
|
|
* @param {String} action
|
|
* @param {Boolean} altKey
|
|
*/
|
|
_shouldCenterTransform: function (target, action, altKey) {
|
|
if (!target) {
|
|
return;
|
|
}
|
|
|
|
var centerTransform;
|
|
|
|
if (action === 'scale' || action === 'scaleX' || action === 'scaleY' || action === 'resizing') {
|
|
centerTransform = this.centeredScaling || target.centeredScaling;
|
|
}
|
|
else if (action === 'rotate') {
|
|
centerTransform = this.centeredRotation || target.centeredRotation;
|
|
}
|
|
|
|
return centerTransform ? !altKey : altKey;
|
|
},
|
|
|
|
/**
|
|
* should disappear before release 4.0
|
|
* @private
|
|
*/
|
|
_getOriginFromCorner: function(target, corner) {
|
|
var origin = {
|
|
x: target.originX,
|
|
y: target.originY
|
|
};
|
|
|
|
if (corner === 'ml' || corner === 'tl' || corner === 'bl') {
|
|
origin.x = 'right';
|
|
}
|
|
else if (corner === 'mr' || corner === 'tr' || corner === 'br') {
|
|
origin.x = 'left';
|
|
}
|
|
|
|
if (corner === 'tl' || corner === 'mt' || corner === 'tr') {
|
|
origin.y = 'bottom';
|
|
}
|
|
else if (corner === 'bl' || corner === 'mb' || corner === 'br') {
|
|
origin.y = 'top';
|
|
}
|
|
return origin;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Boolean} alreadySelected true if target is already selected
|
|
* @param {String} corner a string representing the corner ml, mr, tl ...
|
|
* @param {Event} e Event object
|
|
* @param {fabric.Object} [target] inserted back to help overriding. Unused
|
|
*/
|
|
_getActionFromCorner: function(alreadySelected, corner, e, target) {
|
|
if (!corner || !alreadySelected) {
|
|
return 'drag';
|
|
}
|
|
var control = target.controls[corner];
|
|
return control.getActionName(e, control, target);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object
|
|
* @param {fabric.Object} target
|
|
*/
|
|
_setupCurrentTransform: function (e, target, alreadySelected) {
|
|
if (!target) {
|
|
return;
|
|
}
|
|
|
|
var pointer = this.getPointer(e), corner = target.__corner,
|
|
control = target.controls[corner],
|
|
actionHandler = (alreadySelected && corner) ?
|
|
control.getActionHandler(e, target, control) : fabric.controlsUtils.dragHandler,
|
|
action = this._getActionFromCorner(alreadySelected, corner, e, target),
|
|
origin = this._getOriginFromCorner(target, corner),
|
|
altKey = e[this.centeredKey],
|
|
transform = {
|
|
target: target,
|
|
action: action,
|
|
actionHandler: actionHandler,
|
|
corner: corner,
|
|
scaleX: target.scaleX,
|
|
scaleY: target.scaleY,
|
|
skewX: target.skewX,
|
|
skewY: target.skewY,
|
|
// used by transation
|
|
offsetX: pointer.x - target.left,
|
|
offsetY: pointer.y - target.top,
|
|
originX: origin.x,
|
|
originY: origin.y,
|
|
ex: pointer.x,
|
|
ey: pointer.y,
|
|
lastX: pointer.x,
|
|
lastY: pointer.y,
|
|
// unsure they are useful anymore.
|
|
// left: target.left,
|
|
// top: target.top,
|
|
theta: degreesToRadians(target.angle),
|
|
// end of unsure
|
|
width: target.width * target.scaleX,
|
|
shiftKey: e.shiftKey,
|
|
altKey: altKey,
|
|
original: fabric.util.saveObjectTransform(target),
|
|
};
|
|
|
|
if (this._shouldCenterTransform(target, action, altKey)) {
|
|
transform.originX = 'center';
|
|
transform.originY = 'center';
|
|
}
|
|
transform.original.originX = origin.x;
|
|
transform.original.originY = origin.y;
|
|
this._currentTransform = transform;
|
|
this._beforeTransform(e);
|
|
},
|
|
|
|
/**
|
|
* Set the cursor type of the canvas element
|
|
* @param {String} value Cursor type of the canvas element.
|
|
* @see http://www.w3.org/TR/css3-ui/#cursor
|
|
*/
|
|
setCursor: function (value) {
|
|
this.upperCanvasEl.style.cursor = value;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx to draw the selection on
|
|
*/
|
|
_drawSelection: function (ctx) {
|
|
var selector = this._groupSelector,
|
|
viewportStart = new fabric.Point(selector.ex, selector.ey),
|
|
start = fabric.util.transformPoint(viewportStart, this.viewportTransform),
|
|
viewportExtent = new fabric.Point(selector.ex + selector.left, selector.ey + selector.top),
|
|
extent = fabric.util.transformPoint(viewportExtent, this.viewportTransform),
|
|
minX = Math.min(start.x, extent.x),
|
|
minY = Math.min(start.y, extent.y),
|
|
maxX = Math.max(start.x, extent.x),
|
|
maxY = Math.max(start.y, extent.y),
|
|
strokeOffset = this.selectionLineWidth / 2;
|
|
|
|
if (this.selectionColor) {
|
|
ctx.fillStyle = this.selectionColor;
|
|
ctx.fillRect(minX, minY, maxX - minX, maxY - minY);
|
|
}
|
|
|
|
if (!this.selectionLineWidth || !this.selectionBorderColor) {
|
|
return;
|
|
}
|
|
ctx.lineWidth = this.selectionLineWidth;
|
|
ctx.strokeStyle = this.selectionBorderColor;
|
|
|
|
minX += strokeOffset;
|
|
minY += strokeOffset;
|
|
maxX -= strokeOffset;
|
|
maxY -= strokeOffset;
|
|
// selection border
|
|
fabric.Object.prototype._setLineDash.call(this, ctx, this.selectionDashArray);
|
|
ctx.strokeRect(minX, minY, maxX - minX, maxY - minY);
|
|
},
|
|
|
|
/**
|
|
* Method that determines what object we are clicking on
|
|
* the skipGroup parameter is for internal use, is needed for shift+click action
|
|
* 11/09/2018 TODO: would be cool if findTarget could discern between being a full target
|
|
* or the outside part of the corner.
|
|
* @param {Event} e mouse event
|
|
* @param {Boolean} skipGroup when true, activeGroup is skipped and only objects are traversed through
|
|
* @return {fabric.Object} the target found
|
|
*/
|
|
findTarget: function (e, skipGroup) {
|
|
if (this.skipTargetFind) {
|
|
return;
|
|
}
|
|
|
|
var ignoreZoom = true,
|
|
pointer = this.getPointer(e, ignoreZoom),
|
|
activeObject = this._activeObject,
|
|
aObjects = this.getActiveObjects(),
|
|
activeTarget, activeTargetSubs,
|
|
isTouch = isTouchEvent(e),
|
|
shouldLookForActive = (aObjects.length > 1 && !skipGroup) || aObjects.length === 1;
|
|
|
|
// first check current group (if one exists)
|
|
// active group does not check sub targets like normal groups.
|
|
// if active group just exits.
|
|
this.targets = [];
|
|
|
|
// if we hit the corner of an activeObject, let's return that.
|
|
if (shouldLookForActive && activeObject._findTargetCorner(pointer, isTouch)) {
|
|
return activeObject;
|
|
}
|
|
if (aObjects.length > 1 && !skipGroup && activeObject === this._searchPossibleTargets([activeObject], pointer)) {
|
|
return activeObject;
|
|
}
|
|
if (aObjects.length === 1 &&
|
|
activeObject === this._searchPossibleTargets([activeObject], pointer)) {
|
|
if (!this.preserveObjectStacking) {
|
|
return activeObject;
|
|
}
|
|
else {
|
|
activeTarget = activeObject;
|
|
activeTargetSubs = this.targets;
|
|
this.targets = [];
|
|
}
|
|
}
|
|
var target = this._searchPossibleTargets(this._objects, pointer);
|
|
if (e[this.altSelectionKey] && target && activeTarget && target !== activeTarget) {
|
|
target = activeTarget;
|
|
this.targets = activeTargetSubs;
|
|
}
|
|
return target;
|
|
},
|
|
|
|
/**
|
|
* Checks point is inside the object.
|
|
* @param {Object} [pointer] x,y object of point coordinates we want to check.
|
|
* @param {fabric.Object} obj Object to test against
|
|
* @param {Object} [globalPointer] x,y object of point coordinates relative to canvas used to search per pixel target.
|
|
* @return {Boolean} true if point is contained within an area of given object
|
|
* @private
|
|
*/
|
|
_checkTarget: function(pointer, obj, globalPointer) {
|
|
if (obj &&
|
|
obj.visible &&
|
|
obj.evented &&
|
|
// http://www.geog.ubc.ca/courses/klink/gis.notes/ncgia/u32.html
|
|
// http://idav.ucdavis.edu/~okreylos/TAship/Spring2000/PointInPolygon.html
|
|
obj.containsPoint(pointer)
|
|
) {
|
|
if ((this.perPixelTargetFind || obj.perPixelTargetFind) && !obj.isEditing) {
|
|
var isTransparent = this.isTargetTransparent(obj, globalPointer.x, globalPointer.y);
|
|
if (!isTransparent) {
|
|
return true;
|
|
}
|
|
}
|
|
else {
|
|
return true;
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Function used to search inside objects an object that contains pointer in bounding box or that contains pointerOnCanvas when painted
|
|
* @param {Array} [objects] objects array to look into
|
|
* @param {Object} [pointer] x,y object of point coordinates we want to check.
|
|
* @return {fabric.Object} object that contains pointer
|
|
* @private
|
|
*/
|
|
_searchPossibleTargets: function(objects, pointer) {
|
|
// Cache all targets where their bounding box contains point.
|
|
var target, i = objects.length, subTarget;
|
|
// Do not check for currently grouped objects, since we check the parent group itself.
|
|
// until we call this function specifically to search inside the activeGroup
|
|
while (i--) {
|
|
var objToCheck = objects[i];
|
|
var pointerToUse = objToCheck.group ?
|
|
this._normalizePointer(objToCheck.group, pointer) : pointer;
|
|
if (this._checkTarget(pointerToUse, objToCheck, pointer)) {
|
|
target = objects[i];
|
|
if (target.subTargetCheck && target instanceof fabric.Group) {
|
|
subTarget = this._searchPossibleTargets(target._objects, pointer);
|
|
subTarget && this.targets.push(subTarget);
|
|
}
|
|
break;
|
|
}
|
|
}
|
|
return target;
|
|
},
|
|
|
|
/**
|
|
* Returns pointer coordinates without the effect of the viewport
|
|
* @param {Object} pointer with "x" and "y" number values
|
|
* @return {Object} object with "x" and "y" number values
|
|
*/
|
|
restorePointerVpt: function(pointer) {
|
|
return fabric.util.transformPoint(
|
|
pointer,
|
|
fabric.util.invertTransform(this.viewportTransform)
|
|
);
|
|
},
|
|
|
|
/**
|
|
* Returns pointer coordinates relative to canvas.
|
|
* Can return coordinates with or without viewportTransform.
|
|
* ignoreZoom false gives back coordinates that represent
|
|
* the point clicked on canvas element.
|
|
* ignoreZoom true gives back coordinates after being processed
|
|
* by the viewportTransform ( sort of coordinates of what is displayed
|
|
* on the canvas where you are clicking.
|
|
* ignoreZoom true = HTMLElement coordinates relative to top,left
|
|
* ignoreZoom false, default = fabric space coordinates, the same used for shape position
|
|
* To interact with your shapes top and left you want to use ignoreZoom true
|
|
* most of the time, while ignoreZoom false will give you coordinates
|
|
* compatible with the object.oCoords system.
|
|
* of the time.
|
|
* @param {Event} e
|
|
* @param {Boolean} ignoreZoom
|
|
* @return {Object} object with "x" and "y" number values
|
|
*/
|
|
getPointer: function (e, ignoreZoom) {
|
|
// return cached values if we are in the event processing chain
|
|
if (this._absolutePointer && !ignoreZoom) {
|
|
return this._absolutePointer;
|
|
}
|
|
if (this._pointer && ignoreZoom) {
|
|
return this._pointer;
|
|
}
|
|
|
|
var pointer = getPointer(e),
|
|
upperCanvasEl = this.upperCanvasEl,
|
|
bounds = upperCanvasEl.getBoundingClientRect(),
|
|
boundsWidth = bounds.width || 0,
|
|
boundsHeight = bounds.height || 0,
|
|
cssScale;
|
|
|
|
if (!boundsWidth || !boundsHeight ) {
|
|
if ('top' in bounds && 'bottom' in bounds) {
|
|
boundsHeight = Math.abs( bounds.top - bounds.bottom );
|
|
}
|
|
if ('right' in bounds && 'left' in bounds) {
|
|
boundsWidth = Math.abs( bounds.right - bounds.left );
|
|
}
|
|
}
|
|
|
|
this.calcOffset();
|
|
pointer.x = pointer.x - this._offset.left;
|
|
pointer.y = pointer.y - this._offset.top;
|
|
if (!ignoreZoom) {
|
|
pointer = this.restorePointerVpt(pointer);
|
|
}
|
|
|
|
var retinaScaling = this.getRetinaScaling();
|
|
if (retinaScaling !== 1) {
|
|
pointer.x /= retinaScaling;
|
|
pointer.y /= retinaScaling;
|
|
}
|
|
|
|
if (boundsWidth === 0 || boundsHeight === 0) {
|
|
// If bounds are not available (i.e. not visible), do not apply scale.
|
|
cssScale = { width: 1, height: 1 };
|
|
}
|
|
else {
|
|
cssScale = {
|
|
width: upperCanvasEl.width / boundsWidth,
|
|
height: upperCanvasEl.height / boundsHeight
|
|
};
|
|
}
|
|
|
|
return {
|
|
x: pointer.x * cssScale.width,
|
|
y: pointer.y * cssScale.height
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @throws {CANVAS_INIT_ERROR} If canvas can not be initialized
|
|
*/
|
|
_createUpperCanvas: function () {
|
|
var lowerCanvasClass = this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/, ''),
|
|
lowerCanvasEl = this.lowerCanvasEl, upperCanvasEl = this.upperCanvasEl;
|
|
|
|
// there is no need to create a new upperCanvas element if we have already one.
|
|
if (upperCanvasEl) {
|
|
upperCanvasEl.className = '';
|
|
}
|
|
else {
|
|
upperCanvasEl = this._createCanvasElement();
|
|
this.upperCanvasEl = upperCanvasEl;
|
|
}
|
|
fabric.util.addClass(upperCanvasEl, 'upper-canvas ' + lowerCanvasClass);
|
|
|
|
this.wrapperEl.appendChild(upperCanvasEl);
|
|
|
|
this._copyCanvasStyle(lowerCanvasEl, upperCanvasEl);
|
|
this._applyCanvasStyle(upperCanvasEl);
|
|
this.contextTop = upperCanvasEl.getContext('2d');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createCacheCanvas: function () {
|
|
this.cacheCanvasEl = this._createCanvasElement();
|
|
this.cacheCanvasEl.setAttribute('width', this.width);
|
|
this.cacheCanvasEl.setAttribute('height', this.height);
|
|
this.contextCache = this.cacheCanvasEl.getContext('2d');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_initWrapperElement: function () {
|
|
this.wrapperEl = fabric.util.wrapElement(this.lowerCanvasEl, 'div', {
|
|
'class': this.containerClass
|
|
});
|
|
fabric.util.setStyle(this.wrapperEl, {
|
|
width: this.width + 'px',
|
|
height: this.height + 'px',
|
|
position: 'relative'
|
|
});
|
|
fabric.util.makeElementUnselectable(this.wrapperEl);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {HTMLElement} element canvas element to apply styles on
|
|
*/
|
|
_applyCanvasStyle: function (element) {
|
|
var width = this.width || element.width,
|
|
height = this.height || element.height;
|
|
|
|
fabric.util.setStyle(element, {
|
|
position: 'absolute',
|
|
width: width + 'px',
|
|
height: height + 'px',
|
|
left: 0,
|
|
top: 0,
|
|
'touch-action': this.allowTouchScrolling ? 'manipulation' : 'none',
|
|
'-ms-touch-action': this.allowTouchScrolling ? 'manipulation' : 'none'
|
|
});
|
|
element.width = width;
|
|
element.height = height;
|
|
fabric.util.makeElementUnselectable(element);
|
|
},
|
|
|
|
/**
|
|
* Copy the entire inline style from one element (fromEl) to another (toEl)
|
|
* @private
|
|
* @param {Element} fromEl Element style is copied from
|
|
* @param {Element} toEl Element copied style is applied to
|
|
*/
|
|
_copyCanvasStyle: function (fromEl, toEl) {
|
|
toEl.style.cssText = fromEl.style.cssText;
|
|
},
|
|
|
|
/**
|
|
* Returns context of canvas where object selection is drawn
|
|
* @return {CanvasRenderingContext2D}
|
|
*/
|
|
getSelectionContext: function() {
|
|
return this.contextTop;
|
|
},
|
|
|
|
/**
|
|
* Returns <canvas> element on which object selection is drawn
|
|
* @return {HTMLCanvasElement}
|
|
*/
|
|
getSelectionElement: function () {
|
|
return this.upperCanvasEl;
|
|
},
|
|
|
|
/**
|
|
* Returns currently active object
|
|
* @return {fabric.Object} active object
|
|
*/
|
|
getActiveObject: function () {
|
|
return this._activeObject;
|
|
},
|
|
|
|
/**
|
|
* Returns an array with the current selected objects
|
|
* @return {fabric.Object} active object
|
|
*/
|
|
getActiveObjects: function () {
|
|
var active = this._activeObject;
|
|
if (active) {
|
|
if (active.type === 'activeSelection' && active._objects) {
|
|
return active._objects.slice(0);
|
|
}
|
|
else {
|
|
return [active];
|
|
}
|
|
}
|
|
return [];
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {fabric.Object} obj Object that was removed
|
|
*/
|
|
_onObjectRemoved: function(obj) {
|
|
// removing active object should fire "selection:cleared" events
|
|
if (obj === this._activeObject) {
|
|
this.fire('before:selection:cleared', { target: obj });
|
|
this._discardActiveObject();
|
|
this.fire('selection:cleared', { target: obj });
|
|
obj.fire('deselected');
|
|
}
|
|
if (obj === this._hoveredTarget){
|
|
this._hoveredTarget = null;
|
|
this._hoveredTargets = [];
|
|
}
|
|
this.callSuper('_onObjectRemoved', obj);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* Compares the old activeObject with the current one and fires correct events
|
|
* @param {fabric.Object} obj old activeObject
|
|
*/
|
|
_fireSelectionEvents: function(oldObjects, e) {
|
|
var somethingChanged = false, objects = this.getActiveObjects(),
|
|
added = [], removed = [];
|
|
oldObjects.forEach(function(oldObject) {
|
|
if (objects.indexOf(oldObject) === -1) {
|
|
somethingChanged = true;
|
|
oldObject.fire('deselected', {
|
|
e: e,
|
|
target: oldObject
|
|
});
|
|
removed.push(oldObject);
|
|
}
|
|
});
|
|
objects.forEach(function(object) {
|
|
if (oldObjects.indexOf(object) === -1) {
|
|
somethingChanged = true;
|
|
object.fire('selected', {
|
|
e: e,
|
|
target: object
|
|
});
|
|
added.push(object);
|
|
}
|
|
});
|
|
if (oldObjects.length > 0 && objects.length > 0) {
|
|
somethingChanged && this.fire('selection:updated', {
|
|
e: e,
|
|
selected: added,
|
|
deselected: removed,
|
|
// added for backward compatibility
|
|
// deprecated
|
|
updated: added[0] || removed[0],
|
|
target: this._activeObject,
|
|
});
|
|
}
|
|
else if (objects.length > 0) {
|
|
this.fire('selection:created', {
|
|
e: e,
|
|
selected: added,
|
|
target: this._activeObject,
|
|
});
|
|
}
|
|
else if (oldObjects.length > 0) {
|
|
this.fire('selection:cleared', {
|
|
e: e,
|
|
deselected: removed,
|
|
});
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Sets given object as the only active object on canvas
|
|
* @param {fabric.Object} object Object to set as an active one
|
|
* @param {Event} [e] Event (passed along when firing "object:selected")
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
setActiveObject: function (object, e) {
|
|
var currentActives = this.getActiveObjects();
|
|
this._setActiveObject(object, e);
|
|
this._fireSelectionEvents(currentActives, e);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* This is a private method for now.
|
|
* This is supposed to be equivalent to setActiveObject but without firing
|
|
* any event. There is commitment to have this stay this way.
|
|
* This is the functional part of setActiveObject.
|
|
* @private
|
|
* @param {Object} object to set as active
|
|
* @param {Event} [e] Event (passed along when firing "object:selected")
|
|
* @return {Boolean} true if the selection happened
|
|
*/
|
|
_setActiveObject: function(object, e) {
|
|
if (this._activeObject === object) {
|
|
return false;
|
|
}
|
|
if (!this._discardActiveObject(e, object)) {
|
|
return false;
|
|
}
|
|
if (object.onSelect({ e: e })) {
|
|
return false;
|
|
}
|
|
this._activeObject = object;
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* This is a private method for now.
|
|
* This is supposed to be equivalent to discardActiveObject but without firing
|
|
* any events. There is commitment to have this stay this way.
|
|
* This is the functional part of discardActiveObject.
|
|
* @param {Event} [e] Event (passed along when firing "object:deselected")
|
|
* @param {Object} object to set as active
|
|
* @return {Boolean} true if the selection happened
|
|
* @private
|
|
*/
|
|
_discardActiveObject: function(e, object) {
|
|
var obj = this._activeObject;
|
|
if (obj) {
|
|
// onDeselect return TRUE to cancel selection;
|
|
if (obj.onDeselect({ e: e, object: object })) {
|
|
return false;
|
|
}
|
|
this._activeObject = null;
|
|
}
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* Discards currently active object and fire events. If the function is called by fabric
|
|
* as a consequence of a mouse event, the event is passed as a parameter and
|
|
* sent to the fire function for the custom events. When used as a method the
|
|
* e param does not have any application.
|
|
* @param {event} e
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
discardActiveObject: function (e) {
|
|
var currentActives = this.getActiveObjects(), activeObject = this.getActiveObject();
|
|
if (currentActives.length) {
|
|
this.fire('before:selection:cleared', { target: activeObject, e: e });
|
|
}
|
|
this._discardActiveObject(e);
|
|
this._fireSelectionEvents(currentActives, e);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Clears a canvas element and removes all event listeners
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
dispose: function () {
|
|
var wrapper = this.wrapperEl;
|
|
this.removeListeners();
|
|
wrapper.removeChild(this.upperCanvasEl);
|
|
wrapper.removeChild(this.lowerCanvasEl);
|
|
this.contextCache = null;
|
|
this.contextTop = null;
|
|
['upperCanvasEl', 'cacheCanvasEl'].forEach((function(element) {
|
|
fabric.util.cleanUpJsdomNode(this[element]);
|
|
this[element] = undefined;
|
|
}).bind(this));
|
|
if (wrapper.parentNode) {
|
|
wrapper.parentNode.replaceChild(this.lowerCanvasEl, this.wrapperEl);
|
|
}
|
|
delete this.wrapperEl;
|
|
fabric.StaticCanvas.prototype.dispose.call(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Clears all contexts (background, main, top) of an instance
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
clear: function () {
|
|
// this.discardActiveGroup();
|
|
this.discardActiveObject();
|
|
this.clearContext(this.contextTop);
|
|
return this.callSuper('clear');
|
|
},
|
|
|
|
/**
|
|
* Draws objects' controls (borders/controls)
|
|
* @param {CanvasRenderingContext2D} ctx Context to render controls on
|
|
*/
|
|
drawControls: function(ctx) {
|
|
var activeObject = this._activeObject;
|
|
|
|
if (activeObject) {
|
|
activeObject._renderControls(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_toObject: function(instance, methodName, propertiesToInclude) {
|
|
//If the object is part of the current selection group, it should
|
|
//be transformed appropriately
|
|
//i.e. it should be serialised as it would appear if the selection group
|
|
//were to be destroyed.
|
|
var originalProperties = this._realizeGroupTransformOnObject(instance),
|
|
object = this.callSuper('_toObject', instance, methodName, propertiesToInclude);
|
|
//Undo the damage we did by changing all of its properties
|
|
this._unwindGroupTransformOnObject(instance, originalProperties);
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Realises an object's group transformation on it
|
|
* @private
|
|
* @param {fabric.Object} [instance] the object to transform (gets mutated)
|
|
* @returns the original values of instance which were changed
|
|
*/
|
|
_realizeGroupTransformOnObject: function(instance) {
|
|
if (instance.group && instance.group.type === 'activeSelection' && this._activeObject === instance.group) {
|
|
var layoutProps = ['angle', 'flipX', 'flipY', 'left', 'scaleX', 'scaleY', 'skewX', 'skewY', 'top'];
|
|
//Copy all the positionally relevant properties across now
|
|
var originalValues = {};
|
|
layoutProps.forEach(function(prop) {
|
|
originalValues[prop] = instance[prop];
|
|
});
|
|
fabric.util.addTransformToObject(instance, this._activeObject.calcOwnMatrix());
|
|
return originalValues;
|
|
}
|
|
else {
|
|
return null;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Restores the changed properties of instance
|
|
* @private
|
|
* @param {fabric.Object} [instance] the object to un-transform (gets mutated)
|
|
* @param {Object} [originalValues] the original values of instance, as returned by _realizeGroupTransformOnObject
|
|
*/
|
|
_unwindGroupTransformOnObject: function(instance, originalValues) {
|
|
if (originalValues) {
|
|
instance.set(originalValues);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setSVGObject: function(markup, instance, reviver) {
|
|
//If the object is in a selection group, simulate what would happen to that
|
|
//object when the group is deselected
|
|
var originalProperties = this._realizeGroupTransformOnObject(instance);
|
|
this.callSuper('_setSVGObject', markup, instance, reviver);
|
|
this._unwindGroupTransformOnObject(instance, originalProperties);
|
|
},
|
|
|
|
setViewportTransform: function (vpt) {
|
|
if (this.renderOnAddRemove && this._activeObject && this._activeObject.isEditing) {
|
|
this._activeObject.clearContextTop();
|
|
}
|
|
fabric.StaticCanvas.prototype.setViewportTransform.call(this, vpt);
|
|
}
|
|
});
|
|
|
|
// copying static properties manually to work around Opera's bug,
|
|
// where "prototype" property is enumerable and overrides existing prototype
|
|
for (var prop in fabric.StaticCanvas) {
|
|
if (prop !== 'prototype') {
|
|
fabric.Canvas[prop] = fabric.StaticCanvas[prop];
|
|
}
|
|
}
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
var addListener = fabric.util.addListener,
|
|
removeListener = fabric.util.removeListener,
|
|
RIGHT_CLICK = 3, MIDDLE_CLICK = 2, LEFT_CLICK = 1,
|
|
addEventOptions = { passive: false };
|
|
|
|
function checkClick(e, value) {
|
|
return e.button && (e.button === value - 1);
|
|
}
|
|
|
|
fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ {
|
|
|
|
/**
|
|
* Contains the id of the touch event that owns the fabric transform
|
|
* @type Number
|
|
* @private
|
|
*/
|
|
mainTouchId: null,
|
|
|
|
/**
|
|
* Adds mouse listeners to canvas
|
|
* @private
|
|
*/
|
|
_initEventListeners: function () {
|
|
// in case we initialized the class twice. This should not happen normally
|
|
// but in some kind of applications where the canvas element may be changed
|
|
// this is a workaround to having double listeners.
|
|
this.removeListeners();
|
|
this._bindEvents();
|
|
this.addOrRemove(addListener, 'add');
|
|
},
|
|
|
|
/**
|
|
* return an event prefix pointer or mouse.
|
|
* @private
|
|
*/
|
|
_getEventPrefix: function () {
|
|
return this.enablePointerEvents ? 'pointer' : 'mouse';
|
|
},
|
|
|
|
addOrRemove: function(functor, eventjsFunctor) {
|
|
var canvasElement = this.upperCanvasEl,
|
|
eventTypePrefix = this._getEventPrefix();
|
|
functor(fabric.window, 'resize', this._onResize);
|
|
functor(canvasElement, eventTypePrefix + 'down', this._onMouseDown);
|
|
functor(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions);
|
|
functor(canvasElement, eventTypePrefix + 'out', this._onMouseOut);
|
|
functor(canvasElement, eventTypePrefix + 'enter', this._onMouseEnter);
|
|
functor(canvasElement, 'wheel', this._onMouseWheel);
|
|
functor(canvasElement, 'contextmenu', this._onContextMenu);
|
|
functor(canvasElement, 'dblclick', this._onDoubleClick);
|
|
functor(canvasElement, 'dragover', this._onDragOver);
|
|
functor(canvasElement, 'dragenter', this._onDragEnter);
|
|
functor(canvasElement, 'dragleave', this._onDragLeave);
|
|
functor(canvasElement, 'drop', this._onDrop);
|
|
if (!this.enablePointerEvents) {
|
|
functor(canvasElement, 'touchstart', this._onTouchStart, addEventOptions);
|
|
}
|
|
if (typeof eventjs !== 'undefined' && eventjsFunctor in eventjs) {
|
|
eventjs[eventjsFunctor](canvasElement, 'gesture', this._onGesture);
|
|
eventjs[eventjsFunctor](canvasElement, 'drag', this._onDrag);
|
|
eventjs[eventjsFunctor](canvasElement, 'orientation', this._onOrientationChange);
|
|
eventjs[eventjsFunctor](canvasElement, 'shake', this._onShake);
|
|
eventjs[eventjsFunctor](canvasElement, 'longpress', this._onLongPress);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Removes all event listeners
|
|
*/
|
|
removeListeners: function() {
|
|
this.addOrRemove(removeListener, 'remove');
|
|
// if you dispose on a mouseDown, before mouse up, you need to clean document to...
|
|
var eventTypePrefix = this._getEventPrefix();
|
|
removeListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp);
|
|
removeListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions);
|
|
removeListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions);
|
|
removeListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_bindEvents: function() {
|
|
if (this.eventsBound) {
|
|
// for any reason we pass here twice we do not want to bind events twice.
|
|
return;
|
|
}
|
|
this._onMouseDown = this._onMouseDown.bind(this);
|
|
this._onTouchStart = this._onTouchStart.bind(this);
|
|
this._onMouseMove = this._onMouseMove.bind(this);
|
|
this._onMouseUp = this._onMouseUp.bind(this);
|
|
this._onTouchEnd = this._onTouchEnd.bind(this);
|
|
this._onResize = this._onResize.bind(this);
|
|
this._onGesture = this._onGesture.bind(this);
|
|
this._onDrag = this._onDrag.bind(this);
|
|
this._onShake = this._onShake.bind(this);
|
|
this._onLongPress = this._onLongPress.bind(this);
|
|
this._onOrientationChange = this._onOrientationChange.bind(this);
|
|
this._onMouseWheel = this._onMouseWheel.bind(this);
|
|
this._onMouseOut = this._onMouseOut.bind(this);
|
|
this._onMouseEnter = this._onMouseEnter.bind(this);
|
|
this._onContextMenu = this._onContextMenu.bind(this);
|
|
this._onDoubleClick = this._onDoubleClick.bind(this);
|
|
this._onDragOver = this._onDragOver.bind(this);
|
|
this._onDragEnter = this._simpleEventHandler.bind(this, 'dragenter');
|
|
this._onDragLeave = this._simpleEventHandler.bind(this, 'dragleave');
|
|
this._onDrop = this._simpleEventHandler.bind(this, 'drop');
|
|
this.eventsBound = true;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} [e] Event object fired on Event.js gesture
|
|
* @param {Event} [self] Inner Event object
|
|
*/
|
|
_onGesture: function(e, self) {
|
|
this.__onTransformGesture && this.__onTransformGesture(e, self);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} [e] Event object fired on Event.js drag
|
|
* @param {Event} [self] Inner Event object
|
|
*/
|
|
_onDrag: function(e, self) {
|
|
this.__onDrag && this.__onDrag(e, self);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} [e] Event object fired on wheel event
|
|
*/
|
|
_onMouseWheel: function(e) {
|
|
this.__onMouseWheel(e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onMouseOut: function(e) {
|
|
var target = this._hoveredTarget;
|
|
this.fire('mouse:out', { target: target, e: e });
|
|
this._hoveredTarget = null;
|
|
target && target.fire('mouseout', { e: e });
|
|
|
|
var _this = this;
|
|
this._hoveredTargets.forEach(function(_target){
|
|
_this.fire('mouse:out', { target: target, e: e });
|
|
_target && target.fire('mouseout', { e: e });
|
|
});
|
|
this._hoveredTargets = [];
|
|
|
|
if (this._iTextInstances) {
|
|
this._iTextInstances.forEach(function(obj) {
|
|
if (obj.isEditing) {
|
|
obj.hiddenTextarea.focus();
|
|
}
|
|
});
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mouseenter
|
|
*/
|
|
_onMouseEnter: function(e) {
|
|
// This find target and consequent 'mouse:over' is used to
|
|
// clear old instances on hovered target.
|
|
// calling findTarget has the side effect of killing target.__corner.
|
|
// as a short term fix we are not firing this if we are currently transforming.
|
|
// as a long term fix we need to separate the action of finding a target with the
|
|
// side effects we added to it.
|
|
if (!this._currentTransform && !this.findTarget(e)) {
|
|
this.fire('mouse:over', { target: null, e: e });
|
|
this._hoveredTarget = null;
|
|
this._hoveredTargets = [];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} [e] Event object fired on Event.js orientation change
|
|
* @param {Event} [self] Inner Event object
|
|
*/
|
|
_onOrientationChange: function(e, self) {
|
|
this.__onOrientationChange && this.__onOrientationChange(e, self);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} [e] Event object fired on Event.js shake
|
|
* @param {Event} [self] Inner Event object
|
|
*/
|
|
_onShake: function(e, self) {
|
|
this.__onShake && this.__onShake(e, self);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} [e] Event object fired on Event.js shake
|
|
* @param {Event} [self] Inner Event object
|
|
*/
|
|
_onLongPress: function(e, self) {
|
|
this.__onLongPress && this.__onLongPress(e, self);
|
|
},
|
|
|
|
/**
|
|
* prevent default to allow drop event to be fired
|
|
* @private
|
|
* @param {Event} [e] Event object fired on Event.js shake
|
|
*/
|
|
_onDragOver: function(e) {
|
|
e.preventDefault();
|
|
var target = this._simpleEventHandler('dragover', e);
|
|
this._fireEnterLeaveEvents(target, e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onContextMenu: function (e) {
|
|
if (this.stopContextMenu) {
|
|
e.stopPropagation();
|
|
e.preventDefault();
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onDoubleClick: function (e) {
|
|
this._cacheTransformEventData(e);
|
|
this._handleEvent(e, 'dblclick');
|
|
this._resetTransformEventData(e);
|
|
},
|
|
|
|
/**
|
|
* Return a the id of an event.
|
|
* returns either the pointerId or the identifier or 0 for the mouse event
|
|
* @private
|
|
* @param {Event} evt Event object
|
|
*/
|
|
getPointerId: function(evt) {
|
|
var changedTouches = evt.changedTouches;
|
|
|
|
if (changedTouches) {
|
|
return changedTouches[0] && changedTouches[0].identifier;
|
|
}
|
|
|
|
if (this.enablePointerEvents) {
|
|
return evt.pointerId;
|
|
}
|
|
|
|
return -1;
|
|
},
|
|
|
|
/**
|
|
* Determines if an event has the id of the event that is considered main
|
|
* @private
|
|
* @param {evt} event Event object
|
|
*/
|
|
_isMainEvent: function(evt) {
|
|
if (evt.isPrimary === true) {
|
|
return true;
|
|
}
|
|
if (evt.isPrimary === false) {
|
|
return false;
|
|
}
|
|
if (evt.type === 'touchend' && evt.touches.length === 0) {
|
|
return true;
|
|
}
|
|
if (evt.changedTouches) {
|
|
return evt.changedTouches[0].identifier === this.mainTouchId;
|
|
}
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onTouchStart: function(e) {
|
|
e.preventDefault();
|
|
if (this.mainTouchId === null) {
|
|
this.mainTouchId = this.getPointerId(e);
|
|
}
|
|
this.__onMouseDown(e);
|
|
this._resetTransformEventData();
|
|
var canvasElement = this.upperCanvasEl,
|
|
eventTypePrefix = this._getEventPrefix();
|
|
addListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions);
|
|
addListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions);
|
|
// Unbind mousedown to prevent double triggers from touch devices
|
|
removeListener(canvasElement, eventTypePrefix + 'down', this._onMouseDown);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onMouseDown: function (e) {
|
|
this.__onMouseDown(e);
|
|
this._resetTransformEventData();
|
|
var canvasElement = this.upperCanvasEl,
|
|
eventTypePrefix = this._getEventPrefix();
|
|
removeListener(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions);
|
|
addListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp);
|
|
addListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onTouchEnd: function(e) {
|
|
if (e.touches.length > 0) {
|
|
// if there are still touches stop here
|
|
return;
|
|
}
|
|
this.__onMouseUp(e);
|
|
this._resetTransformEventData();
|
|
this.mainTouchId = null;
|
|
var eventTypePrefix = this._getEventPrefix();
|
|
removeListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions);
|
|
removeListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions);
|
|
var _this = this;
|
|
if (this._willAddMouseDown) {
|
|
clearTimeout(this._willAddMouseDown);
|
|
}
|
|
this._willAddMouseDown = setTimeout(function() {
|
|
// Wait 400ms before rebinding mousedown to prevent double triggers
|
|
// from touch devices
|
|
addListener(_this.upperCanvasEl, eventTypePrefix + 'down', _this._onMouseDown);
|
|
_this._willAddMouseDown = 0;
|
|
}, 400);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mouseup
|
|
*/
|
|
_onMouseUp: function (e) {
|
|
this.__onMouseUp(e);
|
|
this._resetTransformEventData();
|
|
var canvasElement = this.upperCanvasEl,
|
|
eventTypePrefix = this._getEventPrefix();
|
|
if (this._isMainEvent(e)) {
|
|
removeListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp);
|
|
removeListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions);
|
|
addListener(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousemove
|
|
*/
|
|
_onMouseMove: function (e) {
|
|
!this.allowTouchScrolling && e.preventDefault && e.preventDefault();
|
|
this.__onMouseMove(e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onResize: function () {
|
|
this.calcOffset();
|
|
},
|
|
|
|
/**
|
|
* Decides whether the canvas should be redrawn in mouseup and mousedown events.
|
|
* @private
|
|
* @param {Object} target
|
|
*/
|
|
_shouldRender: function(target) {
|
|
var activeObject = this._activeObject;
|
|
|
|
if (
|
|
!!activeObject !== !!target ||
|
|
(activeObject && target && (activeObject !== target))
|
|
) {
|
|
// this covers: switch of target, from target to no target, selection of target
|
|
// multiSelection with key and mouse
|
|
return true;
|
|
}
|
|
else if (activeObject && activeObject.isEditing) {
|
|
// if we mouse up/down over a editing textbox a cursor change,
|
|
// there is no need to re render
|
|
return false;
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Method that defines the actions when mouse is released on canvas.
|
|
* The method resets the currentTransform parameters, store the image corner
|
|
* position in the image object and render the canvas on top.
|
|
* @private
|
|
* @param {Event} e Event object fired on mouseup
|
|
*/
|
|
__onMouseUp: function (e) {
|
|
var target, transform = this._currentTransform,
|
|
groupSelector = this._groupSelector, shouldRender = false,
|
|
isClick = (!groupSelector || (groupSelector.left === 0 && groupSelector.top === 0));
|
|
this._cacheTransformEventData(e);
|
|
target = this._target;
|
|
this._handleEvent(e, 'up:before');
|
|
// if right/middle click just fire events and return
|
|
// target undefined will make the _handleEvent search the target
|
|
if (checkClick(e, RIGHT_CLICK)) {
|
|
if (this.fireRightClick) {
|
|
this._handleEvent(e, 'up', RIGHT_CLICK, isClick);
|
|
}
|
|
return;
|
|
}
|
|
|
|
if (checkClick(e, MIDDLE_CLICK)) {
|
|
if (this.fireMiddleClick) {
|
|
this._handleEvent(e, 'up', MIDDLE_CLICK, isClick);
|
|
}
|
|
this._resetTransformEventData();
|
|
return;
|
|
}
|
|
|
|
if (this.isDrawingMode && this._isCurrentlyDrawing) {
|
|
this._onMouseUpInDrawingMode(e);
|
|
return;
|
|
}
|
|
|
|
if (!this._isMainEvent(e)) {
|
|
return;
|
|
}
|
|
if (transform) {
|
|
this._finalizeCurrentTransform(e);
|
|
shouldRender = transform.actionPerformed;
|
|
}
|
|
if (!isClick) {
|
|
var targetWasActive = target === this._activeObject;
|
|
this._maybeGroupObjects(e);
|
|
if (!shouldRender) {
|
|
shouldRender = (
|
|
this._shouldRender(target) ||
|
|
(!targetWasActive && target === this._activeObject)
|
|
);
|
|
}
|
|
}
|
|
if (target) {
|
|
if (target.selectable && target !== this._activeObject && target.activeOn === 'up') {
|
|
this.setActiveObject(target, e);
|
|
shouldRender = true;
|
|
}
|
|
else {
|
|
var corner = target._findTargetCorner(
|
|
this.getPointer(e, true),
|
|
fabric.util.isTouchEvent(e)
|
|
);
|
|
var control = target.controls[corner],
|
|
mouseUpHandler = control && control.getMouseUpHandler(e, target, control);
|
|
if (mouseUpHandler) {
|
|
var pointer = this.getPointer(e);
|
|
mouseUpHandler(e, transform, pointer.x, pointer.y);
|
|
}
|
|
}
|
|
target.isMoving = false;
|
|
}
|
|
this._setCursorFromEvent(e, target);
|
|
this._handleEvent(e, 'up', LEFT_CLICK, isClick);
|
|
this._groupSelector = null;
|
|
this._currentTransform = null;
|
|
// reset the target information about which corner is selected
|
|
target && (target.__corner = 0);
|
|
if (shouldRender) {
|
|
this.requestRenderAll();
|
|
}
|
|
else if (!isClick) {
|
|
this.renderTop();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* Handle event firing for target and subtargets
|
|
* @param {Event} e event from mouse
|
|
* @param {String} eventType event to fire (up, down or move)
|
|
* @return {Fabric.Object} target return the the target found, for internal reasons.
|
|
*/
|
|
_simpleEventHandler: function(eventType, e) {
|
|
var target = this.findTarget(e),
|
|
targets = this.targets,
|
|
options = {
|
|
e: e,
|
|
target: target,
|
|
subTargets: targets,
|
|
};
|
|
this.fire(eventType, options);
|
|
target && target.fire(eventType, options);
|
|
if (!targets) {
|
|
return target;
|
|
}
|
|
for (var i = 0; i < targets.length; i++) {
|
|
targets[i].fire(eventType, options);
|
|
}
|
|
return target;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* Handle event firing for target and subtargets
|
|
* @param {Event} e event from mouse
|
|
* @param {String} eventType event to fire (up, down or move)
|
|
* @param {fabric.Object} targetObj receiving event
|
|
* @param {Number} [button] button used in the event 1 = left, 2 = middle, 3 = right
|
|
* @param {Boolean} isClick for left button only, indicates that the mouse up happened without move.
|
|
*/
|
|
_handleEvent: function(e, eventType, button, isClick) {
|
|
var target = this._target,
|
|
targets = this.targets || [],
|
|
options = {
|
|
e: e,
|
|
target: target,
|
|
subTargets: targets,
|
|
button: button || LEFT_CLICK,
|
|
isClick: isClick || false,
|
|
pointer: this._pointer,
|
|
absolutePointer: this._absolutePointer,
|
|
transform: this._currentTransform
|
|
};
|
|
if (eventType === 'up') {
|
|
options.currentTarget = this.findTarget(e);
|
|
options.currentSubTargets = this.targets;
|
|
}
|
|
this.fire('mouse:' + eventType, options);
|
|
target && target.fire('mouse' + eventType, options);
|
|
for (var i = 0; i < targets.length; i++) {
|
|
targets[i].fire('mouse' + eventType, options);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e send the mouse event that generate the finalize down, so it can be used in the event
|
|
*/
|
|
_finalizeCurrentTransform: function(e) {
|
|
|
|
var transform = this._currentTransform,
|
|
target = transform.target,
|
|
eventName,
|
|
options = {
|
|
e: e,
|
|
target: target,
|
|
transform: transform,
|
|
action: transform.action,
|
|
};
|
|
|
|
if (target._scaling) {
|
|
target._scaling = false;
|
|
}
|
|
|
|
target.setCoords();
|
|
|
|
if (transform.actionPerformed || (this.stateful && target.hasStateChanged())) {
|
|
if (transform.actionPerformed) {
|
|
// this is not friendly to the new control api.
|
|
// is deprecated.
|
|
eventName = this._addEventOptions(options, transform);
|
|
this._fire(eventName, options);
|
|
}
|
|
this._fire('modified', options);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Mutate option object in order to add by property and give back the event name.
|
|
* @private
|
|
* @deprecated since 4.2.0
|
|
* @param {Object} options to mutate
|
|
* @param {Object} transform to inspect action from
|
|
*/
|
|
_addEventOptions: function(options, transform) {
|
|
// we can probably add more details at low cost
|
|
// scale change, rotation changes, translation changes
|
|
var eventName, by;
|
|
switch (transform.action) {
|
|
case 'scaleX':
|
|
eventName = 'scaled';
|
|
by = 'x';
|
|
break;
|
|
case 'scaleY':
|
|
eventName = 'scaled';
|
|
by = 'y';
|
|
break;
|
|
case 'skewX':
|
|
eventName = 'skewed';
|
|
by = 'x';
|
|
break;
|
|
case 'skewY':
|
|
eventName = 'skewed';
|
|
by = 'y';
|
|
break;
|
|
case 'scale':
|
|
eventName = 'scaled';
|
|
by = 'equally';
|
|
break;
|
|
case 'rotate':
|
|
eventName = 'rotated';
|
|
break;
|
|
case 'drag':
|
|
eventName = 'moved';
|
|
break;
|
|
}
|
|
options.by = by;
|
|
return eventName;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
_onMouseDownInDrawingMode: function(e) {
|
|
this._isCurrentlyDrawing = true;
|
|
if (this.getActiveObject()) {
|
|
this.discardActiveObject(e).requestRenderAll();
|
|
}
|
|
var pointer = this.getPointer(e);
|
|
this.freeDrawingBrush.onMouseDown(pointer, { e: e, pointer: pointer });
|
|
this._handleEvent(e, 'down');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mousemove
|
|
*/
|
|
_onMouseMoveInDrawingMode: function(e) {
|
|
if (this._isCurrentlyDrawing) {
|
|
var pointer = this.getPointer(e);
|
|
this.freeDrawingBrush.onMouseMove(pointer, { e: e, pointer: pointer });
|
|
}
|
|
this.setCursor(this.freeDrawingCursor);
|
|
this._handleEvent(e, 'move');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object fired on mouseup
|
|
*/
|
|
_onMouseUpInDrawingMode: function(e) {
|
|
var pointer = this.getPointer(e);
|
|
this._isCurrentlyDrawing = this.freeDrawingBrush.onMouseUp({ e: e, pointer: pointer });
|
|
this._handleEvent(e, 'up');
|
|
},
|
|
|
|
/**
|
|
* Method that defines the actions when mouse is clicked on canvas.
|
|
* The method inits the currentTransform parameters and renders all the
|
|
* canvas so the current image can be placed on the top canvas and the rest
|
|
* in on the container one.
|
|
* @private
|
|
* @param {Event} e Event object fired on mousedown
|
|
*/
|
|
__onMouseDown: function (e) {
|
|
this._cacheTransformEventData(e);
|
|
this._handleEvent(e, 'down:before');
|
|
var target = this._target;
|
|
// if right click just fire events
|
|
if (checkClick(e, RIGHT_CLICK)) {
|
|
if (this.fireRightClick) {
|
|
this._handleEvent(e, 'down', RIGHT_CLICK);
|
|
}
|
|
return;
|
|
}
|
|
|
|
if (checkClick(e, MIDDLE_CLICK)) {
|
|
if (this.fireMiddleClick) {
|
|
this._handleEvent(e, 'down', MIDDLE_CLICK);
|
|
}
|
|
return;
|
|
}
|
|
|
|
if (this.isDrawingMode) {
|
|
this._onMouseDownInDrawingMode(e);
|
|
return;
|
|
}
|
|
|
|
if (!this._isMainEvent(e)) {
|
|
return;
|
|
}
|
|
|
|
// ignore if some object is being transformed at this moment
|
|
if (this._currentTransform) {
|
|
return;
|
|
}
|
|
|
|
var pointer = this._pointer;
|
|
// save pointer for check in __onMouseUp event
|
|
this._previousPointer = pointer;
|
|
var shouldRender = this._shouldRender(target),
|
|
shouldGroup = this._shouldGroup(e, target);
|
|
if (this._shouldClearSelection(e, target)) {
|
|
this.discardActiveObject(e);
|
|
}
|
|
else if (shouldGroup) {
|
|
this._handleGrouping(e, target);
|
|
target = this._activeObject;
|
|
}
|
|
|
|
if (this.selection && (!target ||
|
|
(!target.selectable && !target.isEditing && target !== this._activeObject))) {
|
|
this._groupSelector = {
|
|
ex: this._absolutePointer.x,
|
|
ey: this._absolutePointer.y,
|
|
top: 0,
|
|
left: 0
|
|
};
|
|
}
|
|
|
|
if (target) {
|
|
var alreadySelected = target === this._activeObject;
|
|
if (target.selectable && target.activeOn === 'down') {
|
|
this.setActiveObject(target, e);
|
|
}
|
|
var corner = target._findTargetCorner(
|
|
this.getPointer(e, true),
|
|
fabric.util.isTouchEvent(e)
|
|
);
|
|
target.__corner = corner;
|
|
if (target === this._activeObject && (corner || !shouldGroup)) {
|
|
this._setupCurrentTransform(e, target, alreadySelected);
|
|
var control = target.controls[corner],
|
|
pointer = this.getPointer(e),
|
|
mouseDownHandler = control && control.getMouseDownHandler(e, target, control);
|
|
if (mouseDownHandler) {
|
|
mouseDownHandler(e, this._currentTransform, pointer.x, pointer.y);
|
|
}
|
|
}
|
|
}
|
|
this._handleEvent(e, 'down');
|
|
// we must renderAll so that we update the visuals
|
|
(shouldRender || shouldGroup) && this.requestRenderAll();
|
|
},
|
|
|
|
/**
|
|
* reset cache form common information needed during event processing
|
|
* @private
|
|
*/
|
|
_resetTransformEventData: function() {
|
|
this._target = null;
|
|
this._pointer = null;
|
|
this._absolutePointer = null;
|
|
},
|
|
|
|
/**
|
|
* Cache common information needed during event processing
|
|
* @private
|
|
* @param {Event} e Event object fired on event
|
|
*/
|
|
_cacheTransformEventData: function(e) {
|
|
// reset in order to avoid stale caching
|
|
this._resetTransformEventData();
|
|
this._pointer = this.getPointer(e, true);
|
|
this._absolutePointer = this.restorePointerVpt(this._pointer);
|
|
this._target = this._currentTransform ? this._currentTransform.target : this.findTarget(e) || null;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_beforeTransform: function(e) {
|
|
var t = this._currentTransform;
|
|
this.stateful && t.target.saveState();
|
|
this.fire('before:transform', {
|
|
e: e,
|
|
transform: t,
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Method that defines the actions when mouse is hovering the canvas.
|
|
* The currentTransform parameter will define whether the user is rotating/scaling/translating
|
|
* an image or neither of them (only hovering). A group selection is also possible and would cancel
|
|
* all any other type of action.
|
|
* In case of an image transformation only the top canvas will be rendered.
|
|
* @private
|
|
* @param {Event} e Event object fired on mousemove
|
|
*/
|
|
__onMouseMove: function (e) {
|
|
this._handleEvent(e, 'move:before');
|
|
this._cacheTransformEventData(e);
|
|
var target, pointer;
|
|
|
|
if (this.isDrawingMode) {
|
|
this._onMouseMoveInDrawingMode(e);
|
|
return;
|
|
}
|
|
|
|
if (!this._isMainEvent(e)) {
|
|
return;
|
|
}
|
|
|
|
var groupSelector = this._groupSelector;
|
|
|
|
// We initially clicked in an empty area, so we draw a box for multiple selection
|
|
if (groupSelector) {
|
|
pointer = this._absolutePointer;
|
|
|
|
groupSelector.left = pointer.x - groupSelector.ex;
|
|
groupSelector.top = pointer.y - groupSelector.ey;
|
|
|
|
this.renderTop();
|
|
}
|
|
else if (!this._currentTransform) {
|
|
target = this.findTarget(e) || null;
|
|
this._setCursorFromEvent(e, target);
|
|
this._fireOverOutEvents(target, e);
|
|
}
|
|
else {
|
|
this._transformObject(e);
|
|
}
|
|
this._handleEvent(e, 'move');
|
|
this._resetTransformEventData();
|
|
},
|
|
|
|
/**
|
|
* Manage the mouseout, mouseover events for the fabric object on the canvas
|
|
* @param {Fabric.Object} target the target where the target from the mousemove event
|
|
* @param {Event} e Event object fired on mousemove
|
|
* @private
|
|
*/
|
|
_fireOverOutEvents: function(target, e) {
|
|
var _hoveredTarget = this._hoveredTarget,
|
|
_hoveredTargets = this._hoveredTargets, targets = this.targets,
|
|
length = Math.max(_hoveredTargets.length, targets.length);
|
|
|
|
this.fireSyntheticInOutEvents(target, e, {
|
|
oldTarget: _hoveredTarget,
|
|
evtOut: 'mouseout',
|
|
canvasEvtOut: 'mouse:out',
|
|
evtIn: 'mouseover',
|
|
canvasEvtIn: 'mouse:over',
|
|
});
|
|
for (var i = 0; i < length; i++){
|
|
this.fireSyntheticInOutEvents(targets[i], e, {
|
|
oldTarget: _hoveredTargets[i],
|
|
evtOut: 'mouseout',
|
|
evtIn: 'mouseover',
|
|
});
|
|
}
|
|
this._hoveredTarget = target;
|
|
this._hoveredTargets = this.targets.concat();
|
|
},
|
|
|
|
/**
|
|
* Manage the dragEnter, dragLeave events for the fabric objects on the canvas
|
|
* @param {Fabric.Object} target the target where the target from the onDrag event
|
|
* @param {Event} e Event object fired on ondrag
|
|
* @private
|
|
*/
|
|
_fireEnterLeaveEvents: function(target, e) {
|
|
var _draggedoverTarget = this._draggedoverTarget,
|
|
_hoveredTargets = this._hoveredTargets, targets = this.targets,
|
|
length = Math.max(_hoveredTargets.length, targets.length);
|
|
|
|
this.fireSyntheticInOutEvents(target, e, {
|
|
oldTarget: _draggedoverTarget,
|
|
evtOut: 'dragleave',
|
|
evtIn: 'dragenter',
|
|
});
|
|
for (var i = 0; i < length; i++) {
|
|
this.fireSyntheticInOutEvents(targets[i], e, {
|
|
oldTarget: _hoveredTargets[i],
|
|
evtOut: 'dragleave',
|
|
evtIn: 'dragenter',
|
|
});
|
|
}
|
|
this._draggedoverTarget = target;
|
|
},
|
|
|
|
/**
|
|
* Manage the synthetic in/out events for the fabric objects on the canvas
|
|
* @param {Fabric.Object} target the target where the target from the supported events
|
|
* @param {Event} e Event object fired
|
|
* @param {Object} config configuration for the function to work
|
|
* @param {String} config.targetName property on the canvas where the old target is stored
|
|
* @param {String} [config.canvasEvtOut] name of the event to fire at canvas level for out
|
|
* @param {String} config.evtOut name of the event to fire for out
|
|
* @param {String} [config.canvasEvtIn] name of the event to fire at canvas level for in
|
|
* @param {String} config.evtIn name of the event to fire for in
|
|
* @private
|
|
*/
|
|
fireSyntheticInOutEvents: function(target, e, config) {
|
|
var inOpt, outOpt, oldTarget = config.oldTarget, outFires, inFires,
|
|
targetChanged = oldTarget !== target, canvasEvtIn = config.canvasEvtIn, canvasEvtOut = config.canvasEvtOut;
|
|
if (targetChanged) {
|
|
inOpt = { e: e, target: target, previousTarget: oldTarget };
|
|
outOpt = { e: e, target: oldTarget, nextTarget: target };
|
|
}
|
|
inFires = target && targetChanged;
|
|
outFires = oldTarget && targetChanged;
|
|
if (outFires) {
|
|
canvasEvtOut && this.fire(canvasEvtOut, outOpt);
|
|
oldTarget.fire(config.evtOut, outOpt);
|
|
}
|
|
if (inFires) {
|
|
canvasEvtIn && this.fire(canvasEvtIn, inOpt);
|
|
target.fire(config.evtIn, inOpt);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Method that defines actions when an Event Mouse Wheel
|
|
* @param {Event} e Event object fired on mouseup
|
|
*/
|
|
__onMouseWheel: function(e) {
|
|
this._cacheTransformEventData(e);
|
|
this._handleEvent(e, 'wheel');
|
|
this._resetTransformEventData();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event fired on mousemove
|
|
*/
|
|
_transformObject: function(e) {
|
|
var pointer = this.getPointer(e),
|
|
transform = this._currentTransform;
|
|
|
|
transform.reset = false;
|
|
transform.shiftKey = e.shiftKey;
|
|
transform.altKey = e[this.centeredKey];
|
|
|
|
this._performTransformAction(e, transform, pointer);
|
|
transform.actionPerformed && this.requestRenderAll();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_performTransformAction: function(e, transform, pointer) {
|
|
var x = pointer.x,
|
|
y = pointer.y,
|
|
action = transform.action,
|
|
actionPerformed = false,
|
|
actionHandler = transform.actionHandler;
|
|
// this object could be created from the function in the control handlers
|
|
|
|
|
|
if (actionHandler) {
|
|
actionPerformed = actionHandler(e, transform, x, y);
|
|
}
|
|
if (action === 'drag' && actionPerformed) {
|
|
transform.target.isMoving = true;
|
|
this.setCursor(transform.target.moveCursor || this.moveCursor);
|
|
}
|
|
transform.actionPerformed = transform.actionPerformed || actionPerformed;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_fire: fabric.controlsUtils.fireEvent,
|
|
|
|
/**
|
|
* Sets the cursor depending on where the canvas is being hovered.
|
|
* Note: very buggy in Opera
|
|
* @param {Event} e Event object
|
|
* @param {Object} target Object that the mouse is hovering, if so.
|
|
*/
|
|
_setCursorFromEvent: function (e, target) {
|
|
if (!target) {
|
|
this.setCursor(this.defaultCursor);
|
|
return false;
|
|
}
|
|
var hoverCursor = target.hoverCursor || this.hoverCursor,
|
|
activeSelection = this._activeObject && this._activeObject.type === 'activeSelection' ?
|
|
this._activeObject : null,
|
|
// only show proper corner when group selection is not active
|
|
corner = (!activeSelection || !activeSelection.contains(target))
|
|
// here we call findTargetCorner always with undefined for the touch parameter.
|
|
// we assume that if you are using a cursor you do not need to interact with
|
|
// the bigger touch area.
|
|
&& target._findTargetCorner(this.getPointer(e, true));
|
|
|
|
if (!corner) {
|
|
if (target.subTargetCheck){
|
|
// hoverCursor should come from top-most subTarget,
|
|
// so we walk the array backwards
|
|
this.targets.concat().reverse().map(function(_target){
|
|
hoverCursor = _target.hoverCursor || hoverCursor;
|
|
});
|
|
}
|
|
this.setCursor(hoverCursor);
|
|
}
|
|
else {
|
|
this.setCursor(this.getCornerCursor(corner, target, e));
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
getCornerCursor: function(corner, target, e) {
|
|
var control = target.controls[corner];
|
|
return control.cursorStyleHandler(e, control, target);
|
|
}
|
|
});
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
var min = Math.min,
|
|
max = Math.max;
|
|
|
|
fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ {
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object
|
|
* @param {fabric.Object} target
|
|
* @return {Boolean}
|
|
*/
|
|
_shouldGroup: function(e, target) {
|
|
var activeObject = this._activeObject;
|
|
return activeObject && this._isSelectionKeyPressed(e) && target && target.selectable && this.selection &&
|
|
(activeObject !== target || activeObject.type === 'activeSelection') && !target.onSelect({ e: e });
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object
|
|
* @param {fabric.Object} target
|
|
*/
|
|
_handleGrouping: function (e, target) {
|
|
var activeObject = this._activeObject;
|
|
// avoid multi select when shift click on a corner
|
|
if (activeObject.__corner) {
|
|
return;
|
|
}
|
|
if (target === activeObject) {
|
|
// if it's a group, find target again, using activeGroup objects
|
|
target = this.findTarget(e, true);
|
|
// if even object is not found or we are on activeObjectCorner, bail out
|
|
if (!target || !target.selectable) {
|
|
return;
|
|
}
|
|
}
|
|
if (activeObject && activeObject.type === 'activeSelection') {
|
|
this._updateActiveSelection(target, e);
|
|
}
|
|
else {
|
|
this._createActiveSelection(target, e);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_updateActiveSelection: function(target, e) {
|
|
var activeSelection = this._activeObject,
|
|
currentActiveObjects = activeSelection._objects.slice(0);
|
|
if (activeSelection.contains(target)) {
|
|
activeSelection.removeWithUpdate(target);
|
|
this._hoveredTarget = target;
|
|
this._hoveredTargets = this.targets.concat();
|
|
if (activeSelection.size() === 1) {
|
|
// activate last remaining object
|
|
this._setActiveObject(activeSelection.item(0), e);
|
|
}
|
|
}
|
|
else {
|
|
activeSelection.addWithUpdate(target);
|
|
this._hoveredTarget = activeSelection;
|
|
this._hoveredTargets = this.targets.concat();
|
|
}
|
|
this._fireSelectionEvents(currentActiveObjects, e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createActiveSelection: function(target, e) {
|
|
var currentActives = this.getActiveObjects(), group = this._createGroup(target);
|
|
this._hoveredTarget = group;
|
|
// ISSUE 4115: should we consider subTargets here?
|
|
// this._hoveredTargets = [];
|
|
// this._hoveredTargets = this.targets.concat();
|
|
this._setActiveObject(group, e);
|
|
this._fireSelectionEvents(currentActives, e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} target
|
|
*/
|
|
_createGroup: function(target) {
|
|
var objects = this._objects,
|
|
isActiveLower = objects.indexOf(this._activeObject) < objects.indexOf(target),
|
|
groupObjects = isActiveLower
|
|
? [this._activeObject, target]
|
|
: [target, this._activeObject];
|
|
this._activeObject.isEditing && this._activeObject.exitEditing();
|
|
return new fabric.ActiveSelection(groupObjects, {
|
|
canvas: this
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e mouse event
|
|
*/
|
|
_groupSelectedObjects: function (e) {
|
|
|
|
var group = this._collectObjects(e),
|
|
aGroup;
|
|
|
|
// do not create group for 1 element only
|
|
if (group.length === 1) {
|
|
this.setActiveObject(group[0], e);
|
|
}
|
|
else if (group.length > 1) {
|
|
aGroup = new fabric.ActiveSelection(group.reverse(), {
|
|
canvas: this
|
|
});
|
|
this.setActiveObject(aGroup, e);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_collectObjects: function(e) {
|
|
var group = [],
|
|
currentObject,
|
|
x1 = this._groupSelector.ex,
|
|
y1 = this._groupSelector.ey,
|
|
x2 = x1 + this._groupSelector.left,
|
|
y2 = y1 + this._groupSelector.top,
|
|
selectionX1Y1 = new fabric.Point(min(x1, x2), min(y1, y2)),
|
|
selectionX2Y2 = new fabric.Point(max(x1, x2), max(y1, y2)),
|
|
allowIntersect = !this.selectionFullyContained,
|
|
isClick = x1 === x2 && y1 === y2;
|
|
// we iterate reverse order to collect top first in case of click.
|
|
for (var i = this._objects.length; i--; ) {
|
|
currentObject = this._objects[i];
|
|
|
|
if (!currentObject || !currentObject.selectable || !currentObject.visible) {
|
|
continue;
|
|
}
|
|
|
|
if ((allowIntersect && currentObject.intersectsWithRect(selectionX1Y1, selectionX2Y2, true)) ||
|
|
currentObject.isContainedWithinRect(selectionX1Y1, selectionX2Y2, true) ||
|
|
(allowIntersect && currentObject.containsPoint(selectionX1Y1, null, true)) ||
|
|
(allowIntersect && currentObject.containsPoint(selectionX2Y2, null, true))
|
|
) {
|
|
group.push(currentObject);
|
|
// only add one object if it's a click
|
|
if (isClick) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (group.length > 1) {
|
|
group = group.filter(function(object) {
|
|
return !object.onSelect({ e: e });
|
|
});
|
|
}
|
|
|
|
return group;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_maybeGroupObjects: function(e) {
|
|
if (this.selection && this._groupSelector) {
|
|
this._groupSelectedObjects(e);
|
|
}
|
|
this.setCursor(this.defaultCursor);
|
|
// clear selection and current transformation
|
|
this._groupSelector = null;
|
|
}
|
|
});
|
|
|
|
})();
|
|
|
|
|
|
(function () {
|
|
fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Exports canvas element to a dataurl image. Note that when multiplier is used, cropping is scaled appropriately
|
|
* @param {Object} [options] Options object
|
|
* @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png"
|
|
* @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg.
|
|
* @param {Number} [options.multiplier=1] Multiplier to scale by, to have consistent
|
|
* @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14
|
|
* @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14
|
|
* @param {Number} [options.width] Cropping width. Introduced in v1.2.14
|
|
* @param {Number} [options.height] Cropping height. Introduced in v1.2.14
|
|
* @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 2.0.0
|
|
* @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format
|
|
* @see {@link http://jsfiddle.net/fabricjs/NfZVb/|jsFiddle demo}
|
|
* @example <caption>Generate jpeg dataURL with lower quality</caption>
|
|
* var dataURL = canvas.toDataURL({
|
|
* format: 'jpeg',
|
|
* quality: 0.8
|
|
* });
|
|
* @example <caption>Generate cropped png dataURL (clipping of canvas)</caption>
|
|
* var dataURL = canvas.toDataURL({
|
|
* format: 'png',
|
|
* left: 100,
|
|
* top: 100,
|
|
* width: 200,
|
|
* height: 200
|
|
* });
|
|
* @example <caption>Generate double scaled png dataURL</caption>
|
|
* var dataURL = canvas.toDataURL({
|
|
* format: 'png',
|
|
* multiplier: 2
|
|
* });
|
|
*/
|
|
toDataURL: function (options) {
|
|
options || (options = { });
|
|
|
|
var format = options.format || 'png',
|
|
quality = options.quality || 1,
|
|
multiplier = (options.multiplier || 1) * (options.enableRetinaScaling ? this.getRetinaScaling() : 1),
|
|
canvasEl = this.toCanvasElement(multiplier, options);
|
|
return fabric.util.toDataURL(canvasEl, format, quality);
|
|
},
|
|
|
|
/**
|
|
* Create a new HTMLCanvas element painted with the current canvas content.
|
|
* No need to resize the actual one or repaint it.
|
|
* Will transfer object ownership to a new canvas, paint it, and set everything back.
|
|
* This is an intermediary step used to get to a dataUrl but also it is useful to
|
|
* create quick image copies of a canvas without passing for the dataUrl string
|
|
* @param {Number} [multiplier] a zoom factor.
|
|
* @param {Object} [cropping] Cropping informations
|
|
* @param {Number} [cropping.left] Cropping left offset.
|
|
* @param {Number} [cropping.top] Cropping top offset.
|
|
* @param {Number} [cropping.width] Cropping width.
|
|
* @param {Number} [cropping.height] Cropping height.
|
|
*/
|
|
toCanvasElement: function(multiplier, cropping) {
|
|
multiplier = multiplier || 1;
|
|
cropping = cropping || { };
|
|
var scaledWidth = (cropping.width || this.width) * multiplier,
|
|
scaledHeight = (cropping.height || this.height) * multiplier,
|
|
zoom = this.getZoom(),
|
|
originalWidth = this.width,
|
|
originalHeight = this.height,
|
|
newZoom = zoom * multiplier,
|
|
vp = this.viewportTransform,
|
|
translateX = (vp[4] - (cropping.left || 0)) * multiplier,
|
|
translateY = (vp[5] - (cropping.top || 0)) * multiplier,
|
|
originalInteractive = this.interactive,
|
|
newVp = [newZoom, 0, 0, newZoom, translateX, translateY],
|
|
originalRetina = this.enableRetinaScaling,
|
|
canvasEl = fabric.util.createCanvasElement(),
|
|
originalContextTop = this.contextTop;
|
|
canvasEl.width = scaledWidth;
|
|
canvasEl.height = scaledHeight;
|
|
this.contextTop = null;
|
|
this.enableRetinaScaling = false;
|
|
this.interactive = false;
|
|
this.viewportTransform = newVp;
|
|
this.width = scaledWidth;
|
|
this.height = scaledHeight;
|
|
this.calcViewportBoundaries();
|
|
this.renderCanvas(canvasEl.getContext('2d'), this._objects);
|
|
this.viewportTransform = vp;
|
|
this.width = originalWidth;
|
|
this.height = originalHeight;
|
|
this.calcViewportBoundaries();
|
|
this.interactive = originalInteractive;
|
|
this.enableRetinaScaling = originalRetina;
|
|
this.contextTop = originalContextTop;
|
|
return canvasEl;
|
|
},
|
|
});
|
|
|
|
})();
|
|
|
|
|
|
fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
/**
|
|
* Populates canvas with data from the specified JSON.
|
|
* JSON format must conform to the one of {@link fabric.Canvas#toJSON}
|
|
* @param {String|Object} json JSON string or object
|
|
* @param {Function} callback Callback, invoked when json is parsed
|
|
* and corresponding objects (e.g: {@link fabric.Image})
|
|
* are initialized
|
|
* @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created.
|
|
* @return {fabric.Canvas} instance
|
|
* @chainable
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-3#deserialization}
|
|
* @see {@link http://jsfiddle.net/fabricjs/fmgXt/|jsFiddle demo}
|
|
* @example <caption>loadFromJSON</caption>
|
|
* canvas.loadFromJSON(json, canvas.renderAll.bind(canvas));
|
|
* @example <caption>loadFromJSON with reviver</caption>
|
|
* canvas.loadFromJSON(json, canvas.renderAll.bind(canvas), function(o, object) {
|
|
* // `o` = json object
|
|
* // `object` = fabric.Object instance
|
|
* // ... do some stuff ...
|
|
* });
|
|
*/
|
|
loadFromJSON: function (json, callback, reviver) {
|
|
if (!json) {
|
|
return;
|
|
}
|
|
|
|
// serialize if it wasn't already
|
|
var serialized = (typeof json === 'string')
|
|
? JSON.parse(json)
|
|
: fabric.util.object.clone(json);
|
|
|
|
var _this = this,
|
|
clipPath = serialized.clipPath,
|
|
renderOnAddRemove = this.renderOnAddRemove;
|
|
|
|
this.renderOnAddRemove = false;
|
|
|
|
delete serialized.clipPath;
|
|
|
|
this._enlivenObjects(serialized.objects, function (enlivenedObjects) {
|
|
_this.clear();
|
|
_this._setBgOverlay(serialized, function () {
|
|
if (clipPath) {
|
|
_this._enlivenObjects([clipPath], function (enlivenedCanvasClip) {
|
|
_this.clipPath = enlivenedCanvasClip[0];
|
|
_this.__setupCanvas.call(_this, serialized, enlivenedObjects, renderOnAddRemove, callback);
|
|
});
|
|
}
|
|
else {
|
|
_this.__setupCanvas.call(_this, serialized, enlivenedObjects, renderOnAddRemove, callback);
|
|
}
|
|
});
|
|
}, reviver);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} serialized Object with background and overlay information
|
|
* @param {Array} restored canvas objects
|
|
* @param {Function} cached renderOnAddRemove callback
|
|
* @param {Function} callback Invoked after all background and overlay images/patterns loaded
|
|
*/
|
|
__setupCanvas: function(serialized, enlivenedObjects, renderOnAddRemove, callback) {
|
|
var _this = this;
|
|
enlivenedObjects.forEach(function(obj, index) {
|
|
// we splice the array just in case some custom classes restored from JSON
|
|
// will add more object to canvas at canvas init.
|
|
_this.insertAt(obj, index);
|
|
});
|
|
this.renderOnAddRemove = renderOnAddRemove;
|
|
// remove parts i cannot set as options
|
|
delete serialized.objects;
|
|
delete serialized.backgroundImage;
|
|
delete serialized.overlayImage;
|
|
delete serialized.background;
|
|
delete serialized.overlay;
|
|
// this._initOptions does too many things to just
|
|
// call it. Normally loading an Object from JSON
|
|
// create the Object instance. Here the Canvas is
|
|
// already an instance and we are just loading things over it
|
|
this._setOptions(serialized);
|
|
this.renderAll();
|
|
callback && callback();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} serialized Object with background and overlay information
|
|
* @param {Function} callback Invoked after all background and overlay images/patterns loaded
|
|
*/
|
|
_setBgOverlay: function(serialized, callback) {
|
|
var loaded = {
|
|
backgroundColor: false,
|
|
overlayColor: false,
|
|
backgroundImage: false,
|
|
overlayImage: false
|
|
};
|
|
|
|
if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background && !serialized.overlay) {
|
|
callback && callback();
|
|
return;
|
|
}
|
|
|
|
var cbIfLoaded = function () {
|
|
if (loaded.backgroundImage && loaded.overlayImage && loaded.backgroundColor && loaded.overlayColor) {
|
|
callback && callback();
|
|
}
|
|
};
|
|
|
|
this.__setBgOverlay('backgroundImage', serialized.backgroundImage, loaded, cbIfLoaded);
|
|
this.__setBgOverlay('overlayImage', serialized.overlayImage, loaded, cbIfLoaded);
|
|
this.__setBgOverlay('backgroundColor', serialized.background, loaded, cbIfLoaded);
|
|
this.__setBgOverlay('overlayColor', serialized.overlay, loaded, cbIfLoaded);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} property Property to set (backgroundImage, overlayImage, backgroundColor, overlayColor)
|
|
* @param {(Object|String)} value Value to set
|
|
* @param {Object} loaded Set loaded property to true if property is set
|
|
* @param {Object} callback Callback function to invoke after property is set
|
|
*/
|
|
__setBgOverlay: function(property, value, loaded, callback) {
|
|
var _this = this;
|
|
|
|
if (!value) {
|
|
loaded[property] = true;
|
|
callback && callback();
|
|
return;
|
|
}
|
|
|
|
if (property === 'backgroundImage' || property === 'overlayImage') {
|
|
fabric.util.enlivenObjects([value], function(enlivedObject){
|
|
_this[property] = enlivedObject[0];
|
|
loaded[property] = true;
|
|
callback && callback();
|
|
});
|
|
}
|
|
else {
|
|
this['set' + fabric.util.string.capitalize(property, true)](value, function() {
|
|
loaded[property] = true;
|
|
callback && callback();
|
|
});
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Array} objects
|
|
* @param {Function} callback
|
|
* @param {Function} [reviver]
|
|
*/
|
|
_enlivenObjects: function (objects, callback, reviver) {
|
|
if (!objects || objects.length === 0) {
|
|
callback && callback([]);
|
|
return;
|
|
}
|
|
|
|
fabric.util.enlivenObjects(objects, function(enlivenedObjects) {
|
|
callback && callback(enlivenedObjects);
|
|
}, null, reviver);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} format
|
|
* @param {Function} callback
|
|
*/
|
|
_toDataURL: function (format, callback) {
|
|
this.clone(function (clone) {
|
|
callback(clone.toDataURL(format));
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} format
|
|
* @param {Number} multiplier
|
|
* @param {Function} callback
|
|
*/
|
|
_toDataURLWithMultiplier: function (format, multiplier, callback) {
|
|
this.clone(function (clone) {
|
|
callback(clone.toDataURLWithMultiplier(format, multiplier));
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Clones canvas instance
|
|
* @param {Object} [callback] Receives cloned instance as a first argument
|
|
* @param {Array} [properties] Array of properties to include in the cloned canvas and children
|
|
*/
|
|
clone: function (callback, properties) {
|
|
var data = JSON.stringify(this.toJSON(properties));
|
|
this.cloneWithoutData(function(clone) {
|
|
clone.loadFromJSON(data, function() {
|
|
callback && callback(clone);
|
|
});
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Clones canvas instance without cloning existing data.
|
|
* This essentially copies canvas dimensions, clipping properties, etc.
|
|
* but leaves data empty (so that you can populate it with your own)
|
|
* @param {Object} [callback] Receives cloned instance as a first argument
|
|
*/
|
|
cloneWithoutData: function(callback) {
|
|
var el = fabric.util.createCanvasElement();
|
|
|
|
el.width = this.width;
|
|
el.height = this.height;
|
|
|
|
var clone = new fabric.Canvas(el);
|
|
if (this.backgroundImage) {
|
|
clone.setBackgroundImage(this.backgroundImage.src, function() {
|
|
clone.renderAll();
|
|
callback && callback(clone);
|
|
});
|
|
clone.backgroundImageOpacity = this.backgroundImageOpacity;
|
|
clone.backgroundImageStretch = this.backgroundImageStretch;
|
|
}
|
|
else {
|
|
callback && callback(clone);
|
|
}
|
|
}
|
|
});
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
clone = fabric.util.object.clone,
|
|
toFixed = fabric.util.toFixed,
|
|
capitalize = fabric.util.string.capitalize,
|
|
degreesToRadians = fabric.util.degreesToRadians,
|
|
objectCaching = !fabric.isLikelyNode,
|
|
ALIASING_LIMIT = 2;
|
|
|
|
if (fabric.Object) {
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Root object class from which all 2d shape classes inherit from
|
|
* @class fabric.Object
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-1#objects}
|
|
* @see {@link fabric.Object#initialize} for constructor definition
|
|
*
|
|
* @fires added
|
|
* @fires removed
|
|
*
|
|
* @fires selected
|
|
* @fires deselected
|
|
* @fires modified
|
|
* @fires modified
|
|
* @fires moved
|
|
* @fires scaled
|
|
* @fires rotated
|
|
* @fires skewed
|
|
*
|
|
* @fires rotating
|
|
* @fires scaling
|
|
* @fires moving
|
|
* @fires skewing
|
|
*
|
|
* @fires mousedown
|
|
* @fires mouseup
|
|
* @fires mouseover
|
|
* @fires mouseout
|
|
* @fires mousewheel
|
|
* @fires mousedblclick
|
|
*
|
|
* @fires dragover
|
|
* @fires dragenter
|
|
* @fires dragleave
|
|
* @fires drop
|
|
*/
|
|
fabric.Object = fabric.util.createClass(fabric.CommonMethods, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Type of an object (rect, circle, path, etc.).
|
|
* Note that this property is meant to be read-only and not meant to be modified.
|
|
* If you modify, certain parts of Fabric (such as JSON loading) won't work correctly.
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'object',
|
|
|
|
/**
|
|
* Horizontal origin of transformation of an object (one of "left", "right", "center")
|
|
* See http://jsfiddle.net/1ow02gea/244/ on how originX/originY affect objects in groups
|
|
* @type String
|
|
* @default
|
|
*/
|
|
originX: 'left',
|
|
|
|
/**
|
|
* Vertical origin of transformation of an object (one of "top", "bottom", "center")
|
|
* See http://jsfiddle.net/1ow02gea/244/ on how originX/originY affect objects in groups
|
|
* @type String
|
|
* @default
|
|
*/
|
|
originY: 'top',
|
|
|
|
/**
|
|
* Top position of an object. Note that by default it's relative to object top. You can change this by setting originY={top/center/bottom}
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
top: 0,
|
|
|
|
/**
|
|
* Left position of an object. Note that by default it's relative to object left. You can change this by setting originX={left/center/right}
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
left: 0,
|
|
|
|
/**
|
|
* Object width
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
width: 0,
|
|
|
|
/**
|
|
* Object height
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
height: 0,
|
|
|
|
/**
|
|
* Object scale factor (horizontal)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
scaleX: 1,
|
|
|
|
/**
|
|
* Object scale factor (vertical)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
scaleY: 1,
|
|
|
|
/**
|
|
* When true, an object is rendered as flipped horizontally
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
flipX: false,
|
|
|
|
/**
|
|
* When true, an object is rendered as flipped vertically
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
flipY: false,
|
|
|
|
/**
|
|
* Opacity of an object
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
opacity: 1,
|
|
|
|
/**
|
|
* Angle of rotation of an object (in degrees)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
angle: 0,
|
|
|
|
/**
|
|
* Angle of skew on x axes of an object (in degrees)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
skewX: 0,
|
|
|
|
/**
|
|
* Angle of skew on y axes of an object (in degrees)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
skewY: 0,
|
|
|
|
/**
|
|
* Size of object's controlling corners (in pixels)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
cornerSize: 13,
|
|
|
|
/**
|
|
* Size of object's controlling corners when touch interaction is detected
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
touchCornerSize: 24,
|
|
|
|
/**
|
|
* When true, object's controlling corners are rendered as transparent inside (i.e. stroke instead of fill)
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
transparentCorners: true,
|
|
|
|
/**
|
|
* Default cursor value used when hovering over this object on canvas
|
|
* @type String
|
|
* @default
|
|
*/
|
|
hoverCursor: null,
|
|
|
|
/**
|
|
* Default cursor value used when moving this object on canvas
|
|
* @type String
|
|
* @default
|
|
*/
|
|
moveCursor: null,
|
|
|
|
/**
|
|
* Padding between object and its controlling borders (in pixels)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
padding: 0,
|
|
|
|
/**
|
|
* Color of controlling borders of an object (when it's active)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
borderColor: 'rgb(178,204,255)',
|
|
|
|
/**
|
|
* Array specifying dash pattern of an object's borders (hasBorder must be true)
|
|
* @since 1.6.2
|
|
* @type Array
|
|
*/
|
|
borderDashArray: null,
|
|
|
|
/**
|
|
* Color of controlling corners of an object (when it's active)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
cornerColor: 'rgb(178,204,255)',
|
|
|
|
/**
|
|
* Color of controlling corners of an object (when it's active and transparentCorners false)
|
|
* @since 1.6.2
|
|
* @type String
|
|
* @default
|
|
*/
|
|
cornerStrokeColor: null,
|
|
|
|
/**
|
|
* Specify style of control, 'rect' or 'circle'
|
|
* @since 1.6.2
|
|
* @type String
|
|
*/
|
|
cornerStyle: 'rect',
|
|
|
|
/**
|
|
* Array specifying dash pattern of an object's control (hasBorder must be true)
|
|
* @since 1.6.2
|
|
* @type Array
|
|
*/
|
|
cornerDashArray: null,
|
|
|
|
/**
|
|
* When true, this object will use center point as the origin of transformation
|
|
* when being scaled via the controls.
|
|
* <b>Backwards incompatibility note:</b> This property replaces "centerTransform" (Boolean).
|
|
* @since 1.3.4
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
centeredScaling: false,
|
|
|
|
/**
|
|
* When true, this object will use center point as the origin of transformation
|
|
* when being rotated via the controls.
|
|
* <b>Backwards incompatibility note:</b> This property replaces "centerTransform" (Boolean).
|
|
* @since 1.3.4
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
centeredRotation: true,
|
|
|
|
/**
|
|
* Color of object's fill
|
|
* takes css colors https://www.w3.org/TR/css-color-3/
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fill: 'rgb(0,0,0)',
|
|
|
|
/**
|
|
* Fill rule used to fill an object
|
|
* accepted values are nonzero, evenodd
|
|
* <b>Backwards incompatibility note:</b> This property was used for setting globalCompositeOperation until v1.4.12 (use `fabric.Object#globalCompositeOperation` instead)
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fillRule: 'nonzero',
|
|
|
|
/**
|
|
* Composite rule used for canvas globalCompositeOperation
|
|
* @type String
|
|
* @default
|
|
*/
|
|
globalCompositeOperation: 'source-over',
|
|
|
|
/**
|
|
* Background color of an object.
|
|
* takes css colors https://www.w3.org/TR/css-color-3/
|
|
* @type String
|
|
* @default
|
|
*/
|
|
backgroundColor: '',
|
|
|
|
/**
|
|
* Selection Background color of an object. colored layer behind the object when it is active.
|
|
* does not mix good with globalCompositeOperation methods.
|
|
* @type String
|
|
* @default
|
|
*/
|
|
selectionBackgroundColor: '',
|
|
|
|
/**
|
|
* When defined, an object is rendered via stroke and this property specifies its color
|
|
* takes css colors https://www.w3.org/TR/css-color-3/
|
|
* @type String
|
|
* @default
|
|
*/
|
|
stroke: null,
|
|
|
|
/**
|
|
* Width of a stroke used to render this object
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeWidth: 1,
|
|
|
|
/**
|
|
* Array specifying dash pattern of an object's stroke (stroke must be defined)
|
|
* @type Array
|
|
*/
|
|
strokeDashArray: null,
|
|
|
|
/**
|
|
* Line offset of an object's stroke
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeDashOffset: 0,
|
|
|
|
/**
|
|
* Line endings style of an object's stroke (one of "butt", "round", "square")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineCap: 'butt',
|
|
|
|
/**
|
|
* Corner style of an object's stroke (one of "bevel", "round", "miter")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
strokeLineJoin: 'miter',
|
|
|
|
/**
|
|
* Maximum miter length (used for strokeLineJoin = "miter") of an object's stroke
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeMiterLimit: 4,
|
|
|
|
/**
|
|
* Shadow object representing shadow of this shape
|
|
* @type fabric.Shadow
|
|
* @default
|
|
*/
|
|
shadow: null,
|
|
|
|
/**
|
|
* Opacity of object's controlling borders when object is active and moving
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
borderOpacityWhenMoving: 0.4,
|
|
|
|
/**
|
|
* Scale factor of object's controlling borders
|
|
* bigger number will make a thicker border
|
|
* border is 1, so this is basically a border thickness
|
|
* since there is no way to change the border itself.
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
borderScaleFactor: 1,
|
|
|
|
/**
|
|
* Minimum allowed scale value of an object
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
minScaleLimit: 0,
|
|
|
|
/**
|
|
* When set to `false`, an object can not be selected for modification (using either point-click-based or group-based selection).
|
|
* But events still fire on it.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
selectable: true,
|
|
|
|
/**
|
|
* When set to `false`, an object can not be a target of events. All events propagate through it. Introduced in v1.3.4
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
evented: true,
|
|
|
|
/**
|
|
* When set to `false`, an object is not rendered on canvas
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
visible: true,
|
|
|
|
/**
|
|
* When set to `false`, object's controls are not displayed and can not be used to manipulate object
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
hasControls: true,
|
|
|
|
/**
|
|
* When set to `false`, object's controlling borders are not rendered
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
hasBorders: true,
|
|
|
|
/**
|
|
* When set to `true`, objects are "found" on canvas on per-pixel basis rather than according to bounding box
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
perPixelTargetFind: false,
|
|
|
|
/**
|
|
* When `false`, default object's values are not included in its serialization
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
includeDefaultValues: true,
|
|
|
|
/**
|
|
* When `true`, object horizontal movement is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockMovementX: false,
|
|
|
|
/**
|
|
* When `true`, object vertical movement is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockMovementY: false,
|
|
|
|
/**
|
|
* When `true`, object rotation is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockRotation: false,
|
|
|
|
/**
|
|
* When `true`, object horizontal scaling is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockScalingX: false,
|
|
|
|
/**
|
|
* When `true`, object vertical scaling is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockScalingY: false,
|
|
|
|
/**
|
|
* When `true`, object horizontal skewing is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockSkewingX: false,
|
|
|
|
/**
|
|
* When `true`, object vertical skewing is locked
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockSkewingY: false,
|
|
|
|
/**
|
|
* When `true`, object cannot be flipped by scaling into negative values
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
lockScalingFlip: false,
|
|
|
|
/**
|
|
* When `true`, object is not exported in OBJECT/JSON
|
|
* @since 1.6.3
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
excludeFromExport: false,
|
|
|
|
/**
|
|
* When `true`, object is cached on an additional canvas.
|
|
* When `false`, object is not cached unless necessary ( clipPath )
|
|
* default to true
|
|
* @since 1.7.0
|
|
* @type Boolean
|
|
* @default true
|
|
*/
|
|
objectCaching: objectCaching,
|
|
|
|
/**
|
|
* When `true`, object properties are checked for cache invalidation. In some particular
|
|
* situation you may want this to be disabled ( spray brush, very big, groups)
|
|
* or if your application does not allow you to modify properties for groups child you want
|
|
* to disable it for groups.
|
|
* default to false
|
|
* since 1.7.0
|
|
* @type Boolean
|
|
* @default false
|
|
*/
|
|
statefullCache: false,
|
|
|
|
/**
|
|
* When `true`, cache does not get updated during scaling. The picture will get blocky if scaled
|
|
* too much and will be redrawn with correct details at the end of scaling.
|
|
* this setting is performance and application dependant.
|
|
* default to true
|
|
* since 1.7.0
|
|
* @type Boolean
|
|
* @default true
|
|
*/
|
|
noScaleCache: true,
|
|
|
|
/**
|
|
* When `false`, the stoke width will scale with the object.
|
|
* When `true`, the stroke will always match the exact pixel size entered for stroke width.
|
|
* default to false
|
|
* @since 2.6.0
|
|
* @type Boolean
|
|
* @default false
|
|
* @type Boolean
|
|
* @default false
|
|
*/
|
|
strokeUniform: false,
|
|
|
|
/**
|
|
* When set to `true`, object's cache will be rerendered next render call.
|
|
* since 1.7.0
|
|
* @type Boolean
|
|
* @default true
|
|
*/
|
|
dirty: true,
|
|
|
|
/**
|
|
* keeps the value of the last hovered corner during mouse move.
|
|
* 0 is no corner, or 'mt', 'ml', 'mtr' etc..
|
|
* It should be private, but there is no harm in using it as
|
|
* a read-only property.
|
|
* @type number|string|any
|
|
* @default 0
|
|
*/
|
|
__corner: 0,
|
|
|
|
/**
|
|
* Determines if the fill or the stroke is drawn first (one of "fill" or "stroke")
|
|
* @type String
|
|
* @default
|
|
*/
|
|
paintFirst: 'fill',
|
|
|
|
/**
|
|
* When 'down', object is set to active on mousedown/touchstart
|
|
* When 'up', object is set to active on mouseup/touchend
|
|
* Experimental. Let's see if this breaks anything before supporting officially
|
|
* @private
|
|
* since 4.4.0
|
|
* @type String
|
|
* @default 'down'
|
|
*/
|
|
activeOn: 'down',
|
|
|
|
/**
|
|
* List of properties to consider when checking if state
|
|
* of an object is changed (fabric.Object#hasStateChanged)
|
|
* as well as for history (undo/redo) purposes
|
|
* @type Array
|
|
*/
|
|
stateProperties: (
|
|
'top left width height scaleX scaleY flipX flipY originX originY transformMatrix ' +
|
|
'stroke strokeWidth strokeDashArray strokeLineCap strokeDashOffset strokeLineJoin strokeMiterLimit ' +
|
|
'angle opacity fill globalCompositeOperation shadow visible backgroundColor ' +
|
|
'skewX skewY fillRule paintFirst clipPath strokeUniform'
|
|
).split(' '),
|
|
|
|
/**
|
|
* List of properties to consider when checking if cache needs refresh
|
|
* Those properties are checked by statefullCache ON ( or lazy mode if we want ) or from single
|
|
* calls to Object.set(key, value). If the key is in this list, the object is marked as dirty
|
|
* and refreshed at the next render
|
|
* @type Array
|
|
*/
|
|
cacheProperties: (
|
|
'fill stroke strokeWidth strokeDashArray width height paintFirst strokeUniform' +
|
|
' strokeLineCap strokeDashOffset strokeLineJoin strokeMiterLimit backgroundColor clipPath'
|
|
).split(' '),
|
|
|
|
/**
|
|
* List of properties to consider for animating colors.
|
|
* @type Array
|
|
*/
|
|
colorProperties: (
|
|
'fill stroke backgroundColor'
|
|
).split(' '),
|
|
|
|
/**
|
|
* a fabricObject that, without stroke define a clipping area with their shape. filled in black
|
|
* the clipPath object gets used when the object has rendered, and the context is placed in the center
|
|
* of the object cacheCanvas.
|
|
* If you want 0,0 of a clipPath to align with an object center, use clipPath.originX/Y to 'center'
|
|
* @type fabric.Object
|
|
*/
|
|
clipPath: undefined,
|
|
|
|
/**
|
|
* Meaningful ONLY when the object is used as clipPath.
|
|
* if true, the clipPath will make the object clip to the outside of the clipPath
|
|
* since 2.4.0
|
|
* @type boolean
|
|
* @default false
|
|
*/
|
|
inverted: false,
|
|
|
|
/**
|
|
* Meaningful ONLY when the object is used as clipPath.
|
|
* if true, the clipPath will have its top and left relative to canvas, and will
|
|
* not be influenced by the object transform. This will make the clipPath relative
|
|
* to the canvas, but clipping just a particular object.
|
|
* WARNING this is beta, this feature may change or be renamed.
|
|
* since 2.4.0
|
|
* @type boolean
|
|
* @default false
|
|
*/
|
|
absolutePositioned: false,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
if (options) {
|
|
this.setOptions(options);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Create a the canvas used to keep the cached copy of the object
|
|
* @private
|
|
*/
|
|
_createCacheCanvas: function() {
|
|
this._cacheProperties = {};
|
|
this._cacheCanvas = fabric.util.createCanvasElement();
|
|
this._cacheContext = this._cacheCanvas.getContext('2d');
|
|
this._updateCacheCanvas();
|
|
// if canvas gets created, is empty, so dirty.
|
|
this.dirty = true;
|
|
},
|
|
|
|
/**
|
|
* Limit the cache dimensions so that X * Y do not cross fabric.perfLimitSizeTotal
|
|
* and each side do not cross fabric.cacheSideLimit
|
|
* those numbers are configurable so that you can get as much detail as you want
|
|
* making bargain with performances.
|
|
* @param {Object} dims
|
|
* @param {Object} dims.width width of canvas
|
|
* @param {Object} dims.height height of canvas
|
|
* @param {Object} dims.zoomX zoomX zoom value to unscale the canvas before drawing cache
|
|
* @param {Object} dims.zoomY zoomY zoom value to unscale the canvas before drawing cache
|
|
* @return {Object}.width width of canvas
|
|
* @return {Object}.height height of canvas
|
|
* @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache
|
|
* @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache
|
|
*/
|
|
_limitCacheSize: function(dims) {
|
|
var perfLimitSizeTotal = fabric.perfLimitSizeTotal,
|
|
width = dims.width, height = dims.height,
|
|
max = fabric.maxCacheSideLimit, min = fabric.minCacheSideLimit;
|
|
if (width <= max && height <= max && width * height <= perfLimitSizeTotal) {
|
|
if (width < min) {
|
|
dims.width = min;
|
|
}
|
|
if (height < min) {
|
|
dims.height = min;
|
|
}
|
|
return dims;
|
|
}
|
|
var ar = width / height, limitedDims = fabric.util.limitDimsByArea(ar, perfLimitSizeTotal),
|
|
capValue = fabric.util.capValue,
|
|
x = capValue(min, limitedDims.x, max),
|
|
y = capValue(min, limitedDims.y, max);
|
|
if (width > x) {
|
|
dims.zoomX /= width / x;
|
|
dims.width = x;
|
|
dims.capped = true;
|
|
}
|
|
if (height > y) {
|
|
dims.zoomY /= height / y;
|
|
dims.height = y;
|
|
dims.capped = true;
|
|
}
|
|
return dims;
|
|
},
|
|
|
|
/**
|
|
* Return the dimension and the zoom level needed to create a cache canvas
|
|
* big enough to host the object to be cached.
|
|
* @private
|
|
* @return {Object}.x width of object to be cached
|
|
* @return {Object}.y height of object to be cached
|
|
* @return {Object}.width width of canvas
|
|
* @return {Object}.height height of canvas
|
|
* @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache
|
|
* @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache
|
|
*/
|
|
_getCacheCanvasDimensions: function() {
|
|
var objectScale = this.getTotalObjectScaling(),
|
|
// caculate dimensions without skewing
|
|
dim = this._getTransformedDimensions(0, 0),
|
|
neededX = dim.x * objectScale.scaleX / this.scaleX,
|
|
neededY = dim.y * objectScale.scaleY / this.scaleY;
|
|
return {
|
|
// for sure this ALIASING_LIMIT is slightly creating problem
|
|
// in situation in which the cache canvas gets an upper limit
|
|
// also objectScale contains already scaleX and scaleY
|
|
width: neededX + ALIASING_LIMIT,
|
|
height: neededY + ALIASING_LIMIT,
|
|
zoomX: objectScale.scaleX,
|
|
zoomY: objectScale.scaleY,
|
|
x: neededX,
|
|
y: neededY
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Update width and height of the canvas for cache
|
|
* returns true or false if canvas needed resize.
|
|
* @private
|
|
* @return {Boolean} true if the canvas has been resized
|
|
*/
|
|
_updateCacheCanvas: function() {
|
|
var targetCanvas = this.canvas;
|
|
if (this.noScaleCache && targetCanvas && targetCanvas._currentTransform) {
|
|
var target = targetCanvas._currentTransform.target,
|
|
action = targetCanvas._currentTransform.action;
|
|
if (this === target && action.slice && action.slice(0, 5) === 'scale') {
|
|
return false;
|
|
}
|
|
}
|
|
var canvas = this._cacheCanvas,
|
|
dims = this._limitCacheSize(this._getCacheCanvasDimensions()),
|
|
minCacheSize = fabric.minCacheSideLimit,
|
|
width = dims.width, height = dims.height, drawingWidth, drawingHeight,
|
|
zoomX = dims.zoomX, zoomY = dims.zoomY,
|
|
dimensionsChanged = width !== this.cacheWidth || height !== this.cacheHeight,
|
|
zoomChanged = this.zoomX !== zoomX || this.zoomY !== zoomY,
|
|
shouldRedraw = dimensionsChanged || zoomChanged,
|
|
additionalWidth = 0, additionalHeight = 0, shouldResizeCanvas = false;
|
|
if (dimensionsChanged) {
|
|
var canvasWidth = this._cacheCanvas.width,
|
|
canvasHeight = this._cacheCanvas.height,
|
|
sizeGrowing = width > canvasWidth || height > canvasHeight,
|
|
sizeShrinking = (width < canvasWidth * 0.9 || height < canvasHeight * 0.9) &&
|
|
canvasWidth > minCacheSize && canvasHeight > minCacheSize;
|
|
shouldResizeCanvas = sizeGrowing || sizeShrinking;
|
|
if (sizeGrowing && !dims.capped && (width > minCacheSize || height > minCacheSize)) {
|
|
additionalWidth = width * 0.1;
|
|
additionalHeight = height * 0.1;
|
|
}
|
|
}
|
|
if (this instanceof fabric.Text && this.path) {
|
|
shouldRedraw = true;
|
|
shouldResizeCanvas = true;
|
|
additionalWidth += this.getHeightOfLine(0) * this.zoomX;
|
|
additionalHeight += this.getHeightOfLine(0) * this.zoomY;
|
|
}
|
|
if (shouldRedraw) {
|
|
if (shouldResizeCanvas) {
|
|
canvas.width = Math.ceil(width + additionalWidth);
|
|
canvas.height = Math.ceil(height + additionalHeight);
|
|
}
|
|
else {
|
|
this._cacheContext.setTransform(1, 0, 0, 1, 0, 0);
|
|
this._cacheContext.clearRect(0, 0, canvas.width, canvas.height);
|
|
}
|
|
drawingWidth = dims.x / 2;
|
|
drawingHeight = dims.y / 2;
|
|
this.cacheTranslationX = Math.round(canvas.width / 2 - drawingWidth) + drawingWidth;
|
|
this.cacheTranslationY = Math.round(canvas.height / 2 - drawingHeight) + drawingHeight;
|
|
this.cacheWidth = width;
|
|
this.cacheHeight = height;
|
|
this._cacheContext.translate(this.cacheTranslationX, this.cacheTranslationY);
|
|
this._cacheContext.scale(zoomX, zoomY);
|
|
this.zoomX = zoomX;
|
|
this.zoomY = zoomY;
|
|
return true;
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Sets object's properties from options
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
setOptions: function(options) {
|
|
this._setOptions(options);
|
|
this._initGradient(options.fill, 'fill');
|
|
this._initGradient(options.stroke, 'stroke');
|
|
this._initPattern(options.fill, 'fill');
|
|
this._initPattern(options.stroke, 'stroke');
|
|
},
|
|
|
|
/**
|
|
* Transforms context when rendering an object
|
|
* @param {CanvasRenderingContext2D} ctx Context
|
|
*/
|
|
transform: function(ctx) {
|
|
var needFullTransform = (this.group && !this.group._transformDone) ||
|
|
(this.group && this.canvas && ctx === this.canvas.contextTop);
|
|
var m = this.calcTransformMatrix(!needFullTransform);
|
|
ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
},
|
|
|
|
/**
|
|
* Returns an object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS,
|
|
|
|
object = {
|
|
type: this.type,
|
|
version: fabric.version,
|
|
originX: this.originX,
|
|
originY: this.originY,
|
|
left: toFixed(this.left, NUM_FRACTION_DIGITS),
|
|
top: toFixed(this.top, NUM_FRACTION_DIGITS),
|
|
width: toFixed(this.width, NUM_FRACTION_DIGITS),
|
|
height: toFixed(this.height, NUM_FRACTION_DIGITS),
|
|
fill: (this.fill && this.fill.toObject) ? this.fill.toObject() : this.fill,
|
|
stroke: (this.stroke && this.stroke.toObject) ? this.stroke.toObject() : this.stroke,
|
|
strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS),
|
|
strokeDashArray: this.strokeDashArray ? this.strokeDashArray.concat() : this.strokeDashArray,
|
|
strokeLineCap: this.strokeLineCap,
|
|
strokeDashOffset: this.strokeDashOffset,
|
|
strokeLineJoin: this.strokeLineJoin,
|
|
strokeUniform: this.strokeUniform,
|
|
strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS),
|
|
scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS),
|
|
scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS),
|
|
angle: toFixed(this.angle, NUM_FRACTION_DIGITS),
|
|
flipX: this.flipX,
|
|
flipY: this.flipY,
|
|
opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS),
|
|
shadow: (this.shadow && this.shadow.toObject) ? this.shadow.toObject() : this.shadow,
|
|
visible: this.visible,
|
|
backgroundColor: this.backgroundColor,
|
|
fillRule: this.fillRule,
|
|
paintFirst: this.paintFirst,
|
|
globalCompositeOperation: this.globalCompositeOperation,
|
|
skewX: toFixed(this.skewX, NUM_FRACTION_DIGITS),
|
|
skewY: toFixed(this.skewY, NUM_FRACTION_DIGITS),
|
|
};
|
|
|
|
if (this.clipPath && !this.clipPath.excludeFromExport) {
|
|
object.clipPath = this.clipPath.toObject(propertiesToInclude);
|
|
object.clipPath.inverted = this.clipPath.inverted;
|
|
object.clipPath.absolutePositioned = this.clipPath.absolutePositioned;
|
|
}
|
|
|
|
fabric.util.populateWithProperties(this, object, propertiesToInclude);
|
|
if (!this.includeDefaultValues) {
|
|
object = this._removeDefaultValues(object);
|
|
}
|
|
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Returns (dataless) object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toDatalessObject: function(propertiesToInclude) {
|
|
// will be overwritten by subclasses
|
|
return this.toObject(propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} object
|
|
*/
|
|
_removeDefaultValues: function(object) {
|
|
var prototype = fabric.util.getKlass(object.type).prototype,
|
|
stateProperties = prototype.stateProperties;
|
|
stateProperties.forEach(function(prop) {
|
|
if (prop === 'left' || prop === 'top') {
|
|
return;
|
|
}
|
|
if (object[prop] === prototype[prop]) {
|
|
delete object[prop];
|
|
}
|
|
var isArray = Object.prototype.toString.call(object[prop]) === '[object Array]' &&
|
|
Object.prototype.toString.call(prototype[prop]) === '[object Array]';
|
|
|
|
// basically a check for [] === []
|
|
if (isArray && object[prop].length === 0 && prototype[prop].length === 0) {
|
|
delete object[prop];
|
|
}
|
|
});
|
|
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Returns a string representation of an instance
|
|
* @return {String}
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.' + capitalize(this.type) + '>';
|
|
},
|
|
|
|
/**
|
|
* Return the object scale factor counting also the group scaling
|
|
* @return {Object} object with scaleX and scaleY properties
|
|
*/
|
|
getObjectScaling: function() {
|
|
// if the object is a top level one, on the canvas, we go for simple aritmetic
|
|
// otherwise the complex method with angles will return approximations and decimals
|
|
// and will likely kill the cache when not needed
|
|
// https://github.com/fabricjs/fabric.js/issues/7157
|
|
if (!this.group) {
|
|
return {
|
|
scaleX: this.scaleX,
|
|
scaleY: this.scaleY,
|
|
};
|
|
}
|
|
// if we are inside a group total zoom calculation is complex, we defer to generic matrices
|
|
var options = fabric.util.qrDecompose(this.calcTransformMatrix());
|
|
return { scaleX: Math.abs(options.scaleX), scaleY: Math.abs(options.scaleY) };
|
|
},
|
|
|
|
/**
|
|
* Return the object scale factor counting also the group scaling, zoom and retina
|
|
* @return {Object} object with scaleX and scaleY properties
|
|
*/
|
|
getTotalObjectScaling: function() {
|
|
var scale = this.getObjectScaling(), scaleX = scale.scaleX, scaleY = scale.scaleY;
|
|
if (this.canvas) {
|
|
var zoom = this.canvas.getZoom();
|
|
var retina = this.canvas.getRetinaScaling();
|
|
scaleX *= zoom * retina;
|
|
scaleY *= zoom * retina;
|
|
}
|
|
return { scaleX: scaleX, scaleY: scaleY };
|
|
},
|
|
|
|
/**
|
|
* Return the object opacity counting also the group property
|
|
* @return {Number}
|
|
*/
|
|
getObjectOpacity: function() {
|
|
var opacity = this.opacity;
|
|
if (this.group) {
|
|
opacity *= this.group.getObjectOpacity();
|
|
}
|
|
return opacity;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} key
|
|
* @param {*} value
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
_set: function(key, value) {
|
|
var shouldConstrainValue = (key === 'scaleX' || key === 'scaleY'),
|
|
isChanged = this[key] !== value, groupNeedsUpdate = false;
|
|
|
|
if (shouldConstrainValue) {
|
|
value = this._constrainScale(value);
|
|
}
|
|
if (key === 'scaleX' && value < 0) {
|
|
this.flipX = !this.flipX;
|
|
value *= -1;
|
|
}
|
|
else if (key === 'scaleY' && value < 0) {
|
|
this.flipY = !this.flipY;
|
|
value *= -1;
|
|
}
|
|
else if (key === 'shadow' && value && !(value instanceof fabric.Shadow)) {
|
|
value = new fabric.Shadow(value);
|
|
}
|
|
else if (key === 'dirty' && this.group) {
|
|
this.group.set('dirty', value);
|
|
}
|
|
|
|
this[key] = value;
|
|
|
|
if (isChanged) {
|
|
groupNeedsUpdate = this.group && this.group.isOnACache();
|
|
if (this.cacheProperties.indexOf(key) > -1) {
|
|
this.dirty = true;
|
|
groupNeedsUpdate && this.group.set('dirty', true);
|
|
}
|
|
else if (groupNeedsUpdate && this.stateProperties.indexOf(key) > -1) {
|
|
this.group.set('dirty', true);
|
|
}
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* This callback function is called by the parent group of an object every
|
|
* time a non-delegated property changes on the group. It is passed the key
|
|
* and value as parameters. Not adding in this function's signature to avoid
|
|
* Travis build error about unused variables.
|
|
*/
|
|
setOnGroup: function() {
|
|
// implemented by sub-classes, as needed.
|
|
},
|
|
|
|
/**
|
|
* Retrieves viewportTransform from Object's canvas if possible
|
|
* @method getViewportTransform
|
|
* @memberOf fabric.Object.prototype
|
|
* @return {Array}
|
|
*/
|
|
getViewportTransform: function() {
|
|
if (this.canvas && this.canvas.viewportTransform) {
|
|
return this.canvas.viewportTransform;
|
|
}
|
|
return fabric.iMatrix.concat();
|
|
},
|
|
|
|
/*
|
|
* @private
|
|
* return if the object would be visible in rendering
|
|
* @memberOf fabric.Object.prototype
|
|
* @return {Boolean}
|
|
*/
|
|
isNotVisible: function() {
|
|
return this.opacity === 0 ||
|
|
(!this.width && !this.height && this.strokeWidth === 0) ||
|
|
!this.visible;
|
|
},
|
|
|
|
/**
|
|
* Renders an object on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
render: function(ctx) {
|
|
// do not render if width/height are zeros or object is not visible
|
|
if (this.isNotVisible()) {
|
|
return;
|
|
}
|
|
if (this.canvas && this.canvas.skipOffscreen && !this.group && !this.isOnScreen()) {
|
|
return;
|
|
}
|
|
ctx.save();
|
|
this._setupCompositeOperation(ctx);
|
|
this.drawSelectionBackground(ctx);
|
|
this.transform(ctx);
|
|
this._setOpacity(ctx);
|
|
this._setShadow(ctx, this);
|
|
if (this.shouldCache()) {
|
|
this.renderCache();
|
|
this.drawCacheOnCanvas(ctx);
|
|
}
|
|
else {
|
|
this._removeCacheCanvas();
|
|
this.dirty = false;
|
|
this.drawObject(ctx);
|
|
if (this.objectCaching && this.statefullCache) {
|
|
this.saveState({ propertySet: 'cacheProperties' });
|
|
}
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
renderCache: function(options) {
|
|
options = options || {};
|
|
if (!this._cacheCanvas) {
|
|
this._createCacheCanvas();
|
|
}
|
|
if (this.isCacheDirty()) {
|
|
this.statefullCache && this.saveState({ propertySet: 'cacheProperties' });
|
|
this.drawObject(this._cacheContext, options.forClipping);
|
|
this.dirty = false;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Remove cacheCanvas and its dimensions from the objects
|
|
*/
|
|
_removeCacheCanvas: function() {
|
|
this._cacheCanvas = null;
|
|
this.cacheWidth = 0;
|
|
this.cacheHeight = 0;
|
|
},
|
|
|
|
/**
|
|
* return true if the object will draw a stroke
|
|
* Does not consider text styles. This is just a shortcut used at rendering time
|
|
* We want it to be an approximation and be fast.
|
|
* wrote to avoid extra caching, it has to return true when stroke happens,
|
|
* can guess when it will not happen at 100% chance, does not matter if it misses
|
|
* some use case where the stroke is invisible.
|
|
* @since 3.0.0
|
|
* @returns Boolean
|
|
*/
|
|
hasStroke: function() {
|
|
return this.stroke && this.stroke !== 'transparent' && this.strokeWidth !== 0;
|
|
},
|
|
|
|
/**
|
|
* return true if the object will draw a fill
|
|
* Does not consider text styles. This is just a shortcut used at rendering time
|
|
* We want it to be an approximation and be fast.
|
|
* wrote to avoid extra caching, it has to return true when fill happens,
|
|
* can guess when it will not happen at 100% chance, does not matter if it misses
|
|
* some use case where the fill is invisible.
|
|
* @since 3.0.0
|
|
* @returns Boolean
|
|
*/
|
|
hasFill: function() {
|
|
return this.fill && this.fill !== 'transparent';
|
|
},
|
|
|
|
/**
|
|
* When set to `true`, force the object to have its own cache, even if it is inside a group
|
|
* it may be needed when your object behave in a particular way on the cache and always needs
|
|
* its own isolated canvas to render correctly.
|
|
* Created to be overridden
|
|
* since 1.7.12
|
|
* @returns Boolean
|
|
*/
|
|
needsItsOwnCache: function() {
|
|
if (this.paintFirst === 'stroke' &&
|
|
this.hasFill() && this.hasStroke() && typeof this.shadow === 'object') {
|
|
return true;
|
|
}
|
|
if (this.clipPath) {
|
|
return true;
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Decide if the object should cache or not. Create its own cache level
|
|
* objectCaching is a global flag, wins over everything
|
|
* needsItsOwnCache should be used when the object drawing method requires
|
|
* a cache step. None of the fabric classes requires it.
|
|
* Generally you do not cache objects in groups because the group outside is cached.
|
|
* Read as: cache if is needed, or if the feature is enabled but we are not already caching.
|
|
* @return {Boolean}
|
|
*/
|
|
shouldCache: function() {
|
|
this.ownCaching = this.needsItsOwnCache() || (
|
|
this.objectCaching &&
|
|
(!this.group || !this.group.isOnACache())
|
|
);
|
|
return this.ownCaching;
|
|
},
|
|
|
|
/**
|
|
* Check if this object or a child object will cast a shadow
|
|
* used by Group.shouldCache to know if child has a shadow recursively
|
|
* @return {Boolean}
|
|
*/
|
|
willDrawShadow: function() {
|
|
return !!this.shadow && (this.shadow.offsetX !== 0 || this.shadow.offsetY !== 0);
|
|
},
|
|
|
|
/**
|
|
* Execute the drawing operation for an object clipPath
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
drawClipPathOnCache: function(ctx) {
|
|
var path = this.clipPath;
|
|
ctx.save();
|
|
// DEBUG: uncomment this line, comment the following
|
|
// ctx.globalAlpha = 0.4
|
|
if (path.inverted) {
|
|
ctx.globalCompositeOperation = 'destination-out';
|
|
}
|
|
else {
|
|
ctx.globalCompositeOperation = 'destination-in';
|
|
}
|
|
//ctx.scale(1 / 2, 1 / 2);
|
|
if (path.absolutePositioned) {
|
|
var m = fabric.util.invertTransform(this.calcTransformMatrix());
|
|
ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]);
|
|
}
|
|
path.transform(ctx);
|
|
ctx.scale(1 / path.zoomX, 1 / path.zoomY);
|
|
ctx.drawImage(path._cacheCanvas, -path.cacheTranslationX, -path.cacheTranslationY);
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Execute the drawing operation for an object on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
drawObject: function(ctx, forClipping) {
|
|
var originalFill = this.fill, originalStroke = this.stroke;
|
|
if (forClipping) {
|
|
this.fill = 'black';
|
|
this.stroke = '';
|
|
this._setClippingProperties(ctx);
|
|
}
|
|
else {
|
|
this._renderBackground(ctx);
|
|
}
|
|
this._render(ctx);
|
|
this._drawClipPath(ctx);
|
|
this.fill = originalFill;
|
|
this.stroke = originalStroke;
|
|
},
|
|
|
|
_drawClipPath: function(ctx) {
|
|
var path = this.clipPath;
|
|
if (!path) { return; }
|
|
// needed to setup a couple of variables
|
|
// path canvas gets overridden with this one.
|
|
// TODO find a better solution?
|
|
path.canvas = this.canvas;
|
|
path.shouldCache();
|
|
path._transformDone = true;
|
|
path.renderCache({ forClipping: true });
|
|
this.drawClipPathOnCache(ctx);
|
|
},
|
|
|
|
/**
|
|
* Paint the cached copy of the object on the target context.
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
drawCacheOnCanvas: function(ctx) {
|
|
ctx.scale(1 / this.zoomX, 1 / this.zoomY);
|
|
ctx.drawImage(this._cacheCanvas, -this.cacheTranslationX, -this.cacheTranslationY);
|
|
},
|
|
|
|
/**
|
|
* Check if cache is dirty
|
|
* @param {Boolean} skipCanvas skip canvas checks because this object is painted
|
|
* on parent canvas.
|
|
*/
|
|
isCacheDirty: function(skipCanvas) {
|
|
if (this.isNotVisible()) {
|
|
return false;
|
|
}
|
|
if (this._cacheCanvas && !skipCanvas && this._updateCacheCanvas()) {
|
|
// in this case the context is already cleared.
|
|
return true;
|
|
}
|
|
else {
|
|
if (this.dirty ||
|
|
(this.clipPath && this.clipPath.absolutePositioned) ||
|
|
(this.statefullCache && this.hasStateChanged('cacheProperties'))
|
|
) {
|
|
if (this._cacheCanvas && !skipCanvas) {
|
|
var width = this.cacheWidth / this.zoomX;
|
|
var height = this.cacheHeight / this.zoomY;
|
|
this._cacheContext.clearRect(-width / 2, -height / 2, width, height);
|
|
}
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Draws a background for the object big as its untransformed dimensions
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderBackground: function(ctx) {
|
|
if (!this.backgroundColor) {
|
|
return;
|
|
}
|
|
var dim = this._getNonTransformedDimensions();
|
|
ctx.fillStyle = this.backgroundColor;
|
|
|
|
ctx.fillRect(
|
|
-dim.x / 2,
|
|
-dim.y / 2,
|
|
dim.x,
|
|
dim.y
|
|
);
|
|
// if there is background color no other shadows
|
|
// should be casted
|
|
this._removeShadow(ctx);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_setOpacity: function(ctx) {
|
|
if (this.group && !this.group._transformDone) {
|
|
ctx.globalAlpha = this.getObjectOpacity();
|
|
}
|
|
else {
|
|
ctx.globalAlpha *= this.opacity;
|
|
}
|
|
},
|
|
|
|
_setStrokeStyles: function(ctx, decl) {
|
|
var stroke = decl.stroke;
|
|
if (stroke) {
|
|
ctx.lineWidth = decl.strokeWidth;
|
|
ctx.lineCap = decl.strokeLineCap;
|
|
ctx.lineDashOffset = decl.strokeDashOffset;
|
|
ctx.lineJoin = decl.strokeLineJoin;
|
|
ctx.miterLimit = decl.strokeMiterLimit;
|
|
if (stroke.toLive) {
|
|
if (stroke.gradientUnits === 'percentage' || stroke.gradientTransform || stroke.patternTransform) {
|
|
// need to transform gradient in a pattern.
|
|
// this is a slow process. If you are hitting this codepath, and the object
|
|
// is not using caching, you should consider switching it on.
|
|
// we need a canvas as big as the current object caching canvas.
|
|
this._applyPatternForTransformedGradient(ctx, stroke);
|
|
}
|
|
else {
|
|
// is a simple gradient or pattern
|
|
ctx.strokeStyle = stroke.toLive(ctx, this);
|
|
this._applyPatternGradientTransform(ctx, stroke);
|
|
}
|
|
}
|
|
else {
|
|
// is a color
|
|
ctx.strokeStyle = decl.stroke;
|
|
}
|
|
}
|
|
},
|
|
|
|
_setFillStyles: function(ctx, decl) {
|
|
var fill = decl.fill;
|
|
if (fill) {
|
|
if (fill.toLive) {
|
|
ctx.fillStyle = fill.toLive(ctx, this);
|
|
this._applyPatternGradientTransform(ctx, decl.fill);
|
|
}
|
|
else {
|
|
ctx.fillStyle = fill;
|
|
}
|
|
}
|
|
},
|
|
|
|
_setClippingProperties: function(ctx) {
|
|
ctx.globalAlpha = 1;
|
|
ctx.strokeStyle = 'transparent';
|
|
ctx.fillStyle = '#000000';
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* Sets line dash
|
|
* @param {CanvasRenderingContext2D} ctx Context to set the dash line on
|
|
* @param {Array} dashArray array representing dashes
|
|
*/
|
|
_setLineDash: function(ctx, dashArray) {
|
|
if (!dashArray || dashArray.length === 0) {
|
|
return;
|
|
}
|
|
// Spec requires the concatenation of two copies the dash list when the number of elements is odd
|
|
if (1 & dashArray.length) {
|
|
dashArray.push.apply(dashArray, dashArray);
|
|
}
|
|
ctx.setLineDash(dashArray);
|
|
},
|
|
|
|
/**
|
|
* Renders controls and borders for the object
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Object} [styleOverride] properties to override the object style
|
|
*/
|
|
_renderControls: function(ctx, styleOverride) {
|
|
var vpt = this.getViewportTransform(),
|
|
matrix = this.calcTransformMatrix(),
|
|
options, drawBorders, drawControls;
|
|
styleOverride = styleOverride || { };
|
|
drawBorders = typeof styleOverride.hasBorders !== 'undefined' ? styleOverride.hasBorders : this.hasBorders;
|
|
drawControls = typeof styleOverride.hasControls !== 'undefined' ? styleOverride.hasControls : this.hasControls;
|
|
matrix = fabric.util.multiplyTransformMatrices(vpt, matrix);
|
|
options = fabric.util.qrDecompose(matrix);
|
|
ctx.save();
|
|
ctx.translate(options.translateX, options.translateY);
|
|
ctx.lineWidth = 1 * this.borderScaleFactor;
|
|
if (!this.group) {
|
|
ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1;
|
|
}
|
|
ctx.rotate(degreesToRadians(options.angle));
|
|
if (styleOverride.forActiveSelection || this.group) {
|
|
drawBorders && this.drawBordersInGroup(ctx, options, styleOverride);
|
|
}
|
|
else {
|
|
drawBorders && this.drawBorders(ctx, styleOverride);
|
|
}
|
|
drawControls && this.drawControls(ctx, styleOverride);
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_setShadow: function(ctx) {
|
|
if (!this.shadow) {
|
|
return;
|
|
}
|
|
|
|
var shadow = this.shadow, canvas = this.canvas, scaling,
|
|
multX = (canvas && canvas.viewportTransform[0]) || 1,
|
|
multY = (canvas && canvas.viewportTransform[3]) || 1;
|
|
if (shadow.nonScaling) {
|
|
scaling = { scaleX: 1, scaleY: 1 };
|
|
}
|
|
else {
|
|
scaling = this.getObjectScaling();
|
|
}
|
|
if (canvas && canvas._isRetinaScaling()) {
|
|
multX *= fabric.devicePixelRatio;
|
|
multY *= fabric.devicePixelRatio;
|
|
}
|
|
ctx.shadowColor = shadow.color;
|
|
ctx.shadowBlur = shadow.blur * fabric.browserShadowBlurConstant *
|
|
(multX + multY) * (scaling.scaleX + scaling.scaleY) / 4;
|
|
ctx.shadowOffsetX = shadow.offsetX * multX * scaling.scaleX;
|
|
ctx.shadowOffsetY = shadow.offsetY * multY * scaling.scaleY;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_removeShadow: function(ctx) {
|
|
if (!this.shadow) {
|
|
return;
|
|
}
|
|
|
|
ctx.shadowColor = '';
|
|
ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Object} filler fabric.Pattern or fabric.Gradient
|
|
* @return {Object} offset.offsetX offset for text rendering
|
|
* @return {Object} offset.offsetY offset for text rendering
|
|
*/
|
|
_applyPatternGradientTransform: function(ctx, filler) {
|
|
if (!filler || !filler.toLive) {
|
|
return { offsetX: 0, offsetY: 0 };
|
|
}
|
|
var t = filler.gradientTransform || filler.patternTransform;
|
|
var offsetX = -this.width / 2 + filler.offsetX || 0,
|
|
offsetY = -this.height / 2 + filler.offsetY || 0;
|
|
|
|
if (filler.gradientUnits === 'percentage') {
|
|
ctx.transform(this.width, 0, 0, this.height, offsetX, offsetY);
|
|
}
|
|
else {
|
|
ctx.transform(1, 0, 0, 1, offsetX, offsetY);
|
|
}
|
|
if (t) {
|
|
ctx.transform(t[0], t[1], t[2], t[3], t[4], t[5]);
|
|
}
|
|
return { offsetX: offsetX, offsetY: offsetY };
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderPaintInOrder: function(ctx) {
|
|
if (this.paintFirst === 'stroke') {
|
|
this._renderStroke(ctx);
|
|
this._renderFill(ctx);
|
|
}
|
|
else {
|
|
this._renderFill(ctx);
|
|
this._renderStroke(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* function that actually render something on the context.
|
|
* empty here to allow Obects to work on tests to benchmark fabric functionalites
|
|
* not related to rendering
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(/* ctx */) {
|
|
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderFill: function(ctx) {
|
|
if (!this.fill) {
|
|
return;
|
|
}
|
|
|
|
ctx.save();
|
|
this._setFillStyles(ctx, this);
|
|
if (this.fillRule === 'evenodd') {
|
|
ctx.fill('evenodd');
|
|
}
|
|
else {
|
|
ctx.fill();
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderStroke: function(ctx) {
|
|
if (!this.stroke || this.strokeWidth === 0) {
|
|
return;
|
|
}
|
|
|
|
if (this.shadow && !this.shadow.affectStroke) {
|
|
this._removeShadow(ctx);
|
|
}
|
|
|
|
ctx.save();
|
|
if (this.strokeUniform && this.group) {
|
|
var scaling = this.getObjectScaling();
|
|
ctx.scale(1 / scaling.scaleX, 1 / scaling.scaleY);
|
|
}
|
|
else if (this.strokeUniform) {
|
|
ctx.scale(1 / this.scaleX, 1 / this.scaleY);
|
|
}
|
|
this._setLineDash(ctx, this.strokeDashArray);
|
|
this._setStrokeStyles(ctx, this);
|
|
ctx.stroke();
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* This function try to patch the missing gradientTransform on canvas gradients.
|
|
* transforming a context to transform the gradient, is going to transform the stroke too.
|
|
* we want to transform the gradient but not the stroke operation, so we create
|
|
* a transformed gradient on a pattern and then we use the pattern instead of the gradient.
|
|
* this method has drwabacks: is slow, is in low resolution, needs a patch for when the size
|
|
* is limited.
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {fabric.Gradient} filler a fabric gradient instance
|
|
*/
|
|
_applyPatternForTransformedGradient: function(ctx, filler) {
|
|
var dims = this._limitCacheSize(this._getCacheCanvasDimensions()),
|
|
pCanvas = fabric.util.createCanvasElement(), pCtx, retinaScaling = this.canvas.getRetinaScaling(),
|
|
width = dims.x / this.scaleX / retinaScaling, height = dims.y / this.scaleY / retinaScaling;
|
|
pCanvas.width = width;
|
|
pCanvas.height = height;
|
|
pCtx = pCanvas.getContext('2d');
|
|
pCtx.beginPath(); pCtx.moveTo(0, 0); pCtx.lineTo(width, 0); pCtx.lineTo(width, height);
|
|
pCtx.lineTo(0, height); pCtx.closePath();
|
|
pCtx.translate(width / 2, height / 2);
|
|
pCtx.scale(
|
|
dims.zoomX / this.scaleX / retinaScaling,
|
|
dims.zoomY / this.scaleY / retinaScaling
|
|
);
|
|
this._applyPatternGradientTransform(pCtx, filler);
|
|
pCtx.fillStyle = filler.toLive(ctx);
|
|
pCtx.fill();
|
|
ctx.translate(-this.width / 2 - this.strokeWidth / 2, -this.height / 2 - this.strokeWidth / 2);
|
|
ctx.scale(
|
|
retinaScaling * this.scaleX / dims.zoomX,
|
|
retinaScaling * this.scaleY / dims.zoomY
|
|
);
|
|
ctx.strokeStyle = pCtx.createPattern(pCanvas, 'no-repeat');
|
|
},
|
|
|
|
/**
|
|
* This function is an helper for svg import. it returns the center of the object in the svg
|
|
* untransformed coordinates
|
|
* @private
|
|
* @return {Object} center point from element coordinates
|
|
*/
|
|
_findCenterFromElement: function() {
|
|
return { x: this.left + this.width / 2, y: this.top + this.height / 2 };
|
|
},
|
|
|
|
/**
|
|
* This function is an helper for svg import. it decompose the transformMatrix
|
|
* and assign properties to object.
|
|
* untransformed coordinates
|
|
* @private
|
|
* @chainable
|
|
*/
|
|
_assignTransformMatrixProps: function() {
|
|
if (this.transformMatrix) {
|
|
var options = fabric.util.qrDecompose(this.transformMatrix);
|
|
this.flipX = false;
|
|
this.flipY = false;
|
|
this.set('scaleX', options.scaleX);
|
|
this.set('scaleY', options.scaleY);
|
|
this.angle = options.angle;
|
|
this.skewX = options.skewX;
|
|
this.skewY = 0;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* This function is an helper for svg import. it removes the transform matrix
|
|
* and set to object properties that fabricjs can handle
|
|
* @private
|
|
* @param {Object} preserveAspectRatioOptions
|
|
* @return {thisArg}
|
|
*/
|
|
_removeTransformMatrix: function(preserveAspectRatioOptions) {
|
|
var center = this._findCenterFromElement();
|
|
if (this.transformMatrix) {
|
|
this._assignTransformMatrixProps();
|
|
center = fabric.util.transformPoint(center, this.transformMatrix);
|
|
}
|
|
this.transformMatrix = null;
|
|
if (preserveAspectRatioOptions) {
|
|
this.scaleX *= preserveAspectRatioOptions.scaleX;
|
|
this.scaleY *= preserveAspectRatioOptions.scaleY;
|
|
this.cropX = preserveAspectRatioOptions.cropX;
|
|
this.cropY = preserveAspectRatioOptions.cropY;
|
|
center.x += preserveAspectRatioOptions.offsetLeft;
|
|
center.y += preserveAspectRatioOptions.offsetTop;
|
|
this.width = preserveAspectRatioOptions.width;
|
|
this.height = preserveAspectRatioOptions.height;
|
|
}
|
|
this.setPositionByOrigin(center, 'center', 'center');
|
|
},
|
|
|
|
/**
|
|
* Clones an instance, using a callback method will work for every object.
|
|
* @param {Function} callback Callback is invoked with a clone as a first argument
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
*/
|
|
clone: function(callback, propertiesToInclude) {
|
|
var objectForm = this.toObject(propertiesToInclude);
|
|
if (this.constructor.fromObject) {
|
|
this.constructor.fromObject(objectForm, callback);
|
|
}
|
|
else {
|
|
fabric.Object._fromObject('Object', objectForm, callback);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Creates an instance of fabric.Image out of an object
|
|
* makes use of toCanvasElement.
|
|
* Once this method was based on toDataUrl and loadImage, so it also had a quality
|
|
* and format option. toCanvasElement is faster and produce no loss of quality.
|
|
* If you need to get a real Jpeg or Png from an object, using toDataURL is the right way to do it.
|
|
* toCanvasElement and then toBlob from the obtained canvas is also a good option.
|
|
* This method is sync now, but still support the callback because we did not want to break.
|
|
* When fabricJS 5.0 will be planned, this will probably be changed to not have a callback.
|
|
* @param {Function} callback callback, invoked with an instance as a first argument
|
|
* @param {Object} [options] for clone as image, passed to toDataURL
|
|
* @param {Number} [options.multiplier=1] Multiplier to scale by
|
|
* @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14
|
|
* @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14
|
|
* @param {Number} [options.width] Cropping width. Introduced in v1.2.14
|
|
* @param {Number} [options.height] Cropping height. Introduced in v1.2.14
|
|
* @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4
|
|
* @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4
|
|
* @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
cloneAsImage: function(callback, options) {
|
|
var canvasEl = this.toCanvasElement(options);
|
|
if (callback) {
|
|
callback(new fabric.Image(canvasEl));
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Converts an object into a HTMLCanvas element
|
|
* @param {Object} options Options object
|
|
* @param {Number} [options.multiplier=1] Multiplier to scale by
|
|
* @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14
|
|
* @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14
|
|
* @param {Number} [options.width] Cropping width. Introduced in v1.2.14
|
|
* @param {Number} [options.height] Cropping height. Introduced in v1.2.14
|
|
* @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4
|
|
* @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4
|
|
* @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2
|
|
* @return {HTMLCanvasElement} Returns DOM element <canvas> with the fabric.Object
|
|
*/
|
|
toCanvasElement: function(options) {
|
|
options || (options = { });
|
|
|
|
var utils = fabric.util, origParams = utils.saveObjectTransform(this),
|
|
originalGroup = this.group,
|
|
originalShadow = this.shadow, abs = Math.abs,
|
|
multiplier = (options.multiplier || 1) * (options.enableRetinaScaling ? fabric.devicePixelRatio : 1);
|
|
delete this.group;
|
|
if (options.withoutTransform) {
|
|
utils.resetObjectTransform(this);
|
|
}
|
|
if (options.withoutShadow) {
|
|
this.shadow = null;
|
|
}
|
|
|
|
var el = fabric.util.createCanvasElement(),
|
|
// skip canvas zoom and calculate with setCoords now.
|
|
boundingRect = this.getBoundingRect(true, true),
|
|
shadow = this.shadow, scaling,
|
|
shadowOffset = { x: 0, y: 0 }, shadowBlur,
|
|
width, height;
|
|
|
|
if (shadow) {
|
|
shadowBlur = shadow.blur;
|
|
if (shadow.nonScaling) {
|
|
scaling = { scaleX: 1, scaleY: 1 };
|
|
}
|
|
else {
|
|
scaling = this.getObjectScaling();
|
|
}
|
|
// consider non scaling shadow.
|
|
shadowOffset.x = 2 * Math.round(abs(shadow.offsetX) + shadowBlur) * (abs(scaling.scaleX));
|
|
shadowOffset.y = 2 * Math.round(abs(shadow.offsetY) + shadowBlur) * (abs(scaling.scaleY));
|
|
}
|
|
width = boundingRect.width + shadowOffset.x;
|
|
height = boundingRect.height + shadowOffset.y;
|
|
// if the current width/height is not an integer
|
|
// we need to make it so.
|
|
el.width = Math.ceil(width);
|
|
el.height = Math.ceil(height);
|
|
var canvas = new fabric.StaticCanvas(el, {
|
|
enableRetinaScaling: false,
|
|
renderOnAddRemove: false,
|
|
skipOffscreen: false,
|
|
});
|
|
if (options.format === 'jpeg') {
|
|
canvas.backgroundColor = '#fff';
|
|
}
|
|
this.setPositionByOrigin(new fabric.Point(canvas.width / 2, canvas.height / 2), 'center', 'center');
|
|
|
|
var originalCanvas = this.canvas;
|
|
canvas.add(this);
|
|
var canvasEl = canvas.toCanvasElement(multiplier || 1, options);
|
|
this.shadow = originalShadow;
|
|
this.set('canvas', originalCanvas);
|
|
if (originalGroup) {
|
|
this.group = originalGroup;
|
|
}
|
|
this.set(origParams).setCoords();
|
|
// canvas.dispose will call image.dispose that will nullify the elements
|
|
// since this canvas is a simple element for the process, we remove references
|
|
// to objects in this way in order to avoid object trashing.
|
|
canvas._objects = [];
|
|
canvas.dispose();
|
|
canvas = null;
|
|
|
|
return canvasEl;
|
|
},
|
|
|
|
/**
|
|
* Converts an object into a data-url-like string
|
|
* @param {Object} options Options object
|
|
* @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png"
|
|
* @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg.
|
|
* @param {Number} [options.multiplier=1] Multiplier to scale by
|
|
* @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14
|
|
* @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14
|
|
* @param {Number} [options.width] Cropping width. Introduced in v1.2.14
|
|
* @param {Number} [options.height] Cropping height. Introduced in v1.2.14
|
|
* @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4
|
|
* @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4
|
|
* @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2
|
|
* @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format
|
|
*/
|
|
toDataURL: function(options) {
|
|
options || (options = { });
|
|
return fabric.util.toDataURL(this.toCanvasElement(options), options.format || 'png', options.quality || 1);
|
|
},
|
|
|
|
/**
|
|
* Returns true if specified type is identical to the type of an instance
|
|
* @param {String} type Type to check against
|
|
* @return {Boolean}
|
|
*/
|
|
isType: function(type) {
|
|
return this.type === type;
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity of this instance (is 1 unless subclassed)
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
},
|
|
|
|
/**
|
|
* Returns a JSON representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} JSON
|
|
*/
|
|
toJSON: function(propertiesToInclude) {
|
|
// delegate, not alias
|
|
return this.toObject(propertiesToInclude);
|
|
},
|
|
|
|
/**
|
|
* Sets "angle" of an instance with centered rotation
|
|
* @param {Number} angle Angle value (in degrees)
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
rotate: function(angle) {
|
|
var shouldCenterOrigin = (this.originX !== 'center' || this.originY !== 'center') && this.centeredRotation;
|
|
|
|
if (shouldCenterOrigin) {
|
|
this._setOriginToCenter();
|
|
}
|
|
|
|
this.set('angle', angle);
|
|
|
|
if (shouldCenterOrigin) {
|
|
this._resetOrigin();
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object horizontally on canvas to which it was added last.
|
|
* You might need to call `setCoords` on an object after centering, to update controls area.
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
centerH: function () {
|
|
this.canvas && this.canvas.centerObjectH(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object horizontally on current viewport of canvas to which it was added last.
|
|
* You might need to call `setCoords` on an object after centering, to update controls area.
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
viewportCenterH: function () {
|
|
this.canvas && this.canvas.viewportCenterObjectH(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically on canvas to which it was added last.
|
|
* You might need to call `setCoords` on an object after centering, to update controls area.
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
centerV: function () {
|
|
this.canvas && this.canvas.centerObjectV(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically on current viewport of canvas to which it was added last.
|
|
* You might need to call `setCoords` on an object after centering, to update controls area.
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
viewportCenterV: function () {
|
|
this.canvas && this.canvas.viewportCenterObjectV(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically and horizontally on canvas to which is was added last
|
|
* You might need to call `setCoords` on an object after centering, to update controls area.
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
center: function () {
|
|
this.canvas && this.canvas.centerObject(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object on current viewport of canvas to which it was added last.
|
|
* You might need to call `setCoords` on an object after centering, to update controls area.
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
viewportCenter: function () {
|
|
this.canvas && this.canvas.viewportCenterObject(this);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns coordinates of a pointer relative to an object
|
|
* @param {Event} e Event to operate upon
|
|
* @param {Object} [pointer] Pointer to operate upon (instead of event)
|
|
* @return {Object} Coordinates of a pointer (x, y)
|
|
*/
|
|
getLocalPointer: function(e, pointer) {
|
|
pointer = pointer || this.canvas.getPointer(e);
|
|
var pClicked = new fabric.Point(pointer.x, pointer.y),
|
|
objectLeftTop = this._getLeftTopCoords();
|
|
if (this.angle) {
|
|
pClicked = fabric.util.rotatePoint(
|
|
pClicked, objectLeftTop, degreesToRadians(-this.angle));
|
|
}
|
|
return {
|
|
x: pClicked.x - objectLeftTop.x,
|
|
y: pClicked.y - objectLeftTop.y
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Sets canvas globalCompositeOperation for specific object
|
|
* custom composition operation for the particular object can be specified using globalCompositeOperation property
|
|
* @param {CanvasRenderingContext2D} ctx Rendering canvas context
|
|
*/
|
|
_setupCompositeOperation: function (ctx) {
|
|
if (this.globalCompositeOperation) {
|
|
ctx.globalCompositeOperation = this.globalCompositeOperation;
|
|
}
|
|
}
|
|
});
|
|
|
|
fabric.util.createAccessors && fabric.util.createAccessors(fabric.Object);
|
|
|
|
extend(fabric.Object.prototype, fabric.Observable);
|
|
|
|
/**
|
|
* Defines the number of fraction digits to use when serializing object values.
|
|
* You can use it to increase/decrease precision of such values like left, top, scaleX, scaleY, etc.
|
|
* @static
|
|
* @memberOf fabric.Object
|
|
* @constant
|
|
* @type Number
|
|
*/
|
|
fabric.Object.NUM_FRACTION_DIGITS = 2;
|
|
|
|
fabric.Object._fromObject = function(className, object, callback, extraParam) {
|
|
var klass = fabric[className];
|
|
object = clone(object, true);
|
|
fabric.util.enlivenPatterns([object.fill, object.stroke], function(patterns) {
|
|
if (typeof patterns[0] !== 'undefined') {
|
|
object.fill = patterns[0];
|
|
}
|
|
if (typeof patterns[1] !== 'undefined') {
|
|
object.stroke = patterns[1];
|
|
}
|
|
fabric.util.enlivenObjects([object.clipPath], function(enlivedProps) {
|
|
object.clipPath = enlivedProps[0];
|
|
var instance = extraParam ? new klass(object[extraParam], object) : new klass(object);
|
|
callback && callback(instance);
|
|
});
|
|
});
|
|
};
|
|
|
|
/**
|
|
* Unique id used internally when creating SVG elements
|
|
* @static
|
|
* @memberOf fabric.Object
|
|
* @type Number
|
|
*/
|
|
fabric.Object.__uid = 0;
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function() {
|
|
|
|
var degreesToRadians = fabric.util.degreesToRadians,
|
|
originXOffset = {
|
|
left: -0.5,
|
|
center: 0,
|
|
right: 0.5
|
|
},
|
|
originYOffset = {
|
|
top: -0.5,
|
|
center: 0,
|
|
bottom: 0.5
|
|
};
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Translates the coordinates from a set of origin to another (based on the object's dimensions)
|
|
* @param {fabric.Point} point The point which corresponds to the originX and originY params
|
|
* @param {String} fromOriginX Horizontal origin: 'left', 'center' or 'right'
|
|
* @param {String} fromOriginY Vertical origin: 'top', 'center' or 'bottom'
|
|
* @param {String} toOriginX Horizontal origin: 'left', 'center' or 'right'
|
|
* @param {String} toOriginY Vertical origin: 'top', 'center' or 'bottom'
|
|
* @return {fabric.Point}
|
|
*/
|
|
translateToGivenOrigin: function(point, fromOriginX, fromOriginY, toOriginX, toOriginY) {
|
|
var x = point.x,
|
|
y = point.y,
|
|
offsetX, offsetY, dim;
|
|
|
|
if (typeof fromOriginX === 'string') {
|
|
fromOriginX = originXOffset[fromOriginX];
|
|
}
|
|
else {
|
|
fromOriginX -= 0.5;
|
|
}
|
|
|
|
if (typeof toOriginX === 'string') {
|
|
toOriginX = originXOffset[toOriginX];
|
|
}
|
|
else {
|
|
toOriginX -= 0.5;
|
|
}
|
|
|
|
offsetX = toOriginX - fromOriginX;
|
|
|
|
if (typeof fromOriginY === 'string') {
|
|
fromOriginY = originYOffset[fromOriginY];
|
|
}
|
|
else {
|
|
fromOriginY -= 0.5;
|
|
}
|
|
|
|
if (typeof toOriginY === 'string') {
|
|
toOriginY = originYOffset[toOriginY];
|
|
}
|
|
else {
|
|
toOriginY -= 0.5;
|
|
}
|
|
|
|
offsetY = toOriginY - fromOriginY;
|
|
|
|
if (offsetX || offsetY) {
|
|
dim = this._getTransformedDimensions();
|
|
x = point.x + offsetX * dim.x;
|
|
y = point.y + offsetY * dim.y;
|
|
}
|
|
|
|
return new fabric.Point(x, y);
|
|
},
|
|
|
|
/**
|
|
* Translates the coordinates from origin to center coordinates (based on the object's dimensions)
|
|
* @param {fabric.Point} point The point which corresponds to the originX and originY params
|
|
* @param {String} originX Horizontal origin: 'left', 'center' or 'right'
|
|
* @param {String} originY Vertical origin: 'top', 'center' or 'bottom'
|
|
* @return {fabric.Point}
|
|
*/
|
|
translateToCenterPoint: function(point, originX, originY) {
|
|
var p = this.translateToGivenOrigin(point, originX, originY, 'center', 'center');
|
|
if (this.angle) {
|
|
return fabric.util.rotatePoint(p, point, degreesToRadians(this.angle));
|
|
}
|
|
return p;
|
|
},
|
|
|
|
/**
|
|
* Translates the coordinates from center to origin coordinates (based on the object's dimensions)
|
|
* @param {fabric.Point} center The point which corresponds to center of the object
|
|
* @param {String} originX Horizontal origin: 'left', 'center' or 'right'
|
|
* @param {String} originY Vertical origin: 'top', 'center' or 'bottom'
|
|
* @return {fabric.Point}
|
|
*/
|
|
translateToOriginPoint: function(center, originX, originY) {
|
|
var p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY);
|
|
if (this.angle) {
|
|
return fabric.util.rotatePoint(p, center, degreesToRadians(this.angle));
|
|
}
|
|
return p;
|
|
},
|
|
|
|
/**
|
|
* Returns the real center coordinates of the object
|
|
* @return {fabric.Point}
|
|
*/
|
|
getCenterPoint: function() {
|
|
var leftTop = new fabric.Point(this.left, this.top);
|
|
return this.translateToCenterPoint(leftTop, this.originX, this.originY);
|
|
},
|
|
|
|
/**
|
|
* Returns the coordinates of the object based on center coordinates
|
|
* @param {fabric.Point} point The point which corresponds to the originX and originY params
|
|
* @return {fabric.Point}
|
|
*/
|
|
// getOriginPoint: function(center) {
|
|
// return this.translateToOriginPoint(center, this.originX, this.originY);
|
|
// },
|
|
|
|
/**
|
|
* Returns the coordinates of the object as if it has a different origin
|
|
* @param {String} originX Horizontal origin: 'left', 'center' or 'right'
|
|
* @param {String} originY Vertical origin: 'top', 'center' or 'bottom'
|
|
* @return {fabric.Point}
|
|
*/
|
|
getPointByOrigin: function(originX, originY) {
|
|
var center = this.getCenterPoint();
|
|
return this.translateToOriginPoint(center, originX, originY);
|
|
},
|
|
|
|
/**
|
|
* Returns the point in local coordinates
|
|
* @param {fabric.Point} point The point relative to the global coordinate system
|
|
* @param {String} originX Horizontal origin: 'left', 'center' or 'right'
|
|
* @param {String} originY Vertical origin: 'top', 'center' or 'bottom'
|
|
* @return {fabric.Point}
|
|
*/
|
|
toLocalPoint: function(point, originX, originY) {
|
|
var center = this.getCenterPoint(),
|
|
p, p2;
|
|
|
|
if (typeof originX !== 'undefined' && typeof originY !== 'undefined' ) {
|
|
p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY);
|
|
}
|
|
else {
|
|
p = new fabric.Point(this.left, this.top);
|
|
}
|
|
|
|
p2 = new fabric.Point(point.x, point.y);
|
|
if (this.angle) {
|
|
p2 = fabric.util.rotatePoint(p2, center, -degreesToRadians(this.angle));
|
|
}
|
|
return p2.subtractEquals(p);
|
|
},
|
|
|
|
/**
|
|
* Returns the point in global coordinates
|
|
* @param {fabric.Point} The point relative to the local coordinate system
|
|
* @return {fabric.Point}
|
|
*/
|
|
// toGlobalPoint: function(point) {
|
|
// return fabric.util.rotatePoint(point, this.getCenterPoint(), degreesToRadians(this.angle)).addEquals(new fabric.Point(this.left, this.top));
|
|
// },
|
|
|
|
/**
|
|
* Sets the position of the object taking into consideration the object's origin
|
|
* @param {fabric.Point} pos The new position of the object
|
|
* @param {String} originX Horizontal origin: 'left', 'center' or 'right'
|
|
* @param {String} originY Vertical origin: 'top', 'center' or 'bottom'
|
|
* @return {void}
|
|
*/
|
|
setPositionByOrigin: function(pos, originX, originY) {
|
|
var center = this.translateToCenterPoint(pos, originX, originY),
|
|
position = this.translateToOriginPoint(center, this.originX, this.originY);
|
|
this.set('left', position.x);
|
|
this.set('top', position.y);
|
|
},
|
|
|
|
/**
|
|
* @param {String} to One of 'left', 'center', 'right'
|
|
*/
|
|
adjustPosition: function(to) {
|
|
var angle = degreesToRadians(this.angle),
|
|
hypotFull = this.getScaledWidth(),
|
|
xFull = fabric.util.cos(angle) * hypotFull,
|
|
yFull = fabric.util.sin(angle) * hypotFull,
|
|
offsetFrom, offsetTo;
|
|
|
|
//TODO: this function does not consider mixed situation like top, center.
|
|
if (typeof this.originX === 'string') {
|
|
offsetFrom = originXOffset[this.originX];
|
|
}
|
|
else {
|
|
offsetFrom = this.originX - 0.5;
|
|
}
|
|
if (typeof to === 'string') {
|
|
offsetTo = originXOffset[to];
|
|
}
|
|
else {
|
|
offsetTo = to - 0.5;
|
|
}
|
|
this.left += xFull * (offsetTo - offsetFrom);
|
|
this.top += yFull * (offsetTo - offsetFrom);
|
|
this.setCoords();
|
|
this.originX = to;
|
|
},
|
|
|
|
/**
|
|
* Sets the origin/position of the object to it's center point
|
|
* @private
|
|
* @return {void}
|
|
*/
|
|
_setOriginToCenter: function() {
|
|
this._originalOriginX = this.originX;
|
|
this._originalOriginY = this.originY;
|
|
|
|
var center = this.getCenterPoint();
|
|
|
|
this.originX = 'center';
|
|
this.originY = 'center';
|
|
|
|
this.left = center.x;
|
|
this.top = center.y;
|
|
},
|
|
|
|
/**
|
|
* Resets the origin/position of the object to it's original origin
|
|
* @private
|
|
* @return {void}
|
|
*/
|
|
_resetOrigin: function() {
|
|
var originPoint = this.translateToOriginPoint(
|
|
this.getCenterPoint(),
|
|
this._originalOriginX,
|
|
this._originalOriginY);
|
|
|
|
this.originX = this._originalOriginX;
|
|
this.originY = this._originalOriginY;
|
|
|
|
this.left = originPoint.x;
|
|
this.top = originPoint.y;
|
|
|
|
this._originalOriginX = null;
|
|
this._originalOriginY = null;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getLeftTopCoords: function() {
|
|
return this.translateToOriginPoint(this.getCenterPoint(), 'left', 'top');
|
|
},
|
|
});
|
|
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
function arrayFromCoords(coords) {
|
|
return [
|
|
new fabric.Point(coords.tl.x, coords.tl.y),
|
|
new fabric.Point(coords.tr.x, coords.tr.y),
|
|
new fabric.Point(coords.br.x, coords.br.y),
|
|
new fabric.Point(coords.bl.x, coords.bl.y)
|
|
];
|
|
}
|
|
|
|
var util = fabric.util,
|
|
degreesToRadians = util.degreesToRadians,
|
|
multiplyMatrices = util.multiplyTransformMatrices,
|
|
transformPoint = util.transformPoint;
|
|
|
|
util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Describe object's corner position in canvas element coordinates.
|
|
* properties are depending on control keys and padding the main controls.
|
|
* each property is an object with x, y and corner.
|
|
* The `corner` property contains in a similar manner the 4 points of the
|
|
* interactive area of the corner.
|
|
* The coordinates depends from the controls positionHandler and are used
|
|
* to draw and locate controls
|
|
* @memberOf fabric.Object.prototype
|
|
*/
|
|
oCoords: null,
|
|
|
|
/**
|
|
* Describe object's corner position in canvas object absolute coordinates
|
|
* properties are tl,tr,bl,br and describe the four main corner.
|
|
* each property is an object with x, y, instance of Fabric.Point.
|
|
* The coordinates depends from this properties: width, height, scaleX, scaleY
|
|
* skewX, skewY, angle, strokeWidth, top, left.
|
|
* Those coordinates are useful to understand where an object is. They get updated
|
|
* with oCoords but they do not need to be updated when zoom or panning change.
|
|
* The coordinates get updated with @method setCoords.
|
|
* You can calculate them without updating with @method calcACoords();
|
|
* @memberOf fabric.Object.prototype
|
|
*/
|
|
aCoords: null,
|
|
|
|
/**
|
|
* Describe object's corner position in canvas element coordinates.
|
|
* includes padding. Used of object detection.
|
|
* set and refreshed with setCoords and calcCoords.
|
|
* @memberOf fabric.Object.prototype
|
|
*/
|
|
lineCoords: null,
|
|
|
|
/**
|
|
* storage for object transform matrix
|
|
*/
|
|
ownMatrixCache: null,
|
|
|
|
/**
|
|
* storage for object full transform matrix
|
|
*/
|
|
matrixCache: null,
|
|
|
|
/**
|
|
* custom controls interface
|
|
* controls are added by default_controls.js
|
|
*/
|
|
controls: { },
|
|
|
|
/**
|
|
* return correct set of coordinates for intersection
|
|
* this will return either aCoords or lineCoords.
|
|
* @param {Boolean} absolute will return aCoords if true or lineCoords
|
|
* @return {Object} {tl, tr, br, bl} points
|
|
*/
|
|
_getCoords: function(absolute, calculate) {
|
|
if (calculate) {
|
|
return (absolute ? this.calcACoords() : this.calcLineCoords());
|
|
}
|
|
if (!this.aCoords || !this.lineCoords) {
|
|
this.setCoords(true);
|
|
}
|
|
return (absolute ? this.aCoords : this.lineCoords);
|
|
},
|
|
|
|
/**
|
|
* return correct set of coordinates for intersection
|
|
* this will return either aCoords or lineCoords.
|
|
* The coords are returned in an array.
|
|
* @return {Array} [tl, tr, br, bl] of points
|
|
*/
|
|
getCoords: function(absolute, calculate) {
|
|
return arrayFromCoords(this._getCoords(absolute, calculate));
|
|
},
|
|
|
|
/**
|
|
* Checks if object intersects with an area formed by 2 points
|
|
* @param {Object} pointTL top-left point of area
|
|
* @param {Object} pointBR bottom-right point of area
|
|
* @param {Boolean} [absolute] use coordinates without viewportTransform
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .oCoords
|
|
* @return {Boolean} true if object intersects with an area formed by 2 points
|
|
*/
|
|
intersectsWithRect: function(pointTL, pointBR, absolute, calculate) {
|
|
var coords = this.getCoords(absolute, calculate),
|
|
intersection = fabric.Intersection.intersectPolygonRectangle(
|
|
coords,
|
|
pointTL,
|
|
pointBR
|
|
);
|
|
return intersection.status === 'Intersection';
|
|
},
|
|
|
|
/**
|
|
* Checks if object intersects with another object
|
|
* @param {Object} other Object to test
|
|
* @param {Boolean} [absolute] use coordinates without viewportTransform
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .oCoords
|
|
* @return {Boolean} true if object intersects with another object
|
|
*/
|
|
intersectsWithObject: function(other, absolute, calculate) {
|
|
var intersection = fabric.Intersection.intersectPolygonPolygon(
|
|
this.getCoords(absolute, calculate),
|
|
other.getCoords(absolute, calculate)
|
|
);
|
|
|
|
return intersection.status === 'Intersection'
|
|
|| other.isContainedWithinObject(this, absolute, calculate)
|
|
|| this.isContainedWithinObject(other, absolute, calculate);
|
|
},
|
|
|
|
/**
|
|
* Checks if object is fully contained within area of another object
|
|
* @param {Object} other Object to test
|
|
* @param {Boolean} [absolute] use coordinates without viewportTransform
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .oCoords
|
|
* @return {Boolean} true if object is fully contained within area of another object
|
|
*/
|
|
isContainedWithinObject: function(other, absolute, calculate) {
|
|
var points = this.getCoords(absolute, calculate),
|
|
otherCoords = absolute ? other.aCoords : other.lineCoords,
|
|
i = 0, lines = other._getImageLines(otherCoords);
|
|
for (; i < 4; i++) {
|
|
if (!other.containsPoint(points[i], lines)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* Checks if object is fully contained within area formed by 2 points
|
|
* @param {Object} pointTL top-left point of area
|
|
* @param {Object} pointBR bottom-right point of area
|
|
* @param {Boolean} [absolute] use coordinates without viewportTransform
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .oCoords
|
|
* @return {Boolean} true if object is fully contained within area formed by 2 points
|
|
*/
|
|
isContainedWithinRect: function(pointTL, pointBR, absolute, calculate) {
|
|
var boundingRect = this.getBoundingRect(absolute, calculate);
|
|
|
|
return (
|
|
boundingRect.left >= pointTL.x &&
|
|
boundingRect.left + boundingRect.width <= pointBR.x &&
|
|
boundingRect.top >= pointTL.y &&
|
|
boundingRect.top + boundingRect.height <= pointBR.y
|
|
);
|
|
},
|
|
|
|
/**
|
|
* Checks if point is inside the object
|
|
* @param {fabric.Point} point Point to check against
|
|
* @param {Object} [lines] object returned from @method _getImageLines
|
|
* @param {Boolean} [absolute] use coordinates without viewportTransform
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .oCoords
|
|
* @return {Boolean} true if point is inside the object
|
|
*/
|
|
containsPoint: function(point, lines, absolute, calculate) {
|
|
var coords = this._getCoords(absolute, calculate),
|
|
lines = lines || this._getImageLines(coords),
|
|
xPoints = this._findCrossPoints(point, lines);
|
|
// if xPoints is odd then point is inside the object
|
|
return (xPoints !== 0 && xPoints % 2 === 1);
|
|
},
|
|
|
|
/**
|
|
* Checks if object is contained within the canvas with current viewportTransform
|
|
* the check is done stopping at first point that appears on screen
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .aCoords
|
|
* @return {Boolean} true if object is fully or partially contained within canvas
|
|
*/
|
|
isOnScreen: function(calculate) {
|
|
if (!this.canvas) {
|
|
return false;
|
|
}
|
|
var pointTL = this.canvas.vptCoords.tl, pointBR = this.canvas.vptCoords.br;
|
|
var points = this.getCoords(true, calculate);
|
|
// if some point is on screen, the object is on screen.
|
|
if (points.some(function(point) {
|
|
return point.x <= pointBR.x && point.x >= pointTL.x &&
|
|
point.y <= pointBR.y && point.y >= pointTL.y;
|
|
})) {
|
|
return true;
|
|
}
|
|
// no points on screen, check intersection with absolute coordinates
|
|
if (this.intersectsWithRect(pointTL, pointBR, true, calculate)) {
|
|
return true;
|
|
}
|
|
return this._containsCenterOfCanvas(pointTL, pointBR, calculate);
|
|
},
|
|
|
|
/**
|
|
* Checks if the object contains the midpoint between canvas extremities
|
|
* Does not make sense outside the context of isOnScreen and isPartiallyOnScreen
|
|
* @private
|
|
* @param {Fabric.Point} pointTL Top Left point
|
|
* @param {Fabric.Point} pointBR Top Right point
|
|
* @param {Boolean} calculate use coordinates of current position instead of .oCoords
|
|
* @return {Boolean} true if the object contains the point
|
|
*/
|
|
_containsCenterOfCanvas: function(pointTL, pointBR, calculate) {
|
|
// worst case scenario the object is so big that contains the screen
|
|
var centerPoint = { x: (pointTL.x + pointBR.x) / 2, y: (pointTL.y + pointBR.y) / 2 };
|
|
if (this.containsPoint(centerPoint, null, true, calculate)) {
|
|
return true;
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Checks if object is partially contained within the canvas with current viewportTransform
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .oCoords
|
|
* @return {Boolean} true if object is partially contained within canvas
|
|
*/
|
|
isPartiallyOnScreen: function(calculate) {
|
|
if (!this.canvas) {
|
|
return false;
|
|
}
|
|
var pointTL = this.canvas.vptCoords.tl, pointBR = this.canvas.vptCoords.br;
|
|
if (this.intersectsWithRect(pointTL, pointBR, true, calculate)) {
|
|
return true;
|
|
}
|
|
var allPointsAreOutside = this.getCoords(true, calculate).every(function(point) {
|
|
return (point.x >= pointBR.x || point.x <= pointTL.x) &&
|
|
(point.y >= pointBR.y || point.y <= pointTL.y);
|
|
});
|
|
return allPointsAreOutside && this._containsCenterOfCanvas(pointTL, pointBR, calculate);
|
|
},
|
|
|
|
/**
|
|
* Method that returns an object with the object edges in it, given the coordinates of the corners
|
|
* @private
|
|
* @param {Object} oCoords Coordinates of the object corners
|
|
*/
|
|
_getImageLines: function(oCoords) {
|
|
|
|
var lines = {
|
|
topline: {
|
|
o: oCoords.tl,
|
|
d: oCoords.tr
|
|
},
|
|
rightline: {
|
|
o: oCoords.tr,
|
|
d: oCoords.br
|
|
},
|
|
bottomline: {
|
|
o: oCoords.br,
|
|
d: oCoords.bl
|
|
},
|
|
leftline: {
|
|
o: oCoords.bl,
|
|
d: oCoords.tl
|
|
}
|
|
};
|
|
|
|
// // debugging
|
|
// if (this.canvas.contextTop) {
|
|
// this.canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2);
|
|
//
|
|
// this.canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2);
|
|
//
|
|
// this.canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2);
|
|
//
|
|
// this.canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2);
|
|
// }
|
|
|
|
return lines;
|
|
},
|
|
|
|
/**
|
|
* Helper method to determine how many cross points are between the 4 object edges
|
|
* and the horizontal line determined by a point on canvas
|
|
* @private
|
|
* @param {fabric.Point} point Point to check
|
|
* @param {Object} lines Coordinates of the object being evaluated
|
|
*/
|
|
// remove yi, not used but left code here just in case.
|
|
_findCrossPoints: function(point, lines) {
|
|
var b1, b2, a1, a2, xi, // yi,
|
|
xcount = 0,
|
|
iLine;
|
|
|
|
for (var lineKey in lines) {
|
|
iLine = lines[lineKey];
|
|
// optimisation 1: line below point. no cross
|
|
if ((iLine.o.y < point.y) && (iLine.d.y < point.y)) {
|
|
continue;
|
|
}
|
|
// optimisation 2: line above point. no cross
|
|
if ((iLine.o.y >= point.y) && (iLine.d.y >= point.y)) {
|
|
continue;
|
|
}
|
|
// optimisation 3: vertical line case
|
|
if ((iLine.o.x === iLine.d.x) && (iLine.o.x >= point.x)) {
|
|
xi = iLine.o.x;
|
|
// yi = point.y;
|
|
}
|
|
// calculate the intersection point
|
|
else {
|
|
b1 = 0;
|
|
b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x);
|
|
a1 = point.y - b1 * point.x;
|
|
a2 = iLine.o.y - b2 * iLine.o.x;
|
|
|
|
xi = -(a1 - a2) / (b1 - b2);
|
|
// yi = a1 + b1 * xi;
|
|
}
|
|
// dont count xi < point.x cases
|
|
if (xi >= point.x) {
|
|
xcount += 1;
|
|
}
|
|
// optimisation 4: specific for square images
|
|
if (xcount === 2) {
|
|
break;
|
|
}
|
|
}
|
|
return xcount;
|
|
},
|
|
|
|
/**
|
|
* Returns coordinates of object's bounding rectangle (left, top, width, height)
|
|
* the box is intended as aligned to axis of canvas.
|
|
* @param {Boolean} [absolute] use coordinates without viewportTransform
|
|
* @param {Boolean} [calculate] use coordinates of current position instead of .oCoords / .aCoords
|
|
* @return {Object} Object with left, top, width, height properties
|
|
*/
|
|
getBoundingRect: function(absolute, calculate) {
|
|
var coords = this.getCoords(absolute, calculate);
|
|
return util.makeBoundingBoxFromPoints(coords);
|
|
},
|
|
|
|
/**
|
|
* Returns width of an object's bounding box counting transformations
|
|
* before 2.0 it was named getWidth();
|
|
* @return {Number} width value
|
|
*/
|
|
getScaledWidth: function() {
|
|
return this._getTransformedDimensions().x;
|
|
},
|
|
|
|
/**
|
|
* Returns height of an object bounding box counting transformations
|
|
* before 2.0 it was named getHeight();
|
|
* @return {Number} height value
|
|
*/
|
|
getScaledHeight: function() {
|
|
return this._getTransformedDimensions().y;
|
|
},
|
|
|
|
/**
|
|
* Makes sure the scale is valid and modifies it if necessary
|
|
* @private
|
|
* @param {Number} value
|
|
* @return {Number}
|
|
*/
|
|
_constrainScale: function(value) {
|
|
if (Math.abs(value) < this.minScaleLimit) {
|
|
if (value < 0) {
|
|
return -this.minScaleLimit;
|
|
}
|
|
else {
|
|
return this.minScaleLimit;
|
|
}
|
|
}
|
|
else if (value === 0) {
|
|
return 0.0001;
|
|
}
|
|
return value;
|
|
},
|
|
|
|
/**
|
|
* Scales an object (equally by x and y)
|
|
* @param {Number} value Scale factor
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
scale: function(value) {
|
|
this._set('scaleX', value);
|
|
this._set('scaleY', value);
|
|
return this.setCoords();
|
|
},
|
|
|
|
/**
|
|
* Scales an object to a given width, with respect to bounding box (scaling by x/y equally)
|
|
* @param {Number} value New width value
|
|
* @param {Boolean} absolute ignore viewport
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
scaleToWidth: function(value, absolute) {
|
|
// adjust to bounding rect factor so that rotated shapes would fit as well
|
|
var boundingRectFactor = this.getBoundingRect(absolute).width / this.getScaledWidth();
|
|
return this.scale(value / this.width / boundingRectFactor);
|
|
},
|
|
|
|
/**
|
|
* Scales an object to a given height, with respect to bounding box (scaling by x/y equally)
|
|
* @param {Number} value New height value
|
|
* @param {Boolean} absolute ignore viewport
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
scaleToHeight: function(value, absolute) {
|
|
// adjust to bounding rect factor so that rotated shapes would fit as well
|
|
var boundingRectFactor = this.getBoundingRect(absolute).height / this.getScaledHeight();
|
|
return this.scale(value / this.height / boundingRectFactor);
|
|
},
|
|
|
|
/**
|
|
* Calculates and returns the .coords of an object.
|
|
* unused by the library, only for the end dev.
|
|
* @return {Object} Object with tl, tr, br, bl ....
|
|
* @chainable
|
|
* @deprecated
|
|
*/
|
|
calcCoords: function(absolute) {
|
|
// this is a compatibility function to avoid removing calcCoords now.
|
|
if (absolute) {
|
|
return this.calcACoords();
|
|
}
|
|
return this.calcOCoords();
|
|
},
|
|
|
|
calcLineCoords: function() {
|
|
var vpt = this.getViewportTransform(),
|
|
padding = this.padding, angle = degreesToRadians(this.angle),
|
|
cos = util.cos(angle), sin = util.sin(angle),
|
|
cosP = cos * padding, sinP = sin * padding, cosPSinP = cosP + sinP,
|
|
cosPMinusSinP = cosP - sinP, aCoords = this.calcACoords();
|
|
|
|
var lineCoords = {
|
|
tl: transformPoint(aCoords.tl, vpt),
|
|
tr: transformPoint(aCoords.tr, vpt),
|
|
bl: transformPoint(aCoords.bl, vpt),
|
|
br: transformPoint(aCoords.br, vpt),
|
|
};
|
|
|
|
if (padding) {
|
|
lineCoords.tl.x -= cosPMinusSinP;
|
|
lineCoords.tl.y -= cosPSinP;
|
|
lineCoords.tr.x += cosPSinP;
|
|
lineCoords.tr.y -= cosPMinusSinP;
|
|
lineCoords.bl.x -= cosPSinP;
|
|
lineCoords.bl.y += cosPMinusSinP;
|
|
lineCoords.br.x += cosPMinusSinP;
|
|
lineCoords.br.y += cosPSinP;
|
|
}
|
|
|
|
return lineCoords;
|
|
},
|
|
|
|
calcOCoords: function() {
|
|
var rotateMatrix = this._calcRotateMatrix(),
|
|
translateMatrix = this._calcTranslateMatrix(),
|
|
vpt = this.getViewportTransform(),
|
|
startMatrix = multiplyMatrices(vpt, translateMatrix),
|
|
finalMatrix = multiplyMatrices(startMatrix, rotateMatrix),
|
|
finalMatrix = multiplyMatrices(finalMatrix, [1 / vpt[0], 0, 0, 1 / vpt[3], 0, 0]),
|
|
dim = this._calculateCurrentDimensions(),
|
|
coords = {};
|
|
this.forEachControl(function(control, key, fabricObject) {
|
|
coords[key] = control.positionHandler(dim, finalMatrix, fabricObject);
|
|
});
|
|
|
|
// debug code
|
|
// var canvas = this.canvas;
|
|
// setTimeout(function() {
|
|
// canvas.contextTop.clearRect(0, 0, 700, 700);
|
|
// canvas.contextTop.fillStyle = 'green';
|
|
// Object.keys(coords).forEach(function(key) {
|
|
// var control = coords[key];
|
|
// canvas.contextTop.fillRect(control.x, control.y, 3, 3);
|
|
// });
|
|
// }, 50);
|
|
return coords;
|
|
},
|
|
|
|
calcACoords: function() {
|
|
var rotateMatrix = this._calcRotateMatrix(),
|
|
translateMatrix = this._calcTranslateMatrix(),
|
|
finalMatrix = multiplyMatrices(translateMatrix, rotateMatrix),
|
|
dim = this._getTransformedDimensions(),
|
|
w = dim.x / 2, h = dim.y / 2;
|
|
return {
|
|
// corners
|
|
tl: transformPoint({ x: -w, y: -h }, finalMatrix),
|
|
tr: transformPoint({ x: w, y: -h }, finalMatrix),
|
|
bl: transformPoint({ x: -w, y: h }, finalMatrix),
|
|
br: transformPoint({ x: w, y: h }, finalMatrix)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Sets corner and controls position coordinates based on current angle, width and height, left and top.
|
|
* oCoords are used to find the corners
|
|
* aCoords are used to quickly find an object on the canvas
|
|
* lineCoords are used to quickly find object during pointer events.
|
|
* See {@link https://github.com/kangax/fabric.js/wiki/When-to-call-setCoords|When-to-call-setCoords}
|
|
* @param {Boolean} [skipCorners] skip calculation of oCoords.
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
setCoords: function(skipCorners) {
|
|
this.aCoords = this.calcACoords();
|
|
// in case we are in a group, for how the inner group target check works,
|
|
// lineCoords are exactly aCoords. Since the vpt gets absorbed by the normalized pointer.
|
|
this.lineCoords = this.group ? this.aCoords : this.calcLineCoords();
|
|
if (skipCorners) {
|
|
return this;
|
|
}
|
|
// set coordinates of the draggable boxes in the corners used to scale/rotate the image
|
|
this.oCoords = this.calcOCoords();
|
|
this._setCornerCoords && this._setCornerCoords();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* calculate rotation matrix of an object
|
|
* @return {Array} rotation matrix for the object
|
|
*/
|
|
_calcRotateMatrix: function() {
|
|
return util.calcRotateMatrix(this);
|
|
},
|
|
|
|
/**
|
|
* calculate the translation matrix for an object transform
|
|
* @return {Array} rotation matrix for the object
|
|
*/
|
|
_calcTranslateMatrix: function() {
|
|
var center = this.getCenterPoint();
|
|
return [1, 0, 0, 1, center.x, center.y];
|
|
},
|
|
|
|
transformMatrixKey: function(skipGroup) {
|
|
var sep = '_', prefix = '';
|
|
if (!skipGroup && this.group) {
|
|
prefix = this.group.transformMatrixKey(skipGroup) + sep;
|
|
};
|
|
return prefix + this.top + sep + this.left + sep + this.scaleX + sep + this.scaleY +
|
|
sep + this.skewX + sep + this.skewY + sep + this.angle + sep + this.originX + sep + this.originY +
|
|
sep + this.width + sep + this.height + sep + this.strokeWidth + this.flipX + this.flipY;
|
|
},
|
|
|
|
/**
|
|
* calculate transform matrix that represents the current transformations from the
|
|
* object's properties.
|
|
* @param {Boolean} [skipGroup] return transform matrix for object not counting parent transformations
|
|
* There are some situation in which this is useful to avoid the fake rotation.
|
|
* @return {Array} transform matrix for the object
|
|
*/
|
|
calcTransformMatrix: function(skipGroup) {
|
|
var matrix = this.calcOwnMatrix();
|
|
if (skipGroup || !this.group) {
|
|
return matrix;
|
|
}
|
|
var key = this.transformMatrixKey(skipGroup), cache = this.matrixCache || (this.matrixCache = {});
|
|
if (cache.key === key) {
|
|
return cache.value;
|
|
}
|
|
if (this.group) {
|
|
matrix = multiplyMatrices(this.group.calcTransformMatrix(false), matrix);
|
|
}
|
|
cache.key = key;
|
|
cache.value = matrix;
|
|
return matrix;
|
|
},
|
|
|
|
/**
|
|
* calculate transform matrix that represents the current transformations from the
|
|
* object's properties, this matrix does not include the group transformation
|
|
* @return {Array} transform matrix for the object
|
|
*/
|
|
calcOwnMatrix: function() {
|
|
var key = this.transformMatrixKey(true), cache = this.ownMatrixCache || (this.ownMatrixCache = {});
|
|
if (cache.key === key) {
|
|
return cache.value;
|
|
}
|
|
var tMatrix = this._calcTranslateMatrix(),
|
|
options = {
|
|
angle: this.angle,
|
|
translateX: tMatrix[4],
|
|
translateY: tMatrix[5],
|
|
scaleX: this.scaleX,
|
|
scaleY: this.scaleY,
|
|
skewX: this.skewX,
|
|
skewY: this.skewY,
|
|
flipX: this.flipX,
|
|
flipY: this.flipY,
|
|
};
|
|
cache.key = key;
|
|
cache.value = util.composeMatrix(options);
|
|
return cache.value;
|
|
},
|
|
|
|
/*
|
|
* Calculate object dimensions from its properties
|
|
* @private
|
|
* @deprecated since 3.4.0, please use fabric.util._calcDimensionsTransformMatrix
|
|
* not including or including flipX, flipY to emulate the flipping boolean
|
|
* @return {Object} .x width dimension
|
|
* @return {Object} .y height dimension
|
|
*/
|
|
_calcDimensionsTransformMatrix: function(skewX, skewY, flipping) {
|
|
return util.calcDimensionsMatrix({
|
|
skewX: skewX,
|
|
skewY: skewY,
|
|
scaleX: this.scaleX * (flipping && this.flipX ? -1 : 1),
|
|
scaleY: this.scaleY * (flipping && this.flipY ? -1 : 1)
|
|
});
|
|
},
|
|
|
|
/*
|
|
* Calculate object dimensions from its properties
|
|
* @private
|
|
* @return {Object} .x width dimension
|
|
* @return {Object} .y height dimension
|
|
*/
|
|
_getNonTransformedDimensions: function() {
|
|
var strokeWidth = this.strokeWidth,
|
|
w = this.width + strokeWidth,
|
|
h = this.height + strokeWidth;
|
|
return { x: w, y: h };
|
|
},
|
|
|
|
/*
|
|
* Calculate object bounding box dimensions from its properties scale, skew.
|
|
* @param {Number} skewX, a value to override current skewX
|
|
* @param {Number} skewY, a value to override current skewY
|
|
* @private
|
|
* @return {Object} .x width dimension
|
|
* @return {Object} .y height dimension
|
|
*/
|
|
_getTransformedDimensions: function(skewX, skewY) {
|
|
if (typeof skewX === 'undefined') {
|
|
skewX = this.skewX;
|
|
}
|
|
if (typeof skewY === 'undefined') {
|
|
skewY = this.skewY;
|
|
}
|
|
var dimensions, dimX, dimY,
|
|
noSkew = skewX === 0 && skewY === 0;
|
|
|
|
if (this.strokeUniform) {
|
|
dimX = this.width;
|
|
dimY = this.height;
|
|
}
|
|
else {
|
|
dimensions = this._getNonTransformedDimensions();
|
|
dimX = dimensions.x;
|
|
dimY = dimensions.y;
|
|
}
|
|
if (noSkew) {
|
|
return this._finalizeDimensions(dimX * this.scaleX, dimY * this.scaleY);
|
|
}
|
|
var bbox = util.sizeAfterTransform(dimX, dimY, {
|
|
scaleX: this.scaleX,
|
|
scaleY: this.scaleY,
|
|
skewX: skewX,
|
|
skewY: skewY,
|
|
});
|
|
return this._finalizeDimensions(bbox.x, bbox.y);
|
|
},
|
|
|
|
/*
|
|
* Calculate object bounding box dimensions from its properties scale, skew.
|
|
* @param Number width width of the bbox
|
|
* @param Number height height of the bbox
|
|
* @private
|
|
* @return {Object} .x finalized width dimension
|
|
* @return {Object} .y finalized height dimension
|
|
*/
|
|
_finalizeDimensions: function(width, height) {
|
|
return this.strokeUniform ?
|
|
{ x: width + this.strokeWidth, y: height + this.strokeWidth }
|
|
:
|
|
{ x: width, y: height };
|
|
},
|
|
|
|
/*
|
|
* Calculate object dimensions for controls box, including padding and canvas zoom.
|
|
* and active selection
|
|
* private
|
|
*/
|
|
_calculateCurrentDimensions: function() {
|
|
var vpt = this.getViewportTransform(),
|
|
dim = this._getTransformedDimensions(),
|
|
p = transformPoint(dim, vpt, true);
|
|
return p.scalarAdd(2 * this.padding);
|
|
},
|
|
});
|
|
})();
|
|
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Moves an object to the bottom of the stack of drawn objects
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
sendToBack: function() {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.sendToBack.call(this.group, this);
|
|
}
|
|
else if (this.canvas) {
|
|
this.canvas.sendToBack(this);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object to the top of the stack of drawn objects
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
bringToFront: function() {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.bringToFront.call(this.group, this);
|
|
}
|
|
else if (this.canvas) {
|
|
this.canvas.bringToFront(this);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object down in stack of drawn objects
|
|
* @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
sendBackwards: function(intersecting) {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this, intersecting);
|
|
}
|
|
else if (this.canvas) {
|
|
this.canvas.sendBackwards(this, intersecting);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object up in stack of drawn objects
|
|
* @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
bringForward: function(intersecting) {
|
|
if (this.group) {
|
|
fabric.StaticCanvas.prototype.bringForward.call(this.group, this, intersecting);
|
|
}
|
|
else if (this.canvas) {
|
|
this.canvas.bringForward(this, intersecting);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Moves an object to specified level in stack of drawn objects
|
|
* @param {Number} index New position of object
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
moveTo: function(index) {
|
|
if (this.group && this.group.type !== 'activeSelection') {
|
|
fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index);
|
|
}
|
|
else if (this.canvas) {
|
|
this.canvas.moveTo(this, index);
|
|
}
|
|
return this;
|
|
}
|
|
});
|
|
|
|
|
|
/* _TO_SVG_START_ */
|
|
(function() {
|
|
function getSvgColorString(prop, value) {
|
|
if (!value) {
|
|
return prop + ': none; ';
|
|
}
|
|
else if (value.toLive) {
|
|
return prop + ': url(#SVGID_' + value.id + '); ';
|
|
}
|
|
else {
|
|
var color = new fabric.Color(value),
|
|
str = prop + ': ' + color.toRgb() + '; ',
|
|
opacity = color.getAlpha();
|
|
if (opacity !== 1) {
|
|
//change the color in rgb + opacity
|
|
str += prop + '-opacity: ' + opacity.toString() + '; ';
|
|
}
|
|
return str;
|
|
}
|
|
}
|
|
|
|
var toFixed = fabric.util.toFixed;
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
/**
|
|
* Returns styles-string for svg-export
|
|
* @param {Boolean} skipShadow a boolean to skip shadow filter output
|
|
* @return {String}
|
|
*/
|
|
getSvgStyles: function(skipShadow) {
|
|
|
|
var fillRule = this.fillRule ? this.fillRule : 'nonzero',
|
|
strokeWidth = this.strokeWidth ? this.strokeWidth : '0',
|
|
strokeDashArray = this.strokeDashArray ? this.strokeDashArray.join(' ') : 'none',
|
|
strokeDashOffset = this.strokeDashOffset ? this.strokeDashOffset : '0',
|
|
strokeLineCap = this.strokeLineCap ? this.strokeLineCap : 'butt',
|
|
strokeLineJoin = this.strokeLineJoin ? this.strokeLineJoin : 'miter',
|
|
strokeMiterLimit = this.strokeMiterLimit ? this.strokeMiterLimit : '4',
|
|
opacity = typeof this.opacity !== 'undefined' ? this.opacity : '1',
|
|
visibility = this.visible ? '' : ' visibility: hidden;',
|
|
filter = skipShadow ? '' : this.getSvgFilter(),
|
|
fill = getSvgColorString('fill', this.fill),
|
|
stroke = getSvgColorString('stroke', this.stroke);
|
|
|
|
return [
|
|
stroke,
|
|
'stroke-width: ', strokeWidth, '; ',
|
|
'stroke-dasharray: ', strokeDashArray, '; ',
|
|
'stroke-linecap: ', strokeLineCap, '; ',
|
|
'stroke-dashoffset: ', strokeDashOffset, '; ',
|
|
'stroke-linejoin: ', strokeLineJoin, '; ',
|
|
'stroke-miterlimit: ', strokeMiterLimit, '; ',
|
|
fill,
|
|
'fill-rule: ', fillRule, '; ',
|
|
'opacity: ', opacity, ';',
|
|
filter,
|
|
visibility
|
|
].join('');
|
|
},
|
|
|
|
/**
|
|
* Returns styles-string for svg-export
|
|
* @param {Object} style the object from which to retrieve style properties
|
|
* @param {Boolean} useWhiteSpace a boolean to include an additional attribute in the style.
|
|
* @return {String}
|
|
*/
|
|
getSvgSpanStyles: function(style, useWhiteSpace) {
|
|
var term = '; ';
|
|
var fontFamily = style.fontFamily ?
|
|
'font-family: ' + (((style.fontFamily.indexOf('\'') === -1 && style.fontFamily.indexOf('"') === -1) ?
|
|
'\'' + style.fontFamily + '\'' : style.fontFamily)) + term : '';
|
|
var strokeWidth = style.strokeWidth ? 'stroke-width: ' + style.strokeWidth + term : '',
|
|
fontFamily = fontFamily,
|
|
fontSize = style.fontSize ? 'font-size: ' + style.fontSize + 'px' + term : '',
|
|
fontStyle = style.fontStyle ? 'font-style: ' + style.fontStyle + term : '',
|
|
fontWeight = style.fontWeight ? 'font-weight: ' + style.fontWeight + term : '',
|
|
fill = style.fill ? getSvgColorString('fill', style.fill) : '',
|
|
stroke = style.stroke ? getSvgColorString('stroke', style.stroke) : '',
|
|
textDecoration = this.getSvgTextDecoration(style),
|
|
deltaY = style.deltaY ? 'baseline-shift: ' + (-style.deltaY) + '; ' : '';
|
|
if (textDecoration) {
|
|
textDecoration = 'text-decoration: ' + textDecoration + term;
|
|
}
|
|
|
|
return [
|
|
stroke,
|
|
strokeWidth,
|
|
fontFamily,
|
|
fontSize,
|
|
fontStyle,
|
|
fontWeight,
|
|
textDecoration,
|
|
fill,
|
|
deltaY,
|
|
useWhiteSpace ? 'white-space: pre; ' : ''
|
|
].join('');
|
|
},
|
|
|
|
/**
|
|
* Returns text-decoration property for svg-export
|
|
* @param {Object} style the object from which to retrieve style properties
|
|
* @return {String}
|
|
*/
|
|
getSvgTextDecoration: function(style) {
|
|
return ['overline', 'underline', 'line-through'].filter(function(decoration) {
|
|
return style[decoration.replace('-', '')];
|
|
}).join(' ');
|
|
},
|
|
|
|
/**
|
|
* Returns filter for svg shadow
|
|
* @return {String}
|
|
*/
|
|
getSvgFilter: function() {
|
|
return this.shadow ? 'filter: url(#SVGID_' + this.shadow.id + ');' : '';
|
|
},
|
|
|
|
/**
|
|
* Returns id attribute for svg output
|
|
* @return {String}
|
|
*/
|
|
getSvgCommons: function() {
|
|
return [
|
|
this.id ? 'id="' + this.id + '" ' : '',
|
|
this.clipPath ? 'clip-path="url(#' + this.clipPath.clipPathId + ')" ' : '',
|
|
].join('');
|
|
},
|
|
|
|
/**
|
|
* Returns transform-string for svg-export
|
|
* @param {Boolean} use the full transform or the single object one.
|
|
* @return {String}
|
|
*/
|
|
getSvgTransform: function(full, additionalTransform) {
|
|
var transform = full ? this.calcTransformMatrix() : this.calcOwnMatrix(),
|
|
svgTransform = 'transform="' + fabric.util.matrixToSVG(transform);
|
|
return svgTransform +
|
|
(additionalTransform || '') + '" ';
|
|
},
|
|
|
|
_setSVGBg: function(textBgRects) {
|
|
if (this.backgroundColor) {
|
|
var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS;
|
|
textBgRects.push(
|
|
'\t\t<rect ',
|
|
this._getFillAttributes(this.backgroundColor),
|
|
' x="',
|
|
toFixed(-this.width / 2, NUM_FRACTION_DIGITS),
|
|
'" y="',
|
|
toFixed(-this.height / 2, NUM_FRACTION_DIGITS),
|
|
'" width="',
|
|
toFixed(this.width, NUM_FRACTION_DIGITS),
|
|
'" height="',
|
|
toFixed(this.height, NUM_FRACTION_DIGITS),
|
|
'"></rect>\n');
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function(reviver) {
|
|
return this._createBaseSVGMarkup(this._toSVG(reviver), { reviver: reviver });
|
|
},
|
|
|
|
/**
|
|
* Returns svg clipPath representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toClipPathSVG: function(reviver) {
|
|
return '\t' + this._createBaseClipPathSVGMarkup(this._toSVG(reviver), { reviver: reviver });
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createBaseClipPathSVGMarkup: function(objectMarkup, options) {
|
|
options = options || {};
|
|
var reviver = options.reviver,
|
|
additionalTransform = options.additionalTransform || '',
|
|
commonPieces = [
|
|
this.getSvgTransform(true, additionalTransform),
|
|
this.getSvgCommons(),
|
|
].join(''),
|
|
// insert commons in the markup, style and svgCommons
|
|
index = objectMarkup.indexOf('COMMON_PARTS');
|
|
objectMarkup[index] = commonPieces;
|
|
return reviver ? reviver(objectMarkup.join('')) : objectMarkup.join('');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createBaseSVGMarkup: function(objectMarkup, options) {
|
|
options = options || {};
|
|
var noStyle = options.noStyle,
|
|
reviver = options.reviver,
|
|
styleInfo = noStyle ? '' : 'style="' + this.getSvgStyles() + '" ',
|
|
shadowInfo = options.withShadow ? 'style="' + this.getSvgFilter() + '" ' : '',
|
|
clipPath = this.clipPath,
|
|
vectorEffect = this.strokeUniform ? 'vector-effect="non-scaling-stroke" ' : '',
|
|
absoluteClipPath = clipPath && clipPath.absolutePositioned,
|
|
stroke = this.stroke, fill = this.fill, shadow = this.shadow,
|
|
commonPieces, markup = [], clipPathMarkup,
|
|
// insert commons in the markup, style and svgCommons
|
|
index = objectMarkup.indexOf('COMMON_PARTS'),
|
|
additionalTransform = options.additionalTransform;
|
|
if (clipPath) {
|
|
clipPath.clipPathId = 'CLIPPATH_' + fabric.Object.__uid++;
|
|
clipPathMarkup = '<clipPath id="' + clipPath.clipPathId + '" >\n' +
|
|
clipPath.toClipPathSVG(reviver) +
|
|
'</clipPath>\n';
|
|
}
|
|
if (absoluteClipPath) {
|
|
markup.push(
|
|
'<g ', shadowInfo, this.getSvgCommons(), ' >\n'
|
|
);
|
|
}
|
|
markup.push(
|
|
'<g ',
|
|
this.getSvgTransform(false),
|
|
!absoluteClipPath ? shadowInfo + this.getSvgCommons() : '',
|
|
' >\n'
|
|
);
|
|
commonPieces = [
|
|
styleInfo,
|
|
vectorEffect,
|
|
noStyle ? '' : this.addPaintOrder(), ' ',
|
|
additionalTransform ? 'transform="' + additionalTransform + '" ' : '',
|
|
].join('');
|
|
objectMarkup[index] = commonPieces;
|
|
if (fill && fill.toLive) {
|
|
markup.push(fill.toSVG(this));
|
|
}
|
|
if (stroke && stroke.toLive) {
|
|
markup.push(stroke.toSVG(this));
|
|
}
|
|
if (shadow) {
|
|
markup.push(shadow.toSVG(this));
|
|
}
|
|
if (clipPath) {
|
|
markup.push(clipPathMarkup);
|
|
}
|
|
markup.push(objectMarkup.join(''));
|
|
markup.push('</g>\n');
|
|
absoluteClipPath && markup.push('</g>\n');
|
|
return reviver ? reviver(markup.join('')) : markup.join('');
|
|
},
|
|
|
|
addPaintOrder: function() {
|
|
return this.paintFirst !== 'fill' ? ' paint-order="' + this.paintFirst + '" ' : '';
|
|
}
|
|
});
|
|
})();
|
|
/* _TO_SVG_END_ */
|
|
|
|
|
|
(function() {
|
|
|
|
var extend = fabric.util.object.extend,
|
|
originalSet = 'stateProperties';
|
|
|
|
/*
|
|
Depends on `stateProperties`
|
|
*/
|
|
function saveProps(origin, destination, props) {
|
|
var tmpObj = { }, deep = true;
|
|
props.forEach(function(prop) {
|
|
tmpObj[prop] = origin[prop];
|
|
});
|
|
|
|
extend(origin[destination], tmpObj, deep);
|
|
}
|
|
|
|
function _isEqual(origValue, currentValue, firstPass) {
|
|
if (origValue === currentValue) {
|
|
// if the objects are identical, return
|
|
return true;
|
|
}
|
|
else if (Array.isArray(origValue)) {
|
|
if (!Array.isArray(currentValue) || origValue.length !== currentValue.length) {
|
|
return false;
|
|
}
|
|
for (var i = 0, len = origValue.length; i < len; i++) {
|
|
if (!_isEqual(origValue[i], currentValue[i])) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
else if (origValue && typeof origValue === 'object') {
|
|
var keys = Object.keys(origValue), key;
|
|
if (!currentValue ||
|
|
typeof currentValue !== 'object' ||
|
|
(!firstPass && keys.length !== Object.keys(currentValue).length)
|
|
) {
|
|
return false;
|
|
}
|
|
for (var i = 0, len = keys.length; i < len; i++) {
|
|
key = keys[i];
|
|
// since clipPath is in the statefull cache list and the clipPath objects
|
|
// would be iterated as an object, this would lead to possible infinite recursion
|
|
// we do not want to compare those.
|
|
if (key === 'canvas' || key === 'group') {
|
|
continue;
|
|
}
|
|
if (!_isEqual(origValue[key], currentValue[key])) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
}
|
|
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* Returns true if object state (one of its state properties) was changed
|
|
* @param {String} [propertySet] optional name for the set of property we want to save
|
|
* @return {Boolean} true if instance' state has changed since `{@link fabric.Object#saveState}` was called
|
|
*/
|
|
hasStateChanged: function(propertySet) {
|
|
propertySet = propertySet || originalSet;
|
|
var dashedPropertySet = '_' + propertySet;
|
|
if (Object.keys(this[dashedPropertySet]).length < this[propertySet].length) {
|
|
return true;
|
|
}
|
|
return !_isEqual(this[dashedPropertySet], this, true);
|
|
},
|
|
|
|
/**
|
|
* Saves state of an object
|
|
* @param {Object} [options] Object with additional `stateProperties` array to include when saving state
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
saveState: function(options) {
|
|
var propertySet = options && options.propertySet || originalSet,
|
|
destination = '_' + propertySet;
|
|
if (!this[destination]) {
|
|
return this.setupState(options);
|
|
}
|
|
saveProps(this, destination, this[propertySet]);
|
|
if (options && options.stateProperties) {
|
|
saveProps(this, destination, options.stateProperties);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Setups state of an object
|
|
* @param {Object} [options] Object with additional `stateProperties` array to include when saving state
|
|
* @return {fabric.Object} thisArg
|
|
*/
|
|
setupState: function(options) {
|
|
options = options || { };
|
|
var propertySet = options.propertySet || originalSet;
|
|
options.propertySet = propertySet;
|
|
this['_' + propertySet] = { };
|
|
this.saveState(options);
|
|
return this;
|
|
}
|
|
});
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
var degreesToRadians = fabric.util.degreesToRadians;
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
/**
|
|
* Determines which corner has been clicked
|
|
* @private
|
|
* @param {Object} pointer The pointer indicating the mouse position
|
|
* @return {String|Boolean} corner code (tl, tr, bl, br, etc.), or false if nothing is found
|
|
*/
|
|
_findTargetCorner: function(pointer, forTouch) {
|
|
// objects in group, anykind, are not self modificable,
|
|
// must not return an hovered corner.
|
|
if (!this.hasControls || this.group || (!this.canvas || this.canvas._activeObject !== this)) {
|
|
return false;
|
|
}
|
|
|
|
var ex = pointer.x,
|
|
ey = pointer.y,
|
|
xPoints,
|
|
lines, keys = Object.keys(this.oCoords),
|
|
j = keys.length - 1, i;
|
|
this.__corner = 0;
|
|
|
|
// cycle in reverse order so we pick first the one on top
|
|
for (; j >= 0; j--) {
|
|
i = keys[j];
|
|
if (!this.isControlVisible(i)) {
|
|
continue;
|
|
}
|
|
|
|
lines = this._getImageLines(forTouch ? this.oCoords[i].touchCorner : this.oCoords[i].corner);
|
|
// // debugging
|
|
//
|
|
// this.canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2);
|
|
//
|
|
// this.canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2);
|
|
//
|
|
// this.canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2);
|
|
//
|
|
// this.canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2);
|
|
// this.canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2);
|
|
|
|
xPoints = this._findCrossPoints({ x: ex, y: ey }, lines);
|
|
if (xPoints !== 0 && xPoints % 2 === 1) {
|
|
this.__corner = i;
|
|
return i;
|
|
}
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Calls a function for each control. The function gets called,
|
|
* with the control, the object that is calling the iterator and the control's key
|
|
* @param {Function} fn function to iterate over the controls over
|
|
*/
|
|
forEachControl: function(fn) {
|
|
for (var i in this.controls) {
|
|
fn(this.controls[i], i, this);
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Sets the coordinates of the draggable boxes in the corners of
|
|
* the image used to scale/rotate it.
|
|
* note: if we would switch to ROUND corner area, all of this would disappear.
|
|
* everything would resolve to a single point and a pythagorean theorem for the distance
|
|
* @private
|
|
*/
|
|
_setCornerCoords: function() {
|
|
var coords = this.oCoords;
|
|
|
|
for (var control in coords) {
|
|
var controlObject = this.controls[control];
|
|
coords[control].corner = controlObject.calcCornerCoords(
|
|
this.angle, this.cornerSize, coords[control].x, coords[control].y, false);
|
|
coords[control].touchCorner = controlObject.calcCornerCoords(
|
|
this.angle, this.touchCornerSize, coords[control].x, coords[control].y, true);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Draws a colored layer behind the object, inside its selection borders.
|
|
* Requires public options: padding, selectionBackgroundColor
|
|
* this function is called when the context is transformed
|
|
* has checks to be skipped when the object is on a staticCanvas
|
|
* @param {CanvasRenderingContext2D} ctx Context to draw on
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
drawSelectionBackground: function(ctx) {
|
|
if (!this.selectionBackgroundColor ||
|
|
(this.canvas && !this.canvas.interactive) ||
|
|
(this.canvas && this.canvas._activeObject !== this)
|
|
) {
|
|
return this;
|
|
}
|
|
ctx.save();
|
|
var center = this.getCenterPoint(), wh = this._calculateCurrentDimensions(),
|
|
vpt = this.canvas.viewportTransform;
|
|
ctx.translate(center.x, center.y);
|
|
ctx.scale(1 / vpt[0], 1 / vpt[3]);
|
|
ctx.rotate(degreesToRadians(this.angle));
|
|
ctx.fillStyle = this.selectionBackgroundColor;
|
|
ctx.fillRect(-wh.x / 2, -wh.y / 2, wh.x, wh.y);
|
|
ctx.restore();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Draws borders of an object's bounding box.
|
|
* Requires public properties: width, height
|
|
* Requires public options: padding, borderColor
|
|
* @param {CanvasRenderingContext2D} ctx Context to draw on
|
|
* @param {Object} styleOverride object to override the object style
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
drawBorders: function(ctx, styleOverride) {
|
|
styleOverride = styleOverride || {};
|
|
var wh = this._calculateCurrentDimensions(),
|
|
strokeWidth = this.borderScaleFactor,
|
|
width = wh.x + strokeWidth,
|
|
height = wh.y + strokeWidth,
|
|
hasControls = typeof styleOverride.hasControls !== 'undefined' ?
|
|
styleOverride.hasControls : this.hasControls,
|
|
shouldStroke = false;
|
|
|
|
ctx.save();
|
|
ctx.strokeStyle = styleOverride.borderColor || this.borderColor;
|
|
this._setLineDash(ctx, styleOverride.borderDashArray || this.borderDashArray);
|
|
|
|
ctx.strokeRect(
|
|
-width / 2,
|
|
-height / 2,
|
|
width,
|
|
height
|
|
);
|
|
|
|
if (hasControls) {
|
|
ctx.beginPath();
|
|
this.forEachControl(function(control, key, fabricObject) {
|
|
// in this moment, the ctx is centered on the object.
|
|
// width and height of the above function are the size of the bbox.
|
|
if (control.withConnection && control.getVisibility(fabricObject, key)) {
|
|
// reset movement for each control
|
|
shouldStroke = true;
|
|
ctx.moveTo(control.x * width, control.y * height);
|
|
ctx.lineTo(
|
|
control.x * width + control.offsetX,
|
|
control.y * height + control.offsetY
|
|
);
|
|
}
|
|
});
|
|
if (shouldStroke) {
|
|
ctx.stroke();
|
|
}
|
|
}
|
|
ctx.restore();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Draws borders of an object's bounding box when it is inside a group.
|
|
* Requires public properties: width, height
|
|
* Requires public options: padding, borderColor
|
|
* @param {CanvasRenderingContext2D} ctx Context to draw on
|
|
* @param {object} options object representing current object parameters
|
|
* @param {Object} styleOverride object to override the object style
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
drawBordersInGroup: function(ctx, options, styleOverride) {
|
|
styleOverride = styleOverride || {};
|
|
var bbox = fabric.util.sizeAfterTransform(this.width, this.height, options),
|
|
strokeWidth = this.strokeWidth,
|
|
strokeUniform = this.strokeUniform,
|
|
borderScaleFactor = this.borderScaleFactor,
|
|
width =
|
|
bbox.x + strokeWidth * (strokeUniform ? this.canvas.getZoom() : options.scaleX) + borderScaleFactor,
|
|
height =
|
|
bbox.y + strokeWidth * (strokeUniform ? this.canvas.getZoom() : options.scaleY) + borderScaleFactor;
|
|
ctx.save();
|
|
this._setLineDash(ctx, styleOverride.borderDashArray || this.borderDashArray);
|
|
ctx.strokeStyle = styleOverride.borderColor || this.borderColor;
|
|
ctx.strokeRect(
|
|
-width / 2,
|
|
-height / 2,
|
|
width,
|
|
height
|
|
);
|
|
|
|
ctx.restore();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Draws corners of an object's bounding box.
|
|
* Requires public properties: width, height
|
|
* Requires public options: cornerSize, padding
|
|
* @param {CanvasRenderingContext2D} ctx Context to draw on
|
|
* @param {Object} styleOverride object to override the object style
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
drawControls: function(ctx, styleOverride) {
|
|
styleOverride = styleOverride || {};
|
|
ctx.save();
|
|
var retinaScaling = this.canvas.getRetinaScaling(), matrix, p;
|
|
ctx.setTransform(retinaScaling, 0, 0, retinaScaling, 0, 0);
|
|
ctx.strokeStyle = ctx.fillStyle = styleOverride.cornerColor || this.cornerColor;
|
|
if (!this.transparentCorners) {
|
|
ctx.strokeStyle = styleOverride.cornerStrokeColor || this.cornerStrokeColor;
|
|
}
|
|
this._setLineDash(ctx, styleOverride.cornerDashArray || this.cornerDashArray);
|
|
this.setCoords();
|
|
if (this.group) {
|
|
// fabricJS does not really support drawing controls inside groups,
|
|
// this piece of code here helps having at least the control in places.
|
|
// If an application needs to show some objects as selected because of some UI state
|
|
// can still call Object._renderControls() on any object they desire, independently of groups.
|
|
// using no padding, circular controls and hiding the rotating cursor is higly suggested,
|
|
matrix = this.group.calcTransformMatrix();
|
|
}
|
|
this.forEachControl(function(control, key, fabricObject) {
|
|
p = fabricObject.oCoords[key];
|
|
if (control.getVisibility(fabricObject, key)) {
|
|
if (matrix) {
|
|
p = fabric.util.transformPoint(p, matrix);
|
|
}
|
|
control.render(ctx, p.x, p.y, styleOverride, fabricObject);
|
|
}
|
|
});
|
|
ctx.restore();
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns true if the specified control is visible, false otherwise.
|
|
* @param {String} controlKey The key of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'.
|
|
* @returns {Boolean} true if the specified control is visible, false otherwise
|
|
*/
|
|
isControlVisible: function(controlKey) {
|
|
return this.controls[controlKey] && this.controls[controlKey].getVisibility(this, controlKey);
|
|
},
|
|
|
|
/**
|
|
* Sets the visibility of the specified control.
|
|
* @param {String} controlKey The key of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'.
|
|
* @param {Boolean} visible true to set the specified control visible, false otherwise
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
setControlVisible: function(controlKey, visible) {
|
|
if (!this._controlsVisibility) {
|
|
this._controlsVisibility = {};
|
|
}
|
|
this._controlsVisibility[controlKey] = visible;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Sets the visibility state of object controls.
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} [options.bl] true to enable the bottom-left control, false to disable it
|
|
* @param {Boolean} [options.br] true to enable the bottom-right control, false to disable it
|
|
* @param {Boolean} [options.mb] true to enable the middle-bottom control, false to disable it
|
|
* @param {Boolean} [options.ml] true to enable the middle-left control, false to disable it
|
|
* @param {Boolean} [options.mr] true to enable the middle-right control, false to disable it
|
|
* @param {Boolean} [options.mt] true to enable the middle-top control, false to disable it
|
|
* @param {Boolean} [options.tl] true to enable the top-left control, false to disable it
|
|
* @param {Boolean} [options.tr] true to enable the top-right control, false to disable it
|
|
* @param {Boolean} [options.mtr] true to enable the middle-top-rotate control, false to disable it
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
setControlsVisibility: function(options) {
|
|
options || (options = { });
|
|
|
|
for (var p in options) {
|
|
this.setControlVisible(p, options[p]);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
|
|
/**
|
|
* This callback function is called every time _discardActiveObject or _setActiveObject
|
|
* try to to deselect this object. If the function returns true, the process is cancelled
|
|
* @param {Object} [options] options sent from the upper functions
|
|
* @param {Event} [options.e] event if the process is generated by an event
|
|
*/
|
|
onDeselect: function() {
|
|
// implemented by sub-classes, as needed.
|
|
},
|
|
|
|
|
|
/**
|
|
* This callback function is called every time _discardActiveObject or _setActiveObject
|
|
* try to to select this object. If the function returns true, the process is cancelled
|
|
* @param {Object} [options] options sent from the upper functions
|
|
* @param {Event} [options.e] event if the process is generated by an event
|
|
*/
|
|
onSelect: function() {
|
|
// implemented by sub-classes, as needed.
|
|
}
|
|
});
|
|
})();
|
|
|
|
|
|
fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Animation duration (in ms) for fx* methods
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
FX_DURATION: 500,
|
|
|
|
/**
|
|
* Centers object horizontally with animation.
|
|
* @param {fabric.Object} object Object to center
|
|
* @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties
|
|
* @param {Function} [callbacks.onComplete] Invoked on completion
|
|
* @param {Function} [callbacks.onChange] Invoked on every step of animation
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxCenterObjectH: function (object, callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: object.left,
|
|
endValue: this.getCenter().left,
|
|
duration: this.FX_DURATION,
|
|
onChange: function(value) {
|
|
object.set('left', value);
|
|
_this.requestRenderAll();
|
|
onChange();
|
|
},
|
|
onComplete: function() {
|
|
object.setCoords();
|
|
onComplete();
|
|
}
|
|
});
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Centers object vertically with animation.
|
|
* @param {fabric.Object} object Object to center
|
|
* @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties
|
|
* @param {Function} [callbacks.onComplete] Invoked on completion
|
|
* @param {Function} [callbacks.onChange] Invoked on every step of animation
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxCenterObjectV: function (object, callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: object.top,
|
|
endValue: this.getCenter().top,
|
|
duration: this.FX_DURATION,
|
|
onChange: function(value) {
|
|
object.set('top', value);
|
|
_this.requestRenderAll();
|
|
onChange();
|
|
},
|
|
onComplete: function() {
|
|
object.setCoords();
|
|
onComplete();
|
|
}
|
|
});
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Same as `fabric.Canvas#remove` but animated
|
|
* @param {fabric.Object} object Object to remove
|
|
* @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties
|
|
* @param {Function} [callbacks.onComplete] Invoked on completion
|
|
* @param {Function} [callbacks.onChange] Invoked on every step of animation
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxRemove: function (object, callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: object.opacity,
|
|
endValue: 0,
|
|
duration: this.FX_DURATION,
|
|
onChange: function(value) {
|
|
object.set('opacity', value);
|
|
_this.requestRenderAll();
|
|
onChange();
|
|
},
|
|
onComplete: function () {
|
|
_this.remove(object);
|
|
onComplete();
|
|
}
|
|
});
|
|
|
|
return this;
|
|
}
|
|
});
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
/**
|
|
* Animates object's properties
|
|
* @param {String|Object} property Property to animate (if string) or properties to animate (if object)
|
|
* @param {Number|Object} value Value to animate property to (if string was given first) or options object
|
|
* @return {fabric.Object} thisArg
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-2#animation}
|
|
* @chainable
|
|
*
|
|
* As object — multiple properties
|
|
*
|
|
* object.animate({ left: ..., top: ... });
|
|
* object.animate({ left: ..., top: ... }, { duration: ... });
|
|
*
|
|
* As string — one property
|
|
*
|
|
* object.animate('left', ...);
|
|
* object.animate('left', { duration: ... });
|
|
*
|
|
*/
|
|
animate: function() {
|
|
if (arguments[0] && typeof arguments[0] === 'object') {
|
|
var propsToAnimate = [], prop, skipCallbacks;
|
|
for (prop in arguments[0]) {
|
|
propsToAnimate.push(prop);
|
|
}
|
|
for (var i = 0, len = propsToAnimate.length; i < len; i++) {
|
|
prop = propsToAnimate[i];
|
|
skipCallbacks = i !== len - 1;
|
|
this._animate(prop, arguments[0][prop], arguments[1], skipCallbacks);
|
|
}
|
|
}
|
|
else {
|
|
this._animate.apply(this, arguments);
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} property Property to animate
|
|
* @param {String} to Value to animate to
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} [skipCallbacks] When true, callbacks like onchange and oncomplete are not invoked
|
|
*/
|
|
_animate: function(property, to, options, skipCallbacks) {
|
|
var _this = this, propPair;
|
|
|
|
to = to.toString();
|
|
|
|
if (!options) {
|
|
options = { };
|
|
}
|
|
else {
|
|
options = fabric.util.object.clone(options);
|
|
}
|
|
|
|
if (~property.indexOf('.')) {
|
|
propPair = property.split('.');
|
|
}
|
|
|
|
var propIsColor =
|
|
_this.colorProperties.indexOf(property) > -1 ||
|
|
(propPair && _this.colorProperties.indexOf(propPair[1]) > -1);
|
|
|
|
var currentValue = propPair
|
|
? this.get(propPair[0])[propPair[1]]
|
|
: this.get(property);
|
|
|
|
if (!('from' in options)) {
|
|
options.from = currentValue;
|
|
}
|
|
|
|
if (!propIsColor) {
|
|
if (~to.indexOf('=')) {
|
|
to = currentValue + parseFloat(to.replace('=', ''));
|
|
}
|
|
else {
|
|
to = parseFloat(to);
|
|
}
|
|
}
|
|
|
|
var _options = {
|
|
startValue: options.from,
|
|
endValue: to,
|
|
byValue: options.by,
|
|
easing: options.easing,
|
|
duration: options.duration,
|
|
abort: options.abort && function(value, valueProgress, timeProgress) {
|
|
return options.abort.call(_this, value, valueProgress, timeProgress);
|
|
},
|
|
onChange: function (value, valueProgress, timeProgress) {
|
|
if (propPair) {
|
|
_this[propPair[0]][propPair[1]] = value;
|
|
}
|
|
else {
|
|
_this.set(property, value);
|
|
}
|
|
if (skipCallbacks) {
|
|
return;
|
|
}
|
|
options.onChange && options.onChange(value, valueProgress, timeProgress);
|
|
},
|
|
onComplete: function (value, valueProgress, timeProgress) {
|
|
if (skipCallbacks) {
|
|
return;
|
|
}
|
|
|
|
_this.setCoords();
|
|
options.onComplete && options.onComplete(value, valueProgress, timeProgress);
|
|
}
|
|
};
|
|
|
|
if (propIsColor) {
|
|
return fabric.util.animateColor(_options.startValue, _options.endValue, _options.duration, _options);
|
|
}
|
|
else {
|
|
return fabric.util.animate(_options);
|
|
}
|
|
}
|
|
});
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
clone = fabric.util.object.clone,
|
|
coordProps = { x1: 1, x2: 1, y1: 1, y2: 1 };
|
|
|
|
if (fabric.Line) {
|
|
fabric.warn('fabric.Line is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Line class
|
|
* @class fabric.Line
|
|
* @extends fabric.Object
|
|
* @see {@link fabric.Line#initialize} for constructor definition
|
|
*/
|
|
fabric.Line = fabric.util.createClass(fabric.Object, /** @lends fabric.Line.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'line',
|
|
|
|
/**
|
|
* x value or first line edge
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
x1: 0,
|
|
|
|
/**
|
|
* y value or first line edge
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
y1: 0,
|
|
|
|
/**
|
|
* x value or second line edge
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
x2: 0,
|
|
|
|
/**
|
|
* y value or second line edge
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
y2: 0,
|
|
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat('x1', 'x2', 'y1', 'y2'),
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array} [points] Array of points
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Line} thisArg
|
|
*/
|
|
initialize: function(points, options) {
|
|
if (!points) {
|
|
points = [0, 0, 0, 0];
|
|
}
|
|
|
|
this.callSuper('initialize', options);
|
|
|
|
this.set('x1', points[0]);
|
|
this.set('y1', points[1]);
|
|
this.set('x2', points[2]);
|
|
this.set('y2', points[3]);
|
|
|
|
this._setWidthHeight(options);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [options] Options
|
|
*/
|
|
_setWidthHeight: function(options) {
|
|
options || (options = { });
|
|
|
|
this.width = Math.abs(this.x2 - this.x1);
|
|
this.height = Math.abs(this.y2 - this.y1);
|
|
|
|
this.left = 'left' in options
|
|
? options.left
|
|
: this._getLeftToOriginX();
|
|
|
|
this.top = 'top' in options
|
|
? options.top
|
|
: this._getTopToOriginY();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} key
|
|
* @param {*} value
|
|
*/
|
|
_set: function(key, value) {
|
|
this.callSuper('_set', key, value);
|
|
if (typeof coordProps[key] !== 'undefined') {
|
|
this._setWidthHeight();
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @return {Number} leftToOriginX Distance from left edge of canvas to originX of Line.
|
|
*/
|
|
_getLeftToOriginX: makeEdgeToOriginGetter(
|
|
{ // property names
|
|
origin: 'originX',
|
|
axis1: 'x1',
|
|
axis2: 'x2',
|
|
dimension: 'width'
|
|
},
|
|
{ // possible values of origin
|
|
nearest: 'left',
|
|
center: 'center',
|
|
farthest: 'right'
|
|
}
|
|
),
|
|
|
|
/**
|
|
* @private
|
|
* @return {Number} topToOriginY Distance from top edge of canvas to originY of Line.
|
|
*/
|
|
_getTopToOriginY: makeEdgeToOriginGetter(
|
|
{ // property names
|
|
origin: 'originY',
|
|
axis1: 'y1',
|
|
axis2: 'y2',
|
|
dimension: 'height'
|
|
},
|
|
{ // possible values of origin
|
|
nearest: 'top',
|
|
center: 'center',
|
|
farthest: 'bottom'
|
|
}
|
|
),
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
ctx.beginPath();
|
|
|
|
|
|
var p = this.calcLinePoints();
|
|
ctx.moveTo(p.x1, p.y1);
|
|
ctx.lineTo(p.x2, p.y2);
|
|
|
|
ctx.lineWidth = this.strokeWidth;
|
|
|
|
// TODO: test this
|
|
// make sure setting "fill" changes color of a line
|
|
// (by copying fillStyle to strokeStyle, since line is stroked, not filled)
|
|
var origStrokeStyle = ctx.strokeStyle;
|
|
ctx.strokeStyle = this.stroke || ctx.fillStyle;
|
|
this.stroke && this._renderStroke(ctx);
|
|
ctx.strokeStyle = origStrokeStyle;
|
|
},
|
|
|
|
/**
|
|
* This function is an helper for svg import. it returns the center of the object in the svg
|
|
* untransformed coordinates
|
|
* @private
|
|
* @return {Object} center point from element coordinates
|
|
*/
|
|
_findCenterFromElement: function() {
|
|
return {
|
|
x: (this.x1 + this.x2) / 2,
|
|
y: (this.y1 + this.y2) / 2,
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @method toObject
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), this.calcLinePoints());
|
|
},
|
|
|
|
/*
|
|
* Calculate object dimensions from its properties
|
|
* @private
|
|
*/
|
|
_getNonTransformedDimensions: function() {
|
|
var dim = this.callSuper('_getNonTransformedDimensions');
|
|
if (this.strokeLineCap === 'butt') {
|
|
if (this.width === 0) {
|
|
dim.y -= this.strokeWidth;
|
|
}
|
|
if (this.height === 0) {
|
|
dim.x -= this.strokeWidth;
|
|
}
|
|
}
|
|
return dim;
|
|
},
|
|
|
|
/**
|
|
* Recalculates line points given width and height
|
|
* @private
|
|
*/
|
|
calcLinePoints: function() {
|
|
var xMult = this.x1 <= this.x2 ? -1 : 1,
|
|
yMult = this.y1 <= this.y2 ? -1 : 1,
|
|
x1 = (xMult * this.width * 0.5),
|
|
y1 = (yMult * this.height * 0.5),
|
|
x2 = (xMult * this.width * -0.5),
|
|
y2 = (yMult * this.height * -0.5);
|
|
|
|
return {
|
|
x1: x1,
|
|
x2: x2,
|
|
y1: y1,
|
|
y2: y2
|
|
};
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
var p = this.calcLinePoints();
|
|
return [
|
|
'<line ', 'COMMON_PARTS',
|
|
'x1="', p.x1,
|
|
'" y1="', p.y1,
|
|
'" x2="', p.x2,
|
|
'" y2="', p.y2,
|
|
'" />\n'
|
|
];
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
});
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Line.fromElement})
|
|
* @static
|
|
* @memberOf fabric.Line
|
|
* @see http://www.w3.org/TR/SVG/shapes.html#LineElement
|
|
*/
|
|
fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x1 y1 x2 y2'.split(' '));
|
|
|
|
/**
|
|
* Returns fabric.Line instance from an SVG element
|
|
* @static
|
|
* @memberOf fabric.Line
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @param {Function} [callback] callback function invoked after parsing
|
|
*/
|
|
fabric.Line.fromElement = function(element, callback, options) {
|
|
options = options || { };
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES),
|
|
points = [
|
|
parsedAttributes.x1 || 0,
|
|
parsedAttributes.y1 || 0,
|
|
parsedAttributes.x2 || 0,
|
|
parsedAttributes.y2 || 0
|
|
];
|
|
callback(new fabric.Line(points, extend(parsedAttributes, options)));
|
|
};
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Returns fabric.Line instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Line
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] invoked with new instance as first argument
|
|
*/
|
|
fabric.Line.fromObject = function(object, callback) {
|
|
function _callback(instance) {
|
|
delete instance.points;
|
|
callback && callback(instance);
|
|
};
|
|
var options = clone(object, true);
|
|
options.points = [object.x1, object.y1, object.x2, object.y2];
|
|
fabric.Object._fromObject('Line', options, _callback, 'points');
|
|
};
|
|
|
|
/**
|
|
* Produces a function that calculates distance from canvas edge to Line origin.
|
|
*/
|
|
function makeEdgeToOriginGetter(propertyNames, originValues) {
|
|
var origin = propertyNames.origin,
|
|
axis1 = propertyNames.axis1,
|
|
axis2 = propertyNames.axis2,
|
|
dimension = propertyNames.dimension,
|
|
nearest = originValues.nearest,
|
|
center = originValues.center,
|
|
farthest = originValues.farthest;
|
|
|
|
return function() {
|
|
switch (this.get(origin)) {
|
|
case nearest:
|
|
return Math.min(this.get(axis1), this.get(axis2));
|
|
case center:
|
|
return Math.min(this.get(axis1), this.get(axis2)) + (0.5 * this.get(dimension));
|
|
case farthest:
|
|
return Math.max(this.get(axis1), this.get(axis2));
|
|
}
|
|
};
|
|
|
|
}
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
pi = Math.PI;
|
|
|
|
if (fabric.Circle) {
|
|
fabric.warn('fabric.Circle is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Circle class
|
|
* @class fabric.Circle
|
|
* @extends fabric.Object
|
|
* @see {@link fabric.Circle#initialize} for constructor definition
|
|
*/
|
|
fabric.Circle = fabric.util.createClass(fabric.Object, /** @lends fabric.Circle.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'circle',
|
|
|
|
/**
|
|
* Radius of this circle
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
radius: 0,
|
|
|
|
/**
|
|
* Start angle of the circle, moving clockwise
|
|
* deprecated type, this should be in degree, this was an oversight.
|
|
* probably will change to degrees in next major version
|
|
* @type Number
|
|
* @default 0
|
|
*/
|
|
startAngle: 0,
|
|
|
|
/**
|
|
* End angle of the circle
|
|
* deprecated type, this should be in degree, this was an oversight.
|
|
* probably will change to degrees in next major version
|
|
* @type Number
|
|
* @default 2Pi
|
|
*/
|
|
endAngle: pi * 2,
|
|
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat('radius', 'startAngle', 'endAngle'),
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} key
|
|
* @param {*} value
|
|
* @return {fabric.Circle} thisArg
|
|
*/
|
|
_set: function(key, value) {
|
|
this.callSuper('_set', key, value);
|
|
|
|
if (key === 'radius') {
|
|
this.setRadius(value);
|
|
}
|
|
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return this.callSuper('toObject', ['radius', 'startAngle', 'endAngle'].concat(propertiesToInclude));
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
var svgString, x = 0, y = 0,
|
|
angle = (this.endAngle - this.startAngle) % ( 2 * pi);
|
|
|
|
if (angle === 0) {
|
|
svgString = [
|
|
'<circle ', 'COMMON_PARTS',
|
|
'cx="' + x + '" cy="' + y + '" ',
|
|
'r="', this.radius,
|
|
'" />\n'
|
|
];
|
|
}
|
|
else {
|
|
var startX = fabric.util.cos(this.startAngle) * this.radius,
|
|
startY = fabric.util.sin(this.startAngle) * this.radius,
|
|
endX = fabric.util.cos(this.endAngle) * this.radius,
|
|
endY = fabric.util.sin(this.endAngle) * this.radius,
|
|
largeFlag = angle > pi ? '1' : '0';
|
|
svgString = [
|
|
'<path d="M ' + startX + ' ' + startY,
|
|
' A ' + this.radius + ' ' + this.radius,
|
|
' 0 ', +largeFlag + ' 1', ' ' + endX + ' ' + endY,
|
|
'" ', 'COMMON_PARTS', ' />\n'
|
|
];
|
|
}
|
|
return svgString;
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
ctx.beginPath();
|
|
ctx.arc(
|
|
0,
|
|
0,
|
|
this.radius,
|
|
this.startAngle,
|
|
this.endAngle, false);
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
|
|
/**
|
|
* Returns horizontal radius of an object (according to how an object is scaled)
|
|
* @return {Number}
|
|
*/
|
|
getRadiusX: function() {
|
|
return this.get('radius') * this.get('scaleX');
|
|
},
|
|
|
|
/**
|
|
* Returns vertical radius of an object (according to how an object is scaled)
|
|
* @return {Number}
|
|
*/
|
|
getRadiusY: function() {
|
|
return this.get('radius') * this.get('scaleY');
|
|
},
|
|
|
|
/**
|
|
* Sets radius of an object (and updates width accordingly)
|
|
* @return {fabric.Circle} thisArg
|
|
*/
|
|
setRadius: function(value) {
|
|
this.radius = value;
|
|
return this.set('width', value * 2).set('height', value * 2);
|
|
},
|
|
});
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Circle.fromElement})
|
|
* @static
|
|
* @memberOf fabric.Circle
|
|
* @see: http://www.w3.org/TR/SVG/shapes.html#CircleElement
|
|
*/
|
|
fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy r'.split(' '));
|
|
|
|
/**
|
|
* Returns {@link fabric.Circle} instance from an SVG element
|
|
* @static
|
|
* @memberOf fabric.Circle
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Function} [callback] Options callback invoked after parsing is finished
|
|
* @param {Object} [options] Options object
|
|
* @throws {Error} If value of `r` attribute is missing or invalid
|
|
*/
|
|
fabric.Circle.fromElement = function(element, callback) {
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES);
|
|
|
|
if (!isValidRadius(parsedAttributes)) {
|
|
throw new Error('value of `r` attribute is required and can not be negative');
|
|
}
|
|
|
|
parsedAttributes.left = (parsedAttributes.left || 0) - parsedAttributes.radius;
|
|
parsedAttributes.top = (parsedAttributes.top || 0) - parsedAttributes.radius;
|
|
callback(new fabric.Circle(parsedAttributes));
|
|
};
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
function isValidRadius(attributes) {
|
|
return (('radius' in attributes) && (attributes.radius >= 0));
|
|
}
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Returns {@link fabric.Circle} instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Circle
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] invoked with new instance as first argument
|
|
* @return {void}
|
|
*/
|
|
fabric.Circle.fromObject = function(object, callback) {
|
|
fabric.Object._fromObject('Circle', object, callback);
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Triangle) {
|
|
fabric.warn('fabric.Triangle is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Triangle class
|
|
* @class fabric.Triangle
|
|
* @extends fabric.Object
|
|
* @return {fabric.Triangle} thisArg
|
|
* @see {@link fabric.Triangle#initialize} for constructor definition
|
|
*/
|
|
fabric.Triangle = fabric.util.createClass(fabric.Object, /** @lends fabric.Triangle.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'triangle',
|
|
|
|
/**
|
|
* Width is set to 100 to compensate the old initialize code that was setting it to 100
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
width: 100,
|
|
|
|
/**
|
|
* Height is set to 100 to compensate the old initialize code that was setting it to 100
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
height: 100,
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
var widthBy2 = this.width / 2,
|
|
heightBy2 = this.height / 2;
|
|
|
|
ctx.beginPath();
|
|
ctx.moveTo(-widthBy2, heightBy2);
|
|
ctx.lineTo(0, -heightBy2);
|
|
ctx.lineTo(widthBy2, heightBy2);
|
|
ctx.closePath();
|
|
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
var widthBy2 = this.width / 2,
|
|
heightBy2 = this.height / 2,
|
|
points = [
|
|
-widthBy2 + ' ' + heightBy2,
|
|
'0 ' + -heightBy2,
|
|
widthBy2 + ' ' + heightBy2
|
|
].join(',');
|
|
return [
|
|
'<polygon ', 'COMMON_PARTS',
|
|
'points="', points,
|
|
'" />'
|
|
];
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
});
|
|
|
|
/**
|
|
* Returns {@link fabric.Triangle} instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Triangle
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] invoked with new instance as first argument
|
|
*/
|
|
fabric.Triangle.fromObject = function(object, callback) {
|
|
return fabric.Object._fromObject('Triangle', object, callback);
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
piBy2 = Math.PI * 2;
|
|
|
|
if (fabric.Ellipse) {
|
|
fabric.warn('fabric.Ellipse is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Ellipse class
|
|
* @class fabric.Ellipse
|
|
* @extends fabric.Object
|
|
* @return {fabric.Ellipse} thisArg
|
|
* @see {@link fabric.Ellipse#initialize} for constructor definition
|
|
*/
|
|
fabric.Ellipse = fabric.util.createClass(fabric.Object, /** @lends fabric.Ellipse.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'ellipse',
|
|
|
|
/**
|
|
* Horizontal radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
rx: 0,
|
|
|
|
/**
|
|
* Vertical radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
ry: 0,
|
|
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat('rx', 'ry'),
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Ellipse} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
this.callSuper('initialize', options);
|
|
this.set('rx', options && options.rx || 0);
|
|
this.set('ry', options && options.ry || 0);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} key
|
|
* @param {*} value
|
|
* @return {fabric.Ellipse} thisArg
|
|
*/
|
|
_set: function(key, value) {
|
|
this.callSuper('_set', key, value);
|
|
switch (key) {
|
|
|
|
case 'rx':
|
|
this.rx = value;
|
|
this.set('width', value * 2);
|
|
break;
|
|
|
|
case 'ry':
|
|
this.ry = value;
|
|
this.set('height', value * 2);
|
|
break;
|
|
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns horizontal radius of an object (according to how an object is scaled)
|
|
* @return {Number}
|
|
*/
|
|
getRx: function() {
|
|
return this.get('rx') * this.get('scaleX');
|
|
},
|
|
|
|
/**
|
|
* Returns Vertical radius of an object (according to how an object is scaled)
|
|
* @return {Number}
|
|
*/
|
|
getRy: function() {
|
|
return this.get('ry') * this.get('scaleY');
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return this.callSuper('toObject', ['rx', 'ry'].concat(propertiesToInclude));
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
return [
|
|
'<ellipse ', 'COMMON_PARTS',
|
|
'cx="0" cy="0" ',
|
|
'rx="', this.rx,
|
|
'" ry="', this.ry,
|
|
'" />\n'
|
|
];
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
ctx.beginPath();
|
|
ctx.save();
|
|
ctx.transform(1, 0, 0, this.ry / this.rx, 0, 0);
|
|
ctx.arc(
|
|
0,
|
|
0,
|
|
this.rx,
|
|
0,
|
|
piBy2,
|
|
false);
|
|
ctx.restore();
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
});
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Ellipse.fromElement})
|
|
* @static
|
|
* @memberOf fabric.Ellipse
|
|
* @see http://www.w3.org/TR/SVG/shapes.html#EllipseElement
|
|
*/
|
|
fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy rx ry'.split(' '));
|
|
|
|
/**
|
|
* Returns {@link fabric.Ellipse} instance from an SVG element
|
|
* @static
|
|
* @memberOf fabric.Ellipse
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Function} [callback] Options callback invoked after parsing is finished
|
|
* @return {fabric.Ellipse}
|
|
*/
|
|
fabric.Ellipse.fromElement = function(element, callback) {
|
|
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES);
|
|
|
|
parsedAttributes.left = (parsedAttributes.left || 0) - parsedAttributes.rx;
|
|
parsedAttributes.top = (parsedAttributes.top || 0) - parsedAttributes.ry;
|
|
callback(new fabric.Ellipse(parsedAttributes));
|
|
};
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Returns {@link fabric.Ellipse} instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Ellipse
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] invoked with new instance as first argument
|
|
* @return {void}
|
|
*/
|
|
fabric.Ellipse.fromObject = function(object, callback) {
|
|
fabric.Object._fromObject('Ellipse', object, callback);
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend;
|
|
|
|
if (fabric.Rect) {
|
|
fabric.warn('fabric.Rect is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Rectangle class
|
|
* @class fabric.Rect
|
|
* @extends fabric.Object
|
|
* @return {fabric.Rect} thisArg
|
|
* @see {@link fabric.Rect#initialize} for constructor definition
|
|
*/
|
|
fabric.Rect = fabric.util.createClass(fabric.Object, /** @lends fabric.Rect.prototype */ {
|
|
|
|
/**
|
|
* List of properties to consider when checking if state of an object is changed ({@link fabric.Object#hasStateChanged})
|
|
* as well as for history (undo/redo) purposes
|
|
* @type Array
|
|
*/
|
|
stateProperties: fabric.Object.prototype.stateProperties.concat('rx', 'ry'),
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'rect',
|
|
|
|
/**
|
|
* Horizontal border radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
rx: 0,
|
|
|
|
/**
|
|
* Vertical border radius
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
ry: 0,
|
|
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat('rx', 'ry'),
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(options) {
|
|
this.callSuper('initialize', options);
|
|
this._initRxRy();
|
|
},
|
|
|
|
/**
|
|
* Initializes rx/ry attributes
|
|
* @private
|
|
*/
|
|
_initRxRy: function() {
|
|
if (this.rx && !this.ry) {
|
|
this.ry = this.rx;
|
|
}
|
|
else if (this.ry && !this.rx) {
|
|
this.rx = this.ry;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
|
|
// 1x1 case (used in spray brush) optimization was removed because
|
|
// with caching and higher zoom level this makes more damage than help
|
|
|
|
var rx = this.rx ? Math.min(this.rx, this.width / 2) : 0,
|
|
ry = this.ry ? Math.min(this.ry, this.height / 2) : 0,
|
|
w = this.width,
|
|
h = this.height,
|
|
x = -this.width / 2,
|
|
y = -this.height / 2,
|
|
isRounded = rx !== 0 || ry !== 0,
|
|
/* "magic number" for bezier approximations of arcs (http://itc.ktu.lt/itc354/Riskus354.pdf) */
|
|
k = 1 - 0.5522847498;
|
|
ctx.beginPath();
|
|
|
|
ctx.moveTo(x + rx, y);
|
|
|
|
ctx.lineTo(x + w - rx, y);
|
|
isRounded && ctx.bezierCurveTo(x + w - k * rx, y, x + w, y + k * ry, x + w, y + ry);
|
|
|
|
ctx.lineTo(x + w, y + h - ry);
|
|
isRounded && ctx.bezierCurveTo(x + w, y + h - k * ry, x + w - k * rx, y + h, x + w - rx, y + h);
|
|
|
|
ctx.lineTo(x + rx, y + h);
|
|
isRounded && ctx.bezierCurveTo(x + k * rx, y + h, x, y + h - k * ry, x, y + h - ry);
|
|
|
|
ctx.lineTo(x, y + ry);
|
|
isRounded && ctx.bezierCurveTo(x, y + k * ry, x + k * rx, y, x + rx, y);
|
|
|
|
ctx.closePath();
|
|
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return this.callSuper('toObject', ['rx', 'ry'].concat(propertiesToInclude));
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
var x = -this.width / 2, y = -this.height / 2;
|
|
return [
|
|
'<rect ', 'COMMON_PARTS',
|
|
'x="', x, '" y="', y,
|
|
'" rx="', this.rx, '" ry="', this.ry,
|
|
'" width="', this.width, '" height="', this.height,
|
|
'" />\n'
|
|
];
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
});
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by `fabric.Rect.fromElement`)
|
|
* @static
|
|
* @memberOf fabric.Rect
|
|
* @see: http://www.w3.org/TR/SVG/shapes.html#RectElement
|
|
*/
|
|
fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y rx ry width height'.split(' '));
|
|
|
|
/**
|
|
* Returns {@link fabric.Rect} instance from an SVG element
|
|
* @static
|
|
* @memberOf fabric.Rect
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Function} callback callback function invoked after parsing
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
fabric.Rect.fromElement = function(element, callback, options) {
|
|
if (!element) {
|
|
return callback(null);
|
|
}
|
|
options = options || { };
|
|
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES);
|
|
parsedAttributes.left = parsedAttributes.left || 0;
|
|
parsedAttributes.top = parsedAttributes.top || 0;
|
|
parsedAttributes.height = parsedAttributes.height || 0;
|
|
parsedAttributes.width = parsedAttributes.width || 0;
|
|
var rect = new fabric.Rect(extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes));
|
|
rect.visible = rect.visible && rect.width > 0 && rect.height > 0;
|
|
callback(rect);
|
|
};
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Returns {@link fabric.Rect} instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Rect
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] Callback to invoke when an fabric.Rect instance is created
|
|
*/
|
|
fabric.Rect.fromObject = function(object, callback) {
|
|
return fabric.Object._fromObject('Rect', object, callback);
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
min = fabric.util.array.min,
|
|
max = fabric.util.array.max,
|
|
toFixed = fabric.util.toFixed;
|
|
|
|
if (fabric.Polyline) {
|
|
fabric.warn('fabric.Polyline is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Polyline class
|
|
* @class fabric.Polyline
|
|
* @extends fabric.Object
|
|
* @see {@link fabric.Polyline#initialize} for constructor definition
|
|
*/
|
|
fabric.Polyline = fabric.util.createClass(fabric.Object, /** @lends fabric.Polyline.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'polyline',
|
|
|
|
/**
|
|
* Points array
|
|
* @type Array
|
|
* @default
|
|
*/
|
|
points: null,
|
|
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat('points'),
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array} points Array of points (where each point is an object with x and y)
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Polyline} thisArg
|
|
* @example
|
|
* var poly = new fabric.Polyline([
|
|
* { x: 10, y: 10 },
|
|
* { x: 50, y: 30 },
|
|
* { x: 40, y: 70 },
|
|
* { x: 60, y: 50 },
|
|
* { x: 100, y: 150 },
|
|
* { x: 40, y: 100 }
|
|
* ], {
|
|
* stroke: 'red',
|
|
* left: 100,
|
|
* top: 100
|
|
* });
|
|
*/
|
|
initialize: function(points, options) {
|
|
options = options || {};
|
|
this.points = points || [];
|
|
this.callSuper('initialize', options);
|
|
this._setPositionDimensions(options);
|
|
},
|
|
|
|
_setPositionDimensions: function(options) {
|
|
var calcDim = this._calcDimensions(options), correctLeftTop;
|
|
this.width = calcDim.width;
|
|
this.height = calcDim.height;
|
|
if (!options.fromSVG) {
|
|
correctLeftTop = this.translateToGivenOrigin(
|
|
{ x: calcDim.left - this.strokeWidth / 2, y: calcDim.top - this.strokeWidth / 2 },
|
|
'left',
|
|
'top',
|
|
this.originX,
|
|
this.originY
|
|
);
|
|
}
|
|
if (typeof options.left === 'undefined') {
|
|
this.left = options.fromSVG ? calcDim.left : correctLeftTop.x;
|
|
}
|
|
if (typeof options.top === 'undefined') {
|
|
this.top = options.fromSVG ? calcDim.top : correctLeftTop.y;
|
|
}
|
|
this.pathOffset = {
|
|
x: calcDim.left + this.width / 2,
|
|
y: calcDim.top + this.height / 2
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Calculate the polygon min and max point from points array,
|
|
* returning an object with left, top, width, height to measure the
|
|
* polygon size
|
|
* @return {Object} object.left X coordinate of the polygon leftmost point
|
|
* @return {Object} object.top Y coordinate of the polygon topmost point
|
|
* @return {Object} object.width distance between X coordinates of the polygon leftmost and rightmost point
|
|
* @return {Object} object.height distance between Y coordinates of the polygon topmost and bottommost point
|
|
* @private
|
|
*/
|
|
_calcDimensions: function() {
|
|
|
|
var points = this.points,
|
|
minX = min(points, 'x') || 0,
|
|
minY = min(points, 'y') || 0,
|
|
maxX = max(points, 'x') || 0,
|
|
maxY = max(points, 'y') || 0,
|
|
width = (maxX - minX),
|
|
height = (maxY - minY);
|
|
|
|
return {
|
|
left: minX,
|
|
top: minY,
|
|
width: width,
|
|
height: height
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
points: this.points.concat()
|
|
});
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
var points = [], diffX = this.pathOffset.x, diffY = this.pathOffset.y,
|
|
NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS;
|
|
|
|
for (var i = 0, len = this.points.length; i < len; i++) {
|
|
points.push(
|
|
toFixed(this.points[i].x - diffX, NUM_FRACTION_DIGITS), ',',
|
|
toFixed(this.points[i].y - diffY, NUM_FRACTION_DIGITS), ' '
|
|
);
|
|
}
|
|
return [
|
|
'<' + this.type + ' ', 'COMMON_PARTS',
|
|
'points="', points.join(''),
|
|
'" />\n'
|
|
];
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
commonRender: function(ctx) {
|
|
var point, len = this.points.length,
|
|
x = this.pathOffset.x,
|
|
y = this.pathOffset.y;
|
|
|
|
if (!len || isNaN(this.points[len - 1].y)) {
|
|
// do not draw if no points or odd points
|
|
// NaN comes from parseFloat of a empty string in parser
|
|
return false;
|
|
}
|
|
ctx.beginPath();
|
|
ctx.moveTo(this.points[0].x - x, this.points[0].y - y);
|
|
for (var i = 0; i < len; i++) {
|
|
point = this.points[i];
|
|
ctx.lineTo(point.x - x, point.y - y);
|
|
}
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
if (!this.commonRender(ctx)) {
|
|
return;
|
|
}
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity of this instance
|
|
*/
|
|
complexity: function() {
|
|
return this.get('points').length;
|
|
}
|
|
});
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Polyline.fromElement})
|
|
* @static
|
|
* @memberOf fabric.Polyline
|
|
* @see: http://www.w3.org/TR/SVG/shapes.html#PolylineElement
|
|
*/
|
|
fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat();
|
|
|
|
/**
|
|
* Returns fabric.Polyline instance from an SVG element
|
|
* @static
|
|
* @memberOf fabric.Polyline
|
|
* @param {SVGElement} element Element to parser
|
|
* @param {Function} callback callback function invoked after parsing
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
fabric.Polyline.fromElementGenerator = function(_class) {
|
|
return function(element, callback, options) {
|
|
if (!element) {
|
|
return callback(null);
|
|
}
|
|
options || (options = { });
|
|
|
|
var points = fabric.parsePointsAttribute(element.getAttribute('points')),
|
|
parsedAttributes = fabric.parseAttributes(element, fabric[_class].ATTRIBUTE_NAMES);
|
|
parsedAttributes.fromSVG = true;
|
|
callback(new fabric[_class](points, extend(parsedAttributes, options)));
|
|
};
|
|
};
|
|
|
|
fabric.Polyline.fromElement = fabric.Polyline.fromElementGenerator('Polyline');
|
|
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Returns fabric.Polyline instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Polyline
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] Callback to invoke when an fabric.Path instance is created
|
|
*/
|
|
fabric.Polyline.fromObject = function(object, callback) {
|
|
return fabric.Object._fromObject('Polyline', object, callback, 'points');
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.Polygon) {
|
|
fabric.warn('fabric.Polygon is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Polygon class
|
|
* @class fabric.Polygon
|
|
* @extends fabric.Polyline
|
|
* @see {@link fabric.Polygon#initialize} for constructor definition
|
|
*/
|
|
fabric.Polygon = fabric.util.createClass(fabric.Polyline, /** @lends fabric.Polygon.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'polygon',
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
if (!this.commonRender(ctx)) {
|
|
return;
|
|
}
|
|
ctx.closePath();
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
|
|
});
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by `fabric.Polygon.fromElement`)
|
|
* @static
|
|
* @memberOf fabric.Polygon
|
|
* @see: http://www.w3.org/TR/SVG/shapes.html#PolygonElement
|
|
*/
|
|
fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat();
|
|
|
|
/**
|
|
* Returns {@link fabric.Polygon} instance from an SVG element
|
|
* @static
|
|
* @memberOf fabric.Polygon
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Function} callback callback function invoked after parsing
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
fabric.Polygon.fromElement = fabric.Polyline.fromElementGenerator('Polygon');
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Returns fabric.Polygon instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Polygon
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] Callback to invoke when an fabric.Path instance is created
|
|
* @return {void}
|
|
*/
|
|
fabric.Polygon.fromObject = function(object, callback) {
|
|
fabric.Object._fromObject('Polygon', object, callback, 'points');
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
min = fabric.util.array.min,
|
|
max = fabric.util.array.max,
|
|
extend = fabric.util.object.extend,
|
|
_toString = Object.prototype.toString,
|
|
toFixed = fabric.util.toFixed;
|
|
|
|
if (fabric.Path) {
|
|
fabric.warn('fabric.Path is already defined');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Path class
|
|
* @class fabric.Path
|
|
* @extends fabric.Object
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-1#path_and_pathgroup}
|
|
* @see {@link fabric.Path#initialize} for constructor definition
|
|
*/
|
|
fabric.Path = fabric.util.createClass(fabric.Object, /** @lends fabric.Path.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'path',
|
|
|
|
/**
|
|
* Array of path points
|
|
* @type Array
|
|
* @default
|
|
*/
|
|
path: null,
|
|
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat('path', 'fillRule'),
|
|
|
|
stateProperties: fabric.Object.prototype.stateProperties.concat('path'),
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array|String} path Path data (sequence of coordinates and corresponding "command" tokens)
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Path} thisArg
|
|
*/
|
|
initialize: function(path, options) {
|
|
options = options || { };
|
|
this.callSuper('initialize', options);
|
|
if (!path) {
|
|
path = [];
|
|
}
|
|
|
|
var fromArray = _toString.call(path) === '[object Array]';
|
|
|
|
this.path = fabric.util.makePathSimpler(
|
|
fromArray ? path : fabric.util.parsePath(path)
|
|
);
|
|
|
|
if (!this.path) {
|
|
return;
|
|
}
|
|
fabric.Polyline.prototype._setPositionDimensions.call(this, options);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx context to render path on
|
|
*/
|
|
_renderPathCommands: function(ctx) {
|
|
var current, // current instruction
|
|
subpathStartX = 0,
|
|
subpathStartY = 0,
|
|
x = 0, // current x
|
|
y = 0, // current y
|
|
controlX = 0, // current control point x
|
|
controlY = 0, // current control point y
|
|
l = -this.pathOffset.x,
|
|
t = -this.pathOffset.y;
|
|
|
|
ctx.beginPath();
|
|
|
|
for (var i = 0, len = this.path.length; i < len; ++i) {
|
|
|
|
current = this.path[i];
|
|
|
|
switch (current[0]) { // first letter
|
|
|
|
case 'L': // lineto, absolute
|
|
x = current[1];
|
|
y = current[2];
|
|
ctx.lineTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'M': // moveTo, absolute
|
|
x = current[1];
|
|
y = current[2];
|
|
subpathStartX = x;
|
|
subpathStartY = y;
|
|
ctx.moveTo(x + l, y + t);
|
|
break;
|
|
|
|
case 'C': // bezierCurveTo, absolute
|
|
x = current[5];
|
|
y = current[6];
|
|
controlX = current[3];
|
|
controlY = current[4];
|
|
ctx.bezierCurveTo(
|
|
current[1] + l,
|
|
current[2] + t,
|
|
controlX + l,
|
|
controlY + t,
|
|
x + l,
|
|
y + t
|
|
);
|
|
break;
|
|
|
|
case 'Q': // quadraticCurveTo, absolute
|
|
ctx.quadraticCurveTo(
|
|
current[1] + l,
|
|
current[2] + t,
|
|
current[3] + l,
|
|
current[4] + t
|
|
);
|
|
x = current[3];
|
|
y = current[4];
|
|
controlX = current[1];
|
|
controlY = current[2];
|
|
break;
|
|
|
|
case 'z':
|
|
case 'Z':
|
|
x = subpathStartX;
|
|
y = subpathStartY;
|
|
ctx.closePath();
|
|
break;
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx context to render path on
|
|
*/
|
|
_render: function(ctx) {
|
|
this._renderPathCommands(ctx);
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of an instance
|
|
* @return {String} string representation of an instance
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Path (' + this.complexity() +
|
|
'): { "top": ' + this.top + ', "left": ' + this.left + ' }>';
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return extend(this.callSuper('toObject', propertiesToInclude), {
|
|
path: this.path.map(function(item) { return item.slice(); }),
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Returns dataless object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toDatalessObject: function(propertiesToInclude) {
|
|
var o = this.toObject(['sourcePath'].concat(propertiesToInclude));
|
|
if (o.sourcePath) {
|
|
delete o.path;
|
|
}
|
|
return o;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
var path = fabric.util.joinPath(this.path);
|
|
return [
|
|
'<path ', 'COMMON_PARTS',
|
|
'd="', path,
|
|
'" stroke-linecap="round" ',
|
|
'/>\n'
|
|
];
|
|
},
|
|
|
|
_getOffsetTransform: function() {
|
|
var digits = fabric.Object.NUM_FRACTION_DIGITS;
|
|
return ' translate(' + toFixed(-this.pathOffset.x, digits) + ', ' +
|
|
toFixed(-this.pathOffset.y, digits) + ')';
|
|
},
|
|
|
|
/**
|
|
* Returns svg clipPath representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toClipPathSVG: function(reviver) {
|
|
var additionalTransform = this._getOffsetTransform();
|
|
return '\t' + this._createBaseClipPathSVGMarkup(
|
|
this._toSVG(), { reviver: reviver, additionalTransform: additionalTransform }
|
|
);
|
|
},
|
|
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function(reviver) {
|
|
var additionalTransform = this._getOffsetTransform();
|
|
return this._createBaseSVGMarkup(this._toSVG(), { reviver: reviver, additionalTransform: additionalTransform });
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns number representation of an instance complexity
|
|
* @return {Number} complexity of this instance
|
|
*/
|
|
complexity: function() {
|
|
return this.path.length;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_calcDimensions: function() {
|
|
|
|
var aX = [],
|
|
aY = [],
|
|
current, // current instruction
|
|
subpathStartX = 0,
|
|
subpathStartY = 0,
|
|
x = 0, // current x
|
|
y = 0, // current y
|
|
bounds;
|
|
|
|
for (var i = 0, len = this.path.length; i < len; ++i) {
|
|
|
|
current = this.path[i];
|
|
|
|
switch (current[0]) { // first letter
|
|
|
|
case 'L': // lineto, absolute
|
|
x = current[1];
|
|
y = current[2];
|
|
bounds = [];
|
|
break;
|
|
|
|
case 'M': // moveTo, absolute
|
|
x = current[1];
|
|
y = current[2];
|
|
subpathStartX = x;
|
|
subpathStartY = y;
|
|
bounds = [];
|
|
break;
|
|
|
|
case 'C': // bezierCurveTo, absolute
|
|
bounds = fabric.util.getBoundsOfCurve(x, y,
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4],
|
|
current[5],
|
|
current[6]
|
|
);
|
|
x = current[5];
|
|
y = current[6];
|
|
break;
|
|
|
|
case 'Q': // quadraticCurveTo, absolute
|
|
bounds = fabric.util.getBoundsOfCurve(x, y,
|
|
current[1],
|
|
current[2],
|
|
current[1],
|
|
current[2],
|
|
current[3],
|
|
current[4]
|
|
);
|
|
x = current[3];
|
|
y = current[4];
|
|
break;
|
|
|
|
case 'z':
|
|
case 'Z':
|
|
x = subpathStartX;
|
|
y = subpathStartY;
|
|
break;
|
|
}
|
|
bounds.forEach(function (point) {
|
|
aX.push(point.x);
|
|
aY.push(point.y);
|
|
});
|
|
aX.push(x);
|
|
aY.push(y);
|
|
}
|
|
|
|
var minX = min(aX) || 0,
|
|
minY = min(aY) || 0,
|
|
maxX = max(aX) || 0,
|
|
maxY = max(aY) || 0,
|
|
deltaX = maxX - minX,
|
|
deltaY = maxY - minY;
|
|
|
|
return {
|
|
left: minX,
|
|
top: minY,
|
|
width: deltaX,
|
|
height: deltaY
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Creates an instance of fabric.Path from an object
|
|
* @static
|
|
* @memberOf fabric.Path
|
|
* @param {Object} object
|
|
* @param {Function} [callback] Callback to invoke when an fabric.Path instance is created
|
|
*/
|
|
fabric.Path.fromObject = function(object, callback) {
|
|
if (typeof object.sourcePath === 'string') {
|
|
var pathUrl = object.sourcePath;
|
|
fabric.loadSVGFromURL(pathUrl, function (elements) {
|
|
var path = elements[0];
|
|
path.setOptions(object);
|
|
callback && callback(path);
|
|
});
|
|
}
|
|
else {
|
|
fabric.Object._fromObject('Path', object, callback, 'path');
|
|
}
|
|
};
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by `fabric.Path.fromElement`)
|
|
* @static
|
|
* @memberOf fabric.Path
|
|
* @see http://www.w3.org/TR/SVG/paths.html#PathElement
|
|
*/
|
|
fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(['d']);
|
|
|
|
/**
|
|
* Creates an instance of fabric.Path from an SVG <path> element
|
|
* @static
|
|
* @memberOf fabric.Path
|
|
* @param {SVGElement} element to parse
|
|
* @param {Function} callback Callback to invoke when an fabric.Path instance is created
|
|
* @param {Object} [options] Options object
|
|
* @param {Function} [callback] Options callback invoked after parsing is finished
|
|
*/
|
|
fabric.Path.fromElement = function(element, callback, options) {
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES);
|
|
parsedAttributes.fromSVG = true;
|
|
callback(new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options)));
|
|
};
|
|
/* _FROM_SVG_END_ */
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
min = fabric.util.array.min,
|
|
max = fabric.util.array.max;
|
|
|
|
if (fabric.Group) {
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Group class
|
|
* @class fabric.Group
|
|
* @extends fabric.Object
|
|
* @mixes fabric.Collection
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-3#groups}
|
|
* @see {@link fabric.Group#initialize} for constructor definition
|
|
*/
|
|
fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, /** @lends fabric.Group.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'group',
|
|
|
|
/**
|
|
* Width of stroke
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeWidth: 0,
|
|
|
|
/**
|
|
* Indicates if click, mouseover, mouseout events & hoverCursor should also check for subtargets
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
subTargetCheck: false,
|
|
|
|
/**
|
|
* Groups are container, do not render anything on theyr own, ence no cache properties
|
|
* @type Array
|
|
* @default
|
|
*/
|
|
cacheProperties: [],
|
|
|
|
/**
|
|
* setOnGroup is a method used for TextBox that is no more used since 2.0.0 The behavior is still
|
|
* available setting this boolean to true.
|
|
* @type Boolean
|
|
* @since 2.0.0
|
|
* @default
|
|
*/
|
|
useSetOnGroup: false,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} objects Group objects
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} [isAlreadyGrouped] if true, objects have been grouped already.
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(objects, options, isAlreadyGrouped) {
|
|
options = options || {};
|
|
this._objects = [];
|
|
// if objects enclosed in a group have been grouped already,
|
|
// we cannot change properties of objects.
|
|
// Thus we need to set options to group without objects,
|
|
isAlreadyGrouped && this.callSuper('initialize', options);
|
|
this._objects = objects || [];
|
|
for (var i = this._objects.length; i--; ) {
|
|
this._objects[i].group = this;
|
|
}
|
|
|
|
if (!isAlreadyGrouped) {
|
|
var center = options && options.centerPoint;
|
|
// we want to set origins before calculating the bounding box.
|
|
// so that the topleft can be set with that in mind.
|
|
// if specific top and left are passed, are overwritten later
|
|
// with the callSuper('initialize', options)
|
|
if (options.originX !== undefined) {
|
|
this.originX = options.originX;
|
|
}
|
|
if (options.originY !== undefined) {
|
|
this.originY = options.originY;
|
|
}
|
|
// if coming from svg i do not want to calc bounds.
|
|
// i assume width and height are passed along options
|
|
center || this._calcBounds();
|
|
this._updateObjectsCoords(center);
|
|
delete options.centerPoint;
|
|
this.callSuper('initialize', options);
|
|
}
|
|
else {
|
|
this._updateObjectsACoords();
|
|
}
|
|
|
|
this.setCoords();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_updateObjectsACoords: function() {
|
|
var skipControls = true;
|
|
for (var i = this._objects.length; i--; ){
|
|
this._objects[i].setCoords(skipControls);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Boolean} [skipCoordsChange] if true, coordinates of objects enclosed in a group do not change
|
|
*/
|
|
_updateObjectsCoords: function(center) {
|
|
var center = center || this.getCenterPoint();
|
|
for (var i = this._objects.length; i--; ){
|
|
this._updateObjectCoords(this._objects[i], center);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} object
|
|
* @param {fabric.Point} center, current center of group.
|
|
*/
|
|
_updateObjectCoords: function(object, center) {
|
|
var objectLeft = object.left,
|
|
objectTop = object.top,
|
|
skipControls = true;
|
|
|
|
object.set({
|
|
left: objectLeft - center.x,
|
|
top: objectTop - center.y
|
|
});
|
|
object.group = this;
|
|
object.setCoords(skipControls);
|
|
},
|
|
|
|
/**
|
|
* Returns string represenation of a group
|
|
* @return {String}
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Group: (' + this.complexity() + ')>';
|
|
},
|
|
|
|
/**
|
|
* Adds an object to a group; Then recalculates group's dimension, position.
|
|
* @param {Object} object
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
addWithUpdate: function(object) {
|
|
var nested = !!this.group;
|
|
this._restoreObjectsState();
|
|
fabric.util.resetObjectTransform(this);
|
|
if (object) {
|
|
if (nested) {
|
|
// if this group is inside another group, we need to pre transform the object
|
|
fabric.util.removeTransformFromObject(object, this.group.calcTransformMatrix());
|
|
}
|
|
this._objects.push(object);
|
|
object.group = this;
|
|
object._set('canvas', this.canvas);
|
|
}
|
|
this._calcBounds();
|
|
this._updateObjectsCoords();
|
|
this.dirty = true;
|
|
if (nested) {
|
|
this.group.addWithUpdate();
|
|
}
|
|
else {
|
|
this.setCoords();
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Removes an object from a group; Then recalculates group's dimension, position.
|
|
* @param {Object} object
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
removeWithUpdate: function(object) {
|
|
this._restoreObjectsState();
|
|
fabric.util.resetObjectTransform(this);
|
|
|
|
this.remove(object);
|
|
this._calcBounds();
|
|
this._updateObjectsCoords();
|
|
this.setCoords();
|
|
this.dirty = true;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onObjectAdded: function(object) {
|
|
this.dirty = true;
|
|
object.group = this;
|
|
object._set('canvas', this.canvas);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onObjectRemoved: function(object) {
|
|
this.dirty = true;
|
|
delete object.group;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_set: function(key, value) {
|
|
var i = this._objects.length;
|
|
if (this.useSetOnGroup) {
|
|
while (i--) {
|
|
this._objects[i].setOnGroup(key, value);
|
|
}
|
|
}
|
|
if (key === 'canvas') {
|
|
while (i--) {
|
|
this._objects[i]._set(key, value);
|
|
}
|
|
}
|
|
fabric.Object.prototype._set.call(this, key, value);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
var _includeDefaultValues = this.includeDefaultValues;
|
|
var objsToObject = this._objects
|
|
.filter(function (obj) {
|
|
return !obj.excludeFromExport;
|
|
})
|
|
.map(function (obj) {
|
|
var originalDefaults = obj.includeDefaultValues;
|
|
obj.includeDefaultValues = _includeDefaultValues;
|
|
var _obj = obj.toObject(propertiesToInclude);
|
|
obj.includeDefaultValues = originalDefaults;
|
|
return _obj;
|
|
});
|
|
var obj = fabric.Object.prototype.toObject.call(this, propertiesToInclude);
|
|
obj.objects = objsToObject;
|
|
return obj;
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance, in dataless mode.
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toDatalessObject: function(propertiesToInclude) {
|
|
var objsToObject, sourcePath = this.sourcePath;
|
|
if (sourcePath) {
|
|
objsToObject = sourcePath;
|
|
}
|
|
else {
|
|
var _includeDefaultValues = this.includeDefaultValues;
|
|
objsToObject = this._objects.map(function(obj) {
|
|
var originalDefaults = obj.includeDefaultValues;
|
|
obj.includeDefaultValues = _includeDefaultValues;
|
|
var _obj = obj.toDatalessObject(propertiesToInclude);
|
|
obj.includeDefaultValues = originalDefaults;
|
|
return _obj;
|
|
});
|
|
}
|
|
var obj = fabric.Object.prototype.toDatalessObject.call(this, propertiesToInclude);
|
|
obj.objects = objsToObject;
|
|
return obj;
|
|
},
|
|
|
|
/**
|
|
* Renders instance on a given context
|
|
* @param {CanvasRenderingContext2D} ctx context to render instance on
|
|
*/
|
|
render: function(ctx) {
|
|
this._transformDone = true;
|
|
this.callSuper('render', ctx);
|
|
this._transformDone = false;
|
|
},
|
|
|
|
/**
|
|
* Decide if the object should cache or not. Create its own cache level
|
|
* needsItsOwnCache should be used when the object drawing method requires
|
|
* a cache step. None of the fabric classes requires it.
|
|
* Generally you do not cache objects in groups because the group is already cached.
|
|
* @return {Boolean}
|
|
*/
|
|
shouldCache: function() {
|
|
var ownCache = fabric.Object.prototype.shouldCache.call(this);
|
|
if (ownCache) {
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
if (this._objects[i].willDrawShadow()) {
|
|
this.ownCaching = false;
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return ownCache;
|
|
},
|
|
|
|
/**
|
|
* Check if this object or a child object will cast a shadow
|
|
* @return {Boolean}
|
|
*/
|
|
willDrawShadow: function() {
|
|
if (fabric.Object.prototype.willDrawShadow.call(this)) {
|
|
return true;
|
|
}
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
if (this._objects[i].willDrawShadow()) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Check if this group or its parent group are caching, recursively up
|
|
* @return {Boolean}
|
|
*/
|
|
isOnACache: function() {
|
|
return this.ownCaching || (this.group && this.group.isOnACache());
|
|
},
|
|
|
|
/**
|
|
* Execute the drawing operation for an object on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
drawObject: function(ctx) {
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
this._objects[i].render(ctx);
|
|
}
|
|
this._drawClipPath(ctx);
|
|
},
|
|
|
|
/**
|
|
* Check if cache is dirty
|
|
*/
|
|
isCacheDirty: function(skipCanvas) {
|
|
if (this.callSuper('isCacheDirty', skipCanvas)) {
|
|
return true;
|
|
}
|
|
if (!this.statefullCache) {
|
|
return false;
|
|
}
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
if (this._objects[i].isCacheDirty(true)) {
|
|
if (this._cacheCanvas) {
|
|
// if this group has not a cache canvas there is nothing to clean
|
|
var x = this.cacheWidth / this.zoomX, y = this.cacheHeight / this.zoomY;
|
|
this._cacheContext.clearRect(-x / 2, -y / 2, x, y);
|
|
}
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Restores original state of each of group objects (original state is that which was before group was created).
|
|
* if the nested boolean is true, the original state will be restored just for the
|
|
* first group and not for all the group chain
|
|
* @private
|
|
* @param {Boolean} nested tell the function to restore object state up to the parent group and not more
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
_restoreObjectsState: function() {
|
|
var groupMatrix = this.calcOwnMatrix();
|
|
this._objects.forEach(function(object) {
|
|
// instead of using _this = this;
|
|
fabric.util.addTransformToObject(object, groupMatrix);
|
|
delete object.group;
|
|
object.setCoords();
|
|
});
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Realises the transform from this group onto the supplied object
|
|
* i.e. it tells you what would happen if the supplied object was in
|
|
* the group, and then the group was destroyed. It mutates the supplied
|
|
* object.
|
|
* Warning: this method is not useful anymore, it has been kept to no break the api.
|
|
* is not used in the fabricJS codebase
|
|
* this method will be reduced to using the utility.
|
|
* @private
|
|
* @deprecated
|
|
* @param {fabric.Object} object
|
|
* @param {Array} parentMatrix parent transformation
|
|
* @return {fabric.Object} transformedObject
|
|
*/
|
|
realizeTransform: function(object, parentMatrix) {
|
|
fabric.util.addTransformToObject(object, parentMatrix);
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Destroys a group (restoring state of its objects)
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
destroy: function() {
|
|
// when group is destroyed objects needs to get a repaint to be eventually
|
|
// displayed on canvas.
|
|
this._objects.forEach(function(object) {
|
|
object.set('dirty', true);
|
|
});
|
|
return this._restoreObjectsState();
|
|
},
|
|
|
|
/**
|
|
* make a group an active selection, remove the group from canvas
|
|
* the group has to be on canvas for this to work.
|
|
* @return {fabric.ActiveSelection} thisArg
|
|
* @chainable
|
|
*/
|
|
toActiveSelection: function() {
|
|
if (!this.canvas) {
|
|
return;
|
|
}
|
|
var objects = this._objects, canvas = this.canvas;
|
|
this._objects = [];
|
|
var options = this.toObject();
|
|
delete options.objects;
|
|
var activeSelection = new fabric.ActiveSelection([]);
|
|
activeSelection.set(options);
|
|
activeSelection.type = 'activeSelection';
|
|
canvas.remove(this);
|
|
objects.forEach(function(object) {
|
|
object.group = activeSelection;
|
|
object.dirty = true;
|
|
canvas.add(object);
|
|
});
|
|
activeSelection.canvas = canvas;
|
|
activeSelection._objects = objects;
|
|
canvas._activeObject = activeSelection;
|
|
activeSelection.setCoords();
|
|
return activeSelection;
|
|
},
|
|
|
|
/**
|
|
* Destroys a group (restoring state of its objects)
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
ungroupOnCanvas: function() {
|
|
return this._restoreObjectsState();
|
|
},
|
|
|
|
/**
|
|
* Sets coordinates of all objects inside group
|
|
* @return {fabric.Group} thisArg
|
|
* @chainable
|
|
*/
|
|
setObjectsCoords: function() {
|
|
var skipControls = true;
|
|
this.forEachObject(function(object) {
|
|
object.setCoords(skipControls);
|
|
});
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_calcBounds: function(onlyWidthHeight) {
|
|
var aX = [],
|
|
aY = [],
|
|
o, prop, coords,
|
|
props = ['tr', 'br', 'bl', 'tl'],
|
|
i = 0, iLen = this._objects.length,
|
|
j, jLen = props.length;
|
|
|
|
for ( ; i < iLen; ++i) {
|
|
o = this._objects[i];
|
|
coords = o.calcACoords();
|
|
for (j = 0; j < jLen; j++) {
|
|
prop = props[j];
|
|
aX.push(coords[prop].x);
|
|
aY.push(coords[prop].y);
|
|
}
|
|
o.aCoords = coords;
|
|
}
|
|
|
|
this._getBounds(aX, aY, onlyWidthHeight);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getBounds: function(aX, aY, onlyWidthHeight) {
|
|
var minXY = new fabric.Point(min(aX), min(aY)),
|
|
maxXY = new fabric.Point(max(aX), max(aY)),
|
|
top = minXY.y || 0, left = minXY.x || 0,
|
|
width = (maxXY.x - minXY.x) || 0,
|
|
height = (maxXY.y - minXY.y) || 0;
|
|
this.width = width;
|
|
this.height = height;
|
|
if (!onlyWidthHeight) {
|
|
// the bounding box always finds the topleft most corner.
|
|
// whatever is the group origin, we set up here the left/top position.
|
|
this.setPositionByOrigin({ x: left, y: top }, 'left', 'top');
|
|
}
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
_toSVG: function(reviver) {
|
|
var svgString = ['<g ', 'COMMON_PARTS', ' >\n'];
|
|
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
svgString.push('\t\t', this._objects[i].toSVG(reviver));
|
|
}
|
|
svgString.push('</g>\n');
|
|
return svgString;
|
|
},
|
|
|
|
/**
|
|
* Returns styles-string for svg-export, specific version for group
|
|
* @return {String}
|
|
*/
|
|
getSvgStyles: function() {
|
|
var opacity = typeof this.opacity !== 'undefined' && this.opacity !== 1 ?
|
|
'opacity: ' + this.opacity + ';' : '',
|
|
visibility = this.visible ? '' : ' visibility: hidden;';
|
|
return [
|
|
opacity,
|
|
this.getSvgFilter(),
|
|
visibility
|
|
].join('');
|
|
},
|
|
|
|
/**
|
|
* Returns svg clipPath representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toClipPathSVG: function(reviver) {
|
|
var svgString = [];
|
|
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
svgString.push('\t', this._objects[i].toClipPathSVG(reviver));
|
|
}
|
|
|
|
return this._createBaseClipPathSVGMarkup(svgString, { reviver: reviver });
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
});
|
|
|
|
/**
|
|
* Returns {@link fabric.Group} instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Group
|
|
* @param {Object} object Object to create a group from
|
|
* @param {Function} [callback] Callback to invoke when an group instance is created
|
|
*/
|
|
fabric.Group.fromObject = function(object, callback) {
|
|
var objects = object.objects,
|
|
options = fabric.util.object.clone(object, true);
|
|
delete options.objects;
|
|
if (typeof objects === 'string') {
|
|
// it has to be an url or something went wrong.
|
|
fabric.loadSVGFromURL(objects, function (elements) {
|
|
var group = fabric.util.groupSVGElements(elements, object, objects);
|
|
group.set(options);
|
|
callback && callback(group);
|
|
});
|
|
return;
|
|
}
|
|
fabric.util.enlivenObjects(objects, function(enlivenedObjects) {
|
|
fabric.util.enlivenObjects([object.clipPath], function(enlivedClipPath) {
|
|
var options = fabric.util.object.clone(object, true);
|
|
options.clipPath = enlivedClipPath[0];
|
|
delete options.objects;
|
|
callback && callback(new fabric.Group(enlivenedObjects, options, true));
|
|
});
|
|
});
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { });
|
|
|
|
if (fabric.ActiveSelection) {
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Group class
|
|
* @class fabric.ActiveSelection
|
|
* @extends fabric.Group
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-3#groups}
|
|
* @see {@link fabric.ActiveSelection#initialize} for constructor definition
|
|
*/
|
|
fabric.ActiveSelection = fabric.util.createClass(fabric.Group, /** @lends fabric.ActiveSelection.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'activeSelection',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} objects ActiveSelection objects
|
|
* @param {Object} [options] Options object
|
|
* @return {Object} thisArg
|
|
*/
|
|
initialize: function(objects, options) {
|
|
options = options || {};
|
|
this._objects = objects || [];
|
|
for (var i = this._objects.length; i--; ) {
|
|
this._objects[i].group = this;
|
|
}
|
|
|
|
if (options.originX) {
|
|
this.originX = options.originX;
|
|
}
|
|
if (options.originY) {
|
|
this.originY = options.originY;
|
|
}
|
|
this._calcBounds();
|
|
this._updateObjectsCoords();
|
|
fabric.Object.prototype.initialize.call(this, options);
|
|
this.setCoords();
|
|
},
|
|
|
|
/**
|
|
* Change te activeSelection to a normal group,
|
|
* High level function that automatically adds it to canvas as
|
|
* active object. no events fired.
|
|
* @since 2.0.0
|
|
* @return {fabric.Group}
|
|
*/
|
|
toGroup: function() {
|
|
var objects = this._objects.concat();
|
|
this._objects = [];
|
|
var options = fabric.Object.prototype.toObject.call(this);
|
|
var newGroup = new fabric.Group([]);
|
|
delete options.type;
|
|
newGroup.set(options);
|
|
objects.forEach(function(object) {
|
|
object.canvas.remove(object);
|
|
object.group = newGroup;
|
|
});
|
|
newGroup._objects = objects;
|
|
if (!this.canvas) {
|
|
return newGroup;
|
|
}
|
|
var canvas = this.canvas;
|
|
canvas.add(newGroup);
|
|
canvas._activeObject = newGroup;
|
|
newGroup.setCoords();
|
|
return newGroup;
|
|
},
|
|
|
|
/**
|
|
* If returns true, deselection is cancelled.
|
|
* @since 2.0.0
|
|
* @return {Boolean} [cancel]
|
|
*/
|
|
onDeselect: function() {
|
|
this.destroy();
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of a group
|
|
* @return {String}
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.ActiveSelection: (' + this.complexity() + ')>';
|
|
},
|
|
|
|
/**
|
|
* Decide if the object should cache or not. Create its own cache level
|
|
* objectCaching is a global flag, wins over everything
|
|
* needsItsOwnCache should be used when the object drawing method requires
|
|
* a cache step. None of the fabric classes requires it.
|
|
* Generally you do not cache objects in groups because the group outside is cached.
|
|
* @return {Boolean}
|
|
*/
|
|
shouldCache: function() {
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Check if this group or its parent group are caching, recursively up
|
|
* @return {Boolean}
|
|
*/
|
|
isOnACache: function() {
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Renders controls and borders for the object
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Object} [styleOverride] properties to override the object style
|
|
* @param {Object} [childrenOverride] properties to override the children overrides
|
|
*/
|
|
_renderControls: function(ctx, styleOverride, childrenOverride) {
|
|
ctx.save();
|
|
ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1;
|
|
this.callSuper('_renderControls', ctx, styleOverride);
|
|
childrenOverride = childrenOverride || { };
|
|
if (typeof childrenOverride.hasControls === 'undefined') {
|
|
childrenOverride.hasControls = false;
|
|
}
|
|
childrenOverride.forActiveSelection = true;
|
|
for (var i = 0, len = this._objects.length; i < len; i++) {
|
|
this._objects[i]._renderControls(ctx, childrenOverride);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns {@link fabric.ActiveSelection} instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.ActiveSelection
|
|
* @param {Object} object Object to create a group from
|
|
* @param {Function} [callback] Callback to invoke when an ActiveSelection instance is created
|
|
*/
|
|
fabric.ActiveSelection.fromObject = function(object, callback) {
|
|
fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) {
|
|
delete object.objects;
|
|
callback && callback(new fabric.ActiveSelection(enlivenedObjects, object, true));
|
|
});
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var extend = fabric.util.object.extend;
|
|
|
|
if (!global.fabric) {
|
|
global.fabric = { };
|
|
}
|
|
|
|
if (global.fabric.Image) {
|
|
fabric.warn('fabric.Image is already defined.');
|
|
return;
|
|
}
|
|
|
|
/**
|
|
* Image class
|
|
* @class fabric.Image
|
|
* @extends fabric.Object
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-1#images}
|
|
* @see {@link fabric.Image#initialize} for constructor definition
|
|
*/
|
|
fabric.Image = fabric.util.createClass(fabric.Object, /** @lends fabric.Image.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'image',
|
|
|
|
/**
|
|
* Width of a stroke.
|
|
* For image quality a stroke multiple of 2 gives better results.
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
strokeWidth: 0,
|
|
|
|
/**
|
|
* When calling {@link fabric.Image.getSrc}, return value from element src with `element.getAttribute('src')`.
|
|
* This allows for relative urls as image src.
|
|
* @since 2.7.0
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
srcFromAttribute: false,
|
|
|
|
/**
|
|
* private
|
|
* contains last value of scaleX to detect
|
|
* if the Image got resized after the last Render
|
|
* @type Number
|
|
*/
|
|
_lastScaleX: 1,
|
|
|
|
/**
|
|
* private
|
|
* contains last value of scaleY to detect
|
|
* if the Image got resized after the last Render
|
|
* @type Number
|
|
*/
|
|
_lastScaleY: 1,
|
|
|
|
/**
|
|
* private
|
|
* contains last value of scaling applied by the apply filter chain
|
|
* @type Number
|
|
*/
|
|
_filterScalingX: 1,
|
|
|
|
/**
|
|
* private
|
|
* contains last value of scaling applied by the apply filter chain
|
|
* @type Number
|
|
*/
|
|
_filterScalingY: 1,
|
|
|
|
/**
|
|
* minimum scale factor under which any resizeFilter is triggered to resize the image
|
|
* 0 will disable the automatic resize. 1 will trigger automatically always.
|
|
* number bigger than 1 are not implemented yet.
|
|
* @type Number
|
|
*/
|
|
minimumScaleTrigger: 0.5,
|
|
|
|
/**
|
|
* List of properties to consider when checking if
|
|
* state of an object is changed ({@link fabric.Object#hasStateChanged})
|
|
* as well as for history (undo/redo) purposes
|
|
* @type Array
|
|
*/
|
|
stateProperties: fabric.Object.prototype.stateProperties.concat('cropX', 'cropY'),
|
|
|
|
/**
|
|
* List of properties to consider when checking if cache needs refresh
|
|
* Those properties are checked by statefullCache ON ( or lazy mode if we want ) or from single
|
|
* calls to Object.set(key, value). If the key is in this list, the object is marked as dirty
|
|
* and refreshed at the next render
|
|
* @type Array
|
|
*/
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat('cropX', 'cropY'),
|
|
|
|
/**
|
|
* key used to retrieve the texture representing this image
|
|
* @since 2.0.0
|
|
* @type String
|
|
* @default
|
|
*/
|
|
cacheKey: '',
|
|
|
|
/**
|
|
* Image crop in pixels from original image size.
|
|
* @since 2.0.0
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
cropX: 0,
|
|
|
|
/**
|
|
* Image crop in pixels from original image size.
|
|
* @since 2.0.0
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
cropY: 0,
|
|
|
|
/**
|
|
* Indicates whether this canvas will use image smoothing when painting this image.
|
|
* Also influence if the cacheCanvas for this image uses imageSmoothing
|
|
* @since 4.0.0-beta.11
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
imageSmoothing: true,
|
|
|
|
/**
|
|
* Constructor
|
|
* Image can be initialized with any canvas drawable or a string.
|
|
* The string should be a url and will be loaded as an image.
|
|
* Canvas and Image element work out of the box, while videos require extra code to work.
|
|
* Please check video element events for seeking.
|
|
* @param {HTMLImageElement | HTMLCanvasElement | HTMLVideoElement | String} element Image element
|
|
* @param {Object} [options] Options object
|
|
* @param {function} [callback] callback function to call after eventual filters applied.
|
|
* @return {fabric.Image} thisArg
|
|
*/
|
|
initialize: function(element, options) {
|
|
options || (options = { });
|
|
this.filters = [];
|
|
this.cacheKey = 'texture' + fabric.Object.__uid++;
|
|
this.callSuper('initialize', options);
|
|
this._initElement(element, options);
|
|
},
|
|
|
|
/**
|
|
* Returns image element which this instance if based on
|
|
* @return {HTMLImageElement} Image element
|
|
*/
|
|
getElement: function() {
|
|
return this._element || {};
|
|
},
|
|
|
|
/**
|
|
* Sets image element for this instance to a specified one.
|
|
* If filters defined they are applied to new image.
|
|
* You might need to call `canvas.renderAll` and `object.setCoords` after replacing, to render new image and update controls area.
|
|
* @param {HTMLImageElement} element
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Image} thisArg
|
|
* @chainable
|
|
*/
|
|
setElement: function(element, options) {
|
|
this.removeTexture(this.cacheKey);
|
|
this.removeTexture(this.cacheKey + '_filtered');
|
|
this._element = element;
|
|
this._originalElement = element;
|
|
this._initConfig(options);
|
|
if (this.filters.length !== 0) {
|
|
this.applyFilters();
|
|
}
|
|
// resizeFilters work on the already filtered copy.
|
|
// we need to apply resizeFilters AFTER normal filters.
|
|
// applyResizeFilters is run more often than normal filters
|
|
// and is triggered by user interactions rather than dev code
|
|
if (this.resizeFilter) {
|
|
this.applyResizeFilters();
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Delete a single texture if in webgl mode
|
|
*/
|
|
removeTexture: function(key) {
|
|
var backend = fabric.filterBackend;
|
|
if (backend && backend.evictCachesForKey) {
|
|
backend.evictCachesForKey(key);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Delete textures, reference to elements and eventually JSDOM cleanup
|
|
*/
|
|
dispose: function() {
|
|
this.removeTexture(this.cacheKey);
|
|
this.removeTexture(this.cacheKey + '_filtered');
|
|
this._cacheContext = undefined;
|
|
['_originalElement', '_element', '_filteredEl', '_cacheCanvas'].forEach((function(element) {
|
|
fabric.util.cleanUpJsdomNode(this[element]);
|
|
this[element] = undefined;
|
|
}).bind(this));
|
|
},
|
|
|
|
/**
|
|
* Get the crossOrigin value (of the corresponding image element)
|
|
*/
|
|
getCrossOrigin: function() {
|
|
return this._originalElement && (this._originalElement.crossOrigin || null);
|
|
},
|
|
|
|
/**
|
|
* Returns original size of an image
|
|
* @return {Object} Object with "width" and "height" properties
|
|
*/
|
|
getOriginalSize: function() {
|
|
var element = this.getElement();
|
|
return {
|
|
width: element.naturalWidth || element.width,
|
|
height: element.naturalHeight || element.height
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_stroke: function(ctx) {
|
|
if (!this.stroke || this.strokeWidth === 0) {
|
|
return;
|
|
}
|
|
var w = this.width / 2, h = this.height / 2;
|
|
ctx.beginPath();
|
|
ctx.moveTo(-w, -h);
|
|
ctx.lineTo(w, -h);
|
|
ctx.lineTo(w, h);
|
|
ctx.lineTo(-w, h);
|
|
ctx.lineTo(-w, -h);
|
|
ctx.closePath();
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
var filters = [];
|
|
|
|
this.filters.forEach(function(filterObj) {
|
|
if (filterObj) {
|
|
filters.push(filterObj.toObject());
|
|
}
|
|
});
|
|
var object = extend(
|
|
this.callSuper(
|
|
'toObject',
|
|
['cropX', 'cropY'].concat(propertiesToInclude)
|
|
), {
|
|
src: this.getSrc(),
|
|
crossOrigin: this.getCrossOrigin(),
|
|
filters: filters,
|
|
});
|
|
if (this.resizeFilter) {
|
|
object.resizeFilter = this.resizeFilter.toObject();
|
|
}
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Returns true if an image has crop applied, inspecting values of cropX,cropY,width,height.
|
|
* @return {Boolean}
|
|
*/
|
|
hasCrop: function() {
|
|
return this.cropX || this.cropY || this.width < this._element.width || this.height < this._element.height;
|
|
},
|
|
|
|
/* _TO_SVG_START_ */
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @return {Array} an array of strings with the specific svg representation
|
|
* of the instance
|
|
*/
|
|
_toSVG: function() {
|
|
var svgString = [], imageMarkup = [], strokeSvg, element = this._element,
|
|
x = -this.width / 2, y = -this.height / 2, clipPath = '', imageRendering = '';
|
|
if (!element) {
|
|
return [];
|
|
}
|
|
if (this.hasCrop()) {
|
|
var clipPathId = fabric.Object.__uid++;
|
|
svgString.push(
|
|
'<clipPath id="imageCrop_' + clipPathId + '">\n',
|
|
'\t<rect x="' + x + '" y="' + y + '" width="' + this.width + '" height="' + this.height + '" />\n',
|
|
'</clipPath>\n'
|
|
);
|
|
clipPath = ' clip-path="url(#imageCrop_' + clipPathId + ')" ';
|
|
}
|
|
if (!this.imageSmoothing) {
|
|
imageRendering = '" image-rendering="optimizeSpeed';
|
|
}
|
|
imageMarkup.push('\t<image ', 'COMMON_PARTS', 'xlink:href="', this.getSvgSrc(true),
|
|
'" x="', x - this.cropX, '" y="', y - this.cropY,
|
|
// we're essentially moving origin of transformation from top/left corner to the center of the shape
|
|
// by wrapping it in container <g> element with actual transformation, then offsetting object to the top/left
|
|
// so that object's center aligns with container's left/top
|
|
'" width="', element.width || element.naturalWidth,
|
|
'" height="', element.height || element.height,
|
|
imageRendering,
|
|
'"', clipPath,
|
|
'></image>\n');
|
|
|
|
if (this.stroke || this.strokeDashArray) {
|
|
var origFill = this.fill;
|
|
this.fill = null;
|
|
strokeSvg = [
|
|
'\t<rect ',
|
|
'x="', x, '" y="', y,
|
|
'" width="', this.width, '" height="', this.height,
|
|
'" style="', this.getSvgStyles(),
|
|
'"/>\n'
|
|
];
|
|
this.fill = origFill;
|
|
}
|
|
if (this.paintFirst !== 'fill') {
|
|
svgString = svgString.concat(strokeSvg, imageMarkup);
|
|
}
|
|
else {
|
|
svgString = svgString.concat(imageMarkup, strokeSvg);
|
|
}
|
|
return svgString;
|
|
},
|
|
/* _TO_SVG_END_ */
|
|
|
|
/**
|
|
* Returns source of an image
|
|
* @param {Boolean} filtered indicates if the src is needed for svg
|
|
* @return {String} Source of an image
|
|
*/
|
|
getSrc: function(filtered) {
|
|
var element = filtered ? this._element : this._originalElement;
|
|
if (element) {
|
|
if (element.toDataURL) {
|
|
return element.toDataURL();
|
|
}
|
|
|
|
if (this.srcFromAttribute) {
|
|
return element.getAttribute('src');
|
|
}
|
|
else {
|
|
return element.src;
|
|
}
|
|
}
|
|
else {
|
|
return this.src || '';
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Sets source of an image
|
|
* @param {String} src Source string (URL)
|
|
* @param {Function} [callback] Callback is invoked when image has been loaded (and all filters have been applied)
|
|
* @param {Object} [options] Options object
|
|
* @param {String} [options.crossOrigin] crossOrigin value (one of "", "anonymous", "use-credentials")
|
|
* @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes
|
|
* @return {fabric.Image} thisArg
|
|
* @chainable
|
|
*/
|
|
setSrc: function(src, callback, options) {
|
|
fabric.util.loadImage(src, function(img, isError) {
|
|
this.setElement(img, options);
|
|
this._setWidthHeight();
|
|
callback && callback(this, isError);
|
|
}, this, options && options.crossOrigin);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of an instance
|
|
* @return {String} String representation of an instance
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Image: { src: "' + this.getSrc() + '" }>';
|
|
},
|
|
|
|
applyResizeFilters: function() {
|
|
var filter = this.resizeFilter,
|
|
minimumScale = this.minimumScaleTrigger,
|
|
objectScale = this.getTotalObjectScaling(),
|
|
scaleX = objectScale.scaleX,
|
|
scaleY = objectScale.scaleY,
|
|
elementToFilter = this._filteredEl || this._originalElement;
|
|
if (this.group) {
|
|
this.set('dirty', true);
|
|
}
|
|
if (!filter || (scaleX > minimumScale && scaleY > minimumScale)) {
|
|
this._element = elementToFilter;
|
|
this._filterScalingX = 1;
|
|
this._filterScalingY = 1;
|
|
this._lastScaleX = scaleX;
|
|
this._lastScaleY = scaleY;
|
|
return;
|
|
}
|
|
if (!fabric.filterBackend) {
|
|
fabric.filterBackend = fabric.initFilterBackend();
|
|
}
|
|
var canvasEl = fabric.util.createCanvasElement(),
|
|
cacheKey = this._filteredEl ? (this.cacheKey + '_filtered') : this.cacheKey,
|
|
sourceWidth = elementToFilter.width, sourceHeight = elementToFilter.height;
|
|
canvasEl.width = sourceWidth;
|
|
canvasEl.height = sourceHeight;
|
|
this._element = canvasEl;
|
|
this._lastScaleX = filter.scaleX = scaleX;
|
|
this._lastScaleY = filter.scaleY = scaleY;
|
|
fabric.filterBackend.applyFilters(
|
|
[filter], elementToFilter, sourceWidth, sourceHeight, this._element, cacheKey);
|
|
this._filterScalingX = canvasEl.width / this._originalElement.width;
|
|
this._filterScalingY = canvasEl.height / this._originalElement.height;
|
|
},
|
|
|
|
/**
|
|
* Applies filters assigned to this image (from "filters" array) or from filter param
|
|
* @method applyFilters
|
|
* @param {Array} filters to be applied
|
|
* @param {Boolean} forResizing specify if the filter operation is a resize operation
|
|
* @return {thisArg} return the fabric.Image object
|
|
* @chainable
|
|
*/
|
|
applyFilters: function(filters) {
|
|
|
|
filters = filters || this.filters || [];
|
|
filters = filters.filter(function(filter) { return filter && !filter.isNeutralState(); });
|
|
this.set('dirty', true);
|
|
|
|
// needs to clear out or WEBGL will not resize correctly
|
|
this.removeTexture(this.cacheKey + '_filtered');
|
|
|
|
if (filters.length === 0) {
|
|
this._element = this._originalElement;
|
|
this._filteredEl = null;
|
|
this._filterScalingX = 1;
|
|
this._filterScalingY = 1;
|
|
return this;
|
|
}
|
|
|
|
var imgElement = this._originalElement,
|
|
sourceWidth = imgElement.naturalWidth || imgElement.width,
|
|
sourceHeight = imgElement.naturalHeight || imgElement.height;
|
|
|
|
if (this._element === this._originalElement) {
|
|
// if the element is the same we need to create a new element
|
|
var canvasEl = fabric.util.createCanvasElement();
|
|
canvasEl.width = sourceWidth;
|
|
canvasEl.height = sourceHeight;
|
|
this._element = canvasEl;
|
|
this._filteredEl = canvasEl;
|
|
}
|
|
else {
|
|
// clear the existing element to get new filter data
|
|
// also dereference the eventual resized _element
|
|
this._element = this._filteredEl;
|
|
this._filteredEl.getContext('2d').clearRect(0, 0, sourceWidth, sourceHeight);
|
|
// we also need to resize again at next renderAll, so remove saved _lastScaleX/Y
|
|
this._lastScaleX = 1;
|
|
this._lastScaleY = 1;
|
|
}
|
|
if (!fabric.filterBackend) {
|
|
fabric.filterBackend = fabric.initFilterBackend();
|
|
}
|
|
fabric.filterBackend.applyFilters(
|
|
filters, this._originalElement, sourceWidth, sourceHeight, this._element, this.cacheKey);
|
|
if (this._originalElement.width !== this._element.width ||
|
|
this._originalElement.height !== this._element.height) {
|
|
this._filterScalingX = this._element.width / this._originalElement.width;
|
|
this._filterScalingY = this._element.height / this._originalElement.height;
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
fabric.util.setImageSmoothing(ctx, this.imageSmoothing);
|
|
if (this.isMoving !== true && this.resizeFilter && this._needsResize()) {
|
|
this.applyResizeFilters();
|
|
}
|
|
this._stroke(ctx);
|
|
this._renderPaintInOrder(ctx);
|
|
},
|
|
|
|
/**
|
|
* Paint the cached copy of the object on the target context.
|
|
* it will set the imageSmoothing for the draw operation
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
drawCacheOnCanvas: function(ctx) {
|
|
fabric.util.setImageSmoothing(ctx, this.imageSmoothing);
|
|
fabric.Object.prototype.drawCacheOnCanvas.call(this, ctx);
|
|
},
|
|
|
|
/**
|
|
* Decide if the object should cache or not. Create its own cache level
|
|
* needsItsOwnCache should be used when the object drawing method requires
|
|
* a cache step. None of the fabric classes requires it.
|
|
* Generally you do not cache objects in groups because the group outside is cached.
|
|
* This is the special image version where we would like to avoid caching where possible.
|
|
* Essentially images do not benefit from caching. They may require caching, and in that
|
|
* case we do it. Also caching an image usually ends in a loss of details.
|
|
* A full performance audit should be done.
|
|
* @return {Boolean}
|
|
*/
|
|
shouldCache: function() {
|
|
return this.needsItsOwnCache();
|
|
},
|
|
|
|
_renderFill: function(ctx) {
|
|
var elementToDraw = this._element;
|
|
if (!elementToDraw) {
|
|
return;
|
|
}
|
|
var scaleX = this._filterScalingX, scaleY = this._filterScalingY,
|
|
w = this.width, h = this.height, min = Math.min, max = Math.max,
|
|
// crop values cannot be lesser than 0.
|
|
cropX = max(this.cropX, 0), cropY = max(this.cropY, 0),
|
|
elWidth = elementToDraw.naturalWidth || elementToDraw.width,
|
|
elHeight = elementToDraw.naturalHeight || elementToDraw.height,
|
|
sX = cropX * scaleX,
|
|
sY = cropY * scaleY,
|
|
// the width height cannot exceed element width/height, starting from the crop offset.
|
|
sW = min(w * scaleX, elWidth - sX),
|
|
sH = min(h * scaleY, elHeight - sY),
|
|
x = -w / 2, y = -h / 2,
|
|
maxDestW = min(w, elWidth / scaleX - cropX),
|
|
maxDestH = min(h, elHeight / scaleY - cropY);
|
|
|
|
elementToDraw && ctx.drawImage(elementToDraw, sX, sY, sW, sH, x, y, maxDestW, maxDestH);
|
|
},
|
|
|
|
/**
|
|
* needed to check if image needs resize
|
|
* @private
|
|
*/
|
|
_needsResize: function() {
|
|
var scale = this.getTotalObjectScaling();
|
|
return (scale.scaleX !== this._lastScaleX || scale.scaleY !== this._lastScaleY);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_resetWidthHeight: function() {
|
|
this.set(this.getOriginalSize());
|
|
},
|
|
|
|
/**
|
|
* The Image class's initialization method. This method is automatically
|
|
* called by the constructor.
|
|
* @private
|
|
* @param {HTMLImageElement|String} element The element representing the image
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
_initElement: function(element, options) {
|
|
this.setElement(fabric.util.getById(element), options);
|
|
fabric.util.addClass(this.getElement(), fabric.Image.CSS_CANVAS);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
_initConfig: function(options) {
|
|
options || (options = { });
|
|
this.setOptions(options);
|
|
this._setWidthHeight(options);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Array} filters to be initialized
|
|
* @param {Function} callback Callback to invoke when all fabric.Image.filters instances are created
|
|
*/
|
|
_initFilters: function(filters, callback) {
|
|
if (filters && filters.length) {
|
|
fabric.util.enlivenObjects(filters, function(enlivenedObjects) {
|
|
callback && callback(enlivenedObjects);
|
|
}, 'fabric.Image.filters');
|
|
}
|
|
else {
|
|
callback && callback();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* Set the width and the height of the image object, using the element or the
|
|
* options.
|
|
* @param {Object} [options] Object with width/height properties
|
|
*/
|
|
_setWidthHeight: function(options) {
|
|
options || (options = { });
|
|
var el = this.getElement();
|
|
this.width = options.width || el.naturalWidth || el.width || 0;
|
|
this.height = options.height || el.naturalHeight || el.height || 0;
|
|
},
|
|
|
|
/**
|
|
* Calculate offset for center and scale factor for the image in order to respect
|
|
* the preserveAspectRatio attribute
|
|
* @private
|
|
* @return {Object}
|
|
*/
|
|
parsePreserveAspectRatioAttribute: function() {
|
|
var pAR = fabric.util.parsePreserveAspectRatioAttribute(this.preserveAspectRatio || ''),
|
|
rWidth = this._element.width, rHeight = this._element.height,
|
|
scaleX = 1, scaleY = 1, offsetLeft = 0, offsetTop = 0, cropX = 0, cropY = 0,
|
|
offset, pWidth = this.width, pHeight = this.height, parsedAttributes = { width: pWidth, height: pHeight };
|
|
if (pAR && (pAR.alignX !== 'none' || pAR.alignY !== 'none')) {
|
|
if (pAR.meetOrSlice === 'meet') {
|
|
scaleX = scaleY = fabric.util.findScaleToFit(this._element, parsedAttributes);
|
|
offset = (pWidth - rWidth * scaleX) / 2;
|
|
if (pAR.alignX === 'Min') {
|
|
offsetLeft = -offset;
|
|
}
|
|
if (pAR.alignX === 'Max') {
|
|
offsetLeft = offset;
|
|
}
|
|
offset = (pHeight - rHeight * scaleY) / 2;
|
|
if (pAR.alignY === 'Min') {
|
|
offsetTop = -offset;
|
|
}
|
|
if (pAR.alignY === 'Max') {
|
|
offsetTop = offset;
|
|
}
|
|
}
|
|
if (pAR.meetOrSlice === 'slice') {
|
|
scaleX = scaleY = fabric.util.findScaleToCover(this._element, parsedAttributes);
|
|
offset = rWidth - pWidth / scaleX;
|
|
if (pAR.alignX === 'Mid') {
|
|
cropX = offset / 2;
|
|
}
|
|
if (pAR.alignX === 'Max') {
|
|
cropX = offset;
|
|
}
|
|
offset = rHeight - pHeight / scaleY;
|
|
if (pAR.alignY === 'Mid') {
|
|
cropY = offset / 2;
|
|
}
|
|
if (pAR.alignY === 'Max') {
|
|
cropY = offset;
|
|
}
|
|
rWidth = pWidth / scaleX;
|
|
rHeight = pHeight / scaleY;
|
|
}
|
|
}
|
|
else {
|
|
scaleX = pWidth / rWidth;
|
|
scaleY = pHeight / rHeight;
|
|
}
|
|
return {
|
|
width: rWidth,
|
|
height: rHeight,
|
|
scaleX: scaleX,
|
|
scaleY: scaleY,
|
|
offsetLeft: offsetLeft,
|
|
offsetTop: offsetTop,
|
|
cropX: cropX,
|
|
cropY: cropY
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Default CSS class name for canvas
|
|
* @static
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fabric.Image.CSS_CANVAS = 'canvas-img';
|
|
|
|
/**
|
|
* Alias for getSrc
|
|
* @static
|
|
*/
|
|
fabric.Image.prototype.getSvgSrc = fabric.Image.prototype.getSrc;
|
|
|
|
/**
|
|
* Creates an instance of fabric.Image from its object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} callback Callback to invoke when an image instance is created
|
|
*/
|
|
fabric.Image.fromObject = function(_object, callback) {
|
|
var object = fabric.util.object.clone(_object);
|
|
fabric.util.loadImage(object.src, function(img, isError) {
|
|
if (isError) {
|
|
callback && callback(null, true);
|
|
return;
|
|
}
|
|
fabric.Image.prototype._initFilters.call(object, object.filters, function(filters) {
|
|
object.filters = filters || [];
|
|
fabric.Image.prototype._initFilters.call(object, [object.resizeFilter], function(resizeFilters) {
|
|
object.resizeFilter = resizeFilters[0];
|
|
fabric.util.enlivenObjects([object.clipPath], function(enlivedProps) {
|
|
object.clipPath = enlivedProps[0];
|
|
var image = new fabric.Image(img, object);
|
|
callback(image, false);
|
|
});
|
|
});
|
|
});
|
|
}, null, object.crossOrigin);
|
|
};
|
|
|
|
/**
|
|
* Creates an instance of fabric.Image from an URL string
|
|
* @static
|
|
* @param {String} url URL to create an image from
|
|
* @param {Function} [callback] Callback to invoke when image is created (newly created image is passed as a first argument). Second argument is a boolean indicating if an error occurred or not.
|
|
* @param {Object} [imgOptions] Options object
|
|
*/
|
|
fabric.Image.fromURL = function(url, callback, imgOptions) {
|
|
fabric.util.loadImage(url, function(img, isError) {
|
|
callback && callback(new fabric.Image(img, imgOptions), isError);
|
|
}, null, imgOptions && imgOptions.crossOrigin);
|
|
};
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Image.fromElement})
|
|
* @static
|
|
* @see {@link http://www.w3.org/TR/SVG/struct.html#ImageElement}
|
|
*/
|
|
fabric.Image.ATTRIBUTE_NAMES =
|
|
fabric.SHARED_ATTRIBUTES.concat(
|
|
'x y width height preserveAspectRatio xlink:href crossOrigin image-rendering'.split(' ')
|
|
);
|
|
|
|
/**
|
|
* Returns {@link fabric.Image} instance from an SVG element
|
|
* @static
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Object} [options] Options object
|
|
* @param {Function} callback Callback to execute when fabric.Image object is created
|
|
* @return {fabric.Image} Instance of fabric.Image
|
|
*/
|
|
fabric.Image.fromElement = function(element, callback, options) {
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Image.ATTRIBUTE_NAMES);
|
|
fabric.Image.fromURL(parsedAttributes['xlink:href'], callback,
|
|
extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes));
|
|
};
|
|
/* _FROM_SVG_END_ */
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ {
|
|
|
|
/**
|
|
* @private
|
|
* @return {Number} angle value
|
|
*/
|
|
_getAngleValueForStraighten: function() {
|
|
var angle = this.angle % 360;
|
|
if (angle > 0) {
|
|
return Math.round((angle - 1) / 90) * 90;
|
|
}
|
|
return Math.round(angle / 90) * 90;
|
|
},
|
|
|
|
/**
|
|
* Straightens an object (rotating it from current angle to one of 0, 90, 180, 270, etc. depending on which is closer)
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
straighten: function() {
|
|
this.rotate(this._getAngleValueForStraighten());
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Same as {@link fabric.Object.prototype.straighten} but with animation
|
|
* @param {Object} callbacks Object with callback functions
|
|
* @param {Function} [callbacks.onComplete] Invoked on completion
|
|
* @param {Function} [callbacks.onChange] Invoked on every step of animation
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
fxStraighten: function(callbacks) {
|
|
callbacks = callbacks || { };
|
|
|
|
var empty = function() { },
|
|
onComplete = callbacks.onComplete || empty,
|
|
onChange = callbacks.onChange || empty,
|
|
_this = this;
|
|
|
|
fabric.util.animate({
|
|
startValue: this.get('angle'),
|
|
endValue: this._getAngleValueForStraighten(),
|
|
duration: this.FX_DURATION,
|
|
onChange: function(value) {
|
|
_this.rotate(value);
|
|
onChange();
|
|
},
|
|
onComplete: function() {
|
|
_this.setCoords();
|
|
onComplete();
|
|
},
|
|
});
|
|
|
|
return this;
|
|
}
|
|
});
|
|
|
|
fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ {
|
|
|
|
/**
|
|
* Straightens object, then rerenders canvas
|
|
* @param {fabric.Object} object Object to straighten
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
straightenObject: function (object) {
|
|
object.straighten();
|
|
this.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Same as {@link fabric.Canvas.prototype.straightenObject}, but animated
|
|
* @param {fabric.Object} object Object to straighten
|
|
* @return {fabric.Canvas} thisArg
|
|
* @chainable
|
|
*/
|
|
fxStraightenObject: function (object) {
|
|
object.fxStraighten({
|
|
onChange: this.requestRenderAllBound
|
|
});
|
|
return this;
|
|
}
|
|
});
|
|
|
|
|
|
(function() {
|
|
|
|
'use strict';
|
|
|
|
/**
|
|
* Tests if webgl supports certain precision
|
|
* @param {WebGL} Canvas WebGL context to test on
|
|
* @param {String} Precision to test can be any of following: 'lowp', 'mediump', 'highp'
|
|
* @returns {Boolean} Whether the user's browser WebGL supports given precision.
|
|
*/
|
|
function testPrecision(gl, precision){
|
|
var fragmentSource = 'precision ' + precision + ' float;\nvoid main(){}';
|
|
var fragmentShader = gl.createShader(gl.FRAGMENT_SHADER);
|
|
gl.shaderSource(fragmentShader, fragmentSource);
|
|
gl.compileShader(fragmentShader);
|
|
if (!gl.getShaderParameter(fragmentShader, gl.COMPILE_STATUS)) {
|
|
return false;
|
|
}
|
|
return true;
|
|
}
|
|
|
|
/**
|
|
* Indicate whether this filtering backend is supported by the user's browser.
|
|
* @param {Number} tileSize check if the tileSize is supported
|
|
* @returns {Boolean} Whether the user's browser supports WebGL.
|
|
*/
|
|
fabric.isWebglSupported = function(tileSize) {
|
|
if (fabric.isLikelyNode) {
|
|
return false;
|
|
}
|
|
tileSize = tileSize || fabric.WebglFilterBackend.prototype.tileSize;
|
|
var canvas = document.createElement('canvas');
|
|
var gl = canvas.getContext('webgl') || canvas.getContext('experimental-webgl');
|
|
var isSupported = false;
|
|
// eslint-disable-next-line
|
|
if (gl) {
|
|
fabric.maxTextureSize = gl.getParameter(gl.MAX_TEXTURE_SIZE);
|
|
isSupported = fabric.maxTextureSize >= tileSize;
|
|
var precisions = ['highp', 'mediump', 'lowp'];
|
|
for (var i = 0; i < 3; i++){
|
|
if (testPrecision(gl, precisions[i])){
|
|
fabric.webGlPrecision = precisions[i];
|
|
break;
|
|
};
|
|
}
|
|
}
|
|
this.isSupported = isSupported;
|
|
return isSupported;
|
|
};
|
|
|
|
fabric.WebglFilterBackend = WebglFilterBackend;
|
|
|
|
/**
|
|
* WebGL filter backend.
|
|
*/
|
|
function WebglFilterBackend(options) {
|
|
if (options && options.tileSize) {
|
|
this.tileSize = options.tileSize;
|
|
}
|
|
this.setupGLContext(this.tileSize, this.tileSize);
|
|
this.captureGPUInfo();
|
|
};
|
|
|
|
WebglFilterBackend.prototype = /** @lends fabric.WebglFilterBackend.prototype */ {
|
|
|
|
tileSize: 2048,
|
|
|
|
/**
|
|
* Experimental. This object is a sort of repository of help layers used to avoid
|
|
* of recreating them during frequent filtering. If you are previewing a filter with
|
|
* a slider you probably do not want to create help layers every filter step.
|
|
* in this object there will be appended some canvases, created once, resized sometimes
|
|
* cleared never. Clearing is left to the developer.
|
|
**/
|
|
resources: {
|
|
|
|
},
|
|
|
|
/**
|
|
* Setup a WebGL context suitable for filtering, and bind any needed event handlers.
|
|
*/
|
|
setupGLContext: function(width, height) {
|
|
this.dispose();
|
|
this.createWebGLCanvas(width, height);
|
|
// eslint-disable-next-line
|
|
this.aPosition = new Float32Array([0, 0, 0, 1, 1, 0, 1, 1]);
|
|
this.chooseFastestCopyGLTo2DMethod(width, height);
|
|
},
|
|
|
|
/**
|
|
* Pick a method to copy data from GL context to 2d canvas. In some browsers using
|
|
* putImageData is faster than drawImage for that specific operation.
|
|
*/
|
|
chooseFastestCopyGLTo2DMethod: function(width, height) {
|
|
var canMeasurePerf = typeof window.performance !== 'undefined', canUseImageData;
|
|
try {
|
|
new ImageData(1, 1);
|
|
canUseImageData = true;
|
|
}
|
|
catch (e) {
|
|
canUseImageData = false;
|
|
}
|
|
// eslint-disable-next-line no-undef
|
|
var canUseArrayBuffer = typeof ArrayBuffer !== 'undefined';
|
|
// eslint-disable-next-line no-undef
|
|
var canUseUint8Clamped = typeof Uint8ClampedArray !== 'undefined';
|
|
|
|
if (!(canMeasurePerf && canUseImageData && canUseArrayBuffer && canUseUint8Clamped)) {
|
|
return;
|
|
}
|
|
|
|
var targetCanvas = fabric.util.createCanvasElement();
|
|
// eslint-disable-next-line no-undef
|
|
var imageBuffer = new ArrayBuffer(width * height * 4);
|
|
if (fabric.forceGLPutImageData) {
|
|
this.imageBuffer = imageBuffer;
|
|
this.copyGLTo2D = copyGLTo2DPutImageData;
|
|
return;
|
|
}
|
|
var testContext = {
|
|
imageBuffer: imageBuffer,
|
|
destinationWidth: width,
|
|
destinationHeight: height,
|
|
targetCanvas: targetCanvas
|
|
};
|
|
var startTime, drawImageTime, putImageDataTime;
|
|
targetCanvas.width = width;
|
|
targetCanvas.height = height;
|
|
|
|
startTime = window.performance.now();
|
|
copyGLTo2DDrawImage.call(testContext, this.gl, testContext);
|
|
drawImageTime = window.performance.now() - startTime;
|
|
|
|
startTime = window.performance.now();
|
|
copyGLTo2DPutImageData.call(testContext, this.gl, testContext);
|
|
putImageDataTime = window.performance.now() - startTime;
|
|
|
|
if (drawImageTime > putImageDataTime) {
|
|
this.imageBuffer = imageBuffer;
|
|
this.copyGLTo2D = copyGLTo2DPutImageData;
|
|
}
|
|
else {
|
|
this.copyGLTo2D = copyGLTo2DDrawImage;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Create a canvas element and associated WebGL context and attaches them as
|
|
* class properties to the GLFilterBackend class.
|
|
*/
|
|
createWebGLCanvas: function(width, height) {
|
|
var canvas = fabric.util.createCanvasElement();
|
|
canvas.width = width;
|
|
canvas.height = height;
|
|
var glOptions = {
|
|
alpha: true,
|
|
premultipliedAlpha: false,
|
|
depth: false,
|
|
stencil: false,
|
|
antialias: false
|
|
},
|
|
gl = canvas.getContext('webgl', glOptions);
|
|
if (!gl) {
|
|
gl = canvas.getContext('experimental-webgl', glOptions);
|
|
}
|
|
if (!gl) {
|
|
return;
|
|
}
|
|
gl.clearColor(0, 0, 0, 0);
|
|
// this canvas can fire webglcontextlost and webglcontextrestored
|
|
this.canvas = canvas;
|
|
this.gl = gl;
|
|
},
|
|
|
|
/**
|
|
* Attempts to apply the requested filters to the source provided, drawing the filtered output
|
|
* to the provided target canvas.
|
|
*
|
|
* @param {Array} filters The filters to apply.
|
|
* @param {HTMLImageElement|HTMLCanvasElement} source The source to be filtered.
|
|
* @param {Number} width The width of the source input.
|
|
* @param {Number} height The height of the source input.
|
|
* @param {HTMLCanvasElement} targetCanvas The destination for filtered output to be drawn.
|
|
* @param {String|undefined} cacheKey A key used to cache resources related to the source. If
|
|
* omitted, caching will be skipped.
|
|
*/
|
|
applyFilters: function(filters, source, width, height, targetCanvas, cacheKey) {
|
|
var gl = this.gl;
|
|
var cachedTexture;
|
|
if (cacheKey) {
|
|
cachedTexture = this.getCachedTexture(cacheKey, source);
|
|
}
|
|
var pipelineState = {
|
|
originalWidth: source.width || source.originalWidth,
|
|
originalHeight: source.height || source.originalHeight,
|
|
sourceWidth: width,
|
|
sourceHeight: height,
|
|
destinationWidth: width,
|
|
destinationHeight: height,
|
|
context: gl,
|
|
sourceTexture: this.createTexture(gl, width, height, !cachedTexture && source),
|
|
targetTexture: this.createTexture(gl, width, height),
|
|
originalTexture: cachedTexture ||
|
|
this.createTexture(gl, width, height, !cachedTexture && source),
|
|
passes: filters.length,
|
|
webgl: true,
|
|
aPosition: this.aPosition,
|
|
programCache: this.programCache,
|
|
pass: 0,
|
|
filterBackend: this,
|
|
targetCanvas: targetCanvas
|
|
};
|
|
var tempFbo = gl.createFramebuffer();
|
|
gl.bindFramebuffer(gl.FRAMEBUFFER, tempFbo);
|
|
filters.forEach(function(filter) { filter && filter.applyTo(pipelineState); });
|
|
resizeCanvasIfNeeded(pipelineState);
|
|
this.copyGLTo2D(gl, pipelineState);
|
|
gl.bindTexture(gl.TEXTURE_2D, null);
|
|
gl.deleteTexture(pipelineState.sourceTexture);
|
|
gl.deleteTexture(pipelineState.targetTexture);
|
|
gl.deleteFramebuffer(tempFbo);
|
|
targetCanvas.getContext('2d').setTransform(1, 0, 0, 1, 0, 0);
|
|
return pipelineState;
|
|
},
|
|
|
|
/**
|
|
* Detach event listeners, remove references, and clean up caches.
|
|
*/
|
|
dispose: function() {
|
|
if (this.canvas) {
|
|
this.canvas = null;
|
|
this.gl = null;
|
|
}
|
|
this.clearWebGLCaches();
|
|
},
|
|
|
|
/**
|
|
* Wipe out WebGL-related caches.
|
|
*/
|
|
clearWebGLCaches: function() {
|
|
this.programCache = {};
|
|
this.textureCache = {};
|
|
},
|
|
|
|
/**
|
|
* Create a WebGL texture object.
|
|
*
|
|
* Accepts specific dimensions to initialize the texture to or a source image.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL context to use for creating the texture.
|
|
* @param {Number} width The width to initialize the texture at.
|
|
* @param {Number} height The height to initialize the texture.
|
|
* @param {HTMLImageElement|HTMLCanvasElement} textureImageSource A source for the texture data.
|
|
* @returns {WebGLTexture}
|
|
*/
|
|
createTexture: function(gl, width, height, textureImageSource) {
|
|
var texture = gl.createTexture();
|
|
gl.bindTexture(gl.TEXTURE_2D, texture);
|
|
gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, gl.NEAREST);
|
|
gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, gl.NEAREST);
|
|
gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
|
|
gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
|
|
if (textureImageSource) {
|
|
gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, textureImageSource);
|
|
}
|
|
else {
|
|
gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, null);
|
|
}
|
|
return texture;
|
|
},
|
|
|
|
/**
|
|
* Can be optionally used to get a texture from the cache array
|
|
*
|
|
* If an existing texture is not found, a new texture is created and cached.
|
|
*
|
|
* @param {String} uniqueId A cache key to use to find an existing texture.
|
|
* @param {HTMLImageElement|HTMLCanvasElement} textureImageSource A source to use to create the
|
|
* texture cache entry if one does not already exist.
|
|
*/
|
|
getCachedTexture: function(uniqueId, textureImageSource) {
|
|
if (this.textureCache[uniqueId]) {
|
|
return this.textureCache[uniqueId];
|
|
}
|
|
else {
|
|
var texture = this.createTexture(
|
|
this.gl, textureImageSource.width, textureImageSource.height, textureImageSource);
|
|
this.textureCache[uniqueId] = texture;
|
|
return texture;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Clear out cached resources related to a source image that has been
|
|
* filtered previously.
|
|
*
|
|
* @param {String} cacheKey The cache key provided when the source image was filtered.
|
|
*/
|
|
evictCachesForKey: function(cacheKey) {
|
|
if (this.textureCache[cacheKey]) {
|
|
this.gl.deleteTexture(this.textureCache[cacheKey]);
|
|
delete this.textureCache[cacheKey];
|
|
}
|
|
},
|
|
|
|
copyGLTo2D: copyGLTo2DDrawImage,
|
|
|
|
/**
|
|
* Attempt to extract GPU information strings from a WebGL context.
|
|
*
|
|
* Useful information when debugging or blacklisting specific GPUs.
|
|
*
|
|
* @returns {Object} A GPU info object with renderer and vendor strings.
|
|
*/
|
|
captureGPUInfo: function() {
|
|
if (this.gpuInfo) {
|
|
return this.gpuInfo;
|
|
}
|
|
var gl = this.gl, gpuInfo = { renderer: '', vendor: '' };
|
|
if (!gl) {
|
|
return gpuInfo;
|
|
}
|
|
var ext = gl.getExtension('WEBGL_debug_renderer_info');
|
|
if (ext) {
|
|
var renderer = gl.getParameter(ext.UNMASKED_RENDERER_WEBGL);
|
|
var vendor = gl.getParameter(ext.UNMASKED_VENDOR_WEBGL);
|
|
if (renderer) {
|
|
gpuInfo.renderer = renderer.toLowerCase();
|
|
}
|
|
if (vendor) {
|
|
gpuInfo.vendor = vendor.toLowerCase();
|
|
}
|
|
}
|
|
this.gpuInfo = gpuInfo;
|
|
return gpuInfo;
|
|
},
|
|
};
|
|
})();
|
|
|
|
function resizeCanvasIfNeeded(pipelineState) {
|
|
var targetCanvas = pipelineState.targetCanvas,
|
|
width = targetCanvas.width, height = targetCanvas.height,
|
|
dWidth = pipelineState.destinationWidth,
|
|
dHeight = pipelineState.destinationHeight;
|
|
|
|
if (width !== dWidth || height !== dHeight) {
|
|
targetCanvas.width = dWidth;
|
|
targetCanvas.height = dHeight;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* Copy an input WebGL canvas on to an output 2D canvas.
|
|
*
|
|
* The WebGL canvas is assumed to be upside down, with the top-left pixel of the
|
|
* desired output image appearing in the bottom-left corner of the WebGL canvas.
|
|
*
|
|
* @param {WebGLRenderingContext} sourceContext The WebGL context to copy from.
|
|
* @param {HTMLCanvasElement} targetCanvas The 2D target canvas to copy on to.
|
|
* @param {Object} pipelineState The 2D target canvas to copy on to.
|
|
*/
|
|
function copyGLTo2DDrawImage(gl, pipelineState) {
|
|
var glCanvas = gl.canvas, targetCanvas = pipelineState.targetCanvas,
|
|
ctx = targetCanvas.getContext('2d');
|
|
ctx.translate(0, targetCanvas.height); // move it down again
|
|
ctx.scale(1, -1); // vertical flip
|
|
// where is my image on the big glcanvas?
|
|
var sourceY = glCanvas.height - targetCanvas.height;
|
|
ctx.drawImage(glCanvas, 0, sourceY, targetCanvas.width, targetCanvas.height, 0, 0,
|
|
targetCanvas.width, targetCanvas.height);
|
|
}
|
|
|
|
/**
|
|
* Copy an input WebGL canvas on to an output 2D canvas using 2d canvas' putImageData
|
|
* API. Measurably faster than using ctx.drawImage in Firefox (version 54 on OSX Sierra).
|
|
*
|
|
* @param {WebGLRenderingContext} sourceContext The WebGL context to copy from.
|
|
* @param {HTMLCanvasElement} targetCanvas The 2D target canvas to copy on to.
|
|
* @param {Object} pipelineState The 2D target canvas to copy on to.
|
|
*/
|
|
function copyGLTo2DPutImageData(gl, pipelineState) {
|
|
var targetCanvas = pipelineState.targetCanvas, ctx = targetCanvas.getContext('2d'),
|
|
dWidth = pipelineState.destinationWidth,
|
|
dHeight = pipelineState.destinationHeight,
|
|
numBytes = dWidth * dHeight * 4;
|
|
|
|
// eslint-disable-next-line no-undef
|
|
var u8 = new Uint8Array(this.imageBuffer, 0, numBytes);
|
|
// eslint-disable-next-line no-undef
|
|
var u8Clamped = new Uint8ClampedArray(this.imageBuffer, 0, numBytes);
|
|
|
|
gl.readPixels(0, 0, dWidth, dHeight, gl.RGBA, gl.UNSIGNED_BYTE, u8);
|
|
var imgData = new ImageData(u8Clamped, dWidth, dHeight);
|
|
ctx.putImageData(imgData, 0, 0);
|
|
}
|
|
|
|
|
|
(function() {
|
|
|
|
'use strict';
|
|
|
|
var noop = function() {};
|
|
|
|
fabric.Canvas2dFilterBackend = Canvas2dFilterBackend;
|
|
|
|
/**
|
|
* Canvas 2D filter backend.
|
|
*/
|
|
function Canvas2dFilterBackend() {};
|
|
|
|
Canvas2dFilterBackend.prototype = /** @lends fabric.Canvas2dFilterBackend.prototype */ {
|
|
evictCachesForKey: noop,
|
|
dispose: noop,
|
|
clearWebGLCaches: noop,
|
|
|
|
/**
|
|
* Experimental. This object is a sort of repository of help layers used to avoid
|
|
* of recreating them during frequent filtering. If you are previewing a filter with
|
|
* a slider you probably do not want to create help layers every filter step.
|
|
* in this object there will be appended some canvases, created once, resized sometimes
|
|
* cleared never. Clearing is left to the developer.
|
|
**/
|
|
resources: {
|
|
|
|
},
|
|
|
|
/**
|
|
* Apply a set of filters against a source image and draw the filtered output
|
|
* to the provided destination canvas.
|
|
*
|
|
* @param {EnhancedFilter} filters The filter to apply.
|
|
* @param {HTMLImageElement|HTMLCanvasElement} sourceElement The source to be filtered.
|
|
* @param {Number} sourceWidth The width of the source input.
|
|
* @param {Number} sourceHeight The height of the source input.
|
|
* @param {HTMLCanvasElement} targetCanvas The destination for filtered output to be drawn.
|
|
*/
|
|
applyFilters: function(filters, sourceElement, sourceWidth, sourceHeight, targetCanvas) {
|
|
var ctx = targetCanvas.getContext('2d');
|
|
ctx.drawImage(sourceElement, 0, 0, sourceWidth, sourceHeight);
|
|
var imageData = ctx.getImageData(0, 0, sourceWidth, sourceHeight);
|
|
var originalImageData = ctx.getImageData(0, 0, sourceWidth, sourceHeight);
|
|
var pipelineState = {
|
|
sourceWidth: sourceWidth,
|
|
sourceHeight: sourceHeight,
|
|
imageData: imageData,
|
|
originalEl: sourceElement,
|
|
originalImageData: originalImageData,
|
|
canvasEl: targetCanvas,
|
|
ctx: ctx,
|
|
filterBackend: this,
|
|
};
|
|
filters.forEach(function(filter) { filter.applyTo(pipelineState); });
|
|
if (pipelineState.imageData.width !== sourceWidth || pipelineState.imageData.height !== sourceHeight) {
|
|
targetCanvas.width = pipelineState.imageData.width;
|
|
targetCanvas.height = pipelineState.imageData.height;
|
|
}
|
|
ctx.putImageData(pipelineState.imageData, 0, 0);
|
|
return pipelineState;
|
|
},
|
|
|
|
};
|
|
})();
|
|
|
|
|
|
/**
|
|
* @namespace fabric.Image.filters
|
|
* @memberOf fabric.Image
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-2#image_filters}
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
*/
|
|
fabric.Image = fabric.Image || { };
|
|
fabric.Image.filters = fabric.Image.filters || { };
|
|
|
|
/**
|
|
* Root filter class from which all filter classes inherit from
|
|
* @class fabric.Image.filters.BaseFilter
|
|
* @memberOf fabric.Image.filters
|
|
*/
|
|
fabric.Image.filters.BaseFilter = fabric.util.createClass(/** @lends fabric.Image.filters.BaseFilter.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'BaseFilter',
|
|
|
|
/**
|
|
* Array of attributes to send with buffers. do not modify
|
|
* @private
|
|
*/
|
|
|
|
vertexSource: 'attribute vec2 aPosition;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vTexCoord = aPosition;\n' +
|
|
'gl_Position = vec4(aPosition * 2.0 - 1.0, 0.0, 1.0);\n' +
|
|
'}',
|
|
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'void main() {\n' +
|
|
'gl_FragColor = texture2D(uTexture, vTexCoord);\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
if (options) {
|
|
this.setOptions(options);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Sets filter's properties from options
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
setOptions: function(options) {
|
|
for (var prop in options) {
|
|
this[prop] = options[prop];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Compile this filter's shader program.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context to use for shader compilation.
|
|
* @param {String} fragmentSource fragmentShader source for compilation
|
|
* @param {String} vertexSource vertexShader source for compilation
|
|
*/
|
|
createProgram: function(gl, fragmentSource, vertexSource) {
|
|
fragmentSource = fragmentSource || this.fragmentSource;
|
|
vertexSource = vertexSource || this.vertexSource;
|
|
if (fabric.webGlPrecision !== 'highp'){
|
|
fragmentSource = fragmentSource.replace(
|
|
/precision highp float/g,
|
|
'precision ' + fabric.webGlPrecision + ' float'
|
|
);
|
|
}
|
|
var vertexShader = gl.createShader(gl.VERTEX_SHADER);
|
|
gl.shaderSource(vertexShader, vertexSource);
|
|
gl.compileShader(vertexShader);
|
|
if (!gl.getShaderParameter(vertexShader, gl.COMPILE_STATUS)) {
|
|
throw new Error(
|
|
// eslint-disable-next-line prefer-template
|
|
'Vertex shader compile error for ' + this.type + ': ' +
|
|
gl.getShaderInfoLog(vertexShader)
|
|
);
|
|
}
|
|
|
|
var fragmentShader = gl.createShader(gl.FRAGMENT_SHADER);
|
|
gl.shaderSource(fragmentShader, fragmentSource);
|
|
gl.compileShader(fragmentShader);
|
|
if (!gl.getShaderParameter(fragmentShader, gl.COMPILE_STATUS)) {
|
|
throw new Error(
|
|
// eslint-disable-next-line prefer-template
|
|
'Fragment shader compile error for ' + this.type + ': ' +
|
|
gl.getShaderInfoLog(fragmentShader)
|
|
);
|
|
}
|
|
|
|
var program = gl.createProgram();
|
|
gl.attachShader(program, vertexShader);
|
|
gl.attachShader(program, fragmentShader);
|
|
gl.linkProgram(program);
|
|
if (!gl.getProgramParameter(program, gl.LINK_STATUS)) {
|
|
throw new Error(
|
|
// eslint-disable-next-line prefer-template
|
|
'Shader link error for "${this.type}" ' +
|
|
gl.getProgramInfoLog(program)
|
|
);
|
|
}
|
|
|
|
var attributeLocations = this.getAttributeLocations(gl, program);
|
|
var uniformLocations = this.getUniformLocations(gl, program) || { };
|
|
uniformLocations.uStepW = gl.getUniformLocation(program, 'uStepW');
|
|
uniformLocations.uStepH = gl.getUniformLocation(program, 'uStepH');
|
|
return {
|
|
program: program,
|
|
attributeLocations: attributeLocations,
|
|
uniformLocations: uniformLocations
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Return a map of attribute names to WebGLAttributeLocation objects.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The canvas context used to compile the shader program.
|
|
* @param {WebGLShaderProgram} program The shader program from which to take attribute locations.
|
|
* @returns {Object} A map of attribute names to attribute locations.
|
|
*/
|
|
getAttributeLocations: function(gl, program) {
|
|
return {
|
|
aPosition: gl.getAttribLocation(program, 'aPosition'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Return a map of uniform names to WebGLUniformLocation objects.
|
|
*
|
|
* Intended to be overridden by subclasses.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The canvas context used to compile the shader program.
|
|
* @param {WebGLShaderProgram} program The shader program from which to take uniform locations.
|
|
* @returns {Object} A map of uniform names to uniform locations.
|
|
*/
|
|
getUniformLocations: function (/* gl, program */) {
|
|
// in case i do not need any special uniform i need to return an empty object
|
|
return { };
|
|
},
|
|
|
|
/**
|
|
* Send attribute data from this filter to its shader program on the GPU.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The canvas context used to compile the shader program.
|
|
* @param {Object} attributeLocations A map of shader attribute names to their locations.
|
|
*/
|
|
sendAttributeData: function(gl, attributeLocations, aPositionData) {
|
|
var attributeLocation = attributeLocations.aPosition;
|
|
var buffer = gl.createBuffer();
|
|
gl.bindBuffer(gl.ARRAY_BUFFER, buffer);
|
|
gl.enableVertexAttribArray(attributeLocation);
|
|
gl.vertexAttribPointer(attributeLocation, 2, gl.FLOAT, false, 0, 0);
|
|
gl.bufferData(gl.ARRAY_BUFFER, aPositionData, gl.STATIC_DRAW);
|
|
},
|
|
|
|
_setupFrameBuffer: function(options) {
|
|
var gl = options.context, width, height;
|
|
if (options.passes > 1) {
|
|
width = options.destinationWidth;
|
|
height = options.destinationHeight;
|
|
if (options.sourceWidth !== width || options.sourceHeight !== height) {
|
|
gl.deleteTexture(options.targetTexture);
|
|
options.targetTexture = options.filterBackend.createTexture(gl, width, height);
|
|
}
|
|
gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D,
|
|
options.targetTexture, 0);
|
|
}
|
|
else {
|
|
// draw last filter on canvas and not to framebuffer.
|
|
gl.bindFramebuffer(gl.FRAMEBUFFER, null);
|
|
gl.finish();
|
|
}
|
|
},
|
|
|
|
_swapTextures: function(options) {
|
|
options.passes--;
|
|
options.pass++;
|
|
var temp = options.targetTexture;
|
|
options.targetTexture = options.sourceTexture;
|
|
options.sourceTexture = temp;
|
|
},
|
|
|
|
/**
|
|
* Generic isNeutral implementation for one parameter based filters.
|
|
* Used only in image applyFilters to discard filters that will not have an effect
|
|
* on the image
|
|
* Other filters may need their own version ( ColorMatrix, HueRotation, gamma, ComposedFilter )
|
|
* @param {Object} options
|
|
**/
|
|
isNeutralState: function(/* options */) {
|
|
var main = this.mainParameter,
|
|
_class = fabric.Image.filters[this.type].prototype;
|
|
if (main) {
|
|
if (Array.isArray(_class[main])) {
|
|
for (var i = _class[main].length; i--;) {
|
|
if (this[main][i] !== _class[main][i]) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
else {
|
|
return _class[main] === this[main];
|
|
}
|
|
}
|
|
else {
|
|
return false;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Apply this filter to the input image data provided.
|
|
*
|
|
* Determines whether to use WebGL or Canvas2D based on the options.webgl flag.
|
|
*
|
|
* @param {Object} options
|
|
* @param {Number} options.passes The number of filters remaining to be executed
|
|
* @param {Boolean} options.webgl Whether to use webgl to render the filter.
|
|
* @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered.
|
|
* @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn.
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
applyTo: function(options) {
|
|
if (options.webgl) {
|
|
this._setupFrameBuffer(options);
|
|
this.applyToWebGL(options);
|
|
this._swapTextures(options);
|
|
}
|
|
else {
|
|
this.applyTo2d(options);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Retrieves the cached shader.
|
|
* @param {Object} options
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
retrieveShader: function(options) {
|
|
if (!options.programCache.hasOwnProperty(this.type)) {
|
|
options.programCache[this.type] = this.createProgram(options.context);
|
|
}
|
|
return options.programCache[this.type];
|
|
},
|
|
|
|
/**
|
|
* Apply this filter using webgl.
|
|
*
|
|
* @param {Object} options
|
|
* @param {Number} options.passes The number of filters remaining to be executed
|
|
* @param {Boolean} options.webgl Whether to use webgl to render the filter.
|
|
* @param {WebGLTexture} options.originalTexture The texture of the original input image.
|
|
* @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered.
|
|
* @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn.
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
applyToWebGL: function(options) {
|
|
var gl = options.context;
|
|
var shader = this.retrieveShader(options);
|
|
if (options.pass === 0 && options.originalTexture) {
|
|
gl.bindTexture(gl.TEXTURE_2D, options.originalTexture);
|
|
}
|
|
else {
|
|
gl.bindTexture(gl.TEXTURE_2D, options.sourceTexture);
|
|
}
|
|
gl.useProgram(shader.program);
|
|
this.sendAttributeData(gl, shader.attributeLocations, options.aPosition);
|
|
|
|
gl.uniform1f(shader.uniformLocations.uStepW, 1 / options.sourceWidth);
|
|
gl.uniform1f(shader.uniformLocations.uStepH, 1 / options.sourceHeight);
|
|
|
|
this.sendUniformData(gl, shader.uniformLocations);
|
|
gl.viewport(0, 0, options.destinationWidth, options.destinationHeight);
|
|
gl.drawArrays(gl.TRIANGLE_STRIP, 0, 4);
|
|
},
|
|
|
|
bindAdditionalTexture: function(gl, texture, textureUnit) {
|
|
gl.activeTexture(textureUnit);
|
|
gl.bindTexture(gl.TEXTURE_2D, texture);
|
|
// reset active texture to 0 as usual
|
|
gl.activeTexture(gl.TEXTURE0);
|
|
},
|
|
|
|
unbindAdditionalTexture: function(gl, textureUnit) {
|
|
gl.activeTexture(textureUnit);
|
|
gl.bindTexture(gl.TEXTURE_2D, null);
|
|
gl.activeTexture(gl.TEXTURE0);
|
|
},
|
|
|
|
getMainParameter: function() {
|
|
return this[this.mainParameter];
|
|
},
|
|
|
|
setMainParameter: function(value) {
|
|
this[this.mainParameter] = value;
|
|
},
|
|
|
|
/**
|
|
* Send uniform data from this filter to its shader program on the GPU.
|
|
*
|
|
* Intended to be overridden by subclasses.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The canvas context used to compile the shader program.
|
|
* @param {Object} uniformLocations A map of shader uniform names to their locations.
|
|
*/
|
|
sendUniformData: function(/* gl, uniformLocations */) {
|
|
// Intentionally left blank. Override me in subclasses.
|
|
},
|
|
|
|
/**
|
|
* If needed by a 2d filter, this functions can create an helper canvas to be used
|
|
* remember that options.targetCanvas is available for use till end of chain.
|
|
*/
|
|
createHelpLayer: function(options) {
|
|
if (!options.helpLayer) {
|
|
var helpLayer = document.createElement('canvas');
|
|
helpLayer.width = options.sourceWidth;
|
|
helpLayer.height = options.sourceHeight;
|
|
options.helpLayer = helpLayer;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function() {
|
|
var object = { type: this.type }, mainP = this.mainParameter;
|
|
if (mainP) {
|
|
object[mainP] = this[mainP];
|
|
}
|
|
return object;
|
|
},
|
|
|
|
/**
|
|
* Returns a JSON representation of an instance
|
|
* @return {Object} JSON
|
|
*/
|
|
toJSON: function() {
|
|
// delegate, not alias
|
|
return this.toObject();
|
|
}
|
|
});
|
|
|
|
fabric.Image.filters.BaseFilter.fromObject = function(object, callback) {
|
|
var filter = new fabric.Image.filters[object.type](object);
|
|
callback && callback(filter);
|
|
return filter;
|
|
};
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Color Matrix filter class
|
|
* @class fabric.Image.filters.ColorMatrix
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.ColorMatrix#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @see {@Link http://www.webwasp.co.uk/tutorials/219/Color_Matrix_Filter.php}
|
|
* @see {@Link http://phoboslab.org/log/2013/11/fast-image-filters-with-webgl}
|
|
* @example <caption>Kodachrome filter</caption>
|
|
* var filter = new fabric.Image.filters.ColorMatrix({
|
|
* matrix: [
|
|
1.1285582396593525, -0.3967382283601348, -0.03992559172921793, 0, 63.72958762196502,
|
|
-0.16404339962244616, 1.0835251566291304, -0.05498805115633132, 0, 24.732407896706203,
|
|
-0.16786010706155763, -0.5603416277695248, 1.6014850761964943, 0, 35.62982807460946,
|
|
0, 0, 0, 1, 0
|
|
]
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.ColorMatrix = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.ColorMatrix.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'ColorMatrix',
|
|
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'uniform mat4 uColorMatrix;\n' +
|
|
'uniform vec4 uConstants;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'color *= uColorMatrix;\n' +
|
|
'color += uConstants;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Colormatrix for pixels.
|
|
* array of 20 floats. Numbers in positions 4, 9, 14, 19 loose meaning
|
|
* outside the -1, 1 range.
|
|
* 0.0039215686 is the part of 1 that get translated to 1 in 2d
|
|
* @param {Array} matrix array of 20 numbers.
|
|
* @default
|
|
*/
|
|
matrix: [
|
|
1, 0, 0, 0, 0,
|
|
0, 1, 0, 0, 0,
|
|
0, 0, 1, 0, 0,
|
|
0, 0, 0, 1, 0
|
|
],
|
|
|
|
mainParameter: 'matrix',
|
|
|
|
/**
|
|
* Lock the colormatrix on the color part, skipping alpha, manly for non webgl scenario
|
|
* to save some calculation
|
|
*/
|
|
colorsOnly: true,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
this.callSuper('initialize', options);
|
|
// create a new array instead mutating the prototype with push
|
|
this.matrix = this.matrix.slice(0);
|
|
},
|
|
|
|
/**
|
|
* Apply the ColorMatrix operation to a Uint8Array representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8Array to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
data = imageData.data,
|
|
iLen = data.length,
|
|
m = this.matrix,
|
|
r, g, b, a, i, colorsOnly = this.colorsOnly;
|
|
|
|
for (i = 0; i < iLen; i += 4) {
|
|
r = data[i];
|
|
g = data[i + 1];
|
|
b = data[i + 2];
|
|
if (colorsOnly) {
|
|
data[i] = r * m[0] + g * m[1] + b * m[2] + m[4] * 255;
|
|
data[i + 1] = r * m[5] + g * m[6] + b * m[7] + m[9] * 255;
|
|
data[i + 2] = r * m[10] + g * m[11] + b * m[12] + m[14] * 255;
|
|
}
|
|
else {
|
|
a = data[i + 3];
|
|
data[i] = r * m[0] + g * m[1] + b * m[2] + a * m[3] + m[4] * 255;
|
|
data[i + 1] = r * m[5] + g * m[6] + b * m[7] + a * m[8] + m[9] * 255;
|
|
data[i + 2] = r * m[10] + g * m[11] + b * m[12] + a * m[13] + m[14] * 255;
|
|
data[i + 3] = r * m[15] + g * m[16] + b * m[17] + a * m[18] + m[19] * 255;
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uColorMatrix: gl.getUniformLocation(program, 'uColorMatrix'),
|
|
uConstants: gl.getUniformLocation(program, 'uConstants'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
var m = this.matrix,
|
|
matrix = [
|
|
m[0], m[1], m[2], m[3],
|
|
m[5], m[6], m[7], m[8],
|
|
m[10], m[11], m[12], m[13],
|
|
m[15], m[16], m[17], m[18]
|
|
],
|
|
constants = [m[4], m[9], m[14], m[19]];
|
|
gl.uniformMatrix4fv(uniformLocations.uColorMatrix, false, matrix);
|
|
gl.uniform4fv(uniformLocations.uConstants, constants);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] function to invoke after filter creation
|
|
* @return {fabric.Image.filters.ColorMatrix} Instance of fabric.Image.filters.ColorMatrix
|
|
*/
|
|
fabric.Image.filters.ColorMatrix.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Brightness filter class
|
|
* @class fabric.Image.filters.Brightness
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Brightness#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Brightness({
|
|
* brightness: 0.05
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.Brightness = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Brightness.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Brightness',
|
|
|
|
/**
|
|
* Fragment source for the brightness program
|
|
*/
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uBrightness;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'color.rgb += uBrightness;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Brightness value, from -1 to 1.
|
|
* translated to -255 to 255 for 2d
|
|
* 0.0039215686 is the part of 1 that get translated to 1 in 2d
|
|
* @param {Number} brightness
|
|
* @default
|
|
*/
|
|
brightness: 0,
|
|
|
|
/**
|
|
* Describe the property that is the filter parameter
|
|
* @param {String} m
|
|
* @default
|
|
*/
|
|
mainParameter: 'brightness',
|
|
|
|
/**
|
|
* Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
if (this.brightness === 0) {
|
|
return;
|
|
}
|
|
var imageData = options.imageData,
|
|
data = imageData.data, i, len = data.length,
|
|
brightness = Math.round(this.brightness * 255);
|
|
for (i = 0; i < len; i += 4) {
|
|
data[i] = data[i] + brightness;
|
|
data[i + 1] = data[i + 1] + brightness;
|
|
data[i + 2] = data[i + 2] + brightness;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uBrightness: gl.getUniformLocation(program, 'uBrightness'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1f(uniformLocations.uBrightness, this.brightness);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Brightness} Instance of fabric.Image.filters.Brightness
|
|
*/
|
|
fabric.Image.filters.Brightness.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Adapted from <a href="http://www.html5rocks.com/en/tutorials/canvas/imagefilters/">html5rocks article</a>
|
|
* @class fabric.Image.filters.Convolute
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Convolute#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example <caption>Sharpen filter</caption>
|
|
* var filter = new fabric.Image.filters.Convolute({
|
|
* matrix: [ 0, -1, 0,
|
|
* -1, 5, -1,
|
|
* 0, -1, 0 ]
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
* @example <caption>Blur filter</caption>
|
|
* var filter = new fabric.Image.filters.Convolute({
|
|
* matrix: [ 1/9, 1/9, 1/9,
|
|
* 1/9, 1/9, 1/9,
|
|
* 1/9, 1/9, 1/9 ]
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
* @example <caption>Emboss filter</caption>
|
|
* var filter = new fabric.Image.filters.Convolute({
|
|
* matrix: [ 1, 1, 1,
|
|
* 1, 0.7, -1,
|
|
* -1, -1, -1 ]
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
* @example <caption>Emboss filter with opaqueness</caption>
|
|
* var filter = new fabric.Image.filters.Convolute({
|
|
* opaque: true,
|
|
* matrix: [ 1, 1, 1,
|
|
* 1, 0.7, -1,
|
|
* -1, -1, -1 ]
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
*/
|
|
filters.Convolute = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Convolute.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Convolute',
|
|
|
|
/*
|
|
* Opaque value (true/false)
|
|
*/
|
|
opaque: false,
|
|
|
|
/*
|
|
* matrix for the filter, max 9x9
|
|
*/
|
|
matrix: [0, 0, 0, 0, 1, 0, 0, 0, 0],
|
|
|
|
/**
|
|
* Fragment source for the brightness program
|
|
*/
|
|
fragmentSource: {
|
|
Convolute_3_1: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[9];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 0);\n' +
|
|
'for (float h = 0.0; h < 3.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 3.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 1), uStepH * (h - 1));\n' +
|
|
'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 3.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
Convolute_3_0: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[9];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 1);\n' +
|
|
'for (float h = 0.0; h < 3.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 3.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 1.0), uStepH * (h - 1.0));\n' +
|
|
'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 3.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'float alpha = texture2D(uTexture, vTexCoord).a;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'gl_FragColor.a = alpha;\n' +
|
|
'}',
|
|
Convolute_5_1: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[25];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 0);\n' +
|
|
'for (float h = 0.0; h < 5.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 5.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 2.0), uStepH * (h - 2.0));\n' +
|
|
'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 5.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
Convolute_5_0: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[25];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 1);\n' +
|
|
'for (float h = 0.0; h < 5.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 5.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 2.0), uStepH * (h - 2.0));\n' +
|
|
'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 5.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'float alpha = texture2D(uTexture, vTexCoord).a;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'gl_FragColor.a = alpha;\n' +
|
|
'}',
|
|
Convolute_7_1: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[49];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 0);\n' +
|
|
'for (float h = 0.0; h < 7.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 7.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 3.0), uStepH * (h - 3.0));\n' +
|
|
'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 7.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
Convolute_7_0: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[49];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 1);\n' +
|
|
'for (float h = 0.0; h < 7.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 7.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 3.0), uStepH * (h - 3.0));\n' +
|
|
'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 7.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'float alpha = texture2D(uTexture, vTexCoord).a;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'gl_FragColor.a = alpha;\n' +
|
|
'}',
|
|
Convolute_9_1: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[81];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 0);\n' +
|
|
'for (float h = 0.0; h < 9.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 9.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 4.0), uStepH * (h - 4.0));\n' +
|
|
'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 9.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
Convolute_9_0: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uMatrix[81];\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0, 0, 0, 1);\n' +
|
|
'for (float h = 0.0; h < 9.0; h+=1.0) {\n' +
|
|
'for (float w = 0.0; w < 9.0; w+=1.0) {\n' +
|
|
'vec2 matrixPos = vec2(uStepW * (w - 4.0), uStepH * (h - 4.0));\n' +
|
|
'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 9.0 + w)];\n' +
|
|
'}\n' +
|
|
'}\n' +
|
|
'float alpha = texture2D(uTexture, vTexCoord).a;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'gl_FragColor.a = alpha;\n' +
|
|
'}',
|
|
},
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Convolute.prototype
|
|
* @param {Object} [options] Options object
|
|
* @param {Boolean} [options.opaque=false] Opaque value (true/false)
|
|
* @param {Array} [options.matrix] Filter matrix
|
|
*/
|
|
|
|
|
|
/**
|
|
* Retrieves the cached shader.
|
|
* @param {Object} options
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
retrieveShader: function(options) {
|
|
var size = Math.sqrt(this.matrix.length);
|
|
var cacheKey = this.type + '_' + size + '_' + (this.opaque ? 1 : 0);
|
|
var shaderSource = this.fragmentSource[cacheKey];
|
|
if (!options.programCache.hasOwnProperty(cacheKey)) {
|
|
options.programCache[cacheKey] = this.createProgram(options.context, shaderSource);
|
|
}
|
|
return options.programCache[cacheKey];
|
|
},
|
|
|
|
/**
|
|
* Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
data = imageData.data,
|
|
weights = this.matrix,
|
|
side = Math.round(Math.sqrt(weights.length)),
|
|
halfSide = Math.floor(side / 2),
|
|
sw = imageData.width,
|
|
sh = imageData.height,
|
|
output = options.ctx.createImageData(sw, sh),
|
|
dst = output.data,
|
|
// go through the destination image pixels
|
|
alphaFac = this.opaque ? 1 : 0,
|
|
r, g, b, a, dstOff,
|
|
scx, scy, srcOff, wt,
|
|
x, y, cx, cy;
|
|
|
|
for (y = 0; y < sh; y++) {
|
|
for (x = 0; x < sw; x++) {
|
|
dstOff = (y * sw + x) * 4;
|
|
// calculate the weighed sum of the source image pixels that
|
|
// fall under the convolution matrix
|
|
r = 0; g = 0; b = 0; a = 0;
|
|
|
|
for (cy = 0; cy < side; cy++) {
|
|
for (cx = 0; cx < side; cx++) {
|
|
scy = y + cy - halfSide;
|
|
scx = x + cx - halfSide;
|
|
|
|
// eslint-disable-next-line max-depth
|
|
if (scy < 0 || scy >= sh || scx < 0 || scx >= sw) {
|
|
continue;
|
|
}
|
|
|
|
srcOff = (scy * sw + scx) * 4;
|
|
wt = weights[cy * side + cx];
|
|
|
|
r += data[srcOff] * wt;
|
|
g += data[srcOff + 1] * wt;
|
|
b += data[srcOff + 2] * wt;
|
|
// eslint-disable-next-line max-depth
|
|
if (!alphaFac) {
|
|
a += data[srcOff + 3] * wt;
|
|
}
|
|
}
|
|
}
|
|
dst[dstOff] = r;
|
|
dst[dstOff + 1] = g;
|
|
dst[dstOff + 2] = b;
|
|
if (!alphaFac) {
|
|
dst[dstOff + 3] = a;
|
|
}
|
|
else {
|
|
dst[dstOff + 3] = data[dstOff + 3];
|
|
}
|
|
}
|
|
}
|
|
options.imageData = output;
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uMatrix: gl.getUniformLocation(program, 'uMatrix'),
|
|
uOpaque: gl.getUniformLocation(program, 'uOpaque'),
|
|
uHalfSize: gl.getUniformLocation(program, 'uHalfSize'),
|
|
uSize: gl.getUniformLocation(program, 'uSize'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1fv(uniformLocations.uMatrix, this.matrix);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function() {
|
|
return extend(this.callSuper('toObject'), {
|
|
opaque: this.opaque,
|
|
matrix: this.matrix
|
|
});
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Convolute} Instance of fabric.Image.filters.Convolute
|
|
*/
|
|
fabric.Image.filters.Convolute.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Grayscale image filter class
|
|
* @class fabric.Image.filters.Grayscale
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Grayscale();
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.Grayscale = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Grayscale.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Grayscale',
|
|
|
|
fragmentSource: {
|
|
average: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'float average = (color.r + color.b + color.g) / 3.0;\n' +
|
|
'gl_FragColor = vec4(average, average, average, color.a);\n' +
|
|
'}',
|
|
lightness: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform int uMode;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 col = texture2D(uTexture, vTexCoord);\n' +
|
|
'float average = (max(max(col.r, col.g),col.b) + min(min(col.r, col.g),col.b)) / 2.0;\n' +
|
|
'gl_FragColor = vec4(average, average, average, col.a);\n' +
|
|
'}',
|
|
luminosity: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform int uMode;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 col = texture2D(uTexture, vTexCoord);\n' +
|
|
'float average = 0.21 * col.r + 0.72 * col.g + 0.07 * col.b;\n' +
|
|
'gl_FragColor = vec4(average, average, average, col.a);\n' +
|
|
'}',
|
|
},
|
|
|
|
|
|
/**
|
|
* Grayscale mode, between 'average', 'lightness', 'luminosity'
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
mode: 'average',
|
|
|
|
mainParameter: 'mode',
|
|
|
|
/**
|
|
* Apply the Grayscale operation to a Uint8Array representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8Array to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
data = imageData.data, i,
|
|
len = data.length, value,
|
|
mode = this.mode;
|
|
for (i = 0; i < len; i += 4) {
|
|
if (mode === 'average') {
|
|
value = (data[i] + data[i + 1] + data[i + 2]) / 3;
|
|
}
|
|
else if (mode === 'lightness') {
|
|
value = (Math.min(data[i], data[i + 1], data[i + 2]) +
|
|
Math.max(data[i], data[i + 1], data[i + 2])) / 2;
|
|
}
|
|
else if (mode === 'luminosity') {
|
|
value = 0.21 * data[i] + 0.72 * data[i + 1] + 0.07 * data[i + 2];
|
|
}
|
|
data[i] = value;
|
|
data[i + 1] = value;
|
|
data[i + 2] = value;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Retrieves the cached shader.
|
|
* @param {Object} options
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
retrieveShader: function(options) {
|
|
var cacheKey = this.type + '_' + this.mode;
|
|
if (!options.programCache.hasOwnProperty(cacheKey)) {
|
|
var shaderSource = this.fragmentSource[this.mode];
|
|
options.programCache[cacheKey] = this.createProgram(options.context, shaderSource);
|
|
}
|
|
return options.programCache[cacheKey];
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uMode: gl.getUniformLocation(program, 'uMode'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
// default average mode.
|
|
var mode = 1;
|
|
gl.uniform1i(uniformLocations.uMode, mode);
|
|
},
|
|
|
|
/**
|
|
* Grayscale filter isNeutralState implementation
|
|
* The filter is never neutral
|
|
* on the image
|
|
**/
|
|
isNeutralState: function() {
|
|
return false;
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Grayscale} Instance of fabric.Image.filters.Grayscale
|
|
*/
|
|
fabric.Image.filters.Grayscale.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Invert filter class
|
|
* @class fabric.Image.filters.Invert
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Invert();
|
|
* object.filters.push(filter);
|
|
* object.applyFilters(canvas.renderAll.bind(canvas));
|
|
*/
|
|
filters.Invert = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Invert.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Invert',
|
|
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform int uInvert;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'if (uInvert == 1) {\n' +
|
|
'gl_FragColor = vec4(1.0 - color.r,1.0 -color.g,1.0 -color.b,color.a);\n' +
|
|
'} else {\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Filter invert. if false, does nothing
|
|
* @param {Boolean} invert
|
|
* @default
|
|
*/
|
|
invert: true,
|
|
|
|
mainParameter: 'invert',
|
|
|
|
/**
|
|
* Apply the Invert operation to a Uint8Array representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8Array to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
data = imageData.data, i,
|
|
len = data.length;
|
|
for (i = 0; i < len; i += 4) {
|
|
data[i] = 255 - data[i];
|
|
data[i + 1] = 255 - data[i + 1];
|
|
data[i + 2] = 255 - data[i + 2];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Invert filter isNeutralState implementation
|
|
* Used only in image applyFilters to discard filters that will not have an effect
|
|
* on the image
|
|
* @param {Object} options
|
|
**/
|
|
isNeutralState: function() {
|
|
return !this.invert;
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uInvert: gl.getUniformLocation(program, 'uInvert'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1i(uniformLocations.uInvert, this.invert);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Invert} Instance of fabric.Image.filters.Invert
|
|
*/
|
|
fabric.Image.filters.Invert.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Noise filter class
|
|
* @class fabric.Image.filters.Noise
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Noise#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Noise({
|
|
* noise: 700
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
*/
|
|
filters.Noise = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Noise.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Noise',
|
|
|
|
/**
|
|
* Fragment source for the noise program
|
|
*/
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'uniform float uNoise;\n' +
|
|
'uniform float uSeed;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'float rand(vec2 co, float seed, float vScale) {\n' +
|
|
'return fract(sin(dot(co.xy * vScale ,vec2(12.9898 , 78.233))) * 43758.5453 * (seed + 0.01) / 2.0);\n' +
|
|
'}\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'color.rgb += (0.5 - rand(vTexCoord, uSeed, 0.1 / uStepH)) * uNoise;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Describe the property that is the filter parameter
|
|
* @param {String} m
|
|
* @default
|
|
*/
|
|
mainParameter: 'noise',
|
|
|
|
/**
|
|
* Noise value, from
|
|
* @param {Number} noise
|
|
* @default
|
|
*/
|
|
noise: 0,
|
|
|
|
/**
|
|
* Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
if (this.noise === 0) {
|
|
return;
|
|
}
|
|
var imageData = options.imageData,
|
|
data = imageData.data, i, len = data.length,
|
|
noise = this.noise, rand;
|
|
|
|
for (i = 0, len = data.length; i < len; i += 4) {
|
|
|
|
rand = (0.5 - Math.random()) * noise;
|
|
|
|
data[i] += rand;
|
|
data[i + 1] += rand;
|
|
data[i + 2] += rand;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uNoise: gl.getUniformLocation(program, 'uNoise'),
|
|
uSeed: gl.getUniformLocation(program, 'uSeed'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1f(uniformLocations.uNoise, this.noise / 255);
|
|
gl.uniform1f(uniformLocations.uSeed, Math.random());
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function() {
|
|
return extend(this.callSuper('toObject'), {
|
|
noise: this.noise
|
|
});
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Noise} Instance of fabric.Image.filters.Noise
|
|
*/
|
|
fabric.Image.filters.Noise.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Pixelate filter class
|
|
* @class fabric.Image.filters.Pixelate
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Pixelate#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Pixelate({
|
|
* blocksize: 8
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.Pixelate = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Pixelate.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Pixelate',
|
|
|
|
blocksize: 4,
|
|
|
|
mainParameter: 'blocksize',
|
|
|
|
/**
|
|
* Fragment source for the Pixelate program
|
|
*/
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uBlocksize;\n' +
|
|
'uniform float uStepW;\n' +
|
|
'uniform float uStepH;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'float blockW = uBlocksize * uStepW;\n' +
|
|
'float blockH = uBlocksize * uStepW;\n' +
|
|
'int posX = int(vTexCoord.x / blockW);\n' +
|
|
'int posY = int(vTexCoord.y / blockH);\n' +
|
|
'float fposX = float(posX);\n' +
|
|
'float fposY = float(posY);\n' +
|
|
'vec2 squareCoords = vec2(fposX * blockW, fposY * blockH);\n' +
|
|
'vec4 color = texture2D(uTexture, squareCoords);\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Apply the Pixelate operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
data = imageData.data,
|
|
iLen = imageData.height,
|
|
jLen = imageData.width,
|
|
index, i, j, r, g, b, a,
|
|
_i, _j, _iLen, _jLen;
|
|
|
|
for (i = 0; i < iLen; i += this.blocksize) {
|
|
for (j = 0; j < jLen; j += this.blocksize) {
|
|
|
|
index = (i * 4) * jLen + (j * 4);
|
|
|
|
r = data[index];
|
|
g = data[index + 1];
|
|
b = data[index + 2];
|
|
a = data[index + 3];
|
|
|
|
_iLen = Math.min(i + this.blocksize, iLen);
|
|
_jLen = Math.min(j + this.blocksize, jLen);
|
|
for (_i = i; _i < _iLen; _i++) {
|
|
for (_j = j; _j < _jLen; _j++) {
|
|
index = (_i * 4) * jLen + (_j * 4);
|
|
data[index] = r;
|
|
data[index + 1] = g;
|
|
data[index + 2] = b;
|
|
data[index + 3] = a;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Indicate when the filter is not gonna apply changes to the image
|
|
**/
|
|
isNeutralState: function() {
|
|
return this.blocksize === 1;
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uBlocksize: gl.getUniformLocation(program, 'uBlocksize'),
|
|
uStepW: gl.getUniformLocation(program, 'uStepW'),
|
|
uStepH: gl.getUniformLocation(program, 'uStepH'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1f(uniformLocations.uBlocksize, this.blocksize);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Pixelate} Instance of fabric.Image.filters.Pixelate
|
|
*/
|
|
fabric.Image.filters.Pixelate.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
extend = fabric.util.object.extend,
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Remove white filter class
|
|
* @class fabric.Image.filters.RemoveColor
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.RemoveColor#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.RemoveColor({
|
|
* threshold: 0.2,
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
*/
|
|
filters.RemoveColor = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.RemoveColor.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'RemoveColor',
|
|
|
|
/**
|
|
* Color to remove, in any format understood by fabric.Color.
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
color: '#FFFFFF',
|
|
|
|
/**
|
|
* Fragment source for the brightness program
|
|
*/
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform vec4 uLow;\n' +
|
|
'uniform vec4 uHigh;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'gl_FragColor = texture2D(uTexture, vTexCoord);\n' +
|
|
'if(all(greaterThan(gl_FragColor.rgb,uLow.rgb)) && all(greaterThan(uHigh.rgb,gl_FragColor.rgb))) {\n' +
|
|
'gl_FragColor.a = 0.0;\n' +
|
|
'}\n' +
|
|
'}',
|
|
|
|
/**
|
|
* distance to actual color, as value up or down from each r,g,b
|
|
* between 0 and 1
|
|
**/
|
|
distance: 0.02,
|
|
|
|
/**
|
|
* For color to remove inside distance, use alpha channel for a smoother deletion
|
|
* NOT IMPLEMENTED YET
|
|
**/
|
|
useAlpha: false,
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.RemoveWhite.prototype
|
|
* @param {Object} [options] Options object
|
|
* @param {Number} [options.color=#RRGGBB] Threshold value
|
|
* @param {Number} [options.distance=10] Distance value
|
|
*/
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
data = imageData.data, i,
|
|
distance = this.distance * 255,
|
|
r, g, b,
|
|
source = new fabric.Color(this.color).getSource(),
|
|
lowC = [
|
|
source[0] - distance,
|
|
source[1] - distance,
|
|
source[2] - distance,
|
|
],
|
|
highC = [
|
|
source[0] + distance,
|
|
source[1] + distance,
|
|
source[2] + distance,
|
|
];
|
|
|
|
|
|
for (i = 0; i < data.length; i += 4) {
|
|
r = data[i];
|
|
g = data[i + 1];
|
|
b = data[i + 2];
|
|
|
|
if (r > lowC[0] &&
|
|
g > lowC[1] &&
|
|
b > lowC[2] &&
|
|
r < highC[0] &&
|
|
g < highC[1] &&
|
|
b < highC[2]) {
|
|
data[i + 3] = 0;
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uLow: gl.getUniformLocation(program, 'uLow'),
|
|
uHigh: gl.getUniformLocation(program, 'uHigh'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
var source = new fabric.Color(this.color).getSource(),
|
|
distance = parseFloat(this.distance),
|
|
lowC = [
|
|
0 + source[0] / 255 - distance,
|
|
0 + source[1] / 255 - distance,
|
|
0 + source[2] / 255 - distance,
|
|
1
|
|
],
|
|
highC = [
|
|
source[0] / 255 + distance,
|
|
source[1] / 255 + distance,
|
|
source[2] / 255 + distance,
|
|
1
|
|
];
|
|
gl.uniform4fv(uniformLocations.uLow, lowC);
|
|
gl.uniform4fv(uniformLocations.uHigh, highC);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function() {
|
|
return extend(this.callSuper('toObject'), {
|
|
color: this.color,
|
|
distance: this.distance
|
|
});
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.RemoveColor} Instance of fabric.Image.filters.RemoveWhite
|
|
*/
|
|
fabric.Image.filters.RemoveColor.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
var matrices = {
|
|
Brownie: [
|
|
0.59970,0.34553,-0.27082,0,0.186,
|
|
-0.03770,0.86095,0.15059,0,-0.1449,
|
|
0.24113,-0.07441,0.44972,0,-0.02965,
|
|
0,0,0,1,0
|
|
],
|
|
Vintage: [
|
|
0.62793,0.32021,-0.03965,0,0.03784,
|
|
0.02578,0.64411,0.03259,0,0.02926,
|
|
0.04660,-0.08512,0.52416,0,0.02023,
|
|
0,0,0,1,0
|
|
],
|
|
Kodachrome: [
|
|
1.12855,-0.39673,-0.03992,0,0.24991,
|
|
-0.16404,1.08352,-0.05498,0,0.09698,
|
|
-0.16786,-0.56034,1.60148,0,0.13972,
|
|
0,0,0,1,0
|
|
],
|
|
Technicolor: [
|
|
1.91252,-0.85453,-0.09155,0,0.04624,
|
|
-0.30878,1.76589,-0.10601,0,-0.27589,
|
|
-0.23110,-0.75018,1.84759,0,0.12137,
|
|
0,0,0,1,0
|
|
],
|
|
Polaroid: [
|
|
1.438,-0.062,-0.062,0,0,
|
|
-0.122,1.378,-0.122,0,0,
|
|
-0.016,-0.016,1.483,0,0,
|
|
0,0,0,1,0
|
|
],
|
|
Sepia: [
|
|
0.393, 0.769, 0.189, 0, 0,
|
|
0.349, 0.686, 0.168, 0, 0,
|
|
0.272, 0.534, 0.131, 0, 0,
|
|
0, 0, 0, 1, 0
|
|
],
|
|
BlackWhite: [
|
|
1.5, 1.5, 1.5, 0, -1,
|
|
1.5, 1.5, 1.5, 0, -1,
|
|
1.5, 1.5, 1.5, 0, -1,
|
|
0, 0, 0, 1, 0,
|
|
]
|
|
};
|
|
|
|
for (var key in matrices) {
|
|
filters[key] = createClass(filters.ColorMatrix, /** @lends fabric.Image.filters.Sepia.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: key,
|
|
|
|
/**
|
|
* Colormatrix for the effect
|
|
* array of 20 floats. Numbers in positions 4, 9, 14, 19 loose meaning
|
|
* outside the -1, 1 range.
|
|
* @param {Array} matrix array of 20 numbers.
|
|
* @default
|
|
*/
|
|
matrix: matrices[key],
|
|
|
|
/**
|
|
* Lock the matrix export for this kind of static, parameter less filters.
|
|
*/
|
|
mainParameter: false,
|
|
/**
|
|
* Lock the colormatrix on the color part, skipping alpha
|
|
*/
|
|
colorsOnly: true,
|
|
|
|
});
|
|
fabric.Image.filters[key].fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
}
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
'use strict';
|
|
|
|
var fabric = global.fabric,
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Color Blend filter class
|
|
* @class fabric.Image.filter.BlendColor
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @example
|
|
* var filter = new fabric.Image.filters.BlendColor({
|
|
* color: '#000',
|
|
* mode: 'multiply'
|
|
* });
|
|
*
|
|
* var filter = new fabric.Image.filters.BlendImage({
|
|
* image: fabricImageObject,
|
|
* mode: 'multiply',
|
|
* alpha: 0.5
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
*/
|
|
|
|
filters.BlendColor = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Blend.prototype */ {
|
|
type: 'BlendColor',
|
|
|
|
/**
|
|
* Color to make the blend operation with. default to a reddish color since black or white
|
|
* gives always strong result.
|
|
**/
|
|
color: '#F95C63',
|
|
|
|
/**
|
|
* Blend mode for the filter: one of multiply, add, diff, screen, subtract,
|
|
* darken, lighten, overlay, exclusion, tint.
|
|
**/
|
|
mode: 'multiply',
|
|
|
|
/**
|
|
* alpha value. represent the strength of the blend color operation.
|
|
**/
|
|
alpha: 1,
|
|
|
|
/**
|
|
* Fragment source for the Multiply program
|
|
*/
|
|
fragmentSource: {
|
|
multiply: 'gl_FragColor.rgb *= uColor.rgb;\n',
|
|
screen: 'gl_FragColor.rgb = 1.0 - (1.0 - gl_FragColor.rgb) * (1.0 - uColor.rgb);\n',
|
|
add: 'gl_FragColor.rgb += uColor.rgb;\n',
|
|
diff: 'gl_FragColor.rgb = abs(gl_FragColor.rgb - uColor.rgb);\n',
|
|
subtract: 'gl_FragColor.rgb -= uColor.rgb;\n',
|
|
lighten: 'gl_FragColor.rgb = max(gl_FragColor.rgb, uColor.rgb);\n',
|
|
darken: 'gl_FragColor.rgb = min(gl_FragColor.rgb, uColor.rgb);\n',
|
|
exclusion: 'gl_FragColor.rgb += uColor.rgb - 2.0 * (uColor.rgb * gl_FragColor.rgb);\n',
|
|
overlay: 'if (uColor.r < 0.5) {\n' +
|
|
'gl_FragColor.r *= 2.0 * uColor.r;\n' +
|
|
'} else {\n' +
|
|
'gl_FragColor.r = 1.0 - 2.0 * (1.0 - gl_FragColor.r) * (1.0 - uColor.r);\n' +
|
|
'}\n' +
|
|
'if (uColor.g < 0.5) {\n' +
|
|
'gl_FragColor.g *= 2.0 * uColor.g;\n' +
|
|
'} else {\n' +
|
|
'gl_FragColor.g = 1.0 - 2.0 * (1.0 - gl_FragColor.g) * (1.0 - uColor.g);\n' +
|
|
'}\n' +
|
|
'if (uColor.b < 0.5) {\n' +
|
|
'gl_FragColor.b *= 2.0 * uColor.b;\n' +
|
|
'} else {\n' +
|
|
'gl_FragColor.b = 1.0 - 2.0 * (1.0 - gl_FragColor.b) * (1.0 - uColor.b);\n' +
|
|
'}\n',
|
|
tint: 'gl_FragColor.rgb *= (1.0 - uColor.a);\n' +
|
|
'gl_FragColor.rgb += uColor.rgb;\n',
|
|
},
|
|
|
|
/**
|
|
* build the fragment source for the filters, joining the common part with
|
|
* the specific one.
|
|
* @param {String} mode the mode of the filter, a key of this.fragmentSource
|
|
* @return {String} the source to be compiled
|
|
* @private
|
|
*/
|
|
buildSource: function(mode) {
|
|
return 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform vec4 uColor;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'if (color.a > 0.0) {\n' +
|
|
this.fragmentSource[mode] +
|
|
'}\n' +
|
|
'}';
|
|
},
|
|
|
|
/**
|
|
* Retrieves the cached shader.
|
|
* @param {Object} options
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
retrieveShader: function(options) {
|
|
var cacheKey = this.type + '_' + this.mode, shaderSource;
|
|
if (!options.programCache.hasOwnProperty(cacheKey)) {
|
|
shaderSource = this.buildSource(this.mode);
|
|
options.programCache[cacheKey] = this.createProgram(options.context, shaderSource);
|
|
}
|
|
return options.programCache[cacheKey];
|
|
},
|
|
|
|
/**
|
|
* Apply the Blend operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
data = imageData.data, iLen = data.length,
|
|
tr, tg, tb,
|
|
r, g, b,
|
|
source, alpha1 = 1 - this.alpha;
|
|
|
|
source = new fabric.Color(this.color).getSource();
|
|
tr = source[0] * this.alpha;
|
|
tg = source[1] * this.alpha;
|
|
tb = source[2] * this.alpha;
|
|
|
|
for (var i = 0; i < iLen; i += 4) {
|
|
|
|
r = data[i];
|
|
g = data[i + 1];
|
|
b = data[i + 2];
|
|
|
|
switch (this.mode) {
|
|
case 'multiply':
|
|
data[i] = r * tr / 255;
|
|
data[i + 1] = g * tg / 255;
|
|
data[i + 2] = b * tb / 255;
|
|
break;
|
|
case 'screen':
|
|
data[i] = 255 - (255 - r) * (255 - tr) / 255;
|
|
data[i + 1] = 255 - (255 - g) * (255 - tg) / 255;
|
|
data[i + 2] = 255 - (255 - b) * (255 - tb) / 255;
|
|
break;
|
|
case 'add':
|
|
data[i] = r + tr;
|
|
data[i + 1] = g + tg;
|
|
data[i + 2] = b + tb;
|
|
break;
|
|
case 'diff':
|
|
case 'difference':
|
|
data[i] = Math.abs(r - tr);
|
|
data[i + 1] = Math.abs(g - tg);
|
|
data[i + 2] = Math.abs(b - tb);
|
|
break;
|
|
case 'subtract':
|
|
data[i] = r - tr;
|
|
data[i + 1] = g - tg;
|
|
data[i + 2] = b - tb;
|
|
break;
|
|
case 'darken':
|
|
data[i] = Math.min(r, tr);
|
|
data[i + 1] = Math.min(g, tg);
|
|
data[i + 2] = Math.min(b, tb);
|
|
break;
|
|
case 'lighten':
|
|
data[i] = Math.max(r, tr);
|
|
data[i + 1] = Math.max(g, tg);
|
|
data[i + 2] = Math.max(b, tb);
|
|
break;
|
|
case 'overlay':
|
|
data[i] = tr < 128 ? (2 * r * tr / 255) : (255 - 2 * (255 - r) * (255 - tr) / 255);
|
|
data[i + 1] = tg < 128 ? (2 * g * tg / 255) : (255 - 2 * (255 - g) * (255 - tg) / 255);
|
|
data[i + 2] = tb < 128 ? (2 * b * tb / 255) : (255 - 2 * (255 - b) * (255 - tb) / 255);
|
|
break;
|
|
case 'exclusion':
|
|
data[i] = tr + r - ((2 * tr * r) / 255);
|
|
data[i + 1] = tg + g - ((2 * tg * g) / 255);
|
|
data[i + 2] = tb + b - ((2 * tb * b) / 255);
|
|
break;
|
|
case 'tint':
|
|
data[i] = tr + r * alpha1;
|
|
data[i + 1] = tg + g * alpha1;
|
|
data[i + 2] = tb + b * alpha1;
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uColor: gl.getUniformLocation(program, 'uColor'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
var source = new fabric.Color(this.color).getSource();
|
|
source[0] = this.alpha * source[0] / 255;
|
|
source[1] = this.alpha * source[1] / 255;
|
|
source[2] = this.alpha * source[2] / 255;
|
|
source[3] = this.alpha;
|
|
gl.uniform4fv(uniformLocations.uColor, source);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function() {
|
|
return {
|
|
type: this.type,
|
|
color: this.color,
|
|
mode: this.mode,
|
|
alpha: this.alpha
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.BlendColor} Instance of fabric.Image.filters.BlendColor
|
|
*/
|
|
fabric.Image.filters.BlendColor.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
'use strict';
|
|
|
|
var fabric = global.fabric,
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Image Blend filter class
|
|
* @class fabric.Image.filter.BlendImage
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @example
|
|
* var filter = new fabric.Image.filters.BlendColor({
|
|
* color: '#000',
|
|
* mode: 'multiply'
|
|
* });
|
|
*
|
|
* var filter = new fabric.Image.filters.BlendImage({
|
|
* image: fabricImageObject,
|
|
* mode: 'multiply',
|
|
* alpha: 0.5
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
*/
|
|
|
|
filters.BlendImage = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.BlendImage.prototype */ {
|
|
type: 'BlendImage',
|
|
|
|
/**
|
|
* Color to make the blend operation with. default to a reddish color since black or white
|
|
* gives always strong result.
|
|
**/
|
|
image: null,
|
|
|
|
/**
|
|
* Blend mode for the filter: one of multiply, add, diff, screen, subtract,
|
|
* darken, lighten, overlay, exclusion, tint.
|
|
**/
|
|
mode: 'multiply',
|
|
|
|
/**
|
|
* alpha value. represent the strength of the blend image operation.
|
|
* not implemented.
|
|
**/
|
|
alpha: 1,
|
|
|
|
vertexSource: 'attribute vec2 aPosition;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'varying vec2 vTexCoord2;\n' +
|
|
'uniform mat3 uTransformMatrix;\n' +
|
|
'void main() {\n' +
|
|
'vTexCoord = aPosition;\n' +
|
|
'vTexCoord2 = (uTransformMatrix * vec3(aPosition, 1.0)).xy;\n' +
|
|
'gl_Position = vec4(aPosition * 2.0 - 1.0, 0.0, 1.0);\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Fragment source for the Multiply program
|
|
*/
|
|
fragmentSource: {
|
|
multiply: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform sampler2D uImage;\n' +
|
|
'uniform vec4 uColor;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'varying vec2 vTexCoord2;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'vec4 color2 = texture2D(uImage, vTexCoord2);\n' +
|
|
'color.rgba *= color2.rgba;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
mask: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform sampler2D uImage;\n' +
|
|
'uniform vec4 uColor;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'varying vec2 vTexCoord2;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'vec4 color2 = texture2D(uImage, vTexCoord2);\n' +
|
|
'color.a = color2.a;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
},
|
|
|
|
/**
|
|
* Retrieves the cached shader.
|
|
* @param {Object} options
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
retrieveShader: function(options) {
|
|
var cacheKey = this.type + '_' + this.mode;
|
|
var shaderSource = this.fragmentSource[this.mode];
|
|
if (!options.programCache.hasOwnProperty(cacheKey)) {
|
|
options.programCache[cacheKey] = this.createProgram(options.context, shaderSource);
|
|
}
|
|
return options.programCache[cacheKey];
|
|
},
|
|
|
|
applyToWebGL: function(options) {
|
|
// load texture to blend.
|
|
var gl = options.context,
|
|
texture = this.createTexture(options.filterBackend, this.image);
|
|
this.bindAdditionalTexture(gl, texture, gl.TEXTURE1);
|
|
this.callSuper('applyToWebGL', options);
|
|
this.unbindAdditionalTexture(gl, gl.TEXTURE1);
|
|
},
|
|
|
|
createTexture: function(backend, image) {
|
|
return backend.getCachedTexture(image.cacheKey, image._element);
|
|
},
|
|
|
|
/**
|
|
* Calculate a transformMatrix to adapt the image to blend over
|
|
* @param {Object} options
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
calculateMatrix: function() {
|
|
var image = this.image,
|
|
width = image._element.width,
|
|
height = image._element.height;
|
|
return [
|
|
1 / image.scaleX, 0, 0,
|
|
0, 1 / image.scaleY, 0,
|
|
-image.left / width, -image.top / height, 1
|
|
];
|
|
},
|
|
|
|
/**
|
|
* Apply the Blend operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
resources = options.filterBackend.resources,
|
|
data = imageData.data, iLen = data.length,
|
|
width = imageData.width,
|
|
height = imageData.height,
|
|
tr, tg, tb, ta,
|
|
r, g, b, a,
|
|
canvas1, context, image = this.image, blendData;
|
|
|
|
if (!resources.blendImage) {
|
|
resources.blendImage = fabric.util.createCanvasElement();
|
|
}
|
|
canvas1 = resources.blendImage;
|
|
context = canvas1.getContext('2d');
|
|
if (canvas1.width !== width || canvas1.height !== height) {
|
|
canvas1.width = width;
|
|
canvas1.height = height;
|
|
}
|
|
else {
|
|
context.clearRect(0, 0, width, height);
|
|
}
|
|
context.setTransform(image.scaleX, 0, 0, image.scaleY, image.left, image.top);
|
|
context.drawImage(image._element, 0, 0, width, height);
|
|
blendData = context.getImageData(0, 0, width, height).data;
|
|
for (var i = 0; i < iLen; i += 4) {
|
|
|
|
r = data[i];
|
|
g = data[i + 1];
|
|
b = data[i + 2];
|
|
a = data[i + 3];
|
|
|
|
tr = blendData[i];
|
|
tg = blendData[i + 1];
|
|
tb = blendData[i + 2];
|
|
ta = blendData[i + 3];
|
|
|
|
switch (this.mode) {
|
|
case 'multiply':
|
|
data[i] = r * tr / 255;
|
|
data[i + 1] = g * tg / 255;
|
|
data[i + 2] = b * tb / 255;
|
|
data[i + 3] = a * ta / 255;
|
|
break;
|
|
case 'mask':
|
|
data[i + 3] = ta;
|
|
break;
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uTransformMatrix: gl.getUniformLocation(program, 'uTransformMatrix'),
|
|
uImage: gl.getUniformLocation(program, 'uImage'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
var matrix = this.calculateMatrix();
|
|
gl.uniform1i(uniformLocations.uImage, 1); // texture unit 1.
|
|
gl.uniformMatrix3fv(uniformLocations.uTransformMatrix, false, matrix);
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function() {
|
|
return {
|
|
type: this.type,
|
|
image: this.image && this.image.toObject(),
|
|
mode: this.mode,
|
|
alpha: this.alpha
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} callback to be invoked after filter creation
|
|
* @return {fabric.Image.filters.BlendImage} Instance of fabric.Image.filters.BlendImage
|
|
*/
|
|
fabric.Image.filters.BlendImage.fromObject = function(object, callback) {
|
|
fabric.Image.fromObject(object.image, function(image) {
|
|
var options = fabric.util.object.clone(object);
|
|
options.image = image;
|
|
callback(new fabric.Image.filters.BlendImage(options));
|
|
});
|
|
};
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }), pow = Math.pow, floor = Math.floor,
|
|
sqrt = Math.sqrt, abs = Math.abs, round = Math.round, sin = Math.sin,
|
|
ceil = Math.ceil,
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Resize image filter class
|
|
* @class fabric.Image.filters.Resize
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Resize();
|
|
* object.filters.push(filter);
|
|
* object.applyFilters(canvas.renderAll.bind(canvas));
|
|
*/
|
|
filters.Resize = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Resize.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Resize',
|
|
|
|
/**
|
|
* Resize type
|
|
* for webgl resizeType is just lanczos, for canvas2d can be:
|
|
* bilinear, hermite, sliceHack, lanczos.
|
|
* @param {String} resizeType
|
|
* @default
|
|
*/
|
|
resizeType: 'hermite',
|
|
|
|
/**
|
|
* Scale factor for resizing, x axis
|
|
* @param {Number} scaleX
|
|
* @default
|
|
*/
|
|
scaleX: 1,
|
|
|
|
/**
|
|
* Scale factor for resizing, y axis
|
|
* @param {Number} scaleY
|
|
* @default
|
|
*/
|
|
scaleY: 1,
|
|
|
|
/**
|
|
* LanczosLobes parameter for lanczos filter, valid for resizeType lanczos
|
|
* @param {Number} lanczosLobes
|
|
* @default
|
|
*/
|
|
lanczosLobes: 3,
|
|
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uDelta: gl.getUniformLocation(program, 'uDelta'),
|
|
uTaps: gl.getUniformLocation(program, 'uTaps'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform2fv(uniformLocations.uDelta, this.horizontal ? [1 / this.width, 0] : [0, 1 / this.height]);
|
|
gl.uniform1fv(uniformLocations.uTaps, this.taps);
|
|
},
|
|
|
|
/**
|
|
* Retrieves the cached shader.
|
|
* @param {Object} options
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
retrieveShader: function(options) {
|
|
var filterWindow = this.getFilterWindow(), cacheKey = this.type + '_' + filterWindow;
|
|
if (!options.programCache.hasOwnProperty(cacheKey)) {
|
|
var fragmentShader = this.generateShader(filterWindow);
|
|
options.programCache[cacheKey] = this.createProgram(options.context, fragmentShader);
|
|
}
|
|
return options.programCache[cacheKey];
|
|
},
|
|
|
|
getFilterWindow: function() {
|
|
var scale = this.tempScale;
|
|
return Math.ceil(this.lanczosLobes / scale);
|
|
},
|
|
|
|
getTaps: function() {
|
|
var lobeFunction = this.lanczosCreate(this.lanczosLobes), scale = this.tempScale,
|
|
filterWindow = this.getFilterWindow(), taps = new Array(filterWindow);
|
|
for (var i = 1; i <= filterWindow; i++) {
|
|
taps[i - 1] = lobeFunction(i * scale);
|
|
}
|
|
return taps;
|
|
},
|
|
|
|
/**
|
|
* Generate vertex and shader sources from the necessary steps numbers
|
|
* @param {Number} filterWindow
|
|
*/
|
|
generateShader: function(filterWindow) {
|
|
var offsets = new Array(filterWindow),
|
|
fragmentShader = this.fragmentSourceTOP, filterWindow;
|
|
|
|
for (var i = 1; i <= filterWindow; i++) {
|
|
offsets[i - 1] = i + '.0 * uDelta';
|
|
}
|
|
|
|
fragmentShader += 'uniform float uTaps[' + filterWindow + '];\n';
|
|
fragmentShader += 'void main() {\n';
|
|
fragmentShader += ' vec4 color = texture2D(uTexture, vTexCoord);\n';
|
|
fragmentShader += ' float sum = 1.0;\n';
|
|
|
|
offsets.forEach(function(offset, i) {
|
|
fragmentShader += ' color += texture2D(uTexture, vTexCoord + ' + offset + ') * uTaps[' + i + '];\n';
|
|
fragmentShader += ' color += texture2D(uTexture, vTexCoord - ' + offset + ') * uTaps[' + i + '];\n';
|
|
fragmentShader += ' sum += 2.0 * uTaps[' + i + '];\n';
|
|
});
|
|
fragmentShader += ' gl_FragColor = color / sum;\n';
|
|
fragmentShader += '}';
|
|
return fragmentShader;
|
|
},
|
|
|
|
fragmentSourceTOP: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform vec2 uDelta;\n' +
|
|
'varying vec2 vTexCoord;\n',
|
|
|
|
/**
|
|
* Apply the resize filter to the image
|
|
* Determines whether to use WebGL or Canvas2D based on the options.webgl flag.
|
|
*
|
|
* @param {Object} options
|
|
* @param {Number} options.passes The number of filters remaining to be executed
|
|
* @param {Boolean} options.webgl Whether to use webgl to render the filter.
|
|
* @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered.
|
|
* @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn.
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
applyTo: function(options) {
|
|
if (options.webgl) {
|
|
options.passes++;
|
|
this.width = options.sourceWidth;
|
|
this.horizontal = true;
|
|
this.dW = Math.round(this.width * this.scaleX);
|
|
this.dH = options.sourceHeight;
|
|
this.tempScale = this.dW / this.width;
|
|
this.taps = this.getTaps();
|
|
options.destinationWidth = this.dW;
|
|
this._setupFrameBuffer(options);
|
|
this.applyToWebGL(options);
|
|
this._swapTextures(options);
|
|
options.sourceWidth = options.destinationWidth;
|
|
|
|
this.height = options.sourceHeight;
|
|
this.horizontal = false;
|
|
this.dH = Math.round(this.height * this.scaleY);
|
|
this.tempScale = this.dH / this.height;
|
|
this.taps = this.getTaps();
|
|
options.destinationHeight = this.dH;
|
|
this._setupFrameBuffer(options);
|
|
this.applyToWebGL(options);
|
|
this._swapTextures(options);
|
|
options.sourceHeight = options.destinationHeight;
|
|
}
|
|
else {
|
|
this.applyTo2d(options);
|
|
}
|
|
},
|
|
|
|
isNeutralState: function() {
|
|
return this.scaleX === 1 && this.scaleY === 1;
|
|
},
|
|
|
|
lanczosCreate: function(lobes) {
|
|
return function(x) {
|
|
if (x >= lobes || x <= -lobes) {
|
|
return 0.0;
|
|
}
|
|
if (x < 1.19209290E-07 && x > -1.19209290E-07) {
|
|
return 1.0;
|
|
}
|
|
x *= Math.PI;
|
|
var xx = x / lobes;
|
|
return (sin(x) / x) * sin(xx) / xx;
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @memberOf fabric.Image.filters.Resize.prototype
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
* @param {Number} scaleX
|
|
* @param {Number} scaleY
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData,
|
|
scaleX = this.scaleX,
|
|
scaleY = this.scaleY;
|
|
|
|
this.rcpScaleX = 1 / scaleX;
|
|
this.rcpScaleY = 1 / scaleY;
|
|
|
|
var oW = imageData.width, oH = imageData.height,
|
|
dW = round(oW * scaleX), dH = round(oH * scaleY),
|
|
newData;
|
|
|
|
if (this.resizeType === 'sliceHack') {
|
|
newData = this.sliceByTwo(options, oW, oH, dW, dH);
|
|
}
|
|
else if (this.resizeType === 'hermite') {
|
|
newData = this.hermiteFastResize(options, oW, oH, dW, dH);
|
|
}
|
|
else if (this.resizeType === 'bilinear') {
|
|
newData = this.bilinearFiltering(options, oW, oH, dW, dH);
|
|
}
|
|
else if (this.resizeType === 'lanczos') {
|
|
newData = this.lanczosResize(options, oW, oH, dW, dH);
|
|
}
|
|
options.imageData = newData;
|
|
},
|
|
|
|
/**
|
|
* Filter sliceByTwo
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
* @param {Number} oW Original Width
|
|
* @param {Number} oH Original Height
|
|
* @param {Number} dW Destination Width
|
|
* @param {Number} dH Destination Height
|
|
* @returns {ImageData}
|
|
*/
|
|
sliceByTwo: function(options, oW, oH, dW, dH) {
|
|
var imageData = options.imageData,
|
|
mult = 0.5, doneW = false, doneH = false, stepW = oW * mult,
|
|
stepH = oH * mult, resources = fabric.filterBackend.resources,
|
|
tmpCanvas, ctx, sX = 0, sY = 0, dX = oW, dY = 0;
|
|
if (!resources.sliceByTwo) {
|
|
resources.sliceByTwo = document.createElement('canvas');
|
|
}
|
|
tmpCanvas = resources.sliceByTwo;
|
|
if (tmpCanvas.width < oW * 1.5 || tmpCanvas.height < oH) {
|
|
tmpCanvas.width = oW * 1.5;
|
|
tmpCanvas.height = oH;
|
|
}
|
|
ctx = tmpCanvas.getContext('2d');
|
|
ctx.clearRect(0, 0, oW * 1.5, oH);
|
|
ctx.putImageData(imageData, 0, 0);
|
|
|
|
dW = floor(dW);
|
|
dH = floor(dH);
|
|
|
|
while (!doneW || !doneH) {
|
|
oW = stepW;
|
|
oH = stepH;
|
|
if (dW < floor(stepW * mult)) {
|
|
stepW = floor(stepW * mult);
|
|
}
|
|
else {
|
|
stepW = dW;
|
|
doneW = true;
|
|
}
|
|
if (dH < floor(stepH * mult)) {
|
|
stepH = floor(stepH * mult);
|
|
}
|
|
else {
|
|
stepH = dH;
|
|
doneH = true;
|
|
}
|
|
ctx.drawImage(tmpCanvas, sX, sY, oW, oH, dX, dY, stepW, stepH);
|
|
sX = dX;
|
|
sY = dY;
|
|
dY += stepH;
|
|
}
|
|
return ctx.getImageData(sX, sY, dW, dH);
|
|
},
|
|
|
|
/**
|
|
* Filter lanczosResize
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
* @param {Number} oW Original Width
|
|
* @param {Number} oH Original Height
|
|
* @param {Number} dW Destination Width
|
|
* @param {Number} dH Destination Height
|
|
* @returns {ImageData}
|
|
*/
|
|
lanczosResize: function(options, oW, oH, dW, dH) {
|
|
|
|
function process(u) {
|
|
var v, i, weight, idx, a, red, green,
|
|
blue, alpha, fX, fY;
|
|
center.x = (u + 0.5) * ratioX;
|
|
icenter.x = floor(center.x);
|
|
for (v = 0; v < dH; v++) {
|
|
center.y = (v + 0.5) * ratioY;
|
|
icenter.y = floor(center.y);
|
|
a = 0; red = 0; green = 0; blue = 0; alpha = 0;
|
|
for (i = icenter.x - range2X; i <= icenter.x + range2X; i++) {
|
|
if (i < 0 || i >= oW) {
|
|
continue;
|
|
}
|
|
fX = floor(1000 * abs(i - center.x));
|
|
if (!cacheLanc[fX]) {
|
|
cacheLanc[fX] = { };
|
|
}
|
|
for (var j = icenter.y - range2Y; j <= icenter.y + range2Y; j++) {
|
|
if (j < 0 || j >= oH) {
|
|
continue;
|
|
}
|
|
fY = floor(1000 * abs(j - center.y));
|
|
if (!cacheLanc[fX][fY]) {
|
|
cacheLanc[fX][fY] = lanczos(sqrt(pow(fX * rcpRatioX, 2) + pow(fY * rcpRatioY, 2)) / 1000);
|
|
}
|
|
weight = cacheLanc[fX][fY];
|
|
if (weight > 0) {
|
|
idx = (j * oW + i) * 4;
|
|
a += weight;
|
|
red += weight * srcData[idx];
|
|
green += weight * srcData[idx + 1];
|
|
blue += weight * srcData[idx + 2];
|
|
alpha += weight * srcData[idx + 3];
|
|
}
|
|
}
|
|
}
|
|
idx = (v * dW + u) * 4;
|
|
destData[idx] = red / a;
|
|
destData[idx + 1] = green / a;
|
|
destData[idx + 2] = blue / a;
|
|
destData[idx + 3] = alpha / a;
|
|
}
|
|
|
|
if (++u < dW) {
|
|
return process(u);
|
|
}
|
|
else {
|
|
return destImg;
|
|
}
|
|
}
|
|
|
|
var srcData = options.imageData.data,
|
|
destImg = options.ctx.createImageData(dW, dH),
|
|
destData = destImg.data,
|
|
lanczos = this.lanczosCreate(this.lanczosLobes),
|
|
ratioX = this.rcpScaleX, ratioY = this.rcpScaleY,
|
|
rcpRatioX = 2 / this.rcpScaleX, rcpRatioY = 2 / this.rcpScaleY,
|
|
range2X = ceil(ratioX * this.lanczosLobes / 2),
|
|
range2Y = ceil(ratioY * this.lanczosLobes / 2),
|
|
cacheLanc = { }, center = { }, icenter = { };
|
|
|
|
return process(0);
|
|
},
|
|
|
|
/**
|
|
* bilinearFiltering
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
* @param {Number} oW Original Width
|
|
* @param {Number} oH Original Height
|
|
* @param {Number} dW Destination Width
|
|
* @param {Number} dH Destination Height
|
|
* @returns {ImageData}
|
|
*/
|
|
bilinearFiltering: function(options, oW, oH, dW, dH) {
|
|
var a, b, c, d, x, y, i, j, xDiff, yDiff, chnl,
|
|
color, offset = 0, origPix, ratioX = this.rcpScaleX,
|
|
ratioY = this.rcpScaleY,
|
|
w4 = 4 * (oW - 1), img = options.imageData,
|
|
pixels = img.data, destImage = options.ctx.createImageData(dW, dH),
|
|
destPixels = destImage.data;
|
|
for (i = 0; i < dH; i++) {
|
|
for (j = 0; j < dW; j++) {
|
|
x = floor(ratioX * j);
|
|
y = floor(ratioY * i);
|
|
xDiff = ratioX * j - x;
|
|
yDiff = ratioY * i - y;
|
|
origPix = 4 * (y * oW + x);
|
|
|
|
for (chnl = 0; chnl < 4; chnl++) {
|
|
a = pixels[origPix + chnl];
|
|
b = pixels[origPix + 4 + chnl];
|
|
c = pixels[origPix + w4 + chnl];
|
|
d = pixels[origPix + w4 + 4 + chnl];
|
|
color = a * (1 - xDiff) * (1 - yDiff) + b * xDiff * (1 - yDiff) +
|
|
c * yDiff * (1 - xDiff) + d * xDiff * yDiff;
|
|
destPixels[offset++] = color;
|
|
}
|
|
}
|
|
}
|
|
return destImage;
|
|
},
|
|
|
|
/**
|
|
* hermiteFastResize
|
|
* @param {Object} canvasEl Canvas element to apply filter to
|
|
* @param {Number} oW Original Width
|
|
* @param {Number} oH Original Height
|
|
* @param {Number} dW Destination Width
|
|
* @param {Number} dH Destination Height
|
|
* @returns {ImageData}
|
|
*/
|
|
hermiteFastResize: function(options, oW, oH, dW, dH) {
|
|
var ratioW = this.rcpScaleX, ratioH = this.rcpScaleY,
|
|
ratioWHalf = ceil(ratioW / 2),
|
|
ratioHHalf = ceil(ratioH / 2),
|
|
img = options.imageData, data = img.data,
|
|
img2 = options.ctx.createImageData(dW, dH), data2 = img2.data;
|
|
for (var j = 0; j < dH; j++) {
|
|
for (var i = 0; i < dW; i++) {
|
|
var x2 = (i + j * dW) * 4, weight = 0, weights = 0, weightsAlpha = 0,
|
|
gxR = 0, gxG = 0, gxB = 0, gxA = 0, centerY = (j + 0.5) * ratioH;
|
|
for (var yy = floor(j * ratioH); yy < (j + 1) * ratioH; yy++) {
|
|
var dy = abs(centerY - (yy + 0.5)) / ratioHHalf,
|
|
centerX = (i + 0.5) * ratioW, w0 = dy * dy;
|
|
for (var xx = floor(i * ratioW); xx < (i + 1) * ratioW; xx++) {
|
|
var dx = abs(centerX - (xx + 0.5)) / ratioWHalf,
|
|
w = sqrt(w0 + dx * dx);
|
|
/* eslint-disable max-depth */
|
|
if (w > 1 && w < -1) {
|
|
continue;
|
|
}
|
|
//hermite filter
|
|
weight = 2 * w * w * w - 3 * w * w + 1;
|
|
if (weight > 0) {
|
|
dx = 4 * (xx + yy * oW);
|
|
//alpha
|
|
gxA += weight * data[dx + 3];
|
|
weightsAlpha += weight;
|
|
//colors
|
|
if (data[dx + 3] < 255) {
|
|
weight = weight * data[dx + 3] / 250;
|
|
}
|
|
gxR += weight * data[dx];
|
|
gxG += weight * data[dx + 1];
|
|
gxB += weight * data[dx + 2];
|
|
weights += weight;
|
|
}
|
|
/* eslint-enable max-depth */
|
|
}
|
|
}
|
|
data2[x2] = gxR / weights;
|
|
data2[x2 + 1] = gxG / weights;
|
|
data2[x2 + 2] = gxB / weights;
|
|
data2[x2 + 3] = gxA / weightsAlpha;
|
|
}
|
|
}
|
|
return img2;
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function() {
|
|
return {
|
|
type: this.type,
|
|
scaleX: this.scaleX,
|
|
scaleY: this.scaleY,
|
|
resizeType: this.resizeType,
|
|
lanczosLobes: this.lanczosLobes
|
|
};
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Resize} Instance of fabric.Image.filters.Resize
|
|
*/
|
|
fabric.Image.filters.Resize.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Contrast filter class
|
|
* @class fabric.Image.filters.Contrast
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Contrast#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Contrast({
|
|
* contrast: 0.25
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.Contrast = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Contrast.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Contrast',
|
|
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uContrast;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'float contrastF = 1.015 * (uContrast + 1.0) / (1.0 * (1.015 - uContrast));\n' +
|
|
'color.rgb = contrastF * (color.rgb - 0.5) + 0.5;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* contrast value, range from -1 to 1.
|
|
* @param {Number} contrast
|
|
* @default 0
|
|
*/
|
|
contrast: 0,
|
|
|
|
mainParameter: 'contrast',
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Contrast.prototype
|
|
* @param {Object} [options] Options object
|
|
* @param {Number} [options.contrast=0] Value to contrast the image up (-1...1)
|
|
*/
|
|
|
|
/**
|
|
* Apply the Contrast operation to a Uint8Array representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8Array to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
if (this.contrast === 0) {
|
|
return;
|
|
}
|
|
var imageData = options.imageData, i, len,
|
|
data = imageData.data, len = data.length,
|
|
contrast = Math.floor(this.contrast * 255),
|
|
contrastF = 259 * (contrast + 255) / (255 * (259 - contrast));
|
|
|
|
for (i = 0; i < len; i += 4) {
|
|
data[i] = contrastF * (data[i] - 128) + 128;
|
|
data[i + 1] = contrastF * (data[i + 1] - 128) + 128;
|
|
data[i + 2] = contrastF * (data[i + 2] - 128) + 128;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uContrast: gl.getUniformLocation(program, 'uContrast'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1f(uniformLocations.uContrast, this.contrast);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Contrast} Instance of fabric.Image.filters.Contrast
|
|
*/
|
|
fabric.Image.filters.Contrast.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Saturate filter class
|
|
* @class fabric.Image.filters.Saturation
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Saturation#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Saturation({
|
|
* saturation: 1
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.Saturation = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Saturation.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Saturation',
|
|
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uSaturation;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'float rgMax = max(color.r, color.g);\n' +
|
|
'float rgbMax = max(rgMax, color.b);\n' +
|
|
'color.r += rgbMax != color.r ? (rgbMax - color.r) * uSaturation : 0.00;\n' +
|
|
'color.g += rgbMax != color.g ? (rgbMax - color.g) * uSaturation : 0.00;\n' +
|
|
'color.b += rgbMax != color.b ? (rgbMax - color.b) * uSaturation : 0.00;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Saturation value, from -1 to 1.
|
|
* Increases/decreases the color saturation.
|
|
* A value of 0 has no effect.
|
|
*
|
|
* @param {Number} saturation
|
|
* @default
|
|
*/
|
|
saturation: 0,
|
|
|
|
mainParameter: 'saturation',
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Saturate.prototype
|
|
* @param {Object} [options] Options object
|
|
* @param {Number} [options.saturate=0] Value to saturate the image (-1...1)
|
|
*/
|
|
|
|
/**
|
|
* Apply the Saturation operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
if (this.saturation === 0) {
|
|
return;
|
|
}
|
|
var imageData = options.imageData,
|
|
data = imageData.data, len = data.length,
|
|
adjust = -this.saturation, i, max;
|
|
|
|
for (i = 0; i < len; i += 4) {
|
|
max = Math.max(data[i], data[i + 1], data[i + 2]);
|
|
data[i] += max !== data[i] ? (max - data[i]) * adjust : 0;
|
|
data[i + 1] += max !== data[i + 1] ? (max - data[i + 1]) * adjust : 0;
|
|
data[i + 2] += max !== data[i + 2] ? (max - data[i + 2]) * adjust : 0;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uSaturation: gl.getUniformLocation(program, 'uSaturation'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1f(uniformLocations.uSaturation, -this.saturation);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Saturation} Instance of fabric.Image.filters.Saturate
|
|
*/
|
|
fabric.Image.filters.Saturation.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Vibrance filter class
|
|
* @class fabric.Image.filters.Vibrance
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Vibrance#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Vibrance({
|
|
* vibrance: 1
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.Vibrance = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Vibrance.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Vibrance',
|
|
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform float uVibrance;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'float max = max(color.r, max(color.g, color.b));\n' +
|
|
'float avg = (color.r + color.g + color.b) / 3.0;\n' +
|
|
'float amt = (abs(max - avg) * 2.0) * uVibrance;\n' +
|
|
'color.r += max != color.r ? (max - color.r) * amt : 0.00;\n' +
|
|
'color.g += max != color.g ? (max - color.g) * amt : 0.00;\n' +
|
|
'color.b += max != color.b ? (max - color.b) * amt : 0.00;\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Vibrance value, from -1 to 1.
|
|
* Increases/decreases the saturation of more muted colors with less effect on saturated colors.
|
|
* A value of 0 has no effect.
|
|
*
|
|
* @param {Number} vibrance
|
|
* @default
|
|
*/
|
|
vibrance: 0,
|
|
|
|
mainParameter: 'vibrance',
|
|
|
|
/**
|
|
* Constructor
|
|
* @memberOf fabric.Image.filters.Vibrance.prototype
|
|
* @param {Object} [options] Options object
|
|
* @param {Number} [options.vibrance=0] Vibrance value for the image (between -1 and 1)
|
|
*/
|
|
|
|
/**
|
|
* Apply the Vibrance operation to a Uint8ClampedArray representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8ClampedArray to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
if (this.vibrance === 0) {
|
|
return;
|
|
}
|
|
var imageData = options.imageData,
|
|
data = imageData.data, len = data.length,
|
|
adjust = -this.vibrance, i, max, avg, amt;
|
|
|
|
for (i = 0; i < len; i += 4) {
|
|
max = Math.max(data[i], data[i + 1], data[i + 2]);
|
|
avg = (data[i] + data[i + 1] + data[i + 2]) / 3;
|
|
amt = ((Math.abs(max - avg) * 2 / 255) * adjust);
|
|
data[i] += max !== data[i] ? (max - data[i]) * amt : 0;
|
|
data[i + 1] += max !== data[i + 1] ? (max - data[i + 1]) * amt : 0;
|
|
data[i + 2] += max !== data[i + 2] ? (max - data[i + 2]) * amt : 0;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uVibrance: gl.getUniformLocation(program, 'uVibrance'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform1f(uniformLocations.uVibrance, -this.vibrance);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Vibrance} Instance of fabric.Image.filters.Vibrance
|
|
*/
|
|
fabric.Image.filters.Vibrance.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Blur filter class
|
|
* @class fabric.Image.filters.Blur
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Blur#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Blur({
|
|
* blur: 0.5
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
* canvas.renderAll();
|
|
*/
|
|
filters.Blur = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Blur.prototype */ {
|
|
|
|
type: 'Blur',
|
|
|
|
/*
|
|
'gl_FragColor = vec4(0.0);',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + -7 * uDelta)*0.0044299121055113265;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + -6 * uDelta)*0.00895781211794;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + -5 * uDelta)*0.0215963866053;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + -4 * uDelta)*0.0443683338718;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + -3 * uDelta)*0.0776744219933;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + -2 * uDelta)*0.115876621105;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + -1 * uDelta)*0.147308056121;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord )*0.159576912161;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + 1 * uDelta)*0.147308056121;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + 2 * uDelta)*0.115876621105;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + 3 * uDelta)*0.0776744219933;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + 4 * uDelta)*0.0443683338718;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + 5 * uDelta)*0.0215963866053;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + 6 * uDelta)*0.00895781211794;',
|
|
'gl_FragColor += texture2D(texture, vTexCoord + 7 * uDelta)*0.0044299121055113265;',
|
|
*/
|
|
|
|
/* eslint-disable max-len */
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform vec2 uDelta;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'const float nSamples = 15.0;\n' +
|
|
'vec3 v3offset = vec3(12.9898, 78.233, 151.7182);\n' +
|
|
'float random(vec3 scale) {\n' +
|
|
/* use the fragment position for a different seed per-pixel */
|
|
'return fract(sin(dot(gl_FragCoord.xyz, scale)) * 43758.5453);\n' +
|
|
'}\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = vec4(0.0);\n' +
|
|
'float total = 0.0;\n' +
|
|
'float offset = random(v3offset);\n' +
|
|
'for (float t = -nSamples; t <= nSamples; t++) {\n' +
|
|
'float percent = (t + offset - 0.5) / nSamples;\n' +
|
|
'float weight = 1.0 - abs(percent);\n' +
|
|
'color += texture2D(uTexture, vTexCoord + uDelta * percent) * weight;\n' +
|
|
'total += weight;\n' +
|
|
'}\n' +
|
|
'gl_FragColor = color / total;\n' +
|
|
'}',
|
|
/* eslint-enable max-len */
|
|
|
|
/**
|
|
* blur value, in percentage of image dimensions.
|
|
* specific to keep the image blur constant at different resolutions
|
|
* range between 0 and 1.
|
|
*/
|
|
blur: 0,
|
|
|
|
mainParameter: 'blur',
|
|
|
|
applyTo: function(options) {
|
|
if (options.webgl) {
|
|
// this aspectRatio is used to give the same blur to vertical and horizontal
|
|
this.aspectRatio = options.sourceWidth / options.sourceHeight;
|
|
options.passes++;
|
|
this._setupFrameBuffer(options);
|
|
this.horizontal = true;
|
|
this.applyToWebGL(options);
|
|
this._swapTextures(options);
|
|
this._setupFrameBuffer(options);
|
|
this.horizontal = false;
|
|
this.applyToWebGL(options);
|
|
this._swapTextures(options);
|
|
}
|
|
else {
|
|
this.applyTo2d(options);
|
|
}
|
|
},
|
|
|
|
applyTo2d: function(options) {
|
|
// paint canvasEl with current image data.
|
|
//options.ctx.putImageData(options.imageData, 0, 0);
|
|
options.imageData = this.simpleBlur(options);
|
|
},
|
|
|
|
simpleBlur: function(options) {
|
|
var resources = options.filterBackend.resources, canvas1, canvas2,
|
|
width = options.imageData.width,
|
|
height = options.imageData.height;
|
|
|
|
if (!resources.blurLayer1) {
|
|
resources.blurLayer1 = fabric.util.createCanvasElement();
|
|
resources.blurLayer2 = fabric.util.createCanvasElement();
|
|
}
|
|
canvas1 = resources.blurLayer1;
|
|
canvas2 = resources.blurLayer2;
|
|
if (canvas1.width !== width || canvas1.height !== height) {
|
|
canvas2.width = canvas1.width = width;
|
|
canvas2.height = canvas1.height = height;
|
|
}
|
|
var ctx1 = canvas1.getContext('2d'),
|
|
ctx2 = canvas2.getContext('2d'),
|
|
nSamples = 15,
|
|
random, percent, j, i,
|
|
blur = this.blur * 0.06 * 0.5;
|
|
|
|
// load first canvas
|
|
ctx1.putImageData(options.imageData, 0, 0);
|
|
ctx2.clearRect(0, 0, width, height);
|
|
|
|
for (i = -nSamples; i <= nSamples; i++) {
|
|
random = (Math.random() - 0.5) / 4;
|
|
percent = i / nSamples;
|
|
j = blur * percent * width + random;
|
|
ctx2.globalAlpha = 1 - Math.abs(percent);
|
|
ctx2.drawImage(canvas1, j, random);
|
|
ctx1.drawImage(canvas2, 0, 0);
|
|
ctx2.globalAlpha = 1;
|
|
ctx2.clearRect(0, 0, canvas2.width, canvas2.height);
|
|
}
|
|
for (i = -nSamples; i <= nSamples; i++) {
|
|
random = (Math.random() - 0.5) / 4;
|
|
percent = i / nSamples;
|
|
j = blur * percent * height + random;
|
|
ctx2.globalAlpha = 1 - Math.abs(percent);
|
|
ctx2.drawImage(canvas1, random, j);
|
|
ctx1.drawImage(canvas2, 0, 0);
|
|
ctx2.globalAlpha = 1;
|
|
ctx2.clearRect(0, 0, canvas2.width, canvas2.height);
|
|
}
|
|
options.ctx.drawImage(canvas1, 0, 0);
|
|
var newImageData = options.ctx.getImageData(0, 0, canvas1.width, canvas1.height);
|
|
ctx1.globalAlpha = 1;
|
|
ctx1.clearRect(0, 0, canvas1.width, canvas1.height);
|
|
return newImageData;
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
delta: gl.getUniformLocation(program, 'uDelta'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
var delta = this.chooseRightDelta();
|
|
gl.uniform2fv(uniformLocations.delta, delta);
|
|
},
|
|
|
|
/**
|
|
* choose right value of image percentage to blur with
|
|
* @returns {Array} a numeric array with delta values
|
|
*/
|
|
chooseRightDelta: function() {
|
|
var blurScale = 1, delta = [0, 0], blur;
|
|
if (this.horizontal) {
|
|
if (this.aspectRatio > 1) {
|
|
// image is wide, i want to shrink radius horizontal
|
|
blurScale = 1 / this.aspectRatio;
|
|
}
|
|
}
|
|
else {
|
|
if (this.aspectRatio < 1) {
|
|
// image is tall, i want to shrink radius vertical
|
|
blurScale = this.aspectRatio;
|
|
}
|
|
}
|
|
blur = blurScale * this.blur * 0.12;
|
|
if (this.horizontal) {
|
|
delta[0] = blur;
|
|
}
|
|
else {
|
|
delta[1] = blur;
|
|
}
|
|
return delta;
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Deserialize a JSON definition of a BlurFilter into a concrete instance.
|
|
*/
|
|
filters.Blur.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* Gamma filter class
|
|
* @class fabric.Image.filters.Gamma
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.Gamma#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.Gamma({
|
|
* gamma: [1, 0.5, 2.1]
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.Gamma = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Gamma.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Gamma',
|
|
|
|
fragmentSource: 'precision highp float;\n' +
|
|
'uniform sampler2D uTexture;\n' +
|
|
'uniform vec3 uGamma;\n' +
|
|
'varying vec2 vTexCoord;\n' +
|
|
'void main() {\n' +
|
|
'vec4 color = texture2D(uTexture, vTexCoord);\n' +
|
|
'vec3 correction = (1.0 / uGamma);\n' +
|
|
'color.r = pow(color.r, correction.r);\n' +
|
|
'color.g = pow(color.g, correction.g);\n' +
|
|
'color.b = pow(color.b, correction.b);\n' +
|
|
'gl_FragColor = color;\n' +
|
|
'gl_FragColor.rgb *= color.a;\n' +
|
|
'}',
|
|
|
|
/**
|
|
* Gamma array value, from 0.01 to 2.2.
|
|
* @param {Array} gamma
|
|
* @default
|
|
*/
|
|
gamma: [1, 1, 1],
|
|
|
|
/**
|
|
* Describe the property that is the filter parameter
|
|
* @param {String} m
|
|
* @default
|
|
*/
|
|
mainParameter: 'gamma',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
this.gamma = [1, 1, 1];
|
|
filters.BaseFilter.prototype.initialize.call(this, options);
|
|
},
|
|
|
|
/**
|
|
* Apply the Gamma operation to a Uint8Array representing the pixels of an image.
|
|
*
|
|
* @param {Object} options
|
|
* @param {ImageData} options.imageData The Uint8Array to be filtered.
|
|
*/
|
|
applyTo2d: function(options) {
|
|
var imageData = options.imageData, data = imageData.data,
|
|
gamma = this.gamma, len = data.length,
|
|
rInv = 1 / gamma[0], gInv = 1 / gamma[1],
|
|
bInv = 1 / gamma[2], i;
|
|
|
|
if (!this.rVals) {
|
|
// eslint-disable-next-line
|
|
this.rVals = new Uint8Array(256);
|
|
// eslint-disable-next-line
|
|
this.gVals = new Uint8Array(256);
|
|
// eslint-disable-next-line
|
|
this.bVals = new Uint8Array(256);
|
|
}
|
|
|
|
// This is an optimization - pre-compute a look-up table for each color channel
|
|
// instead of performing these pow calls for each pixel in the image.
|
|
for (i = 0, len = 256; i < len; i++) {
|
|
this.rVals[i] = Math.pow(i / 255, rInv) * 255;
|
|
this.gVals[i] = Math.pow(i / 255, gInv) * 255;
|
|
this.bVals[i] = Math.pow(i / 255, bInv) * 255;
|
|
}
|
|
for (i = 0, len = data.length; i < len; i += 4) {
|
|
data[i] = this.rVals[data[i]];
|
|
data[i + 1] = this.gVals[data[i + 1]];
|
|
data[i + 2] = this.bVals[data[i + 2]];
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return WebGL uniform locations for this filter's shader.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {WebGLShaderProgram} program This filter's compiled shader program.
|
|
*/
|
|
getUniformLocations: function(gl, program) {
|
|
return {
|
|
uGamma: gl.getUniformLocation(program, 'uGamma'),
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Send data from this filter to its shader program's uniforms.
|
|
*
|
|
* @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader.
|
|
* @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects
|
|
*/
|
|
sendUniformData: function(gl, uniformLocations) {
|
|
gl.uniform3fv(uniformLocations.uGamma, this.gamma);
|
|
},
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.Gamma} Instance of fabric.Image.filters.Gamma
|
|
*/
|
|
fabric.Image.filters.Gamma.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* A container class that knows how to apply a sequence of filters to an input image.
|
|
*/
|
|
filters.Composed = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Composed.prototype */ {
|
|
|
|
type: 'Composed',
|
|
|
|
/**
|
|
* A non sparse array of filters to apply
|
|
*/
|
|
subFilters: [],
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
initialize: function(options) {
|
|
this.callSuper('initialize', options);
|
|
// create a new array instead mutating the prototype with push
|
|
this.subFilters = this.subFilters.slice(0);
|
|
},
|
|
|
|
/**
|
|
* Apply this container's filters to the input image provided.
|
|
*
|
|
* @param {Object} options
|
|
* @param {Number} options.passes The number of filters remaining to be applied.
|
|
*/
|
|
applyTo: function(options) {
|
|
options.passes += this.subFilters.length - 1;
|
|
this.subFilters.forEach(function(filter) {
|
|
filter.applyTo(options);
|
|
});
|
|
},
|
|
|
|
/**
|
|
* Serialize this filter into JSON.
|
|
*
|
|
* @returns {Object} A JSON representation of this filter.
|
|
*/
|
|
toObject: function() {
|
|
return fabric.util.object.extend(this.callSuper('toObject'), {
|
|
subFilters: this.subFilters.map(function(filter) { return filter.toObject(); }),
|
|
});
|
|
},
|
|
|
|
isNeutralState: function() {
|
|
return !this.subFilters.some(function(filter) { return !filter.isNeutralState(); });
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Deserialize a JSON definition of a ComposedFilter into a concrete instance.
|
|
*/
|
|
fabric.Image.filters.Composed.fromObject = function(object, callback) {
|
|
var filters = object.subFilters || [],
|
|
subFilters = filters.map(function(filter) {
|
|
return new fabric.Image.filters[filter.type](filter);
|
|
}),
|
|
instance = new fabric.Image.filters.Composed({ subFilters: subFilters });
|
|
callback && callback(instance);
|
|
return instance;
|
|
};
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
filters = fabric.Image.filters,
|
|
createClass = fabric.util.createClass;
|
|
|
|
/**
|
|
* HueRotation filter class
|
|
* @class fabric.Image.filters.HueRotation
|
|
* @memberOf fabric.Image.filters
|
|
* @extends fabric.Image.filters.BaseFilter
|
|
* @see {@link fabric.Image.filters.HueRotation#initialize} for constructor definition
|
|
* @see {@link http://fabricjs.com/image-filters|ImageFilters demo}
|
|
* @example
|
|
* var filter = new fabric.Image.filters.HueRotation({
|
|
* rotation: -0.5
|
|
* });
|
|
* object.filters.push(filter);
|
|
* object.applyFilters();
|
|
*/
|
|
filters.HueRotation = createClass(filters.ColorMatrix, /** @lends fabric.Image.filters.HueRotation.prototype */ {
|
|
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'HueRotation',
|
|
|
|
/**
|
|
* HueRotation value, from -1 to 1.
|
|
* the unit is radians
|
|
* @param {Number} myParameter
|
|
* @default
|
|
*/
|
|
rotation: 0,
|
|
|
|
/**
|
|
* Describe the property that is the filter parameter
|
|
* @param {String} m
|
|
* @default
|
|
*/
|
|
mainParameter: 'rotation',
|
|
|
|
calculateMatrix: function() {
|
|
var rad = this.rotation * Math.PI, cos = fabric.util.cos(rad), sin = fabric.util.sin(rad),
|
|
aThird = 1 / 3, aThirdSqtSin = Math.sqrt(aThird) * sin, OneMinusCos = 1 - cos;
|
|
this.matrix = [
|
|
1, 0, 0, 0, 0,
|
|
0, 1, 0, 0, 0,
|
|
0, 0, 1, 0, 0,
|
|
0, 0, 0, 1, 0
|
|
];
|
|
this.matrix[0] = cos + OneMinusCos / 3;
|
|
this.matrix[1] = aThird * OneMinusCos - aThirdSqtSin;
|
|
this.matrix[2] = aThird * OneMinusCos + aThirdSqtSin;
|
|
this.matrix[5] = aThird * OneMinusCos + aThirdSqtSin;
|
|
this.matrix[6] = cos + aThird * OneMinusCos;
|
|
this.matrix[7] = aThird * OneMinusCos - aThirdSqtSin;
|
|
this.matrix[10] = aThird * OneMinusCos - aThirdSqtSin;
|
|
this.matrix[11] = aThird * OneMinusCos + aThirdSqtSin;
|
|
this.matrix[12] = cos + aThird * OneMinusCos;
|
|
},
|
|
|
|
/**
|
|
* HueRotation isNeutralState implementation
|
|
* Used only in image applyFilters to discard filters that will not have an effect
|
|
* on the image
|
|
* @param {Object} options
|
|
**/
|
|
isNeutralState: function(options) {
|
|
this.calculateMatrix();
|
|
return filters.BaseFilter.prototype.isNeutralState.call(this, options);
|
|
},
|
|
|
|
/**
|
|
* Apply this filter to the input image data provided.
|
|
*
|
|
* Determines whether to use WebGL or Canvas2D based on the options.webgl flag.
|
|
*
|
|
* @param {Object} options
|
|
* @param {Number} options.passes The number of filters remaining to be executed
|
|
* @param {Boolean} options.webgl Whether to use webgl to render the filter.
|
|
* @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered.
|
|
* @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn.
|
|
* @param {WebGLRenderingContext} options.context The GL context used for rendering.
|
|
* @param {Object} options.programCache A map of compiled shader programs, keyed by filter type.
|
|
*/
|
|
applyTo: function(options) {
|
|
this.calculateMatrix();
|
|
filters.BaseFilter.prototype.applyTo.call(this, options);
|
|
},
|
|
|
|
});
|
|
|
|
/**
|
|
* Returns filter instance from an object representation
|
|
* @static
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] to be invoked after filter creation
|
|
* @return {fabric.Image.filters.HueRotation} Instance of fabric.Image.filters.HueRotation
|
|
*/
|
|
fabric.Image.filters.HueRotation.fromObject = fabric.Image.filters.BaseFilter.fromObject;
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = { }),
|
|
clone = fabric.util.object.clone;
|
|
|
|
if (fabric.Text) {
|
|
fabric.warn('fabric.Text is already defined');
|
|
return;
|
|
}
|
|
|
|
var additionalProps =
|
|
('fontFamily fontWeight fontSize text underline overline linethrough' +
|
|
' textAlign fontStyle lineHeight textBackgroundColor charSpacing styles' +
|
|
' direction path pathStartOffset pathSide').split(' ');
|
|
|
|
/**
|
|
* Text class
|
|
* @class fabric.Text
|
|
* @extends fabric.Object
|
|
* @return {fabric.Text} thisArg
|
|
* @tutorial {@link http://fabricjs.com/fabric-intro-part-2#text}
|
|
* @see {@link fabric.Text#initialize} for constructor definition
|
|
*/
|
|
fabric.Text = fabric.util.createClass(fabric.Object, /** @lends fabric.Text.prototype */ {
|
|
|
|
/**
|
|
* Properties which when set cause object to change dimensions
|
|
* @type Array
|
|
* @private
|
|
*/
|
|
_dimensionAffectingProps: [
|
|
'fontSize',
|
|
'fontWeight',
|
|
'fontFamily',
|
|
'fontStyle',
|
|
'lineHeight',
|
|
'text',
|
|
'charSpacing',
|
|
'textAlign',
|
|
'styles',
|
|
'path',
|
|
'pathStartOffset',
|
|
'pathSide'
|
|
],
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_reNewline: /\r?\n/,
|
|
|
|
/**
|
|
* Use this regular expression to filter for whitespaces that is not a new line.
|
|
* Mostly used when text is 'justify' aligned.
|
|
* @private
|
|
*/
|
|
_reSpacesAndTabs: /[ \t\r]/g,
|
|
|
|
/**
|
|
* Use this regular expression to filter for whitespace that is not a new line.
|
|
* Mostly used when text is 'justify' aligned.
|
|
* @private
|
|
*/
|
|
_reSpaceAndTab: /[ \t\r]/,
|
|
|
|
/**
|
|
* Use this regular expression to filter consecutive groups of non spaces.
|
|
* Mostly used when text is 'justify' aligned.
|
|
* @private
|
|
*/
|
|
_reWords: /\S+/g,
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'text',
|
|
|
|
/**
|
|
* Font size (in pixels)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
fontSize: 40,
|
|
|
|
/**
|
|
* Font weight (e.g. bold, normal, 400, 600, 800)
|
|
* @type {(Number|String)}
|
|
* @default
|
|
*/
|
|
fontWeight: 'normal',
|
|
|
|
/**
|
|
* Font family
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fontFamily: 'Times New Roman',
|
|
|
|
/**
|
|
* Text decoration underline.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
underline: false,
|
|
|
|
/**
|
|
* Text decoration overline.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
overline: false,
|
|
|
|
/**
|
|
* Text decoration linethrough.
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
linethrough: false,
|
|
|
|
/**
|
|
* Text alignment. Possible values: "left", "center", "right", "justify",
|
|
* "justify-left", "justify-center" or "justify-right".
|
|
* @type String
|
|
* @default
|
|
*/
|
|
textAlign: 'left',
|
|
|
|
/**
|
|
* Font style . Possible values: "", "normal", "italic" or "oblique".
|
|
* @type String
|
|
* @default
|
|
*/
|
|
fontStyle: 'normal',
|
|
|
|
/**
|
|
* Line height
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
lineHeight: 1.16,
|
|
|
|
/**
|
|
* Superscript schema object (minimum overlap)
|
|
* @type {Object}
|
|
* @default
|
|
*/
|
|
superscript: {
|
|
size: 0.60, // fontSize factor
|
|
baseline: -0.35 // baseline-shift factor (upwards)
|
|
},
|
|
|
|
/**
|
|
* Subscript schema object (minimum overlap)
|
|
* @type {Object}
|
|
* @default
|
|
*/
|
|
subscript: {
|
|
size: 0.60, // fontSize factor
|
|
baseline: 0.11 // baseline-shift factor (downwards)
|
|
},
|
|
|
|
/**
|
|
* Background color of text lines
|
|
* @type String
|
|
* @default
|
|
*/
|
|
textBackgroundColor: '',
|
|
|
|
/**
|
|
* List of properties to consider when checking if
|
|
* state of an object is changed ({@link fabric.Object#hasStateChanged})
|
|
* as well as for history (undo/redo) purposes
|
|
* @type Array
|
|
*/
|
|
stateProperties: fabric.Object.prototype.stateProperties.concat(additionalProps),
|
|
|
|
/**
|
|
* List of properties to consider when checking if cache needs refresh
|
|
* @type Array
|
|
*/
|
|
cacheProperties: fabric.Object.prototype.cacheProperties.concat(additionalProps),
|
|
|
|
/**
|
|
* When defined, an object is rendered via stroke and this property specifies its color.
|
|
* <b>Backwards incompatibility note:</b> This property was named "strokeStyle" until v1.1.6
|
|
* @type String
|
|
* @default
|
|
*/
|
|
stroke: null,
|
|
|
|
/**
|
|
* Shadow object representing shadow of this shape.
|
|
* <b>Backwards incompatibility note:</b> This property was named "textShadow" (String) until v1.2.11
|
|
* @type fabric.Shadow
|
|
* @default
|
|
*/
|
|
shadow: null,
|
|
|
|
/**
|
|
* fabric.Path that the text should follow.
|
|
* since 4.6.0 the path will be drawn automatically.
|
|
* if you want to make the path visible, give it a stroke and strokeWidth or fill value
|
|
* if you want it to be hidden, assign visible = false to the path.
|
|
* This feature is in BETA, and SVG import/export is not yet supported.
|
|
* @type fabric.Path
|
|
* @example
|
|
* var textPath = new fabric.Text('Text on a path', {
|
|
* top: 150,
|
|
* left: 150,
|
|
* textAlign: 'center',
|
|
* charSpacing: -50,
|
|
* path: new fabric.Path('M 0 0 C 50 -100 150 -100 200 0', {
|
|
* strokeWidth: 1,
|
|
* visible: false
|
|
* }),
|
|
* pathSide: 'left',
|
|
* pathStartOffset: 0
|
|
* });
|
|
* @default
|
|
*/
|
|
path: null,
|
|
|
|
/**
|
|
* Offset amount for text path starting position
|
|
* Only used when text has a path
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
pathStartOffset: 0,
|
|
|
|
/**
|
|
* Which side of the path the text should be drawn on.
|
|
* Only used when text has a path
|
|
* @type {String} 'left|right'
|
|
* @default
|
|
*/
|
|
pathSide: 'left',
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_fontSizeFraction: 0.222,
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
offsets: {
|
|
underline: 0.10,
|
|
linethrough: -0.315,
|
|
overline: -0.88
|
|
},
|
|
|
|
/**
|
|
* Text Line proportion to font Size (in pixels)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
_fontSizeMult: 1.13,
|
|
|
|
/**
|
|
* additional space between characters
|
|
* expressed in thousands of em unit
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
charSpacing: 0,
|
|
|
|
/**
|
|
* Object containing character styles - top-level properties -> line numbers,
|
|
* 2nd-level properties - character numbers
|
|
* @type Object
|
|
* @default
|
|
*/
|
|
styles: null,
|
|
|
|
/**
|
|
* Reference to a context to measure text char or couple of chars
|
|
* the cacheContext of the canvas will be used or a freshly created one if the object is not on canvas
|
|
* once created it will be referenced on fabric._measuringContext to avoid creating a canvas for every
|
|
* text object created.
|
|
* @type {CanvasRenderingContext2D}
|
|
* @default
|
|
*/
|
|
_measuringContext: null,
|
|
|
|
/**
|
|
* Baseline shift, styles only, keep at 0 for the main text object
|
|
* @type {Number}
|
|
* @default
|
|
*/
|
|
deltaY: 0,
|
|
|
|
/**
|
|
* WARNING: EXPERIMENTAL. NOT SUPPORTED YET
|
|
* determine the direction of the text.
|
|
* This has to be set manually together with textAlign and originX for proper
|
|
* experience.
|
|
* some interesting link for the future
|
|
* https://www.w3.org/International/questions/qa-bidi-unicode-controls
|
|
* @since 4.5.0
|
|
* @type {String} 'ltr|rtl'
|
|
* @default
|
|
*/
|
|
direction: 'ltr',
|
|
|
|
/**
|
|
* Array of properties that define a style unit (of 'styles').
|
|
* @type {Array}
|
|
* @default
|
|
*/
|
|
_styleProperties: [
|
|
'stroke',
|
|
'strokeWidth',
|
|
'fill',
|
|
'fontFamily',
|
|
'fontSize',
|
|
'fontWeight',
|
|
'fontStyle',
|
|
'underline',
|
|
'overline',
|
|
'linethrough',
|
|
'deltaY',
|
|
'textBackgroundColor',
|
|
],
|
|
|
|
/**
|
|
* contains characters bounding boxes
|
|
*/
|
|
__charBounds: [],
|
|
|
|
/**
|
|
* use this size when measuring text. To avoid IE11 rounding errors
|
|
* @type {Number}
|
|
* @default
|
|
* @readonly
|
|
* @private
|
|
*/
|
|
CACHE_FONT_SIZE: 400,
|
|
|
|
/**
|
|
* contains the min text width to avoid getting 0
|
|
* @type {Number}
|
|
* @default
|
|
*/
|
|
MIN_TEXT_WIDTH: 2,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {String} text Text string
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Text} thisArg
|
|
*/
|
|
initialize: function(text, options) {
|
|
this.styles = options ? (options.styles || { }) : { };
|
|
this.text = text;
|
|
this.__skipDimension = true;
|
|
this.callSuper('initialize', options);
|
|
if (this.path) {
|
|
this.setPathInfo();
|
|
}
|
|
this.__skipDimension = false;
|
|
this.initDimensions();
|
|
this.setCoords();
|
|
this.setupState({ propertySet: '_dimensionAffectingProps' });
|
|
},
|
|
|
|
/**
|
|
* If text has a path, it will add the extra information needed
|
|
* for path and text calculations
|
|
* @return {fabric.Text} thisArg
|
|
*/
|
|
setPathInfo: function() {
|
|
var path = this.path;
|
|
if (path) {
|
|
path.segmentsInfo = fabric.util.getPathSegmentsInfo(path.path);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Return a context for measurement of text string.
|
|
* if created it gets stored for reuse
|
|
* @param {String} text Text string
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.Text} thisArg
|
|
*/
|
|
getMeasuringContext: function() {
|
|
// if we did not return we have to measure something.
|
|
if (!fabric._measuringContext) {
|
|
fabric._measuringContext = this.canvas && this.canvas.contextCache ||
|
|
fabric.util.createCanvasElement().getContext('2d');
|
|
}
|
|
return fabric._measuringContext;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* Divides text into lines of text and lines of graphemes.
|
|
*/
|
|
_splitText: function() {
|
|
var newLines = this._splitTextIntoLines(this.text);
|
|
this.textLines = newLines.lines;
|
|
this._textLines = newLines.graphemeLines;
|
|
this._unwrappedTextLines = newLines._unwrappedLines;
|
|
this._text = newLines.graphemeText;
|
|
return newLines;
|
|
},
|
|
|
|
/**
|
|
* Initialize or update text dimensions.
|
|
* Updates this.width and this.height with the proper values.
|
|
* Does not return dimensions.
|
|
*/
|
|
initDimensions: function() {
|
|
if (this.__skipDimension) {
|
|
return;
|
|
}
|
|
this._splitText();
|
|
this._clearCache();
|
|
if (this.path) {
|
|
this.width = this.path.width;
|
|
this.height = this.path.height;
|
|
}
|
|
else {
|
|
this.width = this.calcTextWidth() || this.cursorWidth || this.MIN_TEXT_WIDTH;
|
|
this.height = this.calcTextHeight();
|
|
}
|
|
if (this.textAlign.indexOf('justify') !== -1) {
|
|
// once text is measured we need to make space fatter to make justified text.
|
|
this.enlargeSpaces();
|
|
}
|
|
this.saveState({ propertySet: '_dimensionAffectingProps' });
|
|
},
|
|
|
|
/**
|
|
* Enlarge space boxes and shift the others
|
|
*/
|
|
enlargeSpaces: function() {
|
|
var diffSpace, currentLineWidth, numberOfSpaces, accumulatedSpace, line, charBound, spaces;
|
|
for (var i = 0, len = this._textLines.length; i < len; i++) {
|
|
if (this.textAlign !== 'justify' && (i === len - 1 || this.isEndOfWrapping(i))) {
|
|
continue;
|
|
}
|
|
accumulatedSpace = 0;
|
|
line = this._textLines[i];
|
|
currentLineWidth = this.getLineWidth(i);
|
|
if (currentLineWidth < this.width && (spaces = this.textLines[i].match(this._reSpacesAndTabs))) {
|
|
numberOfSpaces = spaces.length;
|
|
diffSpace = (this.width - currentLineWidth) / numberOfSpaces;
|
|
for (var j = 0, jlen = line.length; j <= jlen; j++) {
|
|
charBound = this.__charBounds[i][j];
|
|
if (this._reSpaceAndTab.test(line[j])) {
|
|
charBound.width += diffSpace;
|
|
charBound.kernedWidth += diffSpace;
|
|
charBound.left += accumulatedSpace;
|
|
accumulatedSpace += diffSpace;
|
|
}
|
|
else {
|
|
charBound.left += accumulatedSpace;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Detect if the text line is ended with an hard break
|
|
* text and itext do not have wrapping, return false
|
|
* @return {Boolean}
|
|
*/
|
|
isEndOfWrapping: function(lineIndex) {
|
|
return lineIndex === this._textLines.length - 1;
|
|
},
|
|
|
|
/**
|
|
* Detect if a line has a linebreak and so we need to account for it when moving
|
|
* and counting style.
|
|
* It return always for text and Itext.
|
|
* @return Number
|
|
*/
|
|
missingNewlineOffset: function() {
|
|
return 1;
|
|
},
|
|
|
|
/**
|
|
* Returns string representation of an instance
|
|
* @return {String} String representation of text object
|
|
*/
|
|
toString: function() {
|
|
return '#<fabric.Text (' + this.complexity() +
|
|
'): { "text": "' + this.text + '", "fontFamily": "' + this.fontFamily + '" }>';
|
|
},
|
|
|
|
/**
|
|
* Return the dimension and the zoom level needed to create a cache canvas
|
|
* big enough to host the object to be cached.
|
|
* @private
|
|
* @param {Object} dim.x width of object to be cached
|
|
* @param {Object} dim.y height of object to be cached
|
|
* @return {Object}.width width of canvas
|
|
* @return {Object}.height height of canvas
|
|
* @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache
|
|
* @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache
|
|
*/
|
|
_getCacheCanvasDimensions: function() {
|
|
var dims = this.callSuper('_getCacheCanvasDimensions');
|
|
var fontSize = this.fontSize;
|
|
dims.width += fontSize * dims.zoomX;
|
|
dims.height += fontSize * dims.zoomY;
|
|
return dims;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
var path = this.path;
|
|
path && !path.isNotVisible() && path._render(ctx);
|
|
this._setTextStyles(ctx);
|
|
this._renderTextLinesBackground(ctx);
|
|
this._renderTextDecoration(ctx, 'underline');
|
|
this._renderText(ctx);
|
|
this._renderTextDecoration(ctx, 'overline');
|
|
this._renderTextDecoration(ctx, 'linethrough');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderText: function(ctx) {
|
|
if (this.paintFirst === 'stroke') {
|
|
this._renderTextStroke(ctx);
|
|
this._renderTextFill(ctx);
|
|
}
|
|
else {
|
|
this._renderTextFill(ctx);
|
|
this._renderTextStroke(ctx);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Set the font parameter of the context with the object properties or with charStyle
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Object} [charStyle] object with font style properties
|
|
* @param {String} [charStyle.fontFamily] Font Family
|
|
* @param {Number} [charStyle.fontSize] Font size in pixels. ( without px suffix )
|
|
* @param {String} [charStyle.fontWeight] Font weight
|
|
* @param {String} [charStyle.fontStyle] Font style (italic|normal)
|
|
*/
|
|
_setTextStyles: function(ctx, charStyle, forMeasuring) {
|
|
ctx.textBaseline = 'alphabetic';
|
|
ctx.font = this._getFontDeclaration(charStyle, forMeasuring);
|
|
},
|
|
|
|
/**
|
|
* calculate and return the text Width measuring each line.
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @return {Number} Maximum width of fabric.Text object
|
|
*/
|
|
calcTextWidth: function() {
|
|
var maxWidth = this.getLineWidth(0);
|
|
|
|
for (var i = 1, len = this._textLines.length; i < len; i++) {
|
|
var currentLineWidth = this.getLineWidth(i);
|
|
if (currentLineWidth > maxWidth) {
|
|
maxWidth = currentLineWidth;
|
|
}
|
|
}
|
|
return maxWidth;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} method Method name ("fillText" or "strokeText")
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {String} line Text to render
|
|
* @param {Number} left Left position of text
|
|
* @param {Number} top Top position of text
|
|
* @param {Number} lineIndex Index of a line in a text
|
|
*/
|
|
_renderTextLine: function(method, ctx, line, left, top, lineIndex) {
|
|
this._renderChars(method, ctx, line, left, top, lineIndex);
|
|
},
|
|
|
|
/**
|
|
* Renders the text background for lines, taking care of style
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderTextLinesBackground: function(ctx) {
|
|
if (!this.textBackgroundColor && !this.styleHas('textBackgroundColor')) {
|
|
return;
|
|
}
|
|
var heightOfLine,
|
|
lineLeftOffset, originalFill = ctx.fillStyle,
|
|
line, lastColor,
|
|
leftOffset = this._getLeftOffset(),
|
|
lineTopOffset = this._getTopOffset(),
|
|
boxStart = 0, boxWidth = 0, charBox, currentColor, path = this.path,
|
|
drawStart;
|
|
|
|
for (var i = 0, len = this._textLines.length; i < len; i++) {
|
|
heightOfLine = this.getHeightOfLine(i);
|
|
if (!this.textBackgroundColor && !this.styleHas('textBackgroundColor', i)) {
|
|
lineTopOffset += heightOfLine;
|
|
continue;
|
|
}
|
|
line = this._textLines[i];
|
|
lineLeftOffset = this._getLineLeftOffset(i);
|
|
boxWidth = 0;
|
|
boxStart = 0;
|
|
lastColor = this.getValueOfPropertyAt(i, 0, 'textBackgroundColor');
|
|
for (var j = 0, jlen = line.length; j < jlen; j++) {
|
|
charBox = this.__charBounds[i][j];
|
|
currentColor = this.getValueOfPropertyAt(i, j, 'textBackgroundColor');
|
|
if (path) {
|
|
ctx.save();
|
|
ctx.translate(charBox.renderLeft, charBox.renderTop);
|
|
ctx.rotate(charBox.angle);
|
|
ctx.fillStyle = currentColor;
|
|
currentColor && ctx.fillRect(
|
|
-charBox.width / 2,
|
|
-heightOfLine / this.lineHeight * (1 - this._fontSizeFraction),
|
|
charBox.width,
|
|
heightOfLine / this.lineHeight
|
|
);
|
|
ctx.restore();
|
|
}
|
|
else if (currentColor !== lastColor) {
|
|
drawStart = leftOffset + lineLeftOffset + boxStart;
|
|
if (this.direction === 'rtl') {
|
|
drawStart = this.width - drawStart - boxWidth;
|
|
}
|
|
ctx.fillStyle = lastColor;
|
|
lastColor && ctx.fillRect(
|
|
drawStart,
|
|
lineTopOffset,
|
|
boxWidth,
|
|
heightOfLine / this.lineHeight
|
|
);
|
|
boxStart = charBox.left;
|
|
boxWidth = charBox.width;
|
|
lastColor = currentColor;
|
|
}
|
|
else {
|
|
boxWidth += charBox.kernedWidth;
|
|
}
|
|
}
|
|
if (currentColor && !path) {
|
|
drawStart = leftOffset + lineLeftOffset + boxStart;
|
|
if (this.direction === 'rtl') {
|
|
drawStart = this.width - drawStart - boxWidth;
|
|
}
|
|
ctx.fillStyle = currentColor;
|
|
ctx.fillRect(
|
|
drawStart,
|
|
lineTopOffset,
|
|
boxWidth,
|
|
heightOfLine / this.lineHeight
|
|
);
|
|
}
|
|
lineTopOffset += heightOfLine;
|
|
}
|
|
ctx.fillStyle = originalFill;
|
|
// if there is text background color no
|
|
// other shadows should be casted
|
|
this._removeShadow(ctx);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} decl style declaration for cache
|
|
* @param {String} decl.fontFamily fontFamily
|
|
* @param {String} decl.fontStyle fontStyle
|
|
* @param {String} decl.fontWeight fontWeight
|
|
* @return {Object} reference to cache
|
|
*/
|
|
getFontCache: function(decl) {
|
|
var fontFamily = decl.fontFamily.toLowerCase();
|
|
if (!fabric.charWidthsCache[fontFamily]) {
|
|
fabric.charWidthsCache[fontFamily] = { };
|
|
}
|
|
var cache = fabric.charWidthsCache[fontFamily],
|
|
cacheProp = decl.fontStyle.toLowerCase() + '_' + (decl.fontWeight + '').toLowerCase();
|
|
if (!cache[cacheProp]) {
|
|
cache[cacheProp] = { };
|
|
}
|
|
return cache[cacheProp];
|
|
},
|
|
|
|
/**
|
|
* measure and return the width of a single character.
|
|
* possibly overridden to accommodate different measure logic or
|
|
* to hook some external lib for character measurement
|
|
* @private
|
|
* @param {String} _char, char to be measured
|
|
* @param {Object} charStyle style of char to be measured
|
|
* @param {String} [previousChar] previous char
|
|
* @param {Object} [prevCharStyle] style of previous char
|
|
*/
|
|
_measureChar: function(_char, charStyle, previousChar, prevCharStyle) {
|
|
// first i try to return from cache
|
|
var fontCache = this.getFontCache(charStyle), fontDeclaration = this._getFontDeclaration(charStyle),
|
|
previousFontDeclaration = this._getFontDeclaration(prevCharStyle), couple = previousChar + _char,
|
|
stylesAreEqual = fontDeclaration === previousFontDeclaration, width, coupleWidth, previousWidth,
|
|
fontMultiplier = charStyle.fontSize / this.CACHE_FONT_SIZE, kernedWidth;
|
|
|
|
if (previousChar && fontCache[previousChar] !== undefined) {
|
|
previousWidth = fontCache[previousChar];
|
|
}
|
|
if (fontCache[_char] !== undefined) {
|
|
kernedWidth = width = fontCache[_char];
|
|
}
|
|
if (stylesAreEqual && fontCache[couple] !== undefined) {
|
|
coupleWidth = fontCache[couple];
|
|
kernedWidth = coupleWidth - previousWidth;
|
|
}
|
|
if (width === undefined || previousWidth === undefined || coupleWidth === undefined) {
|
|
var ctx = this.getMeasuringContext();
|
|
// send a TRUE to specify measuring font size CACHE_FONT_SIZE
|
|
this._setTextStyles(ctx, charStyle, true);
|
|
}
|
|
if (width === undefined) {
|
|
kernedWidth = width = ctx.measureText(_char).width;
|
|
fontCache[_char] = width;
|
|
}
|
|
if (previousWidth === undefined && stylesAreEqual && previousChar) {
|
|
previousWidth = ctx.measureText(previousChar).width;
|
|
fontCache[previousChar] = previousWidth;
|
|
}
|
|
if (stylesAreEqual && coupleWidth === undefined) {
|
|
// we can measure the kerning couple and subtract the width of the previous character
|
|
coupleWidth = ctx.measureText(couple).width;
|
|
fontCache[couple] = coupleWidth;
|
|
kernedWidth = coupleWidth - previousWidth;
|
|
}
|
|
return { width: width * fontMultiplier, kernedWidth: kernedWidth * fontMultiplier };
|
|
},
|
|
|
|
/**
|
|
* Computes height of character at given position
|
|
* @param {Number} line the line index number
|
|
* @param {Number} _char the character index number
|
|
* @return {Number} fontSize of the character
|
|
*/
|
|
getHeightOfChar: function(line, _char) {
|
|
return this.getValueOfPropertyAt(line, _char, 'fontSize');
|
|
},
|
|
|
|
/**
|
|
* measure a text line measuring all characters.
|
|
* @param {Number} lineIndex line number
|
|
* @return {Number} Line width
|
|
*/
|
|
measureLine: function(lineIndex) {
|
|
var lineInfo = this._measureLine(lineIndex);
|
|
if (this.charSpacing !== 0) {
|
|
lineInfo.width -= this._getWidthOfCharSpacing();
|
|
}
|
|
if (lineInfo.width < 0) {
|
|
lineInfo.width = 0;
|
|
}
|
|
return lineInfo;
|
|
},
|
|
|
|
/**
|
|
* measure every grapheme of a line, populating __charBounds
|
|
* @param {Number} lineIndex
|
|
* @return {Object} object.width total width of characters
|
|
* @return {Object} object.widthOfSpaces length of chars that match this._reSpacesAndTabs
|
|
*/
|
|
_measureLine: function(lineIndex) {
|
|
var width = 0, i, grapheme, line = this._textLines[lineIndex], prevGrapheme,
|
|
graphemeInfo, numOfSpaces = 0, lineBounds = new Array(line.length),
|
|
positionInPath = 0, startingPoint, totalPathLength, path = this.path,
|
|
reverse = this.pathSide === 'right';
|
|
|
|
this.__charBounds[lineIndex] = lineBounds;
|
|
for (i = 0; i < line.length; i++) {
|
|
grapheme = line[i];
|
|
graphemeInfo = this._getGraphemeBox(grapheme, lineIndex, i, prevGrapheme);
|
|
lineBounds[i] = graphemeInfo;
|
|
width += graphemeInfo.kernedWidth;
|
|
prevGrapheme = grapheme;
|
|
}
|
|
// this latest bound box represent the last character of the line
|
|
// to simplify cursor handling in interactive mode.
|
|
lineBounds[i] = {
|
|
left: graphemeInfo ? graphemeInfo.left + graphemeInfo.width : 0,
|
|
width: 0,
|
|
kernedWidth: 0,
|
|
height: this.fontSize
|
|
};
|
|
if (path) {
|
|
totalPathLength = path.segmentsInfo[path.segmentsInfo.length - 1].length;
|
|
startingPoint = fabric.util.getPointOnPath(path.path, 0, path.segmentsInfo);
|
|
startingPoint.x += path.pathOffset.x;
|
|
startingPoint.y += path.pathOffset.y;
|
|
switch (this.textAlign) {
|
|
case 'left':
|
|
positionInPath = reverse ? (totalPathLength - width) : 0;
|
|
break;
|
|
case 'center':
|
|
positionInPath = (totalPathLength - width) / 2;
|
|
break;
|
|
case 'right':
|
|
positionInPath = reverse ? 0 : (totalPathLength - width);
|
|
break;
|
|
//todo - add support for justify
|
|
}
|
|
positionInPath += this.pathStartOffset * (reverse ? -1 : 1);
|
|
for (i = reverse ? line.length - 1 : 0;
|
|
reverse ? i >= 0 : i < line.length;
|
|
reverse ? i-- : i++) {
|
|
graphemeInfo = lineBounds[i];
|
|
if (positionInPath > totalPathLength) {
|
|
positionInPath %= totalPathLength;
|
|
}
|
|
else if (positionInPath < 0) {
|
|
positionInPath += totalPathLength;
|
|
}
|
|
// it would probably much faster to send all the grapheme position for a line
|
|
// and calculate path position/angle at once.
|
|
this._setGraphemeOnPath(positionInPath, graphemeInfo, startingPoint);
|
|
positionInPath += graphemeInfo.kernedWidth;
|
|
}
|
|
}
|
|
return { width: width, numOfSpaces: numOfSpaces };
|
|
},
|
|
|
|
/**
|
|
* Calculate the angle and the left,top position of the char that follow a path.
|
|
* It appends it to graphemeInfo to be reused later at rendering
|
|
* @private
|
|
* @param {Number} positionInPath to be measured
|
|
* @param {Object} graphemeInfo current grapheme box information
|
|
* @param {Object} startingPoint position of the point
|
|
*/
|
|
_setGraphemeOnPath: function(positionInPath, graphemeInfo, startingPoint) {
|
|
var centerPosition = positionInPath + graphemeInfo.kernedWidth / 2,
|
|
path = this.path;
|
|
|
|
// we are at currentPositionOnPath. we want to know what point on the path is.
|
|
var info = fabric.util.getPointOnPath(path.path, centerPosition, path.segmentsInfo);
|
|
graphemeInfo.renderLeft = info.x - startingPoint.x;
|
|
graphemeInfo.renderTop = info.y - startingPoint.y;
|
|
graphemeInfo.angle = info.angle + (this.pathSide === 'right' ? Math.PI : 0);
|
|
},
|
|
|
|
/**
|
|
* Measure and return the info of a single grapheme.
|
|
* needs the the info of previous graphemes already filled
|
|
* @private
|
|
* @param {String} grapheme to be measured
|
|
* @param {Number} lineIndex index of the line where the char is
|
|
* @param {Number} charIndex position in the line
|
|
* @param {String} [prevGrapheme] character preceding the one to be measured
|
|
*/
|
|
_getGraphemeBox: function(grapheme, lineIndex, charIndex, prevGrapheme, skipLeft) {
|
|
var style = this.getCompleteStyleDeclaration(lineIndex, charIndex),
|
|
prevStyle = prevGrapheme ? this.getCompleteStyleDeclaration(lineIndex, charIndex - 1) : { },
|
|
info = this._measureChar(grapheme, style, prevGrapheme, prevStyle),
|
|
kernedWidth = info.kernedWidth,
|
|
width = info.width, charSpacing;
|
|
|
|
if (this.charSpacing !== 0) {
|
|
charSpacing = this._getWidthOfCharSpacing();
|
|
width += charSpacing;
|
|
kernedWidth += charSpacing;
|
|
}
|
|
|
|
var box = {
|
|
width: width,
|
|
left: 0,
|
|
height: style.fontSize,
|
|
kernedWidth: kernedWidth,
|
|
deltaY: style.deltaY,
|
|
};
|
|
if (charIndex > 0 && !skipLeft) {
|
|
var previousBox = this.__charBounds[lineIndex][charIndex - 1];
|
|
box.left = previousBox.left + previousBox.width + info.kernedWidth - info.width;
|
|
}
|
|
return box;
|
|
},
|
|
|
|
/**
|
|
* Calculate height of line at 'lineIndex'
|
|
* @param {Number} lineIndex index of line to calculate
|
|
* @return {Number}
|
|
*/
|
|
getHeightOfLine: function(lineIndex) {
|
|
if (this.__lineHeights[lineIndex]) {
|
|
return this.__lineHeights[lineIndex];
|
|
}
|
|
|
|
var line = this._textLines[lineIndex],
|
|
// char 0 is measured before the line cycle because it nneds to char
|
|
// emptylines
|
|
maxHeight = this.getHeightOfChar(lineIndex, 0);
|
|
for (var i = 1, len = line.length; i < len; i++) {
|
|
maxHeight = Math.max(this.getHeightOfChar(lineIndex, i), maxHeight);
|
|
}
|
|
|
|
return this.__lineHeights[lineIndex] = maxHeight * this.lineHeight * this._fontSizeMult;
|
|
},
|
|
|
|
/**
|
|
* Calculate text box height
|
|
*/
|
|
calcTextHeight: function() {
|
|
var lineHeight, height = 0;
|
|
for (var i = 0, len = this._textLines.length; i < len; i++) {
|
|
lineHeight = this.getHeightOfLine(i);
|
|
height += (i === len - 1 ? lineHeight / this.lineHeight : lineHeight);
|
|
}
|
|
return height;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @return {Number} Left offset
|
|
*/
|
|
_getLeftOffset: function() {
|
|
return this.direction === 'ltr' ? -this.width / 2 : this.width / 2;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @return {Number} Top offset
|
|
*/
|
|
_getTopOffset: function() {
|
|
return -this.height / 2;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {String} method Method name ("fillText" or "strokeText")
|
|
*/
|
|
_renderTextCommon: function(ctx, method) {
|
|
ctx.save();
|
|
var lineHeights = 0, left = this._getLeftOffset(), top = this._getTopOffset();
|
|
for (var i = 0, len = this._textLines.length; i < len; i++) {
|
|
var heightOfLine = this.getHeightOfLine(i),
|
|
maxHeight = heightOfLine / this.lineHeight,
|
|
leftOffset = this._getLineLeftOffset(i);
|
|
this._renderTextLine(
|
|
method,
|
|
ctx,
|
|
this._textLines[i],
|
|
left + leftOffset,
|
|
top + lineHeights + maxHeight,
|
|
i
|
|
);
|
|
lineHeights += heightOfLine;
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderTextFill: function(ctx) {
|
|
if (!this.fill && !this.styleHas('fill')) {
|
|
return;
|
|
}
|
|
|
|
this._renderTextCommon(ctx, 'fillText');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderTextStroke: function(ctx) {
|
|
if ((!this.stroke || this.strokeWidth === 0) && this.isEmptyStyles()) {
|
|
return;
|
|
}
|
|
|
|
if (this.shadow && !this.shadow.affectStroke) {
|
|
this._removeShadow(ctx);
|
|
}
|
|
|
|
ctx.save();
|
|
this._setLineDash(ctx, this.strokeDashArray);
|
|
ctx.beginPath();
|
|
this._renderTextCommon(ctx, 'strokeText');
|
|
ctx.closePath();
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} method fillText or strokeText.
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Array} line Content of the line, splitted in an array by grapheme
|
|
* @param {Number} left
|
|
* @param {Number} top
|
|
* @param {Number} lineIndex
|
|
*/
|
|
_renderChars: function(method, ctx, line, left, top, lineIndex) {
|
|
// set proper line offset
|
|
var lineHeight = this.getHeightOfLine(lineIndex),
|
|
isJustify = this.textAlign.indexOf('justify') !== -1,
|
|
actualStyle,
|
|
nextStyle,
|
|
charsToRender = '',
|
|
charBox,
|
|
boxWidth = 0,
|
|
timeToRender,
|
|
path = this.path,
|
|
shortCut = !isJustify && this.charSpacing === 0 && this.isEmptyStyles(lineIndex) && !path,
|
|
isLtr = this.direction === 'ltr', sign = this.direction === 'ltr' ? 1 : -1,
|
|
drawingLeft;
|
|
|
|
ctx.save();
|
|
top -= lineHeight * this._fontSizeFraction / this.lineHeight;
|
|
if (shortCut) {
|
|
// render all the line in one pass without checking
|
|
// drawingLeft = isLtr ? left : left - this.getLineWidth(lineIndex);
|
|
ctx.canvas.setAttribute('dir', isLtr ? 'ltr' : 'rtl');
|
|
ctx.direction = isLtr ? 'ltr' : 'rtl';
|
|
ctx.textAlign = isLtr ? 'left' : 'right';
|
|
this._renderChar(method, ctx, lineIndex, 0, line.join(''), left, top, lineHeight);
|
|
ctx.restore();
|
|
return;
|
|
}
|
|
for (var i = 0, len = line.length - 1; i <= len; i++) {
|
|
timeToRender = i === len || this.charSpacing || path;
|
|
charsToRender += line[i];
|
|
charBox = this.__charBounds[lineIndex][i];
|
|
if (boxWidth === 0) {
|
|
left += sign * (charBox.kernedWidth - charBox.width);
|
|
boxWidth += charBox.width;
|
|
}
|
|
else {
|
|
boxWidth += charBox.kernedWidth;
|
|
}
|
|
if (isJustify && !timeToRender) {
|
|
if (this._reSpaceAndTab.test(line[i])) {
|
|
timeToRender = true;
|
|
}
|
|
}
|
|
if (!timeToRender) {
|
|
// if we have charSpacing, we render char by char
|
|
actualStyle = actualStyle || this.getCompleteStyleDeclaration(lineIndex, i);
|
|
nextStyle = this.getCompleteStyleDeclaration(lineIndex, i + 1);
|
|
timeToRender = this._hasStyleChanged(actualStyle, nextStyle);
|
|
}
|
|
if (timeToRender) {
|
|
if (path) {
|
|
ctx.save();
|
|
ctx.translate(charBox.renderLeft, charBox.renderTop);
|
|
ctx.rotate(charBox.angle);
|
|
this._renderChar(method, ctx, lineIndex, i, charsToRender, -boxWidth / 2, 0, lineHeight);
|
|
ctx.restore();
|
|
}
|
|
else {
|
|
drawingLeft = left;
|
|
ctx.canvas.setAttribute('dir', isLtr ? 'ltr' : 'rtl');
|
|
ctx.direction = isLtr ? 'ltr' : 'rtl';
|
|
ctx.textAlign = isLtr ? 'left' : 'right';
|
|
this._renderChar(method, ctx, lineIndex, i, charsToRender, drawingLeft, top, lineHeight);
|
|
}
|
|
charsToRender = '';
|
|
actualStyle = nextStyle;
|
|
left += sign * boxWidth;
|
|
boxWidth = 0;
|
|
}
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* This function try to patch the missing gradientTransform on canvas gradients.
|
|
* transforming a context to transform the gradient, is going to transform the stroke too.
|
|
* we want to transform the gradient but not the stroke operation, so we create
|
|
* a transformed gradient on a pattern and then we use the pattern instead of the gradient.
|
|
* this method has drawbacks: is slow, is in low resolution, needs a patch for when the size
|
|
* is limited.
|
|
* @private
|
|
* @param {fabric.Gradient} filler a fabric gradient instance
|
|
* @return {CanvasPattern} a pattern to use as fill/stroke style
|
|
*/
|
|
_applyPatternGradientTransformText: function(filler) {
|
|
var pCanvas = fabric.util.createCanvasElement(), pCtx,
|
|
// TODO: verify compatibility with strokeUniform
|
|
width = this.width + this.strokeWidth, height = this.height + this.strokeWidth;
|
|
pCanvas.width = width;
|
|
pCanvas.height = height;
|
|
pCtx = pCanvas.getContext('2d');
|
|
pCtx.beginPath(); pCtx.moveTo(0, 0); pCtx.lineTo(width, 0); pCtx.lineTo(width, height);
|
|
pCtx.lineTo(0, height); pCtx.closePath();
|
|
pCtx.translate(width / 2, height / 2);
|
|
pCtx.fillStyle = filler.toLive(pCtx);
|
|
this._applyPatternGradientTransform(pCtx, filler);
|
|
pCtx.fill();
|
|
return pCtx.createPattern(pCanvas, 'no-repeat');
|
|
},
|
|
|
|
handleFiller: function(ctx, property, filler) {
|
|
var offsetX, offsetY;
|
|
if (filler.toLive) {
|
|
if (filler.gradientUnits === 'percentage' || filler.gradientTransform || filler.patternTransform) {
|
|
// need to transform gradient in a pattern.
|
|
// this is a slow process. If you are hitting this codepath, and the object
|
|
// is not using caching, you should consider switching it on.
|
|
// we need a canvas as big as the current object caching canvas.
|
|
offsetX = -this.width / 2;
|
|
offsetY = -this.height / 2;
|
|
ctx.translate(offsetX, offsetY);
|
|
ctx[property] = this._applyPatternGradientTransformText(filler);
|
|
return { offsetX: offsetX, offsetY: offsetY };
|
|
}
|
|
else {
|
|
// is a simple gradient or pattern
|
|
ctx[property] = filler.toLive(ctx, this);
|
|
return this._applyPatternGradientTransform(ctx, filler);
|
|
}
|
|
}
|
|
else {
|
|
// is a color
|
|
ctx[property] = filler;
|
|
}
|
|
return { offsetX: 0, offsetY: 0 };
|
|
},
|
|
|
|
_setStrokeStyles: function(ctx, decl) {
|
|
ctx.lineWidth = decl.strokeWidth;
|
|
ctx.lineCap = this.strokeLineCap;
|
|
ctx.lineDashOffset = this.strokeDashOffset;
|
|
ctx.lineJoin = this.strokeLineJoin;
|
|
ctx.miterLimit = this.strokeMiterLimit;
|
|
return this.handleFiller(ctx, 'strokeStyle', decl.stroke);
|
|
},
|
|
|
|
_setFillStyles: function(ctx, decl) {
|
|
return this.handleFiller(ctx, 'fillStyle', decl.fill);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} method
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @param {String} _char
|
|
* @param {Number} left Left coordinate
|
|
* @param {Number} top Top coordinate
|
|
* @param {Number} lineHeight Height of the line
|
|
*/
|
|
_renderChar: function(method, ctx, lineIndex, charIndex, _char, left, top) {
|
|
var decl = this._getStyleDeclaration(lineIndex, charIndex),
|
|
fullDecl = this.getCompleteStyleDeclaration(lineIndex, charIndex),
|
|
shouldFill = method === 'fillText' && fullDecl.fill,
|
|
shouldStroke = method === 'strokeText' && fullDecl.stroke && fullDecl.strokeWidth,
|
|
fillOffsets, strokeOffsets;
|
|
|
|
if (!shouldStroke && !shouldFill) {
|
|
return;
|
|
}
|
|
ctx.save();
|
|
|
|
shouldFill && (fillOffsets = this._setFillStyles(ctx, fullDecl));
|
|
shouldStroke && (strokeOffsets = this._setStrokeStyles(ctx, fullDecl));
|
|
|
|
ctx.font = this._getFontDeclaration(fullDecl);
|
|
|
|
|
|
if (decl && decl.textBackgroundColor) {
|
|
this._removeShadow(ctx);
|
|
}
|
|
if (decl && decl.deltaY) {
|
|
top += decl.deltaY;
|
|
}
|
|
shouldFill && ctx.fillText(_char, left - fillOffsets.offsetX, top - fillOffsets.offsetY);
|
|
shouldStroke && ctx.strokeText(_char, left - strokeOffsets.offsetX, top - strokeOffsets.offsetY);
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Turns the character into a 'superior figure' (i.e. 'superscript')
|
|
* @param {Number} start selection start
|
|
* @param {Number} end selection end
|
|
* @returns {fabric.Text} thisArg
|
|
* @chainable
|
|
*/
|
|
setSuperscript: function(start, end) {
|
|
return this._setScript(start, end, this.superscript);
|
|
},
|
|
|
|
/**
|
|
* Turns the character into an 'inferior figure' (i.e. 'subscript')
|
|
* @param {Number} start selection start
|
|
* @param {Number} end selection end
|
|
* @returns {fabric.Text} thisArg
|
|
* @chainable
|
|
*/
|
|
setSubscript: function(start, end) {
|
|
return this._setScript(start, end, this.subscript);
|
|
},
|
|
|
|
/**
|
|
* Applies 'schema' at given position
|
|
* @private
|
|
* @param {Number} start selection start
|
|
* @param {Number} end selection end
|
|
* @param {Number} schema
|
|
* @returns {fabric.Text} thisArg
|
|
* @chainable
|
|
*/
|
|
_setScript: function(start, end, schema) {
|
|
var loc = this.get2DCursorLocation(start, true),
|
|
fontSize = this.getValueOfPropertyAt(loc.lineIndex, loc.charIndex, 'fontSize'),
|
|
dy = this.getValueOfPropertyAt(loc.lineIndex, loc.charIndex, 'deltaY'),
|
|
style = { fontSize: fontSize * schema.size, deltaY: dy + fontSize * schema.baseline };
|
|
this.setSelectionStyles(style, start, end);
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} prevStyle
|
|
* @param {Object} thisStyle
|
|
*/
|
|
_hasStyleChanged: function(prevStyle, thisStyle) {
|
|
return prevStyle.fill !== thisStyle.fill ||
|
|
prevStyle.stroke !== thisStyle.stroke ||
|
|
prevStyle.strokeWidth !== thisStyle.strokeWidth ||
|
|
prevStyle.fontSize !== thisStyle.fontSize ||
|
|
prevStyle.fontFamily !== thisStyle.fontFamily ||
|
|
prevStyle.fontWeight !== thisStyle.fontWeight ||
|
|
prevStyle.fontStyle !== thisStyle.fontStyle ||
|
|
prevStyle.deltaY !== thisStyle.deltaY;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Object} prevStyle
|
|
* @param {Object} thisStyle
|
|
*/
|
|
_hasStyleChangedForSvg: function(prevStyle, thisStyle) {
|
|
return this._hasStyleChanged(prevStyle, thisStyle) ||
|
|
prevStyle.overline !== thisStyle.overline ||
|
|
prevStyle.underline !== thisStyle.underline ||
|
|
prevStyle.linethrough !== thisStyle.linethrough;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Number} lineIndex index text line
|
|
* @return {Number} Line left offset
|
|
*/
|
|
_getLineLeftOffset: function(lineIndex) {
|
|
var lineWidth = this.getLineWidth(lineIndex),
|
|
lineDiff = this.width - lineWidth, textAlign = this.textAlign, direction = this.direction,
|
|
isEndOfWrapping, leftOffset = 0, isEndOfWrapping = this.isEndOfWrapping(lineIndex);
|
|
if (textAlign === 'justify'
|
|
|| (textAlign === 'justify-center' && !isEndOfWrapping)
|
|
|| (textAlign === 'justify-right' && !isEndOfWrapping)
|
|
|| (textAlign === 'justify-left' && !isEndOfWrapping)
|
|
) {
|
|
return 0;
|
|
}
|
|
if (textAlign === 'center') {
|
|
leftOffset = lineDiff / 2;
|
|
}
|
|
if (textAlign === 'right') {
|
|
leftOffset = lineDiff;
|
|
}
|
|
if (textAlign === 'justify-center') {
|
|
leftOffset = lineDiff / 2;
|
|
}
|
|
if (textAlign === 'justify-right') {
|
|
leftOffset = lineDiff;
|
|
}
|
|
if (direction === 'rtl') {
|
|
leftOffset -= lineDiff;
|
|
}
|
|
return leftOffset;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_clearCache: function() {
|
|
this.__lineWidths = [];
|
|
this.__lineHeights = [];
|
|
this.__charBounds = [];
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_shouldClearDimensionCache: function() {
|
|
var shouldClear = this._forceClearCache;
|
|
shouldClear || (shouldClear = this.hasStateChanged('_dimensionAffectingProps'));
|
|
if (shouldClear) {
|
|
this.dirty = true;
|
|
this._forceClearCache = false;
|
|
}
|
|
return shouldClear;
|
|
},
|
|
|
|
/**
|
|
* Measure a single line given its index. Used to calculate the initial
|
|
* text bounding box. The values are calculated and stored in __lineWidths cache.
|
|
* @private
|
|
* @param {Number} lineIndex line number
|
|
* @return {Number} Line width
|
|
*/
|
|
getLineWidth: function(lineIndex) {
|
|
if (this.__lineWidths[lineIndex]) {
|
|
return this.__lineWidths[lineIndex];
|
|
}
|
|
|
|
var width, line = this._textLines[lineIndex], lineInfo;
|
|
|
|
if (line === '') {
|
|
width = 0;
|
|
}
|
|
else {
|
|
lineInfo = this.measureLine(lineIndex);
|
|
width = lineInfo.width;
|
|
}
|
|
this.__lineWidths[lineIndex] = width;
|
|
return width;
|
|
},
|
|
|
|
_getWidthOfCharSpacing: function() {
|
|
if (this.charSpacing !== 0) {
|
|
return this.fontSize * this.charSpacing / 1000;
|
|
}
|
|
return 0;
|
|
},
|
|
|
|
/**
|
|
* Retrieves the value of property at given character position
|
|
* @param {Number} lineIndex the line number
|
|
* @param {Number} charIndex the character number
|
|
* @param {String} property the property name
|
|
* @returns the value of 'property'
|
|
*/
|
|
getValueOfPropertyAt: function(lineIndex, charIndex, property) {
|
|
var charStyle = this._getStyleDeclaration(lineIndex, charIndex);
|
|
if (charStyle && typeof charStyle[property] !== 'undefined') {
|
|
return charStyle[property];
|
|
}
|
|
return this[property];
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_renderTextDecoration: function(ctx, type) {
|
|
if (!this[type] && !this.styleHas(type)) {
|
|
return;
|
|
}
|
|
var heightOfLine, size, _size,
|
|
lineLeftOffset, dy, _dy,
|
|
line, lastDecoration,
|
|
leftOffset = this._getLeftOffset(),
|
|
topOffset = this._getTopOffset(), top,
|
|
boxStart, boxWidth, charBox, currentDecoration,
|
|
maxHeight, currentFill, lastFill, path = this.path,
|
|
charSpacing = this._getWidthOfCharSpacing(),
|
|
offsetY = this.offsets[type];
|
|
|
|
for (var i = 0, len = this._textLines.length; i < len; i++) {
|
|
heightOfLine = this.getHeightOfLine(i);
|
|
if (!this[type] && !this.styleHas(type, i)) {
|
|
topOffset += heightOfLine;
|
|
continue;
|
|
}
|
|
line = this._textLines[i];
|
|
maxHeight = heightOfLine / this.lineHeight;
|
|
lineLeftOffset = this._getLineLeftOffset(i);
|
|
boxStart = 0;
|
|
boxWidth = 0;
|
|
lastDecoration = this.getValueOfPropertyAt(i, 0, type);
|
|
lastFill = this.getValueOfPropertyAt(i, 0, 'fill');
|
|
top = topOffset + maxHeight * (1 - this._fontSizeFraction);
|
|
size = this.getHeightOfChar(i, 0);
|
|
dy = this.getValueOfPropertyAt(i, 0, 'deltaY');
|
|
for (var j = 0, jlen = line.length; j < jlen; j++) {
|
|
charBox = this.__charBounds[i][j];
|
|
currentDecoration = this.getValueOfPropertyAt(i, j, type);
|
|
currentFill = this.getValueOfPropertyAt(i, j, 'fill');
|
|
_size = this.getHeightOfChar(i, j);
|
|
_dy = this.getValueOfPropertyAt(i, j, 'deltaY');
|
|
if (path && currentDecoration && currentFill) {
|
|
ctx.save();
|
|
ctx.fillStyle = lastFill;
|
|
ctx.translate(charBox.renderLeft, charBox.renderTop);
|
|
ctx.rotate(charBox.angle);
|
|
ctx.fillRect(
|
|
-charBox.kernedWidth / 2,
|
|
offsetY * _size + _dy,
|
|
charBox.kernedWidth,
|
|
this.fontSize / 15
|
|
);
|
|
ctx.restore();
|
|
}
|
|
else if (
|
|
(currentDecoration !== lastDecoration || currentFill !== lastFill || _size !== size || _dy !== dy)
|
|
&& boxWidth > 0
|
|
) {
|
|
var drawStart = leftOffset + lineLeftOffset + boxStart;
|
|
if (this.direction === 'rtl') {
|
|
drawStart = this.width - drawStart - boxWidth;
|
|
}
|
|
if (lastDecoration && lastFill) {
|
|
ctx.fillStyle = lastFill;
|
|
ctx.fillRect(
|
|
drawStart,
|
|
top + offsetY * size + dy,
|
|
boxWidth,
|
|
this.fontSize / 15
|
|
);
|
|
}
|
|
boxStart = charBox.left;
|
|
boxWidth = charBox.width;
|
|
lastDecoration = currentDecoration;
|
|
lastFill = currentFill;
|
|
size = _size;
|
|
dy = _dy;
|
|
}
|
|
else {
|
|
boxWidth += charBox.kernedWidth;
|
|
}
|
|
}
|
|
var drawStart = leftOffset + lineLeftOffset + boxStart;
|
|
if (this.direction === 'rtl') {
|
|
drawStart = this.width - drawStart - boxWidth;
|
|
}
|
|
ctx.fillStyle = currentFill;
|
|
currentDecoration && currentFill && ctx.fillRect(
|
|
drawStart,
|
|
top + offsetY * size + dy,
|
|
boxWidth - charSpacing,
|
|
this.fontSize / 15
|
|
);
|
|
topOffset += heightOfLine;
|
|
}
|
|
// if there is text background color no
|
|
// other shadows should be casted
|
|
this._removeShadow(ctx);
|
|
},
|
|
|
|
/**
|
|
* return font declaration string for canvas context
|
|
* @param {Object} [styleObject] object
|
|
* @returns {String} font declaration formatted for canvas context.
|
|
*/
|
|
_getFontDeclaration: function(styleObject, forMeasuring) {
|
|
var style = styleObject || this, family = this.fontFamily,
|
|
fontIsGeneric = fabric.Text.genericFonts.indexOf(family.toLowerCase()) > -1;
|
|
var fontFamily = family === undefined ||
|
|
family.indexOf('\'') > -1 || family.indexOf(',') > -1 ||
|
|
family.indexOf('"') > -1 || fontIsGeneric
|
|
? style.fontFamily : '"' + style.fontFamily + '"';
|
|
return [
|
|
// node-canvas needs "weight style", while browsers need "style weight"
|
|
// verify if this can be fixed in JSDOM
|
|
(fabric.isLikelyNode ? style.fontWeight : style.fontStyle),
|
|
(fabric.isLikelyNode ? style.fontStyle : style.fontWeight),
|
|
forMeasuring ? this.CACHE_FONT_SIZE + 'px' : style.fontSize + 'px',
|
|
fontFamily
|
|
].join(' ');
|
|
},
|
|
|
|
/**
|
|
* Renders text instance on a specified context
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
render: function(ctx) {
|
|
// do not render if object is not visible
|
|
if (!this.visible) {
|
|
return;
|
|
}
|
|
if (this.canvas && this.canvas.skipOffscreen && !this.group && !this.isOnScreen()) {
|
|
return;
|
|
}
|
|
if (this._shouldClearDimensionCache()) {
|
|
this.initDimensions();
|
|
}
|
|
this.callSuper('render', ctx);
|
|
},
|
|
|
|
/**
|
|
* Returns the text as an array of lines.
|
|
* @param {String} text text to split
|
|
* @returns {Array} Lines in the text
|
|
*/
|
|
_splitTextIntoLines: function(text) {
|
|
var lines = text.split(this._reNewline),
|
|
newLines = new Array(lines.length),
|
|
newLine = ['\n'],
|
|
newText = [];
|
|
for (var i = 0; i < lines.length; i++) {
|
|
newLines[i] = fabric.util.string.graphemeSplit(lines[i]);
|
|
newText = newText.concat(newLines[i], newLine);
|
|
}
|
|
newText.pop();
|
|
return { _unwrappedLines: newLines, lines: lines, graphemeText: newText, graphemeLines: newLines };
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} Object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
var allProperties = additionalProps.concat(propertiesToInclude);
|
|
var obj = this.callSuper('toObject', allProperties);
|
|
// styles will be overridden with a properly cloned structure
|
|
obj.styles = clone(this.styles, true);
|
|
if (obj.path) {
|
|
obj.path = this.path.toObject();
|
|
}
|
|
return obj;
|
|
},
|
|
|
|
/**
|
|
* Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`.
|
|
* @param {String|Object} key Property name or object (if object, iterate over the object properties)
|
|
* @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one)
|
|
* @return {fabric.Object} thisArg
|
|
* @chainable
|
|
*/
|
|
set: function(key, value) {
|
|
this.callSuper('set', key, value);
|
|
var needsDims = false;
|
|
var isAddingPath = false;
|
|
if (typeof key === 'object') {
|
|
for (var _key in key) {
|
|
if (_key === 'path') {
|
|
this.setPathInfo();
|
|
}
|
|
needsDims = needsDims || this._dimensionAffectingProps.indexOf(_key) !== -1;
|
|
isAddingPath = isAddingPath || _key === 'path';
|
|
}
|
|
}
|
|
else {
|
|
needsDims = this._dimensionAffectingProps.indexOf(key) !== -1;
|
|
isAddingPath = key === 'path';
|
|
}
|
|
if (isAddingPath) {
|
|
this.setPathInfo();
|
|
}
|
|
if (needsDims) {
|
|
this.initDimensions();
|
|
this.setCoords();
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns complexity of an instance
|
|
* @return {Number} complexity
|
|
*/
|
|
complexity: function() {
|
|
return 1;
|
|
}
|
|
});
|
|
|
|
/* _FROM_SVG_START_ */
|
|
/**
|
|
* List of attribute names to account for when parsing SVG element (used by {@link fabric.Text.fromElement})
|
|
* @static
|
|
* @memberOf fabric.Text
|
|
* @see: http://www.w3.org/TR/SVG/text.html#TextElement
|
|
*/
|
|
fabric.Text.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(
|
|
'x y dx dy font-family font-style font-weight font-size letter-spacing text-decoration text-anchor'.split(' '));
|
|
|
|
/**
|
|
* Default SVG font size
|
|
* @static
|
|
* @memberOf fabric.Text
|
|
*/
|
|
fabric.Text.DEFAULT_SVG_FONT_SIZE = 16;
|
|
|
|
/**
|
|
* Returns fabric.Text instance from an SVG element (<b>not yet implemented</b>)
|
|
* @static
|
|
* @memberOf fabric.Text
|
|
* @param {SVGElement} element Element to parse
|
|
* @param {Function} callback callback function invoked after parsing
|
|
* @param {Object} [options] Options object
|
|
*/
|
|
fabric.Text.fromElement = function(element, callback, options) {
|
|
if (!element) {
|
|
return callback(null);
|
|
}
|
|
|
|
var parsedAttributes = fabric.parseAttributes(element, fabric.Text.ATTRIBUTE_NAMES),
|
|
parsedAnchor = parsedAttributes.textAnchor || 'left';
|
|
options = fabric.util.object.extend((options ? clone(options) : { }), parsedAttributes);
|
|
|
|
options.top = options.top || 0;
|
|
options.left = options.left || 0;
|
|
if (parsedAttributes.textDecoration) {
|
|
var textDecoration = parsedAttributes.textDecoration;
|
|
if (textDecoration.indexOf('underline') !== -1) {
|
|
options.underline = true;
|
|
}
|
|
if (textDecoration.indexOf('overline') !== -1) {
|
|
options.overline = true;
|
|
}
|
|
if (textDecoration.indexOf('line-through') !== -1) {
|
|
options.linethrough = true;
|
|
}
|
|
delete options.textDecoration;
|
|
}
|
|
if ('dx' in parsedAttributes) {
|
|
options.left += parsedAttributes.dx;
|
|
}
|
|
if ('dy' in parsedAttributes) {
|
|
options.top += parsedAttributes.dy;
|
|
}
|
|
if (!('fontSize' in options)) {
|
|
options.fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE;
|
|
}
|
|
|
|
var textContent = '';
|
|
|
|
// The XML is not properly parsed in IE9 so a workaround to get
|
|
// textContent is through firstChild.data. Another workaround would be
|
|
// to convert XML loaded from a file to be converted using DOMParser (same way loadSVGFromString() does)
|
|
if (!('textContent' in element)) {
|
|
if ('firstChild' in element && element.firstChild !== null) {
|
|
if ('data' in element.firstChild && element.firstChild.data !== null) {
|
|
textContent = element.firstChild.data;
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
textContent = element.textContent;
|
|
}
|
|
|
|
textContent = textContent.replace(/^\s+|\s+$|\n+/g, '').replace(/\s+/g, ' ');
|
|
var originalStrokeWidth = options.strokeWidth;
|
|
options.strokeWidth = 0;
|
|
|
|
var text = new fabric.Text(textContent, options),
|
|
textHeightScaleFactor = text.getScaledHeight() / text.height,
|
|
lineHeightDiff = (text.height + text.strokeWidth) * text.lineHeight - text.height,
|
|
scaledDiff = lineHeightDiff * textHeightScaleFactor,
|
|
textHeight = text.getScaledHeight() + scaledDiff,
|
|
offX = 0;
|
|
/*
|
|
Adjust positioning:
|
|
x/y attributes in SVG correspond to the bottom-left corner of text bounding box
|
|
fabric output by default at top, left.
|
|
*/
|
|
if (parsedAnchor === 'center') {
|
|
offX = text.getScaledWidth() / 2;
|
|
}
|
|
if (parsedAnchor === 'right') {
|
|
offX = text.getScaledWidth();
|
|
}
|
|
text.set({
|
|
left: text.left - offX,
|
|
top: text.top - (textHeight - text.fontSize * (0.07 + text._fontSizeFraction)) / text.lineHeight,
|
|
strokeWidth: typeof originalStrokeWidth !== 'undefined' ? originalStrokeWidth : 1,
|
|
});
|
|
callback(text);
|
|
};
|
|
/* _FROM_SVG_END_ */
|
|
|
|
/**
|
|
* Returns fabric.Text instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Text
|
|
* @param {Object} object plain js Object to create an instance from
|
|
* @param {Function} [callback] Callback to invoke when an fabric.Text instance is created
|
|
*/
|
|
fabric.Text.fromObject = function(object, callback) {
|
|
var objectCopy = clone(object), path = object.path;
|
|
delete objectCopy.path;
|
|
return fabric.Object._fromObject('Text', objectCopy, function(textInstance) {
|
|
if (path) {
|
|
fabric.Object._fromObject('Path', path, function(pathInstance) {
|
|
textInstance.set('path', pathInstance);
|
|
callback(textInstance);
|
|
}, 'path');
|
|
}
|
|
else {
|
|
callback(textInstance);
|
|
}
|
|
}, 'text');
|
|
};
|
|
|
|
fabric.Text.genericFonts = ['sans-serif', 'serif', 'cursive', 'fantasy', 'monospace'];
|
|
|
|
fabric.util.createAccessors && fabric.util.createAccessors(fabric.Text);
|
|
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function() {
|
|
fabric.util.object.extend(fabric.Text.prototype, /** @lends fabric.Text.prototype */ {
|
|
/**
|
|
* Returns true if object has no styling or no styling in a line
|
|
* @param {Number} lineIndex , lineIndex is on wrapped lines.
|
|
* @return {Boolean}
|
|
*/
|
|
isEmptyStyles: function(lineIndex) {
|
|
if (!this.styles) {
|
|
return true;
|
|
}
|
|
if (typeof lineIndex !== 'undefined' && !this.styles[lineIndex]) {
|
|
return true;
|
|
}
|
|
var obj = typeof lineIndex === 'undefined' ? this.styles : { line: this.styles[lineIndex] };
|
|
for (var p1 in obj) {
|
|
for (var p2 in obj[p1]) {
|
|
// eslint-disable-next-line no-unused-vars
|
|
for (var p3 in obj[p1][p2]) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* Returns true if object has a style property or has it ina specified line
|
|
* This function is used to detect if a text will use a particular property or not.
|
|
* @param {String} property to check for
|
|
* @param {Number} lineIndex to check the style on
|
|
* @return {Boolean}
|
|
*/
|
|
styleHas: function(property, lineIndex) {
|
|
if (!this.styles || !property || property === '') {
|
|
return false;
|
|
}
|
|
if (typeof lineIndex !== 'undefined' && !this.styles[lineIndex]) {
|
|
return false;
|
|
}
|
|
var obj = typeof lineIndex === 'undefined' ? this.styles : { 0: this.styles[lineIndex] };
|
|
// eslint-disable-next-line
|
|
for (var p1 in obj) {
|
|
// eslint-disable-next-line
|
|
for (var p2 in obj[p1]) {
|
|
if (typeof obj[p1][p2][property] !== 'undefined') {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Check if characters in a text have a value for a property
|
|
* whose value matches the textbox's value for that property. If so,
|
|
* the character-level property is deleted. If the character
|
|
* has no other properties, then it is also deleted. Finally,
|
|
* if the line containing that character has no other characters
|
|
* then it also is deleted.
|
|
*
|
|
* @param {string} property The property to compare between characters and text.
|
|
*/
|
|
cleanStyle: function(property) {
|
|
if (!this.styles || !property || property === '') {
|
|
return false;
|
|
}
|
|
var obj = this.styles, stylesCount = 0, letterCount, stylePropertyValue,
|
|
allStyleObjectPropertiesMatch = true, graphemeCount = 0, styleObject;
|
|
// eslint-disable-next-line
|
|
for (var p1 in obj) {
|
|
letterCount = 0;
|
|
// eslint-disable-next-line
|
|
for (var p2 in obj[p1]) {
|
|
var styleObject = obj[p1][p2],
|
|
stylePropertyHasBeenSet = styleObject.hasOwnProperty(property);
|
|
|
|
stylesCount++;
|
|
|
|
if (stylePropertyHasBeenSet) {
|
|
if (!stylePropertyValue) {
|
|
stylePropertyValue = styleObject[property];
|
|
}
|
|
else if (styleObject[property] !== stylePropertyValue) {
|
|
allStyleObjectPropertiesMatch = false;
|
|
}
|
|
|
|
if (styleObject[property] === this[property]) {
|
|
delete styleObject[property];
|
|
}
|
|
}
|
|
else {
|
|
allStyleObjectPropertiesMatch = false;
|
|
}
|
|
|
|
if (Object.keys(styleObject).length !== 0) {
|
|
letterCount++;
|
|
}
|
|
else {
|
|
delete obj[p1][p2];
|
|
}
|
|
}
|
|
|
|
if (letterCount === 0) {
|
|
delete obj[p1];
|
|
}
|
|
}
|
|
// if every grapheme has the same style set then
|
|
// delete those styles and set it on the parent
|
|
for (var i = 0; i < this._textLines.length; i++) {
|
|
graphemeCount += this._textLines[i].length;
|
|
}
|
|
if (allStyleObjectPropertiesMatch && stylesCount === graphemeCount) {
|
|
this[property] = stylePropertyValue;
|
|
this.removeStyle(property);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Remove a style property or properties from all individual character styles
|
|
* in a text object. Deletes the character style object if it contains no other style
|
|
* props. Deletes a line style object if it contains no other character styles.
|
|
*
|
|
* @param {String} props The property to remove from character styles.
|
|
*/
|
|
removeStyle: function(property) {
|
|
if (!this.styles || !property || property === '') {
|
|
return;
|
|
}
|
|
var obj = this.styles, line, lineNum, charNum;
|
|
for (lineNum in obj) {
|
|
line = obj[lineNum];
|
|
for (charNum in line) {
|
|
delete line[charNum][property];
|
|
if (Object.keys(line[charNum]).length === 0) {
|
|
delete line[charNum];
|
|
}
|
|
}
|
|
if (Object.keys(line).length === 0) {
|
|
delete obj[lineNum];
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_extendStyles: function(index, styles) {
|
|
var loc = this.get2DCursorLocation(index);
|
|
|
|
if (!this._getLineStyle(loc.lineIndex)) {
|
|
this._setLineStyle(loc.lineIndex);
|
|
}
|
|
|
|
if (!this._getStyleDeclaration(loc.lineIndex, loc.charIndex)) {
|
|
this._setStyleDeclaration(loc.lineIndex, loc.charIndex, {});
|
|
}
|
|
|
|
fabric.util.object.extend(this._getStyleDeclaration(loc.lineIndex, loc.charIndex), styles);
|
|
},
|
|
|
|
/**
|
|
* Returns 2d representation (lineIndex and charIndex) of cursor (or selection start)
|
|
* @param {Number} [selectionStart] Optional index. When not given, current selectionStart is used.
|
|
* @param {Boolean} [skipWrapping] consider the location for unwrapped lines. useful to manage styles.
|
|
*/
|
|
get2DCursorLocation: function(selectionStart, skipWrapping) {
|
|
if (typeof selectionStart === 'undefined') {
|
|
selectionStart = this.selectionStart;
|
|
}
|
|
var lines = skipWrapping ? this._unwrappedTextLines : this._textLines,
|
|
len = lines.length;
|
|
for (var i = 0; i < len; i++) {
|
|
if (selectionStart <= lines[i].length) {
|
|
return {
|
|
lineIndex: i,
|
|
charIndex: selectionStart
|
|
};
|
|
}
|
|
selectionStart -= lines[i].length + this.missingNewlineOffset(i);
|
|
}
|
|
return {
|
|
lineIndex: i - 1,
|
|
charIndex: lines[i - 1].length < selectionStart ? lines[i - 1].length : selectionStart
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Gets style of a current selection/cursor (at the start position)
|
|
* if startIndex or endIndex are not provided, selectionStart or selectionEnd will be used.
|
|
* @param {Number} [startIndex] Start index to get styles at
|
|
* @param {Number} [endIndex] End index to get styles at, if not specified selectionEnd or startIndex + 1
|
|
* @param {Boolean} [complete] get full style or not
|
|
* @return {Array} styles an array with one, zero or more Style objects
|
|
*/
|
|
getSelectionStyles: function(startIndex, endIndex, complete) {
|
|
if (typeof startIndex === 'undefined') {
|
|
startIndex = this.selectionStart || 0;
|
|
}
|
|
if (typeof endIndex === 'undefined') {
|
|
endIndex = this.selectionEnd || startIndex;
|
|
}
|
|
var styles = [];
|
|
for (var i = startIndex; i < endIndex; i++) {
|
|
styles.push(this.getStyleAtPosition(i, complete));
|
|
}
|
|
return styles;
|
|
},
|
|
|
|
/**
|
|
* Gets style of a current selection/cursor position
|
|
* @param {Number} position to get styles at
|
|
* @param {Boolean} [complete] full style if true
|
|
* @return {Object} style Style object at a specified index
|
|
* @private
|
|
*/
|
|
getStyleAtPosition: function(position, complete) {
|
|
var loc = this.get2DCursorLocation(position),
|
|
style = complete ? this.getCompleteStyleDeclaration(loc.lineIndex, loc.charIndex) :
|
|
this._getStyleDeclaration(loc.lineIndex, loc.charIndex);
|
|
return style || {};
|
|
},
|
|
|
|
/**
|
|
* Sets style of a current selection, if no selection exist, do not set anything.
|
|
* @param {Object} [styles] Styles object
|
|
* @param {Number} [startIndex] Start index to get styles at
|
|
* @param {Number} [endIndex] End index to get styles at, if not specified selectionEnd or startIndex + 1
|
|
* @return {fabric.IText} thisArg
|
|
* @chainable
|
|
*/
|
|
setSelectionStyles: function(styles, startIndex, endIndex) {
|
|
if (typeof startIndex === 'undefined') {
|
|
startIndex = this.selectionStart || 0;
|
|
}
|
|
if (typeof endIndex === 'undefined') {
|
|
endIndex = this.selectionEnd || startIndex;
|
|
}
|
|
for (var i = startIndex; i < endIndex; i++) {
|
|
this._extendStyles(i, styles);
|
|
}
|
|
/* not included in _extendStyles to avoid clearing cache more than once */
|
|
this._forceClearCache = true;
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* get the reference, not a clone, of the style object for a given character
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @return {Object} style object
|
|
*/
|
|
_getStyleDeclaration: function(lineIndex, charIndex) {
|
|
var lineStyle = this.styles && this.styles[lineIndex];
|
|
if (!lineStyle) {
|
|
return null;
|
|
}
|
|
return lineStyle[charIndex];
|
|
},
|
|
|
|
/**
|
|
* return a new object that contains all the style property for a character
|
|
* the object returned is newly created
|
|
* @param {Number} lineIndex of the line where the character is
|
|
* @param {Number} charIndex position of the character on the line
|
|
* @return {Object} style object
|
|
*/
|
|
getCompleteStyleDeclaration: function(lineIndex, charIndex) {
|
|
var style = this._getStyleDeclaration(lineIndex, charIndex) || { },
|
|
styleObject = { }, prop;
|
|
for (var i = 0; i < this._styleProperties.length; i++) {
|
|
prop = this._styleProperties[i];
|
|
styleObject[prop] = typeof style[prop] === 'undefined' ? this[prop] : style[prop];
|
|
}
|
|
return styleObject;
|
|
},
|
|
|
|
/**
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @param {Object} style
|
|
* @private
|
|
*/
|
|
_setStyleDeclaration: function(lineIndex, charIndex, style) {
|
|
this.styles[lineIndex][charIndex] = style;
|
|
},
|
|
|
|
/**
|
|
*
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @private
|
|
*/
|
|
_deleteStyleDeclaration: function(lineIndex, charIndex) {
|
|
delete this.styles[lineIndex][charIndex];
|
|
},
|
|
|
|
/**
|
|
* @param {Number} lineIndex
|
|
* @return {Boolean} if the line exists or not
|
|
* @private
|
|
*/
|
|
_getLineStyle: function(lineIndex) {
|
|
return !!this.styles[lineIndex];
|
|
},
|
|
|
|
/**
|
|
* Set the line style to an empty object so that is initialized
|
|
* @param {Number} lineIndex
|
|
* @private
|
|
*/
|
|
_setLineStyle: function(lineIndex) {
|
|
this.styles[lineIndex] = {};
|
|
},
|
|
|
|
/**
|
|
* @param {Number} lineIndex
|
|
* @private
|
|
*/
|
|
_deleteLineStyle: function(lineIndex) {
|
|
delete this.styles[lineIndex];
|
|
}
|
|
});
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
function parseDecoration(object) {
|
|
if (object.textDecoration) {
|
|
object.textDecoration.indexOf('underline') > -1 && (object.underline = true);
|
|
object.textDecoration.indexOf('line-through') > -1 && (object.linethrough = true);
|
|
object.textDecoration.indexOf('overline') > -1 && (object.overline = true);
|
|
delete object.textDecoration;
|
|
}
|
|
}
|
|
|
|
/**
|
|
* IText class (introduced in <b>v1.4</b>) Events are also fired with "text:"
|
|
* prefix when observing canvas.
|
|
* @class fabric.IText
|
|
* @extends fabric.Text
|
|
* @mixes fabric.Observable
|
|
*
|
|
* @fires changed
|
|
* @fires selection:changed
|
|
* @fires editing:entered
|
|
* @fires editing:exited
|
|
*
|
|
* @return {fabric.IText} thisArg
|
|
* @see {@link fabric.IText#initialize} for constructor definition
|
|
*
|
|
* <p>Supported key combinations:</p>
|
|
* <pre>
|
|
* Move cursor: left, right, up, down
|
|
* Select character: shift + left, shift + right
|
|
* Select text vertically: shift + up, shift + down
|
|
* Move cursor by word: alt + left, alt + right
|
|
* Select words: shift + alt + left, shift + alt + right
|
|
* Move cursor to line start/end: cmd + left, cmd + right or home, end
|
|
* Select till start/end of line: cmd + shift + left, cmd + shift + right or shift + home, shift + end
|
|
* Jump to start/end of text: cmd + up, cmd + down
|
|
* Select till start/end of text: cmd + shift + up, cmd + shift + down or shift + pgUp, shift + pgDown
|
|
* Delete character: backspace
|
|
* Delete word: alt + backspace
|
|
* Delete line: cmd + backspace
|
|
* Forward delete: delete
|
|
* Copy text: ctrl/cmd + c
|
|
* Paste text: ctrl/cmd + v
|
|
* Cut text: ctrl/cmd + x
|
|
* Select entire text: ctrl/cmd + a
|
|
* Quit editing tab or esc
|
|
* </pre>
|
|
*
|
|
* <p>Supported mouse/touch combination</p>
|
|
* <pre>
|
|
* Position cursor: click/touch
|
|
* Create selection: click/touch & drag
|
|
* Create selection: click & shift + click
|
|
* Select word: double click
|
|
* Select line: triple click
|
|
* </pre>
|
|
*/
|
|
fabric.IText = fabric.util.createClass(fabric.Text, fabric.Observable, /** @lends fabric.IText.prototype */ {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'i-text',
|
|
|
|
/**
|
|
* Index where text selection starts (or where cursor is when there is no selection)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
selectionStart: 0,
|
|
|
|
/**
|
|
* Index where text selection ends
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
selectionEnd: 0,
|
|
|
|
/**
|
|
* Color of text selection
|
|
* @type String
|
|
* @default
|
|
*/
|
|
selectionColor: 'rgba(17,119,255,0.3)',
|
|
|
|
/**
|
|
* Indicates whether text is in editing mode
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
isEditing: false,
|
|
|
|
/**
|
|
* Indicates whether a text can be edited
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
editable: true,
|
|
|
|
/**
|
|
* Border color of text object while it's in editing mode
|
|
* @type String
|
|
* @default
|
|
*/
|
|
editingBorderColor: 'rgba(102,153,255,0.25)',
|
|
|
|
/**
|
|
* Width of cursor (in px)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
cursorWidth: 2,
|
|
|
|
/**
|
|
* Color of text cursor color in editing mode.
|
|
* if not set (default) will take color from the text.
|
|
* if set to a color value that fabric can understand, it will
|
|
* be used instead of the color of the text at the current position.
|
|
* @type String
|
|
* @default
|
|
*/
|
|
cursorColor: '',
|
|
|
|
/**
|
|
* Delay between cursor blink (in ms)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
cursorDelay: 1000,
|
|
|
|
/**
|
|
* Duration of cursor fadein (in ms)
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
cursorDuration: 600,
|
|
|
|
/**
|
|
* Indicates whether internal text char widths can be cached
|
|
* @type Boolean
|
|
* @default
|
|
*/
|
|
caching: true,
|
|
|
|
/**
|
|
* DOM container to append the hiddenTextarea.
|
|
* An alternative to attaching to the document.body.
|
|
* Useful to reduce laggish redraw of the full document.body tree and
|
|
* also with modals event capturing that won't let the textarea take focus.
|
|
* @type HTMLElement
|
|
* @default
|
|
*/
|
|
hiddenTextareaContainer: null,
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_reSpace: /\s|\n/,
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_currentCursorOpacity: 0,
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_selectionDirection: null,
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_abortCursorAnimation: false,
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
__widthOfSpace: [],
|
|
|
|
/**
|
|
* Helps determining when the text is in composition, so that the cursor
|
|
* rendering is altered.
|
|
*/
|
|
inCompositionMode: false,
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {String} text Text string
|
|
* @param {Object} [options] Options object
|
|
* @return {fabric.IText} thisArg
|
|
*/
|
|
initialize: function(text, options) {
|
|
this.callSuper('initialize', text, options);
|
|
this.initBehavior();
|
|
},
|
|
|
|
/**
|
|
* Sets selection start (left boundary of a selection)
|
|
* @param {Number} index Index to set selection start to
|
|
*/
|
|
setSelectionStart: function(index) {
|
|
index = Math.max(index, 0);
|
|
this._updateAndFire('selectionStart', index);
|
|
},
|
|
|
|
/**
|
|
* Sets selection end (right boundary of a selection)
|
|
* @param {Number} index Index to set selection end to
|
|
*/
|
|
setSelectionEnd: function(index) {
|
|
index = Math.min(index, this.text.length);
|
|
this._updateAndFire('selectionEnd', index);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {String} property 'selectionStart' or 'selectionEnd'
|
|
* @param {Number} index new position of property
|
|
*/
|
|
_updateAndFire: function(property, index) {
|
|
if (this[property] !== index) {
|
|
this._fireSelectionChanged();
|
|
this[property] = index;
|
|
}
|
|
this._updateTextarea();
|
|
},
|
|
|
|
/**
|
|
* Fires the even of selection changed
|
|
* @private
|
|
*/
|
|
_fireSelectionChanged: function() {
|
|
this.fire('selection:changed');
|
|
this.canvas && this.canvas.fire('text:selection:changed', { target: this });
|
|
},
|
|
|
|
/**
|
|
* Initialize text dimensions. Render all text on given context
|
|
* or on a offscreen canvas to get the text width with measureText.
|
|
* Updates this.width and this.height with the proper values.
|
|
* Does not return dimensions.
|
|
* @private
|
|
*/
|
|
initDimensions: function() {
|
|
this.isEditing && this.initDelayedCursor();
|
|
this.clearContextTop();
|
|
this.callSuper('initDimensions');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
render: function(ctx) {
|
|
this.clearContextTop();
|
|
this.callSuper('render', ctx);
|
|
// clear the cursorOffsetCache, so we ensure to calculate once per renderCursor
|
|
// the correct position but not at every cursor animation.
|
|
this.cursorOffsetCache = { };
|
|
this.renderCursorOrSelection();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {CanvasRenderingContext2D} ctx Context to render on
|
|
*/
|
|
_render: function(ctx) {
|
|
this.callSuper('_render', ctx);
|
|
},
|
|
|
|
/**
|
|
* Prepare and clean the contextTop
|
|
*/
|
|
clearContextTop: function(skipRestore) {
|
|
if (!this.isEditing || !this.canvas || !this.canvas.contextTop) {
|
|
return;
|
|
}
|
|
var ctx = this.canvas.contextTop, v = this.canvas.viewportTransform;
|
|
ctx.save();
|
|
ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]);
|
|
this.transform(ctx);
|
|
this._clearTextArea(ctx);
|
|
skipRestore || ctx.restore();
|
|
},
|
|
/**
|
|
* Renders cursor or selection (depending on what exists)
|
|
* it does on the contextTop. If contextTop is not available, do nothing.
|
|
*/
|
|
renderCursorOrSelection: function() {
|
|
if (!this.isEditing || !this.canvas || !this.canvas.contextTop) {
|
|
return;
|
|
}
|
|
var boundaries = this._getCursorBoundaries(),
|
|
ctx = this.canvas.contextTop;
|
|
this.clearContextTop(true);
|
|
if (this.selectionStart === this.selectionEnd) {
|
|
this.renderCursor(boundaries, ctx);
|
|
}
|
|
else {
|
|
this.renderSelection(boundaries, ctx);
|
|
}
|
|
ctx.restore();
|
|
},
|
|
|
|
_clearTextArea: function(ctx) {
|
|
// we add 4 pixel, to be sure to do not leave any pixel out
|
|
var width = this.width + 4, height = this.height + 4;
|
|
ctx.clearRect(-width / 2, -height / 2, width, height);
|
|
},
|
|
|
|
/**
|
|
* Returns cursor boundaries (left, top, leftOffset, topOffset)
|
|
* @private
|
|
* @param {Array} chars Array of characters
|
|
* @param {String} typeOfBoundaries
|
|
*/
|
|
_getCursorBoundaries: function(position) {
|
|
|
|
// left/top are left/top of entire text box
|
|
// leftOffset/topOffset are offset from that left/top point of a text box
|
|
|
|
if (typeof position === 'undefined') {
|
|
position = this.selectionStart;
|
|
}
|
|
|
|
var left = this._getLeftOffset(),
|
|
top = this._getTopOffset(),
|
|
offsets = this._getCursorBoundariesOffsets(position);
|
|
return {
|
|
left: left,
|
|
top: top,
|
|
leftOffset: offsets.left,
|
|
topOffset: offsets.top
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getCursorBoundariesOffsets: function(position) {
|
|
if (this.cursorOffsetCache && 'top' in this.cursorOffsetCache) {
|
|
return this.cursorOffsetCache;
|
|
}
|
|
var lineLeftOffset,
|
|
lineIndex,
|
|
charIndex,
|
|
topOffset = 0,
|
|
leftOffset = 0,
|
|
boundaries,
|
|
cursorPosition = this.get2DCursorLocation(position);
|
|
charIndex = cursorPosition.charIndex;
|
|
lineIndex = cursorPosition.lineIndex;
|
|
for (var i = 0; i < lineIndex; i++) {
|
|
topOffset += this.getHeightOfLine(i);
|
|
}
|
|
lineLeftOffset = this._getLineLeftOffset(lineIndex);
|
|
var bound = this.__charBounds[lineIndex][charIndex];
|
|
bound && (leftOffset = bound.left);
|
|
if (this.charSpacing !== 0 && charIndex === this._textLines[lineIndex].length) {
|
|
leftOffset -= this._getWidthOfCharSpacing();
|
|
}
|
|
boundaries = {
|
|
top: topOffset,
|
|
left: lineLeftOffset + (leftOffset > 0 ? leftOffset : 0),
|
|
};
|
|
if (this.direction === 'rtl') {
|
|
boundaries.left *= -1;
|
|
}
|
|
this.cursorOffsetCache = boundaries;
|
|
return this.cursorOffsetCache;
|
|
},
|
|
|
|
/**
|
|
* Renders cursor
|
|
* @param {Object} boundaries
|
|
* @param {CanvasRenderingContext2D} ctx transformed context to draw on
|
|
*/
|
|
renderCursor: function(boundaries, ctx) {
|
|
var cursorLocation = this.get2DCursorLocation(),
|
|
lineIndex = cursorLocation.lineIndex,
|
|
charIndex = cursorLocation.charIndex > 0 ? cursorLocation.charIndex - 1 : 0,
|
|
charHeight = this.getValueOfPropertyAt(lineIndex, charIndex, 'fontSize'),
|
|
multiplier = this.scaleX * this.canvas.getZoom(),
|
|
cursorWidth = this.cursorWidth / multiplier,
|
|
topOffset = boundaries.topOffset,
|
|
dy = this.getValueOfPropertyAt(lineIndex, charIndex, 'deltaY');
|
|
topOffset += (1 - this._fontSizeFraction) * this.getHeightOfLine(lineIndex) / this.lineHeight
|
|
- charHeight * (1 - this._fontSizeFraction);
|
|
|
|
if (this.inCompositionMode) {
|
|
this.renderSelection(boundaries, ctx);
|
|
}
|
|
ctx.fillStyle = this.cursorColor || this.getValueOfPropertyAt(lineIndex, charIndex, 'fill');
|
|
ctx.globalAlpha = this.__isMousedown ? 1 : this._currentCursorOpacity;
|
|
ctx.fillRect(
|
|
boundaries.left + boundaries.leftOffset - cursorWidth / 2,
|
|
topOffset + boundaries.top + dy,
|
|
cursorWidth,
|
|
charHeight);
|
|
},
|
|
|
|
/**
|
|
* Renders text selection
|
|
* @param {Object} boundaries Object with left/top/leftOffset/topOffset
|
|
* @param {CanvasRenderingContext2D} ctx transformed context to draw on
|
|
*/
|
|
renderSelection: function(boundaries, ctx) {
|
|
|
|
var selectionStart = this.inCompositionMode ? this.hiddenTextarea.selectionStart : this.selectionStart,
|
|
selectionEnd = this.inCompositionMode ? this.hiddenTextarea.selectionEnd : this.selectionEnd,
|
|
isJustify = this.textAlign.indexOf('justify') !== -1,
|
|
start = this.get2DCursorLocation(selectionStart),
|
|
end = this.get2DCursorLocation(selectionEnd),
|
|
startLine = start.lineIndex,
|
|
endLine = end.lineIndex,
|
|
startChar = start.charIndex < 0 ? 0 : start.charIndex,
|
|
endChar = end.charIndex < 0 ? 0 : end.charIndex;
|
|
|
|
for (var i = startLine; i <= endLine; i++) {
|
|
var lineOffset = this._getLineLeftOffset(i) || 0,
|
|
lineHeight = this.getHeightOfLine(i),
|
|
realLineHeight = 0, boxStart = 0, boxEnd = 0;
|
|
|
|
if (i === startLine) {
|
|
boxStart = this.__charBounds[startLine][startChar].left;
|
|
}
|
|
if (i >= startLine && i < endLine) {
|
|
boxEnd = isJustify && !this.isEndOfWrapping(i) ? this.width : this.getLineWidth(i) || 5; // WTF is this 5?
|
|
}
|
|
else if (i === endLine) {
|
|
if (endChar === 0) {
|
|
boxEnd = this.__charBounds[endLine][endChar].left;
|
|
}
|
|
else {
|
|
var charSpacing = this._getWidthOfCharSpacing();
|
|
boxEnd = this.__charBounds[endLine][endChar - 1].left
|
|
+ this.__charBounds[endLine][endChar - 1].width - charSpacing;
|
|
}
|
|
}
|
|
realLineHeight = lineHeight;
|
|
if (this.lineHeight < 1 || (i === endLine && this.lineHeight > 1)) {
|
|
lineHeight /= this.lineHeight;
|
|
}
|
|
var drawStart = boundaries.left + lineOffset + boxStart,
|
|
drawWidth = boxEnd - boxStart,
|
|
drawHeight = lineHeight, extraTop = 0;
|
|
if (this.inCompositionMode) {
|
|
ctx.fillStyle = this.compositionColor || 'black';
|
|
drawHeight = 1;
|
|
extraTop = lineHeight;
|
|
}
|
|
else {
|
|
ctx.fillStyle = this.selectionColor;
|
|
}
|
|
if (this.direction === 'rtl') {
|
|
drawStart = this.width - drawStart - drawWidth;
|
|
}
|
|
ctx.fillRect(
|
|
drawStart,
|
|
boundaries.top + boundaries.topOffset + extraTop,
|
|
drawWidth,
|
|
drawHeight);
|
|
boundaries.topOffset += realLineHeight;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* High level function to know the height of the cursor.
|
|
* the currentChar is the one that precedes the cursor
|
|
* Returns fontSize of char at the current cursor
|
|
* Unused from the library, is for the end user
|
|
* @return {Number} Character font size
|
|
*/
|
|
getCurrentCharFontSize: function() {
|
|
var cp = this._getCurrentCharIndex();
|
|
return this.getValueOfPropertyAt(cp.l, cp.c, 'fontSize');
|
|
},
|
|
|
|
/**
|
|
* High level function to know the color of the cursor.
|
|
* the currentChar is the one that precedes the cursor
|
|
* Returns color (fill) of char at the current cursor
|
|
* if the text object has a pattern or gradient for filler, it will return that.
|
|
* Unused by the library, is for the end user
|
|
* @return {String | fabric.Gradient | fabric.Pattern} Character color (fill)
|
|
*/
|
|
getCurrentCharColor: function() {
|
|
var cp = this._getCurrentCharIndex();
|
|
return this.getValueOfPropertyAt(cp.l, cp.c, 'fill');
|
|
},
|
|
|
|
/**
|
|
* Returns the cursor position for the getCurrent.. functions
|
|
* @private
|
|
*/
|
|
_getCurrentCharIndex: function() {
|
|
var cursorPosition = this.get2DCursorLocation(this.selectionStart, true),
|
|
charIndex = cursorPosition.charIndex > 0 ? cursorPosition.charIndex - 1 : 0;
|
|
return { l: cursorPosition.lineIndex, c: charIndex };
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns fabric.IText instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.IText
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {function} [callback] invoked with new instance as argument
|
|
*/
|
|
fabric.IText.fromObject = function(object, callback) {
|
|
parseDecoration(object);
|
|
if (object.styles) {
|
|
for (var i in object.styles) {
|
|
for (var j in object.styles[i]) {
|
|
parseDecoration(object.styles[i][j]);
|
|
}
|
|
}
|
|
}
|
|
fabric.Object._fromObject('IText', object, callback, 'text');
|
|
};
|
|
})();
|
|
|
|
|
|
(function() {
|
|
|
|
var clone = fabric.util.object.clone;
|
|
|
|
fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ {
|
|
|
|
/**
|
|
* Initializes all the interactive behavior of IText
|
|
*/
|
|
initBehavior: function() {
|
|
this.initAddedHandler();
|
|
this.initRemovedHandler();
|
|
this.initCursorSelectionHandlers();
|
|
this.initDoubleClickSimulation();
|
|
this.mouseMoveHandler = this.mouseMoveHandler.bind(this);
|
|
},
|
|
|
|
onDeselect: function() {
|
|
this.isEditing && this.exitEditing();
|
|
this.selected = false;
|
|
},
|
|
|
|
/**
|
|
* Initializes "added" event handler
|
|
*/
|
|
initAddedHandler: function() {
|
|
var _this = this;
|
|
this.on('added', function() {
|
|
var canvas = _this.canvas;
|
|
if (canvas) {
|
|
if (!canvas._hasITextHandlers) {
|
|
canvas._hasITextHandlers = true;
|
|
_this._initCanvasHandlers(canvas);
|
|
}
|
|
canvas._iTextInstances = canvas._iTextInstances || [];
|
|
canvas._iTextInstances.push(_this);
|
|
}
|
|
});
|
|
},
|
|
|
|
initRemovedHandler: function() {
|
|
var _this = this;
|
|
this.on('removed', function() {
|
|
var canvas = _this.canvas;
|
|
if (canvas) {
|
|
canvas._iTextInstances = canvas._iTextInstances || [];
|
|
fabric.util.removeFromArray(canvas._iTextInstances, _this);
|
|
if (canvas._iTextInstances.length === 0) {
|
|
canvas._hasITextHandlers = false;
|
|
_this._removeCanvasHandlers(canvas);
|
|
}
|
|
}
|
|
});
|
|
},
|
|
|
|
/**
|
|
* register canvas event to manage exiting on other instances
|
|
* @private
|
|
*/
|
|
_initCanvasHandlers: function(canvas) {
|
|
canvas._mouseUpITextHandler = function() {
|
|
if (canvas._iTextInstances) {
|
|
canvas._iTextInstances.forEach(function(obj) {
|
|
obj.__isMousedown = false;
|
|
});
|
|
}
|
|
};
|
|
canvas.on('mouse:up', canvas._mouseUpITextHandler);
|
|
},
|
|
|
|
/**
|
|
* remove canvas event to manage exiting on other instances
|
|
* @private
|
|
*/
|
|
_removeCanvasHandlers: function(canvas) {
|
|
canvas.off('mouse:up', canvas._mouseUpITextHandler);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_tick: function() {
|
|
this._currentTickState = this._animateCursor(this, 1, this.cursorDuration, '_onTickComplete');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_animateCursor: function(obj, targetOpacity, duration, completeMethod) {
|
|
|
|
var tickState;
|
|
|
|
tickState = {
|
|
isAborted: false,
|
|
abort: function() {
|
|
this.isAborted = true;
|
|
},
|
|
};
|
|
|
|
obj.animate('_currentCursorOpacity', targetOpacity, {
|
|
duration: duration,
|
|
onComplete: function() {
|
|
if (!tickState.isAborted) {
|
|
obj[completeMethod]();
|
|
}
|
|
},
|
|
onChange: function() {
|
|
// we do not want to animate a selection, only cursor
|
|
if (obj.canvas && obj.selectionStart === obj.selectionEnd) {
|
|
obj.renderCursorOrSelection();
|
|
}
|
|
},
|
|
abort: function() {
|
|
return tickState.isAborted;
|
|
}
|
|
});
|
|
return tickState;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_onTickComplete: function() {
|
|
|
|
var _this = this;
|
|
|
|
if (this._cursorTimeout1) {
|
|
clearTimeout(this._cursorTimeout1);
|
|
}
|
|
this._cursorTimeout1 = setTimeout(function() {
|
|
_this._currentTickCompleteState = _this._animateCursor(_this, 0, this.cursorDuration / 2, '_tick');
|
|
}, 100);
|
|
},
|
|
|
|
/**
|
|
* Initializes delayed cursor
|
|
*/
|
|
initDelayedCursor: function(restart) {
|
|
var _this = this,
|
|
delay = restart ? 0 : this.cursorDelay;
|
|
|
|
this.abortCursorAnimation();
|
|
this._currentCursorOpacity = 1;
|
|
this._cursorTimeout2 = setTimeout(function() {
|
|
_this._tick();
|
|
}, delay);
|
|
},
|
|
|
|
/**
|
|
* Aborts cursor animation and clears all timeouts
|
|
*/
|
|
abortCursorAnimation: function() {
|
|
var shouldClear = this._currentTickState || this._currentTickCompleteState,
|
|
canvas = this.canvas;
|
|
this._currentTickState && this._currentTickState.abort();
|
|
this._currentTickCompleteState && this._currentTickCompleteState.abort();
|
|
|
|
clearTimeout(this._cursorTimeout1);
|
|
clearTimeout(this._cursorTimeout2);
|
|
|
|
this._currentCursorOpacity = 0;
|
|
// to clear just itext area we need to transform the context
|
|
// it may not be worth it
|
|
if (shouldClear && canvas) {
|
|
canvas.clearContext(canvas.contextTop || canvas.contextContainer);
|
|
}
|
|
|
|
},
|
|
|
|
/**
|
|
* Selects entire text
|
|
* @return {fabric.IText} thisArg
|
|
* @chainable
|
|
*/
|
|
selectAll: function() {
|
|
this.selectionStart = 0;
|
|
this.selectionEnd = this._text.length;
|
|
this._fireSelectionChanged();
|
|
this._updateTextarea();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Returns selected text
|
|
* @return {String}
|
|
*/
|
|
getSelectedText: function() {
|
|
return this._text.slice(this.selectionStart, this.selectionEnd).join('');
|
|
},
|
|
|
|
/**
|
|
* Find new selection index representing start of current word according to current selection index
|
|
* @param {Number} startFrom Current selection index
|
|
* @return {Number} New selection index
|
|
*/
|
|
findWordBoundaryLeft: function(startFrom) {
|
|
var offset = 0, index = startFrom - 1;
|
|
|
|
// remove space before cursor first
|
|
if (this._reSpace.test(this._text[index])) {
|
|
while (this._reSpace.test(this._text[index])) {
|
|
offset++;
|
|
index--;
|
|
}
|
|
}
|
|
while (/\S/.test(this._text[index]) && index > -1) {
|
|
offset++;
|
|
index--;
|
|
}
|
|
|
|
return startFrom - offset;
|
|
},
|
|
|
|
/**
|
|
* Find new selection index representing end of current word according to current selection index
|
|
* @param {Number} startFrom Current selection index
|
|
* @return {Number} New selection index
|
|
*/
|
|
findWordBoundaryRight: function(startFrom) {
|
|
var offset = 0, index = startFrom;
|
|
|
|
// remove space after cursor first
|
|
if (this._reSpace.test(this._text[index])) {
|
|
while (this._reSpace.test(this._text[index])) {
|
|
offset++;
|
|
index++;
|
|
}
|
|
}
|
|
while (/\S/.test(this._text[index]) && index < this._text.length) {
|
|
offset++;
|
|
index++;
|
|
}
|
|
|
|
return startFrom + offset;
|
|
},
|
|
|
|
/**
|
|
* Find new selection index representing start of current line according to current selection index
|
|
* @param {Number} startFrom Current selection index
|
|
* @return {Number} New selection index
|
|
*/
|
|
findLineBoundaryLeft: function(startFrom) {
|
|
var offset = 0, index = startFrom - 1;
|
|
|
|
while (!/\n/.test(this._text[index]) && index > -1) {
|
|
offset++;
|
|
index--;
|
|
}
|
|
|
|
return startFrom - offset;
|
|
},
|
|
|
|
/**
|
|
* Find new selection index representing end of current line according to current selection index
|
|
* @param {Number} startFrom Current selection index
|
|
* @return {Number} New selection index
|
|
*/
|
|
findLineBoundaryRight: function(startFrom) {
|
|
var offset = 0, index = startFrom;
|
|
|
|
while (!/\n/.test(this._text[index]) && index < this._text.length) {
|
|
offset++;
|
|
index++;
|
|
}
|
|
|
|
return startFrom + offset;
|
|
},
|
|
|
|
/**
|
|
* Finds index corresponding to beginning or end of a word
|
|
* @param {Number} selectionStart Index of a character
|
|
* @param {Number} direction 1 or -1
|
|
* @return {Number} Index of the beginning or end of a word
|
|
*/
|
|
searchWordBoundary: function(selectionStart, direction) {
|
|
var text = this._text,
|
|
index = this._reSpace.test(text[selectionStart]) ? selectionStart - 1 : selectionStart,
|
|
_char = text[index],
|
|
// wrong
|
|
reNonWord = fabric.reNonWord;
|
|
|
|
while (!reNonWord.test(_char) && index > 0 && index < text.length) {
|
|
index += direction;
|
|
_char = text[index];
|
|
}
|
|
if (reNonWord.test(_char)) {
|
|
index += direction === 1 ? 0 : 1;
|
|
}
|
|
return index;
|
|
},
|
|
|
|
/**
|
|
* Selects a word based on the index
|
|
* @param {Number} selectionStart Index of a character
|
|
*/
|
|
selectWord: function(selectionStart) {
|
|
selectionStart = selectionStart || this.selectionStart;
|
|
var newSelectionStart = this.searchWordBoundary(selectionStart, -1), /* search backwards */
|
|
newSelectionEnd = this.searchWordBoundary(selectionStart, 1); /* search forward */
|
|
|
|
this.selectionStart = newSelectionStart;
|
|
this.selectionEnd = newSelectionEnd;
|
|
this._fireSelectionChanged();
|
|
this._updateTextarea();
|
|
this.renderCursorOrSelection();
|
|
},
|
|
|
|
/**
|
|
* Selects a line based on the index
|
|
* @param {Number} selectionStart Index of a character
|
|
* @return {fabric.IText} thisArg
|
|
* @chainable
|
|
*/
|
|
selectLine: function(selectionStart) {
|
|
selectionStart = selectionStart || this.selectionStart;
|
|
var newSelectionStart = this.findLineBoundaryLeft(selectionStart),
|
|
newSelectionEnd = this.findLineBoundaryRight(selectionStart);
|
|
|
|
this.selectionStart = newSelectionStart;
|
|
this.selectionEnd = newSelectionEnd;
|
|
this._fireSelectionChanged();
|
|
this._updateTextarea();
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* Enters editing state
|
|
* @return {fabric.IText} thisArg
|
|
* @chainable
|
|
*/
|
|
enterEditing: function(e) {
|
|
if (this.isEditing || !this.editable) {
|
|
return;
|
|
}
|
|
|
|
if (this.canvas) {
|
|
this.canvas.calcOffset();
|
|
this.exitEditingOnOthers(this.canvas);
|
|
}
|
|
|
|
this.isEditing = true;
|
|
|
|
this.initHiddenTextarea(e);
|
|
this.hiddenTextarea.focus();
|
|
this.hiddenTextarea.value = this.text;
|
|
this._updateTextarea();
|
|
this._saveEditingProps();
|
|
this._setEditingProps();
|
|
this._textBeforeEdit = this.text;
|
|
|
|
this._tick();
|
|
this.fire('editing:entered');
|
|
this._fireSelectionChanged();
|
|
if (!this.canvas) {
|
|
return this;
|
|
}
|
|
this.canvas.fire('text:editing:entered', { target: this });
|
|
this.initMouseMoveHandler();
|
|
this.canvas.requestRenderAll();
|
|
return this;
|
|
},
|
|
|
|
exitEditingOnOthers: function(canvas) {
|
|
if (canvas._iTextInstances) {
|
|
canvas._iTextInstances.forEach(function(obj) {
|
|
obj.selected = false;
|
|
if (obj.isEditing) {
|
|
obj.exitEditing();
|
|
}
|
|
});
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Initializes "mousemove" event handler
|
|
*/
|
|
initMouseMoveHandler: function() {
|
|
this.canvas.on('mouse:move', this.mouseMoveHandler);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
mouseMoveHandler: function(options) {
|
|
if (!this.__isMousedown || !this.isEditing) {
|
|
return;
|
|
}
|
|
|
|
var newSelectionStart = this.getSelectionStartFromPointer(options.e),
|
|
currentStart = this.selectionStart,
|
|
currentEnd = this.selectionEnd;
|
|
if (
|
|
(newSelectionStart !== this.__selectionStartOnMouseDown || currentStart === currentEnd)
|
|
&&
|
|
(currentStart === newSelectionStart || currentEnd === newSelectionStart)
|
|
) {
|
|
return;
|
|
}
|
|
if (newSelectionStart > this.__selectionStartOnMouseDown) {
|
|
this.selectionStart = this.__selectionStartOnMouseDown;
|
|
this.selectionEnd = newSelectionStart;
|
|
}
|
|
else {
|
|
this.selectionStart = newSelectionStart;
|
|
this.selectionEnd = this.__selectionStartOnMouseDown;
|
|
}
|
|
if (this.selectionStart !== currentStart || this.selectionEnd !== currentEnd) {
|
|
this.restartCursorIfNeeded();
|
|
this._fireSelectionChanged();
|
|
this._updateTextarea();
|
|
this.renderCursorOrSelection();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_setEditingProps: function() {
|
|
this.hoverCursor = 'text';
|
|
|
|
if (this.canvas) {
|
|
this.canvas.defaultCursor = this.canvas.moveCursor = 'text';
|
|
}
|
|
|
|
this.borderColor = this.editingBorderColor;
|
|
this.hasControls = this.selectable = false;
|
|
this.lockMovementX = this.lockMovementY = true;
|
|
},
|
|
|
|
/**
|
|
* convert from textarea to grapheme indexes
|
|
*/
|
|
fromStringToGraphemeSelection: function(start, end, text) {
|
|
var smallerTextStart = text.slice(0, start),
|
|
graphemeStart = fabric.util.string.graphemeSplit(smallerTextStart).length;
|
|
if (start === end) {
|
|
return { selectionStart: graphemeStart, selectionEnd: graphemeStart };
|
|
}
|
|
var smallerTextEnd = text.slice(start, end),
|
|
graphemeEnd = fabric.util.string.graphemeSplit(smallerTextEnd).length;
|
|
return { selectionStart: graphemeStart, selectionEnd: graphemeStart + graphemeEnd };
|
|
},
|
|
|
|
/**
|
|
* convert from fabric to textarea values
|
|
*/
|
|
fromGraphemeToStringSelection: function(start, end, _text) {
|
|
var smallerTextStart = _text.slice(0, start),
|
|
graphemeStart = smallerTextStart.join('').length;
|
|
if (start === end) {
|
|
return { selectionStart: graphemeStart, selectionEnd: graphemeStart };
|
|
}
|
|
var smallerTextEnd = _text.slice(start, end),
|
|
graphemeEnd = smallerTextEnd.join('').length;
|
|
return { selectionStart: graphemeStart, selectionEnd: graphemeStart + graphemeEnd };
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_updateTextarea: function() {
|
|
this.cursorOffsetCache = { };
|
|
if (!this.hiddenTextarea) {
|
|
return;
|
|
}
|
|
if (!this.inCompositionMode) {
|
|
var newSelection = this.fromGraphemeToStringSelection(this.selectionStart, this.selectionEnd, this._text);
|
|
this.hiddenTextarea.selectionStart = newSelection.selectionStart;
|
|
this.hiddenTextarea.selectionEnd = newSelection.selectionEnd;
|
|
}
|
|
this.updateTextareaPosition();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
updateFromTextArea: function() {
|
|
if (!this.hiddenTextarea) {
|
|
return;
|
|
}
|
|
this.cursorOffsetCache = { };
|
|
this.text = this.hiddenTextarea.value;
|
|
if (this._shouldClearDimensionCache()) {
|
|
this.initDimensions();
|
|
this.setCoords();
|
|
}
|
|
var newSelection = this.fromStringToGraphemeSelection(
|
|
this.hiddenTextarea.selectionStart, this.hiddenTextarea.selectionEnd, this.hiddenTextarea.value);
|
|
this.selectionEnd = this.selectionStart = newSelection.selectionEnd;
|
|
if (!this.inCompositionMode) {
|
|
this.selectionStart = newSelection.selectionStart;
|
|
}
|
|
this.updateTextareaPosition();
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
updateTextareaPosition: function() {
|
|
if (this.selectionStart === this.selectionEnd) {
|
|
var style = this._calcTextareaPosition();
|
|
this.hiddenTextarea.style.left = style.left;
|
|
this.hiddenTextarea.style.top = style.top;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @return {Object} style contains style for hiddenTextarea
|
|
*/
|
|
_calcTextareaPosition: function() {
|
|
if (!this.canvas) {
|
|
return { x: 1, y: 1 };
|
|
}
|
|
var desiredPosition = this.inCompositionMode ? this.compositionStart : this.selectionStart,
|
|
boundaries = this._getCursorBoundaries(desiredPosition),
|
|
cursorLocation = this.get2DCursorLocation(desiredPosition),
|
|
lineIndex = cursorLocation.lineIndex,
|
|
charIndex = cursorLocation.charIndex,
|
|
charHeight = this.getValueOfPropertyAt(lineIndex, charIndex, 'fontSize') * this.lineHeight,
|
|
leftOffset = boundaries.leftOffset,
|
|
m = this.calcTransformMatrix(),
|
|
p = {
|
|
x: boundaries.left + leftOffset,
|
|
y: boundaries.top + boundaries.topOffset + charHeight
|
|
},
|
|
retinaScaling = this.canvas.getRetinaScaling(),
|
|
upperCanvas = this.canvas.upperCanvasEl,
|
|
upperCanvasWidth = upperCanvas.width / retinaScaling,
|
|
upperCanvasHeight = upperCanvas.height / retinaScaling,
|
|
maxWidth = upperCanvasWidth - charHeight,
|
|
maxHeight = upperCanvasHeight - charHeight,
|
|
scaleX = upperCanvas.clientWidth / upperCanvasWidth,
|
|
scaleY = upperCanvas.clientHeight / upperCanvasHeight;
|
|
|
|
p = fabric.util.transformPoint(p, m);
|
|
p = fabric.util.transformPoint(p, this.canvas.viewportTransform);
|
|
p.x *= scaleX;
|
|
p.y *= scaleY;
|
|
if (p.x < 0) {
|
|
p.x = 0;
|
|
}
|
|
if (p.x > maxWidth) {
|
|
p.x = maxWidth;
|
|
}
|
|
if (p.y < 0) {
|
|
p.y = 0;
|
|
}
|
|
if (p.y > maxHeight) {
|
|
p.y = maxHeight;
|
|
}
|
|
|
|
// add canvas offset on document
|
|
p.x += this.canvas._offset.left;
|
|
p.y += this.canvas._offset.top;
|
|
|
|
return { left: p.x + 'px', top: p.y + 'px', fontSize: charHeight + 'px', charHeight: charHeight };
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_saveEditingProps: function() {
|
|
this._savedProps = {
|
|
hasControls: this.hasControls,
|
|
borderColor: this.borderColor,
|
|
lockMovementX: this.lockMovementX,
|
|
lockMovementY: this.lockMovementY,
|
|
hoverCursor: this.hoverCursor,
|
|
selectable: this.selectable,
|
|
defaultCursor: this.canvas && this.canvas.defaultCursor,
|
|
moveCursor: this.canvas && this.canvas.moveCursor
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_restoreEditingProps: function() {
|
|
if (!this._savedProps) {
|
|
return;
|
|
}
|
|
|
|
this.hoverCursor = this._savedProps.hoverCursor;
|
|
this.hasControls = this._savedProps.hasControls;
|
|
this.borderColor = this._savedProps.borderColor;
|
|
this.selectable = this._savedProps.selectable;
|
|
this.lockMovementX = this._savedProps.lockMovementX;
|
|
this.lockMovementY = this._savedProps.lockMovementY;
|
|
|
|
if (this.canvas) {
|
|
this.canvas.defaultCursor = this._savedProps.defaultCursor;
|
|
this.canvas.moveCursor = this._savedProps.moveCursor;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Exits from editing state
|
|
* @return {fabric.IText} thisArg
|
|
* @chainable
|
|
*/
|
|
exitEditing: function() {
|
|
var isTextChanged = (this._textBeforeEdit !== this.text);
|
|
var hiddenTextarea = this.hiddenTextarea;
|
|
this.selected = false;
|
|
this.isEditing = false;
|
|
|
|
this.selectionEnd = this.selectionStart;
|
|
|
|
if (hiddenTextarea) {
|
|
hiddenTextarea.blur && hiddenTextarea.blur();
|
|
hiddenTextarea.parentNode && hiddenTextarea.parentNode.removeChild(hiddenTextarea);
|
|
}
|
|
this.hiddenTextarea = null;
|
|
this.abortCursorAnimation();
|
|
this._restoreEditingProps();
|
|
this._currentCursorOpacity = 0;
|
|
if (this._shouldClearDimensionCache()) {
|
|
this.initDimensions();
|
|
this.setCoords();
|
|
}
|
|
this.fire('editing:exited');
|
|
isTextChanged && this.fire('modified');
|
|
if (this.canvas) {
|
|
this.canvas.off('mouse:move', this.mouseMoveHandler);
|
|
this.canvas.fire('text:editing:exited', { target: this });
|
|
isTextChanged && this.canvas.fire('object:modified', { target: this });
|
|
}
|
|
return this;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_removeExtraneousStyles: function() {
|
|
for (var prop in this.styles) {
|
|
if (!this._textLines[prop]) {
|
|
delete this.styles[prop];
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* remove and reflow a style block from start to end.
|
|
* @param {Number} start linear start position for removal (included in removal)
|
|
* @param {Number} end linear end position for removal ( excluded from removal )
|
|
*/
|
|
removeStyleFromTo: function(start, end) {
|
|
var cursorStart = this.get2DCursorLocation(start, true),
|
|
cursorEnd = this.get2DCursorLocation(end, true),
|
|
lineStart = cursorStart.lineIndex,
|
|
charStart = cursorStart.charIndex,
|
|
lineEnd = cursorEnd.lineIndex,
|
|
charEnd = cursorEnd.charIndex,
|
|
i, styleObj;
|
|
if (lineStart !== lineEnd) {
|
|
// step1 remove the trailing of lineStart
|
|
if (this.styles[lineStart]) {
|
|
for (i = charStart; i < this._unwrappedTextLines[lineStart].length; i++) {
|
|
delete this.styles[lineStart][i];
|
|
}
|
|
}
|
|
// step2 move the trailing of lineEnd to lineStart if needed
|
|
if (this.styles[lineEnd]) {
|
|
for (i = charEnd; i < this._unwrappedTextLines[lineEnd].length; i++) {
|
|
styleObj = this.styles[lineEnd][i];
|
|
if (styleObj) {
|
|
this.styles[lineStart] || (this.styles[lineStart] = { });
|
|
this.styles[lineStart][charStart + i - charEnd] = styleObj;
|
|
}
|
|
}
|
|
}
|
|
// step3 detects lines will be completely removed.
|
|
for (i = lineStart + 1; i <= lineEnd; i++) {
|
|
delete this.styles[i];
|
|
}
|
|
// step4 shift remaining lines.
|
|
this.shiftLineStyles(lineEnd, lineStart - lineEnd);
|
|
}
|
|
else {
|
|
// remove and shift left on the same line
|
|
if (this.styles[lineStart]) {
|
|
styleObj = this.styles[lineStart];
|
|
var diff = charEnd - charStart, numericChar, _char;
|
|
for (i = charStart; i < charEnd; i++) {
|
|
delete styleObj[i];
|
|
}
|
|
for (_char in this.styles[lineStart]) {
|
|
numericChar = parseInt(_char, 10);
|
|
if (numericChar >= charEnd) {
|
|
styleObj[numericChar - diff] = styleObj[_char];
|
|
delete styleObj[_char];
|
|
}
|
|
}
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Shifts line styles up or down
|
|
* @param {Number} lineIndex Index of a line
|
|
* @param {Number} offset Can any number?
|
|
*/
|
|
shiftLineStyles: function(lineIndex, offset) {
|
|
// shift all line styles by offset upward or downward
|
|
// do not clone deep. we need new array, not new style objects
|
|
var clonedStyles = clone(this.styles);
|
|
for (var line in this.styles) {
|
|
var numericLine = parseInt(line, 10);
|
|
if (numericLine > lineIndex) {
|
|
this.styles[numericLine + offset] = clonedStyles[numericLine];
|
|
if (!clonedStyles[numericLine - offset]) {
|
|
delete this.styles[numericLine];
|
|
}
|
|
}
|
|
}
|
|
},
|
|
|
|
restartCursorIfNeeded: function() {
|
|
if (!this._currentTickState || this._currentTickState.isAborted
|
|
|| !this._currentTickCompleteState || this._currentTickCompleteState.isAborted
|
|
) {
|
|
this.initDelayedCursor();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Handle insertion of more consecutive style lines for when one or more
|
|
* newlines gets added to the text. Since current style needs to be shifted
|
|
* first we shift the current style of the number lines needed, then we add
|
|
* new lines from the last to the first.
|
|
* @param {Number} lineIndex Index of a line
|
|
* @param {Number} charIndex Index of a char
|
|
* @param {Number} qty number of lines to add
|
|
* @param {Array} copiedStyle Array of objects styles
|
|
*/
|
|
insertNewlineStyleObject: function(lineIndex, charIndex, qty, copiedStyle) {
|
|
var currentCharStyle,
|
|
newLineStyles = {},
|
|
somethingAdded = false,
|
|
isEndOfLine = this._unwrappedTextLines[lineIndex].length === charIndex;
|
|
|
|
qty || (qty = 1);
|
|
this.shiftLineStyles(lineIndex, qty);
|
|
if (this.styles[lineIndex]) {
|
|
currentCharStyle = this.styles[lineIndex][charIndex === 0 ? charIndex : charIndex - 1];
|
|
}
|
|
// we clone styles of all chars
|
|
// after cursor onto the current line
|
|
for (var index in this.styles[lineIndex]) {
|
|
var numIndex = parseInt(index, 10);
|
|
if (numIndex >= charIndex) {
|
|
somethingAdded = true;
|
|
newLineStyles[numIndex - charIndex] = this.styles[lineIndex][index];
|
|
// remove lines from the previous line since they're on a new line now
|
|
if (!(isEndOfLine && charIndex === 0)) {
|
|
delete this.styles[lineIndex][index];
|
|
}
|
|
}
|
|
}
|
|
var styleCarriedOver = false;
|
|
if (somethingAdded && !isEndOfLine) {
|
|
// if is end of line, the extra style we copied
|
|
// is probably not something we want
|
|
this.styles[lineIndex + qty] = newLineStyles;
|
|
styleCarriedOver = true;
|
|
}
|
|
if (styleCarriedOver) {
|
|
// skip the last line of since we already prepared it.
|
|
qty--;
|
|
}
|
|
// for the all the lines or all the other lines
|
|
// we clone current char style onto the next (otherwise empty) line
|
|
while (qty > 0) {
|
|
if (copiedStyle && copiedStyle[qty - 1]) {
|
|
this.styles[lineIndex + qty] = { 0: clone(copiedStyle[qty - 1]) };
|
|
}
|
|
else if (currentCharStyle) {
|
|
this.styles[lineIndex + qty] = { 0: clone(currentCharStyle) };
|
|
}
|
|
else {
|
|
delete this.styles[lineIndex + qty];
|
|
}
|
|
qty--;
|
|
}
|
|
this._forceClearCache = true;
|
|
},
|
|
|
|
/**
|
|
* Inserts style object for a given line/char index
|
|
* @param {Number} lineIndex Index of a line
|
|
* @param {Number} charIndex Index of a char
|
|
* @param {Number} quantity number Style object to insert, if given
|
|
* @param {Array} copiedStyle array of style objects
|
|
*/
|
|
insertCharStyleObject: function(lineIndex, charIndex, quantity, copiedStyle) {
|
|
if (!this.styles) {
|
|
this.styles = {};
|
|
}
|
|
var currentLineStyles = this.styles[lineIndex],
|
|
currentLineStylesCloned = currentLineStyles ? clone(currentLineStyles) : {};
|
|
|
|
quantity || (quantity = 1);
|
|
// shift all char styles by quantity forward
|
|
// 0,1,2,3 -> (charIndex=2) -> 0,1,3,4 -> (insert 2) -> 0,1,2,3,4
|
|
for (var index in currentLineStylesCloned) {
|
|
var numericIndex = parseInt(index, 10);
|
|
if (numericIndex >= charIndex) {
|
|
currentLineStyles[numericIndex + quantity] = currentLineStylesCloned[numericIndex];
|
|
// only delete the style if there was nothing moved there
|
|
if (!currentLineStylesCloned[numericIndex - quantity]) {
|
|
delete currentLineStyles[numericIndex];
|
|
}
|
|
}
|
|
}
|
|
this._forceClearCache = true;
|
|
if (copiedStyle) {
|
|
while (quantity--) {
|
|
if (!Object.keys(copiedStyle[quantity]).length) {
|
|
continue;
|
|
}
|
|
if (!this.styles[lineIndex]) {
|
|
this.styles[lineIndex] = {};
|
|
}
|
|
this.styles[lineIndex][charIndex + quantity] = clone(copiedStyle[quantity]);
|
|
}
|
|
return;
|
|
}
|
|
if (!currentLineStyles) {
|
|
return;
|
|
}
|
|
var newStyle = currentLineStyles[charIndex ? charIndex - 1 : 1];
|
|
while (newStyle && quantity--) {
|
|
this.styles[lineIndex][charIndex + quantity] = clone(newStyle);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Inserts style object(s)
|
|
* @param {Array} insertedText Characters at the location where style is inserted
|
|
* @param {Number} start cursor index for inserting style
|
|
* @param {Array} [copiedStyle] array of style objects to insert.
|
|
*/
|
|
insertNewStyleBlock: function(insertedText, start, copiedStyle) {
|
|
var cursorLoc = this.get2DCursorLocation(start, true),
|
|
addedLines = [0], linesLength = 0;
|
|
// get an array of how many char per lines are being added.
|
|
for (var i = 0; i < insertedText.length; i++) {
|
|
if (insertedText[i] === '\n') {
|
|
linesLength++;
|
|
addedLines[linesLength] = 0;
|
|
}
|
|
else {
|
|
addedLines[linesLength]++;
|
|
}
|
|
}
|
|
// for the first line copy the style from the current char position.
|
|
if (addedLines[0] > 0) {
|
|
this.insertCharStyleObject(cursorLoc.lineIndex, cursorLoc.charIndex, addedLines[0], copiedStyle);
|
|
copiedStyle = copiedStyle && copiedStyle.slice(addedLines[0] + 1);
|
|
}
|
|
linesLength && this.insertNewlineStyleObject(
|
|
cursorLoc.lineIndex, cursorLoc.charIndex + addedLines[0], linesLength);
|
|
for (var i = 1; i < linesLength; i++) {
|
|
if (addedLines[i] > 0) {
|
|
this.insertCharStyleObject(cursorLoc.lineIndex + i, 0, addedLines[i], copiedStyle);
|
|
}
|
|
else if (copiedStyle) {
|
|
this.styles[cursorLoc.lineIndex + i][0] = copiedStyle[0];
|
|
}
|
|
copiedStyle = copiedStyle && copiedStyle.slice(addedLines[i] + 1);
|
|
}
|
|
// we use i outside the loop to get it like linesLength
|
|
if (addedLines[i] > 0) {
|
|
this.insertCharStyleObject(cursorLoc.lineIndex + i, 0, addedLines[i], copiedStyle);
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Set the selectionStart and selectionEnd according to the new position of cursor
|
|
* mimic the key - mouse navigation when shift is pressed.
|
|
*/
|
|
setSelectionStartEndWithShift: function(start, end, newSelection) {
|
|
if (newSelection <= start) {
|
|
if (end === start) {
|
|
this._selectionDirection = 'left';
|
|
}
|
|
else if (this._selectionDirection === 'right') {
|
|
this._selectionDirection = 'left';
|
|
this.selectionEnd = start;
|
|
}
|
|
this.selectionStart = newSelection;
|
|
}
|
|
else if (newSelection > start && newSelection < end) {
|
|
if (this._selectionDirection === 'right') {
|
|
this.selectionEnd = newSelection;
|
|
}
|
|
else {
|
|
this.selectionStart = newSelection;
|
|
}
|
|
}
|
|
else {
|
|
// newSelection is > selection start and end
|
|
if (end === start) {
|
|
this._selectionDirection = 'right';
|
|
}
|
|
else if (this._selectionDirection === 'left') {
|
|
this._selectionDirection = 'right';
|
|
this.selectionStart = end;
|
|
}
|
|
this.selectionEnd = newSelection;
|
|
}
|
|
},
|
|
|
|
setSelectionInBoundaries: function() {
|
|
var length = this.text.length;
|
|
if (this.selectionStart > length) {
|
|
this.selectionStart = length;
|
|
}
|
|
else if (this.selectionStart < 0) {
|
|
this.selectionStart = 0;
|
|
}
|
|
if (this.selectionEnd > length) {
|
|
this.selectionEnd = length;
|
|
}
|
|
else if (this.selectionEnd < 0) {
|
|
this.selectionEnd = 0;
|
|
}
|
|
}
|
|
});
|
|
})();
|
|
|
|
|
|
fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ {
|
|
/**
|
|
* Initializes "dbclick" event handler
|
|
*/
|
|
initDoubleClickSimulation: function() {
|
|
|
|
// for double click
|
|
this.__lastClickTime = +new Date();
|
|
|
|
// for triple click
|
|
this.__lastLastClickTime = +new Date();
|
|
|
|
this.__lastPointer = { };
|
|
|
|
this.on('mousedown', this.onMouseDown);
|
|
},
|
|
|
|
/**
|
|
* Default event handler to simulate triple click
|
|
* @private
|
|
*/
|
|
onMouseDown: function(options) {
|
|
if (!this.canvas) {
|
|
return;
|
|
}
|
|
this.__newClickTime = +new Date();
|
|
var newPointer = options.pointer;
|
|
if (this.isTripleClick(newPointer)) {
|
|
this.fire('tripleclick', options);
|
|
this._stopEvent(options.e);
|
|
}
|
|
this.__lastLastClickTime = this.__lastClickTime;
|
|
this.__lastClickTime = this.__newClickTime;
|
|
this.__lastPointer = newPointer;
|
|
this.__lastIsEditing = this.isEditing;
|
|
this.__lastSelected = this.selected;
|
|
},
|
|
|
|
isTripleClick: function(newPointer) {
|
|
return this.__newClickTime - this.__lastClickTime < 500 &&
|
|
this.__lastClickTime - this.__lastLastClickTime < 500 &&
|
|
this.__lastPointer.x === newPointer.x &&
|
|
this.__lastPointer.y === newPointer.y;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_stopEvent: function(e) {
|
|
e.preventDefault && e.preventDefault();
|
|
e.stopPropagation && e.stopPropagation();
|
|
},
|
|
|
|
/**
|
|
* Initializes event handlers related to cursor or selection
|
|
*/
|
|
initCursorSelectionHandlers: function() {
|
|
this.initMousedownHandler();
|
|
this.initMouseupHandler();
|
|
this.initClicks();
|
|
},
|
|
|
|
/**
|
|
* Default handler for double click, select a word
|
|
*/
|
|
doubleClickHandler: function(options) {
|
|
if (!this.isEditing) {
|
|
return;
|
|
}
|
|
this.selectWord(this.getSelectionStartFromPointer(options.e));
|
|
},
|
|
|
|
/**
|
|
* Default handler for triple click, select a line
|
|
*/
|
|
tripleClickHandler: function(options) {
|
|
if (!this.isEditing) {
|
|
return;
|
|
}
|
|
this.selectLine(this.getSelectionStartFromPointer(options.e));
|
|
},
|
|
|
|
/**
|
|
* Initializes double and triple click event handlers
|
|
*/
|
|
initClicks: function() {
|
|
this.on('mousedblclick', this.doubleClickHandler);
|
|
this.on('tripleclick', this.tripleClickHandler);
|
|
},
|
|
|
|
/**
|
|
* Default event handler for the basic functionalities needed on _mouseDown
|
|
* can be overridden to do something different.
|
|
* Scope of this implementation is: find the click position, set selectionStart
|
|
* find selectionEnd, initialize the drawing of either cursor or selection area
|
|
* initializing a mousedDown on a text area will cancel fabricjs knowledge of
|
|
* current compositionMode. It will be set to false.
|
|
*/
|
|
_mouseDownHandler: function(options) {
|
|
if (!this.canvas || !this.editable || (options.e.button && options.e.button !== 1)) {
|
|
return;
|
|
}
|
|
|
|
this.__isMousedown = true;
|
|
|
|
if (this.selected) {
|
|
this.inCompositionMode = false;
|
|
this.setCursorByClick(options.e);
|
|
}
|
|
|
|
if (this.isEditing) {
|
|
this.__selectionStartOnMouseDown = this.selectionStart;
|
|
if (this.selectionStart === this.selectionEnd) {
|
|
this.abortCursorAnimation();
|
|
}
|
|
this.renderCursorOrSelection();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Default event handler for the basic functionalities needed on mousedown:before
|
|
* can be overridden to do something different.
|
|
* Scope of this implementation is: verify the object is already selected when mousing down
|
|
*/
|
|
_mouseDownHandlerBefore: function(options) {
|
|
if (!this.canvas || !this.editable || (options.e.button && options.e.button !== 1)) {
|
|
return;
|
|
}
|
|
// we want to avoid that an object that was selected and then becomes unselectable,
|
|
// may trigger editing mode in some way.
|
|
this.selected = this === this.canvas._activeObject;
|
|
},
|
|
|
|
/**
|
|
* Initializes "mousedown" event handler
|
|
*/
|
|
initMousedownHandler: function() {
|
|
this.on('mousedown', this._mouseDownHandler);
|
|
this.on('mousedown:before', this._mouseDownHandlerBefore);
|
|
},
|
|
|
|
/**
|
|
* Initializes "mouseup" event handler
|
|
*/
|
|
initMouseupHandler: function() {
|
|
this.on('mouseup', this.mouseUpHandler);
|
|
},
|
|
|
|
/**
|
|
* standard handler for mouse up, overridable
|
|
* @private
|
|
*/
|
|
mouseUpHandler: function(options) {
|
|
this.__isMousedown = false;
|
|
if (!this.editable || this.group ||
|
|
(options.transform && options.transform.actionPerformed) ||
|
|
(options.e.button && options.e.button !== 1)) {
|
|
return;
|
|
}
|
|
|
|
if (this.canvas) {
|
|
var currentActive = this.canvas._activeObject;
|
|
if (currentActive && currentActive !== this) {
|
|
// avoid running this logic when there is an active object
|
|
// this because is possible with shift click and fast clicks,
|
|
// to rapidly deselect and reselect this object and trigger an enterEdit
|
|
return;
|
|
}
|
|
}
|
|
|
|
if (this.__lastSelected && !this.__corner) {
|
|
this.selected = false;
|
|
this.__lastSelected = false;
|
|
this.enterEditing(options.e);
|
|
if (this.selectionStart === this.selectionEnd) {
|
|
this.initDelayedCursor(true);
|
|
}
|
|
else {
|
|
this.renderCursorOrSelection();
|
|
}
|
|
}
|
|
else {
|
|
this.selected = true;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Changes cursor location in a text depending on passed pointer (x/y) object
|
|
* @param {Event} e Event object
|
|
*/
|
|
setCursorByClick: function(e) {
|
|
var newSelection = this.getSelectionStartFromPointer(e),
|
|
start = this.selectionStart, end = this.selectionEnd;
|
|
if (e.shiftKey) {
|
|
this.setSelectionStartEndWithShift(start, end, newSelection);
|
|
}
|
|
else {
|
|
this.selectionStart = newSelection;
|
|
this.selectionEnd = newSelection;
|
|
}
|
|
if (this.isEditing) {
|
|
this._fireSelectionChanged();
|
|
this._updateTextarea();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns index of a character corresponding to where an object was clicked
|
|
* @param {Event} e Event object
|
|
* @return {Number} Index of a character
|
|
*/
|
|
getSelectionStartFromPointer: function(e) {
|
|
var mouseOffset = this.getLocalPointer(e),
|
|
prevWidth = 0,
|
|
width = 0,
|
|
height = 0,
|
|
charIndex = 0,
|
|
lineIndex = 0,
|
|
lineLeftOffset,
|
|
line;
|
|
for (var i = 0, len = this._textLines.length; i < len; i++) {
|
|
if (height <= mouseOffset.y) {
|
|
height += this.getHeightOfLine(i) * this.scaleY;
|
|
lineIndex = i;
|
|
if (i > 0) {
|
|
charIndex += this._textLines[i - 1].length + this.missingNewlineOffset(i - 1);
|
|
}
|
|
}
|
|
else {
|
|
break;
|
|
}
|
|
}
|
|
lineLeftOffset = this._getLineLeftOffset(lineIndex);
|
|
width = lineLeftOffset * this.scaleX;
|
|
line = this._textLines[lineIndex];
|
|
// handling of RTL: in order to get things work correctly,
|
|
// we assume RTL writing is mirrored compared to LTR writing.
|
|
// so in position detection we mirror the X offset, and when is time
|
|
// of rendering it, we mirror it again.
|
|
if (this.direction === 'rtl') {
|
|
mouseOffset.x = this.width * this.scaleX - mouseOffset.x + width;
|
|
}
|
|
for (var j = 0, jlen = line.length; j < jlen; j++) {
|
|
prevWidth = width;
|
|
// i removed something about flipX here, check.
|
|
width += this.__charBounds[lineIndex][j].kernedWidth * this.scaleX;
|
|
if (width <= mouseOffset.x) {
|
|
charIndex++;
|
|
}
|
|
else {
|
|
break;
|
|
}
|
|
}
|
|
return this._getNewSelectionStartFromOffset(mouseOffset, prevWidth, width, charIndex, jlen);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getNewSelectionStartFromOffset: function(mouseOffset, prevWidth, width, index, jlen) {
|
|
// we need Math.abs because when width is after the last char, the offset is given as 1, while is 0
|
|
var distanceBtwLastCharAndCursor = mouseOffset.x - prevWidth,
|
|
distanceBtwNextCharAndCursor = width - mouseOffset.x,
|
|
offset = distanceBtwNextCharAndCursor > distanceBtwLastCharAndCursor ||
|
|
distanceBtwNextCharAndCursor < 0 ? 0 : 1,
|
|
newSelectionStart = index + offset;
|
|
// if object is horizontally flipped, mirror cursor location from the end
|
|
if (this.flipX) {
|
|
newSelectionStart = jlen - newSelectionStart;
|
|
}
|
|
|
|
if (newSelectionStart > this._text.length) {
|
|
newSelectionStart = this._text.length;
|
|
}
|
|
|
|
return newSelectionStart;
|
|
}
|
|
});
|
|
|
|
|
|
fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ {
|
|
|
|
/**
|
|
* Initializes hidden textarea (needed to bring up keyboard in iOS)
|
|
*/
|
|
initHiddenTextarea: function() {
|
|
this.hiddenTextarea = fabric.document.createElement('textarea');
|
|
this.hiddenTextarea.setAttribute('autocapitalize', 'off');
|
|
this.hiddenTextarea.setAttribute('autocorrect', 'off');
|
|
this.hiddenTextarea.setAttribute('autocomplete', 'off');
|
|
this.hiddenTextarea.setAttribute('spellcheck', 'false');
|
|
this.hiddenTextarea.setAttribute('data-fabric-hiddentextarea', '');
|
|
this.hiddenTextarea.setAttribute('wrap', 'off');
|
|
var style = this._calcTextareaPosition();
|
|
// line-height: 1px; was removed from the style to fix this:
|
|
// https://bugs.chromium.org/p/chromium/issues/detail?id=870966
|
|
this.hiddenTextarea.style.cssText = 'position: absolute; top: ' + style.top +
|
|
'; left: ' + style.left + '; z-index: -999; opacity: 0; width: 1px; height: 1px; font-size: 1px;' +
|
|
' paddingï½°top: ' + style.fontSize + ';';
|
|
|
|
if (this.hiddenTextareaContainer) {
|
|
this.hiddenTextareaContainer.appendChild(this.hiddenTextarea);
|
|
}
|
|
else {
|
|
fabric.document.body.appendChild(this.hiddenTextarea);
|
|
}
|
|
|
|
fabric.util.addListener(this.hiddenTextarea, 'keydown', this.onKeyDown.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'keyup', this.onKeyUp.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'input', this.onInput.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'copy', this.copy.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'cut', this.copy.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'paste', this.paste.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'compositionstart', this.onCompositionStart.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'compositionupdate', this.onCompositionUpdate.bind(this));
|
|
fabric.util.addListener(this.hiddenTextarea, 'compositionend', this.onCompositionEnd.bind(this));
|
|
|
|
if (!this._clickHandlerInitialized && this.canvas) {
|
|
fabric.util.addListener(this.canvas.upperCanvasEl, 'click', this.onClick.bind(this));
|
|
this._clickHandlerInitialized = true;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* For functionalities on keyDown
|
|
* Map a special key to a function of the instance/prototype
|
|
* If you need different behaviour for ESC or TAB or arrows, you have to change
|
|
* this map setting the name of a function that you build on the fabric.Itext or
|
|
* your prototype.
|
|
* the map change will affect all Instances unless you need for only some text Instances
|
|
* in that case you have to clone this object and assign your Instance.
|
|
* this.keysMap = fabric.util.object.clone(this.keysMap);
|
|
* The function must be in fabric.Itext.prototype.myFunction And will receive event as args[0]
|
|
*/
|
|
keysMap: {
|
|
9: 'exitEditing',
|
|
27: 'exitEditing',
|
|
33: 'moveCursorUp',
|
|
34: 'moveCursorDown',
|
|
35: 'moveCursorRight',
|
|
36: 'moveCursorLeft',
|
|
37: 'moveCursorLeft',
|
|
38: 'moveCursorUp',
|
|
39: 'moveCursorRight',
|
|
40: 'moveCursorDown',
|
|
},
|
|
|
|
keysMapRtl: {
|
|
9: 'exitEditing',
|
|
27: 'exitEditing',
|
|
33: 'moveCursorUp',
|
|
34: 'moveCursorDown',
|
|
35: 'moveCursorLeft',
|
|
36: 'moveCursorRight',
|
|
37: 'moveCursorRight',
|
|
38: 'moveCursorUp',
|
|
39: 'moveCursorLeft',
|
|
40: 'moveCursorDown',
|
|
},
|
|
|
|
/**
|
|
* For functionalities on keyUp + ctrl || cmd
|
|
*/
|
|
ctrlKeysMapUp: {
|
|
67: 'copy',
|
|
88: 'cut'
|
|
},
|
|
|
|
/**
|
|
* For functionalities on keyDown + ctrl || cmd
|
|
*/
|
|
ctrlKeysMapDown: {
|
|
65: 'selectAll'
|
|
},
|
|
|
|
onClick: function() {
|
|
// No need to trigger click event here, focus is enough to have the keyboard appear on Android
|
|
this.hiddenTextarea && this.hiddenTextarea.focus();
|
|
},
|
|
|
|
/**
|
|
* Handles keydown event
|
|
* only used for arrows and combination of modifier keys.
|
|
* @param {Event} e Event object
|
|
*/
|
|
onKeyDown: function(e) {
|
|
if (!this.isEditing) {
|
|
return;
|
|
}
|
|
var keyMap = this.direction === 'rtl' ? this.keysMapRtl : this.keysMap;
|
|
if (e.keyCode in keyMap) {
|
|
this[keyMap[e.keyCode]](e);
|
|
}
|
|
else if ((e.keyCode in this.ctrlKeysMapDown) && (e.ctrlKey || e.metaKey)) {
|
|
this[this.ctrlKeysMapDown[e.keyCode]](e);
|
|
}
|
|
else {
|
|
return;
|
|
}
|
|
e.stopImmediatePropagation();
|
|
e.preventDefault();
|
|
if (e.keyCode >= 33 && e.keyCode <= 40) {
|
|
// if i press an arrow key just update selection
|
|
this.inCompositionMode = false;
|
|
this.clearContextTop();
|
|
this.renderCursorOrSelection();
|
|
}
|
|
else {
|
|
this.canvas && this.canvas.requestRenderAll();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Handles keyup event
|
|
* We handle KeyUp because ie11 and edge have difficulties copy/pasting
|
|
* if a copy/cut event fired, keyup is dismissed
|
|
* @param {Event} e Event object
|
|
*/
|
|
onKeyUp: function(e) {
|
|
if (!this.isEditing || this._copyDone || this.inCompositionMode) {
|
|
this._copyDone = false;
|
|
return;
|
|
}
|
|
if ((e.keyCode in this.ctrlKeysMapUp) && (e.ctrlKey || e.metaKey)) {
|
|
this[this.ctrlKeysMapUp[e.keyCode]](e);
|
|
}
|
|
else {
|
|
return;
|
|
}
|
|
e.stopImmediatePropagation();
|
|
e.preventDefault();
|
|
this.canvas && this.canvas.requestRenderAll();
|
|
},
|
|
|
|
/**
|
|
* Handles onInput event
|
|
* @param {Event} e Event object
|
|
*/
|
|
onInput: function(e) {
|
|
var fromPaste = this.fromPaste;
|
|
this.fromPaste = false;
|
|
e && e.stopPropagation();
|
|
if (!this.isEditing) {
|
|
return;
|
|
}
|
|
// decisions about style changes.
|
|
var nextText = this._splitTextIntoLines(this.hiddenTextarea.value).graphemeText,
|
|
charCount = this._text.length,
|
|
nextCharCount = nextText.length,
|
|
removedText, insertedText,
|
|
charDiff = nextCharCount - charCount,
|
|
selectionStart = this.selectionStart, selectionEnd = this.selectionEnd,
|
|
selection = selectionStart !== selectionEnd,
|
|
copiedStyle, removeFrom, removeTo;
|
|
if (this.hiddenTextarea.value === '') {
|
|
this.styles = { };
|
|
this.updateFromTextArea();
|
|
this.fire('changed');
|
|
if (this.canvas) {
|
|
this.canvas.fire('text:changed', { target: this });
|
|
this.canvas.requestRenderAll();
|
|
}
|
|
return;
|
|
}
|
|
|
|
var textareaSelection = this.fromStringToGraphemeSelection(
|
|
this.hiddenTextarea.selectionStart,
|
|
this.hiddenTextarea.selectionEnd,
|
|
this.hiddenTextarea.value
|
|
);
|
|
var backDelete = selectionStart > textareaSelection.selectionStart;
|
|
|
|
if (selection) {
|
|
removedText = this._text.slice(selectionStart, selectionEnd);
|
|
charDiff += selectionEnd - selectionStart;
|
|
}
|
|
else if (nextCharCount < charCount) {
|
|
if (backDelete) {
|
|
removedText = this._text.slice(selectionEnd + charDiff, selectionEnd);
|
|
}
|
|
else {
|
|
removedText = this._text.slice(selectionStart, selectionStart - charDiff);
|
|
}
|
|
}
|
|
insertedText = nextText.slice(textareaSelection.selectionEnd - charDiff, textareaSelection.selectionEnd);
|
|
if (removedText && removedText.length) {
|
|
if (insertedText.length) {
|
|
// let's copy some style before deleting.
|
|
// we want to copy the style before the cursor OR the style at the cursor if selection
|
|
// is bigger than 0.
|
|
copiedStyle = this.getSelectionStyles(selectionStart, selectionStart + 1, false);
|
|
// now duplicate the style one for each inserted text.
|
|
copiedStyle = insertedText.map(function() {
|
|
// this return an array of references, but that is fine since we are
|
|
// copying the style later.
|
|
return copiedStyle[0];
|
|
});
|
|
}
|
|
if (selection) {
|
|
removeFrom = selectionStart;
|
|
removeTo = selectionEnd;
|
|
}
|
|
else if (backDelete) {
|
|
// detect differences between forwardDelete and backDelete
|
|
removeFrom = selectionEnd - removedText.length;
|
|
removeTo = selectionEnd;
|
|
}
|
|
else {
|
|
removeFrom = selectionEnd;
|
|
removeTo = selectionEnd + removedText.length;
|
|
}
|
|
this.removeStyleFromTo(removeFrom, removeTo);
|
|
}
|
|
if (insertedText.length) {
|
|
if (fromPaste && insertedText.join('') === fabric.copiedText && !fabric.disableStyleCopyPaste) {
|
|
copiedStyle = fabric.copiedTextStyle;
|
|
}
|
|
this.insertNewStyleBlock(insertedText, selectionStart, copiedStyle);
|
|
}
|
|
this.updateFromTextArea();
|
|
this.fire('changed');
|
|
if (this.canvas) {
|
|
this.canvas.fire('text:changed', { target: this });
|
|
this.canvas.requestRenderAll();
|
|
}
|
|
},
|
|
/**
|
|
* Composition start
|
|
*/
|
|
onCompositionStart: function() {
|
|
this.inCompositionMode = true;
|
|
},
|
|
|
|
/**
|
|
* Composition end
|
|
*/
|
|
onCompositionEnd: function() {
|
|
this.inCompositionMode = false;
|
|
},
|
|
|
|
// /**
|
|
// * Composition update
|
|
// */
|
|
onCompositionUpdate: function(e) {
|
|
this.compositionStart = e.target.selectionStart;
|
|
this.compositionEnd = e.target.selectionEnd;
|
|
this.updateTextareaPosition();
|
|
},
|
|
|
|
/**
|
|
* Copies selected text
|
|
* @param {Event} e Event object
|
|
*/
|
|
copy: function() {
|
|
if (this.selectionStart === this.selectionEnd) {
|
|
//do not cut-copy if no selection
|
|
return;
|
|
}
|
|
|
|
fabric.copiedText = this.getSelectedText();
|
|
if (!fabric.disableStyleCopyPaste) {
|
|
fabric.copiedTextStyle = this.getSelectionStyles(this.selectionStart, this.selectionEnd, true);
|
|
}
|
|
else {
|
|
fabric.copiedTextStyle = null;
|
|
}
|
|
this._copyDone = true;
|
|
},
|
|
|
|
/**
|
|
* Pastes text
|
|
* @param {Event} e Event object
|
|
*/
|
|
paste: function() {
|
|
this.fromPaste = true;
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Event} e Event object
|
|
* @return {Object} Clipboard data object
|
|
*/
|
|
_getClipboardData: function(e) {
|
|
return (e && e.clipboardData) || fabric.window.clipboardData;
|
|
},
|
|
|
|
/**
|
|
* Finds the width in pixels before the cursor on the same line
|
|
* @private
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @return {Number} widthBeforeCursor width before cursor
|
|
*/
|
|
_getWidthBeforeCursor: function(lineIndex, charIndex) {
|
|
var widthBeforeCursor = this._getLineLeftOffset(lineIndex), bound;
|
|
|
|
if (charIndex > 0) {
|
|
bound = this.__charBounds[lineIndex][charIndex - 1];
|
|
widthBeforeCursor += bound.left + bound.width;
|
|
}
|
|
return widthBeforeCursor;
|
|
},
|
|
|
|
/**
|
|
* Gets start offset of a selection
|
|
* @param {Event} e Event object
|
|
* @param {Boolean} isRight
|
|
* @return {Number}
|
|
*/
|
|
getDownCursorOffset: function(e, isRight) {
|
|
var selectionProp = this._getSelectionForOffset(e, isRight),
|
|
cursorLocation = this.get2DCursorLocation(selectionProp),
|
|
lineIndex = cursorLocation.lineIndex;
|
|
// if on last line, down cursor goes to end of line
|
|
if (lineIndex === this._textLines.length - 1 || e.metaKey || e.keyCode === 34) {
|
|
// move to the end of a text
|
|
return this._text.length - selectionProp;
|
|
}
|
|
var charIndex = cursorLocation.charIndex,
|
|
widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex),
|
|
indexOnOtherLine = this._getIndexOnLine(lineIndex + 1, widthBeforeCursor),
|
|
textAfterCursor = this._textLines[lineIndex].slice(charIndex);
|
|
return textAfterCursor.length + indexOnOtherLine + 1 + this.missingNewlineOffset(lineIndex);
|
|
},
|
|
|
|
/**
|
|
* private
|
|
* Helps finding if the offset should be counted from Start or End
|
|
* @param {Event} e Event object
|
|
* @param {Boolean} isRight
|
|
* @return {Number}
|
|
*/
|
|
_getSelectionForOffset: function(e, isRight) {
|
|
if (e.shiftKey && this.selectionStart !== this.selectionEnd && isRight) {
|
|
return this.selectionEnd;
|
|
}
|
|
else {
|
|
return this.selectionStart;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @param {Event} e Event object
|
|
* @param {Boolean} isRight
|
|
* @return {Number}
|
|
*/
|
|
getUpCursorOffset: function(e, isRight) {
|
|
var selectionProp = this._getSelectionForOffset(e, isRight),
|
|
cursorLocation = this.get2DCursorLocation(selectionProp),
|
|
lineIndex = cursorLocation.lineIndex;
|
|
if (lineIndex === 0 || e.metaKey || e.keyCode === 33) {
|
|
// if on first line, up cursor goes to start of line
|
|
return -selectionProp;
|
|
}
|
|
var charIndex = cursorLocation.charIndex,
|
|
widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex),
|
|
indexOnOtherLine = this._getIndexOnLine(lineIndex - 1, widthBeforeCursor),
|
|
textBeforeCursor = this._textLines[lineIndex].slice(0, charIndex),
|
|
missingNewlineOffset = this.missingNewlineOffset(lineIndex - 1);
|
|
// return a negative offset
|
|
return -this._textLines[lineIndex - 1].length
|
|
+ indexOnOtherLine - textBeforeCursor.length + (1 - missingNewlineOffset);
|
|
},
|
|
|
|
/**
|
|
* for a given width it founds the matching character.
|
|
* @private
|
|
*/
|
|
_getIndexOnLine: function(lineIndex, width) {
|
|
|
|
var line = this._textLines[lineIndex],
|
|
lineLeftOffset = this._getLineLeftOffset(lineIndex),
|
|
widthOfCharsOnLine = lineLeftOffset,
|
|
indexOnLine = 0, charWidth, foundMatch;
|
|
|
|
for (var j = 0, jlen = line.length; j < jlen; j++) {
|
|
charWidth = this.__charBounds[lineIndex][j].width;
|
|
widthOfCharsOnLine += charWidth;
|
|
if (widthOfCharsOnLine > width) {
|
|
foundMatch = true;
|
|
var leftEdge = widthOfCharsOnLine - charWidth,
|
|
rightEdge = widthOfCharsOnLine,
|
|
offsetFromLeftEdge = Math.abs(leftEdge - width),
|
|
offsetFromRightEdge = Math.abs(rightEdge - width);
|
|
|
|
indexOnLine = offsetFromRightEdge < offsetFromLeftEdge ? j : (j - 1);
|
|
break;
|
|
}
|
|
}
|
|
|
|
// reached end
|
|
if (!foundMatch) {
|
|
indexOnLine = line.length - 1;
|
|
}
|
|
|
|
return indexOnLine;
|
|
},
|
|
|
|
|
|
/**
|
|
* Moves cursor down
|
|
* @param {Event} e Event object
|
|
*/
|
|
moveCursorDown: function(e) {
|
|
if (this.selectionStart >= this._text.length && this.selectionEnd >= this._text.length) {
|
|
return;
|
|
}
|
|
this._moveCursorUpOrDown('Down', e);
|
|
},
|
|
|
|
/**
|
|
* Moves cursor up
|
|
* @param {Event} e Event object
|
|
*/
|
|
moveCursorUp: function(e) {
|
|
if (this.selectionStart === 0 && this.selectionEnd === 0) {
|
|
return;
|
|
}
|
|
this._moveCursorUpOrDown('Up', e);
|
|
},
|
|
|
|
/**
|
|
* Moves cursor up or down, fires the events
|
|
* @param {String} direction 'Up' or 'Down'
|
|
* @param {Event} e Event object
|
|
*/
|
|
_moveCursorUpOrDown: function(direction, e) {
|
|
// getUpCursorOffset
|
|
// getDownCursorOffset
|
|
var action = 'get' + direction + 'CursorOffset',
|
|
offset = this[action](e, this._selectionDirection === 'right');
|
|
if (e.shiftKey) {
|
|
this.moveCursorWithShift(offset);
|
|
}
|
|
else {
|
|
this.moveCursorWithoutShift(offset);
|
|
}
|
|
if (offset !== 0) {
|
|
this.setSelectionInBoundaries();
|
|
this.abortCursorAnimation();
|
|
this._currentCursorOpacity = 1;
|
|
this.initDelayedCursor();
|
|
this._fireSelectionChanged();
|
|
this._updateTextarea();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Moves cursor with shift
|
|
* @param {Number} offset
|
|
*/
|
|
moveCursorWithShift: function(offset) {
|
|
var newSelection = this._selectionDirection === 'left'
|
|
? this.selectionStart + offset
|
|
: this.selectionEnd + offset;
|
|
this.setSelectionStartEndWithShift(this.selectionStart, this.selectionEnd, newSelection);
|
|
return offset !== 0;
|
|
},
|
|
|
|
/**
|
|
* Moves cursor up without shift
|
|
* @param {Number} offset
|
|
*/
|
|
moveCursorWithoutShift: function(offset) {
|
|
if (offset < 0) {
|
|
this.selectionStart += offset;
|
|
this.selectionEnd = this.selectionStart;
|
|
}
|
|
else {
|
|
this.selectionEnd += offset;
|
|
this.selectionStart = this.selectionEnd;
|
|
}
|
|
return offset !== 0;
|
|
},
|
|
|
|
/**
|
|
* Moves cursor left
|
|
* @param {Event} e Event object
|
|
*/
|
|
moveCursorLeft: function(e) {
|
|
if (this.selectionStart === 0 && this.selectionEnd === 0) {
|
|
return;
|
|
}
|
|
this._moveCursorLeftOrRight('Left', e);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @return {Boolean} true if a change happened
|
|
*/
|
|
_move: function(e, prop, direction) {
|
|
var newValue;
|
|
if (e.altKey) {
|
|
newValue = this['findWordBoundary' + direction](this[prop]);
|
|
}
|
|
else if (e.metaKey || e.keyCode === 35 || e.keyCode === 36 ) {
|
|
newValue = this['findLineBoundary' + direction](this[prop]);
|
|
}
|
|
else {
|
|
this[prop] += direction === 'Left' ? -1 : 1;
|
|
return true;
|
|
}
|
|
if (typeof newValue !== undefined && this[prop] !== newValue) {
|
|
this[prop] = newValue;
|
|
return true;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_moveLeft: function(e, prop) {
|
|
return this._move(e, prop, 'Left');
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_moveRight: function(e, prop) {
|
|
return this._move(e, prop, 'Right');
|
|
},
|
|
|
|
/**
|
|
* Moves cursor left without keeping selection
|
|
* @param {Event} e
|
|
*/
|
|
moveCursorLeftWithoutShift: function(e) {
|
|
var change = true;
|
|
this._selectionDirection = 'left';
|
|
|
|
// only move cursor when there is no selection,
|
|
// otherwise we discard it, and leave cursor on same place
|
|
if (this.selectionEnd === this.selectionStart && this.selectionStart !== 0) {
|
|
change = this._moveLeft(e, 'selectionStart');
|
|
|
|
}
|
|
this.selectionEnd = this.selectionStart;
|
|
return change;
|
|
},
|
|
|
|
/**
|
|
* Moves cursor left while keeping selection
|
|
* @param {Event} e
|
|
*/
|
|
moveCursorLeftWithShift: function(e) {
|
|
if (this._selectionDirection === 'right' && this.selectionStart !== this.selectionEnd) {
|
|
return this._moveLeft(e, 'selectionEnd');
|
|
}
|
|
else if (this.selectionStart !== 0){
|
|
this._selectionDirection = 'left';
|
|
return this._moveLeft(e, 'selectionStart');
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Moves cursor right
|
|
* @param {Event} e Event object
|
|
*/
|
|
moveCursorRight: function(e) {
|
|
if (this.selectionStart >= this._text.length && this.selectionEnd >= this._text.length) {
|
|
return;
|
|
}
|
|
this._moveCursorLeftOrRight('Right', e);
|
|
},
|
|
|
|
/**
|
|
* Moves cursor right or Left, fires event
|
|
* @param {String} direction 'Left', 'Right'
|
|
* @param {Event} e Event object
|
|
*/
|
|
_moveCursorLeftOrRight: function(direction, e) {
|
|
var actionName = 'moveCursor' + direction + 'With';
|
|
this._currentCursorOpacity = 1;
|
|
|
|
if (e.shiftKey) {
|
|
actionName += 'Shift';
|
|
}
|
|
else {
|
|
actionName += 'outShift';
|
|
}
|
|
if (this[actionName](e)) {
|
|
this.abortCursorAnimation();
|
|
this.initDelayedCursor();
|
|
this._fireSelectionChanged();
|
|
this._updateTextarea();
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Moves cursor right while keeping selection
|
|
* @param {Event} e
|
|
*/
|
|
moveCursorRightWithShift: function(e) {
|
|
if (this._selectionDirection === 'left' && this.selectionStart !== this.selectionEnd) {
|
|
return this._moveRight(e, 'selectionStart');
|
|
}
|
|
else if (this.selectionEnd !== this._text.length) {
|
|
this._selectionDirection = 'right';
|
|
return this._moveRight(e, 'selectionEnd');
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Moves cursor right without keeping selection
|
|
* @param {Event} e Event object
|
|
*/
|
|
moveCursorRightWithoutShift: function(e) {
|
|
var changed = true;
|
|
this._selectionDirection = 'right';
|
|
|
|
if (this.selectionStart === this.selectionEnd) {
|
|
changed = this._moveRight(e, 'selectionStart');
|
|
this.selectionEnd = this.selectionStart;
|
|
}
|
|
else {
|
|
this.selectionStart = this.selectionEnd;
|
|
}
|
|
return changed;
|
|
},
|
|
|
|
/**
|
|
* Removes characters from start/end
|
|
* start/end ar per grapheme position in _text array.
|
|
*
|
|
* @param {Number} start
|
|
* @param {Number} end default to start + 1
|
|
*/
|
|
removeChars: function(start, end) {
|
|
if (typeof end === 'undefined') {
|
|
end = start + 1;
|
|
}
|
|
this.removeStyleFromTo(start, end);
|
|
this._text.splice(start, end - start);
|
|
this.text = this._text.join('');
|
|
this.set('dirty', true);
|
|
if (this._shouldClearDimensionCache()) {
|
|
this.initDimensions();
|
|
this.setCoords();
|
|
}
|
|
this._removeExtraneousStyles();
|
|
},
|
|
|
|
/**
|
|
* insert characters at start position, before start position.
|
|
* start equal 1 it means the text get inserted between actual grapheme 0 and 1
|
|
* if style array is provided, it must be as the same length of text in graphemes
|
|
* if end is provided and is bigger than start, old text is replaced.
|
|
* start/end ar per grapheme position in _text array.
|
|
*
|
|
* @param {String} text text to insert
|
|
* @param {Array} style array of style objects
|
|
* @param {Number} start
|
|
* @param {Number} end default to start + 1
|
|
*/
|
|
insertChars: function(text, style, start, end) {
|
|
if (typeof end === 'undefined') {
|
|
end = start;
|
|
}
|
|
if (end > start) {
|
|
this.removeStyleFromTo(start, end);
|
|
}
|
|
var graphemes = fabric.util.string.graphemeSplit(text);
|
|
this.insertNewStyleBlock(graphemes, start, style);
|
|
this._text = [].concat(this._text.slice(0, start), graphemes, this._text.slice(end));
|
|
this.text = this._text.join('');
|
|
this.set('dirty', true);
|
|
if (this._shouldClearDimensionCache()) {
|
|
this.initDimensions();
|
|
this.setCoords();
|
|
}
|
|
this._removeExtraneousStyles();
|
|
},
|
|
|
|
});
|
|
|
|
|
|
/* _TO_SVG_START_ */
|
|
(function() {
|
|
var toFixed = fabric.util.toFixed,
|
|
multipleSpacesRegex = / +/g;
|
|
|
|
fabric.util.object.extend(fabric.Text.prototype, /** @lends fabric.Text.prototype */ {
|
|
|
|
/**
|
|
* Returns SVG representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
_toSVG: function() {
|
|
var offsets = this._getSVGLeftTopOffsets(),
|
|
textAndBg = this._getSVGTextAndBg(offsets.textTop, offsets.textLeft);
|
|
return this._wrapSVGTextAndBg(textAndBg);
|
|
},
|
|
|
|
/**
|
|
* Returns svg representation of an instance
|
|
* @param {Function} [reviver] Method for further parsing of svg representation.
|
|
* @return {String} svg representation of an instance
|
|
*/
|
|
toSVG: function(reviver) {
|
|
return this._createBaseSVGMarkup(
|
|
this._toSVG(),
|
|
{ reviver: reviver, noStyle: true, withShadow: true }
|
|
);
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getSVGLeftTopOffsets: function() {
|
|
return {
|
|
textLeft: -this.width / 2,
|
|
textTop: -this.height / 2,
|
|
lineTop: this.getHeightOfLine(0)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_wrapSVGTextAndBg: function(textAndBg) {
|
|
var noShadow = true,
|
|
textDecoration = this.getSvgTextDecoration(this);
|
|
return [
|
|
textAndBg.textBgRects.join(''),
|
|
'\t\t<text xml:space="preserve" ',
|
|
(this.fontFamily ? 'font-family="' + this.fontFamily.replace(/"/g, '\'') + '" ' : ''),
|
|
(this.fontSize ? 'font-size="' + this.fontSize + '" ' : ''),
|
|
(this.fontStyle ? 'font-style="' + this.fontStyle + '" ' : ''),
|
|
(this.fontWeight ? 'font-weight="' + this.fontWeight + '" ' : ''),
|
|
(textDecoration ? 'text-decoration="' + textDecoration + '" ' : ''),
|
|
'style="', this.getSvgStyles(noShadow), '"', this.addPaintOrder(), ' >',
|
|
textAndBg.textSpans.join(''),
|
|
'</text>\n'
|
|
];
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
* @param {Number} textTopOffset Text top offset
|
|
* @param {Number} textLeftOffset Text left offset
|
|
* @return {Object}
|
|
*/
|
|
_getSVGTextAndBg: function(textTopOffset, textLeftOffset) {
|
|
var textSpans = [],
|
|
textBgRects = [],
|
|
height = textTopOffset, lineOffset;
|
|
// bounding-box background
|
|
this._setSVGBg(textBgRects);
|
|
|
|
// text and text-background
|
|
for (var i = 0, len = this._textLines.length; i < len; i++) {
|
|
lineOffset = this._getLineLeftOffset(i);
|
|
if (this.textBackgroundColor || this.styleHas('textBackgroundColor', i)) {
|
|
this._setSVGTextLineBg(textBgRects, i, textLeftOffset + lineOffset, height);
|
|
}
|
|
this._setSVGTextLineText(textSpans, i, textLeftOffset + lineOffset, height);
|
|
height += this.getHeightOfLine(i);
|
|
}
|
|
|
|
return {
|
|
textSpans: textSpans,
|
|
textBgRects: textBgRects
|
|
};
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_createTextCharSpan: function(_char, styleDecl, left, top) {
|
|
var shouldUseWhitespace = _char !== _char.trim() || _char.match(multipleSpacesRegex),
|
|
styleProps = this.getSvgSpanStyles(styleDecl, shouldUseWhitespace),
|
|
fillStyles = styleProps ? 'style="' + styleProps + '"' : '',
|
|
dy = styleDecl.deltaY, dySpan = '',
|
|
NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS;
|
|
if (dy) {
|
|
dySpan = ' dy="' + toFixed(dy, NUM_FRACTION_DIGITS) + '" ';
|
|
}
|
|
return [
|
|
'<tspan x="', toFixed(left, NUM_FRACTION_DIGITS), '" y="',
|
|
toFixed(top, NUM_FRACTION_DIGITS), '" ', dySpan,
|
|
fillStyles, '>',
|
|
fabric.util.string.escapeXml(_char),
|
|
'</tspan>'
|
|
].join('');
|
|
},
|
|
|
|
_setSVGTextLineText: function(textSpans, lineIndex, textLeftOffset, textTopOffset) {
|
|
// set proper line offset
|
|
var lineHeight = this.getHeightOfLine(lineIndex),
|
|
isJustify = this.textAlign.indexOf('justify') !== -1,
|
|
actualStyle,
|
|
nextStyle,
|
|
charsToRender = '',
|
|
charBox, style,
|
|
boxWidth = 0,
|
|
line = this._textLines[lineIndex],
|
|
timeToRender;
|
|
|
|
textTopOffset += lineHeight * (1 - this._fontSizeFraction) / this.lineHeight;
|
|
for (var i = 0, len = line.length - 1; i <= len; i++) {
|
|
timeToRender = i === len || this.charSpacing;
|
|
charsToRender += line[i];
|
|
charBox = this.__charBounds[lineIndex][i];
|
|
if (boxWidth === 0) {
|
|
textLeftOffset += charBox.kernedWidth - charBox.width;
|
|
boxWidth += charBox.width;
|
|
}
|
|
else {
|
|
boxWidth += charBox.kernedWidth;
|
|
}
|
|
if (isJustify && !timeToRender) {
|
|
if (this._reSpaceAndTab.test(line[i])) {
|
|
timeToRender = true;
|
|
}
|
|
}
|
|
if (!timeToRender) {
|
|
// if we have charSpacing, we render char by char
|
|
actualStyle = actualStyle || this.getCompleteStyleDeclaration(lineIndex, i);
|
|
nextStyle = this.getCompleteStyleDeclaration(lineIndex, i + 1);
|
|
timeToRender = this._hasStyleChangedForSvg(actualStyle, nextStyle);
|
|
}
|
|
if (timeToRender) {
|
|
style = this._getStyleDeclaration(lineIndex, i) || { };
|
|
textSpans.push(this._createTextCharSpan(charsToRender, style, textLeftOffset, textTopOffset));
|
|
charsToRender = '';
|
|
actualStyle = nextStyle;
|
|
textLeftOffset += boxWidth;
|
|
boxWidth = 0;
|
|
}
|
|
}
|
|
},
|
|
|
|
_pushTextBgRect: function(textBgRects, color, left, top, width, height) {
|
|
var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS;
|
|
textBgRects.push(
|
|
'\t\t<rect ',
|
|
this._getFillAttributes(color),
|
|
' x="',
|
|
toFixed(left, NUM_FRACTION_DIGITS),
|
|
'" y="',
|
|
toFixed(top, NUM_FRACTION_DIGITS),
|
|
'" width="',
|
|
toFixed(width, NUM_FRACTION_DIGITS),
|
|
'" height="',
|
|
toFixed(height, NUM_FRACTION_DIGITS),
|
|
'"></rect>\n');
|
|
},
|
|
|
|
_setSVGTextLineBg: function(textBgRects, i, leftOffset, textTopOffset) {
|
|
var line = this._textLines[i],
|
|
heightOfLine = this.getHeightOfLine(i) / this.lineHeight,
|
|
boxWidth = 0,
|
|
boxStart = 0,
|
|
charBox, currentColor,
|
|
lastColor = this.getValueOfPropertyAt(i, 0, 'textBackgroundColor');
|
|
for (var j = 0, jlen = line.length; j < jlen; j++) {
|
|
charBox = this.__charBounds[i][j];
|
|
currentColor = this.getValueOfPropertyAt(i, j, 'textBackgroundColor');
|
|
if (currentColor !== lastColor) {
|
|
lastColor && this._pushTextBgRect(textBgRects, lastColor, leftOffset + boxStart,
|
|
textTopOffset, boxWidth, heightOfLine);
|
|
boxStart = charBox.left;
|
|
boxWidth = charBox.width;
|
|
lastColor = currentColor;
|
|
}
|
|
else {
|
|
boxWidth += charBox.kernedWidth;
|
|
}
|
|
}
|
|
currentColor && this._pushTextBgRect(textBgRects, currentColor, leftOffset + boxStart,
|
|
textTopOffset, boxWidth, heightOfLine);
|
|
},
|
|
|
|
/**
|
|
* Adobe Illustrator (at least CS5) is unable to render rgba()-based fill values
|
|
* we work around it by "moving" alpha channel into opacity attribute and setting fill's alpha to 1
|
|
*
|
|
* @private
|
|
* @param {*} value
|
|
* @return {String}
|
|
*/
|
|
_getFillAttributes: function(value) {
|
|
var fillColor = (value && typeof value === 'string') ? new fabric.Color(value) : '';
|
|
if (!fillColor || !fillColor.getSource() || fillColor.getAlpha() === 1) {
|
|
return 'fill="' + value + '"';
|
|
}
|
|
return 'opacity="' + fillColor.getAlpha() + '" fill="' + fillColor.setAlpha(1).toRgb() + '"';
|
|
},
|
|
|
|
/**
|
|
* @private
|
|
*/
|
|
_getSVGLineTopOffset: function(lineIndex) {
|
|
var lineTopOffset = 0, lastHeight = 0;
|
|
for (var j = 0; j < lineIndex; j++) {
|
|
lineTopOffset += this.getHeightOfLine(j);
|
|
}
|
|
lastHeight = this.getHeightOfLine(j);
|
|
return {
|
|
lineTop: lineTopOffset,
|
|
offset: (this._fontSizeMult - this._fontSizeFraction) * lastHeight / (this.lineHeight * this._fontSizeMult)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Returns styles-string for svg-export
|
|
* @param {Boolean} skipShadow a boolean to skip shadow filter output
|
|
* @return {String}
|
|
*/
|
|
getSvgStyles: function(skipShadow) {
|
|
var svgStyle = fabric.Object.prototype.getSvgStyles.call(this, skipShadow);
|
|
return svgStyle + ' white-space: pre;';
|
|
},
|
|
});
|
|
})();
|
|
/* _TO_SVG_END_ */
|
|
|
|
|
|
(function(global) {
|
|
|
|
'use strict';
|
|
|
|
var fabric = global.fabric || (global.fabric = {});
|
|
|
|
/**
|
|
* Textbox class, based on IText, allows the user to resize the text rectangle
|
|
* and wraps lines automatically. Textboxes have their Y scaling locked, the
|
|
* user can only change width. Height is adjusted automatically based on the
|
|
* wrapping of lines.
|
|
* @class fabric.Textbox
|
|
* @extends fabric.IText
|
|
* @mixes fabric.Observable
|
|
* @return {fabric.Textbox} thisArg
|
|
* @see {@link fabric.Textbox#initialize} for constructor definition
|
|
*/
|
|
fabric.Textbox = fabric.util.createClass(fabric.IText, fabric.Observable, {
|
|
|
|
/**
|
|
* Type of an object
|
|
* @type String
|
|
* @default
|
|
*/
|
|
type: 'textbox',
|
|
|
|
/**
|
|
* Minimum width of textbox, in pixels.
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
minWidth: 20,
|
|
|
|
/**
|
|
* Minimum calculated width of a textbox, in pixels.
|
|
* fixed to 2 so that an empty textbox cannot go to 0
|
|
* and is still selectable without text.
|
|
* @type Number
|
|
* @default
|
|
*/
|
|
dynamicMinWidth: 2,
|
|
|
|
/**
|
|
* Cached array of text wrapping.
|
|
* @type Array
|
|
*/
|
|
__cachedLines: null,
|
|
|
|
/**
|
|
* Override standard Object class values
|
|
*/
|
|
lockScalingFlip: true,
|
|
|
|
/**
|
|
* Override standard Object class values
|
|
* Textbox needs this on false
|
|
*/
|
|
noScaleCache: false,
|
|
|
|
/**
|
|
* Properties which when set cause object to change dimensions
|
|
* @type Object
|
|
* @private
|
|
*/
|
|
_dimensionAffectingProps: fabric.Text.prototype._dimensionAffectingProps.concat('width'),
|
|
|
|
/**
|
|
* Use this regular expression to split strings in breakable lines
|
|
* @private
|
|
*/
|
|
_wordJoiners: /[ \t\r]/,
|
|
|
|
/**
|
|
* Use this boolean property in order to split strings that have no white space concept.
|
|
* this is a cheap way to help with chinese/japanese
|
|
* @type Boolean
|
|
* @since 2.6.0
|
|
*/
|
|
splitByGrapheme: false,
|
|
|
|
/**
|
|
* Unlike superclass's version of this function, Textbox does not update
|
|
* its width.
|
|
* @private
|
|
* @override
|
|
*/
|
|
initDimensions: function() {
|
|
if (this.__skipDimension) {
|
|
return;
|
|
}
|
|
this.isEditing && this.initDelayedCursor();
|
|
this.clearContextTop();
|
|
this._clearCache();
|
|
// clear dynamicMinWidth as it will be different after we re-wrap line
|
|
this.dynamicMinWidth = 0;
|
|
// wrap lines
|
|
this._styleMap = this._generateStyleMap(this._splitText());
|
|
// if after wrapping, the width is smaller than dynamicMinWidth, change the width and re-wrap
|
|
if (this.dynamicMinWidth > this.width) {
|
|
this._set('width', this.dynamicMinWidth);
|
|
}
|
|
if (this.textAlign.indexOf('justify') !== -1) {
|
|
// once text is measured we need to make space fatter to make justified text.
|
|
this.enlargeSpaces();
|
|
}
|
|
// clear cache and re-calculate height
|
|
this.height = this.calcTextHeight();
|
|
this.saveState({ propertySet: '_dimensionAffectingProps' });
|
|
},
|
|
|
|
/**
|
|
* Generate an object that translates the style object so that it is
|
|
* broken up by visual lines (new lines and automatic wrapping).
|
|
* The original text styles object is broken up by actual lines (new lines only),
|
|
* which is only sufficient for Text / IText
|
|
* @private
|
|
*/
|
|
_generateStyleMap: function(textInfo) {
|
|
var realLineCount = 0,
|
|
realLineCharCount = 0,
|
|
charCount = 0,
|
|
map = {};
|
|
|
|
for (var i = 0; i < textInfo.graphemeLines.length; i++) {
|
|
if (textInfo.graphemeText[charCount] === '\n' && i > 0) {
|
|
realLineCharCount = 0;
|
|
charCount++;
|
|
realLineCount++;
|
|
}
|
|
else if (!this.splitByGrapheme && this._reSpaceAndTab.test(textInfo.graphemeText[charCount]) && i > 0) {
|
|
// this case deals with space's that are removed from end of lines when wrapping
|
|
realLineCharCount++;
|
|
charCount++;
|
|
}
|
|
|
|
map[i] = { line: realLineCount, offset: realLineCharCount };
|
|
|
|
charCount += textInfo.graphemeLines[i].length;
|
|
realLineCharCount += textInfo.graphemeLines[i].length;
|
|
}
|
|
|
|
return map;
|
|
},
|
|
|
|
/**
|
|
* Returns true if object has a style property or has it on a specified line
|
|
* @param {Number} lineIndex
|
|
* @return {Boolean}
|
|
*/
|
|
styleHas: function(property, lineIndex) {
|
|
if (this._styleMap && !this.isWrapping) {
|
|
var map = this._styleMap[lineIndex];
|
|
if (map) {
|
|
lineIndex = map.line;
|
|
}
|
|
}
|
|
return fabric.Text.prototype.styleHas.call(this, property, lineIndex);
|
|
},
|
|
|
|
/**
|
|
* Returns true if object has no styling or no styling in a line
|
|
* @param {Number} lineIndex , lineIndex is on wrapped lines.
|
|
* @return {Boolean}
|
|
*/
|
|
isEmptyStyles: function(lineIndex) {
|
|
if (!this.styles) {
|
|
return true;
|
|
}
|
|
var offset = 0, nextLineIndex = lineIndex + 1, nextOffset, obj, shouldLimit = false,
|
|
map = this._styleMap[lineIndex], mapNextLine = this._styleMap[lineIndex + 1];
|
|
if (map) {
|
|
lineIndex = map.line;
|
|
offset = map.offset;
|
|
}
|
|
if (mapNextLine) {
|
|
nextLineIndex = mapNextLine.line;
|
|
shouldLimit = nextLineIndex === lineIndex;
|
|
nextOffset = mapNextLine.offset;
|
|
}
|
|
obj = typeof lineIndex === 'undefined' ? this.styles : { line: this.styles[lineIndex] };
|
|
for (var p1 in obj) {
|
|
for (var p2 in obj[p1]) {
|
|
if (p2 >= offset && (!shouldLimit || p2 < nextOffset)) {
|
|
// eslint-disable-next-line no-unused-vars
|
|
for (var p3 in obj[p1][p2]) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return true;
|
|
},
|
|
|
|
/**
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @private
|
|
*/
|
|
_getStyleDeclaration: function(lineIndex, charIndex) {
|
|
if (this._styleMap && !this.isWrapping) {
|
|
var map = this._styleMap[lineIndex];
|
|
if (!map) {
|
|
return null;
|
|
}
|
|
lineIndex = map.line;
|
|
charIndex = map.offset + charIndex;
|
|
}
|
|
return this.callSuper('_getStyleDeclaration', lineIndex, charIndex);
|
|
},
|
|
|
|
/**
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @param {Object} style
|
|
* @private
|
|
*/
|
|
_setStyleDeclaration: function(lineIndex, charIndex, style) {
|
|
var map = this._styleMap[lineIndex];
|
|
lineIndex = map.line;
|
|
charIndex = map.offset + charIndex;
|
|
|
|
this.styles[lineIndex][charIndex] = style;
|
|
},
|
|
|
|
/**
|
|
* @param {Number} lineIndex
|
|
* @param {Number} charIndex
|
|
* @private
|
|
*/
|
|
_deleteStyleDeclaration: function(lineIndex, charIndex) {
|
|
var map = this._styleMap[lineIndex];
|
|
lineIndex = map.line;
|
|
charIndex = map.offset + charIndex;
|
|
delete this.styles[lineIndex][charIndex];
|
|
},
|
|
|
|
/**
|
|
* probably broken need a fix
|
|
* Returns the real style line that correspond to the wrapped lineIndex line
|
|
* Used just to verify if the line does exist or not.
|
|
* @param {Number} lineIndex
|
|
* @returns {Boolean} if the line exists or not
|
|
* @private
|
|
*/
|
|
_getLineStyle: function(lineIndex) {
|
|
var map = this._styleMap[lineIndex];
|
|
return !!this.styles[map.line];
|
|
},
|
|
|
|
/**
|
|
* Set the line style to an empty object so that is initialized
|
|
* @param {Number} lineIndex
|
|
* @param {Object} style
|
|
* @private
|
|
*/
|
|
_setLineStyle: function(lineIndex) {
|
|
var map = this._styleMap[lineIndex];
|
|
this.styles[map.line] = {};
|
|
},
|
|
|
|
/**
|
|
* Wraps text using the 'width' property of Textbox. First this function
|
|
* splits text on newlines, so we preserve newlines entered by the user.
|
|
* Then it wraps each line using the width of the Textbox by calling
|
|
* _wrapLine().
|
|
* @param {Array} lines The string array of text that is split into lines
|
|
* @param {Number} desiredWidth width you want to wrap to
|
|
* @returns {Array} Array of lines
|
|
*/
|
|
_wrapText: function(lines, desiredWidth) {
|
|
var wrapped = [], i;
|
|
this.isWrapping = true;
|
|
for (i = 0; i < lines.length; i++) {
|
|
wrapped = wrapped.concat(this._wrapLine(lines[i], i, desiredWidth));
|
|
}
|
|
this.isWrapping = false;
|
|
return wrapped;
|
|
},
|
|
|
|
/**
|
|
* Helper function to measure a string of text, given its lineIndex and charIndex offset
|
|
* it gets called when charBounds are not available yet.
|
|
* @param {CanvasRenderingContext2D} ctx
|
|
* @param {String} text
|
|
* @param {number} lineIndex
|
|
* @param {number} charOffset
|
|
* @returns {number}
|
|
* @private
|
|
*/
|
|
_measureWord: function(word, lineIndex, charOffset) {
|
|
var width = 0, prevGrapheme, skipLeft = true;
|
|
charOffset = charOffset || 0;
|
|
for (var i = 0, len = word.length; i < len; i++) {
|
|
var box = this._getGraphemeBox(word[i], lineIndex, i + charOffset, prevGrapheme, skipLeft);
|
|
width += box.kernedWidth;
|
|
prevGrapheme = word[i];
|
|
}
|
|
return width;
|
|
},
|
|
|
|
/**
|
|
* Wraps a line of text using the width of the Textbox and a context.
|
|
* @param {Array} line The grapheme array that represent the line
|
|
* @param {Number} lineIndex
|
|
* @param {Number} desiredWidth width you want to wrap the line to
|
|
* @param {Number} reservedSpace space to remove from wrapping for custom functionalities
|
|
* @returns {Array} Array of line(s) into which the given text is wrapped
|
|
* to.
|
|
*/
|
|
_wrapLine: function(_line, lineIndex, desiredWidth, reservedSpace) {
|
|
var lineWidth = 0,
|
|
splitByGrapheme = this.splitByGrapheme,
|
|
graphemeLines = [],
|
|
line = [],
|
|
// spaces in different languages?
|
|
words = splitByGrapheme ? fabric.util.string.graphemeSplit(_line) : _line.split(this._wordJoiners),
|
|
word = '',
|
|
offset = 0,
|
|
infix = splitByGrapheme ? '' : ' ',
|
|
wordWidth = 0,
|
|
infixWidth = 0,
|
|
largestWordWidth = 0,
|
|
lineJustStarted = true,
|
|
additionalSpace = this._getWidthOfCharSpacing(),
|
|
reservedSpace = reservedSpace || 0;
|
|
// fix a difference between split and graphemeSplit
|
|
if (words.length === 0) {
|
|
words.push([]);
|
|
}
|
|
desiredWidth -= reservedSpace;
|
|
for (var i = 0; i < words.length; i++) {
|
|
// if using splitByGrapheme words are already in graphemes.
|
|
word = splitByGrapheme ? words[i] : fabric.util.string.graphemeSplit(words[i]);
|
|
wordWidth = this._measureWord(word, lineIndex, offset);
|
|
offset += word.length;
|
|
|
|
lineWidth += infixWidth + wordWidth - additionalSpace;
|
|
if (lineWidth > desiredWidth && !lineJustStarted) {
|
|
graphemeLines.push(line);
|
|
line = [];
|
|
lineWidth = wordWidth;
|
|
lineJustStarted = true;
|
|
}
|
|
else {
|
|
lineWidth += additionalSpace;
|
|
}
|
|
|
|
if (!lineJustStarted && !splitByGrapheme) {
|
|
line.push(infix);
|
|
}
|
|
line = line.concat(word);
|
|
|
|
infixWidth = splitByGrapheme ? 0 : this._measureWord([infix], lineIndex, offset);
|
|
offset++;
|
|
lineJustStarted = false;
|
|
// keep track of largest word
|
|
if (wordWidth > largestWordWidth) {
|
|
largestWordWidth = wordWidth;
|
|
}
|
|
}
|
|
|
|
i && graphemeLines.push(line);
|
|
|
|
if (largestWordWidth + reservedSpace > this.dynamicMinWidth) {
|
|
this.dynamicMinWidth = largestWordWidth - additionalSpace + reservedSpace;
|
|
}
|
|
return graphemeLines;
|
|
},
|
|
|
|
/**
|
|
* Detect if the text line is ended with an hard break
|
|
* text and itext do not have wrapping, return false
|
|
* @param {Number} lineIndex text to split
|
|
* @return {Boolean}
|
|
*/
|
|
isEndOfWrapping: function(lineIndex) {
|
|
if (!this._styleMap[lineIndex + 1]) {
|
|
// is last line, return true;
|
|
return true;
|
|
}
|
|
if (this._styleMap[lineIndex + 1].line !== this._styleMap[lineIndex].line) {
|
|
// this is last line before a line break, return true;
|
|
return true;
|
|
}
|
|
return false;
|
|
},
|
|
|
|
/**
|
|
* Detect if a line has a linebreak and so we need to account for it when moving
|
|
* and counting style.
|
|
* @return Number
|
|
*/
|
|
missingNewlineOffset: function(lineIndex) {
|
|
if (this.splitByGrapheme) {
|
|
return this.isEndOfWrapping(lineIndex) ? 1 : 0;
|
|
}
|
|
return 1;
|
|
},
|
|
|
|
/**
|
|
* Gets lines of text to render in the Textbox. This function calculates
|
|
* text wrapping on the fly every time it is called.
|
|
* @param {String} text text to split
|
|
* @returns {Array} Array of lines in the Textbox.
|
|
* @override
|
|
*/
|
|
_splitTextIntoLines: function(text) {
|
|
var newText = fabric.Text.prototype._splitTextIntoLines.call(this, text),
|
|
graphemeLines = this._wrapText(newText.lines, this.width),
|
|
lines = new Array(graphemeLines.length);
|
|
for (var i = 0; i < graphemeLines.length; i++) {
|
|
lines[i] = graphemeLines[i].join('');
|
|
}
|
|
newText.lines = lines;
|
|
newText.graphemeLines = graphemeLines;
|
|
return newText;
|
|
},
|
|
|
|
getMinWidth: function() {
|
|
return Math.max(this.minWidth, this.dynamicMinWidth);
|
|
},
|
|
|
|
_removeExtraneousStyles: function() {
|
|
var linesToKeep = {};
|
|
for (var prop in this._styleMap) {
|
|
if (this._textLines[prop]) {
|
|
linesToKeep[this._styleMap[prop].line] = 1;
|
|
}
|
|
}
|
|
for (var prop in this.styles) {
|
|
if (!linesToKeep[prop]) {
|
|
delete this.styles[prop];
|
|
}
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Returns object representation of an instance
|
|
* @method toObject
|
|
* @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output
|
|
* @return {Object} object representation of an instance
|
|
*/
|
|
toObject: function(propertiesToInclude) {
|
|
return this.callSuper('toObject', ['minWidth', 'splitByGrapheme'].concat(propertiesToInclude));
|
|
}
|
|
});
|
|
|
|
/**
|
|
* Returns fabric.Textbox instance from an object representation
|
|
* @static
|
|
* @memberOf fabric.Textbox
|
|
* @param {Object} object Object to create an instance from
|
|
* @param {Function} [callback] Callback to invoke when an fabric.Textbox instance is created
|
|
*/
|
|
fabric.Textbox.fromObject = function(object, callback) {
|
|
return fabric.Object._fromObject('Textbox', object, callback, 'text');
|
|
};
|
|
})( true ? exports : 0);
|
|
|
|
|
|
(function() {
|
|
|
|
var controlsUtils = fabric.controlsUtils,
|
|
scaleSkewStyleHandler = controlsUtils.scaleSkewCursorStyleHandler,
|
|
scaleStyleHandler = controlsUtils.scaleCursorStyleHandler,
|
|
scalingEqually = controlsUtils.scalingEqually,
|
|
scalingYOrSkewingX = controlsUtils.scalingYOrSkewingX,
|
|
scalingXOrSkewingY = controlsUtils.scalingXOrSkewingY,
|
|
scaleOrSkewActionName = controlsUtils.scaleOrSkewActionName,
|
|
objectControls = fabric.Object.prototype.controls;
|
|
|
|
objectControls.ml = new fabric.Control({
|
|
x: -0.5,
|
|
y: 0,
|
|
cursorStyleHandler: scaleSkewStyleHandler,
|
|
actionHandler: scalingXOrSkewingY,
|
|
getActionName: scaleOrSkewActionName,
|
|
});
|
|
|
|
objectControls.mr = new fabric.Control({
|
|
x: 0.5,
|
|
y: 0,
|
|
cursorStyleHandler: scaleSkewStyleHandler,
|
|
actionHandler: scalingXOrSkewingY,
|
|
getActionName: scaleOrSkewActionName,
|
|
});
|
|
|
|
objectControls.mb = new fabric.Control({
|
|
x: 0,
|
|
y: 0.5,
|
|
cursorStyleHandler: scaleSkewStyleHandler,
|
|
actionHandler: scalingYOrSkewingX,
|
|
getActionName: scaleOrSkewActionName,
|
|
});
|
|
|
|
objectControls.mt = new fabric.Control({
|
|
x: 0,
|
|
y: -0.5,
|
|
cursorStyleHandler: scaleSkewStyleHandler,
|
|
actionHandler: scalingYOrSkewingX,
|
|
getActionName: scaleOrSkewActionName,
|
|
});
|
|
|
|
objectControls.tl = new fabric.Control({
|
|
x: -0.5,
|
|
y: -0.5,
|
|
cursorStyleHandler: scaleStyleHandler,
|
|
actionHandler: scalingEqually
|
|
});
|
|
|
|
objectControls.tr = new fabric.Control({
|
|
x: 0.5,
|
|
y: -0.5,
|
|
cursorStyleHandler: scaleStyleHandler,
|
|
actionHandler: scalingEqually
|
|
});
|
|
|
|
objectControls.bl = new fabric.Control({
|
|
x: -0.5,
|
|
y: 0.5,
|
|
cursorStyleHandler: scaleStyleHandler,
|
|
actionHandler: scalingEqually
|
|
});
|
|
|
|
objectControls.br = new fabric.Control({
|
|
x: 0.5,
|
|
y: 0.5,
|
|
cursorStyleHandler: scaleStyleHandler,
|
|
actionHandler: scalingEqually
|
|
});
|
|
|
|
objectControls.mtr = new fabric.Control({
|
|
x: 0,
|
|
y: -0.5,
|
|
actionHandler: controlsUtils.rotationWithSnapping,
|
|
cursorStyleHandler: controlsUtils.rotationStyleHandler,
|
|
offsetY: -40,
|
|
withConnection: true,
|
|
actionName: 'rotate',
|
|
});
|
|
|
|
if (fabric.Textbox) {
|
|
// this is breaking the prototype inheritance, no time / ideas to fix it.
|
|
// is important to document that if you want to have all objects to have a
|
|
// specific custom control, you have to add it to Object prototype and to Textbox
|
|
// prototype. The controls are shared as references. So changes to control `tr`
|
|
// can still apply to all objects if needed.
|
|
var textBoxControls = fabric.Textbox.prototype.controls = { };
|
|
|
|
textBoxControls.mtr = objectControls.mtr;
|
|
textBoxControls.tr = objectControls.tr;
|
|
textBoxControls.br = objectControls.br;
|
|
textBoxControls.tl = objectControls.tl;
|
|
textBoxControls.bl = objectControls.bl;
|
|
textBoxControls.mt = objectControls.mt;
|
|
textBoxControls.mb = objectControls.mb;
|
|
|
|
textBoxControls.mr = new fabric.Control({
|
|
x: 0.5,
|
|
y: 0,
|
|
actionHandler: controlsUtils.changeWidth,
|
|
cursorStyleHandler: scaleSkewStyleHandler,
|
|
actionName: 'resizing',
|
|
});
|
|
|
|
textBoxControls.ml = new fabric.Control({
|
|
x: -0.5,
|
|
y: 0,
|
|
actionHandler: controlsUtils.changeWidth,
|
|
cursorStyleHandler: scaleSkewStyleHandler,
|
|
actionName: 'resizing',
|
|
});
|
|
}
|
|
})();
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3053:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
/* eslint-disable complexity */
|
|
/**
|
|
* @fileoverview Returns the first index at which a given element can be found in the array.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
var isArray = __webpack_require__(602);
|
|
|
|
/**
|
|
* @module array
|
|
*/
|
|
|
|
/**
|
|
* Returns the first index at which a given element can be found in the array
|
|
* from start index(default 0), or -1 if it is not present.
|
|
* It compares searchElement to elements of the Array using strict equality
|
|
* (the same method used by the ===, or triple-equals, operator).
|
|
* @param {*} searchElement Element to locate in the array
|
|
* @param {Array} array Array that will be traversed.
|
|
* @param {number} startIndex Start index in array for searching (default 0)
|
|
* @returns {number} the First index at which a given element, or -1 if it is not present
|
|
* @memberof module:array
|
|
* @example
|
|
* // ES6
|
|
* import inArray from 'tui-code-snippet/array/inArray';
|
|
*
|
|
* // CommonJS
|
|
* const inArray = require('tui-code-snippet/array/inArray');
|
|
*
|
|
* const arr = ['one', 'two', 'three', 'four'];
|
|
* const idx1 = inArray('one', arr, 3); // -1
|
|
* const idx2 = inArray('one', arr); // 0
|
|
*/
|
|
function inArray(searchElement, array, startIndex) {
|
|
var i;
|
|
var length;
|
|
startIndex = startIndex || 0;
|
|
|
|
if (!isArray(array)) {
|
|
return -1;
|
|
}
|
|
|
|
if (Array.prototype.indexOf) {
|
|
return Array.prototype.indexOf.call(array, searchElement, startIndex);
|
|
}
|
|
|
|
length = array.length;
|
|
for (i = startIndex; startIndex >= 0 && i < length; i += 1) {
|
|
if (array[i] === searchElement) {
|
|
return i;
|
|
}
|
|
}
|
|
|
|
return -1;
|
|
}
|
|
|
|
module.exports = inArray;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8592:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Execute the provided callback once for each property of object(or element of array) which actually exist.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
var isArray = __webpack_require__(602);
|
|
var forEachArray = __webpack_require__(6092);
|
|
var forEachOwnProperties = __webpack_require__(5573);
|
|
|
|
/**
|
|
* @module collection
|
|
*/
|
|
|
|
/**
|
|
* Execute the provided callback once for each property of object(or element of array) which actually exist.
|
|
* If the object is Array-like object(ex-arguments object), It needs to transform to Array.(see 'ex2' of example).
|
|
* If the callback function returns false, the loop will be stopped.
|
|
* Callback function(iteratee) is invoked with three arguments:
|
|
* 1) The value of the property(or The value of the element)
|
|
* 2) The name of the property(or The index of the element)
|
|
* 3) The object being traversed
|
|
* @param {Object} obj The object that will be traversed
|
|
* @param {function} iteratee Callback function
|
|
* @param {Object} [context] Context(this) of callback function
|
|
* @memberof module:collection
|
|
* @example
|
|
* // ES6
|
|
* import forEach from 'tui-code-snippet/collection/forEach';
|
|
*
|
|
* // CommonJS
|
|
* const forEach = require('tui-code-snippet/collection/forEach');
|
|
*
|
|
* let sum = 0;
|
|
*
|
|
* forEach([1,2,3], function(value){
|
|
* sum += value;
|
|
* });
|
|
* alert(sum); // 6
|
|
*
|
|
* // In case of Array-like object
|
|
* const array = Array.prototype.slice.call(arrayLike); // change to array
|
|
* forEach(array, function(value){
|
|
* sum += value;
|
|
* });
|
|
*/
|
|
function forEach(obj, iteratee, context) {
|
|
if (isArray(obj)) {
|
|
forEachArray(obj, iteratee, context);
|
|
} else {
|
|
forEachOwnProperties(obj, iteratee, context);
|
|
}
|
|
}
|
|
|
|
module.exports = forEach;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6092:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Execute the provided callback once for each element present in the array(or Array-like object) in ascending order.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Execute the provided callback once for each element present
|
|
* in the array(or Array-like object) in ascending order.
|
|
* If the callback function returns false, the loop will be stopped.
|
|
* Callback function(iteratee) is invoked with three arguments:
|
|
* 1) The value of the element
|
|
* 2) The index of the element
|
|
* 3) The array(or Array-like object) being traversed
|
|
* @param {Array|Arguments|NodeList} arr The array(or Array-like object) that will be traversed
|
|
* @param {function} iteratee Callback function
|
|
* @param {Object} [context] Context(this) of callback function
|
|
* @memberof module:collection
|
|
* @example
|
|
* // ES6
|
|
* import forEachArray from 'tui-code-snippet/collection/forEachArray';
|
|
*
|
|
* // CommonJS
|
|
* const forEachArray = require('tui-code-snippet/collection/forEachArray');
|
|
*
|
|
* let sum = 0;
|
|
*
|
|
* forEachArray([1,2,3], function(value){
|
|
* sum += value;
|
|
* });
|
|
* alert(sum); // 6
|
|
*/
|
|
function forEachArray(arr, iteratee, context) {
|
|
var index = 0;
|
|
var len = arr.length;
|
|
|
|
context = context || null;
|
|
|
|
for (; index < len; index += 1) {
|
|
if (iteratee.call(context, arr[index], index, arr) === false) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
module.exports = forEachArray;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5573:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Execute the provided callback once for each property of object which actually exist.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Execute the provided callback once for each property of object which actually exist.
|
|
* If the callback function returns false, the loop will be stopped.
|
|
* Callback function(iteratee) is invoked with three arguments:
|
|
* 1) The value of the property
|
|
* 2) The name of the property
|
|
* 3) The object being traversed
|
|
* @param {Object} obj The object that will be traversed
|
|
* @param {function} iteratee Callback function
|
|
* @param {Object} [context] Context(this) of callback function
|
|
* @memberof module:collection
|
|
* @example
|
|
* // ES6
|
|
* import forEachOwnProperties from 'tui-code-snippet/collection/forEachOwnProperties';
|
|
*
|
|
* // CommonJS
|
|
* const forEachOwnProperties = require('tui-code-snippet/collection/forEachOwnProperties');
|
|
*
|
|
* let sum = 0;
|
|
*
|
|
* forEachOwnProperties({a:1,b:2,c:3}, function(value){
|
|
* sum += value;
|
|
* });
|
|
* alert(sum); // 6
|
|
*/
|
|
function forEachOwnProperties(obj, iteratee, context) {
|
|
var key;
|
|
|
|
context = context || null;
|
|
|
|
for (key in obj) {
|
|
if (obj.hasOwnProperty(key)) {
|
|
if (iteratee.call(context, obj[key], key, obj) === false) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
module.exports = forEachOwnProperties;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9052:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview This module provides some functions for custom events. And it is implemented in the observer design pattern.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
var extend = __webpack_require__(961);
|
|
var isExisty = __webpack_require__(9886);
|
|
var isString = __webpack_require__(2560);
|
|
var isObject = __webpack_require__(5393);
|
|
var isArray = __webpack_require__(602);
|
|
var isFunction = __webpack_require__(5183);
|
|
var forEach = __webpack_require__(8592);
|
|
|
|
var R_EVENTNAME_SPLIT = /\s+/g;
|
|
|
|
/**
|
|
* @class
|
|
* @example
|
|
* // ES6
|
|
* import CustomEvents from 'tui-code-snippet/customEvents/customEvents';
|
|
*
|
|
* // CommonJS
|
|
* const CustomEvents = require('tui-code-snippet/customEvents/customEvents');
|
|
*/
|
|
function CustomEvents() {
|
|
/**
|
|
* @type {HandlerItem[]}
|
|
*/
|
|
this.events = null;
|
|
|
|
/**
|
|
* only for checking specific context event was binded
|
|
* @type {object[]}
|
|
*/
|
|
this.contexts = null;
|
|
}
|
|
|
|
/**
|
|
* Mixin custom events feature to specific constructor
|
|
* @param {function} func - constructor
|
|
* @example
|
|
* //ES6
|
|
* import CustomEvents from 'tui-code-snippet/customEvents/customEvents';
|
|
*
|
|
* // CommonJS
|
|
* const CustomEvents = require('tui-code-snippet/customEvents/customEvents');
|
|
*
|
|
* function Model() {
|
|
* this.name = '';
|
|
* }
|
|
* CustomEvents.mixin(Model);
|
|
*
|
|
* const model = new Model();
|
|
* model.on('change', function() { this.name = 'model'; }, this);
|
|
* model.fire('change');
|
|
* alert(model.name); // 'model';
|
|
*/
|
|
CustomEvents.mixin = function(func) {
|
|
extend(func.prototype, CustomEvents.prototype);
|
|
};
|
|
|
|
/**
|
|
* Get HandlerItem object
|
|
* @param {function} handler - handler function
|
|
* @param {object} [context] - context for handler
|
|
* @returns {HandlerItem} HandlerItem object
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._getHandlerItem = function(handler, context) {
|
|
var item = {handler: handler};
|
|
|
|
if (context) {
|
|
item.context = context;
|
|
}
|
|
|
|
return item;
|
|
};
|
|
|
|
/**
|
|
* Get event object safely
|
|
* @param {string} [eventName] - create sub event map if not exist.
|
|
* @returns {(object|array)} event object. if you supplied `eventName`
|
|
* parameter then make new array and return it
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._safeEvent = function(eventName) {
|
|
var events = this.events;
|
|
var byName;
|
|
|
|
if (!events) {
|
|
events = this.events = {};
|
|
}
|
|
|
|
if (eventName) {
|
|
byName = events[eventName];
|
|
|
|
if (!byName) {
|
|
byName = [];
|
|
events[eventName] = byName;
|
|
}
|
|
|
|
events = byName;
|
|
}
|
|
|
|
return events;
|
|
};
|
|
|
|
/**
|
|
* Get context array safely
|
|
* @returns {array} context array
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._safeContext = function() {
|
|
var context = this.contexts;
|
|
|
|
if (!context) {
|
|
context = this.contexts = [];
|
|
}
|
|
|
|
return context;
|
|
};
|
|
|
|
/**
|
|
* Get index of context
|
|
* @param {object} ctx - context that used for bind custom event
|
|
* @returns {number} index of context
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._indexOfContext = function(ctx) {
|
|
var context = this._safeContext();
|
|
var index = 0;
|
|
|
|
while (context[index]) {
|
|
if (ctx === context[index][0]) {
|
|
return index;
|
|
}
|
|
|
|
index += 1;
|
|
}
|
|
|
|
return -1;
|
|
};
|
|
|
|
/**
|
|
* Memorize supplied context for recognize supplied object is context or
|
|
* name: handler pair object when off()
|
|
* @param {object} ctx - context object to memorize
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._memorizeContext = function(ctx) {
|
|
var context, index;
|
|
|
|
if (!isExisty(ctx)) {
|
|
return;
|
|
}
|
|
|
|
context = this._safeContext();
|
|
index = this._indexOfContext(ctx);
|
|
|
|
if (index > -1) {
|
|
context[index][1] += 1;
|
|
} else {
|
|
context.push([ctx, 1]);
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Forget supplied context object
|
|
* @param {object} ctx - context object to forget
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._forgetContext = function(ctx) {
|
|
var context, contextIndex;
|
|
|
|
if (!isExisty(ctx)) {
|
|
return;
|
|
}
|
|
|
|
context = this._safeContext();
|
|
contextIndex = this._indexOfContext(ctx);
|
|
|
|
if (contextIndex > -1) {
|
|
context[contextIndex][1] -= 1;
|
|
|
|
if (context[contextIndex][1] <= 0) {
|
|
context.splice(contextIndex, 1);
|
|
}
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Bind event handler
|
|
* @param {(string|{name:string, handler:function})} eventName - custom
|
|
* event name or an object {eventName: handler}
|
|
* @param {(function|object)} [handler] - handler function or context
|
|
* @param {object} [context] - context for binding
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._bindEvent = function(eventName, handler, context) {
|
|
var events = this._safeEvent(eventName);
|
|
this._memorizeContext(context);
|
|
events.push(this._getHandlerItem(handler, context));
|
|
};
|
|
|
|
/**
|
|
* Bind event handlers
|
|
* @param {(string|{name:string, handler:function})} eventName - custom
|
|
* event name or an object {eventName: handler}
|
|
* @param {(function|object)} [handler] - handler function or context
|
|
* @param {object} [context] - context for binding
|
|
* //-- #1. Get Module --//
|
|
* // ES6
|
|
* import CustomEvents from 'tui-code-snippet/customEvents/customEvents';
|
|
*
|
|
* // CommonJS
|
|
* const CustomEvents = require('tui-code-snippet/customEvents/customEvents');
|
|
*
|
|
* //-- #2. Use method --//
|
|
* // # 2.1 Basic Usage
|
|
* CustomEvents.on('onload', handler);
|
|
*
|
|
* // # 2.2 With context
|
|
* CustomEvents.on('onload', handler, myObj);
|
|
*
|
|
* // # 2.3 Bind by object that name, handler pairs
|
|
* CustomEvents.on({
|
|
* 'play': handler,
|
|
* 'pause': handler2
|
|
* });
|
|
*
|
|
* // # 2.4 Bind by object that name, handler pairs with context object
|
|
* CustomEvents.on({
|
|
* 'play': handler
|
|
* }, myObj);
|
|
*/
|
|
CustomEvents.prototype.on = function(eventName, handler, context) {
|
|
var self = this;
|
|
|
|
if (isString(eventName)) {
|
|
// [syntax 1, 2]
|
|
eventName = eventName.split(R_EVENTNAME_SPLIT);
|
|
forEach(eventName, function(name) {
|
|
self._bindEvent(name, handler, context);
|
|
});
|
|
} else if (isObject(eventName)) {
|
|
// [syntax 3, 4]
|
|
context = handler;
|
|
forEach(eventName, function(func, name) {
|
|
self.on(name, func, context);
|
|
});
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Bind one-shot event handlers
|
|
* @param {(string|{name:string,handler:function})} eventName - custom
|
|
* event name or an object {eventName: handler}
|
|
* @param {function|object} [handler] - handler function or context
|
|
* @param {object} [context] - context for binding
|
|
*/
|
|
CustomEvents.prototype.once = function(eventName, handler, context) {
|
|
var self = this;
|
|
|
|
if (isObject(eventName)) {
|
|
context = handler;
|
|
forEach(eventName, function(func, name) {
|
|
self.once(name, func, context);
|
|
});
|
|
|
|
return;
|
|
}
|
|
|
|
function onceHandler() { // eslint-disable-line require-jsdoc
|
|
handler.apply(context, arguments);
|
|
self.off(eventName, onceHandler, context);
|
|
}
|
|
|
|
this.on(eventName, onceHandler, context);
|
|
};
|
|
|
|
/**
|
|
* Splice supplied array by callback result
|
|
* @param {array} arr - array to splice
|
|
* @param {function} predicate - function return boolean
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._spliceMatches = function(arr, predicate) {
|
|
var i = 0;
|
|
var len;
|
|
|
|
if (!isArray(arr)) {
|
|
return;
|
|
}
|
|
|
|
for (len = arr.length; i < len; i += 1) {
|
|
if (predicate(arr[i]) === true) {
|
|
arr.splice(i, 1);
|
|
len -= 1;
|
|
i -= 1;
|
|
}
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Get matcher for unbind specific handler events
|
|
* @param {function} handler - handler function
|
|
* @returns {function} handler matcher
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._matchHandler = function(handler) {
|
|
var self = this;
|
|
|
|
return function(item) {
|
|
var needRemove = handler === item.handler;
|
|
|
|
if (needRemove) {
|
|
self._forgetContext(item.context);
|
|
}
|
|
|
|
return needRemove;
|
|
};
|
|
};
|
|
|
|
/**
|
|
* Get matcher for unbind specific context events
|
|
* @param {object} context - context
|
|
* @returns {function} object matcher
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._matchContext = function(context) {
|
|
var self = this;
|
|
|
|
return function(item) {
|
|
var needRemove = context === item.context;
|
|
|
|
if (needRemove) {
|
|
self._forgetContext(item.context);
|
|
}
|
|
|
|
return needRemove;
|
|
};
|
|
};
|
|
|
|
/**
|
|
* Get matcher for unbind specific hander, context pair events
|
|
* @param {function} handler - handler function
|
|
* @param {object} context - context
|
|
* @returns {function} handler, context matcher
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._matchHandlerAndContext = function(handler, context) {
|
|
var self = this;
|
|
|
|
return function(item) {
|
|
var matchHandler = (handler === item.handler);
|
|
var matchContext = (context === item.context);
|
|
var needRemove = (matchHandler && matchContext);
|
|
|
|
if (needRemove) {
|
|
self._forgetContext(item.context);
|
|
}
|
|
|
|
return needRemove;
|
|
};
|
|
};
|
|
|
|
/**
|
|
* Unbind event by event name
|
|
* @param {string} eventName - custom event name to unbind
|
|
* @param {function} [handler] - handler function
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._offByEventName = function(eventName, handler) {
|
|
var self = this;
|
|
var andByHandler = isFunction(handler);
|
|
var matchHandler = self._matchHandler(handler);
|
|
|
|
eventName = eventName.split(R_EVENTNAME_SPLIT);
|
|
|
|
forEach(eventName, function(name) {
|
|
var handlerItems = self._safeEvent(name);
|
|
|
|
if (andByHandler) {
|
|
self._spliceMatches(handlerItems, matchHandler);
|
|
} else {
|
|
forEach(handlerItems, function(item) {
|
|
self._forgetContext(item.context);
|
|
});
|
|
|
|
self.events[name] = [];
|
|
}
|
|
});
|
|
};
|
|
|
|
/**
|
|
* Unbind event by handler function
|
|
* @param {function} handler - handler function
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._offByHandler = function(handler) {
|
|
var self = this;
|
|
var matchHandler = this._matchHandler(handler);
|
|
|
|
forEach(this._safeEvent(), function(handlerItems) {
|
|
self._spliceMatches(handlerItems, matchHandler);
|
|
});
|
|
};
|
|
|
|
/**
|
|
* Unbind event by object(name: handler pair object or context object)
|
|
* @param {object} obj - context or {name: handler} pair object
|
|
* @param {function} handler - handler function
|
|
* @private
|
|
*/
|
|
CustomEvents.prototype._offByObject = function(obj, handler) {
|
|
var self = this;
|
|
var matchFunc;
|
|
|
|
if (this._indexOfContext(obj) < 0) {
|
|
forEach(obj, function(func, name) {
|
|
self.off(name, func);
|
|
});
|
|
} else if (isString(handler)) {
|
|
matchFunc = this._matchContext(obj);
|
|
|
|
self._spliceMatches(this._safeEvent(handler), matchFunc);
|
|
} else if (isFunction(handler)) {
|
|
matchFunc = this._matchHandlerAndContext(handler, obj);
|
|
|
|
forEach(this._safeEvent(), function(handlerItems) {
|
|
self._spliceMatches(handlerItems, matchFunc);
|
|
});
|
|
} else {
|
|
matchFunc = this._matchContext(obj);
|
|
|
|
forEach(this._safeEvent(), function(handlerItems) {
|
|
self._spliceMatches(handlerItems, matchFunc);
|
|
});
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Unbind custom events
|
|
* @param {(string|object|function)} eventName - event name or context or
|
|
* {name: handler} pair object or handler function
|
|
* @param {(function)} handler - handler function
|
|
* @example
|
|
* //-- #1. Get Module --//
|
|
* // ES6
|
|
* import CustomEvents from 'tui-code-snippet/customEvents/customEvents';
|
|
*
|
|
* // CommonJS
|
|
* const CustomEvents = require('tui-code-snippet/customEvents/customEvents');
|
|
*
|
|
* //-- #2. Use method --//
|
|
* // # 2.1 off by event name
|
|
* CustomEvents.off('onload');
|
|
*
|
|
* // # 2.2 off by event name and handler
|
|
* CustomEvents.off('play', handler);
|
|
*
|
|
* // # 2.3 off by handler
|
|
* CustomEvents.off(handler);
|
|
*
|
|
* // # 2.4 off by context
|
|
* CustomEvents.off(myObj);
|
|
*
|
|
* // # 2.5 off by context and handler
|
|
* CustomEvents.off(myObj, handler);
|
|
*
|
|
* // # 2.6 off by context and event name
|
|
* CustomEvents.off(myObj, 'onload');
|
|
*
|
|
* // # 2.7 off by an Object.<string, function> that is {eventName: handler}
|
|
* CustomEvents.off({
|
|
* 'play': handler,
|
|
* 'pause': handler2
|
|
* });
|
|
*
|
|
* // # 2.8 off the all events
|
|
* CustomEvents.off();
|
|
*/
|
|
CustomEvents.prototype.off = function(eventName, handler) {
|
|
if (isString(eventName)) {
|
|
// [syntax 1, 2]
|
|
this._offByEventName(eventName, handler);
|
|
} else if (!arguments.length) {
|
|
// [syntax 8]
|
|
this.events = {};
|
|
this.contexts = [];
|
|
} else if (isFunction(eventName)) {
|
|
// [syntax 3]
|
|
this._offByHandler(eventName);
|
|
} else if (isObject(eventName)) {
|
|
// [syntax 4, 5, 6]
|
|
this._offByObject(eventName, handler);
|
|
}
|
|
};
|
|
|
|
/**
|
|
* Fire custom event
|
|
* @param {string} eventName - name of custom event
|
|
*/
|
|
CustomEvents.prototype.fire = function(eventName) { // eslint-disable-line
|
|
this.invoke.apply(this, arguments);
|
|
};
|
|
|
|
/**
|
|
* Fire a event and returns the result of operation 'boolean AND' with all
|
|
* listener's results.
|
|
*
|
|
* So, It is different from {@link CustomEvents#fire}.
|
|
*
|
|
* In service code, use this as a before event in component level usually
|
|
* for notifying that the event is cancelable.
|
|
* @param {string} eventName - Custom event name
|
|
* @param {...*} data - Data for event
|
|
* @returns {boolean} The result of operation 'boolean AND'
|
|
* @example
|
|
* const map = new Map();
|
|
* map.on({
|
|
* 'beforeZoom': function() {
|
|
* // It should cancel the 'zoom' event by some conditions.
|
|
* if (that.disabled && this.getState()) {
|
|
* return false;
|
|
* }
|
|
* return true;
|
|
* }
|
|
* });
|
|
*
|
|
* if (this.invoke('beforeZoom')) { // check the result of 'beforeZoom'
|
|
* // if true,
|
|
* // doSomething
|
|
* }
|
|
*/
|
|
CustomEvents.prototype.invoke = function(eventName) {
|
|
var events, args, index, item;
|
|
|
|
if (!this.hasListener(eventName)) {
|
|
return true;
|
|
}
|
|
|
|
events = this._safeEvent(eventName);
|
|
args = Array.prototype.slice.call(arguments, 1);
|
|
index = 0;
|
|
|
|
while (events[index]) {
|
|
item = events[index];
|
|
|
|
if (item.handler.apply(item.context, args) === false) {
|
|
return false;
|
|
}
|
|
|
|
index += 1;
|
|
}
|
|
|
|
return true;
|
|
};
|
|
|
|
/**
|
|
* Return whether at least one of the handlers is registered in the given
|
|
* event name.
|
|
* @param {string} eventName - Custom event name
|
|
* @returns {boolean} Is there at least one handler in event name?
|
|
*/
|
|
CustomEvents.prototype.hasListener = function(eventName) {
|
|
return this.getListenerLength(eventName) > 0;
|
|
};
|
|
|
|
/**
|
|
* Return a count of events registered.
|
|
* @param {string} eventName - Custom event name
|
|
* @returns {number} number of event
|
|
*/
|
|
CustomEvents.prototype.getListenerLength = function(eventName) {
|
|
var events = this._safeEvent(eventName);
|
|
|
|
return events.length;
|
|
};
|
|
|
|
module.exports = CustomEvents;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 961:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Extend the target object from other objects.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* @module object
|
|
*/
|
|
|
|
/**
|
|
* Extend the target object from other objects.
|
|
* @param {object} target - Object that will be extended
|
|
* @param {...object} objects - Objects as sources
|
|
* @returns {object} Extended object
|
|
* @memberof module:object
|
|
*/
|
|
function extend(target, objects) { // eslint-disable-line no-unused-vars
|
|
var hasOwnProp = Object.prototype.hasOwnProperty;
|
|
var source, prop, i, len;
|
|
|
|
for (i = 1, len = arguments.length; i < len; i += 1) {
|
|
source = arguments[i];
|
|
for (prop in source) {
|
|
if (hasOwnProp.call(source, prop)) {
|
|
target[prop] = source[prop];
|
|
}
|
|
}
|
|
}
|
|
|
|
return target;
|
|
}
|
|
|
|
module.exports = extend;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1610:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Retrieve a nested item from the given object/array.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
var isUndefined = __webpack_require__(5695);
|
|
var isNull = __webpack_require__(3778);
|
|
|
|
/**
|
|
* Retrieve a nested item from the given object/array.
|
|
* @param {object|Array} obj - Object for retrieving
|
|
* @param {...string|number} paths - Paths of property
|
|
* @returns {*} Value
|
|
* @memberof module:object
|
|
* @example
|
|
* // ES6
|
|
* import pick from 'tui-code-snippet/object/pick';
|
|
*
|
|
* // CommonJS
|
|
* const pick = require('tui-code-snippet/object/pick');
|
|
*
|
|
* cosnt obj = {
|
|
* 'key1': 1,
|
|
* 'nested' : {
|
|
* 'key1': 11,
|
|
* 'nested': {
|
|
* 'key1': 21
|
|
* }
|
|
* }
|
|
* };
|
|
* pick(obj, 'nested', 'nested', 'key1'); // 21
|
|
* pick(obj, 'nested', 'nested', 'key2'); // undefined
|
|
*
|
|
* const arr = ['a', 'b', 'c'];
|
|
* pick(arr, 1); // 'b'
|
|
*/
|
|
function pick(obj, paths) { // eslint-disable-line no-unused-vars
|
|
var args = arguments;
|
|
var target = args[0];
|
|
var i = 1;
|
|
var length = args.length;
|
|
|
|
for (; i < length; i += 1) {
|
|
if (isUndefined(target) ||
|
|
isNull(target)) {
|
|
return;
|
|
}
|
|
|
|
target = target[args[i]];
|
|
}
|
|
|
|
return target; // eslint-disable-line consistent-return
|
|
}
|
|
|
|
module.exports = pick;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4564:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Request image ping.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
var forEachOwnProperties = __webpack_require__(5573);
|
|
|
|
/**
|
|
* @module request
|
|
*/
|
|
|
|
/**
|
|
* Request image ping.
|
|
* @param {String} url url for ping request
|
|
* @param {Object} trackingInfo infos for make query string
|
|
* @returns {HTMLElement}
|
|
* @memberof module:request
|
|
* @example
|
|
* // ES6
|
|
* import imagePing from 'tui-code-snippet/request/imagePing';
|
|
*
|
|
* // CommonJS
|
|
* const imagePing = require('tui-code-snippet/request/imagePing');
|
|
*
|
|
* imagePing('https://www.google-analytics.com/collect', {
|
|
* v: 1,
|
|
* t: 'event',
|
|
* tid: 'trackingid',
|
|
* cid: 'cid',
|
|
* dp: 'dp',
|
|
* dh: 'dh'
|
|
* });
|
|
*/
|
|
function imagePing(url, trackingInfo) {
|
|
var trackingElement = document.createElement('img');
|
|
var queryString = '';
|
|
forEachOwnProperties(trackingInfo, function(value, key) {
|
|
queryString += '&' + key + '=' + value;
|
|
});
|
|
queryString = queryString.substring(1);
|
|
|
|
trackingElement.src = url + '?' + queryString;
|
|
|
|
trackingElement.style.display = 'none';
|
|
document.body.appendChild(trackingElement);
|
|
document.body.removeChild(trackingElement);
|
|
|
|
return trackingElement;
|
|
}
|
|
|
|
module.exports = imagePing;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4729:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Send hostname on DOMContentLoaded.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
var isUndefined = __webpack_require__(5695);
|
|
var imagePing = __webpack_require__(4564);
|
|
|
|
var ms7days = 7 * 24 * 60 * 60 * 1000;
|
|
|
|
/**
|
|
* Check if the date has passed 7 days
|
|
* @param {number} date - milliseconds
|
|
* @returns {boolean}
|
|
* @private
|
|
*/
|
|
function isExpired(date) {
|
|
var now = new Date().getTime();
|
|
|
|
return now - date > ms7days;
|
|
}
|
|
|
|
/**
|
|
* Send hostname on DOMContentLoaded.
|
|
* To prevent hostname set tui.usageStatistics to false.
|
|
* @param {string} appName - application name
|
|
* @param {string} trackingId - GA tracking ID
|
|
* @ignore
|
|
*/
|
|
function sendHostname(appName, trackingId) {
|
|
var url = 'https://www.google-analytics.com/collect';
|
|
var hostname = location.hostname;
|
|
var hitType = 'event';
|
|
var eventCategory = 'use';
|
|
var applicationKeyForStorage = 'TOAST UI ' + appName + ' for ' + hostname + ': Statistics';
|
|
var date = window.localStorage.getItem(applicationKeyForStorage);
|
|
|
|
// skip if the flag is defined and is set to false explicitly
|
|
if (!isUndefined(window.tui) && window.tui.usageStatistics === false) {
|
|
return;
|
|
}
|
|
|
|
// skip if not pass seven days old
|
|
if (date && !isExpired(date)) {
|
|
return;
|
|
}
|
|
|
|
window.localStorage.setItem(applicationKeyForStorage, new Date().getTime());
|
|
|
|
setTimeout(function() {
|
|
if (document.readyState === 'interactive' || document.readyState === 'complete') {
|
|
imagePing(url, {
|
|
v: 1,
|
|
t: hitType,
|
|
tid: trackingId,
|
|
cid: hostname,
|
|
dp: hostname,
|
|
dh: appName,
|
|
el: appName,
|
|
ec: eventCategory
|
|
});
|
|
}
|
|
}, 1000);
|
|
}
|
|
|
|
module.exports = sendHostname;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 602:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Check whether the given variable is an instance of Array or not.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Check whether the given variable is an instance of Array or not.
|
|
* If the given variable is an instance of Array, return true.
|
|
* @param {*} obj - Target for checking
|
|
* @returns {boolean} Is array instance?
|
|
* @memberof module:type
|
|
*/
|
|
function isArray(obj) {
|
|
return obj instanceof Array;
|
|
}
|
|
|
|
module.exports = isArray;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9886:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Check whether the given variable is existing or not.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
var isUndefined = __webpack_require__(5695);
|
|
var isNull = __webpack_require__(3778);
|
|
|
|
/**
|
|
* Check whether the given variable is existing or not.
|
|
* If the given variable is not null and not undefined, returns true.
|
|
* @param {*} param - Target for checking
|
|
* @returns {boolean} Is existy?
|
|
* @memberof module:type
|
|
* @example
|
|
* // ES6
|
|
* import isExisty from 'tui-code-snippet/type/isExisty');
|
|
*
|
|
* // CommonJS
|
|
* const isExisty = require('tui-code-snippet/type/isExisty');
|
|
*
|
|
* isExisty(''); //true
|
|
* isExisty(0); //true
|
|
* isExisty([]); //true
|
|
* isExisty({}); //true
|
|
* isExisty(null); //false
|
|
* isExisty(undefined); //false
|
|
*/
|
|
function isExisty(param) {
|
|
return !isUndefined(param) && !isNull(param);
|
|
}
|
|
|
|
module.exports = isExisty;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5183:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Check whether the given variable is a function or not.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Check whether the given variable is a function or not.
|
|
* If the given variable is a function, return true.
|
|
* @param {*} obj - Target for checking
|
|
* @returns {boolean} Is function?
|
|
* @memberof module:type
|
|
*/
|
|
function isFunction(obj) {
|
|
return obj instanceof Function;
|
|
}
|
|
|
|
module.exports = isFunction;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3778:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Check whether the given variable is null or not.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Check whether the given variable is null or not.
|
|
* If the given variable(arguments[0]) is null, returns true.
|
|
* @param {*} obj - Target for checking
|
|
* @returns {boolean} Is null?
|
|
* @memberof module:type
|
|
*/
|
|
function isNull(obj) {
|
|
return obj === null;
|
|
}
|
|
|
|
module.exports = isNull;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5393:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Check whether the given variable is an object or not.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Check whether the given variable is an object or not.
|
|
* If the given variable is an object, return true.
|
|
* @param {*} obj - Target for checking
|
|
* @returns {boolean} Is object?
|
|
* @memberof module:type
|
|
*/
|
|
function isObject(obj) {
|
|
return obj === Object(obj);
|
|
}
|
|
|
|
module.exports = isObject;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2560:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Check whether the given variable is a string or not.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Check whether the given variable is a string or not.
|
|
* If the given variable is a string, return true.
|
|
* @param {*} obj - Target for checking
|
|
* @returns {boolean} Is string?
|
|
* @memberof module:type
|
|
*/
|
|
function isString(obj) {
|
|
return typeof obj === 'string' || obj instanceof String;
|
|
}
|
|
|
|
module.exports = isString;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5695:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
/**
|
|
* @fileoverview Check whether the given variable is undefined or not.
|
|
* @author NHN FE Development Lab <dl_javascript@nhn.com>
|
|
*/
|
|
|
|
|
|
|
|
/**
|
|
* Check whether the given variable is undefined or not.
|
|
* If the given variable is undefined, returns true.
|
|
* @param {*} obj - Target for checking
|
|
* @returns {boolean} Is undefined?
|
|
* @memberof module:type
|
|
*/
|
|
function isUndefined(obj) {
|
|
return obj === undefined; // eslint-disable-line no-undefined
|
|
}
|
|
|
|
module.exports = isUndefined;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4426:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(4486);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9406:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(4877);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 789:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(7178);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 381:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(5603);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7636:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(1206);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1899:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(6174);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 899:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(57);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8005:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(4741);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6562:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(8368);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9131:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(3739);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4383:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(172);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6065:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(4963);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1734:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(7820);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2461:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(5636);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5214:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(5059);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6397:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(3969);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8189:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(6618);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9146:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(5279);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4496:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(9562);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3972:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(652);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7172:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(2813);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1845:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(8664);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 662:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(1457);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 711:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(2937);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6623:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(9297);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7077:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(8026);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9856:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(2044);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4230:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(2214);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 184:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(9256);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3742:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
module.exports = __webpack_require__(5659);
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1801:
|
|
/***/ (function(module) {
|
|
|
|
var DIVISOR = {
|
|
rect: 1,
|
|
circle: 2,
|
|
triangle: 1
|
|
};
|
|
var DIMENSION_KEYS = {
|
|
rect: {
|
|
w: 'width',
|
|
h: 'height'
|
|
},
|
|
circle: {
|
|
w: 'rx',
|
|
h: 'ry'
|
|
},
|
|
triangle: {
|
|
w: 'width',
|
|
h: 'height'
|
|
}
|
|
};
|
|
/**
|
|
* Set the start point value to the shape object
|
|
* @param {fabric.Object} shape - Shape object
|
|
* @ignore
|
|
*/
|
|
|
|
function setStartPoint(shape) {
|
|
var originX = shape.originX,
|
|
originY = shape.originY;
|
|
var originKey = originX.substring(0, 1) + originY.substring(0, 1);
|
|
shape.startPoint = shape.origins[originKey];
|
|
}
|
|
/**
|
|
* Get the positions of ratated origin by the pointer value
|
|
* @param {{x: number, y: number}} origin - Origin value
|
|
* @param {{x: number, y: number}} pointer - Pointer value
|
|
* @param {number} angle - Rotating angle
|
|
* @returns {Object} Postions of origin
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
function getPositionsOfRotatedOrigin(origin, pointer, angle) {
|
|
var sx = origin.x;
|
|
var sy = origin.y;
|
|
var px = pointer.x;
|
|
var py = pointer.y;
|
|
var r = angle * Math.PI / 180;
|
|
var rx = (px - sx) * Math.cos(r) - (py - sy) * Math.sin(r) + sx;
|
|
var ry = (px - sx) * Math.sin(r) + (py - sy) * Math.cos(r) + sy;
|
|
return {
|
|
originX: sx > rx ? 'right' : 'left',
|
|
originY: sy > ry ? 'bottom' : 'top'
|
|
};
|
|
}
|
|
/**
|
|
* Whether the shape has the center origin or not
|
|
* @param {fabric.Object} shape - Shape object
|
|
* @returns {boolean} State
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
function hasCenterOrigin(shape) {
|
|
return shape.originX === 'center' && shape.originY === 'center';
|
|
}
|
|
/**
|
|
* Adjust the origin of shape by the start point
|
|
* @param {{x: number, y: number}} pointer - Pointer value
|
|
* @param {fabric.Object} shape - Shape object
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
function adjustOriginByStartPoint(pointer, shape) {
|
|
var centerPoint = shape.getPointByOrigin('center', 'center');
|
|
var angle = -shape.angle;
|
|
var originPositions = getPositionsOfRotatedOrigin(centerPoint, pointer, angle);
|
|
var originX = originPositions.originX,
|
|
originY = originPositions.originY;
|
|
var origin = shape.getPointByOrigin(originX, originY);
|
|
var left = shape.left - (centerPoint.x - origin.x);
|
|
var top = shape.top - (centerPoint.y - origin.y);
|
|
shape.set({
|
|
originX: originX,
|
|
originY: originY,
|
|
left: left,
|
|
top: top
|
|
});
|
|
shape.setCoords();
|
|
}
|
|
/**
|
|
* Adjust the origin of shape by the moving pointer value
|
|
* @param {{x: number, y: number}} pointer - Pointer value
|
|
* @param {fabric.Object} shape - Shape object
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
function adjustOriginByMovingPointer(pointer, shape) {
|
|
var origin = shape.startPoint;
|
|
var angle = -shape.angle;
|
|
var originPositions = getPositionsOfRotatedOrigin(origin, pointer, angle);
|
|
var originX = originPositions.originX,
|
|
originY = originPositions.originY;
|
|
shape.setPositionByOrigin(origin, originX, originY);
|
|
shape.setCoords();
|
|
}
|
|
/**
|
|
* Adjust the dimension of shape on firing scaling event
|
|
* @param {fabric.Object} shape - Shape object
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
function adjustDimensionOnScaling(shape) {
|
|
var type = shape.type,
|
|
scaleX = shape.scaleX,
|
|
scaleY = shape.scaleY;
|
|
var dimensionKeys = DIMENSION_KEYS[type];
|
|
var width = shape[dimensionKeys.w] * scaleX;
|
|
var height = shape[dimensionKeys.h] * scaleY;
|
|
|
|
if (shape.isRegular) {
|
|
var maxScale = Math.max(scaleX, scaleY);
|
|
width = shape[dimensionKeys.w] * maxScale;
|
|
height = shape[dimensionKeys.h] * maxScale;
|
|
}
|
|
|
|
var options = {
|
|
hasControls: false,
|
|
hasBorders: false,
|
|
scaleX: 1,
|
|
scaleY: 1
|
|
};
|
|
options[dimensionKeys.w] = width;
|
|
options[dimensionKeys.h] = height;
|
|
shape.set(options);
|
|
}
|
|
/**
|
|
* Adjust the dimension of shape on firing mouse move event
|
|
* @param {{x: number, y: number}} pointer - Pointer value
|
|
* @param {fabric.Object} shape - Shape object
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
function adjustDimensionOnMouseMove(pointer, shape) {
|
|
var type = shape.type,
|
|
strokeWidth = shape.strokeWidth,
|
|
origin = shape.startPoint;
|
|
var divisor = DIVISOR[type];
|
|
var dimensionKeys = DIMENSION_KEYS[type];
|
|
var isTriangle = !!(shape.type === 'triangle');
|
|
var options = {};
|
|
var width = Math.abs(origin.x - pointer.x) / divisor;
|
|
var height = Math.abs(origin.y - pointer.y) / divisor;
|
|
|
|
if (width > strokeWidth) {
|
|
width -= strokeWidth / divisor;
|
|
}
|
|
|
|
if (height > strokeWidth) {
|
|
height -= strokeWidth / divisor;
|
|
}
|
|
|
|
if (shape.isRegular) {
|
|
width = height = Math.max(width, height);
|
|
|
|
if (isTriangle) {
|
|
height = Math.sqrt(3) / 2 * width;
|
|
}
|
|
}
|
|
|
|
options[dimensionKeys.w] = width;
|
|
options[dimensionKeys.h] = height;
|
|
shape.set(options);
|
|
}
|
|
|
|
module.exports = {
|
|
/**
|
|
* Set each origin value to shape
|
|
* @param {fabric.Object} shape - Shape object
|
|
*/
|
|
setOrigins: function setOrigins(shape) {
|
|
var leftTopPoint = shape.getPointByOrigin('left', 'top');
|
|
var rightTopPoint = shape.getPointByOrigin('right', 'top');
|
|
var rightBottomPoint = shape.getPointByOrigin('right', 'bottom');
|
|
var leftBottomPoint = shape.getPointByOrigin('left', 'bottom');
|
|
shape.origins = {
|
|
lt: leftTopPoint,
|
|
rt: rightTopPoint,
|
|
rb: rightBottomPoint,
|
|
lb: leftBottomPoint
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Resize the shape
|
|
* @param {fabric.Object} shape - Shape object
|
|
* @param {{x: number, y: number}} pointer - Mouse pointer values on canvas
|
|
* @param {boolean} isScaling - Whether the resizing action is scaling or not
|
|
*/
|
|
resize: function resize(shape, pointer, isScaling) {
|
|
if (hasCenterOrigin(shape)) {
|
|
adjustOriginByStartPoint(pointer, shape);
|
|
setStartPoint(shape);
|
|
}
|
|
|
|
if (isScaling) {
|
|
adjustDimensionOnScaling(shape, pointer);
|
|
} else {
|
|
adjustDimensionOnMouseMove(pointer, shape);
|
|
}
|
|
|
|
adjustOriginByMovingPointer(pointer, shape);
|
|
},
|
|
|
|
/**
|
|
* Adjust the origin position of shape to center
|
|
* @param {fabric.Object} shape - Shape object
|
|
*/
|
|
adjustOriginToCenter: function adjustOriginToCenter(shape) {
|
|
var centerPoint = shape.getPointByOrigin('center', 'center');
|
|
var originX = shape.originX,
|
|
originY = shape.originY;
|
|
var origin = shape.getPointByOrigin(originX, originY);
|
|
var left = shape.left + (centerPoint.x - origin.x);
|
|
var top = shape.top + (centerPoint.y - origin.y);
|
|
shape.set({
|
|
hasControls: true,
|
|
hasBorders: true,
|
|
originX: 'center',
|
|
originY: 'center',
|
|
left: left,
|
|
top: top
|
|
});
|
|
shape.setCoords(); // For left, top properties
|
|
}
|
|
};
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2221:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(5454);
|
|
__webpack_require__(9173);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Array.from;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5078:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(8118);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Array.isArray;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6135:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(9106);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').concat;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9510:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(1710);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').fill;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3971:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(3436);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').filter;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 98:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(9823);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').forEach;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2089:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(2276);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').indexOf;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6209:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(3838);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').map;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2671:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(5818);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').slice;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1375:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(2178);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Array').splice;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3528:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(665);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('Function').bind;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5739:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(8939);
|
|
__webpack_require__(5454);
|
|
var getIteratorMethod = __webpack_require__(8703);
|
|
|
|
module.exports = getIteratorMethod;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 278:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var bind = __webpack_require__(3528);
|
|
|
|
var FunctionPrototype = Function.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.bind;
|
|
return it === FunctionPrototype || (it instanceof Function && own === FunctionPrototype.bind) ? bind : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1484:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var concat = __webpack_require__(6135);
|
|
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.concat;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.concat) ? concat : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7731:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fill = __webpack_require__(9510);
|
|
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.fill;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.fill) ? fill : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3669:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var filter = __webpack_require__(3971);
|
|
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.filter;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.filter) ? filter : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2604:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var indexOf = __webpack_require__(2089);
|
|
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.indexOf;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.indexOf) ? indexOf : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 263:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var map = __webpack_require__(6209);
|
|
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.map;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.map) ? map : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7663:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var slice = __webpack_require__(2671);
|
|
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.slice;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.slice) ? slice : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5063:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var splice = __webpack_require__(1375);
|
|
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.splice;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.splice) ? splice : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6813:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var trim = __webpack_require__(3842);
|
|
|
|
var StringPrototype = String.prototype;
|
|
|
|
module.exports = function (it) {
|
|
var own = it.trim;
|
|
return typeof it === 'string' || it === StringPrototype
|
|
|| (it instanceof String && own === StringPrototype.trim) ? trim : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6285:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(2666);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Number.parseInt;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3213:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(3113);
|
|
var path = __webpack_require__(7545);
|
|
|
|
var Object = path.Object;
|
|
|
|
module.exports = function create(P, D) {
|
|
return Object.create(P, D);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3512:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(297);
|
|
var path = __webpack_require__(7545);
|
|
|
|
var Object = path.Object;
|
|
|
|
var defineProperty = module.exports = function defineProperty(it, key, desc) {
|
|
return Object.defineProperty(it, key, desc);
|
|
};
|
|
|
|
if (Object.defineProperty.sham) defineProperty.sham = true;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8168:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(9234);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Object.getPrototypeOf;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8651:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(2647);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Object.keys;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3083:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(3222);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Object.setPrototypeOf;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2987:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(4859);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.parseFloat;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2239:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(5706);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.parseInt;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3154:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(4242);
|
|
__webpack_require__(8939);
|
|
__webpack_require__(6663);
|
|
__webpack_require__(9021);
|
|
__webpack_require__(7884);
|
|
__webpack_require__(8885);
|
|
__webpack_require__(1868);
|
|
__webpack_require__(5454);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Promise;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6577:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(5397);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Reflect.construct;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3842:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(957);
|
|
var entryVirtual = __webpack_require__(5607);
|
|
|
|
module.exports = entryVirtual('String').trim;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5008:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(9106);
|
|
__webpack_require__(6663);
|
|
__webpack_require__(6187);
|
|
__webpack_require__(9781);
|
|
__webpack_require__(492);
|
|
__webpack_require__(6681);
|
|
__webpack_require__(9594);
|
|
__webpack_require__(3665);
|
|
__webpack_require__(9017);
|
|
__webpack_require__(1250);
|
|
__webpack_require__(9786);
|
|
__webpack_require__(503);
|
|
__webpack_require__(6565);
|
|
__webpack_require__(9322);
|
|
__webpack_require__(3610);
|
|
__webpack_require__(6886);
|
|
__webpack_require__(3514);
|
|
__webpack_require__(8671);
|
|
__webpack_require__(8556);
|
|
__webpack_require__(1367);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.Symbol;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 994:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(8939);
|
|
__webpack_require__(6663);
|
|
__webpack_require__(5454);
|
|
__webpack_require__(3665);
|
|
var WrappedWellKnownSymbolModule = __webpack_require__(9207);
|
|
|
|
module.exports = WrappedWellKnownSymbolModule.f('iterator');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2813:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(3822);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8664:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(1434);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1457:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(7710);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2937:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(4741);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9297:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(4963);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8026:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(7820);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2044:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(8980);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2214:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(6672);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9256:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(2285);
|
|
__webpack_require__(177);
|
|
__webpack_require__(9031);
|
|
__webpack_require__(6658);
|
|
__webpack_require__(1875);
|
|
__webpack_require__(8658);
|
|
// TODO: Remove from `core-js@4`
|
|
__webpack_require__(4592);
|
|
// TODO: Remove from `core-js@4`
|
|
__webpack_require__(6680);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5659:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(8535);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6235:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isCallable = __webpack_require__(6447);
|
|
var tryToString = __webpack_require__(9288);
|
|
|
|
// `Assert: IsCallable(argument) is true`
|
|
module.exports = function (argument) {
|
|
if (isCallable(argument)) return argument;
|
|
throw TypeError(tryToString(argument) + ' is not a function');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1404:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isConstructor = __webpack_require__(2091);
|
|
var tryToString = __webpack_require__(9288);
|
|
|
|
// `Assert: IsConstructor(argument) is true`
|
|
module.exports = function (argument) {
|
|
if (isConstructor(argument)) return argument;
|
|
throw TypeError(tryToString(argument) + ' is not a constructor');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7757:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isCallable = __webpack_require__(6447);
|
|
|
|
module.exports = function (argument) {
|
|
if (typeof argument === 'object' || isCallable(argument)) return argument;
|
|
throw TypeError("Can't set " + String(argument) + ' as a prototype');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7423:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = function () { /* empty */ };
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6961:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = function (it, Constructor, name) {
|
|
if (it instanceof Constructor) return it;
|
|
throw TypeError('Incorrect ' + (name ? name + ' ' : '') + 'invocation');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1138:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isObject = __webpack_require__(5744);
|
|
|
|
// `Assert: Type(argument) is Object`
|
|
module.exports = function (argument) {
|
|
if (isObject(argument)) return argument;
|
|
throw TypeError(String(argument) + ' is not an object');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2724:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var toObject = __webpack_require__(1795);
|
|
var toAbsoluteIndex = __webpack_require__(7739);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
|
|
// `Array.prototype.fill` method implementation
|
|
// https://tc39.es/ecma262/#sec-array.prototype.fill
|
|
module.exports = function fill(value /* , start = 0, end = @length */) {
|
|
var O = toObject(this);
|
|
var length = lengthOfArrayLike(O);
|
|
var argumentsLength = arguments.length;
|
|
var index = toAbsoluteIndex(argumentsLength > 1 ? arguments[1] : undefined, length);
|
|
var end = argumentsLength > 2 ? arguments[2] : undefined;
|
|
var endPos = end === undefined ? length : toAbsoluteIndex(end, length);
|
|
while (endPos > index) O[index++] = value;
|
|
return O;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7397:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $forEach = __webpack_require__(454).forEach;
|
|
var arrayMethodIsStrict = __webpack_require__(424);
|
|
|
|
var STRICT_METHOD = arrayMethodIsStrict('forEach');
|
|
|
|
// `Array.prototype.forEach` method implementation
|
|
// https://tc39.es/ecma262/#sec-array.prototype.foreach
|
|
module.exports = !STRICT_METHOD ? function forEach(callbackfn /* , thisArg */) {
|
|
return $forEach(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined);
|
|
// eslint-disable-next-line es/no-array-prototype-foreach -- safe
|
|
} : [].forEach;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 841:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var bind = __webpack_require__(8043);
|
|
var toObject = __webpack_require__(1795);
|
|
var callWithSafeIterationClosing = __webpack_require__(1635);
|
|
var isArrayIteratorMethod = __webpack_require__(6109);
|
|
var isConstructor = __webpack_require__(2091);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
var createProperty = __webpack_require__(9361);
|
|
var getIterator = __webpack_require__(1669);
|
|
var getIteratorMethod = __webpack_require__(8703);
|
|
|
|
// `Array.from` method implementation
|
|
// https://tc39.es/ecma262/#sec-array.from
|
|
module.exports = function from(arrayLike /* , mapfn = undefined, thisArg = undefined */) {
|
|
var O = toObject(arrayLike);
|
|
var IS_CONSTRUCTOR = isConstructor(this);
|
|
var argumentsLength = arguments.length;
|
|
var mapfn = argumentsLength > 1 ? arguments[1] : undefined;
|
|
var mapping = mapfn !== undefined;
|
|
if (mapping) mapfn = bind(mapfn, argumentsLength > 2 ? arguments[2] : undefined, 2);
|
|
var iteratorMethod = getIteratorMethod(O);
|
|
var index = 0;
|
|
var length, result, step, iterator, next, value;
|
|
// if the target is not iterable or it's an array with the default iterator - use a simple case
|
|
if (iteratorMethod && !(this == Array && isArrayIteratorMethod(iteratorMethod))) {
|
|
iterator = getIterator(O, iteratorMethod);
|
|
next = iterator.next;
|
|
result = IS_CONSTRUCTOR ? new this() : [];
|
|
for (;!(step = next.call(iterator)).done; index++) {
|
|
value = mapping ? callWithSafeIterationClosing(iterator, mapfn, [step.value, index], true) : step.value;
|
|
createProperty(result, index, value);
|
|
}
|
|
} else {
|
|
length = lengthOfArrayLike(O);
|
|
result = IS_CONSTRUCTOR ? new this(length) : Array(length);
|
|
for (;length > index; index++) {
|
|
value = mapping ? mapfn(O[index], index) : O[index];
|
|
createProperty(result, index, value);
|
|
}
|
|
}
|
|
result.length = index;
|
|
return result;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8180:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var toIndexedObject = __webpack_require__(101);
|
|
var toAbsoluteIndex = __webpack_require__(7739);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
|
|
// `Array.prototype.{ indexOf, includes }` methods implementation
|
|
var createMethod = function (IS_INCLUDES) {
|
|
return function ($this, el, fromIndex) {
|
|
var O = toIndexedObject($this);
|
|
var length = lengthOfArrayLike(O);
|
|
var index = toAbsoluteIndex(fromIndex, length);
|
|
var value;
|
|
// Array#includes uses SameValueZero equality algorithm
|
|
// eslint-disable-next-line no-self-compare -- NaN check
|
|
if (IS_INCLUDES && el != el) while (length > index) {
|
|
value = O[index++];
|
|
// eslint-disable-next-line no-self-compare -- NaN check
|
|
if (value != value) return true;
|
|
// Array#indexOf ignores holes, Array#includes - not
|
|
} else for (;length > index; index++) {
|
|
if ((IS_INCLUDES || index in O) && O[index] === el) return IS_INCLUDES || index || 0;
|
|
} return !IS_INCLUDES && -1;
|
|
};
|
|
};
|
|
|
|
module.exports = {
|
|
// `Array.prototype.includes` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.includes
|
|
includes: createMethod(true),
|
|
// `Array.prototype.indexOf` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.indexof
|
|
indexOf: createMethod(false)
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 454:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var bind = __webpack_require__(8043);
|
|
var IndexedObject = __webpack_require__(2202);
|
|
var toObject = __webpack_require__(1795);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
var arraySpeciesCreate = __webpack_require__(1321);
|
|
|
|
var push = [].push;
|
|
|
|
// `Array.prototype.{ forEach, map, filter, some, every, find, findIndex, filterReject }` methods implementation
|
|
var createMethod = function (TYPE) {
|
|
var IS_MAP = TYPE == 1;
|
|
var IS_FILTER = TYPE == 2;
|
|
var IS_SOME = TYPE == 3;
|
|
var IS_EVERY = TYPE == 4;
|
|
var IS_FIND_INDEX = TYPE == 6;
|
|
var IS_FILTER_REJECT = TYPE == 7;
|
|
var NO_HOLES = TYPE == 5 || IS_FIND_INDEX;
|
|
return function ($this, callbackfn, that, specificCreate) {
|
|
var O = toObject($this);
|
|
var self = IndexedObject(O);
|
|
var boundFunction = bind(callbackfn, that, 3);
|
|
var length = lengthOfArrayLike(self);
|
|
var index = 0;
|
|
var create = specificCreate || arraySpeciesCreate;
|
|
var target = IS_MAP ? create($this, length) : IS_FILTER || IS_FILTER_REJECT ? create($this, 0) : undefined;
|
|
var value, result;
|
|
for (;length > index; index++) if (NO_HOLES || index in self) {
|
|
value = self[index];
|
|
result = boundFunction(value, index, O);
|
|
if (TYPE) {
|
|
if (IS_MAP) target[index] = result; // map
|
|
else if (result) switch (TYPE) {
|
|
case 3: return true; // some
|
|
case 5: return value; // find
|
|
case 6: return index; // findIndex
|
|
case 2: push.call(target, value); // filter
|
|
} else switch (TYPE) {
|
|
case 4: return false; // every
|
|
case 7: push.call(target, value); // filterReject
|
|
}
|
|
}
|
|
}
|
|
return IS_FIND_INDEX ? -1 : IS_SOME || IS_EVERY ? IS_EVERY : target;
|
|
};
|
|
};
|
|
|
|
module.exports = {
|
|
// `Array.prototype.forEach` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.foreach
|
|
forEach: createMethod(0),
|
|
// `Array.prototype.map` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.map
|
|
map: createMethod(1),
|
|
// `Array.prototype.filter` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.filter
|
|
filter: createMethod(2),
|
|
// `Array.prototype.some` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.some
|
|
some: createMethod(3),
|
|
// `Array.prototype.every` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.every
|
|
every: createMethod(4),
|
|
// `Array.prototype.find` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.find
|
|
find: createMethod(5),
|
|
// `Array.prototype.findIndex` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.findIndex
|
|
findIndex: createMethod(6),
|
|
// `Array.prototype.filterReject` method
|
|
// https://github.com/tc39/proposal-array-filtering
|
|
filterReject: createMethod(7)
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 242:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fails = __webpack_require__(6192);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var V8_VERSION = __webpack_require__(4218);
|
|
|
|
var SPECIES = wellKnownSymbol('species');
|
|
|
|
module.exports = function (METHOD_NAME) {
|
|
// We can't use this feature detection in V8 since it causes
|
|
// deoptimization and serious performance degradation
|
|
// https://github.com/zloirock/core-js/issues/677
|
|
return V8_VERSION >= 51 || !fails(function () {
|
|
var array = [];
|
|
var constructor = array.constructor = {};
|
|
constructor[SPECIES] = function () {
|
|
return { foo: 1 };
|
|
};
|
|
return array[METHOD_NAME](Boolean).foo !== 1;
|
|
});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 424:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var fails = __webpack_require__(6192);
|
|
|
|
module.exports = function (METHOD_NAME, argument) {
|
|
var method = [][METHOD_NAME];
|
|
return !!method && fails(function () {
|
|
// eslint-disable-next-line no-useless-call,no-throw-literal -- required for testing
|
|
method.call(null, argument || function () { throw 1; }, 1);
|
|
});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3712:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isArray = __webpack_require__(4770);
|
|
var isConstructor = __webpack_require__(2091);
|
|
var isObject = __webpack_require__(5744);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var SPECIES = wellKnownSymbol('species');
|
|
|
|
// a part of `ArraySpeciesCreate` abstract operation
|
|
// https://tc39.es/ecma262/#sec-arrayspeciescreate
|
|
module.exports = function (originalArray) {
|
|
var C;
|
|
if (isArray(originalArray)) {
|
|
C = originalArray.constructor;
|
|
// cross-realm fallback
|
|
if (isConstructor(C) && (C === Array || isArray(C.prototype))) C = undefined;
|
|
else if (isObject(C)) {
|
|
C = C[SPECIES];
|
|
if (C === null) C = undefined;
|
|
}
|
|
} return C === undefined ? Array : C;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1321:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var arraySpeciesConstructor = __webpack_require__(3712);
|
|
|
|
// `ArraySpeciesCreate` abstract operation
|
|
// https://tc39.es/ecma262/#sec-arrayspeciescreate
|
|
module.exports = function (originalArray, length) {
|
|
return new (arraySpeciesConstructor(originalArray))(length === 0 ? 0 : length);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1635:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var anObject = __webpack_require__(1138);
|
|
var iteratorClose = __webpack_require__(6639);
|
|
|
|
// call something on iterator step with safe closing on error
|
|
module.exports = function (iterator, fn, value, ENTRIES) {
|
|
try {
|
|
return ENTRIES ? fn(anObject(value)[0], value[1]) : fn(value);
|
|
} catch (error) {
|
|
iteratorClose(iterator, 'throw', error);
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9770:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var ITERATOR = wellKnownSymbol('iterator');
|
|
var SAFE_CLOSING = false;
|
|
|
|
try {
|
|
var called = 0;
|
|
var iteratorWithReturn = {
|
|
next: function () {
|
|
return { done: !!called++ };
|
|
},
|
|
'return': function () {
|
|
SAFE_CLOSING = true;
|
|
}
|
|
};
|
|
iteratorWithReturn[ITERATOR] = function () {
|
|
return this;
|
|
};
|
|
// eslint-disable-next-line es/no-array-from, no-throw-literal -- required for testing
|
|
Array.from(iteratorWithReturn, function () { throw 2; });
|
|
} catch (error) { /* empty */ }
|
|
|
|
module.exports = function (exec, SKIP_CLOSING) {
|
|
if (!SKIP_CLOSING && !SAFE_CLOSING) return false;
|
|
var ITERATION_SUPPORT = false;
|
|
try {
|
|
var object = {};
|
|
object[ITERATOR] = function () {
|
|
return {
|
|
next: function () {
|
|
return { done: ITERATION_SUPPORT = true };
|
|
}
|
|
};
|
|
};
|
|
exec(object);
|
|
} catch (error) { /* empty */ }
|
|
return ITERATION_SUPPORT;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9272:
|
|
/***/ (function(module) {
|
|
|
|
var toString = {}.toString;
|
|
|
|
module.exports = function (it) {
|
|
return toString.call(it).slice(8, -1);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4696:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var TO_STRING_TAG_SUPPORT = __webpack_require__(3471);
|
|
var isCallable = __webpack_require__(6447);
|
|
var classofRaw = __webpack_require__(9272);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var TO_STRING_TAG = wellKnownSymbol('toStringTag');
|
|
// ES3 wrong here
|
|
var CORRECT_ARGUMENTS = classofRaw(function () { return arguments; }()) == 'Arguments';
|
|
|
|
// fallback for IE11 Script Access Denied error
|
|
var tryGet = function (it, key) {
|
|
try {
|
|
return it[key];
|
|
} catch (error) { /* empty */ }
|
|
};
|
|
|
|
// getting tag from ES6+ `Object.prototype.toString`
|
|
module.exports = TO_STRING_TAG_SUPPORT ? classofRaw : function (it) {
|
|
var O, tag, result;
|
|
return it === undefined ? 'Undefined' : it === null ? 'Null'
|
|
// @@toStringTag case
|
|
: typeof (tag = tryGet(O = Object(it), TO_STRING_TAG)) == 'string' ? tag
|
|
// builtinTag case
|
|
: CORRECT_ARGUMENTS ? classofRaw(O)
|
|
// ES3 arguments fallback
|
|
: (result = classofRaw(O)) == 'Object' && isCallable(O.callee) ? 'Arguments' : result;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4635:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fails = __webpack_require__(6192);
|
|
|
|
module.exports = !fails(function () {
|
|
function F() { /* empty */ }
|
|
F.prototype.constructor = null;
|
|
// eslint-disable-next-line es/no-object-getprototypeof -- required for testing
|
|
return Object.getPrototypeOf(new F()) !== F.prototype;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5148:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var IteratorPrototype = __webpack_require__(4413).IteratorPrototype;
|
|
var create = __webpack_require__(2853);
|
|
var createPropertyDescriptor = __webpack_require__(774);
|
|
var setToStringTag = __webpack_require__(1284);
|
|
var Iterators = __webpack_require__(7771);
|
|
|
|
var returnThis = function () { return this; };
|
|
|
|
module.exports = function (IteratorConstructor, NAME, next) {
|
|
var TO_STRING_TAG = NAME + ' Iterator';
|
|
IteratorConstructor.prototype = create(IteratorPrototype, { next: createPropertyDescriptor(1, next) });
|
|
setToStringTag(IteratorConstructor, TO_STRING_TAG, false, true);
|
|
Iterators[TO_STRING_TAG] = returnThis;
|
|
return IteratorConstructor;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8711:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var definePropertyModule = __webpack_require__(2760);
|
|
var createPropertyDescriptor = __webpack_require__(774);
|
|
|
|
module.exports = DESCRIPTORS ? function (object, key, value) {
|
|
return definePropertyModule.f(object, key, createPropertyDescriptor(1, value));
|
|
} : function (object, key, value) {
|
|
object[key] = value;
|
|
return object;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 774:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = function (bitmap, value) {
|
|
return {
|
|
enumerable: !(bitmap & 1),
|
|
configurable: !(bitmap & 2),
|
|
writable: !(bitmap & 4),
|
|
value: value
|
|
};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9361:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var toPropertyKey = __webpack_require__(77);
|
|
var definePropertyModule = __webpack_require__(2760);
|
|
var createPropertyDescriptor = __webpack_require__(774);
|
|
|
|
module.exports = function (object, key, value) {
|
|
var propertyKey = toPropertyKey(key);
|
|
if (propertyKey in object) definePropertyModule.f(object, propertyKey, createPropertyDescriptor(0, value));
|
|
else object[propertyKey] = value;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7218:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var IS_PURE = __webpack_require__(5546);
|
|
var FunctionName = __webpack_require__(2282);
|
|
var isCallable = __webpack_require__(6447);
|
|
var createIteratorConstructor = __webpack_require__(5148);
|
|
var getPrototypeOf = __webpack_require__(9341);
|
|
var setPrototypeOf = __webpack_require__(4469);
|
|
var setToStringTag = __webpack_require__(1284);
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
var redefine = __webpack_require__(9482);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var Iterators = __webpack_require__(7771);
|
|
var IteratorsCore = __webpack_require__(4413);
|
|
|
|
var PROPER_FUNCTION_NAME = FunctionName.PROPER;
|
|
var CONFIGURABLE_FUNCTION_NAME = FunctionName.CONFIGURABLE;
|
|
var IteratorPrototype = IteratorsCore.IteratorPrototype;
|
|
var BUGGY_SAFARI_ITERATORS = IteratorsCore.BUGGY_SAFARI_ITERATORS;
|
|
var ITERATOR = wellKnownSymbol('iterator');
|
|
var KEYS = 'keys';
|
|
var VALUES = 'values';
|
|
var ENTRIES = 'entries';
|
|
|
|
var returnThis = function () { return this; };
|
|
|
|
module.exports = function (Iterable, NAME, IteratorConstructor, next, DEFAULT, IS_SET, FORCED) {
|
|
createIteratorConstructor(IteratorConstructor, NAME, next);
|
|
|
|
var getIterationMethod = function (KIND) {
|
|
if (KIND === DEFAULT && defaultIterator) return defaultIterator;
|
|
if (!BUGGY_SAFARI_ITERATORS && KIND in IterablePrototype) return IterablePrototype[KIND];
|
|
switch (KIND) {
|
|
case KEYS: return function keys() { return new IteratorConstructor(this, KIND); };
|
|
case VALUES: return function values() { return new IteratorConstructor(this, KIND); };
|
|
case ENTRIES: return function entries() { return new IteratorConstructor(this, KIND); };
|
|
} return function () { return new IteratorConstructor(this); };
|
|
};
|
|
|
|
var TO_STRING_TAG = NAME + ' Iterator';
|
|
var INCORRECT_VALUES_NAME = false;
|
|
var IterablePrototype = Iterable.prototype;
|
|
var nativeIterator = IterablePrototype[ITERATOR]
|
|
|| IterablePrototype['@@iterator']
|
|
|| DEFAULT && IterablePrototype[DEFAULT];
|
|
var defaultIterator = !BUGGY_SAFARI_ITERATORS && nativeIterator || getIterationMethod(DEFAULT);
|
|
var anyNativeIterator = NAME == 'Array' ? IterablePrototype.entries || nativeIterator : nativeIterator;
|
|
var CurrentIteratorPrototype, methods, KEY;
|
|
|
|
// fix native
|
|
if (anyNativeIterator) {
|
|
CurrentIteratorPrototype = getPrototypeOf(anyNativeIterator.call(new Iterable()));
|
|
if (CurrentIteratorPrototype !== Object.prototype && CurrentIteratorPrototype.next) {
|
|
if (!IS_PURE && getPrototypeOf(CurrentIteratorPrototype) !== IteratorPrototype) {
|
|
if (setPrototypeOf) {
|
|
setPrototypeOf(CurrentIteratorPrototype, IteratorPrototype);
|
|
} else if (!isCallable(CurrentIteratorPrototype[ITERATOR])) {
|
|
redefine(CurrentIteratorPrototype, ITERATOR, returnThis);
|
|
}
|
|
}
|
|
// Set @@toStringTag to native iterators
|
|
setToStringTag(CurrentIteratorPrototype, TO_STRING_TAG, true, true);
|
|
if (IS_PURE) Iterators[TO_STRING_TAG] = returnThis;
|
|
}
|
|
}
|
|
|
|
// fix Array.prototype.{ values, @@iterator }.name in V8 / FF
|
|
if (PROPER_FUNCTION_NAME && DEFAULT == VALUES && nativeIterator && nativeIterator.name !== VALUES) {
|
|
if (!IS_PURE && CONFIGURABLE_FUNCTION_NAME) {
|
|
createNonEnumerableProperty(IterablePrototype, 'name', VALUES);
|
|
} else {
|
|
INCORRECT_VALUES_NAME = true;
|
|
defaultIterator = function values() { return nativeIterator.call(this); };
|
|
}
|
|
}
|
|
|
|
// export additional methods
|
|
if (DEFAULT) {
|
|
methods = {
|
|
values: getIterationMethod(VALUES),
|
|
keys: IS_SET ? defaultIterator : getIterationMethod(KEYS),
|
|
entries: getIterationMethod(ENTRIES)
|
|
};
|
|
if (FORCED) for (KEY in methods) {
|
|
if (BUGGY_SAFARI_ITERATORS || INCORRECT_VALUES_NAME || !(KEY in IterablePrototype)) {
|
|
redefine(IterablePrototype, KEY, methods[KEY]);
|
|
}
|
|
} else $({ target: NAME, proto: true, forced: BUGGY_SAFARI_ITERATORS || INCORRECT_VALUES_NAME }, methods);
|
|
}
|
|
|
|
// define iterator
|
|
if ((!IS_PURE || FORCED) && IterablePrototype[ITERATOR] !== defaultIterator) {
|
|
redefine(IterablePrototype, ITERATOR, defaultIterator, { name: DEFAULT });
|
|
}
|
|
Iterators[NAME] = defaultIterator;
|
|
|
|
return methods;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1488:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var path = __webpack_require__(7545);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var wrappedWellKnownSymbolModule = __webpack_require__(9207);
|
|
var defineProperty = __webpack_require__(2760).f;
|
|
|
|
module.exports = function (NAME) {
|
|
var Symbol = path.Symbol || (path.Symbol = {});
|
|
if (!hasOwn(Symbol, NAME)) defineProperty(Symbol, NAME, {
|
|
value: wrappedWellKnownSymbolModule.f(NAME)
|
|
});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 69:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fails = __webpack_require__(6192);
|
|
|
|
// Detect IE8's incomplete defineProperty implementation
|
|
module.exports = !fails(function () {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- required for testing
|
|
return Object.defineProperty({}, 1, { get: function () { return 7; } })[1] != 7;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7449:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var isObject = __webpack_require__(5744);
|
|
|
|
var document = global.document;
|
|
// typeof document.createElement is 'object' in old IE
|
|
var EXISTS = isObject(document) && isObject(document.createElement);
|
|
|
|
module.exports = function (it) {
|
|
return EXISTS ? document.createElement(it) : {};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7365:
|
|
/***/ (function(module) {
|
|
|
|
// iterable DOM collections
|
|
// flag - `iterable` interface - 'entries', 'keys', 'values', 'forEach' methods
|
|
module.exports = {
|
|
CSSRuleList: 0,
|
|
CSSStyleDeclaration: 0,
|
|
CSSValueList: 0,
|
|
ClientRectList: 0,
|
|
DOMRectList: 0,
|
|
DOMStringList: 0,
|
|
DOMTokenList: 1,
|
|
DataTransferItemList: 0,
|
|
FileList: 0,
|
|
HTMLAllCollection: 0,
|
|
HTMLCollection: 0,
|
|
HTMLFormElement: 0,
|
|
HTMLSelectElement: 0,
|
|
MediaList: 0,
|
|
MimeTypeArray: 0,
|
|
NamedNodeMap: 0,
|
|
NodeList: 1,
|
|
PaintRequestList: 0,
|
|
Plugin: 0,
|
|
PluginArray: 0,
|
|
SVGLengthList: 0,
|
|
SVGNumberList: 0,
|
|
SVGPathSegList: 0,
|
|
SVGPointList: 0,
|
|
SVGStringList: 0,
|
|
SVGTransformList: 0,
|
|
SourceBufferList: 0,
|
|
StyleSheetList: 0,
|
|
TextTrackCueList: 0,
|
|
TextTrackList: 0,
|
|
TouchList: 0
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2957:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = typeof window == 'object';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9347:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var userAgent = __webpack_require__(8989);
|
|
var global = __webpack_require__(8576);
|
|
|
|
module.exports = /ipad|iphone|ipod/i.test(userAgent) && global.Pebble !== undefined;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9536:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var userAgent = __webpack_require__(8989);
|
|
|
|
module.exports = /(?:ipad|iphone|ipod).*applewebkit/i.test(userAgent);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 224:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var classof = __webpack_require__(9272);
|
|
var global = __webpack_require__(8576);
|
|
|
|
module.exports = classof(global.process) == 'process';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5914:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var userAgent = __webpack_require__(8989);
|
|
|
|
module.exports = /web0s(?!.*chrome)/i.test(userAgent);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8989:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var getBuiltIn = __webpack_require__(150);
|
|
|
|
module.exports = getBuiltIn('navigator', 'userAgent') || '';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4218:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var userAgent = __webpack_require__(8989);
|
|
|
|
var process = global.process;
|
|
var Deno = global.Deno;
|
|
var versions = process && process.versions || Deno && Deno.version;
|
|
var v8 = versions && versions.v8;
|
|
var match, version;
|
|
|
|
if (v8) {
|
|
match = v8.split('.');
|
|
version = match[0] < 4 ? 1 : match[0] + match[1];
|
|
} else if (userAgent) {
|
|
match = userAgent.match(/Edge\/(\d+)/);
|
|
if (!match || match[1] >= 74) {
|
|
match = userAgent.match(/Chrome\/(\d+)/);
|
|
if (match) version = match[1];
|
|
}
|
|
}
|
|
|
|
module.exports = version && +version;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5607:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = function (CONSTRUCTOR) {
|
|
return path[CONSTRUCTOR + 'Prototype'];
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2952:
|
|
/***/ (function(module) {
|
|
|
|
// IE8- don't enum bug keys
|
|
module.exports = [
|
|
'constructor',
|
|
'hasOwnProperty',
|
|
'isPrototypeOf',
|
|
'propertyIsEnumerable',
|
|
'toLocaleString',
|
|
'toString',
|
|
'valueOf'
|
|
];
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3085:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var global = __webpack_require__(8576);
|
|
var isCallable = __webpack_require__(6447);
|
|
var getOwnPropertyDescriptor = __webpack_require__(5141).f;
|
|
var isForced = __webpack_require__(9245);
|
|
var path = __webpack_require__(7545);
|
|
var bind = __webpack_require__(8043);
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
var hasOwn = __webpack_require__(4500);
|
|
|
|
var wrapConstructor = function (NativeConstructor) {
|
|
var Wrapper = function (a, b, c) {
|
|
if (this instanceof NativeConstructor) {
|
|
switch (arguments.length) {
|
|
case 0: return new NativeConstructor();
|
|
case 1: return new NativeConstructor(a);
|
|
case 2: return new NativeConstructor(a, b);
|
|
} return new NativeConstructor(a, b, c);
|
|
} return NativeConstructor.apply(this, arguments);
|
|
};
|
|
Wrapper.prototype = NativeConstructor.prototype;
|
|
return Wrapper;
|
|
};
|
|
|
|
/*
|
|
options.target - name of the target object
|
|
options.global - target is the global object
|
|
options.stat - export as static methods of target
|
|
options.proto - export as prototype methods of target
|
|
options.real - real prototype method for the `pure` version
|
|
options.forced - export even if the native feature is available
|
|
options.bind - bind methods to the target, required for the `pure` version
|
|
options.wrap - wrap constructors to preventing global pollution, required for the `pure` version
|
|
options.unsafe - use the simple assignment of property instead of delete + defineProperty
|
|
options.sham - add a flag to not completely full polyfills
|
|
options.enumerable - export as enumerable property
|
|
options.noTargetGet - prevent calling a getter on target
|
|
options.name - the .name of the function if it does not match the key
|
|
*/
|
|
module.exports = function (options, source) {
|
|
var TARGET = options.target;
|
|
var GLOBAL = options.global;
|
|
var STATIC = options.stat;
|
|
var PROTO = options.proto;
|
|
|
|
var nativeSource = GLOBAL ? global : STATIC ? global[TARGET] : (global[TARGET] || {}).prototype;
|
|
|
|
var target = GLOBAL ? path : path[TARGET] || createNonEnumerableProperty(path, TARGET, {})[TARGET];
|
|
var targetPrototype = target.prototype;
|
|
|
|
var FORCED, USE_NATIVE, VIRTUAL_PROTOTYPE;
|
|
var key, sourceProperty, targetProperty, nativeProperty, resultProperty, descriptor;
|
|
|
|
for (key in source) {
|
|
FORCED = isForced(GLOBAL ? key : TARGET + (STATIC ? '.' : '#') + key, options.forced);
|
|
// contains in native
|
|
USE_NATIVE = !FORCED && nativeSource && hasOwn(nativeSource, key);
|
|
|
|
targetProperty = target[key];
|
|
|
|
if (USE_NATIVE) if (options.noTargetGet) {
|
|
descriptor = getOwnPropertyDescriptor(nativeSource, key);
|
|
nativeProperty = descriptor && descriptor.value;
|
|
} else nativeProperty = nativeSource[key];
|
|
|
|
// export native or implementation
|
|
sourceProperty = (USE_NATIVE && nativeProperty) ? nativeProperty : source[key];
|
|
|
|
if (USE_NATIVE && typeof targetProperty === typeof sourceProperty) continue;
|
|
|
|
// bind timers to global for call from export context
|
|
if (options.bind && USE_NATIVE) resultProperty = bind(sourceProperty, global);
|
|
// wrap global constructors for prevent changs in this version
|
|
else if (options.wrap && USE_NATIVE) resultProperty = wrapConstructor(sourceProperty);
|
|
// make static versions for prototype methods
|
|
else if (PROTO && isCallable(sourceProperty)) resultProperty = bind(Function.call, sourceProperty);
|
|
// default case
|
|
else resultProperty = sourceProperty;
|
|
|
|
// add a flag to not completely full polyfills
|
|
if (options.sham || (sourceProperty && sourceProperty.sham) || (targetProperty && targetProperty.sham)) {
|
|
createNonEnumerableProperty(resultProperty, 'sham', true);
|
|
}
|
|
|
|
createNonEnumerableProperty(target, key, resultProperty);
|
|
|
|
if (PROTO) {
|
|
VIRTUAL_PROTOTYPE = TARGET + 'Prototype';
|
|
if (!hasOwn(path, VIRTUAL_PROTOTYPE)) {
|
|
createNonEnumerableProperty(path, VIRTUAL_PROTOTYPE, {});
|
|
}
|
|
// export virtual prototype methods
|
|
createNonEnumerableProperty(path[VIRTUAL_PROTOTYPE], key, sourceProperty);
|
|
// export real prototype methods
|
|
if (options.real && targetPrototype && !targetPrototype[key]) {
|
|
createNonEnumerableProperty(targetPrototype, key, sourceProperty);
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6192:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = function (exec) {
|
|
try {
|
|
return !!exec();
|
|
} catch (error) {
|
|
return true;
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8043:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var aCallable = __webpack_require__(6235);
|
|
|
|
// optional / simple context binding
|
|
module.exports = function (fn, that, length) {
|
|
aCallable(fn);
|
|
if (that === undefined) return fn;
|
|
switch (length) {
|
|
case 0: return function () {
|
|
return fn.call(that);
|
|
};
|
|
case 1: return function (a) {
|
|
return fn.call(that, a);
|
|
};
|
|
case 2: return function (a, b) {
|
|
return fn.call(that, a, b);
|
|
};
|
|
case 3: return function (a, b, c) {
|
|
return fn.call(that, a, b, c);
|
|
};
|
|
}
|
|
return function (/* ...args */) {
|
|
return fn.apply(that, arguments);
|
|
};
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6782:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var aCallable = __webpack_require__(6235);
|
|
var isObject = __webpack_require__(5744);
|
|
|
|
var slice = [].slice;
|
|
var factories = {};
|
|
|
|
var construct = function (C, argsLength, args) {
|
|
if (!(argsLength in factories)) {
|
|
for (var list = [], i = 0; i < argsLength; i++) list[i] = 'a[' + i + ']';
|
|
// eslint-disable-next-line no-new-func -- we have no proper alternatives, IE8- only
|
|
factories[argsLength] = Function('C,a', 'return new C(' + list.join(',') + ')');
|
|
} return factories[argsLength](C, args);
|
|
};
|
|
|
|
// `Function.prototype.bind` method implementation
|
|
// https://tc39.es/ecma262/#sec-function.prototype.bind
|
|
module.exports = Function.bind || function bind(that /* , ...args */) {
|
|
var fn = aCallable(this);
|
|
var partArgs = slice.call(arguments, 1);
|
|
var boundFunction = function bound(/* args... */) {
|
|
var args = partArgs.concat(slice.call(arguments));
|
|
return this instanceof boundFunction ? construct(fn, args.length, args) : fn.apply(that, args);
|
|
};
|
|
if (isObject(fn.prototype)) boundFunction.prototype = fn.prototype;
|
|
return boundFunction;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2282:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var hasOwn = __webpack_require__(4500);
|
|
|
|
var FunctionPrototype = Function.prototype;
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var getDescriptor = DESCRIPTORS && Object.getOwnPropertyDescriptor;
|
|
|
|
var EXISTS = hasOwn(FunctionPrototype, 'name');
|
|
// additional protection from minified / mangled / dropped function names
|
|
var PROPER = EXISTS && (function something() { /* empty */ }).name === 'something';
|
|
var CONFIGURABLE = EXISTS && (!DESCRIPTORS || (DESCRIPTORS && getDescriptor(FunctionPrototype, 'name').configurable));
|
|
|
|
module.exports = {
|
|
EXISTS: EXISTS,
|
|
PROPER: PROPER,
|
|
CONFIGURABLE: CONFIGURABLE
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 150:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var path = __webpack_require__(7545);
|
|
var global = __webpack_require__(8576);
|
|
var isCallable = __webpack_require__(6447);
|
|
|
|
var aFunction = function (variable) {
|
|
return isCallable(variable) ? variable : undefined;
|
|
};
|
|
|
|
module.exports = function (namespace, method) {
|
|
return arguments.length < 2 ? aFunction(path[namespace]) || aFunction(global[namespace])
|
|
: path[namespace] && path[namespace][method] || global[namespace] && global[namespace][method];
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8703:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var classof = __webpack_require__(4696);
|
|
var getMethod = __webpack_require__(5037);
|
|
var Iterators = __webpack_require__(7771);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var ITERATOR = wellKnownSymbol('iterator');
|
|
|
|
module.exports = function (it) {
|
|
if (it != undefined) return getMethod(it, ITERATOR)
|
|
|| getMethod(it, '@@iterator')
|
|
|| Iterators[classof(it)];
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1669:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var aCallable = __webpack_require__(6235);
|
|
var anObject = __webpack_require__(1138);
|
|
var getIteratorMethod = __webpack_require__(8703);
|
|
|
|
module.exports = function (argument, usingIterator) {
|
|
var iteratorMethod = arguments.length < 2 ? getIteratorMethod(argument) : usingIterator;
|
|
if (aCallable(iteratorMethod)) return anObject(iteratorMethod.call(argument));
|
|
throw TypeError(String(argument) + ' is not iterable');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5037:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var aCallable = __webpack_require__(6235);
|
|
|
|
// `GetMethod` abstract operation
|
|
// https://tc39.es/ecma262/#sec-getmethod
|
|
module.exports = function (V, P) {
|
|
var func = V[P];
|
|
return func == null ? undefined : aCallable(func);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8576:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var check = function (it) {
|
|
return it && it.Math == Math && it;
|
|
};
|
|
|
|
// https://github.com/zloirock/core-js/issues/86#issuecomment-115759028
|
|
module.exports =
|
|
// eslint-disable-next-line es/no-global-this -- safe
|
|
check(typeof globalThis == 'object' && globalThis) ||
|
|
check(typeof window == 'object' && window) ||
|
|
// eslint-disable-next-line no-restricted-globals -- safe
|
|
check(typeof self == 'object' && self) ||
|
|
check(typeof __webpack_require__.g == 'object' && __webpack_require__.g) ||
|
|
// eslint-disable-next-line no-new-func -- fallback
|
|
(function () { return this; })() || Function('return this')();
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4500:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var toObject = __webpack_require__(1795);
|
|
|
|
var hasOwnProperty = {}.hasOwnProperty;
|
|
|
|
// `HasOwnProperty` abstract operation
|
|
// https://tc39.es/ecma262/#sec-hasownproperty
|
|
module.exports = Object.hasOwn || function hasOwn(it, key) {
|
|
return hasOwnProperty.call(toObject(it), key);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4535:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = {};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3681:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
|
|
module.exports = function (a, b) {
|
|
var console = global.console;
|
|
if (console && console.error) {
|
|
arguments.length === 1 ? console.error(a) : console.error(a, b);
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7403:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var getBuiltIn = __webpack_require__(150);
|
|
|
|
module.exports = getBuiltIn('document', 'documentElement');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 188:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var fails = __webpack_require__(6192);
|
|
var createElement = __webpack_require__(7449);
|
|
|
|
// Thank's IE8 for his funny defineProperty
|
|
module.exports = !DESCRIPTORS && !fails(function () {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- requied for testing
|
|
return Object.defineProperty(createElement('div'), 'a', {
|
|
get: function () { return 7; }
|
|
}).a != 7;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2202:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fails = __webpack_require__(6192);
|
|
var classof = __webpack_require__(9272);
|
|
|
|
var split = ''.split;
|
|
|
|
// fallback for non-array-like ES3 and non-enumerable old V8 strings
|
|
module.exports = fails(function () {
|
|
// throws an error in rhino, see https://github.com/mozilla/rhino/issues/346
|
|
// eslint-disable-next-line no-prototype-builtins -- safe
|
|
return !Object('z').propertyIsEnumerable(0);
|
|
}) ? function (it) {
|
|
return classof(it) == 'String' ? split.call(it, '') : Object(it);
|
|
} : Object;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9516:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isCallable = __webpack_require__(6447);
|
|
var store = __webpack_require__(6434);
|
|
|
|
var functionToString = Function.toString;
|
|
|
|
// this helper broken in `core-js@3.4.1-3.4.4`, so we can't use `shared` helper
|
|
if (!isCallable(store.inspectSource)) {
|
|
store.inspectSource = function (it) {
|
|
return functionToString.call(it);
|
|
};
|
|
}
|
|
|
|
module.exports = store.inspectSource;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 273:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isObject = __webpack_require__(5744);
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
|
|
// `InstallErrorCause` abstract operation
|
|
// https://tc39.es/proposal-error-cause/#sec-errorobjects-install-error-cause
|
|
module.exports = function (O, options) {
|
|
if (isObject(options) && 'cause' in options) {
|
|
createNonEnumerableProperty(O, 'cause', O.cause);
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3326:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var NATIVE_WEAK_MAP = __webpack_require__(8921);
|
|
var global = __webpack_require__(8576);
|
|
var isObject = __webpack_require__(5744);
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var shared = __webpack_require__(6434);
|
|
var sharedKey = __webpack_require__(9766);
|
|
var hiddenKeys = __webpack_require__(4535);
|
|
|
|
var OBJECT_ALREADY_INITIALIZED = 'Object already initialized';
|
|
var WeakMap = global.WeakMap;
|
|
var set, get, has;
|
|
|
|
var enforce = function (it) {
|
|
return has(it) ? get(it) : set(it, {});
|
|
};
|
|
|
|
var getterFor = function (TYPE) {
|
|
return function (it) {
|
|
var state;
|
|
if (!isObject(it) || (state = get(it)).type !== TYPE) {
|
|
throw TypeError('Incompatible receiver, ' + TYPE + ' required');
|
|
} return state;
|
|
};
|
|
};
|
|
|
|
if (NATIVE_WEAK_MAP || shared.state) {
|
|
var store = shared.state || (shared.state = new WeakMap());
|
|
var wmget = store.get;
|
|
var wmhas = store.has;
|
|
var wmset = store.set;
|
|
set = function (it, metadata) {
|
|
if (wmhas.call(store, it)) throw new TypeError(OBJECT_ALREADY_INITIALIZED);
|
|
metadata.facade = it;
|
|
wmset.call(store, it, metadata);
|
|
return metadata;
|
|
};
|
|
get = function (it) {
|
|
return wmget.call(store, it) || {};
|
|
};
|
|
has = function (it) {
|
|
return wmhas.call(store, it);
|
|
};
|
|
} else {
|
|
var STATE = sharedKey('state');
|
|
hiddenKeys[STATE] = true;
|
|
set = function (it, metadata) {
|
|
if (hasOwn(it, STATE)) throw new TypeError(OBJECT_ALREADY_INITIALIZED);
|
|
metadata.facade = it;
|
|
createNonEnumerableProperty(it, STATE, metadata);
|
|
return metadata;
|
|
};
|
|
get = function (it) {
|
|
return hasOwn(it, STATE) ? it[STATE] : {};
|
|
};
|
|
has = function (it) {
|
|
return hasOwn(it, STATE);
|
|
};
|
|
}
|
|
|
|
module.exports = {
|
|
set: set,
|
|
get: get,
|
|
has: has,
|
|
enforce: enforce,
|
|
getterFor: getterFor
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6109:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var Iterators = __webpack_require__(7771);
|
|
|
|
var ITERATOR = wellKnownSymbol('iterator');
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
// check on default Array iterator
|
|
module.exports = function (it) {
|
|
return it !== undefined && (Iterators.Array === it || ArrayPrototype[ITERATOR] === it);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4770:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var classof = __webpack_require__(9272);
|
|
|
|
// `IsArray` abstract operation
|
|
// https://tc39.es/ecma262/#sec-isarray
|
|
// eslint-disable-next-line es/no-array-isarray -- safe
|
|
module.exports = Array.isArray || function isArray(argument) {
|
|
return classof(argument) == 'Array';
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6447:
|
|
/***/ (function(module) {
|
|
|
|
// `IsCallable` abstract operation
|
|
// https://tc39.es/ecma262/#sec-iscallable
|
|
module.exports = function (argument) {
|
|
return typeof argument === 'function';
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2091:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fails = __webpack_require__(6192);
|
|
var isCallable = __webpack_require__(6447);
|
|
var classof = __webpack_require__(4696);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var inspectSource = __webpack_require__(9516);
|
|
|
|
var empty = [];
|
|
var construct = getBuiltIn('Reflect', 'construct');
|
|
var constructorRegExp = /^\s*(?:class|function)\b/;
|
|
var exec = constructorRegExp.exec;
|
|
var INCORRECT_TO_STRING = !constructorRegExp.exec(function () { /* empty */ });
|
|
|
|
var isConstructorModern = function (argument) {
|
|
if (!isCallable(argument)) return false;
|
|
try {
|
|
construct(Object, empty, argument);
|
|
return true;
|
|
} catch (error) {
|
|
return false;
|
|
}
|
|
};
|
|
|
|
var isConstructorLegacy = function (argument) {
|
|
if (!isCallable(argument)) return false;
|
|
switch (classof(argument)) {
|
|
case 'AsyncFunction':
|
|
case 'GeneratorFunction':
|
|
case 'AsyncGeneratorFunction': return false;
|
|
// we can't check .prototype since constructors produced by .bind haven't it
|
|
} return INCORRECT_TO_STRING || !!exec.call(constructorRegExp, inspectSource(argument));
|
|
};
|
|
|
|
// `IsConstructor` abstract operation
|
|
// https://tc39.es/ecma262/#sec-isconstructor
|
|
module.exports = !construct || fails(function () {
|
|
var called;
|
|
return isConstructorModern(isConstructorModern.call)
|
|
|| !isConstructorModern(Object)
|
|
|| !isConstructorModern(function () { called = true; })
|
|
|| called;
|
|
}) ? isConstructorLegacy : isConstructorModern;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9245:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fails = __webpack_require__(6192);
|
|
var isCallable = __webpack_require__(6447);
|
|
|
|
var replacement = /#|\.prototype\./;
|
|
|
|
var isForced = function (feature, detection) {
|
|
var value = data[normalize(feature)];
|
|
return value == POLYFILL ? true
|
|
: value == NATIVE ? false
|
|
: isCallable(detection) ? fails(detection)
|
|
: !!detection;
|
|
};
|
|
|
|
var normalize = isForced.normalize = function (string) {
|
|
return String(string).replace(replacement, '.').toLowerCase();
|
|
};
|
|
|
|
var data = isForced.data = {};
|
|
var NATIVE = isForced.NATIVE = 'N';
|
|
var POLYFILL = isForced.POLYFILL = 'P';
|
|
|
|
module.exports = isForced;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5744:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isCallable = __webpack_require__(6447);
|
|
|
|
module.exports = function (it) {
|
|
return typeof it === 'object' ? it !== null : isCallable(it);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5546:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = true;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3236:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isCallable = __webpack_require__(6447);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var USE_SYMBOL_AS_UID = __webpack_require__(615);
|
|
|
|
module.exports = USE_SYMBOL_AS_UID ? function (it) {
|
|
return typeof it == 'symbol';
|
|
} : function (it) {
|
|
var $Symbol = getBuiltIn('Symbol');
|
|
return isCallable($Symbol) && Object(it) instanceof $Symbol;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3442:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var anObject = __webpack_require__(1138);
|
|
var isArrayIteratorMethod = __webpack_require__(6109);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
var bind = __webpack_require__(8043);
|
|
var getIterator = __webpack_require__(1669);
|
|
var getIteratorMethod = __webpack_require__(8703);
|
|
var iteratorClose = __webpack_require__(6639);
|
|
|
|
var Result = function (stopped, result) {
|
|
this.stopped = stopped;
|
|
this.result = result;
|
|
};
|
|
|
|
module.exports = function (iterable, unboundFunction, options) {
|
|
var that = options && options.that;
|
|
var AS_ENTRIES = !!(options && options.AS_ENTRIES);
|
|
var IS_ITERATOR = !!(options && options.IS_ITERATOR);
|
|
var INTERRUPTED = !!(options && options.INTERRUPTED);
|
|
var fn = bind(unboundFunction, that, 1 + AS_ENTRIES + INTERRUPTED);
|
|
var iterator, iterFn, index, length, result, next, step;
|
|
|
|
var stop = function (condition) {
|
|
if (iterator) iteratorClose(iterator, 'normal', condition);
|
|
return new Result(true, condition);
|
|
};
|
|
|
|
var callFn = function (value) {
|
|
if (AS_ENTRIES) {
|
|
anObject(value);
|
|
return INTERRUPTED ? fn(value[0], value[1], stop) : fn(value[0], value[1]);
|
|
} return INTERRUPTED ? fn(value, stop) : fn(value);
|
|
};
|
|
|
|
if (IS_ITERATOR) {
|
|
iterator = iterable;
|
|
} else {
|
|
iterFn = getIteratorMethod(iterable);
|
|
if (!iterFn) throw TypeError(String(iterable) + ' is not iterable');
|
|
// optimisation for array iterators
|
|
if (isArrayIteratorMethod(iterFn)) {
|
|
for (index = 0, length = lengthOfArrayLike(iterable); length > index; index++) {
|
|
result = callFn(iterable[index]);
|
|
if (result && result instanceof Result) return result;
|
|
} return new Result(false);
|
|
}
|
|
iterator = getIterator(iterable, iterFn);
|
|
}
|
|
|
|
next = iterator.next;
|
|
while (!(step = next.call(iterator)).done) {
|
|
try {
|
|
result = callFn(step.value);
|
|
} catch (error) {
|
|
iteratorClose(iterator, 'throw', error);
|
|
}
|
|
if (typeof result == 'object' && result && result instanceof Result) return result;
|
|
} return new Result(false);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6639:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var anObject = __webpack_require__(1138);
|
|
var getMethod = __webpack_require__(5037);
|
|
|
|
module.exports = function (iterator, kind, value) {
|
|
var innerResult, innerError;
|
|
anObject(iterator);
|
|
try {
|
|
innerResult = getMethod(iterator, 'return');
|
|
if (!innerResult) {
|
|
if (kind === 'throw') throw value;
|
|
return value;
|
|
}
|
|
innerResult = innerResult.call(iterator);
|
|
} catch (error) {
|
|
innerError = true;
|
|
innerResult = error;
|
|
}
|
|
if (kind === 'throw') throw value;
|
|
if (innerError) throw innerResult;
|
|
anObject(innerResult);
|
|
return value;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4413:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var fails = __webpack_require__(6192);
|
|
var isCallable = __webpack_require__(6447);
|
|
var create = __webpack_require__(2853);
|
|
var getPrototypeOf = __webpack_require__(9341);
|
|
var redefine = __webpack_require__(9482);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var IS_PURE = __webpack_require__(5546);
|
|
|
|
var ITERATOR = wellKnownSymbol('iterator');
|
|
var BUGGY_SAFARI_ITERATORS = false;
|
|
|
|
// `%IteratorPrototype%` object
|
|
// https://tc39.es/ecma262/#sec-%iteratorprototype%-object
|
|
var IteratorPrototype, PrototypeOfArrayIteratorPrototype, arrayIterator;
|
|
|
|
/* eslint-disable es/no-array-prototype-keys -- safe */
|
|
if ([].keys) {
|
|
arrayIterator = [].keys();
|
|
// Safari 8 has buggy iterators w/o `next`
|
|
if (!('next' in arrayIterator)) BUGGY_SAFARI_ITERATORS = true;
|
|
else {
|
|
PrototypeOfArrayIteratorPrototype = getPrototypeOf(getPrototypeOf(arrayIterator));
|
|
if (PrototypeOfArrayIteratorPrototype !== Object.prototype) IteratorPrototype = PrototypeOfArrayIteratorPrototype;
|
|
}
|
|
}
|
|
|
|
var NEW_ITERATOR_PROTOTYPE = IteratorPrototype == undefined || fails(function () {
|
|
var test = {};
|
|
// FF44- legacy iterators case
|
|
return IteratorPrototype[ITERATOR].call(test) !== test;
|
|
});
|
|
|
|
if (NEW_ITERATOR_PROTOTYPE) IteratorPrototype = {};
|
|
else if (IS_PURE) IteratorPrototype = create(IteratorPrototype);
|
|
|
|
// `%IteratorPrototype%[@@iterator]()` method
|
|
// https://tc39.es/ecma262/#sec-%iteratorprototype%-@@iterator
|
|
if (!isCallable(IteratorPrototype[ITERATOR])) {
|
|
redefine(IteratorPrototype, ITERATOR, function () {
|
|
return this;
|
|
});
|
|
}
|
|
|
|
module.exports = {
|
|
IteratorPrototype: IteratorPrototype,
|
|
BUGGY_SAFARI_ITERATORS: BUGGY_SAFARI_ITERATORS
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7771:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = {};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4104:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var toLength = __webpack_require__(8445);
|
|
|
|
// `LengthOfArrayLike` abstract operation
|
|
// https://tc39.es/ecma262/#sec-lengthofarraylike
|
|
module.exports = function (obj) {
|
|
return toLength(obj.length);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2950:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var getOwnPropertyDescriptor = __webpack_require__(5141).f;
|
|
var macrotask = __webpack_require__(7160).set;
|
|
var IS_IOS = __webpack_require__(9536);
|
|
var IS_IOS_PEBBLE = __webpack_require__(9347);
|
|
var IS_WEBOS_WEBKIT = __webpack_require__(5914);
|
|
var IS_NODE = __webpack_require__(224);
|
|
|
|
var MutationObserver = global.MutationObserver || global.WebKitMutationObserver;
|
|
var document = global.document;
|
|
var process = global.process;
|
|
var Promise = global.Promise;
|
|
// Node.js 11 shows ExperimentalWarning on getting `queueMicrotask`
|
|
var queueMicrotaskDescriptor = getOwnPropertyDescriptor(global, 'queueMicrotask');
|
|
var queueMicrotask = queueMicrotaskDescriptor && queueMicrotaskDescriptor.value;
|
|
|
|
var flush, head, last, notify, toggle, node, promise, then;
|
|
|
|
// modern engines have queueMicrotask method
|
|
if (!queueMicrotask) {
|
|
flush = function () {
|
|
var parent, fn;
|
|
if (IS_NODE && (parent = process.domain)) parent.exit();
|
|
while (head) {
|
|
fn = head.fn;
|
|
head = head.next;
|
|
try {
|
|
fn();
|
|
} catch (error) {
|
|
if (head) notify();
|
|
else last = undefined;
|
|
throw error;
|
|
}
|
|
} last = undefined;
|
|
if (parent) parent.enter();
|
|
};
|
|
|
|
// browsers with MutationObserver, except iOS - https://github.com/zloirock/core-js/issues/339
|
|
// also except WebOS Webkit https://github.com/zloirock/core-js/issues/898
|
|
if (!IS_IOS && !IS_NODE && !IS_WEBOS_WEBKIT && MutationObserver && document) {
|
|
toggle = true;
|
|
node = document.createTextNode('');
|
|
new MutationObserver(flush).observe(node, { characterData: true });
|
|
notify = function () {
|
|
node.data = toggle = !toggle;
|
|
};
|
|
// environments with maybe non-completely correct, but existent Promise
|
|
} else if (!IS_IOS_PEBBLE && Promise && Promise.resolve) {
|
|
// Promise.resolve without an argument throws an error in LG WebOS 2
|
|
promise = Promise.resolve(undefined);
|
|
// workaround of WebKit ~ iOS Safari 10.1 bug
|
|
promise.constructor = Promise;
|
|
then = promise.then;
|
|
notify = function () {
|
|
then.call(promise, flush);
|
|
};
|
|
// Node.js without promises
|
|
} else if (IS_NODE) {
|
|
notify = function () {
|
|
process.nextTick(flush);
|
|
};
|
|
// for other environments - macrotask based on:
|
|
// - setImmediate
|
|
// - MessageChannel
|
|
// - window.postMessag
|
|
// - onreadystatechange
|
|
// - setTimeout
|
|
} else {
|
|
notify = function () {
|
|
// strange IE + webpack dev server bug - use .call(global)
|
|
macrotask.call(global, flush);
|
|
};
|
|
}
|
|
}
|
|
|
|
module.exports = queueMicrotask || function (fn) {
|
|
var task = { fn: fn, next: undefined };
|
|
if (last) last.next = task;
|
|
if (!head) {
|
|
head = task;
|
|
notify();
|
|
} last = task;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4471:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
|
|
module.exports = global.Promise;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3045:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
/* eslint-disable es/no-symbol -- required for testing */
|
|
var V8_VERSION = __webpack_require__(4218);
|
|
var fails = __webpack_require__(6192);
|
|
|
|
// eslint-disable-next-line es/no-object-getownpropertysymbols -- required for testing
|
|
module.exports = !!Object.getOwnPropertySymbols && !fails(function () {
|
|
var symbol = Symbol();
|
|
// Chrome 38 Symbol has incorrect toString conversion
|
|
// `get-own-property-symbols` polyfill symbols converted to object are not Symbol instances
|
|
return !String(symbol) || !(Object(symbol) instanceof Symbol) ||
|
|
// Chrome 38-40 symbols are not inherited from DOM collections prototypes to instances
|
|
!Symbol.sham && V8_VERSION && V8_VERSION < 41;
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4551:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var fails = __webpack_require__(6192);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var IS_PURE = __webpack_require__(5546);
|
|
|
|
var ITERATOR = wellKnownSymbol('iterator');
|
|
|
|
module.exports = !fails(function () {
|
|
var url = new URL('b?a=1&b=2&c=3', 'http://a');
|
|
var searchParams = url.searchParams;
|
|
var result = '';
|
|
url.pathname = 'c%20d';
|
|
searchParams.forEach(function (value, key) {
|
|
searchParams['delete']('b');
|
|
result += key + value;
|
|
});
|
|
return (IS_PURE && !url.toJSON)
|
|
|| !searchParams.sort
|
|
|| url.href !== 'http://a/c%20d?a=1&c=3'
|
|
|| searchParams.get('c') !== '3'
|
|
|| String(new URLSearchParams('?a=1')) !== 'a=1'
|
|
|| !searchParams[ITERATOR]
|
|
// throws in Edge
|
|
|| new URL('https://a@b').username !== 'a'
|
|
|| new URLSearchParams(new URLSearchParams('a=b')).get('a') !== 'b'
|
|
// not punycoded in Edge
|
|
|| new URL('http://теÑÑ‚').host !== 'xn--e1aybc'
|
|
// not escaped in Chrome 62-
|
|
|| new URL('http://a#б').hash !== '#%D0%B1'
|
|
// fails in Chrome 66-
|
|
|| result !== 'a1c3'
|
|
// throws in Safari
|
|
|| new URL('http://x', undefined).host !== 'x';
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8921:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var isCallable = __webpack_require__(6447);
|
|
var inspectSource = __webpack_require__(9516);
|
|
|
|
var WeakMap = global.WeakMap;
|
|
|
|
module.exports = isCallable(WeakMap) && /native code/.test(inspectSource(WeakMap));
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9438:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var aCallable = __webpack_require__(6235);
|
|
|
|
var PromiseCapability = function (C) {
|
|
var resolve, reject;
|
|
this.promise = new C(function ($$resolve, $$reject) {
|
|
if (resolve !== undefined || reject !== undefined) throw TypeError('Bad Promise constructor');
|
|
resolve = $$resolve;
|
|
reject = $$reject;
|
|
});
|
|
this.resolve = aCallable(resolve);
|
|
this.reject = aCallable(reject);
|
|
};
|
|
|
|
// `NewPromiseCapability` abstract operation
|
|
// https://tc39.es/ecma262/#sec-newpromisecapability
|
|
module.exports.f = function (C) {
|
|
return new PromiseCapability(C);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 15:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var fails = __webpack_require__(6192);
|
|
var toString = __webpack_require__(4845);
|
|
var trim = __webpack_require__(4277).trim;
|
|
var whitespaces = __webpack_require__(1450);
|
|
|
|
var $parseFloat = global.parseFloat;
|
|
var Symbol = global.Symbol;
|
|
var ITERATOR = Symbol && Symbol.iterator;
|
|
var FORCED = 1 / $parseFloat(whitespaces + '-0') !== -Infinity
|
|
// MS Edge 18- broken with boxed symbols
|
|
|| (ITERATOR && !fails(function () { $parseFloat(Object(ITERATOR)); }));
|
|
|
|
// `parseFloat` method
|
|
// https://tc39.es/ecma262/#sec-parsefloat-string
|
|
module.exports = FORCED ? function parseFloat(string) {
|
|
var trimmedString = trim(toString(string));
|
|
var result = $parseFloat(trimmedString);
|
|
return result === 0 && trimmedString.charAt(0) == '-' ? -0 : result;
|
|
} : $parseFloat;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2558:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var fails = __webpack_require__(6192);
|
|
var toString = __webpack_require__(4845);
|
|
var trim = __webpack_require__(4277).trim;
|
|
var whitespaces = __webpack_require__(1450);
|
|
|
|
var $parseInt = global.parseInt;
|
|
var Symbol = global.Symbol;
|
|
var ITERATOR = Symbol && Symbol.iterator;
|
|
var hex = /^[+-]?0[Xx]/;
|
|
var FORCED = $parseInt(whitespaces + '08') !== 8 || $parseInt(whitespaces + '0x16') !== 22
|
|
// MS Edge 18- broken with boxed symbols
|
|
|| (ITERATOR && !fails(function () { $parseInt(Object(ITERATOR)); }));
|
|
|
|
// `parseInt` method
|
|
// https://tc39.es/ecma262/#sec-parseint-string-radix
|
|
module.exports = FORCED ? function parseInt(string, radix) {
|
|
var S = trim(toString(string));
|
|
return $parseInt(S, (radix >>> 0) || (hex.test(S) ? 16 : 10));
|
|
} : $parseInt;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2503:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var fails = __webpack_require__(6192);
|
|
var objectKeys = __webpack_require__(7653);
|
|
var getOwnPropertySymbolsModule = __webpack_require__(4750);
|
|
var propertyIsEnumerableModule = __webpack_require__(6007);
|
|
var toObject = __webpack_require__(1795);
|
|
var IndexedObject = __webpack_require__(2202);
|
|
|
|
// eslint-disable-next-line es/no-object-assign -- safe
|
|
var $assign = Object.assign;
|
|
// eslint-disable-next-line es/no-object-defineproperty -- required for testing
|
|
var defineProperty = Object.defineProperty;
|
|
|
|
// `Object.assign` method
|
|
// https://tc39.es/ecma262/#sec-object.assign
|
|
module.exports = !$assign || fails(function () {
|
|
// should have correct order of operations (Edge bug)
|
|
if (DESCRIPTORS && $assign({ b: 1 }, $assign(defineProperty({}, 'a', {
|
|
enumerable: true,
|
|
get: function () {
|
|
defineProperty(this, 'b', {
|
|
value: 3,
|
|
enumerable: false
|
|
});
|
|
}
|
|
}), { b: 2 })).b !== 1) return true;
|
|
// should work with symbols and should have deterministic property order (V8 bug)
|
|
var A = {};
|
|
var B = {};
|
|
// eslint-disable-next-line es/no-symbol -- safe
|
|
var symbol = Symbol();
|
|
var alphabet = 'abcdefghijklmnopqrst';
|
|
A[symbol] = 7;
|
|
alphabet.split('').forEach(function (chr) { B[chr] = chr; });
|
|
return $assign({}, A)[symbol] != 7 || objectKeys($assign({}, B)).join('') != alphabet;
|
|
}) ? function assign(target, source) { // eslint-disable-line no-unused-vars -- required for `.length`
|
|
var T = toObject(target);
|
|
var argumentsLength = arguments.length;
|
|
var index = 1;
|
|
var getOwnPropertySymbols = getOwnPropertySymbolsModule.f;
|
|
var propertyIsEnumerable = propertyIsEnumerableModule.f;
|
|
while (argumentsLength > index) {
|
|
var S = IndexedObject(arguments[index++]);
|
|
var keys = getOwnPropertySymbols ? objectKeys(S).concat(getOwnPropertySymbols(S)) : objectKeys(S);
|
|
var length = keys.length;
|
|
var j = 0;
|
|
var key;
|
|
while (length > j) {
|
|
key = keys[j++];
|
|
if (!DESCRIPTORS || propertyIsEnumerable.call(S, key)) T[key] = S[key];
|
|
}
|
|
} return T;
|
|
} : $assign;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2853:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
/* global ActiveXObject -- old IE, WSH */
|
|
var anObject = __webpack_require__(1138);
|
|
var defineProperties = __webpack_require__(1187);
|
|
var enumBugKeys = __webpack_require__(2952);
|
|
var hiddenKeys = __webpack_require__(4535);
|
|
var html = __webpack_require__(7403);
|
|
var documentCreateElement = __webpack_require__(7449);
|
|
var sharedKey = __webpack_require__(9766);
|
|
|
|
var GT = '>';
|
|
var LT = '<';
|
|
var PROTOTYPE = 'prototype';
|
|
var SCRIPT = 'script';
|
|
var IE_PROTO = sharedKey('IE_PROTO');
|
|
|
|
var EmptyConstructor = function () { /* empty */ };
|
|
|
|
var scriptTag = function (content) {
|
|
return LT + SCRIPT + GT + content + LT + '/' + SCRIPT + GT;
|
|
};
|
|
|
|
// Create object with fake `null` prototype: use ActiveX Object with cleared prototype
|
|
var NullProtoObjectViaActiveX = function (activeXDocument) {
|
|
activeXDocument.write(scriptTag(''));
|
|
activeXDocument.close();
|
|
var temp = activeXDocument.parentWindow.Object;
|
|
activeXDocument = null; // avoid memory leak
|
|
return temp;
|
|
};
|
|
|
|
// Create object with fake `null` prototype: use iframe Object with cleared prototype
|
|
var NullProtoObjectViaIFrame = function () {
|
|
// Thrash, waste and sodomy: IE GC bug
|
|
var iframe = documentCreateElement('iframe');
|
|
var JS = 'java' + SCRIPT + ':';
|
|
var iframeDocument;
|
|
iframe.style.display = 'none';
|
|
html.appendChild(iframe);
|
|
// https://github.com/zloirock/core-js/issues/475
|
|
iframe.src = String(JS);
|
|
iframeDocument = iframe.contentWindow.document;
|
|
iframeDocument.open();
|
|
iframeDocument.write(scriptTag('document.F=Object'));
|
|
iframeDocument.close();
|
|
return iframeDocument.F;
|
|
};
|
|
|
|
// Check for document.domain and active x support
|
|
// No need to use active x approach when document.domain is not set
|
|
// see https://github.com/es-shims/es5-shim/issues/150
|
|
// variation of https://github.com/kitcambridge/es5-shim/commit/4f738ac066346
|
|
// avoid IE GC bug
|
|
var activeXDocument;
|
|
var NullProtoObject = function () {
|
|
try {
|
|
activeXDocument = new ActiveXObject('htmlfile');
|
|
} catch (error) { /* ignore */ }
|
|
NullProtoObject = typeof document != 'undefined'
|
|
? document.domain && activeXDocument
|
|
? NullProtoObjectViaActiveX(activeXDocument) // old IE
|
|
: NullProtoObjectViaIFrame()
|
|
: NullProtoObjectViaActiveX(activeXDocument); // WSH
|
|
var length = enumBugKeys.length;
|
|
while (length--) delete NullProtoObject[PROTOTYPE][enumBugKeys[length]];
|
|
return NullProtoObject();
|
|
};
|
|
|
|
hiddenKeys[IE_PROTO] = true;
|
|
|
|
// `Object.create` method
|
|
// https://tc39.es/ecma262/#sec-object.create
|
|
module.exports = Object.create || function create(O, Properties) {
|
|
var result;
|
|
if (O !== null) {
|
|
EmptyConstructor[PROTOTYPE] = anObject(O);
|
|
result = new EmptyConstructor();
|
|
EmptyConstructor[PROTOTYPE] = null;
|
|
// add "__proto__" for Object.getPrototypeOf polyfill
|
|
result[IE_PROTO] = O;
|
|
} else result = NullProtoObject();
|
|
return Properties === undefined ? result : defineProperties(result, Properties);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1187:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var definePropertyModule = __webpack_require__(2760);
|
|
var anObject = __webpack_require__(1138);
|
|
var objectKeys = __webpack_require__(7653);
|
|
|
|
// `Object.defineProperties` method
|
|
// https://tc39.es/ecma262/#sec-object.defineproperties
|
|
// eslint-disable-next-line es/no-object-defineproperties -- safe
|
|
module.exports = DESCRIPTORS ? Object.defineProperties : function defineProperties(O, Properties) {
|
|
anObject(O);
|
|
var keys = objectKeys(Properties);
|
|
var length = keys.length;
|
|
var index = 0;
|
|
var key;
|
|
while (length > index) definePropertyModule.f(O, key = keys[index++], Properties[key]);
|
|
return O;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2760:
|
|
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {
|
|
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var IE8_DOM_DEFINE = __webpack_require__(188);
|
|
var anObject = __webpack_require__(1138);
|
|
var toPropertyKey = __webpack_require__(77);
|
|
|
|
// eslint-disable-next-line es/no-object-defineproperty -- safe
|
|
var $defineProperty = Object.defineProperty;
|
|
|
|
// `Object.defineProperty` method
|
|
// https://tc39.es/ecma262/#sec-object.defineproperty
|
|
exports.f = DESCRIPTORS ? $defineProperty : function defineProperty(O, P, Attributes) {
|
|
anObject(O);
|
|
P = toPropertyKey(P);
|
|
anObject(Attributes);
|
|
if (IE8_DOM_DEFINE) try {
|
|
return $defineProperty(O, P, Attributes);
|
|
} catch (error) { /* empty */ }
|
|
if ('get' in Attributes || 'set' in Attributes) throw TypeError('Accessors not supported');
|
|
if ('value' in Attributes) O[P] = Attributes.value;
|
|
return O;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5141:
|
|
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {
|
|
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var propertyIsEnumerableModule = __webpack_require__(6007);
|
|
var createPropertyDescriptor = __webpack_require__(774);
|
|
var toIndexedObject = __webpack_require__(101);
|
|
var toPropertyKey = __webpack_require__(77);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var IE8_DOM_DEFINE = __webpack_require__(188);
|
|
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var $getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;
|
|
|
|
// `Object.getOwnPropertyDescriptor` method
|
|
// https://tc39.es/ecma262/#sec-object.getownpropertydescriptor
|
|
exports.f = DESCRIPTORS ? $getOwnPropertyDescriptor : function getOwnPropertyDescriptor(O, P) {
|
|
O = toIndexedObject(O);
|
|
P = toPropertyKey(P);
|
|
if (IE8_DOM_DEFINE) try {
|
|
return $getOwnPropertyDescriptor(O, P);
|
|
} catch (error) { /* empty */ }
|
|
if (hasOwn(O, P)) return createPropertyDescriptor(!propertyIsEnumerableModule.f.call(O, P), O[P]);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4052:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
/* eslint-disable es/no-object-getownpropertynames -- safe */
|
|
var toIndexedObject = __webpack_require__(101);
|
|
var $getOwnPropertyNames = __webpack_require__(2092).f;
|
|
|
|
var toString = {}.toString;
|
|
|
|
var windowNames = typeof window == 'object' && window && Object.getOwnPropertyNames
|
|
? Object.getOwnPropertyNames(window) : [];
|
|
|
|
var getWindowNames = function (it) {
|
|
try {
|
|
return $getOwnPropertyNames(it);
|
|
} catch (error) {
|
|
return windowNames.slice();
|
|
}
|
|
};
|
|
|
|
// fallback for IE11 buggy Object.getOwnPropertyNames with iframe and window
|
|
module.exports.f = function getOwnPropertyNames(it) {
|
|
return windowNames && toString.call(it) == '[object Window]'
|
|
? getWindowNames(it)
|
|
: $getOwnPropertyNames(toIndexedObject(it));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2092:
|
|
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {
|
|
|
|
var internalObjectKeys = __webpack_require__(7934);
|
|
var enumBugKeys = __webpack_require__(2952);
|
|
|
|
var hiddenKeys = enumBugKeys.concat('length', 'prototype');
|
|
|
|
// `Object.getOwnPropertyNames` method
|
|
// https://tc39.es/ecma262/#sec-object.getownpropertynames
|
|
// eslint-disable-next-line es/no-object-getownpropertynames -- safe
|
|
exports.f = Object.getOwnPropertyNames || function getOwnPropertyNames(O) {
|
|
return internalObjectKeys(O, hiddenKeys);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4750:
|
|
/***/ (function(__unused_webpack_module, exports) {
|
|
|
|
// eslint-disable-next-line es/no-object-getownpropertysymbols -- safe
|
|
exports.f = Object.getOwnPropertySymbols;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9341:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var hasOwn = __webpack_require__(4500);
|
|
var isCallable = __webpack_require__(6447);
|
|
var toObject = __webpack_require__(1795);
|
|
var sharedKey = __webpack_require__(9766);
|
|
var CORRECT_PROTOTYPE_GETTER = __webpack_require__(4635);
|
|
|
|
var IE_PROTO = sharedKey('IE_PROTO');
|
|
var ObjectPrototype = Object.prototype;
|
|
|
|
// `Object.getPrototypeOf` method
|
|
// https://tc39.es/ecma262/#sec-object.getprototypeof
|
|
// eslint-disable-next-line es/no-object-getprototypeof -- safe
|
|
module.exports = CORRECT_PROTOTYPE_GETTER ? Object.getPrototypeOf : function (O) {
|
|
var object = toObject(O);
|
|
if (hasOwn(object, IE_PROTO)) return object[IE_PROTO];
|
|
var constructor = object.constructor;
|
|
if (isCallable(constructor) && object instanceof constructor) {
|
|
return constructor.prototype;
|
|
} return object instanceof Object ? ObjectPrototype : null;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7934:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var hasOwn = __webpack_require__(4500);
|
|
var toIndexedObject = __webpack_require__(101);
|
|
var indexOf = __webpack_require__(8180).indexOf;
|
|
var hiddenKeys = __webpack_require__(4535);
|
|
|
|
module.exports = function (object, names) {
|
|
var O = toIndexedObject(object);
|
|
var i = 0;
|
|
var result = [];
|
|
var key;
|
|
for (key in O) !hasOwn(hiddenKeys, key) && hasOwn(O, key) && result.push(key);
|
|
// Don't enum bug & hidden keys
|
|
while (names.length > i) if (hasOwn(O, key = names[i++])) {
|
|
~indexOf(result, key) || result.push(key);
|
|
}
|
|
return result;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7653:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var internalObjectKeys = __webpack_require__(7934);
|
|
var enumBugKeys = __webpack_require__(2952);
|
|
|
|
// `Object.keys` method
|
|
// https://tc39.es/ecma262/#sec-object.keys
|
|
// eslint-disable-next-line es/no-object-keys -- safe
|
|
module.exports = Object.keys || function keys(O) {
|
|
return internalObjectKeys(O, enumBugKeys);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6007:
|
|
/***/ (function(__unused_webpack_module, exports) {
|
|
|
|
"use strict";
|
|
|
|
var $propertyIsEnumerable = {}.propertyIsEnumerable;
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
var getOwnPropertyDescriptor = Object.getOwnPropertyDescriptor;
|
|
|
|
// Nashorn ~ JDK8 bug
|
|
var NASHORN_BUG = getOwnPropertyDescriptor && !$propertyIsEnumerable.call({ 1: 2 }, 1);
|
|
|
|
// `Object.prototype.propertyIsEnumerable` method implementation
|
|
// https://tc39.es/ecma262/#sec-object.prototype.propertyisenumerable
|
|
exports.f = NASHORN_BUG ? function propertyIsEnumerable(V) {
|
|
var descriptor = getOwnPropertyDescriptor(this, V);
|
|
return !!descriptor && descriptor.enumerable;
|
|
} : $propertyIsEnumerable;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4469:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
/* eslint-disable no-proto -- safe */
|
|
var anObject = __webpack_require__(1138);
|
|
var aPossiblePrototype = __webpack_require__(7757);
|
|
|
|
// `Object.setPrototypeOf` method
|
|
// https://tc39.es/ecma262/#sec-object.setprototypeof
|
|
// Works with __proto__ only. Old v8 can't work with null proto objects.
|
|
// eslint-disable-next-line es/no-object-setprototypeof -- safe
|
|
module.exports = Object.setPrototypeOf || ('__proto__' in {} ? function () {
|
|
var CORRECT_SETTER = false;
|
|
var test = {};
|
|
var setter;
|
|
try {
|
|
// eslint-disable-next-line es/no-object-getownpropertydescriptor -- safe
|
|
setter = Object.getOwnPropertyDescriptor(Object.prototype, '__proto__').set;
|
|
setter.call(test, []);
|
|
CORRECT_SETTER = test instanceof Array;
|
|
} catch (error) { /* empty */ }
|
|
return function setPrototypeOf(O, proto) {
|
|
anObject(O);
|
|
aPossiblePrototype(proto);
|
|
if (CORRECT_SETTER) setter.call(O, proto);
|
|
else O.__proto__ = proto;
|
|
return O;
|
|
};
|
|
}() : undefined);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 158:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var TO_STRING_TAG_SUPPORT = __webpack_require__(3471);
|
|
var classof = __webpack_require__(4696);
|
|
|
|
// `Object.prototype.toString` method implementation
|
|
// https://tc39.es/ecma262/#sec-object.prototype.tostring
|
|
module.exports = TO_STRING_TAG_SUPPORT ? {}.toString : function toString() {
|
|
return '[object ' + classof(this) + ']';
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 380:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isCallable = __webpack_require__(6447);
|
|
var isObject = __webpack_require__(5744);
|
|
|
|
// `OrdinaryToPrimitive` abstract operation
|
|
// https://tc39.es/ecma262/#sec-ordinarytoprimitive
|
|
module.exports = function (input, pref) {
|
|
var fn, val;
|
|
if (pref === 'string' && isCallable(fn = input.toString) && !isObject(val = fn.call(input))) return val;
|
|
if (isCallable(fn = input.valueOf) && !isObject(val = fn.call(input))) return val;
|
|
if (pref !== 'string' && isCallable(fn = input.toString) && !isObject(val = fn.call(input))) return val;
|
|
throw TypeError("Can't convert object to primitive value");
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7545:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = {};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 892:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = function (exec) {
|
|
try {
|
|
return { error: false, value: exec() };
|
|
} catch (error) {
|
|
return { error: true, value: error };
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9126:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var anObject = __webpack_require__(1138);
|
|
var isObject = __webpack_require__(5744);
|
|
var newPromiseCapability = __webpack_require__(9438);
|
|
|
|
module.exports = function (C, x) {
|
|
anObject(C);
|
|
if (isObject(x) && x.constructor === C) return x;
|
|
var promiseCapability = newPromiseCapability.f(C);
|
|
var resolve = promiseCapability.resolve;
|
|
resolve(x);
|
|
return promiseCapability.promise;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 533:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var redefine = __webpack_require__(9482);
|
|
|
|
module.exports = function (target, src, options) {
|
|
for (var key in src) {
|
|
if (options && options.unsafe && target[key]) target[key] = src[key];
|
|
else redefine(target, key, src[key], options);
|
|
} return target;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9482:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
|
|
module.exports = function (target, key, value, options) {
|
|
if (options && options.enumerable) target[key] = value;
|
|
else createNonEnumerableProperty(target, key, value);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3209:
|
|
/***/ (function(module) {
|
|
|
|
// `RequireObjectCoercible` abstract operation
|
|
// https://tc39.es/ecma262/#sec-requireobjectcoercible
|
|
module.exports = function (it) {
|
|
if (it == undefined) throw TypeError("Can't call method on " + it);
|
|
return it;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7613:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
|
|
module.exports = function (key, value) {
|
|
try {
|
|
// eslint-disable-next-line es/no-object-defineproperty -- safe
|
|
Object.defineProperty(global, key, { value: value, configurable: true, writable: true });
|
|
} catch (error) {
|
|
global[key] = value;
|
|
} return value;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3656:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var definePropertyModule = __webpack_require__(2760);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
|
|
var SPECIES = wellKnownSymbol('species');
|
|
|
|
module.exports = function (CONSTRUCTOR_NAME) {
|
|
var Constructor = getBuiltIn(CONSTRUCTOR_NAME);
|
|
var defineProperty = definePropertyModule.f;
|
|
|
|
if (DESCRIPTORS && Constructor && !Constructor[SPECIES]) {
|
|
defineProperty(Constructor, SPECIES, {
|
|
configurable: true,
|
|
get: function () { return this; }
|
|
});
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1284:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var TO_STRING_TAG_SUPPORT = __webpack_require__(3471);
|
|
var defineProperty = __webpack_require__(2760).f;
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var toString = __webpack_require__(158);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var TO_STRING_TAG = wellKnownSymbol('toStringTag');
|
|
|
|
module.exports = function (it, TAG, STATIC, SET_METHOD) {
|
|
if (it) {
|
|
var target = STATIC ? it : it.prototype;
|
|
if (!hasOwn(target, TO_STRING_TAG)) {
|
|
defineProperty(target, TO_STRING_TAG, { configurable: true, value: TAG });
|
|
}
|
|
if (SET_METHOD && !TO_STRING_TAG_SUPPORT) {
|
|
createNonEnumerableProperty(target, 'toString', toString);
|
|
}
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9766:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var shared = __webpack_require__(8717);
|
|
var uid = __webpack_require__(2759);
|
|
|
|
var keys = shared('keys');
|
|
|
|
module.exports = function (key) {
|
|
return keys[key] || (keys[key] = uid(key));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6434:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var setGlobal = __webpack_require__(7613);
|
|
|
|
var SHARED = '__core-js_shared__';
|
|
var store = global[SHARED] || setGlobal(SHARED, {});
|
|
|
|
module.exports = store;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8717:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var IS_PURE = __webpack_require__(5546);
|
|
var store = __webpack_require__(6434);
|
|
|
|
(module.exports = function (key, value) {
|
|
return store[key] || (store[key] = value !== undefined ? value : {});
|
|
})('versions', []).push({
|
|
version: '3.18.2',
|
|
mode: IS_PURE ? 'pure' : 'global',
|
|
copyright: '© 2021 Denis Pushkarev (zloirock.ru)'
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4743:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var anObject = __webpack_require__(1138);
|
|
var aConstructor = __webpack_require__(1404);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var SPECIES = wellKnownSymbol('species');
|
|
|
|
// `SpeciesConstructor` abstract operation
|
|
// https://tc39.es/ecma262/#sec-speciesconstructor
|
|
module.exports = function (O, defaultConstructor) {
|
|
var C = anObject(O).constructor;
|
|
var S;
|
|
return C === undefined || (S = anObject(C)[SPECIES]) == undefined ? defaultConstructor : aConstructor(S);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 863:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var toIntegerOrInfinity = __webpack_require__(1941);
|
|
var toString = __webpack_require__(4845);
|
|
var requireObjectCoercible = __webpack_require__(3209);
|
|
|
|
var createMethod = function (CONVERT_TO_STRING) {
|
|
return function ($this, pos) {
|
|
var S = toString(requireObjectCoercible($this));
|
|
var position = toIntegerOrInfinity(pos);
|
|
var size = S.length;
|
|
var first, second;
|
|
if (position < 0 || position >= size) return CONVERT_TO_STRING ? '' : undefined;
|
|
first = S.charCodeAt(position);
|
|
return first < 0xD800 || first > 0xDBFF || position + 1 === size
|
|
|| (second = S.charCodeAt(position + 1)) < 0xDC00 || second > 0xDFFF
|
|
? CONVERT_TO_STRING ? S.charAt(position) : first
|
|
: CONVERT_TO_STRING ? S.slice(position, position + 2) : (first - 0xD800 << 10) + (second - 0xDC00) + 0x10000;
|
|
};
|
|
};
|
|
|
|
module.exports = {
|
|
// `String.prototype.codePointAt` method
|
|
// https://tc39.es/ecma262/#sec-string.prototype.codepointat
|
|
codeAt: createMethod(false),
|
|
// `String.prototype.at` method
|
|
// https://github.com/mathiasbynens/String.prototype.at
|
|
charAt: createMethod(true)
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7977:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
|
|
// based on https://github.com/bestiejs/punycode.js/blob/master/punycode.js
|
|
var maxInt = 2147483647; // aka. 0x7FFFFFFF or 2^31-1
|
|
var base = 36;
|
|
var tMin = 1;
|
|
var tMax = 26;
|
|
var skew = 38;
|
|
var damp = 700;
|
|
var initialBias = 72;
|
|
var initialN = 128; // 0x80
|
|
var delimiter = '-'; // '\x2D'
|
|
var regexNonASCII = /[^\0-\u007E]/; // non-ASCII chars
|
|
var regexSeparators = /[.\u3002\uFF0E\uFF61]/g; // RFC 3490 separators
|
|
var OVERFLOW_ERROR = 'Overflow: input needs wider integers to process';
|
|
var baseMinusTMin = base - tMin;
|
|
var floor = Math.floor;
|
|
var stringFromCharCode = String.fromCharCode;
|
|
|
|
/**
|
|
* Creates an array containing the numeric code points of each Unicode
|
|
* character in the string. While JavaScript uses UCS-2 internally,
|
|
* this function will convert a pair of surrogate halves (each of which
|
|
* UCS-2 exposes as separate characters) into a single code point,
|
|
* matching UTF-16.
|
|
*/
|
|
var ucs2decode = function (string) {
|
|
var output = [];
|
|
var counter = 0;
|
|
var length = string.length;
|
|
while (counter < length) {
|
|
var value = string.charCodeAt(counter++);
|
|
if (value >= 0xD800 && value <= 0xDBFF && counter < length) {
|
|
// It's a high surrogate, and there is a next character.
|
|
var extra = string.charCodeAt(counter++);
|
|
if ((extra & 0xFC00) == 0xDC00) { // Low surrogate.
|
|
output.push(((value & 0x3FF) << 10) + (extra & 0x3FF) + 0x10000);
|
|
} else {
|
|
// It's an unmatched surrogate; only append this code unit, in case the
|
|
// next code unit is the high surrogate of a surrogate pair.
|
|
output.push(value);
|
|
counter--;
|
|
}
|
|
} else {
|
|
output.push(value);
|
|
}
|
|
}
|
|
return output;
|
|
};
|
|
|
|
/**
|
|
* Converts a digit/integer into a basic code point.
|
|
*/
|
|
var digitToBasic = function (digit) {
|
|
// 0..25 map to ASCII a..z or A..Z
|
|
// 26..35 map to ASCII 0..9
|
|
return digit + 22 + 75 * (digit < 26);
|
|
};
|
|
|
|
/**
|
|
* Bias adaptation function as per section 3.4 of RFC 3492.
|
|
* https://tools.ietf.org/html/rfc3492#section-3.4
|
|
*/
|
|
var adapt = function (delta, numPoints, firstTime) {
|
|
var k = 0;
|
|
delta = firstTime ? floor(delta / damp) : delta >> 1;
|
|
delta += floor(delta / numPoints);
|
|
for (; delta > baseMinusTMin * tMax >> 1; k += base) {
|
|
delta = floor(delta / baseMinusTMin);
|
|
}
|
|
return floor(k + (baseMinusTMin + 1) * delta / (delta + skew));
|
|
};
|
|
|
|
/**
|
|
* Converts a string of Unicode symbols (e.g. a domain name label) to a
|
|
* Punycode string of ASCII-only symbols.
|
|
*/
|
|
// eslint-disable-next-line max-statements -- TODO
|
|
var encode = function (input) {
|
|
var output = [];
|
|
|
|
// Convert the input in UCS-2 to an array of Unicode code points.
|
|
input = ucs2decode(input);
|
|
|
|
// Cache the length.
|
|
var inputLength = input.length;
|
|
|
|
// Initialize the state.
|
|
var n = initialN;
|
|
var delta = 0;
|
|
var bias = initialBias;
|
|
var i, currentValue;
|
|
|
|
// Handle the basic code points.
|
|
for (i = 0; i < input.length; i++) {
|
|
currentValue = input[i];
|
|
if (currentValue < 0x80) {
|
|
output.push(stringFromCharCode(currentValue));
|
|
}
|
|
}
|
|
|
|
var basicLength = output.length; // number of basic code points.
|
|
var handledCPCount = basicLength; // number of code points that have been handled;
|
|
|
|
// Finish the basic string with a delimiter unless it's empty.
|
|
if (basicLength) {
|
|
output.push(delimiter);
|
|
}
|
|
|
|
// Main encoding loop:
|
|
while (handledCPCount < inputLength) {
|
|
// All non-basic code points < n have been handled already. Find the next larger one:
|
|
var m = maxInt;
|
|
for (i = 0; i < input.length; i++) {
|
|
currentValue = input[i];
|
|
if (currentValue >= n && currentValue < m) {
|
|
m = currentValue;
|
|
}
|
|
}
|
|
|
|
// Increase `delta` enough to advance the decoder's <n,i> state to <m,0>, but guard against overflow.
|
|
var handledCPCountPlusOne = handledCPCount + 1;
|
|
if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) {
|
|
throw RangeError(OVERFLOW_ERROR);
|
|
}
|
|
|
|
delta += (m - n) * handledCPCountPlusOne;
|
|
n = m;
|
|
|
|
for (i = 0; i < input.length; i++) {
|
|
currentValue = input[i];
|
|
if (currentValue < n && ++delta > maxInt) {
|
|
throw RangeError(OVERFLOW_ERROR);
|
|
}
|
|
if (currentValue == n) {
|
|
// Represent delta as a generalized variable-length integer.
|
|
var q = delta;
|
|
for (var k = base; /* no condition */; k += base) {
|
|
var t = k <= bias ? tMin : (k >= bias + tMax ? tMax : k - bias);
|
|
if (q < t) break;
|
|
var qMinusT = q - t;
|
|
var baseMinusT = base - t;
|
|
output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT)));
|
|
q = floor(qMinusT / baseMinusT);
|
|
}
|
|
|
|
output.push(stringFromCharCode(digitToBasic(q)));
|
|
bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength);
|
|
delta = 0;
|
|
++handledCPCount;
|
|
}
|
|
}
|
|
|
|
++delta;
|
|
++n;
|
|
}
|
|
return output.join('');
|
|
};
|
|
|
|
module.exports = function (input) {
|
|
var encoded = [];
|
|
var labels = input.toLowerCase().replace(regexSeparators, '\u002E').split('.');
|
|
var i, label;
|
|
for (i = 0; i < labels.length; i++) {
|
|
label = labels[i];
|
|
encoded.push(regexNonASCII.test(label) ? 'xn--' + encode(label) : label);
|
|
}
|
|
return encoded.join('.');
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6815:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var PROPER_FUNCTION_NAME = __webpack_require__(2282).PROPER;
|
|
var fails = __webpack_require__(6192);
|
|
var whitespaces = __webpack_require__(1450);
|
|
|
|
var non = '\u200B\u0085\u180E';
|
|
|
|
// check that a method works with the correct list
|
|
// of whitespaces and has a correct name
|
|
module.exports = function (METHOD_NAME) {
|
|
return fails(function () {
|
|
return !!whitespaces[METHOD_NAME]()
|
|
|| non[METHOD_NAME]() !== non
|
|
|| (PROPER_FUNCTION_NAME && whitespaces[METHOD_NAME].name !== METHOD_NAME);
|
|
});
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4277:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var requireObjectCoercible = __webpack_require__(3209);
|
|
var toString = __webpack_require__(4845);
|
|
var whitespaces = __webpack_require__(1450);
|
|
|
|
var whitespace = '[' + whitespaces + ']';
|
|
var ltrim = RegExp('^' + whitespace + whitespace + '*');
|
|
var rtrim = RegExp(whitespace + whitespace + '*$');
|
|
|
|
// `String.prototype.{ trim, trimStart, trimEnd, trimLeft, trimRight }` methods implementation
|
|
var createMethod = function (TYPE) {
|
|
return function ($this) {
|
|
var string = toString(requireObjectCoercible($this));
|
|
if (TYPE & 1) string = string.replace(ltrim, '');
|
|
if (TYPE & 2) string = string.replace(rtrim, '');
|
|
return string;
|
|
};
|
|
};
|
|
|
|
module.exports = {
|
|
// `String.prototype.{ trimLeft, trimStart }` methods
|
|
// https://tc39.es/ecma262/#sec-string.prototype.trimstart
|
|
start: createMethod(1),
|
|
// `String.prototype.{ trimRight, trimEnd }` methods
|
|
// https://tc39.es/ecma262/#sec-string.prototype.trimend
|
|
end: createMethod(2),
|
|
// `String.prototype.trim` method
|
|
// https://tc39.es/ecma262/#sec-string.prototype.trim
|
|
trim: createMethod(3)
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7160:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var isCallable = __webpack_require__(6447);
|
|
var fails = __webpack_require__(6192);
|
|
var bind = __webpack_require__(8043);
|
|
var html = __webpack_require__(7403);
|
|
var createElement = __webpack_require__(7449);
|
|
var IS_IOS = __webpack_require__(9536);
|
|
var IS_NODE = __webpack_require__(224);
|
|
|
|
var set = global.setImmediate;
|
|
var clear = global.clearImmediate;
|
|
var process = global.process;
|
|
var MessageChannel = global.MessageChannel;
|
|
var Dispatch = global.Dispatch;
|
|
var counter = 0;
|
|
var queue = {};
|
|
var ONREADYSTATECHANGE = 'onreadystatechange';
|
|
var location, defer, channel, port;
|
|
|
|
try {
|
|
// Deno throws a ReferenceError on `location` access without `--location` flag
|
|
location = global.location;
|
|
} catch (error) { /* empty */ }
|
|
|
|
var run = function (id) {
|
|
// eslint-disable-next-line no-prototype-builtins -- safe
|
|
if (queue.hasOwnProperty(id)) {
|
|
var fn = queue[id];
|
|
delete queue[id];
|
|
fn();
|
|
}
|
|
};
|
|
|
|
var runner = function (id) {
|
|
return function () {
|
|
run(id);
|
|
};
|
|
};
|
|
|
|
var listener = function (event) {
|
|
run(event.data);
|
|
};
|
|
|
|
var post = function (id) {
|
|
// old engines have not location.origin
|
|
global.postMessage(String(id), location.protocol + '//' + location.host);
|
|
};
|
|
|
|
// Node.js 0.9+ & IE10+ has setImmediate, otherwise:
|
|
if (!set || !clear) {
|
|
set = function setImmediate(fn) {
|
|
var args = [];
|
|
var argumentsLength = arguments.length;
|
|
var i = 1;
|
|
while (argumentsLength > i) args.push(arguments[i++]);
|
|
queue[++counter] = function () {
|
|
// eslint-disable-next-line no-new-func -- spec requirement
|
|
(isCallable(fn) ? fn : Function(fn)).apply(undefined, args);
|
|
};
|
|
defer(counter);
|
|
return counter;
|
|
};
|
|
clear = function clearImmediate(id) {
|
|
delete queue[id];
|
|
};
|
|
// Node.js 0.8-
|
|
if (IS_NODE) {
|
|
defer = function (id) {
|
|
process.nextTick(runner(id));
|
|
};
|
|
// Sphere (JS game engine) Dispatch API
|
|
} else if (Dispatch && Dispatch.now) {
|
|
defer = function (id) {
|
|
Dispatch.now(runner(id));
|
|
};
|
|
// Browsers with MessageChannel, includes WebWorkers
|
|
// except iOS - https://github.com/zloirock/core-js/issues/624
|
|
} else if (MessageChannel && !IS_IOS) {
|
|
channel = new MessageChannel();
|
|
port = channel.port2;
|
|
channel.port1.onmessage = listener;
|
|
defer = bind(port.postMessage, port, 1);
|
|
// Browsers with postMessage, skip WebWorkers
|
|
// IE8 has postMessage, but it's sync & typeof its postMessage is 'object'
|
|
} else if (
|
|
global.addEventListener &&
|
|
isCallable(global.postMessage) &&
|
|
!global.importScripts &&
|
|
location && location.protocol !== 'file:' &&
|
|
!fails(post)
|
|
) {
|
|
defer = post;
|
|
global.addEventListener('message', listener, false);
|
|
// IE8-
|
|
} else if (ONREADYSTATECHANGE in createElement('script')) {
|
|
defer = function (id) {
|
|
html.appendChild(createElement('script'))[ONREADYSTATECHANGE] = function () {
|
|
html.removeChild(this);
|
|
run(id);
|
|
};
|
|
};
|
|
// Rest old browsers
|
|
} else {
|
|
defer = function (id) {
|
|
setTimeout(runner(id), 0);
|
|
};
|
|
}
|
|
}
|
|
|
|
module.exports = {
|
|
set: set,
|
|
clear: clear
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7739:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var toIntegerOrInfinity = __webpack_require__(1941);
|
|
|
|
var max = Math.max;
|
|
var min = Math.min;
|
|
|
|
// Helper for a popular repeating case of the spec:
|
|
// Let integer be ? ToInteger(index).
|
|
// If integer < 0, let result be max((length + integer), 0); else let result be min(integer, length).
|
|
module.exports = function (index, length) {
|
|
var integer = toIntegerOrInfinity(index);
|
|
return integer < 0 ? max(integer + length, 0) : min(integer, length);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 101:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
// toObject with fallback for non-array-like ES3 strings
|
|
var IndexedObject = __webpack_require__(2202);
|
|
var requireObjectCoercible = __webpack_require__(3209);
|
|
|
|
module.exports = function (it) {
|
|
return IndexedObject(requireObjectCoercible(it));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1941:
|
|
/***/ (function(module) {
|
|
|
|
var ceil = Math.ceil;
|
|
var floor = Math.floor;
|
|
|
|
// `ToIntegerOrInfinity` abstract operation
|
|
// https://tc39.es/ecma262/#sec-tointegerorinfinity
|
|
module.exports = function (argument) {
|
|
var number = +argument;
|
|
// eslint-disable-next-line no-self-compare -- safe
|
|
return number !== number || number === 0 ? 0 : (number > 0 ? floor : ceil)(number);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8445:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var toIntegerOrInfinity = __webpack_require__(1941);
|
|
|
|
var min = Math.min;
|
|
|
|
// `ToLength` abstract operation
|
|
// https://tc39.es/ecma262/#sec-tolength
|
|
module.exports = function (argument) {
|
|
return argument > 0 ? min(toIntegerOrInfinity(argument), 0x1FFFFFFFFFFFFF) : 0; // 2 ** 53 - 1 == 9007199254740991
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1795:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var requireObjectCoercible = __webpack_require__(3209);
|
|
|
|
// `ToObject` abstract operation
|
|
// https://tc39.es/ecma262/#sec-toobject
|
|
module.exports = function (argument) {
|
|
return Object(requireObjectCoercible(argument));
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7888:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var isObject = __webpack_require__(5744);
|
|
var isSymbol = __webpack_require__(3236);
|
|
var getMethod = __webpack_require__(5037);
|
|
var ordinaryToPrimitive = __webpack_require__(380);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var TO_PRIMITIVE = wellKnownSymbol('toPrimitive');
|
|
|
|
// `ToPrimitive` abstract operation
|
|
// https://tc39.es/ecma262/#sec-toprimitive
|
|
module.exports = function (input, pref) {
|
|
if (!isObject(input) || isSymbol(input)) return input;
|
|
var exoticToPrim = getMethod(input, TO_PRIMITIVE);
|
|
var result;
|
|
if (exoticToPrim) {
|
|
if (pref === undefined) pref = 'default';
|
|
result = exoticToPrim.call(input, pref);
|
|
if (!isObject(result) || isSymbol(result)) return result;
|
|
throw TypeError("Can't convert object to primitive value");
|
|
}
|
|
if (pref === undefined) pref = 'number';
|
|
return ordinaryToPrimitive(input, pref);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 77:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var toPrimitive = __webpack_require__(7888);
|
|
var isSymbol = __webpack_require__(3236);
|
|
|
|
// `ToPropertyKey` abstract operation
|
|
// https://tc39.es/ecma262/#sec-topropertykey
|
|
module.exports = function (argument) {
|
|
var key = toPrimitive(argument, 'string');
|
|
return isSymbol(key) ? key : String(key);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3471:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var TO_STRING_TAG = wellKnownSymbol('toStringTag');
|
|
var test = {};
|
|
|
|
test[TO_STRING_TAG] = 'z';
|
|
|
|
module.exports = String(test) === '[object z]';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4845:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var classof = __webpack_require__(4696);
|
|
|
|
module.exports = function (argument) {
|
|
if (classof(argument) === 'Symbol') throw TypeError('Cannot convert a Symbol value to a string');
|
|
return String(argument);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9288:
|
|
/***/ (function(module) {
|
|
|
|
module.exports = function (argument) {
|
|
try {
|
|
return String(argument);
|
|
} catch (error) {
|
|
return 'Object';
|
|
}
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2759:
|
|
/***/ (function(module) {
|
|
|
|
var id = 0;
|
|
var postfix = Math.random();
|
|
|
|
module.exports = function (key) {
|
|
return 'Symbol(' + String(key === undefined ? '' : key) + ')_' + (++id + postfix).toString(36);
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 615:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
/* eslint-disable es/no-symbol -- required for testing */
|
|
var NATIVE_SYMBOL = __webpack_require__(3045);
|
|
|
|
module.exports = NATIVE_SYMBOL
|
|
&& !Symbol.sham
|
|
&& typeof Symbol.iterator == 'symbol';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9207:
|
|
/***/ (function(__unused_webpack_module, exports, __webpack_require__) {
|
|
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
exports.f = wellKnownSymbol;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8182:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var shared = __webpack_require__(8717);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var uid = __webpack_require__(2759);
|
|
var NATIVE_SYMBOL = __webpack_require__(3045);
|
|
var USE_SYMBOL_AS_UID = __webpack_require__(615);
|
|
|
|
var WellKnownSymbolsStore = shared('wks');
|
|
var Symbol = global.Symbol;
|
|
var createWellKnownSymbol = USE_SYMBOL_AS_UID ? Symbol : Symbol && Symbol.withoutSetter || uid;
|
|
|
|
module.exports = function (name) {
|
|
if (!hasOwn(WellKnownSymbolsStore, name) || !(NATIVE_SYMBOL || typeof WellKnownSymbolsStore[name] == 'string')) {
|
|
if (NATIVE_SYMBOL && hasOwn(Symbol, name)) {
|
|
WellKnownSymbolsStore[name] = Symbol[name];
|
|
} else {
|
|
WellKnownSymbolsStore[name] = createWellKnownSymbol('Symbol.' + name);
|
|
}
|
|
} return WellKnownSymbolsStore[name];
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1450:
|
|
/***/ (function(module) {
|
|
|
|
// a string of all valid unicode whitespaces
|
|
module.exports = '\u0009\u000A\u000B\u000C\u000D\u0020\u00A0\u1680\u2000\u2001\u2002' +
|
|
'\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200A\u202F\u205F\u3000\u2028\u2029\uFEFF';
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4242:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var getPrototypeOf = __webpack_require__(9341);
|
|
var setPrototypeOf = __webpack_require__(4469);
|
|
var create = __webpack_require__(2853);
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
var createPropertyDescriptor = __webpack_require__(774);
|
|
var installErrorCause = __webpack_require__(273);
|
|
var iterate = __webpack_require__(3442);
|
|
var toString = __webpack_require__(4845);
|
|
|
|
var $AggregateError = function AggregateError(errors, message /* , options */) {
|
|
var that = this;
|
|
var options = arguments.length > 2 ? arguments[2] : undefined;
|
|
if (!(that instanceof $AggregateError)) return new $AggregateError(errors, message, options);
|
|
if (setPrototypeOf) {
|
|
// eslint-disable-next-line unicorn/error-message -- expected
|
|
that = setPrototypeOf(new Error(undefined), getPrototypeOf(that));
|
|
}
|
|
if (message !== undefined) createNonEnumerableProperty(that, 'message', toString(message));
|
|
installErrorCause(that, options);
|
|
var errorsArray = [];
|
|
iterate(errors, errorsArray.push, { that: errorsArray });
|
|
createNonEnumerableProperty(that, 'errors', errorsArray);
|
|
return that;
|
|
};
|
|
|
|
$AggregateError.prototype = create(Error.prototype, {
|
|
constructor: createPropertyDescriptor(5, $AggregateError),
|
|
message: createPropertyDescriptor(5, ''),
|
|
name: createPropertyDescriptor(5, 'AggregateError')
|
|
});
|
|
|
|
// `AggregateError` constructor
|
|
// https://tc39.es/ecma262/#sec-aggregate-error-constructor
|
|
$({ global: true }, {
|
|
AggregateError: $AggregateError
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9106:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var fails = __webpack_require__(6192);
|
|
var isArray = __webpack_require__(4770);
|
|
var isObject = __webpack_require__(5744);
|
|
var toObject = __webpack_require__(1795);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
var createProperty = __webpack_require__(9361);
|
|
var arraySpeciesCreate = __webpack_require__(1321);
|
|
var arrayMethodHasSpeciesSupport = __webpack_require__(242);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var V8_VERSION = __webpack_require__(4218);
|
|
|
|
var IS_CONCAT_SPREADABLE = wellKnownSymbol('isConcatSpreadable');
|
|
var MAX_SAFE_INTEGER = 0x1FFFFFFFFFFFFF;
|
|
var MAXIMUM_ALLOWED_INDEX_EXCEEDED = 'Maximum allowed index exceeded';
|
|
|
|
// We can't use this feature detection in V8 since it causes
|
|
// deoptimization and serious performance degradation
|
|
// https://github.com/zloirock/core-js/issues/679
|
|
var IS_CONCAT_SPREADABLE_SUPPORT = V8_VERSION >= 51 || !fails(function () {
|
|
var array = [];
|
|
array[IS_CONCAT_SPREADABLE] = false;
|
|
return array.concat()[0] !== array;
|
|
});
|
|
|
|
var SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('concat');
|
|
|
|
var isConcatSpreadable = function (O) {
|
|
if (!isObject(O)) return false;
|
|
var spreadable = O[IS_CONCAT_SPREADABLE];
|
|
return spreadable !== undefined ? !!spreadable : isArray(O);
|
|
};
|
|
|
|
var FORCED = !IS_CONCAT_SPREADABLE_SUPPORT || !SPECIES_SUPPORT;
|
|
|
|
// `Array.prototype.concat` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.concat
|
|
// with adding support of @@isConcatSpreadable and @@species
|
|
$({ target: 'Array', proto: true, forced: FORCED }, {
|
|
// eslint-disable-next-line no-unused-vars -- required for `.length`
|
|
concat: function concat(arg) {
|
|
var O = toObject(this);
|
|
var A = arraySpeciesCreate(O, 0);
|
|
var n = 0;
|
|
var i, k, length, len, E;
|
|
for (i = -1, length = arguments.length; i < length; i++) {
|
|
E = i === -1 ? O : arguments[i];
|
|
if (isConcatSpreadable(E)) {
|
|
len = lengthOfArrayLike(E);
|
|
if (n + len > MAX_SAFE_INTEGER) throw TypeError(MAXIMUM_ALLOWED_INDEX_EXCEEDED);
|
|
for (k = 0; k < len; k++, n++) if (k in E) createProperty(A, n, E[k]);
|
|
} else {
|
|
if (n >= MAX_SAFE_INTEGER) throw TypeError(MAXIMUM_ALLOWED_INDEX_EXCEEDED);
|
|
createProperty(A, n++, E);
|
|
}
|
|
}
|
|
A.length = n;
|
|
return A;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1710:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var fill = __webpack_require__(2724);
|
|
var addToUnscopables = __webpack_require__(7423);
|
|
|
|
// `Array.prototype.fill` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.fill
|
|
$({ target: 'Array', proto: true }, {
|
|
fill: fill
|
|
});
|
|
|
|
// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables
|
|
addToUnscopables('fill');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3436:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var $filter = __webpack_require__(454).filter;
|
|
var arrayMethodHasSpeciesSupport = __webpack_require__(242);
|
|
|
|
var HAS_SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('filter');
|
|
|
|
// `Array.prototype.filter` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.filter
|
|
// with adding support of @@species
|
|
$({ target: 'Array', proto: true, forced: !HAS_SPECIES_SUPPORT }, {
|
|
filter: function filter(callbackfn /* , thisArg */) {
|
|
return $filter(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined);
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9823:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var forEach = __webpack_require__(7397);
|
|
|
|
// `Array.prototype.forEach` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.foreach
|
|
// eslint-disable-next-line es/no-array-prototype-foreach -- safe
|
|
$({ target: 'Array', proto: true, forced: [].forEach != forEach }, {
|
|
forEach: forEach
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9173:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var from = __webpack_require__(841);
|
|
var checkCorrectnessOfIteration = __webpack_require__(9770);
|
|
|
|
var INCORRECT_ITERATION = !checkCorrectnessOfIteration(function (iterable) {
|
|
// eslint-disable-next-line es/no-array-from -- required for testing
|
|
Array.from(iterable);
|
|
});
|
|
|
|
// `Array.from` method
|
|
// https://tc39.es/ecma262/#sec-array.from
|
|
$({ target: 'Array', stat: true, forced: INCORRECT_ITERATION }, {
|
|
from: from
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2276:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
/* eslint-disable es/no-array-prototype-indexof -- required for testing */
|
|
var $ = __webpack_require__(3085);
|
|
var $indexOf = __webpack_require__(8180).indexOf;
|
|
var arrayMethodIsStrict = __webpack_require__(424);
|
|
|
|
var nativeIndexOf = [].indexOf;
|
|
|
|
var NEGATIVE_ZERO = !!nativeIndexOf && 1 / [1].indexOf(1, -0) < 0;
|
|
var STRICT_METHOD = arrayMethodIsStrict('indexOf');
|
|
|
|
// `Array.prototype.indexOf` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.indexof
|
|
$({ target: 'Array', proto: true, forced: NEGATIVE_ZERO || !STRICT_METHOD }, {
|
|
indexOf: function indexOf(searchElement /* , fromIndex = 0 */) {
|
|
return NEGATIVE_ZERO
|
|
// convert -0 to +0
|
|
? nativeIndexOf.apply(this, arguments) || 0
|
|
: $indexOf(this, searchElement, arguments.length > 1 ? arguments[1] : undefined);
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8118:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var isArray = __webpack_require__(4770);
|
|
|
|
// `Array.isArray` method
|
|
// https://tc39.es/ecma262/#sec-array.isarray
|
|
$({ target: 'Array', stat: true }, {
|
|
isArray: isArray
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8939:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var toIndexedObject = __webpack_require__(101);
|
|
var addToUnscopables = __webpack_require__(7423);
|
|
var Iterators = __webpack_require__(7771);
|
|
var InternalStateModule = __webpack_require__(3326);
|
|
var defineIterator = __webpack_require__(7218);
|
|
|
|
var ARRAY_ITERATOR = 'Array Iterator';
|
|
var setInternalState = InternalStateModule.set;
|
|
var getInternalState = InternalStateModule.getterFor(ARRAY_ITERATOR);
|
|
|
|
// `Array.prototype.entries` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.entries
|
|
// `Array.prototype.keys` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.keys
|
|
// `Array.prototype.values` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.values
|
|
// `Array.prototype[@@iterator]` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype-@@iterator
|
|
// `CreateArrayIterator` internal method
|
|
// https://tc39.es/ecma262/#sec-createarrayiterator
|
|
module.exports = defineIterator(Array, 'Array', function (iterated, kind) {
|
|
setInternalState(this, {
|
|
type: ARRAY_ITERATOR,
|
|
target: toIndexedObject(iterated), // target
|
|
index: 0, // next index
|
|
kind: kind // kind
|
|
});
|
|
// `%ArrayIteratorPrototype%.next` method
|
|
// https://tc39.es/ecma262/#sec-%arrayiteratorprototype%.next
|
|
}, function () {
|
|
var state = getInternalState(this);
|
|
var target = state.target;
|
|
var kind = state.kind;
|
|
var index = state.index++;
|
|
if (!target || index >= target.length) {
|
|
state.target = undefined;
|
|
return { value: undefined, done: true };
|
|
}
|
|
if (kind == 'keys') return { value: index, done: false };
|
|
if (kind == 'values') return { value: target[index], done: false };
|
|
return { value: [index, target[index]], done: false };
|
|
}, 'values');
|
|
|
|
// argumentsList[@@iterator] is %ArrayProto_values%
|
|
// https://tc39.es/ecma262/#sec-createunmappedargumentsobject
|
|
// https://tc39.es/ecma262/#sec-createmappedargumentsobject
|
|
Iterators.Arguments = Iterators.Array;
|
|
|
|
// https://tc39.es/ecma262/#sec-array.prototype-@@unscopables
|
|
addToUnscopables('keys');
|
|
addToUnscopables('values');
|
|
addToUnscopables('entries');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3838:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var $map = __webpack_require__(454).map;
|
|
var arrayMethodHasSpeciesSupport = __webpack_require__(242);
|
|
|
|
var HAS_SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('map');
|
|
|
|
// `Array.prototype.map` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.map
|
|
// with adding support of @@species
|
|
$({ target: 'Array', proto: true, forced: !HAS_SPECIES_SUPPORT }, {
|
|
map: function map(callbackfn /* , thisArg */) {
|
|
return $map(this, callbackfn, arguments.length > 1 ? arguments[1] : undefined);
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5818:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var isArray = __webpack_require__(4770);
|
|
var isConstructor = __webpack_require__(2091);
|
|
var isObject = __webpack_require__(5744);
|
|
var toAbsoluteIndex = __webpack_require__(7739);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
var toIndexedObject = __webpack_require__(101);
|
|
var createProperty = __webpack_require__(9361);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var arrayMethodHasSpeciesSupport = __webpack_require__(242);
|
|
|
|
var HAS_SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('slice');
|
|
|
|
var SPECIES = wellKnownSymbol('species');
|
|
var nativeSlice = [].slice;
|
|
var max = Math.max;
|
|
|
|
// `Array.prototype.slice` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.slice
|
|
// fallback for not array-like ES3 strings and DOM objects
|
|
$({ target: 'Array', proto: true, forced: !HAS_SPECIES_SUPPORT }, {
|
|
slice: function slice(start, end) {
|
|
var O = toIndexedObject(this);
|
|
var length = lengthOfArrayLike(O);
|
|
var k = toAbsoluteIndex(start, length);
|
|
var fin = toAbsoluteIndex(end === undefined ? length : end, length);
|
|
// inline `ArraySpeciesCreate` for usage native `Array#slice` where it's possible
|
|
var Constructor, result, n;
|
|
if (isArray(O)) {
|
|
Constructor = O.constructor;
|
|
// cross-realm fallback
|
|
if (isConstructor(Constructor) && (Constructor === Array || isArray(Constructor.prototype))) {
|
|
Constructor = undefined;
|
|
} else if (isObject(Constructor)) {
|
|
Constructor = Constructor[SPECIES];
|
|
if (Constructor === null) Constructor = undefined;
|
|
}
|
|
if (Constructor === Array || Constructor === undefined) {
|
|
return nativeSlice.call(O, k, fin);
|
|
}
|
|
}
|
|
result = new (Constructor === undefined ? Array : Constructor)(max(fin - k, 0));
|
|
for (n = 0; k < fin; k++, n++) if (k in O) createProperty(result, n, O[k]);
|
|
result.length = n;
|
|
return result;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2178:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var toAbsoluteIndex = __webpack_require__(7739);
|
|
var toIntegerOrInfinity = __webpack_require__(1941);
|
|
var lengthOfArrayLike = __webpack_require__(4104);
|
|
var toObject = __webpack_require__(1795);
|
|
var arraySpeciesCreate = __webpack_require__(1321);
|
|
var createProperty = __webpack_require__(9361);
|
|
var arrayMethodHasSpeciesSupport = __webpack_require__(242);
|
|
|
|
var HAS_SPECIES_SUPPORT = arrayMethodHasSpeciesSupport('splice');
|
|
|
|
var max = Math.max;
|
|
var min = Math.min;
|
|
var MAX_SAFE_INTEGER = 0x1FFFFFFFFFFFFF;
|
|
var MAXIMUM_ALLOWED_LENGTH_EXCEEDED = 'Maximum allowed length exceeded';
|
|
|
|
// `Array.prototype.splice` method
|
|
// https://tc39.es/ecma262/#sec-array.prototype.splice
|
|
// with adding support of @@species
|
|
$({ target: 'Array', proto: true, forced: !HAS_SPECIES_SUPPORT }, {
|
|
splice: function splice(start, deleteCount /* , ...items */) {
|
|
var O = toObject(this);
|
|
var len = lengthOfArrayLike(O);
|
|
var actualStart = toAbsoluteIndex(start, len);
|
|
var argumentsLength = arguments.length;
|
|
var insertCount, actualDeleteCount, A, k, from, to;
|
|
if (argumentsLength === 0) {
|
|
insertCount = actualDeleteCount = 0;
|
|
} else if (argumentsLength === 1) {
|
|
insertCount = 0;
|
|
actualDeleteCount = len - actualStart;
|
|
} else {
|
|
insertCount = argumentsLength - 2;
|
|
actualDeleteCount = min(max(toIntegerOrInfinity(deleteCount), 0), len - actualStart);
|
|
}
|
|
if (len + insertCount - actualDeleteCount > MAX_SAFE_INTEGER) {
|
|
throw TypeError(MAXIMUM_ALLOWED_LENGTH_EXCEEDED);
|
|
}
|
|
A = arraySpeciesCreate(O, actualDeleteCount);
|
|
for (k = 0; k < actualDeleteCount; k++) {
|
|
from = actualStart + k;
|
|
if (from in O) createProperty(A, k, O[from]);
|
|
}
|
|
A.length = actualDeleteCount;
|
|
if (insertCount < actualDeleteCount) {
|
|
for (k = actualStart; k < len - actualDeleteCount; k++) {
|
|
from = k + actualDeleteCount;
|
|
to = k + insertCount;
|
|
if (from in O) O[to] = O[from];
|
|
else delete O[to];
|
|
}
|
|
for (k = len; k > len - actualDeleteCount + insertCount; k--) delete O[k - 1];
|
|
} else if (insertCount > actualDeleteCount) {
|
|
for (k = len - actualDeleteCount; k > actualStart; k--) {
|
|
from = k + actualDeleteCount - 1;
|
|
to = k + insertCount - 1;
|
|
if (from in O) O[to] = O[from];
|
|
else delete O[to];
|
|
}
|
|
}
|
|
for (k = 0; k < insertCount; k++) {
|
|
O[k + actualStart] = arguments[k + 2];
|
|
}
|
|
O.length = len - actualDeleteCount + insertCount;
|
|
return A;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 665:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var bind = __webpack_require__(6782);
|
|
|
|
// `Function.prototype.bind` method
|
|
// https://tc39.es/ecma262/#sec-function.prototype.bind
|
|
$({ target: 'Function', proto: true }, {
|
|
bind: bind
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8671:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var global = __webpack_require__(8576);
|
|
var setToStringTag = __webpack_require__(1284);
|
|
|
|
// JSON[@@toStringTag] property
|
|
// https://tc39.es/ecma262/#sec-json-@@tostringtag
|
|
setToStringTag(global.JSON, 'JSON', true);
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8556:
|
|
/***/ (function() {
|
|
|
|
// empty
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2666:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var parseInt = __webpack_require__(2558);
|
|
|
|
// `Number.parseInt` method
|
|
// https://tc39.es/ecma262/#sec-number.parseint
|
|
// eslint-disable-next-line es/no-number-parseint -- required for testing
|
|
$({ target: 'Number', stat: true, forced: Number.parseInt != parseInt }, {
|
|
parseInt: parseInt
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3113:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var create = __webpack_require__(2853);
|
|
|
|
// `Object.create` method
|
|
// https://tc39.es/ecma262/#sec-object.create
|
|
$({ target: 'Object', stat: true, sham: !DESCRIPTORS }, {
|
|
create: create
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 297:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var objectDefinePropertyModile = __webpack_require__(2760);
|
|
|
|
// `Object.defineProperty` method
|
|
// https://tc39.es/ecma262/#sec-object.defineproperty
|
|
$({ target: 'Object', stat: true, forced: !DESCRIPTORS, sham: !DESCRIPTORS }, {
|
|
defineProperty: objectDefinePropertyModile.f
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9234:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var fails = __webpack_require__(6192);
|
|
var toObject = __webpack_require__(1795);
|
|
var nativeGetPrototypeOf = __webpack_require__(9341);
|
|
var CORRECT_PROTOTYPE_GETTER = __webpack_require__(4635);
|
|
|
|
var FAILS_ON_PRIMITIVES = fails(function () { nativeGetPrototypeOf(1); });
|
|
|
|
// `Object.getPrototypeOf` method
|
|
// https://tc39.es/ecma262/#sec-object.getprototypeof
|
|
$({ target: 'Object', stat: true, forced: FAILS_ON_PRIMITIVES, sham: !CORRECT_PROTOTYPE_GETTER }, {
|
|
getPrototypeOf: function getPrototypeOf(it) {
|
|
return nativeGetPrototypeOf(toObject(it));
|
|
}
|
|
});
|
|
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2647:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var toObject = __webpack_require__(1795);
|
|
var nativeKeys = __webpack_require__(7653);
|
|
var fails = __webpack_require__(6192);
|
|
|
|
var FAILS_ON_PRIMITIVES = fails(function () { nativeKeys(1); });
|
|
|
|
// `Object.keys` method
|
|
// https://tc39.es/ecma262/#sec-object.keys
|
|
$({ target: 'Object', stat: true, forced: FAILS_ON_PRIMITIVES }, {
|
|
keys: function keys(it) {
|
|
return nativeKeys(toObject(it));
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3222:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var setPrototypeOf = __webpack_require__(4469);
|
|
|
|
// `Object.setPrototypeOf` method
|
|
// https://tc39.es/ecma262/#sec-object.setprototypeof
|
|
$({ target: 'Object', stat: true }, {
|
|
setPrototypeOf: setPrototypeOf
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6663:
|
|
/***/ (function() {
|
|
|
|
// empty
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4859:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var $parseFloat = __webpack_require__(15);
|
|
|
|
// `parseFloat` method
|
|
// https://tc39.es/ecma262/#sec-parsefloat-string
|
|
$({ global: true, forced: parseFloat != $parseFloat }, {
|
|
parseFloat: $parseFloat
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5706:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var $parseInt = __webpack_require__(2558);
|
|
|
|
// `parseInt` method
|
|
// https://tc39.es/ecma262/#sec-parseint-string-radix
|
|
$({ global: true, forced: parseInt != $parseInt }, {
|
|
parseInt: $parseInt
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7884:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var aCallable = __webpack_require__(6235);
|
|
var newPromiseCapabilityModule = __webpack_require__(9438);
|
|
var perform = __webpack_require__(892);
|
|
var iterate = __webpack_require__(3442);
|
|
|
|
// `Promise.allSettled` method
|
|
// https://tc39.es/ecma262/#sec-promise.allsettled
|
|
$({ target: 'Promise', stat: true }, {
|
|
allSettled: function allSettled(iterable) {
|
|
var C = this;
|
|
var capability = newPromiseCapabilityModule.f(C);
|
|
var resolve = capability.resolve;
|
|
var reject = capability.reject;
|
|
var result = perform(function () {
|
|
var promiseResolve = aCallable(C.resolve);
|
|
var values = [];
|
|
var counter = 0;
|
|
var remaining = 1;
|
|
iterate(iterable, function (promise) {
|
|
var index = counter++;
|
|
var alreadyCalled = false;
|
|
values.push(undefined);
|
|
remaining++;
|
|
promiseResolve.call(C, promise).then(function (value) {
|
|
if (alreadyCalled) return;
|
|
alreadyCalled = true;
|
|
values[index] = { status: 'fulfilled', value: value };
|
|
--remaining || resolve(values);
|
|
}, function (error) {
|
|
if (alreadyCalled) return;
|
|
alreadyCalled = true;
|
|
values[index] = { status: 'rejected', reason: error };
|
|
--remaining || resolve(values);
|
|
});
|
|
});
|
|
--remaining || resolve(values);
|
|
});
|
|
if (result.error) reject(result.value);
|
|
return capability.promise;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8885:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var aCallable = __webpack_require__(6235);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var newPromiseCapabilityModule = __webpack_require__(9438);
|
|
var perform = __webpack_require__(892);
|
|
var iterate = __webpack_require__(3442);
|
|
|
|
var PROMISE_ANY_ERROR = 'No one promise resolved';
|
|
|
|
// `Promise.any` method
|
|
// https://tc39.es/ecma262/#sec-promise.any
|
|
$({ target: 'Promise', stat: true }, {
|
|
any: function any(iterable) {
|
|
var C = this;
|
|
var capability = newPromiseCapabilityModule.f(C);
|
|
var resolve = capability.resolve;
|
|
var reject = capability.reject;
|
|
var result = perform(function () {
|
|
var promiseResolve = aCallable(C.resolve);
|
|
var errors = [];
|
|
var counter = 0;
|
|
var remaining = 1;
|
|
var alreadyResolved = false;
|
|
iterate(iterable, function (promise) {
|
|
var index = counter++;
|
|
var alreadyRejected = false;
|
|
errors.push(undefined);
|
|
remaining++;
|
|
promiseResolve.call(C, promise).then(function (value) {
|
|
if (alreadyRejected || alreadyResolved) return;
|
|
alreadyResolved = true;
|
|
resolve(value);
|
|
}, function (error) {
|
|
if (alreadyRejected || alreadyResolved) return;
|
|
alreadyRejected = true;
|
|
errors[index] = error;
|
|
--remaining || reject(new (getBuiltIn('AggregateError'))(errors, PROMISE_ANY_ERROR));
|
|
});
|
|
});
|
|
--remaining || reject(new (getBuiltIn('AggregateError'))(errors, PROMISE_ANY_ERROR));
|
|
});
|
|
if (result.error) reject(result.value);
|
|
return capability.promise;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1868:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var IS_PURE = __webpack_require__(5546);
|
|
var NativePromise = __webpack_require__(4471);
|
|
var fails = __webpack_require__(6192);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var isCallable = __webpack_require__(6447);
|
|
var speciesConstructor = __webpack_require__(4743);
|
|
var promiseResolve = __webpack_require__(9126);
|
|
var redefine = __webpack_require__(9482);
|
|
|
|
// Safari bug https://bugs.webkit.org/show_bug.cgi?id=200829
|
|
var NON_GENERIC = !!NativePromise && fails(function () {
|
|
NativePromise.prototype['finally'].call({ then: function () { /* empty */ } }, function () { /* empty */ });
|
|
});
|
|
|
|
// `Promise.prototype.finally` method
|
|
// https://tc39.es/ecma262/#sec-promise.prototype.finally
|
|
$({ target: 'Promise', proto: true, real: true, forced: NON_GENERIC }, {
|
|
'finally': function (onFinally) {
|
|
var C = speciesConstructor(this, getBuiltIn('Promise'));
|
|
var isFunction = isCallable(onFinally);
|
|
return this.then(
|
|
isFunction ? function (x) {
|
|
return promiseResolve(C, onFinally()).then(function () { return x; });
|
|
} : onFinally,
|
|
isFunction ? function (e) {
|
|
return promiseResolve(C, onFinally()).then(function () { throw e; });
|
|
} : onFinally
|
|
);
|
|
}
|
|
});
|
|
|
|
// makes sure that native promise-based APIs `Promise#finally` properly works with patched `Promise#then`
|
|
if (!IS_PURE && isCallable(NativePromise)) {
|
|
var method = getBuiltIn('Promise').prototype['finally'];
|
|
if (NativePromise.prototype['finally'] !== method) {
|
|
redefine(NativePromise.prototype, 'finally', method, { unsafe: true });
|
|
}
|
|
}
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9021:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var IS_PURE = __webpack_require__(5546);
|
|
var global = __webpack_require__(8576);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var NativePromise = __webpack_require__(4471);
|
|
var redefine = __webpack_require__(9482);
|
|
var redefineAll = __webpack_require__(533);
|
|
var setPrototypeOf = __webpack_require__(4469);
|
|
var setToStringTag = __webpack_require__(1284);
|
|
var setSpecies = __webpack_require__(3656);
|
|
var aCallable = __webpack_require__(6235);
|
|
var isCallable = __webpack_require__(6447);
|
|
var isObject = __webpack_require__(5744);
|
|
var anInstance = __webpack_require__(6961);
|
|
var inspectSource = __webpack_require__(9516);
|
|
var iterate = __webpack_require__(3442);
|
|
var checkCorrectnessOfIteration = __webpack_require__(9770);
|
|
var speciesConstructor = __webpack_require__(4743);
|
|
var task = __webpack_require__(7160).set;
|
|
var microtask = __webpack_require__(2950);
|
|
var promiseResolve = __webpack_require__(9126);
|
|
var hostReportErrors = __webpack_require__(3681);
|
|
var newPromiseCapabilityModule = __webpack_require__(9438);
|
|
var perform = __webpack_require__(892);
|
|
var InternalStateModule = __webpack_require__(3326);
|
|
var isForced = __webpack_require__(9245);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var IS_BROWSER = __webpack_require__(2957);
|
|
var IS_NODE = __webpack_require__(224);
|
|
var V8_VERSION = __webpack_require__(4218);
|
|
|
|
var SPECIES = wellKnownSymbol('species');
|
|
var PROMISE = 'Promise';
|
|
var getInternalState = InternalStateModule.get;
|
|
var setInternalState = InternalStateModule.set;
|
|
var getInternalPromiseState = InternalStateModule.getterFor(PROMISE);
|
|
var NativePromisePrototype = NativePromise && NativePromise.prototype;
|
|
var PromiseConstructor = NativePromise;
|
|
var PromiseConstructorPrototype = NativePromisePrototype;
|
|
var TypeError = global.TypeError;
|
|
var document = global.document;
|
|
var process = global.process;
|
|
var newPromiseCapability = newPromiseCapabilityModule.f;
|
|
var newGenericPromiseCapability = newPromiseCapability;
|
|
var DISPATCH_EVENT = !!(document && document.createEvent && global.dispatchEvent);
|
|
var NATIVE_REJECTION_EVENT = isCallable(global.PromiseRejectionEvent);
|
|
var UNHANDLED_REJECTION = 'unhandledrejection';
|
|
var REJECTION_HANDLED = 'rejectionhandled';
|
|
var PENDING = 0;
|
|
var FULFILLED = 1;
|
|
var REJECTED = 2;
|
|
var HANDLED = 1;
|
|
var UNHANDLED = 2;
|
|
var SUBCLASSING = false;
|
|
var Internal, OwnPromiseCapability, PromiseWrapper, nativeThen;
|
|
|
|
var FORCED = isForced(PROMISE, function () {
|
|
var PROMISE_CONSTRUCTOR_SOURCE = inspectSource(PromiseConstructor);
|
|
var GLOBAL_CORE_JS_PROMISE = PROMISE_CONSTRUCTOR_SOURCE !== String(PromiseConstructor);
|
|
// V8 6.6 (Node 10 and Chrome 66) have a bug with resolving custom thenables
|
|
// https://bugs.chromium.org/p/chromium/issues/detail?id=830565
|
|
// We can't detect it synchronously, so just check versions
|
|
if (!GLOBAL_CORE_JS_PROMISE && V8_VERSION === 66) return true;
|
|
// We need Promise#finally in the pure version for preventing prototype pollution
|
|
if (IS_PURE && !PromiseConstructorPrototype['finally']) return true;
|
|
// We can't use @@species feature detection in V8 since it causes
|
|
// deoptimization and performance degradation
|
|
// https://github.com/zloirock/core-js/issues/679
|
|
if (V8_VERSION >= 51 && /native code/.test(PROMISE_CONSTRUCTOR_SOURCE)) return false;
|
|
// Detect correctness of subclassing with @@species support
|
|
var promise = new PromiseConstructor(function (resolve) { resolve(1); });
|
|
var FakePromise = function (exec) {
|
|
exec(function () { /* empty */ }, function () { /* empty */ });
|
|
};
|
|
var constructor = promise.constructor = {};
|
|
constructor[SPECIES] = FakePromise;
|
|
SUBCLASSING = promise.then(function () { /* empty */ }) instanceof FakePromise;
|
|
if (!SUBCLASSING) return true;
|
|
// Unhandled rejections tracking support, NodeJS Promise without it fails @@species test
|
|
return !GLOBAL_CORE_JS_PROMISE && IS_BROWSER && !NATIVE_REJECTION_EVENT;
|
|
});
|
|
|
|
var INCORRECT_ITERATION = FORCED || !checkCorrectnessOfIteration(function (iterable) {
|
|
PromiseConstructor.all(iterable)['catch'](function () { /* empty */ });
|
|
});
|
|
|
|
// helpers
|
|
var isThenable = function (it) {
|
|
var then;
|
|
return isObject(it) && isCallable(then = it.then) ? then : false;
|
|
};
|
|
|
|
var notify = function (state, isReject) {
|
|
if (state.notified) return;
|
|
state.notified = true;
|
|
var chain = state.reactions;
|
|
microtask(function () {
|
|
var value = state.value;
|
|
var ok = state.state == FULFILLED;
|
|
var index = 0;
|
|
// variable length - can't use forEach
|
|
while (chain.length > index) {
|
|
var reaction = chain[index++];
|
|
var handler = ok ? reaction.ok : reaction.fail;
|
|
var resolve = reaction.resolve;
|
|
var reject = reaction.reject;
|
|
var domain = reaction.domain;
|
|
var result, then, exited;
|
|
try {
|
|
if (handler) {
|
|
if (!ok) {
|
|
if (state.rejection === UNHANDLED) onHandleUnhandled(state);
|
|
state.rejection = HANDLED;
|
|
}
|
|
if (handler === true) result = value;
|
|
else {
|
|
if (domain) domain.enter();
|
|
result = handler(value); // can throw
|
|
if (domain) {
|
|
domain.exit();
|
|
exited = true;
|
|
}
|
|
}
|
|
if (result === reaction.promise) {
|
|
reject(TypeError('Promise-chain cycle'));
|
|
} else if (then = isThenable(result)) {
|
|
then.call(result, resolve, reject);
|
|
} else resolve(result);
|
|
} else reject(value);
|
|
} catch (error) {
|
|
if (domain && !exited) domain.exit();
|
|
reject(error);
|
|
}
|
|
}
|
|
state.reactions = [];
|
|
state.notified = false;
|
|
if (isReject && !state.rejection) onUnhandled(state);
|
|
});
|
|
};
|
|
|
|
var dispatchEvent = function (name, promise, reason) {
|
|
var event, handler;
|
|
if (DISPATCH_EVENT) {
|
|
event = document.createEvent('Event');
|
|
event.promise = promise;
|
|
event.reason = reason;
|
|
event.initEvent(name, false, true);
|
|
global.dispatchEvent(event);
|
|
} else event = { promise: promise, reason: reason };
|
|
if (!NATIVE_REJECTION_EVENT && (handler = global['on' + name])) handler(event);
|
|
else if (name === UNHANDLED_REJECTION) hostReportErrors('Unhandled promise rejection', reason);
|
|
};
|
|
|
|
var onUnhandled = function (state) {
|
|
task.call(global, function () {
|
|
var promise = state.facade;
|
|
var value = state.value;
|
|
var IS_UNHANDLED = isUnhandled(state);
|
|
var result;
|
|
if (IS_UNHANDLED) {
|
|
result = perform(function () {
|
|
if (IS_NODE) {
|
|
process.emit('unhandledRejection', value, promise);
|
|
} else dispatchEvent(UNHANDLED_REJECTION, promise, value);
|
|
});
|
|
// Browsers should not trigger `rejectionHandled` event if it was handled here, NodeJS - should
|
|
state.rejection = IS_NODE || isUnhandled(state) ? UNHANDLED : HANDLED;
|
|
if (result.error) throw result.value;
|
|
}
|
|
});
|
|
};
|
|
|
|
var isUnhandled = function (state) {
|
|
return state.rejection !== HANDLED && !state.parent;
|
|
};
|
|
|
|
var onHandleUnhandled = function (state) {
|
|
task.call(global, function () {
|
|
var promise = state.facade;
|
|
if (IS_NODE) {
|
|
process.emit('rejectionHandled', promise);
|
|
} else dispatchEvent(REJECTION_HANDLED, promise, state.value);
|
|
});
|
|
};
|
|
|
|
var bind = function (fn, state, unwrap) {
|
|
return function (value) {
|
|
fn(state, value, unwrap);
|
|
};
|
|
};
|
|
|
|
var internalReject = function (state, value, unwrap) {
|
|
if (state.done) return;
|
|
state.done = true;
|
|
if (unwrap) state = unwrap;
|
|
state.value = value;
|
|
state.state = REJECTED;
|
|
notify(state, true);
|
|
};
|
|
|
|
var internalResolve = function (state, value, unwrap) {
|
|
if (state.done) return;
|
|
state.done = true;
|
|
if (unwrap) state = unwrap;
|
|
try {
|
|
if (state.facade === value) throw TypeError("Promise can't be resolved itself");
|
|
var then = isThenable(value);
|
|
if (then) {
|
|
microtask(function () {
|
|
var wrapper = { done: false };
|
|
try {
|
|
then.call(value,
|
|
bind(internalResolve, wrapper, state),
|
|
bind(internalReject, wrapper, state)
|
|
);
|
|
} catch (error) {
|
|
internalReject(wrapper, error, state);
|
|
}
|
|
});
|
|
} else {
|
|
state.value = value;
|
|
state.state = FULFILLED;
|
|
notify(state, false);
|
|
}
|
|
} catch (error) {
|
|
internalReject({ done: false }, error, state);
|
|
}
|
|
};
|
|
|
|
// constructor polyfill
|
|
if (FORCED) {
|
|
// 25.4.3.1 Promise(executor)
|
|
PromiseConstructor = function Promise(executor) {
|
|
anInstance(this, PromiseConstructor, PROMISE);
|
|
aCallable(executor);
|
|
Internal.call(this);
|
|
var state = getInternalState(this);
|
|
try {
|
|
executor(bind(internalResolve, state), bind(internalReject, state));
|
|
} catch (error) {
|
|
internalReject(state, error);
|
|
}
|
|
};
|
|
PromiseConstructorPrototype = PromiseConstructor.prototype;
|
|
// eslint-disable-next-line no-unused-vars -- required for `.length`
|
|
Internal = function Promise(executor) {
|
|
setInternalState(this, {
|
|
type: PROMISE,
|
|
done: false,
|
|
notified: false,
|
|
parent: false,
|
|
reactions: [],
|
|
rejection: false,
|
|
state: PENDING,
|
|
value: undefined
|
|
});
|
|
};
|
|
Internal.prototype = redefineAll(PromiseConstructorPrototype, {
|
|
// `Promise.prototype.then` method
|
|
// https://tc39.es/ecma262/#sec-promise.prototype.then
|
|
then: function then(onFulfilled, onRejected) {
|
|
var state = getInternalPromiseState(this);
|
|
var reaction = newPromiseCapability(speciesConstructor(this, PromiseConstructor));
|
|
reaction.ok = isCallable(onFulfilled) ? onFulfilled : true;
|
|
reaction.fail = isCallable(onRejected) && onRejected;
|
|
reaction.domain = IS_NODE ? process.domain : undefined;
|
|
state.parent = true;
|
|
state.reactions.push(reaction);
|
|
if (state.state != PENDING) notify(state, false);
|
|
return reaction.promise;
|
|
},
|
|
// `Promise.prototype.catch` method
|
|
// https://tc39.es/ecma262/#sec-promise.prototype.catch
|
|
'catch': function (onRejected) {
|
|
return this.then(undefined, onRejected);
|
|
}
|
|
});
|
|
OwnPromiseCapability = function () {
|
|
var promise = new Internal();
|
|
var state = getInternalState(promise);
|
|
this.promise = promise;
|
|
this.resolve = bind(internalResolve, state);
|
|
this.reject = bind(internalReject, state);
|
|
};
|
|
newPromiseCapabilityModule.f = newPromiseCapability = function (C) {
|
|
return C === PromiseConstructor || C === PromiseWrapper
|
|
? new OwnPromiseCapability(C)
|
|
: newGenericPromiseCapability(C);
|
|
};
|
|
|
|
if (!IS_PURE && isCallable(NativePromise) && NativePromisePrototype !== Object.prototype) {
|
|
nativeThen = NativePromisePrototype.then;
|
|
|
|
if (!SUBCLASSING) {
|
|
// make `Promise#then` return a polyfilled `Promise` for native promise-based APIs
|
|
redefine(NativePromisePrototype, 'then', function then(onFulfilled, onRejected) {
|
|
var that = this;
|
|
return new PromiseConstructor(function (resolve, reject) {
|
|
nativeThen.call(that, resolve, reject);
|
|
}).then(onFulfilled, onRejected);
|
|
// https://github.com/zloirock/core-js/issues/640
|
|
}, { unsafe: true });
|
|
|
|
// makes sure that native promise-based APIs `Promise#catch` properly works with patched `Promise#then`
|
|
redefine(NativePromisePrototype, 'catch', PromiseConstructorPrototype['catch'], { unsafe: true });
|
|
}
|
|
|
|
// make `.constructor === Promise` work for native promise-based APIs
|
|
try {
|
|
delete NativePromisePrototype.constructor;
|
|
} catch (error) { /* empty */ }
|
|
|
|
// make `instanceof Promise` work for native promise-based APIs
|
|
if (setPrototypeOf) {
|
|
setPrototypeOf(NativePromisePrototype, PromiseConstructorPrototype);
|
|
}
|
|
}
|
|
}
|
|
|
|
$({ global: true, wrap: true, forced: FORCED }, {
|
|
Promise: PromiseConstructor
|
|
});
|
|
|
|
setToStringTag(PromiseConstructor, PROMISE, false, true);
|
|
setSpecies(PROMISE);
|
|
|
|
PromiseWrapper = getBuiltIn(PROMISE);
|
|
|
|
// statics
|
|
$({ target: PROMISE, stat: true, forced: FORCED }, {
|
|
// `Promise.reject` method
|
|
// https://tc39.es/ecma262/#sec-promise.reject
|
|
reject: function reject(r) {
|
|
var capability = newPromiseCapability(this);
|
|
capability.reject.call(undefined, r);
|
|
return capability.promise;
|
|
}
|
|
});
|
|
|
|
$({ target: PROMISE, stat: true, forced: IS_PURE || FORCED }, {
|
|
// `Promise.resolve` method
|
|
// https://tc39.es/ecma262/#sec-promise.resolve
|
|
resolve: function resolve(x) {
|
|
return promiseResolve(IS_PURE && this === PromiseWrapper ? PromiseConstructor : this, x);
|
|
}
|
|
});
|
|
|
|
$({ target: PROMISE, stat: true, forced: INCORRECT_ITERATION }, {
|
|
// `Promise.all` method
|
|
// https://tc39.es/ecma262/#sec-promise.all
|
|
all: function all(iterable) {
|
|
var C = this;
|
|
var capability = newPromiseCapability(C);
|
|
var resolve = capability.resolve;
|
|
var reject = capability.reject;
|
|
var result = perform(function () {
|
|
var $promiseResolve = aCallable(C.resolve);
|
|
var values = [];
|
|
var counter = 0;
|
|
var remaining = 1;
|
|
iterate(iterable, function (promise) {
|
|
var index = counter++;
|
|
var alreadyCalled = false;
|
|
values.push(undefined);
|
|
remaining++;
|
|
$promiseResolve.call(C, promise).then(function (value) {
|
|
if (alreadyCalled) return;
|
|
alreadyCalled = true;
|
|
values[index] = value;
|
|
--remaining || resolve(values);
|
|
}, reject);
|
|
});
|
|
--remaining || resolve(values);
|
|
});
|
|
if (result.error) reject(result.value);
|
|
return capability.promise;
|
|
},
|
|
// `Promise.race` method
|
|
// https://tc39.es/ecma262/#sec-promise.race
|
|
race: function race(iterable) {
|
|
var C = this;
|
|
var capability = newPromiseCapability(C);
|
|
var reject = capability.reject;
|
|
var result = perform(function () {
|
|
var $promiseResolve = aCallable(C.resolve);
|
|
iterate(iterable, function (promise) {
|
|
$promiseResolve.call(C, promise).then(capability.resolve, reject);
|
|
});
|
|
});
|
|
if (result.error) reject(result.value);
|
|
return capability.promise;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5397:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var aConstructor = __webpack_require__(1404);
|
|
var anObject = __webpack_require__(1138);
|
|
var isObject = __webpack_require__(5744);
|
|
var create = __webpack_require__(2853);
|
|
var bind = __webpack_require__(6782);
|
|
var fails = __webpack_require__(6192);
|
|
|
|
var nativeConstruct = getBuiltIn('Reflect', 'construct');
|
|
|
|
// `Reflect.construct` method
|
|
// https://tc39.es/ecma262/#sec-reflect.construct
|
|
// MS Edge supports only 2 arguments and argumentsList argument is optional
|
|
// FF Nightly sets third argument as `new.target`, but does not create `this` from it
|
|
var NEW_TARGET_BUG = fails(function () {
|
|
function F() { /* empty */ }
|
|
return !(nativeConstruct(function () { /* empty */ }, [], F) instanceof F);
|
|
});
|
|
var ARGS_BUG = !fails(function () {
|
|
nativeConstruct(function () { /* empty */ });
|
|
});
|
|
var FORCED = NEW_TARGET_BUG || ARGS_BUG;
|
|
|
|
$({ target: 'Reflect', stat: true, forced: FORCED, sham: FORCED }, {
|
|
construct: function construct(Target, args /* , newTarget */) {
|
|
aConstructor(Target);
|
|
anObject(args);
|
|
var newTarget = arguments.length < 3 ? Target : aConstructor(arguments[2]);
|
|
if (ARGS_BUG && !NEW_TARGET_BUG) return nativeConstruct(Target, args, newTarget);
|
|
if (Target == newTarget) {
|
|
// w/o altered newTarget, optimization for 0-4 arguments
|
|
switch (args.length) {
|
|
case 0: return new Target();
|
|
case 1: return new Target(args[0]);
|
|
case 2: return new Target(args[0], args[1]);
|
|
case 3: return new Target(args[0], args[1], args[2]);
|
|
case 4: return new Target(args[0], args[1], args[2], args[3]);
|
|
}
|
|
// w/o altered newTarget, lot of arguments case
|
|
var $args = [null];
|
|
$args.push.apply($args, args);
|
|
return new (bind.apply(Target, $args))();
|
|
}
|
|
// with altered newTarget, not support built-in constructors
|
|
var proto = newTarget.prototype;
|
|
var instance = create(isObject(proto) ? proto : Object.prototype);
|
|
var result = Function.apply.call(Target, instance, args);
|
|
return isObject(result) ? result : instance;
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1367:
|
|
/***/ (function() {
|
|
|
|
// empty
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5454:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var charAt = __webpack_require__(863).charAt;
|
|
var toString = __webpack_require__(4845);
|
|
var InternalStateModule = __webpack_require__(3326);
|
|
var defineIterator = __webpack_require__(7218);
|
|
|
|
var STRING_ITERATOR = 'String Iterator';
|
|
var setInternalState = InternalStateModule.set;
|
|
var getInternalState = InternalStateModule.getterFor(STRING_ITERATOR);
|
|
|
|
// `String.prototype[@@iterator]` method
|
|
// https://tc39.es/ecma262/#sec-string.prototype-@@iterator
|
|
defineIterator(String, 'String', function (iterated) {
|
|
setInternalState(this, {
|
|
type: STRING_ITERATOR,
|
|
string: toString(iterated),
|
|
index: 0
|
|
});
|
|
// `%StringIteratorPrototype%.next` method
|
|
// https://tc39.es/ecma262/#sec-%stringiteratorprototype%.next
|
|
}, function next() {
|
|
var state = getInternalState(this);
|
|
var string = state.string;
|
|
var index = state.index;
|
|
var point;
|
|
if (index >= string.length) return { value: undefined, done: true };
|
|
point = charAt(string, index);
|
|
state.index += point.length;
|
|
return { value: point, done: false };
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 957:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var $trim = __webpack_require__(4277).trim;
|
|
var forcedStringTrimMethod = __webpack_require__(6815);
|
|
|
|
// `String.prototype.trim` method
|
|
// https://tc39.es/ecma262/#sec-string.prototype.trim
|
|
$({ target: 'String', proto: true, forced: forcedStringTrimMethod('trim') }, {
|
|
trim: function trim() {
|
|
return $trim(this);
|
|
}
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9781:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.asyncIterator` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.asynciterator
|
|
defineWellKnownSymbol('asyncIterator');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 492:
|
|
/***/ (function() {
|
|
|
|
// empty
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6681:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.hasInstance` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.hasinstance
|
|
defineWellKnownSymbol('hasInstance');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9594:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.isConcatSpreadable` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.isconcatspreadable
|
|
defineWellKnownSymbol('isConcatSpreadable');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3665:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.iterator` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.iterator
|
|
defineWellKnownSymbol('iterator');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6187:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var global = __webpack_require__(8576);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var IS_PURE = __webpack_require__(5546);
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var NATIVE_SYMBOL = __webpack_require__(3045);
|
|
var fails = __webpack_require__(6192);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var isArray = __webpack_require__(4770);
|
|
var isCallable = __webpack_require__(6447);
|
|
var isObject = __webpack_require__(5744);
|
|
var isSymbol = __webpack_require__(3236);
|
|
var anObject = __webpack_require__(1138);
|
|
var toObject = __webpack_require__(1795);
|
|
var toIndexedObject = __webpack_require__(101);
|
|
var toPropertyKey = __webpack_require__(77);
|
|
var $toString = __webpack_require__(4845);
|
|
var createPropertyDescriptor = __webpack_require__(774);
|
|
var nativeObjectCreate = __webpack_require__(2853);
|
|
var objectKeys = __webpack_require__(7653);
|
|
var getOwnPropertyNamesModule = __webpack_require__(2092);
|
|
var getOwnPropertyNamesExternal = __webpack_require__(4052);
|
|
var getOwnPropertySymbolsModule = __webpack_require__(4750);
|
|
var getOwnPropertyDescriptorModule = __webpack_require__(5141);
|
|
var definePropertyModule = __webpack_require__(2760);
|
|
var propertyIsEnumerableModule = __webpack_require__(6007);
|
|
var redefine = __webpack_require__(9482);
|
|
var shared = __webpack_require__(8717);
|
|
var sharedKey = __webpack_require__(9766);
|
|
var hiddenKeys = __webpack_require__(4535);
|
|
var uid = __webpack_require__(2759);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
var wrappedWellKnownSymbolModule = __webpack_require__(9207);
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
var setToStringTag = __webpack_require__(1284);
|
|
var InternalStateModule = __webpack_require__(3326);
|
|
var $forEach = __webpack_require__(454).forEach;
|
|
|
|
var HIDDEN = sharedKey('hidden');
|
|
var SYMBOL = 'Symbol';
|
|
var PROTOTYPE = 'prototype';
|
|
var TO_PRIMITIVE = wellKnownSymbol('toPrimitive');
|
|
var setInternalState = InternalStateModule.set;
|
|
var getInternalState = InternalStateModule.getterFor(SYMBOL);
|
|
var ObjectPrototype = Object[PROTOTYPE];
|
|
var $Symbol = global.Symbol;
|
|
var $stringify = getBuiltIn('JSON', 'stringify');
|
|
var nativeGetOwnPropertyDescriptor = getOwnPropertyDescriptorModule.f;
|
|
var nativeDefineProperty = definePropertyModule.f;
|
|
var nativeGetOwnPropertyNames = getOwnPropertyNamesExternal.f;
|
|
var nativePropertyIsEnumerable = propertyIsEnumerableModule.f;
|
|
var AllSymbols = shared('symbols');
|
|
var ObjectPrototypeSymbols = shared('op-symbols');
|
|
var StringToSymbolRegistry = shared('string-to-symbol-registry');
|
|
var SymbolToStringRegistry = shared('symbol-to-string-registry');
|
|
var WellKnownSymbolsStore = shared('wks');
|
|
var QObject = global.QObject;
|
|
// Don't use setters in Qt Script, https://github.com/zloirock/core-js/issues/173
|
|
var USE_SETTER = !QObject || !QObject[PROTOTYPE] || !QObject[PROTOTYPE].findChild;
|
|
|
|
// fallback for old Android, https://code.google.com/p/v8/issues/detail?id=687
|
|
var setSymbolDescriptor = DESCRIPTORS && fails(function () {
|
|
return nativeObjectCreate(nativeDefineProperty({}, 'a', {
|
|
get: function () { return nativeDefineProperty(this, 'a', { value: 7 }).a; }
|
|
})).a != 7;
|
|
}) ? function (O, P, Attributes) {
|
|
var ObjectPrototypeDescriptor = nativeGetOwnPropertyDescriptor(ObjectPrototype, P);
|
|
if (ObjectPrototypeDescriptor) delete ObjectPrototype[P];
|
|
nativeDefineProperty(O, P, Attributes);
|
|
if (ObjectPrototypeDescriptor && O !== ObjectPrototype) {
|
|
nativeDefineProperty(ObjectPrototype, P, ObjectPrototypeDescriptor);
|
|
}
|
|
} : nativeDefineProperty;
|
|
|
|
var wrap = function (tag, description) {
|
|
var symbol = AllSymbols[tag] = nativeObjectCreate($Symbol[PROTOTYPE]);
|
|
setInternalState(symbol, {
|
|
type: SYMBOL,
|
|
tag: tag,
|
|
description: description
|
|
});
|
|
if (!DESCRIPTORS) symbol.description = description;
|
|
return symbol;
|
|
};
|
|
|
|
var $defineProperty = function defineProperty(O, P, Attributes) {
|
|
if (O === ObjectPrototype) $defineProperty(ObjectPrototypeSymbols, P, Attributes);
|
|
anObject(O);
|
|
var key = toPropertyKey(P);
|
|
anObject(Attributes);
|
|
if (hasOwn(AllSymbols, key)) {
|
|
if (!Attributes.enumerable) {
|
|
if (!hasOwn(O, HIDDEN)) nativeDefineProperty(O, HIDDEN, createPropertyDescriptor(1, {}));
|
|
O[HIDDEN][key] = true;
|
|
} else {
|
|
if (hasOwn(O, HIDDEN) && O[HIDDEN][key]) O[HIDDEN][key] = false;
|
|
Attributes = nativeObjectCreate(Attributes, { enumerable: createPropertyDescriptor(0, false) });
|
|
} return setSymbolDescriptor(O, key, Attributes);
|
|
} return nativeDefineProperty(O, key, Attributes);
|
|
};
|
|
|
|
var $defineProperties = function defineProperties(O, Properties) {
|
|
anObject(O);
|
|
var properties = toIndexedObject(Properties);
|
|
var keys = objectKeys(properties).concat($getOwnPropertySymbols(properties));
|
|
$forEach(keys, function (key) {
|
|
if (!DESCRIPTORS || $propertyIsEnumerable.call(properties, key)) $defineProperty(O, key, properties[key]);
|
|
});
|
|
return O;
|
|
};
|
|
|
|
var $create = function create(O, Properties) {
|
|
return Properties === undefined ? nativeObjectCreate(O) : $defineProperties(nativeObjectCreate(O), Properties);
|
|
};
|
|
|
|
var $propertyIsEnumerable = function propertyIsEnumerable(V) {
|
|
var P = toPropertyKey(V);
|
|
var enumerable = nativePropertyIsEnumerable.call(this, P);
|
|
if (this === ObjectPrototype && hasOwn(AllSymbols, P) && !hasOwn(ObjectPrototypeSymbols, P)) return false;
|
|
return enumerable || !hasOwn(this, P) || !hasOwn(AllSymbols, P) || hasOwn(this, HIDDEN) && this[HIDDEN][P]
|
|
? enumerable : true;
|
|
};
|
|
|
|
var $getOwnPropertyDescriptor = function getOwnPropertyDescriptor(O, P) {
|
|
var it = toIndexedObject(O);
|
|
var key = toPropertyKey(P);
|
|
if (it === ObjectPrototype && hasOwn(AllSymbols, key) && !hasOwn(ObjectPrototypeSymbols, key)) return;
|
|
var descriptor = nativeGetOwnPropertyDescriptor(it, key);
|
|
if (descriptor && hasOwn(AllSymbols, key) && !(hasOwn(it, HIDDEN) && it[HIDDEN][key])) {
|
|
descriptor.enumerable = true;
|
|
}
|
|
return descriptor;
|
|
};
|
|
|
|
var $getOwnPropertyNames = function getOwnPropertyNames(O) {
|
|
var names = nativeGetOwnPropertyNames(toIndexedObject(O));
|
|
var result = [];
|
|
$forEach(names, function (key) {
|
|
if (!hasOwn(AllSymbols, key) && !hasOwn(hiddenKeys, key)) result.push(key);
|
|
});
|
|
return result;
|
|
};
|
|
|
|
var $getOwnPropertySymbols = function getOwnPropertySymbols(O) {
|
|
var IS_OBJECT_PROTOTYPE = O === ObjectPrototype;
|
|
var names = nativeGetOwnPropertyNames(IS_OBJECT_PROTOTYPE ? ObjectPrototypeSymbols : toIndexedObject(O));
|
|
var result = [];
|
|
$forEach(names, function (key) {
|
|
if (hasOwn(AllSymbols, key) && (!IS_OBJECT_PROTOTYPE || hasOwn(ObjectPrototype, key))) {
|
|
result.push(AllSymbols[key]);
|
|
}
|
|
});
|
|
return result;
|
|
};
|
|
|
|
// `Symbol` constructor
|
|
// https://tc39.es/ecma262/#sec-symbol-constructor
|
|
if (!NATIVE_SYMBOL) {
|
|
$Symbol = function Symbol() {
|
|
if (this instanceof $Symbol) throw TypeError('Symbol is not a constructor');
|
|
var description = !arguments.length || arguments[0] === undefined ? undefined : $toString(arguments[0]);
|
|
var tag = uid(description);
|
|
var setter = function (value) {
|
|
if (this === ObjectPrototype) setter.call(ObjectPrototypeSymbols, value);
|
|
if (hasOwn(this, HIDDEN) && hasOwn(this[HIDDEN], tag)) this[HIDDEN][tag] = false;
|
|
setSymbolDescriptor(this, tag, createPropertyDescriptor(1, value));
|
|
};
|
|
if (DESCRIPTORS && USE_SETTER) setSymbolDescriptor(ObjectPrototype, tag, { configurable: true, set: setter });
|
|
return wrap(tag, description);
|
|
};
|
|
|
|
redefine($Symbol[PROTOTYPE], 'toString', function toString() {
|
|
return getInternalState(this).tag;
|
|
});
|
|
|
|
redefine($Symbol, 'withoutSetter', function (description) {
|
|
return wrap(uid(description), description);
|
|
});
|
|
|
|
propertyIsEnumerableModule.f = $propertyIsEnumerable;
|
|
definePropertyModule.f = $defineProperty;
|
|
getOwnPropertyDescriptorModule.f = $getOwnPropertyDescriptor;
|
|
getOwnPropertyNamesModule.f = getOwnPropertyNamesExternal.f = $getOwnPropertyNames;
|
|
getOwnPropertySymbolsModule.f = $getOwnPropertySymbols;
|
|
|
|
wrappedWellKnownSymbolModule.f = function (name) {
|
|
return wrap(wellKnownSymbol(name), name);
|
|
};
|
|
|
|
if (DESCRIPTORS) {
|
|
// https://github.com/tc39/proposal-Symbol-description
|
|
nativeDefineProperty($Symbol[PROTOTYPE], 'description', {
|
|
configurable: true,
|
|
get: function description() {
|
|
return getInternalState(this).description;
|
|
}
|
|
});
|
|
if (!IS_PURE) {
|
|
redefine(ObjectPrototype, 'propertyIsEnumerable', $propertyIsEnumerable, { unsafe: true });
|
|
}
|
|
}
|
|
}
|
|
|
|
$({ global: true, wrap: true, forced: !NATIVE_SYMBOL, sham: !NATIVE_SYMBOL }, {
|
|
Symbol: $Symbol
|
|
});
|
|
|
|
$forEach(objectKeys(WellKnownSymbolsStore), function (name) {
|
|
defineWellKnownSymbol(name);
|
|
});
|
|
|
|
$({ target: SYMBOL, stat: true, forced: !NATIVE_SYMBOL }, {
|
|
// `Symbol.for` method
|
|
// https://tc39.es/ecma262/#sec-symbol.for
|
|
'for': function (key) {
|
|
var string = $toString(key);
|
|
if (hasOwn(StringToSymbolRegistry, string)) return StringToSymbolRegistry[string];
|
|
var symbol = $Symbol(string);
|
|
StringToSymbolRegistry[string] = symbol;
|
|
SymbolToStringRegistry[symbol] = string;
|
|
return symbol;
|
|
},
|
|
// `Symbol.keyFor` method
|
|
// https://tc39.es/ecma262/#sec-symbol.keyfor
|
|
keyFor: function keyFor(sym) {
|
|
if (!isSymbol(sym)) throw TypeError(sym + ' is not a symbol');
|
|
if (hasOwn(SymbolToStringRegistry, sym)) return SymbolToStringRegistry[sym];
|
|
},
|
|
useSetter: function () { USE_SETTER = true; },
|
|
useSimple: function () { USE_SETTER = false; }
|
|
});
|
|
|
|
$({ target: 'Object', stat: true, forced: !NATIVE_SYMBOL, sham: !DESCRIPTORS }, {
|
|
// `Object.create` method
|
|
// https://tc39.es/ecma262/#sec-object.create
|
|
create: $create,
|
|
// `Object.defineProperty` method
|
|
// https://tc39.es/ecma262/#sec-object.defineproperty
|
|
defineProperty: $defineProperty,
|
|
// `Object.defineProperties` method
|
|
// https://tc39.es/ecma262/#sec-object.defineproperties
|
|
defineProperties: $defineProperties,
|
|
// `Object.getOwnPropertyDescriptor` method
|
|
// https://tc39.es/ecma262/#sec-object.getownpropertydescriptors
|
|
getOwnPropertyDescriptor: $getOwnPropertyDescriptor
|
|
});
|
|
|
|
$({ target: 'Object', stat: true, forced: !NATIVE_SYMBOL }, {
|
|
// `Object.getOwnPropertyNames` method
|
|
// https://tc39.es/ecma262/#sec-object.getownpropertynames
|
|
getOwnPropertyNames: $getOwnPropertyNames,
|
|
// `Object.getOwnPropertySymbols` method
|
|
// https://tc39.es/ecma262/#sec-object.getownpropertysymbols
|
|
getOwnPropertySymbols: $getOwnPropertySymbols
|
|
});
|
|
|
|
// Chrome 38 and 39 `Object.getOwnPropertySymbols` fails on primitives
|
|
// https://bugs.chromium.org/p/v8/issues/detail?id=3443
|
|
$({ target: 'Object', stat: true, forced: fails(function () { getOwnPropertySymbolsModule.f(1); }) }, {
|
|
getOwnPropertySymbols: function getOwnPropertySymbols(it) {
|
|
return getOwnPropertySymbolsModule.f(toObject(it));
|
|
}
|
|
});
|
|
|
|
// `JSON.stringify` method behavior with symbols
|
|
// https://tc39.es/ecma262/#sec-json.stringify
|
|
if ($stringify) {
|
|
var FORCED_JSON_STRINGIFY = !NATIVE_SYMBOL || fails(function () {
|
|
var symbol = $Symbol();
|
|
// MS Edge converts symbol values to JSON as {}
|
|
return $stringify([symbol]) != '[null]'
|
|
// WebKit converts symbol values to JSON as null
|
|
|| $stringify({ a: symbol }) != '{}'
|
|
// V8 throws on boxed symbols
|
|
|| $stringify(Object(symbol)) != '{}';
|
|
});
|
|
|
|
$({ target: 'JSON', stat: true, forced: FORCED_JSON_STRINGIFY }, {
|
|
// eslint-disable-next-line no-unused-vars -- required for `.length`
|
|
stringify: function stringify(it, replacer, space) {
|
|
var args = [it];
|
|
var index = 1;
|
|
var $replacer;
|
|
while (arguments.length > index) args.push(arguments[index++]);
|
|
$replacer = replacer;
|
|
if (!isObject(replacer) && it === undefined || isSymbol(it)) return; // IE8 returns string on undefined
|
|
if (!isArray(replacer)) replacer = function (key, value) {
|
|
if (isCallable($replacer)) value = $replacer.call(this, key, value);
|
|
if (!isSymbol(value)) return value;
|
|
};
|
|
args[1] = replacer;
|
|
return $stringify.apply(null, args);
|
|
}
|
|
});
|
|
}
|
|
|
|
// `Symbol.prototype[@@toPrimitive]` method
|
|
// https://tc39.es/ecma262/#sec-symbol.prototype-@@toprimitive
|
|
if (!$Symbol[PROTOTYPE][TO_PRIMITIVE]) {
|
|
var valueOf = $Symbol[PROTOTYPE].valueOf;
|
|
redefine($Symbol[PROTOTYPE], TO_PRIMITIVE, function () {
|
|
return valueOf.apply(this, arguments);
|
|
});
|
|
}
|
|
// `Symbol.prototype[@@toStringTag]` property
|
|
// https://tc39.es/ecma262/#sec-symbol.prototype-@@tostringtag
|
|
setToStringTag($Symbol, SYMBOL);
|
|
|
|
hiddenKeys[HIDDEN] = true;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1250:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.matchAll` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.matchall
|
|
defineWellKnownSymbol('matchAll');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9017:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.match` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.match
|
|
defineWellKnownSymbol('match');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9786:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.replace` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.replace
|
|
defineWellKnownSymbol('replace');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 503:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.search` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.search
|
|
defineWellKnownSymbol('search');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6565:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.species` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.species
|
|
defineWellKnownSymbol('species');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9322:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.split` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.split
|
|
defineWellKnownSymbol('split');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3610:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.toPrimitive` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.toprimitive
|
|
defineWellKnownSymbol('toPrimitive');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6886:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.toStringTag` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.tostringtag
|
|
defineWellKnownSymbol('toStringTag');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3514:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.unscopables` well-known symbol
|
|
// https://tc39.es/ecma262/#sec-symbol.unscopables
|
|
defineWellKnownSymbol('unscopables');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 177:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.asyncDispose` well-known symbol
|
|
// https://github.com/tc39/proposal-using-statement
|
|
defineWellKnownSymbol('asyncDispose');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9031:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.dispose` well-known symbol
|
|
// https://github.com/tc39/proposal-using-statement
|
|
defineWellKnownSymbol('dispose');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6658:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.matcher` well-known symbol
|
|
// https://github.com/tc39/proposal-pattern-matching
|
|
defineWellKnownSymbol('matcher');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1875:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.metadata` well-known symbol
|
|
// https://github.com/tc39/proposal-decorators
|
|
defineWellKnownSymbol('metadata');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8658:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.observable` well-known symbol
|
|
// https://github.com/tc39/proposal-observable
|
|
defineWellKnownSymbol('observable');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4592:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
// TODO: remove from `core-js@4`
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
// `Symbol.patternMatch` well-known symbol
|
|
// https://github.com/tc39/proposal-pattern-matching
|
|
defineWellKnownSymbol('patternMatch');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6680:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
// TODO: remove from `core-js@4`
|
|
var defineWellKnownSymbol = __webpack_require__(1488);
|
|
|
|
defineWellKnownSymbol('replaceAll');
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 162:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(8939);
|
|
var DOMIterables = __webpack_require__(7365);
|
|
var global = __webpack_require__(8576);
|
|
var classof = __webpack_require__(4696);
|
|
var createNonEnumerableProperty = __webpack_require__(8711);
|
|
var Iterators = __webpack_require__(7771);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var TO_STRING_TAG = wellKnownSymbol('toStringTag');
|
|
|
|
for (var COLLECTION_NAME in DOMIterables) {
|
|
var Collection = global[COLLECTION_NAME];
|
|
var CollectionPrototype = Collection && Collection.prototype;
|
|
if (CollectionPrototype && classof(CollectionPrototype) !== TO_STRING_TAG) {
|
|
createNonEnumerableProperty(CollectionPrototype, TO_STRING_TAG, COLLECTION_NAME);
|
|
}
|
|
Iterators[COLLECTION_NAME] = Iterators.Array;
|
|
}
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2906:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var $ = __webpack_require__(3085);
|
|
var global = __webpack_require__(8576);
|
|
var isCallable = __webpack_require__(6447);
|
|
var userAgent = __webpack_require__(8989);
|
|
|
|
var slice = [].slice;
|
|
var MSIE = /MSIE .\./.test(userAgent); // <- dirty ie9- check
|
|
|
|
var wrap = function (scheduler) {
|
|
return function (handler, timeout /* , ...arguments */) {
|
|
var boundArgs = arguments.length > 2;
|
|
var args = boundArgs ? slice.call(arguments, 2) : undefined;
|
|
return scheduler(boundArgs ? function () {
|
|
// eslint-disable-next-line no-new-func -- spec requirement
|
|
(isCallable(handler) ? handler : Function(handler)).apply(this, args);
|
|
} : handler, timeout);
|
|
};
|
|
};
|
|
|
|
// ie9- setTimeout & setInterval additional parameters fix
|
|
// https://html.spec.whatwg.org/multipage/timers-and-user-prompts.html#timers
|
|
$({ global: true, bind: true, forced: MSIE }, {
|
|
// `setTimeout` method
|
|
// https://html.spec.whatwg.org/multipage/timers-and-user-prompts.html#dom-settimeout
|
|
setTimeout: wrap(global.setTimeout),
|
|
// `setInterval` method
|
|
// https://html.spec.whatwg.org/multipage/timers-and-user-prompts.html#dom-setinterval
|
|
setInterval: wrap(global.setInterval)
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9336:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
// TODO: in core-js@4, move /modules/ dependencies to public entries for better optimization by tools like `preset-env`
|
|
__webpack_require__(8939);
|
|
var $ = __webpack_require__(3085);
|
|
var getBuiltIn = __webpack_require__(150);
|
|
var USE_NATIVE_URL = __webpack_require__(4551);
|
|
var redefine = __webpack_require__(9482);
|
|
var redefineAll = __webpack_require__(533);
|
|
var setToStringTag = __webpack_require__(1284);
|
|
var createIteratorConstructor = __webpack_require__(5148);
|
|
var InternalStateModule = __webpack_require__(3326);
|
|
var anInstance = __webpack_require__(6961);
|
|
var isCallable = __webpack_require__(6447);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var bind = __webpack_require__(8043);
|
|
var classof = __webpack_require__(4696);
|
|
var anObject = __webpack_require__(1138);
|
|
var isObject = __webpack_require__(5744);
|
|
var $toString = __webpack_require__(4845);
|
|
var create = __webpack_require__(2853);
|
|
var createPropertyDescriptor = __webpack_require__(774);
|
|
var getIterator = __webpack_require__(1669);
|
|
var getIteratorMethod = __webpack_require__(8703);
|
|
var wellKnownSymbol = __webpack_require__(8182);
|
|
|
|
var nativeFetch = getBuiltIn('fetch');
|
|
var NativeRequest = getBuiltIn('Request');
|
|
var RequestPrototype = NativeRequest && NativeRequest.prototype;
|
|
var Headers = getBuiltIn('Headers');
|
|
var ITERATOR = wellKnownSymbol('iterator');
|
|
var URL_SEARCH_PARAMS = 'URLSearchParams';
|
|
var URL_SEARCH_PARAMS_ITERATOR = URL_SEARCH_PARAMS + 'Iterator';
|
|
var setInternalState = InternalStateModule.set;
|
|
var getInternalParamsState = InternalStateModule.getterFor(URL_SEARCH_PARAMS);
|
|
var getInternalIteratorState = InternalStateModule.getterFor(URL_SEARCH_PARAMS_ITERATOR);
|
|
|
|
var plus = /\+/g;
|
|
var sequences = Array(4);
|
|
|
|
var percentSequence = function (bytes) {
|
|
return sequences[bytes - 1] || (sequences[bytes - 1] = RegExp('((?:%[\\da-f]{2}){' + bytes + '})', 'gi'));
|
|
};
|
|
|
|
var percentDecode = function (sequence) {
|
|
try {
|
|
return decodeURIComponent(sequence);
|
|
} catch (error) {
|
|
return sequence;
|
|
}
|
|
};
|
|
|
|
var deserialize = function (it) {
|
|
var result = it.replace(plus, ' ');
|
|
var bytes = 4;
|
|
try {
|
|
return decodeURIComponent(result);
|
|
} catch (error) {
|
|
while (bytes) {
|
|
result = result.replace(percentSequence(bytes--), percentDecode);
|
|
}
|
|
return result;
|
|
}
|
|
};
|
|
|
|
var find = /[!'()~]|%20/g;
|
|
|
|
var replace = {
|
|
'!': '%21',
|
|
"'": '%27',
|
|
'(': '%28',
|
|
')': '%29',
|
|
'~': '%7E',
|
|
'%20': '+'
|
|
};
|
|
|
|
var replacer = function (match) {
|
|
return replace[match];
|
|
};
|
|
|
|
var serialize = function (it) {
|
|
return encodeURIComponent(it).replace(find, replacer);
|
|
};
|
|
|
|
var parseSearchParams = function (result, query) {
|
|
if (query) {
|
|
var attributes = query.split('&');
|
|
var index = 0;
|
|
var attribute, entry;
|
|
while (index < attributes.length) {
|
|
attribute = attributes[index++];
|
|
if (attribute.length) {
|
|
entry = attribute.split('=');
|
|
result.push({
|
|
key: deserialize(entry.shift()),
|
|
value: deserialize(entry.join('='))
|
|
});
|
|
}
|
|
}
|
|
}
|
|
};
|
|
|
|
var updateSearchParams = function (query) {
|
|
this.entries.length = 0;
|
|
parseSearchParams(this.entries, query);
|
|
};
|
|
|
|
var validateArgumentsLength = function (passed, required) {
|
|
if (passed < required) throw TypeError('Not enough arguments');
|
|
};
|
|
|
|
var URLSearchParamsIterator = createIteratorConstructor(function Iterator(params, kind) {
|
|
setInternalState(this, {
|
|
type: URL_SEARCH_PARAMS_ITERATOR,
|
|
iterator: getIterator(getInternalParamsState(params).entries),
|
|
kind: kind
|
|
});
|
|
}, 'Iterator', function next() {
|
|
var state = getInternalIteratorState(this);
|
|
var kind = state.kind;
|
|
var step = state.iterator.next();
|
|
var entry = step.value;
|
|
if (!step.done) {
|
|
step.value = kind === 'keys' ? entry.key : kind === 'values' ? entry.value : [entry.key, entry.value];
|
|
} return step;
|
|
});
|
|
|
|
// `URLSearchParams` constructor
|
|
// https://url.spec.whatwg.org/#interface-urlsearchparams
|
|
var URLSearchParamsConstructor = function URLSearchParams(/* init */) {
|
|
anInstance(this, URLSearchParamsConstructor, URL_SEARCH_PARAMS);
|
|
var init = arguments.length > 0 ? arguments[0] : undefined;
|
|
var that = this;
|
|
var entries = [];
|
|
var iteratorMethod, iterator, next, step, entryIterator, entryNext, first, second, key;
|
|
|
|
setInternalState(that, {
|
|
type: URL_SEARCH_PARAMS,
|
|
entries: entries,
|
|
updateURL: function () { /* empty */ },
|
|
updateSearchParams: updateSearchParams
|
|
});
|
|
|
|
if (init !== undefined) {
|
|
if (isObject(init)) {
|
|
iteratorMethod = getIteratorMethod(init);
|
|
if (iteratorMethod) {
|
|
iterator = getIterator(init, iteratorMethod);
|
|
next = iterator.next;
|
|
while (!(step = next.call(iterator)).done) {
|
|
entryIterator = getIterator(anObject(step.value));
|
|
entryNext = entryIterator.next;
|
|
if (
|
|
(first = entryNext.call(entryIterator)).done ||
|
|
(second = entryNext.call(entryIterator)).done ||
|
|
!entryNext.call(entryIterator).done
|
|
) throw TypeError('Expected sequence with length 2');
|
|
entries.push({ key: $toString(first.value), value: $toString(second.value) });
|
|
}
|
|
} else for (key in init) if (hasOwn(init, key)) entries.push({ key: key, value: $toString(init[key]) });
|
|
} else {
|
|
parseSearchParams(
|
|
entries,
|
|
typeof init === 'string' ? init.charAt(0) === '?' ? init.slice(1) : init : $toString(init)
|
|
);
|
|
}
|
|
}
|
|
};
|
|
|
|
var URLSearchParamsPrototype = URLSearchParamsConstructor.prototype;
|
|
|
|
redefineAll(URLSearchParamsPrototype, {
|
|
// `URLSearchParams.prototype.append` method
|
|
// https://url.spec.whatwg.org/#dom-urlsearchparams-append
|
|
append: function append(name, value) {
|
|
validateArgumentsLength(arguments.length, 2);
|
|
var state = getInternalParamsState(this);
|
|
state.entries.push({ key: $toString(name), value: $toString(value) });
|
|
state.updateURL();
|
|
},
|
|
// `URLSearchParams.prototype.delete` method
|
|
// https://url.spec.whatwg.org/#dom-urlsearchparams-delete
|
|
'delete': function (name) {
|
|
validateArgumentsLength(arguments.length, 1);
|
|
var state = getInternalParamsState(this);
|
|
var entries = state.entries;
|
|
var key = $toString(name);
|
|
var index = 0;
|
|
while (index < entries.length) {
|
|
if (entries[index].key === key) entries.splice(index, 1);
|
|
else index++;
|
|
}
|
|
state.updateURL();
|
|
},
|
|
// `URLSearchParams.prototype.get` method
|
|
// https://url.spec.whatwg.org/#dom-urlsearchparams-get
|
|
get: function get(name) {
|
|
validateArgumentsLength(arguments.length, 1);
|
|
var entries = getInternalParamsState(this).entries;
|
|
var key = $toString(name);
|
|
var index = 0;
|
|
for (; index < entries.length; index++) {
|
|
if (entries[index].key === key) return entries[index].value;
|
|
}
|
|
return null;
|
|
},
|
|
// `URLSearchParams.prototype.getAll` method
|
|
// https://url.spec.whatwg.org/#dom-urlsearchparams-getall
|
|
getAll: function getAll(name) {
|
|
validateArgumentsLength(arguments.length, 1);
|
|
var entries = getInternalParamsState(this).entries;
|
|
var key = $toString(name);
|
|
var result = [];
|
|
var index = 0;
|
|
for (; index < entries.length; index++) {
|
|
if (entries[index].key === key) result.push(entries[index].value);
|
|
}
|
|
return result;
|
|
},
|
|
// `URLSearchParams.prototype.has` method
|
|
// https://url.spec.whatwg.org/#dom-urlsearchparams-has
|
|
has: function has(name) {
|
|
validateArgumentsLength(arguments.length, 1);
|
|
var entries = getInternalParamsState(this).entries;
|
|
var key = $toString(name);
|
|
var index = 0;
|
|
while (index < entries.length) {
|
|
if (entries[index++].key === key) return true;
|
|
}
|
|
return false;
|
|
},
|
|
// `URLSearchParams.prototype.set` method
|
|
// https://url.spec.whatwg.org/#dom-urlsearchparams-set
|
|
set: function set(name, value) {
|
|
validateArgumentsLength(arguments.length, 1);
|
|
var state = getInternalParamsState(this);
|
|
var entries = state.entries;
|
|
var found = false;
|
|
var key = $toString(name);
|
|
var val = $toString(value);
|
|
var index = 0;
|
|
var entry;
|
|
for (; index < entries.length; index++) {
|
|
entry = entries[index];
|
|
if (entry.key === key) {
|
|
if (found) entries.splice(index--, 1);
|
|
else {
|
|
found = true;
|
|
entry.value = val;
|
|
}
|
|
}
|
|
}
|
|
if (!found) entries.push({ key: key, value: val });
|
|
state.updateURL();
|
|
},
|
|
// `URLSearchParams.prototype.sort` method
|
|
// https://url.spec.whatwg.org/#dom-urlsearchparams-sort
|
|
sort: function sort() {
|
|
var state = getInternalParamsState(this);
|
|
var entries = state.entries;
|
|
// Array#sort is not stable in some engines
|
|
var slice = entries.slice();
|
|
var entry, entriesIndex, sliceIndex;
|
|
entries.length = 0;
|
|
for (sliceIndex = 0; sliceIndex < slice.length; sliceIndex++) {
|
|
entry = slice[sliceIndex];
|
|
for (entriesIndex = 0; entriesIndex < sliceIndex; entriesIndex++) {
|
|
if (entries[entriesIndex].key > entry.key) {
|
|
entries.splice(entriesIndex, 0, entry);
|
|
break;
|
|
}
|
|
}
|
|
if (entriesIndex === sliceIndex) entries.push(entry);
|
|
}
|
|
state.updateURL();
|
|
},
|
|
// `URLSearchParams.prototype.forEach` method
|
|
forEach: function forEach(callback /* , thisArg */) {
|
|
var entries = getInternalParamsState(this).entries;
|
|
var boundFunction = bind(callback, arguments.length > 1 ? arguments[1] : undefined, 3);
|
|
var index = 0;
|
|
var entry;
|
|
while (index < entries.length) {
|
|
entry = entries[index++];
|
|
boundFunction(entry.value, entry.key, this);
|
|
}
|
|
},
|
|
// `URLSearchParams.prototype.keys` method
|
|
keys: function keys() {
|
|
return new URLSearchParamsIterator(this, 'keys');
|
|
},
|
|
// `URLSearchParams.prototype.values` method
|
|
values: function values() {
|
|
return new URLSearchParamsIterator(this, 'values');
|
|
},
|
|
// `URLSearchParams.prototype.entries` method
|
|
entries: function entries() {
|
|
return new URLSearchParamsIterator(this, 'entries');
|
|
}
|
|
}, { enumerable: true });
|
|
|
|
// `URLSearchParams.prototype[@@iterator]` method
|
|
redefine(URLSearchParamsPrototype, ITERATOR, URLSearchParamsPrototype.entries, { name: 'entries' });
|
|
|
|
// `URLSearchParams.prototype.toString` method
|
|
// https://url.spec.whatwg.org/#urlsearchparams-stringification-behavior
|
|
redefine(URLSearchParamsPrototype, 'toString', function toString() {
|
|
var entries = getInternalParamsState(this).entries;
|
|
var result = [];
|
|
var index = 0;
|
|
var entry;
|
|
while (index < entries.length) {
|
|
entry = entries[index++];
|
|
result.push(serialize(entry.key) + '=' + serialize(entry.value));
|
|
} return result.join('&');
|
|
}, { enumerable: true });
|
|
|
|
setToStringTag(URLSearchParamsConstructor, URL_SEARCH_PARAMS);
|
|
|
|
$({ global: true, forced: !USE_NATIVE_URL }, {
|
|
URLSearchParams: URLSearchParamsConstructor
|
|
});
|
|
|
|
// Wrap `fetch` and `Request` for correct work with polyfilled `URLSearchParams`
|
|
if (!USE_NATIVE_URL && isCallable(Headers)) {
|
|
var wrapRequestOptions = function (init) {
|
|
if (isObject(init)) {
|
|
var body = init.body;
|
|
var headers;
|
|
if (classof(body) === URL_SEARCH_PARAMS) {
|
|
headers = init.headers ? new Headers(init.headers) : new Headers();
|
|
if (!headers.has('content-type')) {
|
|
headers.set('content-type', 'application/x-www-form-urlencoded;charset=UTF-8');
|
|
}
|
|
return create(init, {
|
|
body: createPropertyDescriptor(0, String(body)),
|
|
headers: createPropertyDescriptor(0, headers)
|
|
});
|
|
}
|
|
} return init;
|
|
};
|
|
|
|
if (isCallable(nativeFetch)) {
|
|
$({ global: true, enumerable: true, forced: true }, {
|
|
fetch: function fetch(input /* , init */) {
|
|
return nativeFetch(input, arguments.length > 1 ? wrapRequestOptions(arguments[1]) : {});
|
|
}
|
|
});
|
|
}
|
|
|
|
if (isCallable(NativeRequest)) {
|
|
var RequestConstructor = function Request(input /* , init */) {
|
|
anInstance(this, RequestConstructor, 'Request');
|
|
return new NativeRequest(input, arguments.length > 1 ? wrapRequestOptions(arguments[1]) : {});
|
|
};
|
|
|
|
RequestPrototype.constructor = RequestConstructor;
|
|
RequestConstructor.prototype = RequestPrototype;
|
|
|
|
$({ global: true, forced: true }, {
|
|
Request: RequestConstructor
|
|
});
|
|
}
|
|
}
|
|
|
|
module.exports = {
|
|
URLSearchParams: URLSearchParamsConstructor,
|
|
getState: getInternalParamsState
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4948:
|
|
/***/ (function(__unused_webpack_module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
"use strict";
|
|
|
|
// TODO: in core-js@4, move /modules/ dependencies to public entries for better optimization by tools like `preset-env`
|
|
__webpack_require__(5454);
|
|
var $ = __webpack_require__(3085);
|
|
var DESCRIPTORS = __webpack_require__(69);
|
|
var USE_NATIVE_URL = __webpack_require__(4551);
|
|
var global = __webpack_require__(8576);
|
|
var defineProperties = __webpack_require__(1187);
|
|
var redefine = __webpack_require__(9482);
|
|
var anInstance = __webpack_require__(6961);
|
|
var hasOwn = __webpack_require__(4500);
|
|
var assign = __webpack_require__(2503);
|
|
var arrayFrom = __webpack_require__(841);
|
|
var codeAt = __webpack_require__(863).codeAt;
|
|
var toASCII = __webpack_require__(7977);
|
|
var $toString = __webpack_require__(4845);
|
|
var setToStringTag = __webpack_require__(1284);
|
|
var URLSearchParamsModule = __webpack_require__(9336);
|
|
var InternalStateModule = __webpack_require__(3326);
|
|
|
|
var NativeURL = global.URL;
|
|
var URLSearchParams = URLSearchParamsModule.URLSearchParams;
|
|
var getInternalSearchParamsState = URLSearchParamsModule.getState;
|
|
var setInternalState = InternalStateModule.set;
|
|
var getInternalURLState = InternalStateModule.getterFor('URL');
|
|
var floor = Math.floor;
|
|
var pow = Math.pow;
|
|
|
|
var INVALID_AUTHORITY = 'Invalid authority';
|
|
var INVALID_SCHEME = 'Invalid scheme';
|
|
var INVALID_HOST = 'Invalid host';
|
|
var INVALID_PORT = 'Invalid port';
|
|
|
|
var ALPHA = /[A-Za-z]/;
|
|
// eslint-disable-next-line regexp/no-obscure-range -- safe
|
|
var ALPHANUMERIC = /[\d+-.A-Za-z]/;
|
|
var DIGIT = /\d/;
|
|
var HEX_START = /^0x/i;
|
|
var OCT = /^[0-7]+$/;
|
|
var DEC = /^\d+$/;
|
|
var HEX = /^[\dA-Fa-f]+$/;
|
|
/* eslint-disable regexp/no-control-character -- safe */
|
|
var FORBIDDEN_HOST_CODE_POINT = /[\0\t\n\r #%/:<>?@[\\\]^|]/;
|
|
var FORBIDDEN_HOST_CODE_POINT_EXCLUDING_PERCENT = /[\0\t\n\r #/:<>?@[\\\]^|]/;
|
|
var LEADING_AND_TRAILING_C0_CONTROL_OR_SPACE = /^[\u0000-\u0020]+|[\u0000-\u0020]+$/g;
|
|
var TAB_AND_NEW_LINE = /[\t\n\r]/g;
|
|
/* eslint-enable regexp/no-control-character -- safe */
|
|
var EOF;
|
|
|
|
var parseHost = function (url, input) {
|
|
var result, codePoints, index;
|
|
if (input.charAt(0) == '[') {
|
|
if (input.charAt(input.length - 1) != ']') return INVALID_HOST;
|
|
result = parseIPv6(input.slice(1, -1));
|
|
if (!result) return INVALID_HOST;
|
|
url.host = result;
|
|
// opaque host
|
|
} else if (!isSpecial(url)) {
|
|
if (FORBIDDEN_HOST_CODE_POINT_EXCLUDING_PERCENT.test(input)) return INVALID_HOST;
|
|
result = '';
|
|
codePoints = arrayFrom(input);
|
|
for (index = 0; index < codePoints.length; index++) {
|
|
result += percentEncode(codePoints[index], C0ControlPercentEncodeSet);
|
|
}
|
|
url.host = result;
|
|
} else {
|
|
input = toASCII(input);
|
|
if (FORBIDDEN_HOST_CODE_POINT.test(input)) return INVALID_HOST;
|
|
result = parseIPv4(input);
|
|
if (result === null) return INVALID_HOST;
|
|
url.host = result;
|
|
}
|
|
};
|
|
|
|
var parseIPv4 = function (input) {
|
|
var parts = input.split('.');
|
|
var partsLength, numbers, index, part, radix, number, ipv4;
|
|
if (parts.length && parts[parts.length - 1] == '') {
|
|
parts.pop();
|
|
}
|
|
partsLength = parts.length;
|
|
if (partsLength > 4) return input;
|
|
numbers = [];
|
|
for (index = 0; index < partsLength; index++) {
|
|
part = parts[index];
|
|
if (part == '') return input;
|
|
radix = 10;
|
|
if (part.length > 1 && part.charAt(0) == '0') {
|
|
radix = HEX_START.test(part) ? 16 : 8;
|
|
part = part.slice(radix == 8 ? 1 : 2);
|
|
}
|
|
if (part === '') {
|
|
number = 0;
|
|
} else {
|
|
if (!(radix == 10 ? DEC : radix == 8 ? OCT : HEX).test(part)) return input;
|
|
number = parseInt(part, radix);
|
|
}
|
|
numbers.push(number);
|
|
}
|
|
for (index = 0; index < partsLength; index++) {
|
|
number = numbers[index];
|
|
if (index == partsLength - 1) {
|
|
if (number >= pow(256, 5 - partsLength)) return null;
|
|
} else if (number > 255) return null;
|
|
}
|
|
ipv4 = numbers.pop();
|
|
for (index = 0; index < numbers.length; index++) {
|
|
ipv4 += numbers[index] * pow(256, 3 - index);
|
|
}
|
|
return ipv4;
|
|
};
|
|
|
|
// eslint-disable-next-line max-statements -- TODO
|
|
var parseIPv6 = function (input) {
|
|
var address = [0, 0, 0, 0, 0, 0, 0, 0];
|
|
var pieceIndex = 0;
|
|
var compress = null;
|
|
var pointer = 0;
|
|
var value, length, numbersSeen, ipv4Piece, number, swaps, swap;
|
|
|
|
var chr = function () {
|
|
return input.charAt(pointer);
|
|
};
|
|
|
|
if (chr() == ':') {
|
|
if (input.charAt(1) != ':') return;
|
|
pointer += 2;
|
|
pieceIndex++;
|
|
compress = pieceIndex;
|
|
}
|
|
while (chr()) {
|
|
if (pieceIndex == 8) return;
|
|
if (chr() == ':') {
|
|
if (compress !== null) return;
|
|
pointer++;
|
|
pieceIndex++;
|
|
compress = pieceIndex;
|
|
continue;
|
|
}
|
|
value = length = 0;
|
|
while (length < 4 && HEX.test(chr())) {
|
|
value = value * 16 + parseInt(chr(), 16);
|
|
pointer++;
|
|
length++;
|
|
}
|
|
if (chr() == '.') {
|
|
if (length == 0) return;
|
|
pointer -= length;
|
|
if (pieceIndex > 6) return;
|
|
numbersSeen = 0;
|
|
while (chr()) {
|
|
ipv4Piece = null;
|
|
if (numbersSeen > 0) {
|
|
if (chr() == '.' && numbersSeen < 4) pointer++;
|
|
else return;
|
|
}
|
|
if (!DIGIT.test(chr())) return;
|
|
while (DIGIT.test(chr())) {
|
|
number = parseInt(chr(), 10);
|
|
if (ipv4Piece === null) ipv4Piece = number;
|
|
else if (ipv4Piece == 0) return;
|
|
else ipv4Piece = ipv4Piece * 10 + number;
|
|
if (ipv4Piece > 255) return;
|
|
pointer++;
|
|
}
|
|
address[pieceIndex] = address[pieceIndex] * 256 + ipv4Piece;
|
|
numbersSeen++;
|
|
if (numbersSeen == 2 || numbersSeen == 4) pieceIndex++;
|
|
}
|
|
if (numbersSeen != 4) return;
|
|
break;
|
|
} else if (chr() == ':') {
|
|
pointer++;
|
|
if (!chr()) return;
|
|
} else if (chr()) return;
|
|
address[pieceIndex++] = value;
|
|
}
|
|
if (compress !== null) {
|
|
swaps = pieceIndex - compress;
|
|
pieceIndex = 7;
|
|
while (pieceIndex != 0 && swaps > 0) {
|
|
swap = address[pieceIndex];
|
|
address[pieceIndex--] = address[compress + swaps - 1];
|
|
address[compress + --swaps] = swap;
|
|
}
|
|
} else if (pieceIndex != 8) return;
|
|
return address;
|
|
};
|
|
|
|
var findLongestZeroSequence = function (ipv6) {
|
|
var maxIndex = null;
|
|
var maxLength = 1;
|
|
var currStart = null;
|
|
var currLength = 0;
|
|
var index = 0;
|
|
for (; index < 8; index++) {
|
|
if (ipv6[index] !== 0) {
|
|
if (currLength > maxLength) {
|
|
maxIndex = currStart;
|
|
maxLength = currLength;
|
|
}
|
|
currStart = null;
|
|
currLength = 0;
|
|
} else {
|
|
if (currStart === null) currStart = index;
|
|
++currLength;
|
|
}
|
|
}
|
|
if (currLength > maxLength) {
|
|
maxIndex = currStart;
|
|
maxLength = currLength;
|
|
}
|
|
return maxIndex;
|
|
};
|
|
|
|
var serializeHost = function (host) {
|
|
var result, index, compress, ignore0;
|
|
// ipv4
|
|
if (typeof host == 'number') {
|
|
result = [];
|
|
for (index = 0; index < 4; index++) {
|
|
result.unshift(host % 256);
|
|
host = floor(host / 256);
|
|
} return result.join('.');
|
|
// ipv6
|
|
} else if (typeof host == 'object') {
|
|
result = '';
|
|
compress = findLongestZeroSequence(host);
|
|
for (index = 0; index < 8; index++) {
|
|
if (ignore0 && host[index] === 0) continue;
|
|
if (ignore0) ignore0 = false;
|
|
if (compress === index) {
|
|
result += index ? ':' : '::';
|
|
ignore0 = true;
|
|
} else {
|
|
result += host[index].toString(16);
|
|
if (index < 7) result += ':';
|
|
}
|
|
}
|
|
return '[' + result + ']';
|
|
} return host;
|
|
};
|
|
|
|
var C0ControlPercentEncodeSet = {};
|
|
var fragmentPercentEncodeSet = assign({}, C0ControlPercentEncodeSet, {
|
|
' ': 1, '"': 1, '<': 1, '>': 1, '`': 1
|
|
});
|
|
var pathPercentEncodeSet = assign({}, fragmentPercentEncodeSet, {
|
|
'#': 1, '?': 1, '{': 1, '}': 1
|
|
});
|
|
var userinfoPercentEncodeSet = assign({}, pathPercentEncodeSet, {
|
|
'/': 1, ':': 1, ';': 1, '=': 1, '@': 1, '[': 1, '\\': 1, ']': 1, '^': 1, '|': 1
|
|
});
|
|
|
|
var percentEncode = function (chr, set) {
|
|
var code = codeAt(chr, 0);
|
|
return code > 0x20 && code < 0x7F && !hasOwn(set, chr) ? chr : encodeURIComponent(chr);
|
|
};
|
|
|
|
var specialSchemes = {
|
|
ftp: 21,
|
|
file: null,
|
|
http: 80,
|
|
https: 443,
|
|
ws: 80,
|
|
wss: 443
|
|
};
|
|
|
|
var isSpecial = function (url) {
|
|
return hasOwn(specialSchemes, url.scheme);
|
|
};
|
|
|
|
var includesCredentials = function (url) {
|
|
return url.username != '' || url.password != '';
|
|
};
|
|
|
|
var cannotHaveUsernamePasswordPort = function (url) {
|
|
return !url.host || url.cannotBeABaseURL || url.scheme == 'file';
|
|
};
|
|
|
|
var isWindowsDriveLetter = function (string, normalized) {
|
|
var second;
|
|
return string.length == 2 && ALPHA.test(string.charAt(0))
|
|
&& ((second = string.charAt(1)) == ':' || (!normalized && second == '|'));
|
|
};
|
|
|
|
var startsWithWindowsDriveLetter = function (string) {
|
|
var third;
|
|
return string.length > 1 && isWindowsDriveLetter(string.slice(0, 2)) && (
|
|
string.length == 2 ||
|
|
((third = string.charAt(2)) === '/' || third === '\\' || third === '?' || third === '#')
|
|
);
|
|
};
|
|
|
|
var shortenURLsPath = function (url) {
|
|
var path = url.path;
|
|
var pathSize = path.length;
|
|
if (pathSize && (url.scheme != 'file' || pathSize != 1 || !isWindowsDriveLetter(path[0], true))) {
|
|
path.pop();
|
|
}
|
|
};
|
|
|
|
var isSingleDot = function (segment) {
|
|
return segment === '.' || segment.toLowerCase() === '%2e';
|
|
};
|
|
|
|
var isDoubleDot = function (segment) {
|
|
segment = segment.toLowerCase();
|
|
return segment === '..' || segment === '%2e.' || segment === '.%2e' || segment === '%2e%2e';
|
|
};
|
|
|
|
// States:
|
|
var SCHEME_START = {};
|
|
var SCHEME = {};
|
|
var NO_SCHEME = {};
|
|
var SPECIAL_RELATIVE_OR_AUTHORITY = {};
|
|
var PATH_OR_AUTHORITY = {};
|
|
var RELATIVE = {};
|
|
var RELATIVE_SLASH = {};
|
|
var SPECIAL_AUTHORITY_SLASHES = {};
|
|
var SPECIAL_AUTHORITY_IGNORE_SLASHES = {};
|
|
var AUTHORITY = {};
|
|
var HOST = {};
|
|
var HOSTNAME = {};
|
|
var PORT = {};
|
|
var FILE = {};
|
|
var FILE_SLASH = {};
|
|
var FILE_HOST = {};
|
|
var PATH_START = {};
|
|
var PATH = {};
|
|
var CANNOT_BE_A_BASE_URL_PATH = {};
|
|
var QUERY = {};
|
|
var FRAGMENT = {};
|
|
|
|
// eslint-disable-next-line max-statements -- TODO
|
|
var parseURL = function (url, input, stateOverride, base) {
|
|
var state = stateOverride || SCHEME_START;
|
|
var pointer = 0;
|
|
var buffer = '';
|
|
var seenAt = false;
|
|
var seenBracket = false;
|
|
var seenPasswordToken = false;
|
|
var codePoints, chr, bufferCodePoints, failure;
|
|
|
|
if (!stateOverride) {
|
|
url.scheme = '';
|
|
url.username = '';
|
|
url.password = '';
|
|
url.host = null;
|
|
url.port = null;
|
|
url.path = [];
|
|
url.query = null;
|
|
url.fragment = null;
|
|
url.cannotBeABaseURL = false;
|
|
input = input.replace(LEADING_AND_TRAILING_C0_CONTROL_OR_SPACE, '');
|
|
}
|
|
|
|
input = input.replace(TAB_AND_NEW_LINE, '');
|
|
|
|
codePoints = arrayFrom(input);
|
|
|
|
while (pointer <= codePoints.length) {
|
|
chr = codePoints[pointer];
|
|
switch (state) {
|
|
case SCHEME_START:
|
|
if (chr && ALPHA.test(chr)) {
|
|
buffer += chr.toLowerCase();
|
|
state = SCHEME;
|
|
} else if (!stateOverride) {
|
|
state = NO_SCHEME;
|
|
continue;
|
|
} else return INVALID_SCHEME;
|
|
break;
|
|
|
|
case SCHEME:
|
|
if (chr && (ALPHANUMERIC.test(chr) || chr == '+' || chr == '-' || chr == '.')) {
|
|
buffer += chr.toLowerCase();
|
|
} else if (chr == ':') {
|
|
if (stateOverride && (
|
|
(isSpecial(url) != hasOwn(specialSchemes, buffer)) ||
|
|
(buffer == 'file' && (includesCredentials(url) || url.port !== null)) ||
|
|
(url.scheme == 'file' && !url.host)
|
|
)) return;
|
|
url.scheme = buffer;
|
|
if (stateOverride) {
|
|
if (isSpecial(url) && specialSchemes[url.scheme] == url.port) url.port = null;
|
|
return;
|
|
}
|
|
buffer = '';
|
|
if (url.scheme == 'file') {
|
|
state = FILE;
|
|
} else if (isSpecial(url) && base && base.scheme == url.scheme) {
|
|
state = SPECIAL_RELATIVE_OR_AUTHORITY;
|
|
} else if (isSpecial(url)) {
|
|
state = SPECIAL_AUTHORITY_SLASHES;
|
|
} else if (codePoints[pointer + 1] == '/') {
|
|
state = PATH_OR_AUTHORITY;
|
|
pointer++;
|
|
} else {
|
|
url.cannotBeABaseURL = true;
|
|
url.path.push('');
|
|
state = CANNOT_BE_A_BASE_URL_PATH;
|
|
}
|
|
} else if (!stateOverride) {
|
|
buffer = '';
|
|
state = NO_SCHEME;
|
|
pointer = 0;
|
|
continue;
|
|
} else return INVALID_SCHEME;
|
|
break;
|
|
|
|
case NO_SCHEME:
|
|
if (!base || (base.cannotBeABaseURL && chr != '#')) return INVALID_SCHEME;
|
|
if (base.cannotBeABaseURL && chr == '#') {
|
|
url.scheme = base.scheme;
|
|
url.path = base.path.slice();
|
|
url.query = base.query;
|
|
url.fragment = '';
|
|
url.cannotBeABaseURL = true;
|
|
state = FRAGMENT;
|
|
break;
|
|
}
|
|
state = base.scheme == 'file' ? FILE : RELATIVE;
|
|
continue;
|
|
|
|
case SPECIAL_RELATIVE_OR_AUTHORITY:
|
|
if (chr == '/' && codePoints[pointer + 1] == '/') {
|
|
state = SPECIAL_AUTHORITY_IGNORE_SLASHES;
|
|
pointer++;
|
|
} else {
|
|
state = RELATIVE;
|
|
continue;
|
|
} break;
|
|
|
|
case PATH_OR_AUTHORITY:
|
|
if (chr == '/') {
|
|
state = AUTHORITY;
|
|
break;
|
|
} else {
|
|
state = PATH;
|
|
continue;
|
|
}
|
|
|
|
case RELATIVE:
|
|
url.scheme = base.scheme;
|
|
if (chr == EOF) {
|
|
url.username = base.username;
|
|
url.password = base.password;
|
|
url.host = base.host;
|
|
url.port = base.port;
|
|
url.path = base.path.slice();
|
|
url.query = base.query;
|
|
} else if (chr == '/' || (chr == '\\' && isSpecial(url))) {
|
|
state = RELATIVE_SLASH;
|
|
} else if (chr == '?') {
|
|
url.username = base.username;
|
|
url.password = base.password;
|
|
url.host = base.host;
|
|
url.port = base.port;
|
|
url.path = base.path.slice();
|
|
url.query = '';
|
|
state = QUERY;
|
|
} else if (chr == '#') {
|
|
url.username = base.username;
|
|
url.password = base.password;
|
|
url.host = base.host;
|
|
url.port = base.port;
|
|
url.path = base.path.slice();
|
|
url.query = base.query;
|
|
url.fragment = '';
|
|
state = FRAGMENT;
|
|
} else {
|
|
url.username = base.username;
|
|
url.password = base.password;
|
|
url.host = base.host;
|
|
url.port = base.port;
|
|
url.path = base.path.slice();
|
|
url.path.pop();
|
|
state = PATH;
|
|
continue;
|
|
} break;
|
|
|
|
case RELATIVE_SLASH:
|
|
if (isSpecial(url) && (chr == '/' || chr == '\\')) {
|
|
state = SPECIAL_AUTHORITY_IGNORE_SLASHES;
|
|
} else if (chr == '/') {
|
|
state = AUTHORITY;
|
|
} else {
|
|
url.username = base.username;
|
|
url.password = base.password;
|
|
url.host = base.host;
|
|
url.port = base.port;
|
|
state = PATH;
|
|
continue;
|
|
} break;
|
|
|
|
case SPECIAL_AUTHORITY_SLASHES:
|
|
state = SPECIAL_AUTHORITY_IGNORE_SLASHES;
|
|
if (chr != '/' || buffer.charAt(pointer + 1) != '/') continue;
|
|
pointer++;
|
|
break;
|
|
|
|
case SPECIAL_AUTHORITY_IGNORE_SLASHES:
|
|
if (chr != '/' && chr != '\\') {
|
|
state = AUTHORITY;
|
|
continue;
|
|
} break;
|
|
|
|
case AUTHORITY:
|
|
if (chr == '@') {
|
|
if (seenAt) buffer = '%40' + buffer;
|
|
seenAt = true;
|
|
bufferCodePoints = arrayFrom(buffer);
|
|
for (var i = 0; i < bufferCodePoints.length; i++) {
|
|
var codePoint = bufferCodePoints[i];
|
|
if (codePoint == ':' && !seenPasswordToken) {
|
|
seenPasswordToken = true;
|
|
continue;
|
|
}
|
|
var encodedCodePoints = percentEncode(codePoint, userinfoPercentEncodeSet);
|
|
if (seenPasswordToken) url.password += encodedCodePoints;
|
|
else url.username += encodedCodePoints;
|
|
}
|
|
buffer = '';
|
|
} else if (
|
|
chr == EOF || chr == '/' || chr == '?' || chr == '#' ||
|
|
(chr == '\\' && isSpecial(url))
|
|
) {
|
|
if (seenAt && buffer == '') return INVALID_AUTHORITY;
|
|
pointer -= arrayFrom(buffer).length + 1;
|
|
buffer = '';
|
|
state = HOST;
|
|
} else buffer += chr;
|
|
break;
|
|
|
|
case HOST:
|
|
case HOSTNAME:
|
|
if (stateOverride && url.scheme == 'file') {
|
|
state = FILE_HOST;
|
|
continue;
|
|
} else if (chr == ':' && !seenBracket) {
|
|
if (buffer == '') return INVALID_HOST;
|
|
failure = parseHost(url, buffer);
|
|
if (failure) return failure;
|
|
buffer = '';
|
|
state = PORT;
|
|
if (stateOverride == HOSTNAME) return;
|
|
} else if (
|
|
chr == EOF || chr == '/' || chr == '?' || chr == '#' ||
|
|
(chr == '\\' && isSpecial(url))
|
|
) {
|
|
if (isSpecial(url) && buffer == '') return INVALID_HOST;
|
|
if (stateOverride && buffer == '' && (includesCredentials(url) || url.port !== null)) return;
|
|
failure = parseHost(url, buffer);
|
|
if (failure) return failure;
|
|
buffer = '';
|
|
state = PATH_START;
|
|
if (stateOverride) return;
|
|
continue;
|
|
} else {
|
|
if (chr == '[') seenBracket = true;
|
|
else if (chr == ']') seenBracket = false;
|
|
buffer += chr;
|
|
} break;
|
|
|
|
case PORT:
|
|
if (DIGIT.test(chr)) {
|
|
buffer += chr;
|
|
} else if (
|
|
chr == EOF || chr == '/' || chr == '?' || chr == '#' ||
|
|
(chr == '\\' && isSpecial(url)) ||
|
|
stateOverride
|
|
) {
|
|
if (buffer != '') {
|
|
var port = parseInt(buffer, 10);
|
|
if (port > 0xFFFF) return INVALID_PORT;
|
|
url.port = (isSpecial(url) && port === specialSchemes[url.scheme]) ? null : port;
|
|
buffer = '';
|
|
}
|
|
if (stateOverride) return;
|
|
state = PATH_START;
|
|
continue;
|
|
} else return INVALID_PORT;
|
|
break;
|
|
|
|
case FILE:
|
|
url.scheme = 'file';
|
|
if (chr == '/' || chr == '\\') state = FILE_SLASH;
|
|
else if (base && base.scheme == 'file') {
|
|
if (chr == EOF) {
|
|
url.host = base.host;
|
|
url.path = base.path.slice();
|
|
url.query = base.query;
|
|
} else if (chr == '?') {
|
|
url.host = base.host;
|
|
url.path = base.path.slice();
|
|
url.query = '';
|
|
state = QUERY;
|
|
} else if (chr == '#') {
|
|
url.host = base.host;
|
|
url.path = base.path.slice();
|
|
url.query = base.query;
|
|
url.fragment = '';
|
|
state = FRAGMENT;
|
|
} else {
|
|
if (!startsWithWindowsDriveLetter(codePoints.slice(pointer).join(''))) {
|
|
url.host = base.host;
|
|
url.path = base.path.slice();
|
|
shortenURLsPath(url);
|
|
}
|
|
state = PATH;
|
|
continue;
|
|
}
|
|
} else {
|
|
state = PATH;
|
|
continue;
|
|
} break;
|
|
|
|
case FILE_SLASH:
|
|
if (chr == '/' || chr == '\\') {
|
|
state = FILE_HOST;
|
|
break;
|
|
}
|
|
if (base && base.scheme == 'file' && !startsWithWindowsDriveLetter(codePoints.slice(pointer).join(''))) {
|
|
if (isWindowsDriveLetter(base.path[0], true)) url.path.push(base.path[0]);
|
|
else url.host = base.host;
|
|
}
|
|
state = PATH;
|
|
continue;
|
|
|
|
case FILE_HOST:
|
|
if (chr == EOF || chr == '/' || chr == '\\' || chr == '?' || chr == '#') {
|
|
if (!stateOverride && isWindowsDriveLetter(buffer)) {
|
|
state = PATH;
|
|
} else if (buffer == '') {
|
|
url.host = '';
|
|
if (stateOverride) return;
|
|
state = PATH_START;
|
|
} else {
|
|
failure = parseHost(url, buffer);
|
|
if (failure) return failure;
|
|
if (url.host == 'localhost') url.host = '';
|
|
if (stateOverride) return;
|
|
buffer = '';
|
|
state = PATH_START;
|
|
} continue;
|
|
} else buffer += chr;
|
|
break;
|
|
|
|
case PATH_START:
|
|
if (isSpecial(url)) {
|
|
state = PATH;
|
|
if (chr != '/' && chr != '\\') continue;
|
|
} else if (!stateOverride && chr == '?') {
|
|
url.query = '';
|
|
state = QUERY;
|
|
} else if (!stateOverride && chr == '#') {
|
|
url.fragment = '';
|
|
state = FRAGMENT;
|
|
} else if (chr != EOF) {
|
|
state = PATH;
|
|
if (chr != '/') continue;
|
|
} break;
|
|
|
|
case PATH:
|
|
if (
|
|
chr == EOF || chr == '/' ||
|
|
(chr == '\\' && isSpecial(url)) ||
|
|
(!stateOverride && (chr == '?' || chr == '#'))
|
|
) {
|
|
if (isDoubleDot(buffer)) {
|
|
shortenURLsPath(url);
|
|
if (chr != '/' && !(chr == '\\' && isSpecial(url))) {
|
|
url.path.push('');
|
|
}
|
|
} else if (isSingleDot(buffer)) {
|
|
if (chr != '/' && !(chr == '\\' && isSpecial(url))) {
|
|
url.path.push('');
|
|
}
|
|
} else {
|
|
if (url.scheme == 'file' && !url.path.length && isWindowsDriveLetter(buffer)) {
|
|
if (url.host) url.host = '';
|
|
buffer = buffer.charAt(0) + ':'; // normalize windows drive letter
|
|
}
|
|
url.path.push(buffer);
|
|
}
|
|
buffer = '';
|
|
if (url.scheme == 'file' && (chr == EOF || chr == '?' || chr == '#')) {
|
|
while (url.path.length > 1 && url.path[0] === '') {
|
|
url.path.shift();
|
|
}
|
|
}
|
|
if (chr == '?') {
|
|
url.query = '';
|
|
state = QUERY;
|
|
} else if (chr == '#') {
|
|
url.fragment = '';
|
|
state = FRAGMENT;
|
|
}
|
|
} else {
|
|
buffer += percentEncode(chr, pathPercentEncodeSet);
|
|
} break;
|
|
|
|
case CANNOT_BE_A_BASE_URL_PATH:
|
|
if (chr == '?') {
|
|
url.query = '';
|
|
state = QUERY;
|
|
} else if (chr == '#') {
|
|
url.fragment = '';
|
|
state = FRAGMENT;
|
|
} else if (chr != EOF) {
|
|
url.path[0] += percentEncode(chr, C0ControlPercentEncodeSet);
|
|
} break;
|
|
|
|
case QUERY:
|
|
if (!stateOverride && chr == '#') {
|
|
url.fragment = '';
|
|
state = FRAGMENT;
|
|
} else if (chr != EOF) {
|
|
if (chr == "'" && isSpecial(url)) url.query += '%27';
|
|
else if (chr == '#') url.query += '%23';
|
|
else url.query += percentEncode(chr, C0ControlPercentEncodeSet);
|
|
} break;
|
|
|
|
case FRAGMENT:
|
|
if (chr != EOF) url.fragment += percentEncode(chr, fragmentPercentEncodeSet);
|
|
break;
|
|
}
|
|
|
|
pointer++;
|
|
}
|
|
};
|
|
|
|
// `URL` constructor
|
|
// https://url.spec.whatwg.org/#url-class
|
|
var URLConstructor = function URL(url /* , base */) {
|
|
var that = anInstance(this, URLConstructor, 'URL');
|
|
var base = arguments.length > 1 ? arguments[1] : undefined;
|
|
var urlString = $toString(url);
|
|
var state = setInternalState(that, { type: 'URL' });
|
|
var baseState, failure;
|
|
if (base !== undefined) {
|
|
if (base instanceof URLConstructor) baseState = getInternalURLState(base);
|
|
else {
|
|
failure = parseURL(baseState = {}, $toString(base));
|
|
if (failure) throw TypeError(failure);
|
|
}
|
|
}
|
|
failure = parseURL(state, urlString, null, baseState);
|
|
if (failure) throw TypeError(failure);
|
|
var searchParams = state.searchParams = new URLSearchParams();
|
|
var searchParamsState = getInternalSearchParamsState(searchParams);
|
|
searchParamsState.updateSearchParams(state.query);
|
|
searchParamsState.updateURL = function () {
|
|
state.query = String(searchParams) || null;
|
|
};
|
|
if (!DESCRIPTORS) {
|
|
that.href = serializeURL.call(that);
|
|
that.origin = getOrigin.call(that);
|
|
that.protocol = getProtocol.call(that);
|
|
that.username = getUsername.call(that);
|
|
that.password = getPassword.call(that);
|
|
that.host = getHost.call(that);
|
|
that.hostname = getHostname.call(that);
|
|
that.port = getPort.call(that);
|
|
that.pathname = getPathname.call(that);
|
|
that.search = getSearch.call(that);
|
|
that.searchParams = getSearchParams.call(that);
|
|
that.hash = getHash.call(that);
|
|
}
|
|
};
|
|
|
|
var URLPrototype = URLConstructor.prototype;
|
|
|
|
var serializeURL = function () {
|
|
var url = getInternalURLState(this);
|
|
var scheme = url.scheme;
|
|
var username = url.username;
|
|
var password = url.password;
|
|
var host = url.host;
|
|
var port = url.port;
|
|
var path = url.path;
|
|
var query = url.query;
|
|
var fragment = url.fragment;
|
|
var output = scheme + ':';
|
|
if (host !== null) {
|
|
output += '//';
|
|
if (includesCredentials(url)) {
|
|
output += username + (password ? ':' + password : '') + '@';
|
|
}
|
|
output += serializeHost(host);
|
|
if (port !== null) output += ':' + port;
|
|
} else if (scheme == 'file') output += '//';
|
|
output += url.cannotBeABaseURL ? path[0] : path.length ? '/' + path.join('/') : '';
|
|
if (query !== null) output += '?' + query;
|
|
if (fragment !== null) output += '#' + fragment;
|
|
return output;
|
|
};
|
|
|
|
var getOrigin = function () {
|
|
var url = getInternalURLState(this);
|
|
var scheme = url.scheme;
|
|
var port = url.port;
|
|
if (scheme == 'blob') try {
|
|
return new URLConstructor(scheme.path[0]).origin;
|
|
} catch (error) {
|
|
return 'null';
|
|
}
|
|
if (scheme == 'file' || !isSpecial(url)) return 'null';
|
|
return scheme + '://' + serializeHost(url.host) + (port !== null ? ':' + port : '');
|
|
};
|
|
|
|
var getProtocol = function () {
|
|
return getInternalURLState(this).scheme + ':';
|
|
};
|
|
|
|
var getUsername = function () {
|
|
return getInternalURLState(this).username;
|
|
};
|
|
|
|
var getPassword = function () {
|
|
return getInternalURLState(this).password;
|
|
};
|
|
|
|
var getHost = function () {
|
|
var url = getInternalURLState(this);
|
|
var host = url.host;
|
|
var port = url.port;
|
|
return host === null ? ''
|
|
: port === null ? serializeHost(host)
|
|
: serializeHost(host) + ':' + port;
|
|
};
|
|
|
|
var getHostname = function () {
|
|
var host = getInternalURLState(this).host;
|
|
return host === null ? '' : serializeHost(host);
|
|
};
|
|
|
|
var getPort = function () {
|
|
var port = getInternalURLState(this).port;
|
|
return port === null ? '' : String(port);
|
|
};
|
|
|
|
var getPathname = function () {
|
|
var url = getInternalURLState(this);
|
|
var path = url.path;
|
|
return url.cannotBeABaseURL ? path[0] : path.length ? '/' + path.join('/') : '';
|
|
};
|
|
|
|
var getSearch = function () {
|
|
var query = getInternalURLState(this).query;
|
|
return query ? '?' + query : '';
|
|
};
|
|
|
|
var getSearchParams = function () {
|
|
return getInternalURLState(this).searchParams;
|
|
};
|
|
|
|
var getHash = function () {
|
|
var fragment = getInternalURLState(this).fragment;
|
|
return fragment ? '#' + fragment : '';
|
|
};
|
|
|
|
var accessorDescriptor = function (getter, setter) {
|
|
return { get: getter, set: setter, configurable: true, enumerable: true };
|
|
};
|
|
|
|
if (DESCRIPTORS) {
|
|
defineProperties(URLPrototype, {
|
|
// `URL.prototype.href` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-href
|
|
href: accessorDescriptor(serializeURL, function (href) {
|
|
var url = getInternalURLState(this);
|
|
var urlString = $toString(href);
|
|
var failure = parseURL(url, urlString);
|
|
if (failure) throw TypeError(failure);
|
|
getInternalSearchParamsState(url.searchParams).updateSearchParams(url.query);
|
|
}),
|
|
// `URL.prototype.origin` getter
|
|
// https://url.spec.whatwg.org/#dom-url-origin
|
|
origin: accessorDescriptor(getOrigin),
|
|
// `URL.prototype.protocol` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-protocol
|
|
protocol: accessorDescriptor(getProtocol, function (protocol) {
|
|
var url = getInternalURLState(this);
|
|
parseURL(url, $toString(protocol) + ':', SCHEME_START);
|
|
}),
|
|
// `URL.prototype.username` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-username
|
|
username: accessorDescriptor(getUsername, function (username) {
|
|
var url = getInternalURLState(this);
|
|
var codePoints = arrayFrom($toString(username));
|
|
if (cannotHaveUsernamePasswordPort(url)) return;
|
|
url.username = '';
|
|
for (var i = 0; i < codePoints.length; i++) {
|
|
url.username += percentEncode(codePoints[i], userinfoPercentEncodeSet);
|
|
}
|
|
}),
|
|
// `URL.prototype.password` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-password
|
|
password: accessorDescriptor(getPassword, function (password) {
|
|
var url = getInternalURLState(this);
|
|
var codePoints = arrayFrom($toString(password));
|
|
if (cannotHaveUsernamePasswordPort(url)) return;
|
|
url.password = '';
|
|
for (var i = 0; i < codePoints.length; i++) {
|
|
url.password += percentEncode(codePoints[i], userinfoPercentEncodeSet);
|
|
}
|
|
}),
|
|
// `URL.prototype.host` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-host
|
|
host: accessorDescriptor(getHost, function (host) {
|
|
var url = getInternalURLState(this);
|
|
if (url.cannotBeABaseURL) return;
|
|
parseURL(url, $toString(host), HOST);
|
|
}),
|
|
// `URL.prototype.hostname` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-hostname
|
|
hostname: accessorDescriptor(getHostname, function (hostname) {
|
|
var url = getInternalURLState(this);
|
|
if (url.cannotBeABaseURL) return;
|
|
parseURL(url, $toString(hostname), HOSTNAME);
|
|
}),
|
|
// `URL.prototype.port` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-port
|
|
port: accessorDescriptor(getPort, function (port) {
|
|
var url = getInternalURLState(this);
|
|
if (cannotHaveUsernamePasswordPort(url)) return;
|
|
port = $toString(port);
|
|
if (port == '') url.port = null;
|
|
else parseURL(url, port, PORT);
|
|
}),
|
|
// `URL.prototype.pathname` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-pathname
|
|
pathname: accessorDescriptor(getPathname, function (pathname) {
|
|
var url = getInternalURLState(this);
|
|
if (url.cannotBeABaseURL) return;
|
|
url.path = [];
|
|
parseURL(url, $toString(pathname), PATH_START);
|
|
}),
|
|
// `URL.prototype.search` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-search
|
|
search: accessorDescriptor(getSearch, function (search) {
|
|
var url = getInternalURLState(this);
|
|
search = $toString(search);
|
|
if (search == '') {
|
|
url.query = null;
|
|
} else {
|
|
if ('?' == search.charAt(0)) search = search.slice(1);
|
|
url.query = '';
|
|
parseURL(url, search, QUERY);
|
|
}
|
|
getInternalSearchParamsState(url.searchParams).updateSearchParams(url.query);
|
|
}),
|
|
// `URL.prototype.searchParams` getter
|
|
// https://url.spec.whatwg.org/#dom-url-searchparams
|
|
searchParams: accessorDescriptor(getSearchParams),
|
|
// `URL.prototype.hash` accessors pair
|
|
// https://url.spec.whatwg.org/#dom-url-hash
|
|
hash: accessorDescriptor(getHash, function (hash) {
|
|
var url = getInternalURLState(this);
|
|
hash = $toString(hash);
|
|
if (hash == '') {
|
|
url.fragment = null;
|
|
return;
|
|
}
|
|
if ('#' == hash.charAt(0)) hash = hash.slice(1);
|
|
url.fragment = '';
|
|
parseURL(url, hash, FRAGMENT);
|
|
})
|
|
});
|
|
}
|
|
|
|
// `URL.prototype.toJSON` method
|
|
// https://url.spec.whatwg.org/#dom-url-tojson
|
|
redefine(URLPrototype, 'toJSON', function toJSON() {
|
|
return serializeURL.call(this);
|
|
}, { enumerable: true });
|
|
|
|
// `URL.prototype.toString` method
|
|
// https://url.spec.whatwg.org/#URL-stringification-behavior
|
|
redefine(URLPrototype, 'toString', function toString() {
|
|
return serializeURL.call(this);
|
|
}, { enumerable: true });
|
|
|
|
if (NativeURL) {
|
|
var nativeCreateObjectURL = NativeURL.createObjectURL;
|
|
var nativeRevokeObjectURL = NativeURL.revokeObjectURL;
|
|
// `URL.createObjectURL` method
|
|
// https://developer.mozilla.org/en-US/docs/Web/API/URL/createObjectURL
|
|
// eslint-disable-next-line no-unused-vars -- required for `.length`
|
|
if (nativeCreateObjectURL) redefine(URLConstructor, 'createObjectURL', function createObjectURL(blob) {
|
|
return nativeCreateObjectURL.apply(NativeURL, arguments);
|
|
});
|
|
// `URL.revokeObjectURL` method
|
|
// https://developer.mozilla.org/en-US/docs/Web/API/URL/revokeObjectURL
|
|
// eslint-disable-next-line no-unused-vars -- required for `.length`
|
|
if (nativeRevokeObjectURL) redefine(URLConstructor, 'revokeObjectURL', function revokeObjectURL(url) {
|
|
return nativeRevokeObjectURL.apply(NativeURL, arguments);
|
|
});
|
|
}
|
|
|
|
setToStringTag(URLConstructor, 'URL');
|
|
|
|
$({ global: true, forced: !USE_NATIVE_URL, sham: !DESCRIPTORS }, {
|
|
URL: URLConstructor
|
|
});
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9801:
|
|
/***/ (function() {
|
|
|
|
// empty
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3822:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(2221);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1434:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(5078);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6899:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(98);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7710:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(5739);
|
|
__webpack_require__(162);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4486:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(278);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4877:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(1484);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7178:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(7731);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5603:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(3669);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 1206:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(162);
|
|
var forEach = __webpack_require__(6899);
|
|
var classof = __webpack_require__(4696);
|
|
var ArrayPrototype = Array.prototype;
|
|
|
|
var DOMIterables = {
|
|
DOMTokenList: true,
|
|
NodeList: true
|
|
};
|
|
|
|
module.exports = function (it) {
|
|
var own = it.forEach;
|
|
return it === ArrayPrototype || (it instanceof Array && own === ArrayPrototype.forEach)
|
|
// eslint-disable-next-line no-prototype-builtins -- safe
|
|
|| DOMIterables.hasOwnProperty(classof(it)) ? forEach : own;
|
|
};
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6174:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(2604);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 57:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(263);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4741:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(7663);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8368:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(5063);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3739:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(6813);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 172:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(6285);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4963:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(3213);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 7820:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(3512);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8980:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(8168);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5636:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(8651);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6672:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(3083);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5059:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(2987);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 3969:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(2239);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6618:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(3154);
|
|
__webpack_require__(162);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5279:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(6577);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 9562:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(2906);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.setTimeout;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2285:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(5008);
|
|
__webpack_require__(162);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 8535:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(994);
|
|
__webpack_require__(162);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 652:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
var parent = __webpack_require__(5668);
|
|
|
|
module.exports = parent;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 5668:
|
|
/***/ (function(module, __unused_webpack_exports, __webpack_require__) {
|
|
|
|
__webpack_require__(4948);
|
|
__webpack_require__(9801);
|
|
__webpack_require__(9336);
|
|
var path = __webpack_require__(7545);
|
|
|
|
module.exports = path.URL;
|
|
|
|
|
|
/***/ }),
|
|
|
|
/***/ 2534:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
module.exports = "data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiBlbmNvZGluZz0iVVRGLTgiPz4KPCFET0NUWVBFIHN2ZyBQVUJMSUMgIi0vL1czQy8vRFREIFNWRyAxLjEvL0VOIiAiaHR0cDovL3d3dy53My5vcmcvR3JhcGhpY3MvU1ZHLzEuMS9EVEQvc3ZnMTEuZHRkIj4KPHN2ZyBkaXNwbGF5PSJub25lIiB4bWxucz0iaHR0cDovL3d3dy53My5vcmcvMjAwMC9zdmciIHhtbG5zOnhsaW5rPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5L3hsaW5rIj4KPGRlZnMgaWQ9InR1aS1pbWFnZS1lZGl0b3Itc3ZnLWRlZmF1bHQtaWNvbnMiPgo8c3ltYm9sIGlkPSJpYy1hcHBseSIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxwYXRoIGQ9Ik0wIDBoMjR2MjRIMHoiIHN0cm9rZT0ibm9uZSIgZmlsbD0ibm9uZSIvPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBkPSJNNCAxMi4wMTFsNSA1TDIwLjAxMSA2Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1jYW5jZWwiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8cGF0aCBkPSJNMCAwaDI0djI0SDB6IiBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiLz4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgZD0iTTYgNmwxMiAxMk0xOCA2TDYgMTgiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWNyb3AiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8cGF0aCBkPSJNMCAwaDI0djI0SDB6IiBzdHJva2U9Im5vbmUiIGZpbGw9Im5vbmUiIC8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik00IDBoMXYyMGExIDEgMCAwIDEtMS0xVjB6TTIwIDE3aC0xVjVoMXYxMnptMCAydjVoLTF2LTVoMXoiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTUgMTloMTl2MUg1ek00Ljc2MiA0djFIMFY0aDQuNzYyek03IDRoMTJhMSAxIDAgMCAxIDEgMUg3VjR6Ii8+Cjwvc3ltYm9sPgo8IS0tIFRoaXMgaWNvbiBtYWRlIGJ5IFBpeGVsIHBlcmZlY3QgZnJvbSB3d3cuZmxhdGljb24uY29tIC0tPgo8c3ltYm9sIGlkPSJpYy1yZXNpemUiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgPHBhdGggZD0iTTAgMGgyNHYyNEgweiIgc3Ryb2tlPSJub25lIiBmaWxsPSJub25lIi8+CiAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNIDE4Ljk4ODI4MSAzLjAxMTcxOSBDIDE4LjgwMDc4MSAyLjgyNDIxOSAxOC41IDIuODI0MjE5IDE4LjMxMjUgMy4wMTE3MTkgTCAxMS42MjEwOTQgOS43MDcwMzEgQyAxMS40Mjk2ODggOS44OTQ1MzEgMTEuNDI5Njg4IDEwLjE5NTMxMiAxMS42MjEwOTQgMTAuMzc4OTA2IEMgMTEuNzEwOTM4IDEwLjQ3MjY1NiAxMS44MzU5MzggMTAuNTE5NTMxIDExLjk1NzAzMSAxMC41MTk1MzEgQyAxMi4wNzgxMjUgMTAuNTE5NTMxIDEyLjIwMzEyNSAxMC40NzI2NTYgMTIuMjkyOTY5IDEwLjM3ODkwNiBMIDE4Ljk4ODI4MSAzLjY4NzUgQyAxOS4xNzU3ODEgMy41IDE5LjE3NTc4MSAzLjE5OTIxOSAxOC45ODgyODEgMy4wMTE3MTkgWiBNIDE4Ljk4ODI4MSAzLjAxMTcxOSAiLz4KICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0gMTguNjUyMzQ0IDIuODY3MTg4IEMgMTguMzg2NzE5IDIuODY3MTg4IDE4LjE3MTg3NSAzLjA4MjAzMSAxOC4xNzE4NzUgMy4zNDc2NTYgTCAxOC4xNzE4NzUgOS4wODU5MzggQyAxOC4xNzE4NzUgOS4zNDc2NTYgMTguMzg2NzE5IDkuNTYyNSAxOC42NTIzNDQgOS41NjI1IEMgMTguOTE3OTY5IDkuNTYyNSAxOS4xMzI4MTIgOS4zNDc2NTYgMTkuMTMyODEyIDkuMDg1OTM4IEwgMTkuMTMyODEyIDMuMzQ3NjU2IEMgMTkuMTMyODEyIDMuMDgyMDMxIDE4LjkxNzk2OSAyLjg2NzE4OCAxOC42NTIzNDQgMi44NjcxODggWiBNIDE4LjY1MjM0NCAyLjg2NzE4OCAiLz4KICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0gMTguNjUyMzQ0IDIuODY3MTg4IEwgMTIuOTE0MDYyIDIuODY3MTg4IEMgMTIuNjUyMzQ0IDIuODY3MTg4IDEyLjQzNzUgMy4wODIwMzEgMTIuNDM3NSAzLjM0NzY1NiBDIDEyLjQzNzUgMy42MTMyODEgMTIuNjUyMzQ0IDMuODI4MTI1IDEyLjkxNDA2MiAzLjgyODEyNSBMIDE4LjY1MjM0NCAzLjgyODEyNSBDIDE4LjkxNzk2OSAzLjgyODEyNSAxOS4xMzI4MTIgMy42MTMyODEgMTkuMTMyODEyIDMuMzQ3NjU2IEMgMTkuMTMyODEyIDMuMDgyMDMxIDE4LjkxNzk2OSAyLjg2NzE4OCAxOC42NTIzNDQgMi44NjcxODggWiBNIDE4LjY1MjM0NCAyLjg2NzE4OCAiLz4KICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0gMTAuMzc4OTA2IDExLjYyMTA5NCBDIDEwLjE5NTMxMiAxMS40MzM1OTQgOS44OTA2MjUgMTEuNDMzNTk0IDkuNzAzMTI1IDExLjYyMTA5NCBMIDMuMDA3ODEyIDE4LjMxNjQwNiBDIDIuODIwMzEyIDE4LjUgMi44MjAzMTIgMTguODA0Njg4IDMuMDA3ODEyIDE4Ljk5MjE4OCBDIDMuMTA1NDY5IDE5LjA4NTkzOCAzLjIyNjU2MiAxOS4xMzI4MTIgMy4zNDc2NTYgMTkuMTMyODEyIEMgMy40Njg3NSAxOS4xMzI4MTIgMy41ODk4NDQgMTkuMDg1OTM4IDMuNjgzNTk0IDE4Ljk5MjE4OCBMIDEwLjM3ODkwNiAxMi4yOTY4NzUgQyAxMC41NjY0MDYgMTIuMTA5Mzc1IDEwLjU2NjQwNiAxMS44MDQ2ODggMTAuMzc4OTA2IDExLjYyMTA5NCBaIE0gMTAuMzc4OTA2IDExLjYyMTA5NCAiLz4KICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0gMy4zNDc2NTYgMTIuNDM3NSBDIDMuMDgyMDMxIDEyLjQzNzUgMi44NjcxODggMTIuNjUyMzQ0IDIuODY3MTg4IDEyLjkxNDA2MiBMIDIuODY3MTg4IDE4LjY1MjM0NCBDIDIuODY3MTg4IDE4LjkxNzk2OSAzLjA4MjAzMSAxOS4xMzI4MTIgMy4zNDc2NTYgMTkuMTMyODEyIEMgMy42MTMyODEgMTkuMTMyODEyIDMuODI4MTI1IDE4LjkxNzk2OSAzLjgyODEyNSAxOC42NTIzNDQgTCAzLjgyODEyNSAxMi45MTQwNjIgQyAzLjgyODEyNSAxMi42NTIzNDQgMy42MTMyODEgMTIuNDM3NSAzLjM0NzY1NiAxMi40Mzc1IFogTSAzLjM0NzY1NiAxMi40Mzc1ICIvPgogIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTSA5LjA4NTkzOCAxOC4xNzE4NzUgTCAzLjM0NzY1NiAxOC4xNzE4NzUgQyAzLjA4MjAzMSAxOC4xNzE4NzUgMi44NjcxODggMTguMzg2NzE5IDIuODY3MTg4IDE4LjY1MjM0NCBDIDIuODY3MTg4IDE4LjkxNzk2OSAzLjA4MjAzMSAxOS4xMzI4MTIgMy4zNDc2NTYgMTkuMTMyODEyIEwgOS4wODU5MzggMTkuMTMyODEyIEMgOS4zNDc2NTYgMTkuMTMyODEyIDkuNTYyNSAxOC45MTc5NjkgOS41NjI1IDE4LjY1MjM0NCBDIDkuNTYyNSAxOC4zODY3MTkgOS4zNDc2NTYgMTguMTcxODc1IDkuMDg1OTM4IDE4LjE3MTg3NSBaIE0gOS4wODU5MzggMTguMTcxODc1ICIvPgogIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTSAyMC41NjI1IDAgTCAxLjQzNzUgMCBDIDAuNjQ0NTMxIDAgMCAwLjY0NDUzMSAwIDEuNDM3NSBMIDAgMjAuNTYyNSBDIDAgMjEuMzU1NDY5IDAuNjQ0NTMxIDIyIDEuNDM3NSAyMiBMIDIwLjU2MjUgMjIgQyAyMS4zNTU0NjkgMjIgMjIgMjEuMzU1NDY5IDIyIDIwLjU2MjUgTCAyMiAxLjQzNzUgQyAyMiAwLjY0NDUzMSAyMS4zNTU0NjkgMCAyMC41NjI1IDAgWiBNIDIxLjA0Mjk2OSAyMC41NjI1IEMgMjEuMDQyOTY5IDIwLjgyODEyNSAyMC44MjgxMjUgMjEuMDQyOTY5IDIwLjU2MjUgMjEuMDQyOTY5IEwgMS40Mzc1IDIxLjA0Mjk2OSBDIDEuMTcxODc1IDIxLjA0Mjk2OSAwLjk1NzAzMSAyMC44MjgxMjUgMC45NTcwMzEgMjAuNTYyNSBMIDAuOTU3MDMxIDEuNDM3NSBDIDAuOTU3MDMxIDEuMTcxODc1IDEuMTcxODc1IDAuOTU3MDMxIDEuNDM3NSAwLjk1NzAzMSBMIDIwLjU2MjUgMC45NTcwMzEgQyAyMC44MjgxMjUgMC45NTcwMzEgMjEuMDQyOTY5IDEuMTcxODc1IDIxLjA0Mjk2OSAxLjQzNzUgWiBNIDIxLjA0Mjk2OSAyMC41NjI1ICIvPgo8L3N5bWJvbD4KPCEtLSAgLS0+CjxzeW1ib2wgaWQ9ImljLWRlbGV0ZS1hbGwiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik01IDIzSDNhMSAxIDAgMCAxLTEtMVY2aDF2MTZoMnYxem0xNi0xMGgtMVY2aDF2N3pNOSAxM0g4di0zaDF2M3ptMyAwaC0xdi0zaDF2M3ptMyAwaC0xdi0zaDF2M3pNMTQuNzk0IDMuNzk0TDEzIDJoLTNMOC4yMDYgMy43OTRBLjk2My45NjMgMCAwIDEgOCAyLjVsLjcwMy0xLjA1NUExIDEgMCAwIDEgOS41MzUgMWgzLjkzYTEgMSAwIDAgMSAuODMyLjQ0NUwxNSAyLjVhLjk2NS45NjUgMCAwIDEtLjIwNiAxLjI5NHpNMTQuMTk3IDRIOC44MDNoNS4zOTR6Ii8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0wIDNoMjN2MUgwek0xMS4yODYgMjFIOC43MTRMOCAyM0g3bDEtMi44VjIwaC4wNzFMOS41IDE2aDFsMS40MjkgNEgxMnYuMmwxIDIuOGgtMWwtLjcxNC0yem0tLjM1Ny0xTDEwIDE3LjQgOS4wNzEgMjBoMS44NTh6TTIwIDIyaDN2MWgtNHYtN2gxdjZ6bS01IDBoM3YxaC00di03aDF2NnoiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWRlbGV0ZSIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTMgNnYxNmgxN1Y2aDF2MTZhMSAxIDAgMCAxLTEgMUgzYTEgMSAwIDAgMS0xLTFWNmgxek0xNC43OTQgMy43OTRMMTMgMmgtM0w4LjIwNiAzLjc5NEEuOTYzLjk2MyAwIDAgMSA4IDIuNWwuNzAzLTEuMDU1QTEgMSAwIDAgMSA5LjUzNSAxaDMuOTNhMSAxIDAgMCAxIC44MzIuNDQ1TDE1IDIuNWEuOTY1Ljk2NSAwIDAgMS0uMjA2IDEuMjk0ek0xNC4xOTcgNEg4LjgwM2g1LjM5NHoiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTAgM2gyM3YxSDB6TTggMTBoMXY2SDh2LTZ6bTMgMGgxdjZoLTF2LTZ6bTMgMGgxdjZoLTF2LTZ6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1kcmF3LWZyZWUiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIGQ9Ik0yLjUgMjAuOTI5QzIuNTk0IDEwLjk3NiA0LjMyMyA2IDcuNjg2IDZjNS44NzIgMCAyLjUyNCAxOSA3LjY5NyAxOXMxLjg5LTE0LjkyOSA2LjQxNC0xNC45MjkgMS4zNTcgMTAuODU4IDUuMTMgMTAuODU4YzEuODAyIDAgMi42NTctMi4yNjIgMi41NjYtNi43ODYiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWRyYXctbGluZSIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgZD0iTTIgMTUuNWgyOCIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtZHJhdyIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgZD0iTTIuNSAyMS41SDVjLjI0NSAwIC40OC0uMDU4LjY5MS0uMTY4bC4xMjQtLjA2NS4xNC4wMWMuNDI5LjAyOC44NS0uMTI3IDEuMTYtLjQzN0wyMi41NSA1LjQwNWEuNS41IDAgMCAwIDAtLjcwN2wtMy4yNDYtMy4yNDVhLjUuNSAwIDAgMC0uNzA3IDBMMy4xNjIgMTYuODg4YTEuNDk1IDEuNDk1IDAgMCAwLS40MzcgMS4xNTVsLjAxLjE0LS4wNjUuMTIzYy0uMTExLjIxMi0uMTcuNDQ4LS4xNy42OTR2Mi41eiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMTYuNDE0IDMuNzA3bDMuODkgMy44OS0uNzA4LjcwNi0zLjg4OS0zLjg4OXoiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWZpbHRlciIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxwYXRoIGQ9Ik0wIDBoMjR2MjRIMHoiIGZpbGw9Im5vbmUiIHN0cm9rZT0ibm9uZSIgLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTEyIDd2MUgyVjdoMTB6bTYgMGg0djFoLTRWN3pNMTIgMTZ2MWgxMHYtMUgxMnptLTYgMEgydjFoNHYtMXoiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTguNSAyMGEzLjUgMy41IDAgMSAxIDAtNyAzLjUgMy41IDAgMCAxIDAgN3ptMC0xYTIuNSAyLjUgMCAxIDAgMC01IDIuNSAyLjUgMCAwIDAgMCA1ek0xNS41IDExYTMuNSAzLjUgMCAxIDEgMC03IDMuNSAzLjUgMCAwIDEgMCA3em0wLTFhMi41IDIuNSAwIDEgMCAwLTUgMi41IDIuNSAwIDAgMCAwIDV6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1mbGlwLXJlc2V0IiB2aWV3Qm94PSIwIDAgMzEgMzIiPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiBkPSJNMzEgMEgwdjMyaDMxeiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMjggMTZhOCA4IDAgMCAxLTggOEgzdi0xaDF2LTdIM2E4IDggMCAwIDEgOC04aDE3djFoLTF2N2gxek0xMSA5YTcgNyAwIDAgMC03IDd2N2gxNmE3IDcgMCAwIDAgNy03VjlIMTF6Ii8+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIHN0cm9rZS1saW5lY2FwPSJzcXVhcmUiIGQ9Ik0yNCA1bDMuNSAzLjVMMjQgMTJNNyAyMGwtMy41IDMuNUw3IDI3Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1mbGlwLXgiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGQ9Ik0zMiAzMkgwVjBoMzJ6Ii8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0xNyAzMmgtMVYwaDF6TTI3LjE2NyAxMWwuNSAzaC0xLjAzbC0uNTQ2LTNoMS4wNzZ6bS0uNS0zaC0xLjEyMkwyNSA1aC01VjRoNS4xNTNhMSAxIDAgMCAxIC45ODYuODM2TDI2LjY2NyA4em0xLjUgOWwuNSAzaC0uOTRsLS41NDUtM2guOTg1em0xIDZsLjYzOSAzLjgzNkExIDEgMCAwIDEgMjguODE5IDI4SDI2di0xaDNsLS43MjYtNGguODk0ek0yMyAyOGgtM3YtMWgzdjF6TTEzIDR2MUg3TDMgMjdoMTB2MUgzLjE4YTEgMSAwIDAgMS0uOTg2LTEuMTY0bDMuNjY2LTIyQTEgMSAwIDAgMSA2Ljg0NyA0SDEzeiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtZmxpcC15IiB2aWV3Qm94PSIwIDAgMzIgMzIiPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiBkPSJNMCAwdjMyaDMyVjB6Ii8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0wIDE2djFoMzJ2LTF6TTExIDI3LjE2N2wzIC41di0xLjAzbC0zLS41NDZ2MS4wNzZ6bS0zLS41di0xLjEyMkw1IDI1di01SDR2NS4xNTNhMSAxIDAgMCAwIC44MzYuOTg2TDggMjYuNjY3em05IDEuNWwzIC41di0uOTRsLTMtLjU0NXYuOTg1em02IDFsMy44MzYuNjM5QTEgMSAwIDAgMCAyOCAyOC44MlYyNmgtMXYzbC00LS43Mjd2Ljg5NHpNMjggMjN2LTNoLTF2M2gxek00IDEzaDFWN2wyMi00djEwaDFWMy4xOGExIDEgMCAwIDAtMS4xNjQtLjk4NmwtMjIgMy42NjdBMSAxIDAgMCAwIDQgNi44NDdWMTN6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1mbGlwIiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPHBhdGggZD0iTTAgMGgyNHYyNEgweiIgZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiAvPgogICAgPHBhdGggZmlsbD0iaW5oZXJpdCIgc3Ryb2tlPSJub25lIiBkPSJNMTEgMGgxdjI0aC0xek0xOSAyMXYtMWgydi0yaDF2MmExIDEgMCAwIDEtMSAxaC0yem0tMiAwaC0zdi0xaDN2MXptNS01aC0xdi0zaDF2M3ptMC01aC0xVjhoMXYzem0wLTVoLTFWNGgtMlYzaDJhMSAxIDAgMCAxIDEgMXYyem0tNS0zdjFoLTNWM2gzek05IDN2MUgydjE2aDd2MUgyYTEgMSAwIDAgMS0xLTFWNGExIDEgMCAwIDEgMS0xaDd6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1oaXN0b3J5IiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiBkPSJNMCAwSDI0VjI0SDB6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtNzQwIC0xNikgdHJhbnNsYXRlKDU0NyA4KSB0cmFuc2xhdGUoMTkzIDgpIi8+CiAgICA8cGF0aCBmaWxsPSJpbmhlcml0IiBzdHJva2U9Im5vbmUiIGQ9Ik0xMi41IDFDMTguMjk5IDEgMjMgNS43MDEgMjMgMTEuNVMxOC4yOTkgMjIgMTIuNSAyMmMtNS4yOSAwLTkuNjY1LTMuOTExLTEwLjM5NC04Ljk5OWgxLjAxMkMzLjgzOCAxNy41MzQgNy43NjQgMjEgMTIuNSAyMWM1LjI0NyAwIDkuNS00LjI1MyA5LjUtOS41UzE3Ljc0NyAyIDEyLjUgMkM4LjQ5IDIgNS4wNiA0LjQ4NSAzLjY2NiA4SDNoNHYxSDJWNGgxdjMuMDIyQzQuNjggMy40NjIgOC4zMDMgMSAxMi41IDF6bS41IDVsLS4wMDEgNS4yOTEgMi41MzcgMi41MzctLjcwOC43MDhMMTIuMjkyIDEySDEyVjZoMXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC03NDAgLTE2KSB0cmFuc2xhdGUoNTQ3IDgpIHRyYW5zbGF0ZSgxOTMgOCkiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWhpc3RvcnktY2hlY2siIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZyBmaWxsPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiID4KICAgICAgICA8cGF0aCBzdHJva2U9IiM1NTU1NTUiIGQ9Ik00LjUgLTFMMS41IDIgNi41IDciIHRyYW5zZm9ybT0idHJhbnNsYXRlKC02MCAtODA0KSB0cmFuc2xhdGUoNjAgODA0KSB0cmFuc2xhdGUoMiAzKSByb3RhdGUoLTkwIDQgMykiIC8+CiAgICA8L2c+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1oaXN0b3J5LWNyb3AiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZyBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgPgogICAgICAgIDxwYXRoIGQ9Ik0wIDBIMTJWMTJIMHoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC04NCAtODA0KSB0cmFuc2xhdGUoODQgODA0KSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0yIDBoMXYxMGMtLjU1MiAwLTEtLjQ0OC0xLTFWMHpNMTAgOXYzSDlWOWgxek05IDJoMXY2SDlWMnoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC04NCAtODA0KSB0cmFuc2xhdGUoODQgODA0KSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0yIDlIMTJWMTBIMnpNOSAyYy41MTMgMCAuOTM2LjM4Ni45OTMuODgzTDEwIDNIM1YyaDZ6TTIgM0gwVjJoMnYxeiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTg0IC04MDQpIHRyYW5zbGF0ZSg4NCA4MDQpIi8+CiAgICA8L2c+Cjwvc3ltYm9sPgo8IS0tIFRoaXMgaWNvbiBtYWRlIGJ5IFBpeGVsIHBlcmZlY3QgZnJvbSB3d3cuZmxhdGljb24uY29tIC0tPgo8c3ltYm9sIGlkPSJpYy1oaXN0b3J5LXJlc2l6ZSIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICA8ZyBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgPgogICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTSA5LjQ5MjE4OCAxLjUwNzgxMiBDIDkuMzk4NDM4IDEuNDE0MDYyIDkuMjUgMS40MTQwNjIgOS4xNTYyNSAxLjUwNzgxMiBMIDUuODEyNSA0Ljg1MTU2MiBDIDUuNzE0ODQ0IDQuOTQ1MzEyIDUuNzE0ODQ0IDUuMDk3NjU2IDUuODEyNSA1LjE4NzUgQyA1Ljg1NTQ2OSA1LjIzNDM3NSA1LjkxNzk2OSA1LjI1NzgxMiA1Ljk3NjU2MiA1LjI1NzgxMiBDIDYuMDM5MDYyIDUuMjU3ODEyIDYuMTAxNTYyIDUuMjM0Mzc1IDYuMTQ4NDM4IDUuMTg3NSBMIDkuNDkyMTg4IDEuODQzNzUgQyA5LjU4NTkzOCAxLjc1IDkuNTg1OTM4IDEuNjAxNTYyIDkuNDkyMTg4IDEuNTA3ODEyIFogTSA5LjQ5MjE4OCAxLjUwNzgxMiAiLz4KICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0gOS4zMjgxMjUgMS40MzM1OTQgQyA5LjE5NTMxMiAxLjQzMzU5NCA5LjA4NTkzOCAxLjUzOTA2MiA5LjA4NTkzOCAxLjY3MTg3NSBMIDkuMDg1OTM4IDQuNTQyOTY5IEMgOS4wODU5MzggNC42NzE4NzUgOS4xOTUzMTIgNC43ODEyNSA5LjMyODEyNSA0Ljc4MTI1IEMgOS40NjA5MzggNC43ODEyNSA5LjU2NjQwNiA0LjY3MTg3NSA5LjU2NjQwNiA0LjU0Mjk2OSBMIDkuNTY2NDA2IDEuNjcxODc1IEMgOS41NjY0MDYgMS41MzkwNjIgOS40NjA5MzggMS40MzM1OTQgOS4zMjgxMjUgMS40MzM1OTQgWiBNIDkuMzI4MTI1IDEuNDMzNTk0ICIvPgogICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTSA5LjMyODEyNSAxLjQzMzU5NCBMIDYuNDU3MDMxIDEuNDMzNTk0IEMgNi4zMjgxMjUgMS40MzM1OTQgNi4yMTg3NSAxLjUzOTA2MiA2LjIxODc1IDEuNjcxODc1IEMgNi4yMTg3NSAxLjgwNDY4OCA2LjMyODEyNSAxLjkxNDA2MiA2LjQ1NzAzMSAxLjkxNDA2MiBMIDkuMzI4MTI1IDEuOTE0MDYyIEMgOS40NjA5MzggMS45MTQwNjIgOS41NjY0MDYgMS44MDQ2ODggOS41NjY0MDYgMS42NzE4NzUgQyA5LjU2NjQwNiAxLjUzOTA2MiA5LjQ2MDkzOCAxLjQzMzU5NCA5LjMyODEyNSAxLjQzMzU5NCBaIE0gOS4zMjgxMjUgMS40MzM1OTQgIi8+CiAgICA8cGF0aCBmaWxsPSIjNDM0MzQzIiBkPSJNIDUuMTg3NSA1LjgxMjUgQyA1LjA5NzY1NiA1LjcxODc1IDQuOTQ1MzEyIDUuNzE4NzUgNC44NTE1NjIgNS44MTI1IEwgMS41MDM5MDYgOS4xNTYyNSBDIDEuNDEwMTU2IDkuMjUgMS40MTAxNTYgOS40MDIzNDQgMS41MDM5MDYgOS40OTYwOTQgQyAxLjU1NDY4OCA5LjU0Mjk2OSAxLjYxMzI4MSA5LjU2NjQwNiAxLjY3MTg3NSA5LjU2NjQwNiBDIDEuNzM0Mzc1IDkuNTY2NDA2IDEuNzk2ODc1IDkuNTQyOTY5IDEuODQzNzUgOS40OTYwOTQgTCA1LjE4NzUgNi4xNDg0MzggQyA1LjI4MTI1IDYuMDU0Njg4IDUuMjgxMjUgNS45MDIzNDQgNS4xODc1IDUuODEyNSBaIE0gNS4xODc1IDUuODEyNSAiLz4KICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0gMS42NzE4NzUgNi4yMTg3NSBDIDEuNTM5MDYyIDYuMjE4NzUgMS40MzM1OTQgNi4zMjgxMjUgMS40MzM1OTQgNi40NTcwMzEgTCAxLjQzMzU5NCA5LjMyODEyNSBDIDEuNDMzNTk0IDkuNDYwOTM4IDEuNTM5MDYyIDkuNTY2NDA2IDEuNjcxODc1IDkuNTY2NDA2IEMgMS44MDQ2ODggOS41NjY0MDYgMS45MTQwNjIgOS40NjA5MzggMS45MTQwNjIgOS4zMjgxMjUgTCAxLjkxNDA2MiA2LjQ1NzAzMSBDIDEuOTE0MDYyIDYuMzI4MTI1IDEuODA0Njg4IDYuMjE4NzUgMS42NzE4NzUgNi4yMTg3NSBaIE0gMS42NzE4NzUgNi4yMTg3NSAiLz4KICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0gNC41NDI5NjkgOS4wODU5MzggTCAxLjY3MTg3NSA5LjA4NTkzOCBDIDEuNTM5MDYyIDkuMDg1OTM4IDEuNDMzNTk0IDkuMTk1MzEyIDEuNDMzNTk0IDkuMzI4MTI1IEMgMS40MzM1OTQgOS40NjA5MzggMS41MzkwNjIgOS41NjY0MDYgMS42NzE4NzUgOS41NjY0MDYgTCA0LjU0Mjk2OSA5LjU2NjQwNiBDIDQuNjcxODc1IDkuNTY2NDA2IDQuNzgxMjUgOS40NjA5MzggNC43ODEyNSA5LjMyODEyNSBDIDQuNzgxMjUgOS4xOTUzMTIgNC42NzE4NzUgOS4wODU5MzggNC41NDI5NjkgOS4wODU5MzggWiBNIDQuNTQyOTY5IDkuMDg1OTM4ICIvPgogICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTSAxMC4yODEyNSAwIEwgMC43MTg3NSAwIEMgMC4zMjAzMTIgMCAwIDAuMzIwMzEyIDAgMC43MTg3NSBMIDAgMTAuMjgxMjUgQyAwIDEwLjY3OTY4OCAwLjMyMDMxMiAxMSAwLjcxODc1IDExIEwgMTAuMjgxMjUgMTEgQyAxMC42Nzk2ODggMTEgMTEgMTAuNjc5Njg4IDExIDEwLjI4MTI1IEwgMTEgMC43MTg3NSBDIDExIDAuMzIwMzEyIDEwLjY3OTY4OCAwIDEwLjI4MTI1IDAgWiBNIDEwLjUyMzQzOCAxMC4yODEyNSBDIDEwLjUyMzQzOCAxMC40MTQwNjIgMTAuNDE0MDYyIDEwLjUyMzQzOCAxMC4yODEyNSAxMC41MjM0MzggTCAwLjcxODc1IDEwLjUyMzQzOCBDIDAuNTg1OTM4IDEwLjUyMzQzOCAwLjQ3NjU2MiAxMC40MTQwNjIgMC40NzY1NjIgMTAuMjgxMjUgTCAwLjQ3NjU2MiAwLjcxODc1IEMgMC40NzY1NjIgMC41ODU5MzggMC41ODU5MzggMC40NzY1NjIgMC43MTg3NSAwLjQ3NjU2MiBMIDEwLjI4MTI1IDAuNDc2NTYyIEMgMTAuNDE0MDYyIDAuNDc2NTYyIDEwLjUyMzQzOCAwLjU4NTkzOCAxMC41MjM0MzggMC43MTg3NSBaIE0gMTAuNTIzNDM4IDEwLjI4MTI1ICIvPgogIDwvZz4KPC9zeW1ib2w+CjwhLS0gIC0tPgo8c3ltYm9sIGlkPSJpYy1oaXN0b3J5LWRyYXciIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZyBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgPgogICAgICAgIDxwYXRoIGQ9Ik0wIDFIMTJWMTNIMHoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xNTYgLTgwNCkgdHJhbnNsYXRlKDE1NiA4MDMpIi8+CiAgICAgICAgPHBhdGggc3Ryb2tlPSIjNDM0MzQzIiBkPSJNOS42MjIgMS41ODRsMS44MzUgMS42NTgtOC4zMSA4LjQwN0wuNSAxMi41VjExbDkuMTIyLTkuNDE2eiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTE1NiAtODA0KSB0cmFuc2xhdGUoMTU2IDgwMykiLz4KICAgICAgICA8cGF0aCBmaWxsPSIjNDM0MzQzIiBkPSJNNy42MjggMy43NTNMMTAuMzc4IDMuNzUzIDEwLjM3OCA0LjI1MyA3LjYyOCA0LjI1M3oiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xNTYgLTgwNCkgdHJhbnNsYXRlKDE1NiA4MDMpIHJvdGF0ZSg0NSA5LjAwMyA0LjAwMykiLz4KICAgIDwvZz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWhpc3RvcnktZmlsdGVyIiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPGcgZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiID4KICAgICAgICA8cGF0aCBkPSJNMCAwSDEyVjEySDB6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMjc2IC04MDQpIHRyYW5zbGF0ZSgyNzYgODA0KSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0xMiAzdjFIOVYzaDN6TTcgNEgwVjNoN3YxeiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTI3NiAtODA0KSB0cmFuc2xhdGUoMjc2IDgwNCkiLz4KICAgICAgICA8cGF0aCBmaWxsPSIjNDM0MzQzIiBkPSJNMTIgOHYxSDlWOGgzek03IDlIMFY4aDd2MXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0yNzYgLTgwNCkgdHJhbnNsYXRlKDI3NiA4MDQpIG1hdHJpeCgtMSAwIDAgMSAxMiAwKSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik04IDFjMS4xMDUgMCAyIC44OTUgMiAycy0uODk1IDItMiAyLTItLjg5NS0yLTIgLjg5NS0yIDItMnptMCAxYy0uNTUyIDAtMSAuNDQ4LTEgMXMuNDQ4IDEgMSAxIDEtLjQ0OCAxLTEtLjQ0OC0xLTEtMXpNNCA3YzEuMTA1IDAgMiAuODk1IDIgMnMtLjg5NSAyLTIgMi0yLS44OTUtMi0yIC44OTUtMiAyLTJ6bTAgMWMtLjU1MiAwLTEgLjQ0OC0xIDFzLjQ0OCAxIDEgMSAxLS40NDggMS0xLS40NDgtMS0xLTF6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMjc2IC04MDQpIHRyYW5zbGF0ZSgyNzYgODA0KSIvPgogICAgPC9nPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaGlzdG9yeS1mbGlwIiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPGcgZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiID4KICAgICAgICA8cGF0aCBkPSJNMCAwSDEyVjEySDB6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMTA4IC04MDQpIHRyYW5zbGF0ZSgxMDggODA0KSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik02IDBMNyAwIDcgMTIgNiAxMnpNMTEgMTBWOWgxdjEuNWMwIC4yNzYtLjIyNC41LS41LjVIMTB2LTFoMXpNNSAxdjFIMXY4aDR2MUguNWMtLjI3NiAwLS41LS4yMjQtLjUtLjV2LTljMC0uMjc2LjIyNC0uNS41LS41SDV6bTcgNXYyaC0xVjZoMXptMC0zdjJoLTFWM2gxek05IDF2MUg3VjFoMnptMi41IDBjLjI3NiAwIC41LjIyNC41LjVWMmgtMlYxaDEuNXpNOSAxMUg3di0xaDJ2MXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xMDggLTgwNCkgdHJhbnNsYXRlKDEwOCA4MDQpIi8+CiAgICA8L2c+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1oaXN0b3J5LWljb24iIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZyBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgPgogICAgICAgIDxwYXRoIGQ9Ik0wIDBIMTJWMTJIMHoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0yMDQgLTgwNCkgdHJhbnNsYXRlKDIwNCA4MDQpIi8+CiAgICAgICAgPHBhdGggc3Ryb2tlPSIjNDM0MzQzIiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiIHN0cm9rZS13aWR0aD0iMS4xIiBkPSJNNiA5LjU2OEwyLjYwMSAxMSAyLjk3NSA3LjQ2NyAwLjUgNC44MiA0LjEzIDQuMDY4IDYgMSA3Ljg3IDQuMDY4IDExLjUgNC44MiA5LjAyNSA3LjQ2NyA5LjM5OSAxMXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0yMDQgLTgwNCkgdHJhbnNsYXRlKDIwNCA4MDQpIi8+CiAgICA8L2c+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1oaXN0b3J5LW1hc2siIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZyBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgPgogICAgICAgIDxnIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0yNTIgLTgwNCkgdHJhbnNsYXRlKDI1MiA4MDQpIj4KICAgICAgICAgICAgPHBhdGggZD0iTTAgMEgxMlYxMkgweiIvPgogICAgICAgICAgICA8Y2lyY2xlIGN4PSI2IiBjeT0iNiIgcj0iMi41IiBzdHJva2U9IiM0NDQiLz4KICAgICAgICAgICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTTExLjUgMGMuMjc2IDAgLjUuMjI0LjUuNXYxMWMwIC4yNzYtLjIyNC41LS41LjVILjVjLS4yNzYgMC0uNS0uMjI0LS41LS41Vi41QzAgLjIyNC4yMjQgMCAuNSAwaDExek0xMSAxSDF2MTBoMTBWMXoiLz4KICAgICAgICA8L2c+CiAgICA8L2c+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1oaXN0b3J5LXJvdGF0ZSIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxkZWZzPgogICAgICAgIDxwYXRoIGlkPSJyZm40cnlsZmZhIiBkPSJNNyAxMmMtLjMzNSAwLS42NjMtLjAyNS0uOTgzLS4wNzRDMy4xNzEgMTEuNDkyIDEgOS4yMDUgMSA2LjQ0NGMwLTEuMzYzLjUzNC0yLjYxMyAxLjQxNS0zLjU4Ii8+CiAgICAgICAgPG1hc2sgaWQ9IjZmOWduMmR5c2IiIHdpZHRoPSI2IiBoZWlnaHQ9IjkuMTM2IiB4PSIwIiB5PSIwIiBtYXNrVW5pdHM9Im9iamVjdEJvdW5kaW5nQm94Ij4KICAgICAgICAgICAgPHVzZSB4bGluazpocmVmPSIjcmZuNHJ5bGZmYSIgc3Ryb2tlPSI0MzQzNDMiLz4KICAgICAgICA8L21hc2s+CiAgICA8L2RlZnM+CiAgICA8ZyBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgPgogICAgICAgIDxnIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xMzIgLTgwNCkgdHJhbnNsYXRlKDEzMiA4MDQpIj4KICAgICAgICAgICAgPHBhdGggZD0iTTAgMC41SDEyVjEyLjVIMHoiLz4KICAgICAgICAgICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTTYuNSAxQzkuNTM4IDEgMTIgMy40NjIgMTIgNi41YzAgMi4zNy0xLjUgNC4zOS0zLjYgNS4xNjNsLS40MDctLjkxNkM5Ljc0NCAxMC4xMyAxMSA4LjQ2MiAxMSA2LjUgMTEgNC4wMTUgOC45ODUgMiA2LjUgMmMtLjc3NyAwLTEuNTA5LjE5Ny0yLjE0Ny41NDRMNCAxLjc1bC0uMjA1LS4wNEM0LjU5NCAxLjI1OCA1LjUxNyAxIDYuNSAxeiIvPgogICAgICAgICAgICA8dXNlIHN0cm9rZT0iIzQzNDM0MyIgc3Ryb2tlLWRhc2hhcnJheT0iMiAxLjI1IiBzdHJva2Utd2lkdGg9IjEiIG1hc2s9InVybCgjNmY5Z24yZHlzYikiIHhsaW5rOmhyZWY9IiNyZm40cnlsZmZhIi8+CiAgICAgICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik00LjI3OSAwTDYgMS43NSA0LjI1IDMuNTcxIDMuNTQzIDIuODY0IDQuNTg2IDEuNzUgMy41NzIgMC43MDd6IiB0cmFuc2Zvcm09Im1hdHJpeCgtMSAwIDAgMSA5LjU0MyAwKSIvPgogICAgICAgIDwvZz4KICAgIDwvZz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWhpc3Rvcnktc2hhcGUiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZyBmaWxsPSJub25lIiBzdHJva2U9Im5vbmUiIGZpbGwtcnVsZT0iZXZlbm9kZCIgPgogICAgICAgIDxwYXRoIGQ9Ik0wIDBIMTJWMTJIMHoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xODAgLTgwNCkgdHJhbnNsYXRlKDE4MCA4MDQpIi8+CiAgICAgICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTTExLjUgNGMuMjc2IDAgLjUuMjI0LjUuNXY3YzAgLjI3Ni0uMjI0LjUtLjUuNWgtN2MtLjI3NiAwLS41LS4yMjQtLjUtLjVWOC44aDFWMTFoNlY1SDguMzQxbC0uNTY4LTFIMTEuNXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0xODAgLTgwNCkgdHJhbnNsYXRlKDE4MCA4MDQpIi8+CiAgICAgICAgPHBhdGggc3Ryb2tlPSIjNDM0MzQzIiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiIGQ9Ik00LjUgMC41TDguNSA3LjYxMSAwLjUgNy42MTF6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMTgwIC04MDQpIHRyYW5zbGF0ZSgxODAgODA0KSIvPgogICAgPC9nPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaGlzdG9yeS10ZXh0IiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPGcgZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiID4KICAgICAgICA8cGF0aCBkPSJNMCAwSDEyVjEySDB6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMjI4IC04MDQpIHRyYW5zbGF0ZSgyMjggODA0KSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0yIDFoOGMuNTUyIDAgMSAuNDQ4IDEgMUgxYzAtLjU1Mi40NDgtMSAxLTF6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMjI4IC04MDQpIHRyYW5zbGF0ZSgyMjggODA0KSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik0xIDFIMlYzSDF6TTEwIDFIMTFWM0gxMHpNNS41IDFMNi41IDEgNi41IDExIDUuNSAxMXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0yMjggLTgwNCkgdHJhbnNsYXRlKDIyOCA4MDQpIi8+CiAgICAgICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTTQgMTBIOFYxMUg0eiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTIyOCAtODA0KSB0cmFuc2xhdGUoMjI4IDgwNCkiLz4KICAgIDwvZz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWhpc3RvcnktbG9hZCIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxnIGZpbGw9Im5vbmUiIHN0cm9rZT0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIj4KICAgICAgICA8cGF0aCBkPSJNMCAwSDEyVjEySDB6IiB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMzI0IC04MDUpIHRyYW5zbGF0ZSgzMjQgODA1KSIvPgogICAgICAgIDxwYXRoIGZpbGw9IiM0MzQzNDMiIGQ9Ik01IDBjLjU1MiAwIDEgLjQ0OCAxIDF2MWg1LjVjLjI3NiAwIC41LjIyNC41LjV2OGMwIC4yNzYtLjIyNC41LS41LjVILjVjLS4yNzYgMC0uNS0uMjI0LS41LS41VjFjMC0uNTUyLjQ0OC0xIDEtMWg0em0wIDFIMXY5aDEwVjNINVYxeiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMyNCAtODA1KSB0cmFuc2xhdGUoMzI0IDgwNSkiLz4KICAgICAgICA8cGF0aCBmaWxsPSIjNDM0MzQzIiBkPSJNMSAyTDUgMiA1IDMgMSAzeiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMyNCAtODA1KSB0cmFuc2xhdGUoMzI0IDgwNSkiLz4KICAgIDwvZz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWhpc3RvcnktZGVsZXRlIiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPGcgZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiBmaWxsLXJ1bGU9ImV2ZW5vZGQiPgogICAgICAgIDxnIGZpbGw9IiM0MzQzNDMiPgogICAgICAgICAgICA8cGF0aCBkPSJNMiA5aDhWMWgxdjguNWMwIC4yNzYtLjIyNC41LS41LjVoLTljLS4yNzYgMC0uNS0uMjI0LS41LS41VjFoMXY4ek0wIDBIMTJWMUgweiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMwMCAtODA0KSB0cmFuc2xhdGUoMzAwIDgwNCkgdHJhbnNsYXRlKDAgMikiLz4KICAgICAgICAgICAgPHBhdGggZD0iTTQgM0g1VjdINHpNNyAzSDhWN0g3eiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTMwMCAtODA0KSB0cmFuc2xhdGUoMzAwIDgwNCkgdHJhbnNsYXRlKDAgMikiLz4KICAgICAgICAgICAgPHBhdGggZD0iTTQgMWg0VjBoMXYxLjVjMCAuMjc2LS4yMjQuNS0uNS41aC01Yy0uMjc2IDAtLjUtLjIyNC0uNS0uNVYwaDF2MXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0zMDAgLTgwNCkgdHJhbnNsYXRlKDMwMCA4MDQpIG1hdHJpeCgxIDAgMCAtMSAwIDIpIi8+CiAgICAgICAgPC9nPgogICAgPC9nPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaGlzdG9yeS1ncm91cCIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxnIGZpbGw9Im5vbmUiIHN0cm9rZT0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIj4KICAgICAgICA8ZyB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMzQ4IC04MDQpIHRyYW5zbGF0ZSgzNDggODA0KSI+CiAgICAgICAgICAgIDxwYXRoIGQ9Ik0wIDBIMTJWMTJIMHoiLz4KICAgICAgICAgICAgPHBhdGggZmlsbD0iIzQzNDM0MyIgZD0iTTEgOXYyaDF2MUguNWMtLjI3NiAwLS41LS4yMjQtLjUtLjVWOWgxem0xMSAxdjEuNWMwIC4yNzYtLjIyNC41LS41LjVIOXYtMWgydi0xaDF6bS00IDF2MUg2di0xaDJ6bS0zIDB2MUgzdi0xaDJ6bTctNHYyaC0xVjdoMXpNMSA2djJIMFY2aDF6bTExLTJ2MmgtMVY0aDF6TTEgM3YySDBWM2gxem0xMC41LTNjLjI3NiAwIC41LjIyNC41LjVWM2gtMVYxaC0xVjBoMS41ek02IDB2MUg0VjBoMnptMyAwdjFIN1YwaDJ6TTAgLjVDMCAuMjI0LjIyNCAwIC41IDBIM3YxSDF2MUgwVi41ek05LjUgNGMuMjc2IDAgLjUuMjI0LjUuNXY1YzAgLjI3Ni0uMjI0LjUtLjUuNWgtNWMtLjI3NiAwLS41LS4yMjQtLjUtLjVWOC4zNTVjLjMxNy4wOTQuNjUyLjE0NSAxIC4xNDVWOWg0VjVoLS41YzAtLjM0OC0uMDUtLjY4My0uMTQ1LTFIOS41eiIvPgogICAgICAgICAgICA8Y2lyY2xlIGN4PSI1IiBjeT0iNSIgcj0iMi41IiBzdHJva2U9IiM0MzQzNDMiLz4KICAgICAgICA8L2c+CiAgICA8L2c+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1pY29uLWFycm93LTIiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIHN0cm9rZS1saW5lY2FwPSJyb3VuZCIgc3Ryb2tlLWxpbmVqb2luPSJyb3VuZCIgZD0iTTIxLjc5MyAxOC41SDIuNXYtNWgxOC45MzVsLTcuNi04aDUuODcybDEwLjUgMTAuNS0xMC41IDEwLjVoLTUuOTE0bDgtOHoiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWljb24tYXJyb3ctMyIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgc3Ryb2tlLWxpbmVjYXA9InJvdW5kIiBzdHJva2UtbGluZWpvaW49InJvdW5kIiBkPSJNMjUuMjg4IDE2LjQyTDE0LjIwOCAyNy41SDYuNzkybDExLjI5MS0xMS4yOTFMNi44MjYgNC41aDcuMzgxbDExLjY2MSAxMS42NjEtLjU4LjI1OHoiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWljb24tYXJyb3ciIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIGQ9Ik0yLjUgMTEuNXY5aDE4djUuMjkzTDMwLjI5MyAxNiAyMC41IDYuMjA3VjExLjVoLTE4eiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaWNvbi1idWJibGUiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIHN0cm9rZS1saW5lY2FwPSJyb3VuZCIgc3Ryb2tlLWxpbmVqb2luPSJyb3VuZCIgZD0iTTIyLjIwNyAyNC41TDE2LjUgMzAuMjA3VjI0LjVIOEE2LjUgNi41IDAgMCAxIDEuNSAxOFY5QTYuNSA2LjUgMCAwIDEgOCAyLjVoMTZBNi41IDYuNSAwIDAgMSAzMC41IDl2OWE2LjUgNi41IDAgMCAxLTYuNSA2LjVoLTEuNzkzeiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaWNvbi1oZWFydCIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIGZpbGwtcnVsZT0ibm9uemVybyIgZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBkPSJNMTUuOTk2IDMwLjY3NWwxLjk4MS0xLjc5YzcuODk4LTcuMTc3IDEwLjM2NS05LjcxOCAxMi4xMzUtMTMuMDEyLjkyMi0xLjcxNiAxLjM3Ny0zLjM3IDEuMzc3LTUuMDc2IDAtNC42NS0zLjY0Ny04LjI5Ny04LjI5Ny04LjI5Ny0yLjMzIDAtNC44NiAxLjUyNy02LjgxNyAzLjgyNGwtLjM4LjQ0Ny0uMzgxLS40NDdDMTMuNjU4IDQuMDI3IDExLjEyNiAyLjUgOC43OTcgMi41IDQuMTQ3IDIuNS41IDYuMTQ3LjUgMTAuNzk3YzAgMS43MTQuNDYgMy4zNzUgMS4zODkgNS4wOTggMS43NzUgMy4yODggNC4yNiA1Ljg0MyAxMi4xMjMgMTIuOTc0bDEuOTg0IDEuODA2eiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaWNvbi1sb2FkIiB2aWV3Qm94PSIwIDAgMzIgMzIiPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiIGQ9Ik0xNy4zMTQgMTguODY3bDEuOTUxLTIuNTMgNCA1LjE4NGgtMTdsNi41LTguODQgNC41NDkgNi4xODZ6Ii8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0xOC4wMSA0YTExLjc5OCAxMS43OTggMCAwIDAgMCAxSDN2MjRoMjRWMTQuOTg2YTguNzM4IDguNzM4IDAgMCAwIDEgMFYyOWExIDEgMCAwIDEtMSAxSDNhMSAxIDAgMCAxLTEtMVY1YTEgMSAwIDAgMSAxLTFoMTUuMDF6Ii8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0yNSAzaDF2OWgtMXoiLz4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgZD0iTTIyIDZsMy41LTMuNUwyOSA2Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1pY29uLWxvY2F0aW9uIiB2aWV3Qm94PSIwIDAgMzIgMzIiPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBkPSJNMTYgMzEuMjhDMjMuNjc1IDIzLjMwMiAyNy41IDE3LjE4MSAyNy41IDEzYzAtNi4zNTEtNS4xNDktMTEuNS0xMS41LTExLjVTNC41IDYuNjQ5IDQuNSAxM2MwIDQuMTgxIDMuODI1IDEwLjMwMiAxMS41IDE4LjI4eiIvPgogICAgPGNpcmNsZSBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIGN4PSIxNiIgY3k9IjEzIiByPSI0LjUiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLWljb24tcG9seWdvbiIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgZD0iTS41NzYgMTZMOC4yOSAyOS41aDE1LjQyTDMxLjQyNCAxNiAyMy43MSAyLjVIOC4yOUwuNTc2IDE2eiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaWNvbi1zdGFyLTIiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIGQ9Ik0xOS40NDYgMzEuNTkybDIuMjY1LTMuMjcyIDMuOTQ2LjI1LjYzNi0zLjk0IDMuNjY1LTEuNTA1LTEuMTItMy44MzIgMi42NTUtMi45NjItMi42NTYtMi45NjIgMS4xMi0zLjgzMi0zLjY2NC0xLjUwNS0uNjM2LTMuOTQxLTMuOTQ2LjI1LTIuMjY1LTMuMjcxTDE2IDMuMDI0IDEyLjU1NCAxLjA3IDEwLjI4OSA0LjM0bC0zLjk0Ni0uMjUtLjYzNiAzLjk0MS0zLjY2NSAxLjUwNSAxLjEyIDMuODMyTC41MDggMTYuMzNsMi42NTYgMi45NjItMS4xMiAzLjgzMiAzLjY2NCAxLjUwNC42MzYgMy45NDIgMy45NDYtLjI1IDIuMjY1IDMuMjdMMTYgMjkuNjM4bDMuNDQ2IDEuOTU1eiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaWNvbi1zdGFyIiB2aWV3Qm94PSIwIDAgMzIgMzIiPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBkPSJNMjUuMjkyIDI5Ljg3OGwtMS43NzUtMTAuMzQ2IDcuNTE3LTcuMzI3LTEwLjM4OC0xLjUxTDE2IDEuMjgybC00LjY0NiA5LjQxMy0xMC4zODggMS41MSA3LjUxNyA3LjMyNy0xLjc3NSAxMC4zNDZMMTYgMjQuOTkzbDkuMjkyIDQuODg1eiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtaWNvbiIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgc3Ryb2tlLWxpbmVjYXA9InJvdW5kIiBzdHJva2UtbGluZWpvaW49InJvdW5kIiBkPSJNMTEuOTIzIDE5LjEzNkw1LjQyNCAyMmwuNzE1LTcuMDY1LTQuNzMxLTUuMjk2IDYuOTQtMS41MDNMMTEuOTIzIDJsMy41NzQgNi4xMzYgNi45NCAxLjUwMy00LjczMSA1LjI5NkwxOC40MiAyMnoiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLW1hc2stbG9hZCIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0ibm9uZSIgZD0iTTAgMGgzMnYzMkgweiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMTguMDEgNGExMS43OTggMTEuNzk4IDAgMCAwIDAgMUgzdjI0aDI0VjE0Ljk4NmE4LjczOCA4LjczOCAwIDAgMCAxIDBWMjlhMSAxIDAgMCAxLTEgMUgzYTEgMSAwIDAgMS0xLTFWNWExIDEgMCAwIDEgMS0xaDE1LjAxek0xNSAyM2E2IDYgMCAxIDEgMC0xMiA2IDYgMCAwIDEgMCAxMnptMC0xYTUgNSAwIDEgMCAwLTEwIDUgNSAwIDAgMCAwIDEweiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMjUgM2gxdjloLTF6Ii8+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIGQ9Ik0yMiA2bDMuNS0zLjVMMjkgNiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtbWFzayIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxjaXJjbGUgY3g9IjEyIiBjeT0iMTIiIHI9IjQuNSIgc3Ryb2tlPSJpbmhlcml0IiBmaWxsPSJub25lIi8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0yIDFoMjBhMSAxIDAgMCAxIDEgMXYyMGExIDEgMCAwIDEtMSAxSDJhMSAxIDAgMCAxLTEtMVYyYTEgMSAwIDAgMSAxLTF6bTAgMXYyMGgyMFYySDJ6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1yZWRvIiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPHBhdGggZD0iTTAgMGgyNHYyNEgweiIgb3BhY2l0eT0iLjUiIGZpbGw9Im5vbmUiIHN0cm9rZT0ibm9uZSIgLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTIxIDZIOWE2IDYgMCAxIDAgMCAxMmgxMnYxSDlBNyA3IDAgMCAxIDkgNWgxMnYxeiIvPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBzdHJva2UtbGluZWNhcD0ic3F1YXJlIiBkPSJNMTkgM2wyLjUgMi41TDE5IDgiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLXJlc2V0IiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPHBhdGggZD0iTTAgMGgyNHYyNEgweiIgb3BhY2l0eT0iLjUiIHN0cm9rZT0ibm9uZSIgZmlsbD0ibm9uZSIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMiAxM3YtMWE3IDcgMCAwIDEgNy03aDEzdjFoLTF2NWgxdjFhNyA3IDAgMCAxLTcgN0gydi0xaDF2LTVIMnptNy03YTYgNiAwIDAgMC02IDZ2NmgxMmE2IDYgMCAwIDAgNi02VjZIOXoiLz4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0iaW5oZXJpdCIgc3Ryb2tlLWxpbmVjYXA9InNxdWFyZSIgZD0iTTE5IDNsMi41IDIuNUwxOSA4TTUgMTZsLTIuNSAyLjVMNSAyMSIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtcm90YXRlLWNsb2Nrd2lzZSIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTI5IDE3aC0uOTI0YzAgNi42MjctNS4zNzMgMTItMTIgMTItNi42MjggMC0xMi01LjM3My0xMi0xMkM0LjA3NiAxMC4zOTggOS40MDcgNS4wNDEgMTYgNVY0QzguODIgNCAzIDkuODIgMyAxN3M1LjgyIDEzIDEzIDEzIDEzLTUuODIgMTMtMTN6Ii8+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIHN0cm9rZS1saW5lY2FwPSJzcXVhcmUiIGQ9Ik0xNiAxLjVsNCAzLTQgMyIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBmaWxsLXJ1bGU9Im5vbnplcm8iIGQ9Ik0xNiA0aDR2MWgtNHoiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLXJvdGF0ZS1jb3VudGVyY2xvY2t3aXNlIiB2aWV3Qm94PSIwIDAgMzIgMzIiPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBkPSJNMyAxN2guOTI0YzAgNi42MjcgNS4zNzMgMTIgMTIgMTIgNi42MjggMCAxMi01LjM3MyAxMi0xMiAwLTYuNjAyLTUuMzMxLTExLjk2LTExLjkyNC0xMlY0YzcuMTggMCAxMyA1LjgyIDEzIDEzcy01LjgyIDEzLTEzIDEzUzMgMjQuMTggMyAxN3oiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZmlsbC1ydWxlPSJub256ZXJvIiBkPSJNMTIgNGg0djFoLTR6Ii8+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIHN0cm9rZS1saW5lY2FwPSJzcXVhcmUiIGQ9Ik0xNiAxLjVsLTQgMyA0IDMiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLXJvdGF0ZSIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxwYXRoIGQ9Ik0wIDBoMjR2MjRIMHoiIGZpbGw9Im5vbmUiIHN0cm9rZT0ibm9uZSIgLz4KICAgIDxwYXRoIGZpbGw9ImluaGVyaXQiIHN0cm9rZT0ibm9uZSIgZD0iTTguMzQ5IDIyLjI1NGExMC4wMDIgMTAuMDAyIDAgMCAxLTIuNzc4LTEuNzE5bC42NS0uNzZhOS4wMDIgOS4wMDIgMCAwIDAgMi40OTUgMS41NDhsLS4zNjcuOTMxem0yLjg3My43MDRsLjA3OC0uOTk3YTkgOSAwIDEgMC0uNTU3LTE3Ljg1MmwtLjE0LS45OUExMC4wNzYgMTAuMDc2IDAgMCAxIDEyLjE0NSAzYzUuNTIzIDAgMTAgNC40NzcgMTAgMTBzLTQuNDc3IDEwLTEwIDEwYy0uMzEyIDAtLjYyLS4wMTQtLjkyNC0uMDQyem0tNy41NTYtNC42NTVhOS45NDIgOS45NDIgMCAwIDEtMS4yNTMtMi45OTZsLjk3My0uMjM0YTguOTQ4IDguOTQ4IDAgMCAwIDEuMTI0IDIuNjkzbC0uODQ0LjUzN3ptLTEuNTAyLTUuOTFBOS45NDkgOS45NDkgMCAwIDEgMi44OCA5LjIzbC45MjUuMzgyYTguOTU0IDguOTU0IDAgMCAwLS42NDQgMi44NDRsLS45OTgtLjA2MnptMi4yMS01LjY4NmMuNjg3LS44NDggMS41MS0xLjU4IDIuNDM2LTIuMTY2bC41MjMuODUyYTkuMDQ4IDkuMDQ4IDAgMCAwLTIuMTg4IDEuOTVsLS43NzEtLjYzNnoiLz4KICAgIDxwYXRoIHN0cm9rZT0iaW5oZXJpdCIgZmlsbD0ibm9uZSIgc3Ryb2tlLWxpbmVjYXA9InNxdWFyZSIgZD0iTTEzIDFsLTIuNSAyLjVMMTMgNiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtc2hhcGUtY2lyY2xlIiB2aWV3Qm94PSIwIDAgMzIgMzIiPgogICAgPGNpcmNsZSBjeD0iMTYiIGN5PSIxNiIgcj0iMTQuNSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1zaGFwZS1yZWN0YW5nbGUiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cmVjdCB3aWR0aD0iMjciIGhlaWdodD0iMjciIHg9IjIuNSIgeT0iMi41IiBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIHJ4PSIxIi8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1zaGFwZS10cmlhbmdsZSIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZS1saW5lY2FwPSJyb3VuZCIgc3Ryb2tlLWxpbmVqb2luPSJyb3VuZCIgZD0iTTE2IDIuNWwxNS41IDI3SC41eiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtc2hhcGUiIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0xNC43MDYgOEgyMWExIDEgMCAwIDEgMSAxdjEyYTEgMSAwIDAgMS0xIDFIOWExIDEgMCAwIDEtMS0xdi00aDF2NGgxMlY5aC01LjcwNmwtLjU4OC0xeiIvPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBzdHJva2UtbGluZWNhcD0icm91bmQiIHN0cm9rZS1saW5lam9pbj0icm91bmQiIGQ9Ik04LjUgMS41bDcuNSAxM0gxeiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtdGV4dC1hbGlnbi1jZW50ZXIiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9Im5vbmUiIGQ9Ik0wIDBoMzJ2MzJIMHoiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTIgNWgyOHYxSDJ6TTggMTJoMTZ2MUg4ek0yIDE5aDI4djFIMnpNOCAyNmgxNnYxSDh6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy10ZXh0LWFsaWduLWxlZnQiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9Im5vbmUiIGQ9Ik0wIDBoMzJ2MzJIMHoiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTIgNWgyOHYxSDJ6TTIgMTJoMTZ2MUgyek0yIDE5aDI4djFIMnpNMiAyNmgxNnYxSDJ6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy10ZXh0LWFsaWduLXJpZ2h0IiB2aWV3Qm94PSIwIDAgMzIgMzIiPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJub25lIiBkPSJNMCAwaDMydjMySDB6Ii8+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9ImluaGVyaXQiIGQ9Ik0yIDVoMjh2MUgyek0xNCAxMmgxNnYxSDE0ek0yIDE5aDI4djFIMnpNMTQgMjZoMTZ2MUgxNHoiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLXRleHQtYm9sZCIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0ibm9uZSIgZD0iTTAgMGgzMnYzMkgweiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNNyAyaDJ2Mkg3ek03IDI4aDJ2Mkg3eiIvPgogICAgPHBhdGggZmlsbD0ibm9uZSIgc3Ryb2tlPSJpbmhlcml0IiBzdHJva2Utd2lkdGg9IjIiIGQ9Ik05IDN2MTJoOWE2IDYgMCAxIDAgMC0xMkg5ek05IDE1djE0aDEwYTcgNyAwIDAgMCAwLTE0SDl6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy10ZXh0LWl0YWxpYyIgdmlld0JveD0iMCAwIDMyIDMyIj4KICAgIDxwYXRoIGZpbGw9Im5vbmUiIHN0cm9rZT0ibm9uZSIgZD0iTTAgMGgzMnYzMkgweiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMTUgMmg1djFoLTV6TTExIDI5aDV2MWgtNXpNMTcgM2gxbC00IDI2aC0xeiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtdGV4dC11bmRlcmxpbmUiIHZpZXdCb3g9IjAgMCAzMiAzMiI+CiAgICA8cGF0aCBzdHJva2U9Im5vbmUiIGZpbGw9Im5vbmUiIGQ9Ik0wIDBoMzJ2MzJIMHoiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTggMnYxNGE4IDggMCAxIDAgMTYgMFYyaDF2MTRhOSA5IDAgMCAxLTE4IDBWMmgxek0zIDI5aDI2djFIM3oiLz4KICAgIDxwYXRoIHN0cm9rZT0ibm9uZSIgZmlsbD0iaW5oZXJpdCIgZD0iTTUgMmg1djFINXpNMjIgMmg1djFoLTV6Ii8+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy10ZXh0IiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNNCAzaDE1YTEgMSAwIDAgMSAxIDFIM2ExIDEgMCAwIDEgMS0xek0zIDRoMXYxSDN6TTE5IDRoMXYxaC0xeiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMTEgM2gxdjE4aC0xeiIvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMTAgMjBoM3YxaC0zeiIvPgo8L3N5bWJvbD4KPHN5bWJvbCBpZD0iaWMtdW5kbyIgdmlld0JveD0iMCAwIDI0IDI0Ij4KICAgIDxwYXRoIGQ9Ik0yNCAwSDB2MjRoMjR6IiBvcGFjaXR5PSIuNSIgZmlsbD0ibm9uZSIgc3Ryb2tlPSJub25lIiAvPgogICAgPHBhdGggc3Ryb2tlPSJub25lIiBmaWxsPSJpbmhlcml0IiBkPSJNMyA2aDEyYTYgNiAwIDEgMSAwIDEySDN2MWgxMmE3IDcgMCAwIDAgMC0xNEgzdjF6Ii8+CiAgICA8cGF0aCBmaWxsPSJub25lIiBzdHJva2U9ImluaGVyaXQiIHN0cm9rZS1saW5lY2FwPSJzcXVhcmUiIGQ9Ik01IDNMMi41IDUuNSA1IDgiLz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLXpvb20taW4iIHZpZXdCb3g9IjAgMCAyNCAyNCI+CiAgICA8ZyB0cmFuc2Zvcm09InRyYW5zbGF0ZSgtMjI5IC0yOTApIHRyYW5zbGF0ZSgyMjkgMjkwKSI+CiAgICAgICAgPGNpcmNsZSBjeD0iMTAuNSIgY3k9IjEwLjUiIHI9IjkiIHN0cm9rZT0iaW5oZXJpdCIgZmlsbD0ibm9uZSIvPgogICAgICAgIDxwYXRoIGZpbGw9ImluaGVyaXQiIGQ9Ik0xOC44MjggMTUuODI4SDE5LjgyOFYyMi44MjhIMTguODI4eiIgdHJhbnNmb3JtPSJyb3RhdGUoLTQ1IDE5LjMyOCAxOS4zMjgpIi8+CiAgICAgICAgPHBhdGggZmlsbD0iaW5oZXJpdCIgZD0iTTcgMTBIMTRWMTFIN3oiLz4KICAgICAgICA8cGF0aCBmaWxsPSJpbmhlcml0IiBkPSJNMTAgN0gxMVYxNEgxMHoiLz4KICAgIDwvZz4KPC9zeW1ib2w+CjxzeW1ib2wgaWQ9ImljLXpvb20tb3V0IiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPGcgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTI2MyAtMjkwKSB0cmFuc2xhdGUoMjYzIDI5MCkiPgogICAgICAgIDxjaXJjbGUgY3g9IjEwLjUiIGN5PSIxMC41IiByPSI5IiBzdHJva2U9ImluaGVyaXQiIGZpbGw9Im5vbmUiLz4KICAgICAgICA8cGF0aCBmaWxsPSJpbmhlcml0IiBkPSJNMTguODI4IDE1LjgyOEgxOS44MjhWMjIuODI4SDE4LjgyOHoiIHRyYW5zZm9ybT0icm90YXRlKC00NSAxOS4zMjggMTkuMzI4KSIvPgogICAgICAgIDxwYXRoIGZpbGw9ImluaGVyaXQiIGQ9Ik03IDEwSDE0VjExSDd6Ii8+CiAgICA8L2c+Cjwvc3ltYm9sPgo8c3ltYm9sIGlkPSJpYy1oYW5kIiB2aWV3Qm94PSIwIDAgMjQgMjQiPgogICAgPGcgZmlsbD0ibm9uZSIgZmlsbC1ydWxlPSJldmVub2RkIiBzdHJva2UtbGluZWpvaW49InJvdW5kIj4KICAgICAgICA8cGF0aCBmaWxsPSJpbmhlcml0IiBmaWxsLXJ1bGU9Im5vbnplcm8iIGQ9Ik04LjY3MiAzLjM2YzEuMzI4IDAgMi4xMTQuNzggMi4yOSAxLjg2OWwuMDE0LjEwMS4wMjMuMDA2djEuMDQybC0uNjM4LS4xODVjLS4xODctLjA1NS0uMzIzLS4yMTEtLjM1NC0uMzk5TDEwIDUuNzEzYzAtLjgyNS0uNDItMS4zNTMtMS4zMjgtMS4zNTNDNy42OTUgNC4zNiA3IDUuMDQxIDcgNS43MTN2Ny45NDFjMCAuNDM5LS41MjQuNjY1LS44NDMuMzY0bC0xLjg2OC0xLjc2MWMtLjU5NS0uNTI4LTEuMzE2LS42MTctMS45MTgtLjIxNi0uNTIyLjM0OC0uNTYyIDEuMjAzLS4xOCAxLjhMNy43MzggMjJoMTEuMDEzbC4yODUtLjUxOGMxLjI0Ny0yLjMyNiAxLjg5Ny00LjI1OSAxLjk2LTUuNzg1bC4wMDQtLjIzOVY4LjAzNWMwLS42NTYtLjUtMS4xNy0xLTEuMTctLjUwMyAwLTEgLjQ1Ni0xIDEuMTcgMCAuMzMzLS4zMi41NzMtLjY0LjQ4TDE4IDguNDFWNy4zNjhsLjA4Ni4wMjYuMDQyLS4xMzZjLjI3OS0uODA1Ljk3OC0xLjMzMiAxLjczOC0xLjM4OEwyMCA1Ljg2NWMxLjA1NyAwIDIgLjk2NyAyIDIuMTd2Ny40MjNjMCAxLjkyOS0uODQ1IDQuMzUyLTIuNTIxIDcuMjktLjA5LjE1Ni0uMjU1LjI1Mi0uNDM1LjI1Mkg3LjQ3NGMtLjE2NiAwLS4zMjEtLjA4Mi0uNDE0LS4yMTlsLTUuNzA0LTguMzljLS42NTMtMS4wMTktLjU4NC0yLjQ4Ni40Ni0zLjE4MiAxLS42NjYgMi4yMTYtLjUxNiAzLjE0OC4zMUw2IDEyLjQ5NVY1LjcxM2MwLTEuMTggMS4wNTgtMi4yNjMgMi40OS0yLjM0OHoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0yOTcgLTI5MCkgdHJhbnNsYXRlKDI5NyAyOTApIi8+CiAgICAgICAgPHBhdGggZmlsbD0iaW5oZXJpdCIgZmlsbC1ydWxlPSJub256ZXJvIiBkPSJNMTIuNSAxLjVjMS4zMjUgMCAyLjQxIDEuMDMyIDIuNDk1IDIuMzM2TDE1IDR2Ny4yMmgtMVY0YzAtLjgyOC0uNjcyLTEuNS0xLjUtMS41LS43OCAwLTEuNDIuNTk1LTEuNDkzIDEuMzU2TDExIDR2Ny4yMmgtMVY0YzAtMS4zOCAxLjEyLTIuNSAyLjUtMi41eiIgdHJhbnNmb3JtPSJ0cmFuc2xhdGUoLTI5NyAtMjkwKSB0cmFuc2xhdGUoMjk3IDI5MCkiLz4KICAgICAgICA8cGF0aCBmaWxsPSJpbmhlcml0IiBmaWxsLXJ1bGU9Im5vbnplcm8iIGQ9Ik0xNi41IDMuNWMxLjMyNSAwIDIuNDEgMS4wMzIgMi40OTUgMi4zMzZMMTkgNnY2LjNoLTFWNmMwLS44MjgtLjY3Mi0xLjUtMS41LTEuNS0uNzggMC0xLjQyLjU5NS0xLjQ5MyAxLjM1NkwxNSA2djIuNDRoLTFWNmMwLTEuMzggMS4xMi0yLjUgMi41LTIuNXoiIHRyYW5zZm9ybT0idHJhbnNsYXRlKC0yOTcgLTI5MCkgdHJhbnNsYXRlKDI5NyAyOTApIi8+CiAgICA8L2c+Cjwvc3ltYm9sPgo8L2RlZnM+Cjwvc3ZnPgo=";
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4858:
|
|
/***/ (function(module) {
|
|
|
|
"use strict";
|
|
module.exports = __WEBPACK_EXTERNAL_MODULE__4858__;
|
|
|
|
/***/ }),
|
|
|
|
/***/ 4960:
|
|
/***/ (function() {
|
|
|
|
/* (ignored) */
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6759:
|
|
/***/ (function() {
|
|
|
|
/* (ignored) */
|
|
|
|
/***/ }),
|
|
|
|
/***/ 6272:
|
|
/***/ (function() {
|
|
|
|
/* (ignored) */
|
|
|
|
/***/ })
|
|
|
|
/******/ });
|
|
/************************************************************************/
|
|
/******/ // The module cache
|
|
/******/ var __webpack_module_cache__ = {};
|
|
/******/
|
|
/******/ // The require function
|
|
/******/ function __webpack_require__(moduleId) {
|
|
/******/ // Check if module is in cache
|
|
/******/ var cachedModule = __webpack_module_cache__[moduleId];
|
|
/******/ if (cachedModule !== undefined) {
|
|
/******/ return cachedModule.exports;
|
|
/******/ }
|
|
/******/ // Create a new module (and put it into the cache)
|
|
/******/ var module = __webpack_module_cache__[moduleId] = {
|
|
/******/ // no module.id needed
|
|
/******/ // no module.loaded needed
|
|
/******/ exports: {}
|
|
/******/ };
|
|
/******/
|
|
/******/ // Execute the module function
|
|
/******/ __webpack_modules__[moduleId](module, module.exports, __webpack_require__);
|
|
/******/
|
|
/******/ // Return the exports of the module
|
|
/******/ return module.exports;
|
|
/******/ }
|
|
/******/
|
|
/************************************************************************/
|
|
/******/ /* webpack/runtime/compat get default export */
|
|
/******/ !function() {
|
|
/******/ // getDefaultExport function for compatibility with non-harmony modules
|
|
/******/ __webpack_require__.n = function(module) {
|
|
/******/ var getter = module && module.__esModule ?
|
|
/******/ function() { return module['default']; } :
|
|
/******/ function() { return module; };
|
|
/******/ __webpack_require__.d(getter, { a: getter });
|
|
/******/ return getter;
|
|
/******/ };
|
|
/******/ }();
|
|
/******/
|
|
/******/ /* webpack/runtime/define property getters */
|
|
/******/ !function() {
|
|
/******/ // define getter functions for harmony exports
|
|
/******/ __webpack_require__.d = function(exports, definition) {
|
|
/******/ for(var key in definition) {
|
|
/******/ if(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {
|
|
/******/ Object.defineProperty(exports, key, { enumerable: true, get: definition[key] });
|
|
/******/ }
|
|
/******/ }
|
|
/******/ };
|
|
/******/ }();
|
|
/******/
|
|
/******/ /* webpack/runtime/global */
|
|
/******/ !function() {
|
|
/******/ __webpack_require__.g = (function() {
|
|
/******/ if (typeof globalThis === 'object') return globalThis;
|
|
/******/ try {
|
|
/******/ return this || new Function('return this')();
|
|
/******/ } catch (e) {
|
|
/******/ if (typeof window === 'object') return window;
|
|
/******/ }
|
|
/******/ })();
|
|
/******/ }();
|
|
/******/
|
|
/******/ /* webpack/runtime/hasOwnProperty shorthand */
|
|
/******/ !function() {
|
|
/******/ __webpack_require__.o = function(obj, prop) { return Object.prototype.hasOwnProperty.call(obj, prop); }
|
|
/******/ }();
|
|
/******/
|
|
/************************************************************************/
|
|
var __webpack_exports__ = {};
|
|
// This entry need to be wrapped in an IIFE because it need to be in strict mode.
|
|
!function() {
|
|
"use strict";
|
|
|
|
// EXPORTS
|
|
__webpack_require__.d(__webpack_exports__, {
|
|
"default": function() { return /* binding */ src; }
|
|
});
|
|
|
|
// UNUSED EXPORTS: ImageEditor
|
|
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/trim.js
|
|
var trim = __webpack_require__(9131);
|
|
var trim_default = /*#__PURE__*/__webpack_require__.n(trim);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/index-of.js
|
|
var index_of = __webpack_require__(1899);
|
|
var index_of_default = /*#__PURE__*/__webpack_require__.n(index_of);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/splice.js
|
|
var splice = __webpack_require__(6562);
|
|
var splice_default = /*#__PURE__*/__webpack_require__.n(splice);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/object/define-property.js
|
|
var define_property = __webpack_require__(1734);
|
|
var define_property_default = /*#__PURE__*/__webpack_require__.n(define_property);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/slice.js
|
|
var slice = __webpack_require__(8005);
|
|
var slice_default = /*#__PURE__*/__webpack_require__.n(slice);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/object/create.js
|
|
var create = __webpack_require__(6065);
|
|
var create_default = /*#__PURE__*/__webpack_require__.n(create);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/set-timeout.js
|
|
var set_timeout = __webpack_require__(4496);
|
|
var set_timeout_default = /*#__PURE__*/__webpack_require__.n(set_timeout);
|
|
;// CONCATENATED MODULE: ./src/js/polyfill.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* eslint-disable */
|
|
// https://developer.mozilla.org/en-US/docs/Web/API/Element/closest
|
|
if (!Element.prototype.matches) {
|
|
Element.prototype.matches = Element.prototype.msMatchesSelector || Element.prototype.webkitMatchesSelector;
|
|
}
|
|
|
|
if (!Element.prototype.closest) {
|
|
Element.prototype.closest = function (s) {
|
|
var el = this;
|
|
|
|
do {
|
|
if (Element.prototype.matches.call(el, s)) return el;
|
|
el = el.parentElement || el.parentNode;
|
|
} while (el !== null && el.nodeType === 1);
|
|
|
|
return null;
|
|
};
|
|
}
|
|
/*
|
|
* classList.js: Cross-browser full element.classList implementation.
|
|
* 1.2.20171210
|
|
*
|
|
* By Eli Grey, http://eligrey.com
|
|
* License: Dedicated to the public domain.
|
|
* See https://github.com/eligrey/classList.js/blob/master/LICENSE.md
|
|
*/
|
|
|
|
/*global self, document, DOMException */
|
|
|
|
/*! @source http://purl.eligrey.com/github/classList.js/blob/master/classList.js */
|
|
|
|
|
|
if ('document' in self) {
|
|
// Full polyfill for browsers with no classList support
|
|
// Including IE < Edge missing SVGElement.classList
|
|
if (!('classList' in document.createElement('_')) || document.createElementNS && !('classList' in document.createElementNS('http://www.w3.org/2000/svg', 'g'))) {
|
|
(function (view) {
|
|
'use strict';
|
|
|
|
if (!('Element' in view)) return;
|
|
|
|
var classListProp = 'classList',
|
|
protoProp = 'prototype',
|
|
elemCtrProto = view.Element[protoProp],
|
|
objCtr = Object,
|
|
strTrim = trim_default()(String[protoProp]) || function () {
|
|
return this.replace(/^\s+|\s+$/g, '');
|
|
},
|
|
arrIndexOf = index_of_default()(Array[protoProp]) || function (item) {
|
|
var i = 0,
|
|
len = this.length;
|
|
|
|
for (; i < len; i++) {
|
|
if (i in this && this[i] === item) {
|
|
return i;
|
|
}
|
|
}
|
|
|
|
return -1;
|
|
},
|
|
// Vendors: please allow content code to instantiate DOMExceptions
|
|
DOMEx = function DOMEx(type, message) {
|
|
this.name = type;
|
|
this.code = DOMException[type];
|
|
this.message = message;
|
|
},
|
|
checkTokenAndGetIndex = function checkTokenAndGetIndex(classList, token) {
|
|
if (token === '') {
|
|
throw new DOMEx('SYNTAX_ERR', 'The token must not be empty.');
|
|
}
|
|
|
|
if (/\s/.test(token)) {
|
|
throw new DOMEx('INVALID_CHARACTER_ERR', 'The token must not contain space characters.');
|
|
}
|
|
|
|
return arrIndexOf.call(classList, token);
|
|
},
|
|
ClassList = function ClassList(elem) {
|
|
var trimmedClasses = strTrim.call(elem.getAttribute('class') || ''),
|
|
classes = trimmedClasses ? trimmedClasses.split(/\s+/) : [],
|
|
i = 0,
|
|
len = classes.length;
|
|
|
|
for (; i < len; i++) {
|
|
this.push(classes[i]);
|
|
}
|
|
|
|
this._updateClassName = function () {
|
|
elem.setAttribute('class', this.toString());
|
|
};
|
|
},
|
|
classListProto = ClassList[protoProp] = [],
|
|
classListGetter = function classListGetter() {
|
|
return new ClassList(this);
|
|
}; // Most DOMException implementations don't allow calling DOMException's toString()
|
|
// on non-DOMExceptions. Error's toString() is sufficient here.
|
|
|
|
|
|
DOMEx[protoProp] = Error[protoProp];
|
|
|
|
classListProto.item = function (i) {
|
|
return this[i] || null;
|
|
};
|
|
|
|
classListProto.contains = function (token) {
|
|
return ~checkTokenAndGetIndex(this, token + '');
|
|
};
|
|
|
|
classListProto.add = function () {
|
|
var tokens = arguments,
|
|
i = 0,
|
|
l = tokens.length,
|
|
token,
|
|
updated = false;
|
|
|
|
do {
|
|
token = tokens[i] + '';
|
|
|
|
if (!~checkTokenAndGetIndex(this, token)) {
|
|
this.push(token);
|
|
updated = true;
|
|
}
|
|
} while (++i < l);
|
|
|
|
if (updated) {
|
|
this._updateClassName();
|
|
}
|
|
};
|
|
|
|
classListProto.remove = function () {
|
|
var tokens = arguments,
|
|
i = 0,
|
|
l = tokens.length,
|
|
token,
|
|
updated = false,
|
|
index;
|
|
|
|
do {
|
|
token = tokens[i] + '';
|
|
index = checkTokenAndGetIndex(this, token);
|
|
|
|
while (~index) {
|
|
var _context;
|
|
|
|
splice_default()(_context = this).call(_context, index, 1);
|
|
|
|
updated = true;
|
|
index = checkTokenAndGetIndex(this, token);
|
|
}
|
|
} while (++i < l);
|
|
|
|
if (updated) {
|
|
this._updateClassName();
|
|
}
|
|
};
|
|
|
|
classListProto.toggle = function (token, force) {
|
|
var result = this.contains(token),
|
|
method = result ? force !== true && 'remove' : force !== false && 'add';
|
|
|
|
if (method) {
|
|
this[method](token);
|
|
}
|
|
|
|
if (force === true || force === false) {
|
|
return force;
|
|
} else {
|
|
return !result;
|
|
}
|
|
};
|
|
|
|
classListProto.replace = function (token, replacement_token) {
|
|
var index = checkTokenAndGetIndex(token + '');
|
|
|
|
if (~index) {
|
|
var _context2;
|
|
|
|
splice_default()(_context2 = this).call(_context2, index, 1, replacement_token);
|
|
|
|
this._updateClassName();
|
|
}
|
|
};
|
|
|
|
classListProto.toString = function () {
|
|
return this.join(' ');
|
|
};
|
|
|
|
if ((define_property_default())) {
|
|
var classListPropDesc = {
|
|
get: classListGetter,
|
|
enumerable: true,
|
|
configurable: true
|
|
};
|
|
|
|
try {
|
|
define_property_default()(elemCtrProto, classListProp, classListPropDesc);
|
|
} catch (ex) {
|
|
// IE 8 doesn't support enumerable:true
|
|
// adding undefined to fight this issue https://github.com/eligrey/classList.js/issues/36
|
|
// modernie IE8-MSW7 machine has IE8 8.0.6001.18702 and is affected
|
|
if (ex.number === undefined || ex.number === -0x7ff5ec54) {
|
|
classListPropDesc.enumerable = false;
|
|
|
|
define_property_default()(elemCtrProto, classListProp, classListPropDesc);
|
|
}
|
|
}
|
|
} else if (objCtr[protoProp].__defineGetter__) {
|
|
elemCtrProto.__defineGetter__(classListProp, classListGetter);
|
|
}
|
|
})(self);
|
|
} // There is full or partial native classList support, so just check if we need
|
|
// to normalize the add/remove and toggle APIs.
|
|
|
|
|
|
(function () {
|
|
'use strict';
|
|
|
|
var testElement = document.createElement('_');
|
|
testElement.classList.add('c1', 'c2'); // Polyfill for IE 10/11 and Firefox <26, where classList.add and
|
|
// classList.remove exist but support only one argument at a time.
|
|
|
|
if (!testElement.classList.contains('c2')) {
|
|
var createMethod = function createMethod(method) {
|
|
var original = DOMTokenList.prototype[method];
|
|
|
|
DOMTokenList.prototype[method] = function (token) {
|
|
var i,
|
|
len = arguments.length;
|
|
|
|
for (i = 0; i < len; i++) {
|
|
token = arguments[i];
|
|
original.call(this, token);
|
|
}
|
|
};
|
|
};
|
|
|
|
createMethod('add');
|
|
createMethod('remove');
|
|
}
|
|
|
|
testElement.classList.toggle('c3', false); // Polyfill for IE 10 and Firefox <24, where classList.toggle does not
|
|
// support the second argument.
|
|
|
|
if (testElement.classList.contains('c3')) {
|
|
var _toggle = DOMTokenList.prototype.toggle;
|
|
|
|
DOMTokenList.prototype.toggle = function (token, force) {
|
|
if (1 in arguments && !this.contains(token) === !force) {
|
|
return force;
|
|
} else {
|
|
return _toggle.call(this, token);
|
|
}
|
|
};
|
|
} // replace() polyfill
|
|
|
|
|
|
if (!('replace' in document.createElement('_').classList)) {
|
|
DOMTokenList.prototype.replace = function (token, replacement_token) {
|
|
var tokens = this.toString().split(' '),
|
|
index = index_of_default()(tokens).call(tokens, token + '');
|
|
|
|
if (~index) {
|
|
tokens = slice_default()(tokens).call(tokens, index);
|
|
this.remove.apply(this, tokens);
|
|
this.add(replacement_token);
|
|
this.add.apply(this, slice_default()(tokens).call(tokens, 1));
|
|
}
|
|
};
|
|
}
|
|
|
|
testElement = null;
|
|
})();
|
|
}
|
|
/*!
|
|
* @copyright Copyright (c) 2017 IcoMoon.io
|
|
* @license Licensed under MIT license
|
|
* See https://github.com/Keyamoon/svgxuse
|
|
* @version 1.2.6
|
|
*/
|
|
|
|
/*jslint browser: true */
|
|
|
|
/*global XDomainRequest, MutationObserver, window */
|
|
|
|
|
|
(function () {
|
|
'use strict';
|
|
|
|
if (typeof window !== 'undefined' && window.addEventListener) {
|
|
var cache = create_default()(null); // holds xhr objects to prevent multiple requests
|
|
|
|
|
|
var checkUseElems;
|
|
var tid; // timeout id
|
|
|
|
var debouncedCheck = function debouncedCheck() {
|
|
clearTimeout(tid);
|
|
tid = set_timeout_default()(checkUseElems, 100);
|
|
};
|
|
|
|
var unobserveChanges = function unobserveChanges() {
|
|
return;
|
|
};
|
|
|
|
var observeChanges = function observeChanges() {
|
|
var observer;
|
|
window.addEventListener('resize', debouncedCheck, false);
|
|
window.addEventListener('orientationchange', debouncedCheck, false);
|
|
|
|
if (window.MutationObserver) {
|
|
observer = new MutationObserver(debouncedCheck);
|
|
observer.observe(document.documentElement, {
|
|
childList: true,
|
|
subtree: true,
|
|
attributes: true
|
|
});
|
|
|
|
unobserveChanges = function unobserveChanges() {
|
|
try {
|
|
observer.disconnect();
|
|
window.removeEventListener('resize', debouncedCheck, false);
|
|
window.removeEventListener('orientationchange', debouncedCheck, false);
|
|
} catch (ignore) {}
|
|
};
|
|
} else {
|
|
document.documentElement.addEventListener('DOMSubtreeModified', debouncedCheck, false);
|
|
|
|
unobserveChanges = function unobserveChanges() {
|
|
document.documentElement.removeEventListener('DOMSubtreeModified', debouncedCheck, false);
|
|
window.removeEventListener('resize', debouncedCheck, false);
|
|
window.removeEventListener('orientationchange', debouncedCheck, false);
|
|
};
|
|
}
|
|
};
|
|
|
|
var createRequest = function createRequest(url) {
|
|
// In IE 9, cross origin requests can only be sent using XDomainRequest.
|
|
// XDomainRequest would fail if CORS headers are not set.
|
|
// Therefore, XDomainRequest should only be used with cross origin requests.
|
|
function getOrigin(loc) {
|
|
var a;
|
|
|
|
if (loc.protocol !== undefined) {
|
|
a = loc;
|
|
} else {
|
|
a = document.createElement('a');
|
|
a.href = loc;
|
|
}
|
|
|
|
return a.protocol.replace(/:/g, '') + a.host;
|
|
}
|
|
|
|
var Request;
|
|
var origin;
|
|
var origin2;
|
|
|
|
if (window.XMLHttpRequest) {
|
|
Request = new XMLHttpRequest();
|
|
origin = getOrigin(location);
|
|
origin2 = getOrigin(url);
|
|
|
|
if (Request.withCredentials === undefined && origin2 !== '' && origin2 !== origin) {
|
|
Request = XDomainRequest || undefined;
|
|
} else {
|
|
Request = XMLHttpRequest;
|
|
}
|
|
}
|
|
|
|
return Request;
|
|
};
|
|
|
|
var xlinkNS = 'http://www.w3.org/1999/xlink';
|
|
|
|
checkUseElems = function checkUseElems() {
|
|
var base;
|
|
var bcr;
|
|
var fallback = ''; // optional fallback URL in case no base path to SVG file was given and no symbol definition was found.
|
|
|
|
var hash;
|
|
var href;
|
|
var i;
|
|
var inProgressCount = 0;
|
|
var isHidden;
|
|
var Request;
|
|
var url;
|
|
var uses;
|
|
var xhr;
|
|
|
|
function observeIfDone() {
|
|
// If done with making changes, start watching for chagnes in DOM again
|
|
inProgressCount -= 1;
|
|
|
|
if (inProgressCount === 0) {
|
|
// if all xhrs were resolved
|
|
unobserveChanges(); // make sure to remove old handlers
|
|
|
|
observeChanges(); // watch for changes to DOM
|
|
}
|
|
}
|
|
|
|
function attrUpdateFunc(spec) {
|
|
return function () {
|
|
if (cache[spec.base] !== true) {
|
|
spec.useEl.setAttributeNS(xlinkNS, 'xlink:href', '#' + spec.hash);
|
|
|
|
if (spec.useEl.hasAttribute('href')) {
|
|
spec.useEl.setAttribute('href', '#' + spec.hash);
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
function onloadFunc(xhr) {
|
|
return function () {
|
|
var body = document.body;
|
|
var x = document.createElement('x');
|
|
var svg;
|
|
xhr.onload = null;
|
|
x.innerHTML = xhr.responseText;
|
|
svg = x.getElementsByTagName('svg')[0];
|
|
|
|
if (svg) {
|
|
svg.setAttribute('aria-hidden', 'true');
|
|
svg.style.position = 'absolute';
|
|
svg.style.width = 0;
|
|
svg.style.height = 0;
|
|
svg.style.overflow = 'hidden';
|
|
body.insertBefore(svg, body.firstChild);
|
|
}
|
|
|
|
observeIfDone();
|
|
};
|
|
}
|
|
|
|
function onErrorTimeout(xhr) {
|
|
return function () {
|
|
xhr.onerror = null;
|
|
xhr.ontimeout = null;
|
|
observeIfDone();
|
|
};
|
|
}
|
|
|
|
unobserveChanges(); // stop watching for changes to DOM
|
|
// find all use elements
|
|
|
|
uses = document.getElementsByTagName('use');
|
|
|
|
for (i = 0; i < uses.length; i += 1) {
|
|
try {
|
|
bcr = uses[i].getBoundingClientRect();
|
|
} catch (ignore) {
|
|
// failed to get bounding rectangle of the use element
|
|
bcr = false;
|
|
}
|
|
|
|
href = uses[i].getAttribute('href') || uses[i].getAttributeNS(xlinkNS, 'href') || uses[i].getAttribute('xlink:href');
|
|
|
|
if (href && href.split) {
|
|
url = href.split('#');
|
|
} else {
|
|
url = ['', ''];
|
|
}
|
|
|
|
base = url[0];
|
|
hash = url[1];
|
|
isHidden = bcr && bcr.left === 0 && bcr.right === 0 && bcr.top === 0 && bcr.bottom === 0;
|
|
|
|
if (bcr && bcr.width === 0 && bcr.height === 0 && !isHidden) {
|
|
// the use element is empty
|
|
// if there is a reference to an external SVG, try to fetch it
|
|
// use the optional fallback URL if there is no reference to an external SVG
|
|
if (fallback && !base.length && hash && !document.getElementById(hash)) {
|
|
base = fallback;
|
|
}
|
|
|
|
if (uses[i].hasAttribute('href')) {
|
|
uses[i].setAttributeNS(xlinkNS, 'xlink:href', href);
|
|
}
|
|
|
|
if (base.length) {
|
|
// schedule updating xlink:href
|
|
xhr = cache[base];
|
|
|
|
if (xhr !== true) {
|
|
// true signifies that prepending the SVG was not required
|
|
set_timeout_default()(attrUpdateFunc({
|
|
useEl: uses[i],
|
|
base: base,
|
|
hash: hash
|
|
}), 0);
|
|
}
|
|
|
|
if (xhr === undefined) {
|
|
Request = createRequest(base);
|
|
|
|
if (Request !== undefined) {
|
|
xhr = new Request();
|
|
cache[base] = xhr;
|
|
xhr.onload = onloadFunc(xhr);
|
|
xhr.onerror = onErrorTimeout(xhr);
|
|
xhr.ontimeout = onErrorTimeout(xhr);
|
|
xhr.open('GET', base);
|
|
xhr.send();
|
|
inProgressCount += 1;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
if (!isHidden) {
|
|
if (cache[base] === undefined) {
|
|
// remember this URL if the use element was not empty and no request was sent
|
|
cache[base] = true;
|
|
} else if (cache[base].onload) {
|
|
// if it turns out that prepending the SVG is not necessary,
|
|
// abort the in-progress xhr.
|
|
cache[base].abort();
|
|
delete cache[base].onload;
|
|
cache[base] = true;
|
|
}
|
|
} else if (base.length && cache[base]) {
|
|
set_timeout_default()(attrUpdateFunc({
|
|
useEl: uses[i],
|
|
base: base,
|
|
hash: hash
|
|
}), 0);
|
|
}
|
|
}
|
|
}
|
|
|
|
uses = '';
|
|
inProgressCount += 1;
|
|
observeIfDone();
|
|
};
|
|
|
|
var _winLoad;
|
|
|
|
_winLoad = function winLoad() {
|
|
window.removeEventListener('load', _winLoad, false); // to prevent memory leaks
|
|
|
|
tid = set_timeout_default()(checkUseElems, 0);
|
|
};
|
|
|
|
if (document.readyState !== 'complete') {
|
|
// The load event fires when all resources have finished loading, which allows detecting whether SVG use elements are empty.
|
|
window.addEventListener('load', _winLoad, false);
|
|
} else {
|
|
// No need to add a listener if the document is already loaded, initialize immediately.
|
|
_winLoad();
|
|
}
|
|
}
|
|
})();
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/array/is-array.js
|
|
var is_array = __webpack_require__(1845);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/arrayLikeToArray.js
|
|
function _arrayLikeToArray(arr, len) {
|
|
if (len == null || len > arr.length) len = arr.length;
|
|
|
|
for (var i = 0, arr2 = new Array(len); i < len; i++) {
|
|
arr2[i] = arr[i];
|
|
}
|
|
|
|
return arr2;
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/arrayWithoutHoles.js
|
|
|
|
|
|
function _arrayWithoutHoles(arr) {
|
|
if (is_array(arr)) return _arrayLikeToArray(arr);
|
|
}
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/symbol.js
|
|
var symbol = __webpack_require__(184);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/get-iterator-method.js
|
|
var get_iterator_method = __webpack_require__(662);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/array/from.js
|
|
var from = __webpack_require__(7172);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/iterableToArray.js
|
|
|
|
|
|
|
|
function _iterableToArray(iter) {
|
|
if (typeof symbol !== "undefined" && get_iterator_method(iter) != null || iter["@@iterator"] != null) return from(iter);
|
|
}
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/instance/slice.js
|
|
var instance_slice = __webpack_require__(711);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/unsupportÉditerableToArray.js
|
|
|
|
|
|
|
|
function _unsupportÉditerableToArray(o, minLen) {
|
|
var _context;
|
|
|
|
if (!o) return;
|
|
if (typeof o === "string") return _arrayLikeToArray(o, minLen);
|
|
|
|
var n = instance_slice(_context = Object.prototype.toString.call(o)).call(_context, 8, -1);
|
|
|
|
if (n === "Object" && o.constructor) n = o.constructor.name;
|
|
if (n === "Map" || n === "Set") return from(o);
|
|
if (n === "Arguments" || /^(?:Ui|I)nt(?:8|16|32)(?:Clamped)?Array$/.test(n)) return _arrayLikeToArray(o, minLen);
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/nonIterableSpread.js
|
|
function _nonIterableSpread() {
|
|
throw new TypeError("Invalid attempt to spread non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/toConsumableArray.js
|
|
|
|
|
|
|
|
|
|
function _toConsumableArray(arr) {
|
|
return _arrayWithoutHoles(arr) || _iterableToArray(arr) || _unsupportÉditerableToArray(arr) || _nonIterableSpread();
|
|
}
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/object/define-property.js
|
|
var object_define_property = __webpack_require__(7077);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/defineProperty.js
|
|
|
|
function _defineProperty(obj, key, value) {
|
|
if (key in obj) {
|
|
object_define_property(obj, key, {
|
|
value: value,
|
|
enumerable: true,
|
|
configurable: true,
|
|
writable: true
|
|
});
|
|
} else {
|
|
obj[key] = value;
|
|
}
|
|
|
|
return obj;
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/classCallCheck.js
|
|
function _classCallCheck(instance, Constructor) {
|
|
if (!(instance instanceof Constructor)) {
|
|
throw new TypeError("Cannot call a class as a function");
|
|
}
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/createClass.js
|
|
|
|
|
|
function _defineProperties(target, props) {
|
|
for (var i = 0; i < props.length; i++) {
|
|
var descriptor = props[i];
|
|
descriptor.enumerable = descriptor.enumerable || false;
|
|
descriptor.configurable = true;
|
|
if ("value" in descriptor) descriptor.writable = true;
|
|
|
|
object_define_property(target, descriptor.key, descriptor);
|
|
}
|
|
}
|
|
|
|
function _createClass(Constructor, protoProps, staticProps) {
|
|
if (protoProps) _defineProperties(Constructor.prototype, protoProps);
|
|
if (staticProps) _defineProperties(Constructor, staticProps);
|
|
return Constructor;
|
|
}
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/bind.js
|
|
var bind = __webpack_require__(4426);
|
|
var bind_default = /*#__PURE__*/__webpack_require__.n(bind);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/concat.js
|
|
var concat = __webpack_require__(9406);
|
|
var concat_default = /*#__PURE__*/__webpack_require__.n(concat);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/promise.js
|
|
var core_js_stable_promise = __webpack_require__(8189);
|
|
var promise_default = /*#__PURE__*/__webpack_require__.n(core_js_stable_promise);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/url.js
|
|
var url = __webpack_require__(3972);
|
|
var url_default = /*#__PURE__*/__webpack_require__.n(url);
|
|
// EXTERNAL MODULE: ./node_modules/fabric/dist/fabric.js
|
|
var fabric = __webpack_require__(2777);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/object/extend.js
|
|
var extend = __webpack_require__(961);
|
|
var extend_default = /*#__PURE__*/__webpack_require__.n(extend);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/type/isUndefined.js
|
|
var type_isUndefined = __webpack_require__(5695);
|
|
var isUndefined_default = /*#__PURE__*/__webpack_require__.n(type_isUndefined);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/collection/forEach.js
|
|
var collection_forEach = __webpack_require__(8592);
|
|
var forEach_default = /*#__PURE__*/__webpack_require__.n(collection_forEach);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/customEvents/customEvents.js
|
|
var customEvents = __webpack_require__(9052);
|
|
var customEvents_default = /*#__PURE__*/__webpack_require__.n(customEvents);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/type/isString.js
|
|
var isString = __webpack_require__(2560);
|
|
var isString_default = /*#__PURE__*/__webpack_require__.n(isString);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/object/keys.js
|
|
var keys = __webpack_require__(2461);
|
|
var keys_default = /*#__PURE__*/__webpack_require__.n(keys);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/arrayWithHoles.js
|
|
|
|
function _arrayWithHoles(arr) {
|
|
if (is_array(arr)) return arr;
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/iterableToArrayLimit.js
|
|
|
|
|
|
function _iterableToArrayLimit(arr, i) {
|
|
var _i = arr == null ? null : typeof symbol !== "undefined" && get_iterator_method(arr) || arr["@@iterator"];
|
|
|
|
if (_i == null) return;
|
|
var _arr = [];
|
|
var _n = true;
|
|
var _d = false;
|
|
|
|
var _s, _e;
|
|
|
|
try {
|
|
for (_i = _i.call(arr); !(_n = (_s = _i.next()).done); _n = true) {
|
|
_arr.push(_s.value);
|
|
|
|
if (i && _arr.length === i) break;
|
|
}
|
|
} catch (err) {
|
|
_d = true;
|
|
_e = err;
|
|
} finally {
|
|
try {
|
|
if (!_n && _i["return"] != null) _i["return"]();
|
|
} finally {
|
|
if (_d) throw _e;
|
|
}
|
|
}
|
|
|
|
return _arr;
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/nonIterableRest.js
|
|
function _nonIterableRest() {
|
|
throw new TypeError("Invalid attempt to destructure non-iterable instance.\nIn order to be iterable, non-array objects must have a [Symbol.iterator]() method.");
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/slicedToArray.js
|
|
|
|
|
|
|
|
|
|
function _slicedToArray(arr, i) {
|
|
return _arrayWithHoles(arr) || _iterableToArrayLimit(arr, i) || _unsupportÉditerableToArray(arr, i) || _nonIterableRest();
|
|
}
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/parse-int.js
|
|
var parse_int = __webpack_require__(6397);
|
|
var parse_int_default = /*#__PURE__*/__webpack_require__.n(parse_int);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/for-each.js
|
|
var for_each = __webpack_require__(7636);
|
|
var for_each_default = /*#__PURE__*/__webpack_require__.n(for_each);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/fill.js
|
|
var instance_fill = __webpack_require__(789);
|
|
var fill_default = /*#__PURE__*/__webpack_require__.n(instance_fill);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/request/sendHostname.js
|
|
var sendHostname = __webpack_require__(4729);
|
|
var sendHostname_default = /*#__PURE__*/__webpack_require__.n(sendHostname);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/object/pick.js
|
|
var pick = __webpack_require__(1610);
|
|
var pick_default = /*#__PURE__*/__webpack_require__.n(pick);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/array/inArray.js
|
|
var inArray = __webpack_require__(3053);
|
|
var inArray_default = /*#__PURE__*/__webpack_require__.n(inArray);
|
|
;// CONCATENATED MODULE: ./src/js/consts.js
|
|
var _context;
|
|
|
|
|
|
|
|
/**
|
|
* Help features for zoom
|
|
* @type {Array.<string>}
|
|
*/
|
|
|
|
var ZOOM_HELP_MENUS = ['zoomIn', 'zoomOut', 'hand'];
|
|
/**
|
|
* Help features for command
|
|
* @type {Array.<string>}
|
|
*/
|
|
|
|
var COMMAND_HELP_MENUS = ['history', 'undo', 'redo', 'reset'];
|
|
/**
|
|
* Help features for delete
|
|
* @type {Array.<string>}
|
|
*/
|
|
|
|
var DELETE_HELP_MENUS = ['delete', 'deleteAll'];
|
|
/**
|
|
* Editor help features
|
|
* @type {Array.<string>}
|
|
*/
|
|
|
|
var HELP_MENUS = concat_default()(_context = []).call(_context, ZOOM_HELP_MENUS, COMMAND_HELP_MENUS, DELETE_HELP_MENUS);
|
|
/**
|
|
* Fill type for shape
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var SHAPE_FILL_TYPE = {
|
|
FILTER: 'filter',
|
|
COLOR: 'color'
|
|
};
|
|
/**
|
|
* Shape type list
|
|
* @type {Array.<string>}
|
|
*/
|
|
|
|
var SHAPE_TYPE = ['rect', 'circle', 'triangle'];
|
|
/**
|
|
* Object type
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var OBJ_TYPE = {
|
|
CROPZONE: 'cropzone'
|
|
};
|
|
/**
|
|
* Filter type map
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var filterType = {
|
|
VINTAGE: 'vintage',
|
|
SEPIA2: 'sepia2',
|
|
REMOVE_COLOR: 'removeColor',
|
|
COLOR_FILTER: 'colorFilter',
|
|
REMOVE_WHITE: 'removeWhite',
|
|
BLEND_COLOR: 'blendColor',
|
|
BLEND: 'blend'
|
|
};
|
|
/**
|
|
* Component names
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var componentNames = keyMirror('IMAGE_LOADER', 'CROPPER', 'FLIP', 'ROTATION', 'FREE_DRAWING', 'LINE', 'TEXT', 'ICON', 'FILTER', 'SHAPE', 'ZOOM', 'RESIZE');
|
|
/**
|
|
* Shape default option
|
|
* @type {Object}
|
|
*/
|
|
|
|
var SHAPE_DEFAULT_OPTIONS = {
|
|
lockSkewingX: true,
|
|
lockSkewingY: true,
|
|
bringForward: true,
|
|
isRegular: false
|
|
};
|
|
/**
|
|
* Cropzone default option
|
|
* @type {Object}
|
|
*/
|
|
|
|
var CROPZONE_DEFAULT_OPTIONS = {
|
|
hasRotatingPoint: false,
|
|
hasBorders: false,
|
|
lockScalingFlip: true,
|
|
lockRotation: true,
|
|
lockSkewingX: true,
|
|
lockSkewingY: true
|
|
};
|
|
/**
|
|
* Command names
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var commandNames = {
|
|
CLEAR_OBJECTS: 'clearObjects',
|
|
LOAD_IMAGE: 'loadImage',
|
|
FLIP_IMAGE: 'flip',
|
|
ROTATE_IMAGE: 'rotate',
|
|
ADD_OBJECT: 'addObject',
|
|
REMOVE_OBJECT: 'removeObject',
|
|
APPLY_FILTER: 'applyFilter',
|
|
REMOVE_FILTER: 'removeFilter',
|
|
ADD_ICON: 'addIcon',
|
|
CHANGE_ICON_COLOR: 'changeIconColor',
|
|
ADD_SHAPE: 'addShape',
|
|
CHANGE_SHAPE: 'changeShape',
|
|
ADD_TEXT: 'addText',
|
|
CHANGE_TEXT: 'changeText',
|
|
CHANGE_TEXT_STYLE: 'changeTextStyle',
|
|
ADD_IMAGE_OBJECT: 'addImageObject',
|
|
RESIZE_CANVAS_DIMENSION: 'resizeCanvasDimension',
|
|
SET_OBJECT_PROPERTIES: 'setObjectProperties',
|
|
SET_OBJECT_POSITION: 'setObjectPosition',
|
|
CHANGE_SELECTION: 'changeSelection',
|
|
RESIZE_IMAGE: 'resize'
|
|
};
|
|
/**
|
|
* Event names
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var eventNames = {
|
|
OBJECT_ACTIVATED: 'objectActivated',
|
|
OBJECT_MOVED: 'objectMoved',
|
|
OBJECT_SCALED: 'objectScaled',
|
|
OBJECT_CREATED: 'objectCreated',
|
|
OBJECT_ROTATED: 'objectRotated',
|
|
OBJECT_ADDED: 'objectAdded',
|
|
OBJECT_MODIFIED: 'objectModified',
|
|
TEXT_EDITING: 'textEditing',
|
|
TEXT_CHANGED: 'textChanged',
|
|
ICON_CREATE_RESIZE: 'iconCreateResize',
|
|
ICON_CREATE_END: 'iconCreateEnd',
|
|
ADD_TEXT: 'addText',
|
|
ADD_OBJECT: 'addObject',
|
|
ADD_OBJECT_AFTER: 'addObjectAfter',
|
|
MOUSE_DOWN: 'mousedown',
|
|
MOUSE_UP: 'mouseup',
|
|
MOUSE_MOVE: 'mousemove',
|
|
// UNDO/REDO Events
|
|
REDO_STACK_CHANGED: 'redoStackChanged',
|
|
UNDO_STACK_CHANGED: 'undoStackChanged',
|
|
SELECTION_CLEARED: 'selectionCleared',
|
|
SELECTION_CREATED: 'selectionCreated',
|
|
EXECUTE_COMMAND: 'executeCommand',
|
|
AFTER_UNDO: 'afterUndo',
|
|
AFTER_REDO: 'afterRedo',
|
|
ZOOM_CHANGED: 'zoomChanged',
|
|
HAND_STARTED: 'handStarted',
|
|
HAND_STOPPED: 'handStopped',
|
|
KEY_DOWN: 'keydown',
|
|
KEY_UP: 'keyup',
|
|
INPUT_BOX_EDITING_STARTED: 'inputBoxEditingStarted',
|
|
INPUT_BOX_EDITING_STOPPED: 'inputBoxEditingStopped',
|
|
FOCUS: 'focus',
|
|
BLUR: 'blur',
|
|
IMAGE_RESIZED: 'imageResized'
|
|
};
|
|
/**
|
|
* Selector names
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var selectorNames = {
|
|
COLOR_PICKER_INPUT_BOX: '.tui-colorpicker-palette-hex'
|
|
};
|
|
/**
|
|
* History names
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var historyNames = {
|
|
LOAD_IMAGE: 'Load',
|
|
LOAD_MASK_IMAGE: 'Mask',
|
|
ADD_MASK_IMAGE: 'Mask',
|
|
ADD_IMAGE_OBJECT: 'Mask',
|
|
CROP: 'Crop',
|
|
RESIZE: 'Resize',
|
|
APPLY_FILTER: 'Filter',
|
|
REMOVE_FILTER: 'Filter',
|
|
CHANGE_SHAPE: 'Shape',
|
|
CHANGE_ICON_COLOR: 'Icon',
|
|
ADD_TEXT: 'Text',
|
|
CHANGE_TEXT_STYLE: 'Text',
|
|
REMOVE_OBJECT: 'Delete',
|
|
CLEAR_OBJECTS: 'Delete'
|
|
};
|
|
/**
|
|
* Editor states
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var drawingModes = keyMirror('NORMAL', 'CROPPER', 'FREE_DRAWING', 'LINE_DRAWING', 'TEXT', 'SHAPE', 'ICON', 'ZOOM', 'RESIZE');
|
|
/**
|
|
* Menu names with drawing mode
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var drawingMenuNames = {
|
|
TEXT: 'text',
|
|
CROP: 'crop',
|
|
RESIZE: 'resize',
|
|
SHAPE: 'shape',
|
|
ZOOM: 'zoom'
|
|
};
|
|
/**
|
|
* Zoom modes
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var zoomModes = {
|
|
DEFAULT: 'normal',
|
|
ZOOM: 'zoom',
|
|
HAND: 'hand'
|
|
};
|
|
/**
|
|
* Shortcut key values
|
|
* @type {Object.<string, number>}
|
|
*/
|
|
|
|
var keyCodes = {
|
|
Z: 90,
|
|
Y: 89,
|
|
C: 67,
|
|
V: 86,
|
|
SHIFT: 16,
|
|
BACKSPACE: 8,
|
|
DEL: 46,
|
|
ARROW_DOWN: 40,
|
|
ARROW_UP: 38,
|
|
SPACE: 32,
|
|
DIGIT_0: 48,
|
|
DIGIT_9: 57
|
|
};
|
|
/**
|
|
* Fabric object options
|
|
* @type {Object.<string, Object>}
|
|
*/
|
|
|
|
var fObjectOptions = {
|
|
SELECTION_STYLE: {
|
|
borderColor: 'red',
|
|
cornerColor: 'green',
|
|
cornerSize: 10,
|
|
originX: 'center',
|
|
originY: 'center',
|
|
transparentCorners: false
|
|
}
|
|
};
|
|
/**
|
|
* Promise reject messages
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var rejectMessages = {
|
|
addedObject: 'The object is already added.',
|
|
flip: 'The flipX and flipY setting values are not changed.',
|
|
invalidDrawingMode: 'This operation is not supported in the drawing mode.',
|
|
invalidParameters: 'Invalid parameters.',
|
|
isLock: 'The executing command state is locked.',
|
|
loadImage: 'The background image is empty.',
|
|
loadingImageFailed: 'Invalid image loaded.',
|
|
noActiveObject: 'There is no active object.',
|
|
noObject: 'The object is not in canvas.',
|
|
redo: 'The promise of redo command is reject.',
|
|
rotation: 'The current angle is same the old angle.',
|
|
undo: 'The promise of undo command is reject.',
|
|
unsupportedOperation: 'Unsupported operation.',
|
|
unsupportedType: 'Unsupported object type.'
|
|
};
|
|
/**
|
|
* Default icon menu svg path
|
|
* @type {Object.<string, string>}
|
|
*/
|
|
|
|
var defaultIconPath = {
|
|
'icon-arrow': 'M40 12V0l24 24-24 24V36H0V12h40z',
|
|
'icon-arrow-2': 'M49,32 H3 V22 h46 l-18,-18 h12 l23,23 L43,50 h-12 l18,-18 z ',
|
|
'icon-arrow-3': 'M43.349998,27 L17.354,53 H1.949999 l25.996,-26 L1.949999,1 h15.404 L43.349998,27 z ',
|
|
'icon-star': 'M35,54.557999 l-19.912001,10.468 l3.804,-22.172001 l-16.108,-15.7 l22.26,-3.236 L35,3.746 l9.956,20.172001 l22.26,3.236 l-16.108,15.7 l3.804,22.172001 z ',
|
|
'icon-star-2': 'M17,31.212 l-7.194,4.08 l-4.728,-6.83 l-8.234,0.524 l-1.328,-8.226 l-7.644,-3.14 l2.338,-7.992 l-5.54,-6.18 l5.54,-6.176 l-2.338,-7.994 l7.644,-3.138 l1.328,-8.226 l8.234,0.522 l4.728,-6.83 L17,-24.312 l7.194,-4.08 l4.728,6.83 l8.234,-0.522 l1.328,8.226 l7.644,3.14 l-2.338,7.992 l5.54,6.178 l-5.54,6.178 l2.338,7.992 l-7.644,3.14 l-1.328,8.226 l-8.234,-0.524 l-4.728,6.83 z ',
|
|
'icon-polygon': 'M3,31 L19,3 h32 l16,28 l-16,28 H19 z ',
|
|
'icon-location': 'M24 62C8 45.503 0 32.837 0 24 0 10.745 10.745 0 24 0s24 10.745 24 24c0 8.837-8 21.503-24 38zm0-28c5.523 0 10-4.477 10-10s-4.477-10-10-10-10 4.477-10 10 4.477 10 10 10z',
|
|
'icon-heart': 'M49.994999,91.349998 l-6.96,-6.333 C18.324001,62.606995 2.01,47.829002 2.01,29.690998 C2.01,14.912998 13.619999,3.299999 28.401001,3.299999 c8.349,0 16.362,5.859 21.594,12 c5.229,-6.141 13.242001,-12 21.591,-12 c14.778,0 26.390999,11.61 26.390999,26.390999 c0,18.138 -16.314001,32.916 -41.025002,55.374001 l-6.96,6.285 z ',
|
|
'icon-bubble': 'M44 48L34 58V48H12C5.373 48 0 42.627 0 36V12C0 5.373 5.373 0 12 0h40c6.627 0 12 5.373 12 12v24c0 6.627-5.373 12-12 12h-8z'
|
|
};
|
|
var defaultRotateRangeValues = {
|
|
realTimeEvent: true,
|
|
min: -360,
|
|
max: 360,
|
|
value: 0
|
|
};
|
|
var defaultDrawRangeValues = {
|
|
min: 5,
|
|
max: 30,
|
|
value: 12
|
|
};
|
|
var defaultShapeStrokeValues = {
|
|
realTimeEvent: true,
|
|
min: 2,
|
|
max: 300,
|
|
value: 3
|
|
};
|
|
var defaultTextRangeValues = {
|
|
realTimeEvent: true,
|
|
min: 10,
|
|
max: 100,
|
|
value: 50
|
|
};
|
|
var defaultFilterRangeValues = {
|
|
tintOpacityRange: {
|
|
realTimeEvent: true,
|
|
min: 0,
|
|
max: 1,
|
|
value: 0.7,
|
|
useDecimal: true
|
|
},
|
|
removewhiteDistanceRange: {
|
|
realTimeEvent: true,
|
|
min: 0,
|
|
max: 1,
|
|
value: 0.2,
|
|
useDecimal: true
|
|
},
|
|
brightnessRange: {
|
|
realTimeEvent: true,
|
|
min: -1,
|
|
max: 1,
|
|
value: 0,
|
|
useDecimal: true
|
|
},
|
|
noiseRange: {
|
|
realTimeEvent: true,
|
|
min: 0,
|
|
max: 1000,
|
|
value: 100
|
|
},
|
|
pixelateRange: {
|
|
realTimeEvent: true,
|
|
min: 2,
|
|
max: 20,
|
|
value: 4
|
|
},
|
|
colorfilterThresholdRange: {
|
|
realTimeEvent: true,
|
|
min: 0,
|
|
max: 1,
|
|
value: 0.2,
|
|
useDecimal: true
|
|
},
|
|
blurFilterRange: {
|
|
value: 0.1
|
|
}
|
|
};
|
|
var emptyCropRectValues = {
|
|
LEFT: 0,
|
|
TOP: 0,
|
|
WIDTH: 0.5,
|
|
HEIGHT: 0.5
|
|
};
|
|
var defaultResizePixelValues = {
|
|
realTimeEvent: true,
|
|
min: 32,
|
|
max: 4088,
|
|
value: 800
|
|
};
|
|
;// CONCATENATED MODULE: ./src/js/util.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var FLOATING_POINT_DIGIT = 2;
|
|
var CSS_PREFIX = 'tui-image-editor-';
|
|
var min = Math.min,
|
|
max = Math.max;
|
|
var hostnameSent = false;
|
|
var lastId = 0;
|
|
function stamp(obj) {
|
|
if (!obj.__fe_id) {
|
|
lastId += 1; // eslint-disable-next-line camelcase
|
|
|
|
obj.__fe_id = lastId;
|
|
}
|
|
|
|
return obj.__fe_id;
|
|
}
|
|
function hasStamp(obj) {
|
|
return !isNil(obj === null || obj === void 0 ? void 0 : obj.__fe_id);
|
|
}
|
|
function isNil(value) {
|
|
return isUndefined(value) || value === null;
|
|
}
|
|
function isFunction(value) {
|
|
return typeof value === 'function';
|
|
}
|
|
/**
|
|
* Clamp value
|
|
* @param {number} value - Value
|
|
* @param {number} minValue - Minimum value
|
|
* @param {number} maxValue - Maximum value
|
|
* @returns {number} clamped value
|
|
*/
|
|
|
|
function clamp(value, minValue, maxValue) {
|
|
if (minValue > maxValue) {
|
|
var _ref = [maxValue, minValue];
|
|
minValue = _ref[0];
|
|
maxValue = _ref[1];
|
|
}
|
|
|
|
return max(minValue, min(value, maxValue));
|
|
}
|
|
/**
|
|
* Make key-value object from arguments
|
|
* @returns {object.<string, string>}
|
|
*/
|
|
|
|
function keyMirror() {
|
|
var obj = {};
|
|
|
|
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
|
|
args[_key] = arguments[_key];
|
|
}
|
|
|
|
forEach_default()(args, function (key) {
|
|
obj[key] = key;
|
|
});
|
|
return obj;
|
|
}
|
|
/**
|
|
* Make CSSText
|
|
* @param {Object} styleObj - Style info object
|
|
* @returns {string} Connected string of style
|
|
*/
|
|
|
|
function makeStyleText(styleObj) {
|
|
var styleStr = '';
|
|
forEach(styleObj, function (value, prop) {
|
|
var _context;
|
|
|
|
styleStr += _concatInstanceProperty(_context = "".concat(prop, ": ")).call(_context, value, ";");
|
|
});
|
|
return styleStr;
|
|
}
|
|
/**
|
|
* Get object's properties
|
|
* @param {Object} obj - object
|
|
* @param {Array} keys - keys
|
|
* @returns {Object} properties object
|
|
*/
|
|
|
|
function getProperties(obj, keys) {
|
|
var props = {};
|
|
var length = keys.length;
|
|
var i = 0;
|
|
var key;
|
|
|
|
for (i = 0; i < length; i += 1) {
|
|
key = keys[i];
|
|
props[key] = obj[key];
|
|
}
|
|
|
|
return props;
|
|
}
|
|
/**
|
|
* ParseInt simpliment
|
|
* @param {number} value - Value
|
|
* @returns {number}
|
|
*/
|
|
|
|
function toInteger(value) {
|
|
return parse_int_default()(value, 10);
|
|
}
|
|
/**
|
|
* String to camelcase string
|
|
* @param {string} targetString - change target
|
|
* @returns {string}
|
|
* @private
|
|
*/
|
|
|
|
function toCamelCase(targetString) {
|
|
return targetString.replace(/-([a-z])/g, function ($0, $1) {
|
|
return $1.toUpperCase();
|
|
});
|
|
}
|
|
/**
|
|
* Check browser file api support
|
|
* @returns {boolean}
|
|
* @private
|
|
*/
|
|
|
|
function isSupportFileApi() {
|
|
return !!(window.File && window.FileList && window.FileReader);
|
|
}
|
|
/**
|
|
* hex to rgb
|
|
* @param {string} color - hex color
|
|
* @param {string} alpha - color alpha value
|
|
* @returns {string} rgb expression
|
|
*/
|
|
|
|
function getRgb(color, alpha) {
|
|
var _context3, _context4, _context5;
|
|
|
|
if (color.length === 4) {
|
|
var _context2;
|
|
|
|
color = concat_default()(_context2 = "".concat(color)).call(_context2, slice_default()(color).call(color, 1, 4));
|
|
}
|
|
|
|
var r = parse_int_default()(slice_default()(color).call(color, 1, 3), 16);
|
|
|
|
var g = parse_int_default()(slice_default()(color).call(color, 3, 5), 16);
|
|
|
|
var b = parse_int_default()(slice_default()(color).call(color, 5, 7), 16);
|
|
|
|
var a = alpha || 1;
|
|
return concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = "rgba(".concat(r, ", ")).call(_context5, g, ", ")).call(_context4, b, ", ")).call(_context3, a, ")");
|
|
}
|
|
/**
|
|
* send hostname
|
|
*/
|
|
|
|
function sendHostName() {
|
|
if (hostnameSent) {
|
|
return;
|
|
}
|
|
|
|
hostnameSent = true;
|
|
sendHostname_default()('image-editor', 'UA-129999381-1');
|
|
}
|
|
/**
|
|
* Apply css resource
|
|
* @param {string} styleBuffer - serialized css text
|
|
* @param {string} tagId - style tag id
|
|
*/
|
|
|
|
function styleLoad(styleBuffer, tagId) {
|
|
var _document$getElements = document.getElementsByTagName('head'),
|
|
_document$getElements2 = _slicedToArray(_document$getElements, 1),
|
|
head = _document$getElements2[0];
|
|
|
|
var linkElement = document.createElement('link');
|
|
var styleData = encodeURIComponent(styleBuffer);
|
|
|
|
if (tagId) {
|
|
linkElement.id = tagId; // linkElement.id = 'tui-image-editor-theme-style';
|
|
}
|
|
|
|
linkElement.setAttribute('rel', 'stylesheet');
|
|
linkElement.setAttribute('type', 'text/css');
|
|
linkElement.setAttribute('href', "data:text/css;charset=UTF-8,".concat(styleData));
|
|
head.appendChild(linkElement);
|
|
}
|
|
/**
|
|
* Get selector
|
|
* @param {HTMLElement} targetElement - target element
|
|
* @returns {Function} selector
|
|
*/
|
|
|
|
function getSelector(targetElement) {
|
|
return function (str) {
|
|
return targetElement.querySelector(str);
|
|
};
|
|
}
|
|
/**
|
|
* Change base64 to blob
|
|
* @param {String} data - base64 string data
|
|
* @returns {Blob} Blob Data
|
|
*/
|
|
|
|
function base64ToBlob(data) {
|
|
var rImageType = /data:(image\/.+);base64,/;
|
|
var mimeString = '';
|
|
var raw, uInt8Array, i;
|
|
raw = data.replace(rImageType, function (header, imageType) {
|
|
mimeString = imageType;
|
|
return '';
|
|
});
|
|
raw = atob(raw);
|
|
var rawLength = raw.length;
|
|
uInt8Array = new Uint8Array(rawLength); // eslint-disable-line
|
|
|
|
for (i = 0; i < rawLength; i += 1) {
|
|
uInt8Array[i] = raw.charCodeAt(i);
|
|
}
|
|
|
|
return new Blob([uInt8Array], {
|
|
type: mimeString
|
|
});
|
|
}
|
|
/**
|
|
* Fix floating point diff.
|
|
* @param {number} value - original value
|
|
* @returns {number} fixed value
|
|
*/
|
|
|
|
function fixFloatingPoint(value) {
|
|
return Number(value.toFixed(FLOATING_POINT_DIGIT));
|
|
}
|
|
/**
|
|
* Assignment for destroying objects.
|
|
* @param {Object} targetObject - object to be removed.
|
|
*/
|
|
|
|
function assignmentForDestroy(targetObject) {
|
|
forEach_default()(targetObject, function (value, key) {
|
|
targetObject[key] = null;
|
|
});
|
|
}
|
|
/**
|
|
* Make class name for ui
|
|
* @param {String} str - main string of className
|
|
* @param {String} prefix - prefix string of className
|
|
* @returns {String} class name
|
|
*/
|
|
|
|
function cls() {
|
|
var _context7;
|
|
|
|
var str = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : '';
|
|
var prefix = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : '';
|
|
|
|
if (str.charAt(0) === '.') {
|
|
var _context6;
|
|
|
|
return concat_default()(_context6 = ".".concat(CSS_PREFIX).concat(prefix)).call(_context6, slice_default()(str).call(str, 1));
|
|
}
|
|
|
|
return concat_default()(_context7 = "".concat(CSS_PREFIX).concat(prefix)).call(_context7, str);
|
|
}
|
|
/**
|
|
* Change object origin
|
|
* @param {fabric.Object} fObject - fabric object
|
|
* @param {Object} origin - origin of fabric object
|
|
* @param {string} originX - horizontal basis.
|
|
* @param {string} originY - vertical basis.
|
|
*/
|
|
|
|
function changeOrigin(fObject, origin) {
|
|
var originX = origin.originX,
|
|
originY = origin.originY;
|
|
|
|
var _fObject$getPointByOr = fObject.getPointByOrigin(originX, originY),
|
|
left = _fObject$getPointByOr.x,
|
|
top = _fObject$getPointByOr.y;
|
|
|
|
fObject.set({
|
|
left: left,
|
|
top: top,
|
|
originX: originX,
|
|
originY: originY
|
|
});
|
|
fObject.setCoords();
|
|
}
|
|
/**
|
|
* Object key value flip
|
|
* @param {Object} targetObject - The data object of the key value.
|
|
* @returns {Object}
|
|
*/
|
|
|
|
function flipObject(targetObject) {
|
|
var _context8;
|
|
|
|
var result = {};
|
|
|
|
for_each_default()(_context8 = keys_default()(targetObject)).call(_context8, function (key) {
|
|
result[targetObject[key]] = key;
|
|
});
|
|
|
|
return result;
|
|
}
|
|
/**
|
|
* Set custom properties
|
|
* @param {Object} targetObject - target object
|
|
* @param {Object} props - custom props object
|
|
*/
|
|
|
|
function setCustomProperty(targetObject, props) {
|
|
targetObject.customProps = targetObject.customProps || {};
|
|
extend_default()(targetObject.customProps, props);
|
|
}
|
|
/**
|
|
* Get custom property
|
|
* @param {fabric.Object} fObject - fabric object
|
|
* @param {Array|string} propNames - prop name array
|
|
* @returns {object | number | string}
|
|
*/
|
|
|
|
function getCustomProperty(fObject, propNames) {
|
|
var resultObject = {};
|
|
|
|
if (isString_default()(propNames)) {
|
|
propNames = [propNames];
|
|
}
|
|
|
|
forEach_default()(propNames, function (propName) {
|
|
resultObject[propName] = fObject.customProps[propName];
|
|
});
|
|
return resultObject;
|
|
}
|
|
/**
|
|
* Capitalize string
|
|
* @param {string} targetString - target string
|
|
* @returns {string}
|
|
*/
|
|
|
|
function capitalizeString(targetString) {
|
|
return targetString.charAt(0).toUpperCase() + slice_default()(targetString).call(targetString, 1);
|
|
}
|
|
/**
|
|
* Array includes check
|
|
* @param {Array} targetArray - target array
|
|
* @param {string|number} compareValue - compare value
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
function includes(targetArray, compareValue) {
|
|
return index_of_default()(targetArray).call(targetArray, compareValue) >= 0;
|
|
}
|
|
/**
|
|
* Get fill type
|
|
* @param {Object | string} fillOption - shape fill option
|
|
* @returns {string} 'color' or 'filter'
|
|
*/
|
|
|
|
function getFillTypeFromOption() {
|
|
var fillOption = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
|
return pick_default()(fillOption, 'type') || SHAPE_FILL_TYPE.COLOR;
|
|
}
|
|
/**
|
|
* Get fill type of shape type object
|
|
* @param {fabric.Object} shapeObj - fabric object
|
|
* @returns {string} 'transparent' or 'color' or 'filter'
|
|
*/
|
|
|
|
function getFillTypeFromObject(shapeObj) {
|
|
var _shapeObj$fill = fill_default()(shapeObj),
|
|
fill = _shapeObj$fill === void 0 ? {} : _shapeObj$fill;
|
|
|
|
if (fill.source) {
|
|
return SHAPE_FILL_TYPE.FILTER;
|
|
}
|
|
|
|
return SHAPE_FILL_TYPE.COLOR;
|
|
}
|
|
/**
|
|
* Check if the object is a shape object.
|
|
* @param {fabric.Object} obj - fabric object
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
function isShape(obj) {
|
|
return inArray_default()(obj.get('type'), SHAPE_TYPE) >= 0;
|
|
}
|
|
/**
|
|
* Get object type
|
|
* @param {string} type - fabric object type
|
|
* @returns {string} type of object (ex: shape, icon, ...)
|
|
*/
|
|
|
|
function getObjectType(type) {
|
|
if (includes(SHAPE_TYPE, type)) {
|
|
return 'Shape';
|
|
}
|
|
|
|
switch (type) {
|
|
case 'i-text':
|
|
return 'Text';
|
|
|
|
case 'path':
|
|
case 'line':
|
|
return 'Draw';
|
|
|
|
case 'activeSelection':
|
|
return 'Group';
|
|
|
|
default:
|
|
return toStartOfCapital(type);
|
|
}
|
|
}
|
|
/**
|
|
* Get filter type
|
|
* @param {string} type - fabric filter type
|
|
* @param {object} [options] - filter type options
|
|
* @param {boolean} [options.useAlpha=true] - usage of alpha(true is 'color filter', false is 'remove white')
|
|
* @param {string} [options.mode] - mode of blendColor
|
|
* @returns {string} type of filter (ex: sepia, blur, ...)
|
|
*/
|
|
|
|
function getFilterType(type) {
|
|
var _ref2 = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
|
|
_ref2$useAlpha = _ref2.useAlpha,
|
|
useAlpha = _ref2$useAlpha === void 0 ? true : _ref2$useAlpha,
|
|
mode = _ref2.mode;
|
|
|
|
var VINTAGE = filterType.VINTAGE,
|
|
REMOVE_COLOR = filterType.REMOVE_COLOR,
|
|
BLEND_COLOR = filterType.BLEND_COLOR,
|
|
SEPIA2 = filterType.SEPIA2,
|
|
COLOR_FILTER = filterType.COLOR_FILTER,
|
|
REMOVE_WHITE = filterType.REMOVE_WHITE,
|
|
BLEND = filterType.BLEND;
|
|
var filterName;
|
|
|
|
switch (type) {
|
|
case VINTAGE:
|
|
filterName = SEPIA2;
|
|
break;
|
|
|
|
case REMOVE_COLOR:
|
|
filterName = useAlpha ? COLOR_FILTER : REMOVE_WHITE;
|
|
break;
|
|
|
|
case BLEND_COLOR:
|
|
filterName = mode === 'add' ? BLEND : mode;
|
|
break;
|
|
|
|
default:
|
|
filterName = type;
|
|
}
|
|
|
|
return toStartOfCapital(filterName);
|
|
}
|
|
/**
|
|
* Check if command is silent command
|
|
* @param {Command|string} command - command or command name
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
|
|
function isSilentCommand(command) {
|
|
var LOAD_IMAGE = commandNames.LOAD_IMAGE;
|
|
return typeof command === 'string' ? LOAD_IMAGE === command : LOAD_IMAGE === command.name;
|
|
}
|
|
/**
|
|
* Get command name
|
|
* @param {Command|string} command - command or command name
|
|
* @returns {{name: string, ?detail: string}}
|
|
*/
|
|
// eslint-disable-next-line complexity, require-jsdoc
|
|
|
|
function getHistoryTitle(command) {
|
|
var _context9, _context10;
|
|
|
|
var FLIP_IMAGE = commandNames.FLIP_IMAGE,
|
|
ROTATE_IMAGE = commandNames.ROTATE_IMAGE,
|
|
ADD_TEXT = commandNames.ADD_TEXT,
|
|
APPLY_FILTER = commandNames.APPLY_FILTER,
|
|
REMOVE_FILTER = commandNames.REMOVE_FILTER,
|
|
CHANGE_SHAPE = commandNames.CHANGE_SHAPE,
|
|
CHANGE_ICON_COLOR = commandNames.CHANGE_ICON_COLOR,
|
|
CHANGE_TEXT_STYLE = commandNames.CHANGE_TEXT_STYLE,
|
|
CLEAR_OBJECTS = commandNames.CLEAR_OBJECTS,
|
|
ADD_IMAGE_OBJECT = commandNames.ADD_IMAGE_OBJECT,
|
|
REMOVE_OBJECT = commandNames.REMOVE_OBJECT,
|
|
RESIZE_IMAGE = commandNames.RESIZE_IMAGE;
|
|
var name = command.name,
|
|
args = command.args;
|
|
var historyInfo;
|
|
|
|
switch (name) {
|
|
case FLIP_IMAGE:
|
|
historyInfo = {
|
|
name: name,
|
|
detail: args[1] === 'reset' ? args[1] : slice_default()(_context9 = args[1]).call(_context9, 4)
|
|
};
|
|
break;
|
|
|
|
case ROTATE_IMAGE:
|
|
historyInfo = {
|
|
name: name,
|
|
detail: args[2]
|
|
};
|
|
break;
|
|
|
|
case APPLY_FILTER:
|
|
historyInfo = {
|
|
name: historyNames.APPLY_FILTER,
|
|
detail: getFilterType(args[1], args[2])
|
|
};
|
|
break;
|
|
|
|
case REMOVE_FILTER:
|
|
historyInfo = {
|
|
name: historyNames.REMOVE_FILTER,
|
|
detail: 'Remove'
|
|
};
|
|
break;
|
|
|
|
case CHANGE_SHAPE:
|
|
historyInfo = {
|
|
name: historyNames.CHANGE_SHAPE,
|
|
detail: 'Change'
|
|
};
|
|
break;
|
|
|
|
case CHANGE_ICON_COLOR:
|
|
historyInfo = {
|
|
name: historyNames.CHANGE_ICON_COLOR,
|
|
detail: 'Change'
|
|
};
|
|
break;
|
|
|
|
case CHANGE_TEXT_STYLE:
|
|
historyInfo = {
|
|
name: historyNames.CHANGE_TEXT_STYLE,
|
|
detail: 'Change'
|
|
};
|
|
break;
|
|
|
|
case REMOVE_OBJECT:
|
|
historyInfo = {
|
|
name: historyNames.REMOVE_OBJECT,
|
|
detail: args[2]
|
|
};
|
|
break;
|
|
|
|
case CLEAR_OBJECTS:
|
|
historyInfo = {
|
|
name: historyNames.CLEAR_OBJECTS,
|
|
detail: 'All'
|
|
};
|
|
break;
|
|
|
|
case ADD_IMAGE_OBJECT:
|
|
historyInfo = {
|
|
name: historyNames.ADD_IMAGE_OBJECT,
|
|
detail: 'Add'
|
|
};
|
|
break;
|
|
|
|
case ADD_TEXT:
|
|
historyInfo = {
|
|
name: historyNames.ADD_TEXT
|
|
};
|
|
break;
|
|
|
|
case RESIZE_IMAGE:
|
|
historyInfo = {
|
|
name: historyNames.RESIZE,
|
|
detail: concat_default()(_context10 = "".concat(~~args[1].width, "x")).call(_context10, ~~args[1].height)
|
|
};
|
|
break;
|
|
|
|
default:
|
|
historyInfo = {
|
|
name: name
|
|
};
|
|
break;
|
|
}
|
|
|
|
if (args[1] === 'mask') {
|
|
historyInfo = {
|
|
name: historyNames.LOAD_MASK_IMAGE,
|
|
detail: 'Apply'
|
|
};
|
|
}
|
|
|
|
return historyInfo;
|
|
}
|
|
/**
|
|
* Get help menubar position(opposite of menubar)
|
|
* @param {string} position - position of menubar
|
|
* @returns {string} position of help menubar
|
|
*/
|
|
|
|
function getHelpMenuBarPosition(position) {
|
|
if (position === 'top') {
|
|
return 'bottom';
|
|
}
|
|
|
|
if (position === 'left') {
|
|
return 'right';
|
|
}
|
|
|
|
if (position === 'right') {
|
|
return 'left';
|
|
}
|
|
|
|
return 'top';
|
|
}
|
|
/**
|
|
* Change to capital start letter
|
|
* @param {string} str - string to change
|
|
* @returns {string}
|
|
*/
|
|
|
|
function toStartOfCapital(str) {
|
|
return str.replace(/[a-z]/, function (first) {
|
|
return first.toUpperCase();
|
|
});
|
|
}
|
|
/**
|
|
* Check if cropRect is Empty.
|
|
* @param {Object} cropRect - cropRect object
|
|
* @param {Number} cropRect.left - cropRect left position value
|
|
* @param {Number} cropRect.top - cropRect top position value
|
|
* @param {Number} cropRect.width - cropRect width value
|
|
* @param {Number} cropRect.height - cropRect height value
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
|
|
function isEmptyCropzone(cropRect) {
|
|
var left = cropRect.left,
|
|
top = cropRect.top,
|
|
width = cropRect.width,
|
|
height = cropRect.height;
|
|
var LEFT = emptyCropRectValues.LEFT,
|
|
TOP = emptyCropRectValues.TOP,
|
|
WIDTH = emptyCropRectValues.WIDTH,
|
|
HEIGHT = emptyCropRectValues.HEIGHT;
|
|
return left === LEFT && top === TOP && width === WIDTH && height === HEIGHT;
|
|
}
|
|
;// CONCATENATED MODULE: ./src/js/factory/errorMessage.js
|
|
|
|
|
|
var types = keyMirror('UN_IMPLEMENTATION', 'NO_COMPONENT_NAME');
|
|
var messages = {
|
|
UN_IMPLEMENTATION: 'Should implement a method: ',
|
|
NO_COMPONENT_NAME: 'Should set a component name'
|
|
};
|
|
var map = {
|
|
UN_IMPLEMENTATION: function UN_IMPLEMENTATION(methodName) {
|
|
return messages.UN_IMPLEMENTATION + methodName;
|
|
},
|
|
NO_COMPONENT_NAME: function NO_COMPONENT_NAME() {
|
|
return messages.NO_COMPONENT_NAME;
|
|
}
|
|
};
|
|
/* harmony default export */ var errorMessage = ({
|
|
types: extend_default()({}, types),
|
|
create: function create(type) {
|
|
type = type.toLowerCase();
|
|
var func = map[type];
|
|
|
|
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
|
args[_key - 1] = arguments[_key];
|
|
}
|
|
|
|
return func.apply(void 0, args);
|
|
}
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/interface/command.js
|
|
|
|
|
|
|
|
|
|
|
|
var createMessage = errorMessage.create;
|
|
var errorTypes = errorMessage.types;
|
|
/**
|
|
* Command class
|
|
* @class
|
|
* @param {{name:function, execute: function, undo: function,
|
|
* executeCallback: function, undoCallback: function}} actions - Command actions
|
|
* @param {Array} args - passing arguments on execute, undo
|
|
* @ignore
|
|
*/
|
|
|
|
var Command = /*#__PURE__*/function () {
|
|
function Command(actions, args) {
|
|
_classCallCheck(this, Command);
|
|
|
|
/**
|
|
* command name
|
|
* @type {string}
|
|
*/
|
|
this.name = actions.name;
|
|
/**
|
|
* arguments
|
|
* @type {Array}
|
|
*/
|
|
|
|
this.args = args;
|
|
/**
|
|
* Execute function
|
|
* @type {function}
|
|
*/
|
|
|
|
this.execute = actions.execute;
|
|
/**
|
|
* Undo function
|
|
* @type {function}
|
|
*/
|
|
|
|
this.undo = actions.undo;
|
|
/**
|
|
* executeCallback
|
|
* @type {function}
|
|
*/
|
|
|
|
this.executeCallback = actions.executeCallback || null;
|
|
/**
|
|
* undoCallback
|
|
* @type {function}
|
|
*/
|
|
|
|
this.undoCallback = actions.undoCallback || null;
|
|
/**
|
|
* data for undo
|
|
* @type {Object}
|
|
*/
|
|
|
|
this.undoData = {};
|
|
}
|
|
/**
|
|
* Execute action
|
|
* @param {Object.<string, Component>} compMap - Components injection
|
|
* @abstract
|
|
*/
|
|
|
|
|
|
_createClass(Command, [{
|
|
key: "execute",
|
|
value: function execute() {
|
|
throw new Error(createMessage(errorTypes.UN_IMPLEMENTATION, 'execute'));
|
|
}
|
|
/**
|
|
* Undo action
|
|
* @param {Object.<string, Component>} compMap - Components injection
|
|
* @abstract
|
|
*/
|
|
|
|
}, {
|
|
key: "undo",
|
|
value: function undo() {
|
|
throw new Error(createMessage(errorTypes.UN_IMPLEMENTATION, 'undo'));
|
|
}
|
|
/**
|
|
* command for redo if undoData exists
|
|
* @returns {boolean} isRedo
|
|
*/
|
|
|
|
}, {
|
|
key: "isRedo",
|
|
get: function get() {
|
|
return keys_default()(this.undoData).length > 0;
|
|
}
|
|
/**
|
|
* Set undoData action
|
|
* @param {Object} undoData - maked undo data
|
|
* @param {Object} cachedUndoDataForSilent - cached undo data
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Object} cachedUndoDataForSilent
|
|
*/
|
|
|
|
}, {
|
|
key: "setUndoData",
|
|
value: function setUndoData(undoData, cachedUndoDataForSilent, isSilent) {
|
|
if (cachedUndoDataForSilent) {
|
|
undoData = cachedUndoDataForSilent;
|
|
}
|
|
|
|
if (!isSilent) {
|
|
extend_default()(this.undoData, undoData);
|
|
cachedUndoDataForSilent = null;
|
|
} else if (!cachedUndoDataForSilent) {
|
|
cachedUndoDataForSilent = undoData;
|
|
}
|
|
|
|
return cachedUndoDataForSilent;
|
|
}
|
|
/**
|
|
* Attach execute callabck
|
|
* @param {function} callback - Callback after execution
|
|
* @returns {Command} this
|
|
*/
|
|
|
|
}, {
|
|
key: "setExecuteCallback",
|
|
value: function setExecuteCallback(callback) {
|
|
this.executeCallback = callback;
|
|
return this;
|
|
}
|
|
/**
|
|
* Attach undo callback
|
|
* @param {function} callback - Callback after undo
|
|
* @returns {Command} this
|
|
*/
|
|
|
|
}, {
|
|
key: "setUndoCallback",
|
|
value: function setUndoCallback(callback) {
|
|
this.undoCallback = callback;
|
|
return this;
|
|
}
|
|
}]);
|
|
|
|
return Command;
|
|
}();
|
|
|
|
/* harmony default export */ var command = (Command);
|
|
;// CONCATENATED MODULE: ./src/js/factory/command.js
|
|
|
|
var commands = {};
|
|
/**
|
|
* Create a command
|
|
* @param {string} name - Command name
|
|
* @param {...*} args - Arguments for creating command
|
|
* @returns {Command}
|
|
* @ignore
|
|
*/
|
|
|
|
function command_create(name) {
|
|
var actions = commands[name];
|
|
|
|
if (actions) {
|
|
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
|
args[_key - 1] = arguments[_key];
|
|
}
|
|
|
|
return new command(actions, args);
|
|
}
|
|
|
|
return null;
|
|
}
|
|
/**
|
|
* Register a command with name as a key
|
|
* @param {Object} command - {name:{string}, execute: {function}, undo: {function}}
|
|
* @param {string} command.name - command name
|
|
* @param {function} command.execute - executable function
|
|
* @param {function} command.undo - undo function
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
function register(command) {
|
|
commands[command.name] = command;
|
|
}
|
|
|
|
/* harmony default export */ var factory_command = ({
|
|
create: command_create,
|
|
register: register
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/invoker.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Invoker
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Invoker = /*#__PURE__*/function () {
|
|
function Invoker() {
|
|
_classCallCheck(this, Invoker);
|
|
|
|
/**
|
|
* Undo stack
|
|
* @type {Array.<Command>}
|
|
* @private
|
|
*/
|
|
this._undoStack = [];
|
|
/**
|
|
* Redo stack
|
|
* @type {Array.<Command>}
|
|
* @private
|
|
*/
|
|
|
|
this._redoStack = [];
|
|
/**
|
|
* Lock-flag for executing command
|
|
* @type {boolean}
|
|
* @private
|
|
*/
|
|
|
|
this._isLocked = false;
|
|
this._isSilent = false;
|
|
}
|
|
/**
|
|
* Invoke command execution
|
|
* @param {Command} command - Command
|
|
* @param {boolean} [isRedo=false] - check if command is redo
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
|
|
_createClass(Invoker, [{
|
|
key: "_invokeExecution",
|
|
value: function _invokeExecution(command) {
|
|
var _this = this;
|
|
|
|
var isRedo = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
|
|
this.lock();
|
|
var args = command.args;
|
|
|
|
if (!args) {
|
|
args = [];
|
|
}
|
|
|
|
return command.execute.apply(command, _toConsumableArray(args)).then(function (value) {
|
|
if (!_this._isSilent) {
|
|
_this.pushUndoStack(command);
|
|
|
|
_this.fire(isRedo ? eventNames.AFTER_REDO : eventNames.EXECUTE_COMMAND, command);
|
|
}
|
|
|
|
_this.unlock();
|
|
|
|
if (isFunction(command.executeCallback)) {
|
|
command.executeCallback(value);
|
|
}
|
|
|
|
return value;
|
|
})['catch'](function (message) {
|
|
_this.unlock();
|
|
|
|
return promise_default().reject(message);
|
|
});
|
|
}
|
|
/**
|
|
* Invoke command undo
|
|
* @param {Command} command - Command
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_invokeUndo",
|
|
value: function _invokeUndo(command) {
|
|
var _this2 = this;
|
|
|
|
this.lock();
|
|
var args = command.args;
|
|
|
|
if (!args) {
|
|
args = [];
|
|
}
|
|
|
|
return command.undo.apply(command, _toConsumableArray(args)).then(function (value) {
|
|
_this2.pushRedoStack(command);
|
|
|
|
_this2.fire(eventNames.AFTER_UNDO, command);
|
|
|
|
_this2.unlock();
|
|
|
|
if (isFunction(command.undoCallback)) {
|
|
command.undoCallback(value);
|
|
}
|
|
|
|
return value;
|
|
})['catch'](function (message) {
|
|
_this2.unlock();
|
|
|
|
return promise_default().reject(message);
|
|
});
|
|
}
|
|
/**
|
|
* fire REDO_STACK_CHANGED event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_fireRedoStackChanged",
|
|
value: function _fireRedoStackChanged() {
|
|
this.fire(eventNames.REDO_STACK_CHANGED, this._redoStack.length);
|
|
}
|
|
/**
|
|
* fire UNDO_STACK_CHANGED event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_fireUndoStackChanged",
|
|
value: function _fireUndoStackChanged() {
|
|
this.fire(eventNames.UNDO_STACK_CHANGED, this._undoStack.length);
|
|
}
|
|
/**
|
|
* Lock this invoker
|
|
*/
|
|
|
|
}, {
|
|
key: "lock",
|
|
value: function lock() {
|
|
this._isLocked = true;
|
|
}
|
|
/**
|
|
* Unlock this invoker
|
|
*/
|
|
|
|
}, {
|
|
key: "unlock",
|
|
value: function unlock() {
|
|
this._isLocked = false;
|
|
}
|
|
}, {
|
|
key: "executeSilent",
|
|
value: function executeSilent() {
|
|
var _this3 = this;
|
|
|
|
this._isSilent = true;
|
|
|
|
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
|
|
args[_key] = arguments[_key];
|
|
}
|
|
|
|
return this.execute.apply(this, concat_default()(args).call(args, [this._isSilent])).then(function () {
|
|
_this3._isSilent = false;
|
|
});
|
|
}
|
|
/**
|
|
* Invoke command
|
|
* Store the command to the undoStack
|
|
* Clear the redoStack
|
|
* @param {String} commandName - Command name
|
|
* @param {...*} args - Arguments for creating command
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "execute",
|
|
value: function execute() {
|
|
var _this4 = this;
|
|
|
|
if (this._isLocked) {
|
|
return promise_default().reject(rejectMessages.isLock);
|
|
}
|
|
|
|
for (var _len2 = arguments.length, args = new Array(_len2), _key2 = 0; _key2 < _len2; _key2++) {
|
|
args[_key2] = arguments[_key2];
|
|
}
|
|
|
|
var command = args[0];
|
|
|
|
if (isString_default()(command)) {
|
|
command = factory_command.create.apply(factory_command, args);
|
|
}
|
|
|
|
return this._invokeExecution(command).then(function (value) {
|
|
_this4.clearRedoStack();
|
|
|
|
return value;
|
|
});
|
|
}
|
|
/**
|
|
* Undo command
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "undo",
|
|
value: function undo() {
|
|
var command = this._undoStack.pop();
|
|
|
|
var promise;
|
|
var message = '';
|
|
|
|
if (command && this._isLocked) {
|
|
this.pushUndoStack(command, true);
|
|
command = null;
|
|
}
|
|
|
|
if (command) {
|
|
if (this.isEmptyUndoStack()) {
|
|
this._fireUndoStackChanged();
|
|
}
|
|
|
|
promise = this._invokeUndo(command);
|
|
} else {
|
|
message = rejectMessages.undo;
|
|
|
|
if (this._isLocked) {
|
|
var _context;
|
|
|
|
message = concat_default()(_context = "".concat(message, " Because ")).call(_context, rejectMessages.isLock);
|
|
}
|
|
|
|
promise = promise_default().reject(message);
|
|
}
|
|
|
|
return promise;
|
|
}
|
|
/**
|
|
* Redo command
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "redo",
|
|
value: function redo() {
|
|
var command = this._redoStack.pop();
|
|
|
|
var promise;
|
|
var message = '';
|
|
|
|
if (command && this._isLocked) {
|
|
this.pushRedoStack(command, true);
|
|
command = null;
|
|
}
|
|
|
|
if (command) {
|
|
if (this.isEmptyRedoStack()) {
|
|
this._fireRedoStackChanged();
|
|
}
|
|
|
|
promise = this._invokeExecution(command, true);
|
|
} else {
|
|
message = rejectMessages.redo;
|
|
|
|
if (this._isLocked) {
|
|
var _context2;
|
|
|
|
message = concat_default()(_context2 = "".concat(message, " Because ")).call(_context2, rejectMessages.isLock);
|
|
}
|
|
|
|
promise = promise_default().reject(message);
|
|
}
|
|
|
|
return promise;
|
|
}
|
|
/**
|
|
* Push undo stack
|
|
* @param {Command} command - command
|
|
* @param {boolean} [isSilent] - Fire event or not
|
|
*/
|
|
|
|
}, {
|
|
key: "pushUndoStack",
|
|
value: function pushUndoStack(command, isSilent) {
|
|
this._undoStack.push(command);
|
|
|
|
if (!isSilent) {
|
|
this._fireUndoStackChanged();
|
|
}
|
|
}
|
|
/**
|
|
* Push redo stack
|
|
* @param {Command} command - command
|
|
* @param {boolean} [isSilent] - Fire event or not
|
|
*/
|
|
|
|
}, {
|
|
key: "pushRedoStack",
|
|
value: function pushRedoStack(command, isSilent) {
|
|
this._redoStack.push(command);
|
|
|
|
if (!isSilent) {
|
|
this._fireRedoStackChanged();
|
|
}
|
|
}
|
|
/**
|
|
* Return whether the redoStack is empty
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
}, {
|
|
key: "isEmptyRedoStack",
|
|
value: function isEmptyRedoStack() {
|
|
return this._redoStack.length === 0;
|
|
}
|
|
/**
|
|
* Return whether the undoStack is empty
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
}, {
|
|
key: "isEmptyUndoStack",
|
|
value: function isEmptyUndoStack() {
|
|
return this._undoStack.length === 0;
|
|
}
|
|
/**
|
|
* Clear undoStack
|
|
*/
|
|
|
|
}, {
|
|
key: "clearUndoStack",
|
|
value: function clearUndoStack() {
|
|
if (!this.isEmptyUndoStack()) {
|
|
this._undoStack = [];
|
|
|
|
this._fireUndoStackChanged();
|
|
}
|
|
}
|
|
/**
|
|
* Clear redoStack
|
|
*/
|
|
|
|
}, {
|
|
key: "clearRedoStack",
|
|
value: function clearRedoStack() {
|
|
if (!this.isEmptyRedoStack()) {
|
|
this._redoStack = [];
|
|
|
|
this._fireRedoStackChanged();
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Invoker;
|
|
}();
|
|
|
|
customEvents_default().mixin(Invoker);
|
|
/* harmony default export */ var invoker = (Invoker);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/parse-float.js
|
|
var parse_float = __webpack_require__(5214);
|
|
var parse_float_default = /*#__PURE__*/__webpack_require__.n(parse_float);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/mainContainer.js
|
|
|
|
/* harmony default export */ var mainContainer = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7;
|
|
|
|
var locale = _ref.locale,
|
|
biImage = _ref.biImage,
|
|
commonStyle = _ref.commonStyle,
|
|
headerStyle = _ref.headerStyle,
|
|
loadButtonStyle = _ref.loadButtonStyle,
|
|
downloadButtonStyle = _ref.downloadButtonStyle,
|
|
submenuStyle = _ref.submenuStyle;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = concat_default()(_context7 = "\n <div class=\"tui-image-editor-main-container\" style=\"".concat(commonStyle, "\">\n <div class=\"tui-image-editor-header\" style=\"")).call(_context7, headerStyle, "\">\n <div class=\"tui-image-editor-header-logo\">\n <img src=\"")).call(_context6, biImage, "\" />\n </div>\n <div class=\"tui-image-editor-header-buttons\">\n <div style=\"")).call(_context5, loadButtonStyle, "\">\n ")).call(_context4, locale.localize('Load'), "\n <input type=\"file\" class=\"tui-image-editor-load-btn\" />\n </div>\n <button class=\"tui-image-editor-download-btn\" style=\"")).call(_context3, downloadButtonStyle, "\">\n ")).call(_context2, locale.localize('Download'), "\n </button>\n </div>\n </div>\n <div class=\"tui-image-editor-main\">\n <div class=\"tui-image-editor-submenu\">\n <div class=\"tui-image-editor-submenu-style\" style=\"")).call(_context, submenuStyle, "\"></div>\n </div>\n <div class=\"tui-image-editor-wrap\">\n <div class=\"tui-image-editor-size-wrap\">\n <div class=\"tui-image-editor-align-wrap\">\n <div class=\"tui-image-editor\"></div>\n </div>\n </div>\n </div>\n </div>\n </div>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/controls.js
|
|
|
|
|
|
/* harmony default export */ var controls = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
var locale = _ref.locale,
|
|
biImage = _ref.biImage,
|
|
loadButtonStyle = _ref.loadButtonStyle,
|
|
downloadButtonStyle = _ref.downloadButtonStyle,
|
|
menuBarPosition = _ref.menuBarPosition;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = "\n <ul class=\"tui-image-editor-help-menu ".concat(getHelpMenuBarPosition(menuBarPosition), "\"></ul>\n <div class=\"tui-image-editor-controls\">\n <div class=\"tui-image-editor-controls-logo\">\n <img src=\"")).call(_context5, biImage, "\" />\n </div>\n <ul class=\"tui-image-editor-menu\"></ul>\n\n <div class=\"tui-image-editor-controls-buttons\">\n <div style=\"")).call(_context4, loadButtonStyle, "\">\n ")).call(_context3, locale.localize('Load'), "\n <input type=\"file\" class=\"tui-image-editor-load-btn\" />\n </div>\n <button class=\"tui-image-editor-download-btn\" style=\"")).call(_context2, downloadButtonStyle, "\">\n ")).call(_context, locale.localize('Download'), "\n </button>\n </div>\n </div>\n");
|
|
});
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/map.js
|
|
var instance_map = __webpack_require__(899);
|
|
var map_default = /*#__PURE__*/__webpack_require__.n(instance_map);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/style.js
|
|
|
|
/* harmony default export */ var style = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11, _context12, _context13, _context14, _context15, _context16, _context17, _context18, _context19, _context20, _context21, _context22, _context23, _context24, _context25, _context26, _context27, _context28, _context29;
|
|
|
|
var subMenuLabelActive = _ref.subMenuLabelActive,
|
|
subMenuLabelNormal = _ref.subMenuLabelNormal,
|
|
subMenuRangeTitle = _ref.subMenuRangeTitle,
|
|
submenuPartitionVertical = _ref.submenuPartitionVertical,
|
|
submenuPartitionHorizontal = _ref.submenuPartitionHorizontal,
|
|
submenuCheckbox = _ref.submenuCheckbox,
|
|
submenuRangePointer = _ref.submenuRangePointer,
|
|
submenuRangeValue = _ref.submenuRangeValue,
|
|
submenuColorpickerTitle = _ref.submenuColorpickerTitle,
|
|
submenuColorpickerButton = _ref.submenuColorpickerButton,
|
|
submenuRangeBar = _ref.submenuRangeBar,
|
|
submenuRangeSubbar = _ref.submenuRangeSubbar,
|
|
submenuDisabledRangePointer = _ref.submenuDisabledRangePointer,
|
|
submenuDisabledRangeBar = _ref.submenuDisabledRangeBar,
|
|
submenuDisabledRangeSubbar = _ref.submenuDisabledRangeSubbar,
|
|
submenuIconSize = _ref.submenuIconSize,
|
|
menuIconSize = _ref.menuIconSize,
|
|
biSize = _ref.biSize,
|
|
menuIconStyle = _ref.menuIconStyle,
|
|
submenuIconStyle = _ref.submenuIconStyle;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = concat_default()(_context7 = concat_default()(_context8 = concat_default()(_context9 = concat_default()(_context10 = concat_default()(_context11 = concat_default()(_context12 = concat_default()(_context13 = concat_default()(_context14 = concat_default()(_context15 = concat_default()(_context16 = concat_default()(_context17 = concat_default()(_context18 = concat_default()(_context19 = concat_default()(_context20 = concat_default()(_context21 = concat_default()(_context22 = concat_default()(_context23 = concat_default()(_context24 = concat_default()(_context25 = concat_default()(_context26 = concat_default()(_context27 = concat_default()(_context28 = concat_default()(_context29 = "\n .tie-icon-add-button.icon-bubble .tui-image-editor-button[data-icontype=\"icon-bubble\"] label,\n .tie-icon-add-button.icon-heart .tui-image-editor-button[data-icontype=\"icon-heart\"] label,\n .tie-icon-add-button.icon-location .tui-image-editor-button[data-icontype=\"icon-location\"] label,\n .tie-icon-add-button.icon-polygon .tui-image-editor-button[data-icontype=\"icon-polygon\"] label,\n .tie-icon-add-button.icon-star .tui-image-editor-button[data-icontype=\"icon-star\"] label,\n .tie-icon-add-button.icon-star-2 .tui-image-editor-button[data-icontype=\"icon-star-2\"] label,\n .tie-icon-add-button.icon-arrow-3 .tui-image-editor-button[data-icontype=\"icon-arrow-3\"] label,\n .tie-icon-add-button.icon-arrow-2 .tui-image-editor-button[data-icontype=\"icon-arrow-2\"] label,\n .tie-icon-add-button.icon-arrow .tui-image-editor-button[data-icontype=\"icon-arrow\"] label,\n .tie-icon-add-button.icon-bubble .tui-image-editor-button[data-icontype=\"icon-bubble\"] label,\n .tie-draw-line-select-button.line .tui-image-editor-button.line label,\n .tie-draw-line-select-button.free .tui-image-editor-button.free label,\n .tie-flip-button.flipX .tui-image-editor-button.flipX label,\n .tie-flip-button.flipY .tui-image-editor-button.flipY label,\n .tie-flip-button.resetFlip .tui-image-editor-button.resetFlip label,\n .tie-crop-button .tui-image-editor-button.apply.active label,\n .tie-crop-preset-button .tui-image-editor-button.preset.active label,\n .tie-resize-button .tui-image-editor-button.apply.active label,\n .tie-resize-preset-button .tui-image-editor-button.preset.active label,\n .tie-shape-button.rect .tui-image-editor-button.rect label,\n .tie-shape-button.circle .tui-image-editor-button.circle label,\n .tie-shape-button.triangle .tui-image-editor-button.triangle label,\n .tie-text-effect-button .tui-image-editor-button.active label,\n .tie-text-align-button.tie-text-align-left .tui-image-editor-button.left label,\n .tie-text-align-button.tie-text-align-center .tui-image-editor-button.center label,\n .tie-text-align-button.tie-text-align-right .tui-image-editor-button.right label,\n .tie-mask-apply.apply.active .tui-image-editor-button.apply label,\n .tui-image-editor-container .tui-image-editor-submenu .tui-image-editor-button:hover > label,\n .tui-image-editor-container .tui-image-editor-checkbox label > span {\n ".concat(subMenuLabelActive, "\n }\n .tui-image-editor-container .tui-image-editor-submenu .tui-image-editor-button > label,\n .tui-image-editor-container .tui-image-editor-range-wrap.tui-image-editor-newline.short label,\n .tui-image-editor-container .tui-image-editor-range-wrap.tui-image-editor-newline.short label > span {\n ")).call(_context29, subMenuLabelNormal, "\n }\n .tui-image-editor-container .tui-image-editor-range-wrap label > span {\n ")).call(_context28, subMenuRangeTitle, "\n }\n .tui-image-editor-container .tui-image-editor-partition > div {\n ")).call(_context27, submenuPartitionVertical, "\n }\n .tui-image-editor-container.left .tui-image-editor-submenu .tui-image-editor-partition > div,\n .tui-image-editor-container.right .tui-image-editor-submenu .tui-image-editor-partition > div {\n ")).call(_context26, submenuPartitionHorizontal, "\n }\n .tui-image-editor-container .tui-image-editor-checkbox label > span:before {\n ")).call(_context25, submenuCheckbox, "\n }\n .tui-image-editor-container .tui-image-editor-checkbox label > input:checked + span:before {\n border: 0;\n }\n .tui-image-editor-container .tui-image-editor-virtual-range-pointer {\n ")).call(_context24, submenuRangePointer, "\n }\n .tui-image-editor-container .tui-image-editor-virtual-range-bar {\n ")).call(_context23, submenuRangeBar, "\n }\n .tui-image-editor-container .tui-image-editor-virtual-range-subbar {\n ")).call(_context22, submenuRangeSubbar, "\n }\n .tui-image-editor-container .tui-image-editor-disabled .tui-image-editor-virtual-range-pointer {\n ")).call(_context21, submenuDisabledRangePointer, "\n }\n .tui-image-editor-container .tui-image-editor-disabled .tui-image-editor-virtual-range-subbar {\n ")).call(_context20, submenuDisabledRangeSubbar, "\n }\n .tui-image-editor-container .tui-image-editor-disabled .tui-image-editor-virtual-range-bar {\n ")).call(_context19, submenuDisabledRangeBar, "\n }\n .tui-image-editor-container .tui-image-editor-range-value {\n ")).call(_context18, submenuRangeValue, "\n }\n .tui-image-editor-container .tui-image-editor-submenu .tui-image-editor-button .color-picker-value + label {\n ")).call(_context17, submenuColorpickerTitle, "\n }\n .tui-image-editor-container .tui-image-editor-submenu .tui-image-editor-button .color-picker-value {\n ")).call(_context16, submenuColorpickerButton, "\n }\n .tui-image-editor-container .svg_ic-menu {\n ")).call(_context15, menuIconSize, "\n }\n .tui-image-editor-container .svg_ic-submenu {\n ")).call(_context14, submenuIconSize, "\n }\n .tui-image-editor-container .tui-image-editor-controls-logo > img,\n .tui-image-editor-container .tui-image-editor-header-logo > img {\n ")).call(_context13, biSize, "\n }\n .tui-image-editor-menu use.normal.use-default,\n .tui-image-editor-help-menu use.normal.use-default {\n fill-rule: evenodd;\n fill: ")).call(_context12, menuIconStyle.normal.color, ";\n stroke: ")).call(_context11, menuIconStyle.normal.color, ";\n }\n .tui-image-editor-menu use.active.use-default,\n .tui-image-editor-help-menu use.active.use-default {\n fill-rule: evenodd;\n fill: ")).call(_context10, menuIconStyle.active.color, ";\n stroke: ")).call(_context9, menuIconStyle.active.color, ";\n }\n .tui-image-editor-menu use.hover.use-default,\n .tui-image-editor-help-menu use.hover.use-default {\n fill-rule: evenodd;\n fill: ")).call(_context8, menuIconStyle.hover.color, ";\n stroke: ")).call(_context7, menuIconStyle.hover.color, ";\n }\n .tui-image-editor-menu use.disabled.use-default,\n .tui-image-editor-help-menu use.disabled.use-default {\n fill-rule: evenodd;\n fill: ")).call(_context6, menuIconStyle.disabled.color, ";\n stroke: ")).call(_context5, menuIconStyle.disabled.color, ";\n }\n .tui-image-editor-submenu use.normal.use-default {\n fill-rule: evenodd;\n fill: ")).call(_context4, submenuIconStyle.normal.color, ";\n stroke: ")).call(_context3, submenuIconStyle.normal.color, ";\n }\n .tui-image-editor-submenu use.active.use-default {\n fill-rule: evenodd;\n fill: ")).call(_context2, submenuIconStyle.active.color, ";\n stroke: ")).call(_context, submenuIconStyle.active.color, ";\n }\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/theme/standard.js
|
|
/**
|
|
* Full configuration for theme.<br>
|
|
* @typedef {object} themeConfig
|
|
* @property {string} common.bi.image - Brand icon image
|
|
* @property {string} common.bisize.width - Icon image width
|
|
* @property {string} common.bisize.height - Icon Image Height
|
|
* @property {string} common.backgroundImage - Background image
|
|
* @property {string} common.backgroundColor - Background color
|
|
* @property {string} common.border - Full area border style
|
|
* @property {string} header.backgroundImage - header area background
|
|
* @property {string} header.backgroundColor - header area background color
|
|
* @property {string} header.border - header area border style
|
|
* @property {string} loadButton.backgroundColor - load button background color
|
|
* @property {string} loadButton.border - load button border style
|
|
* @property {string} loadButton.color - load button foreground color
|
|
* @property {string} loadButton.fontFamily - load button font type
|
|
* @property {string} loadButton.fontSize - load button font size
|
|
* @property {string} downloadButton.backgroundColor - download button background color
|
|
* @property {string} downloadButton.border - download button border style
|
|
* @property {string} downloadButton.color - download button foreground color
|
|
* @property {string} downloadButton.fontFamily - download button font type
|
|
* @property {string} downloadButton.fontSize - download button font size
|
|
* @property {string} menu.normalIcon.color - Menu normal color for default icon
|
|
* @property {string} menu.normalIcon.path - Menu normal icon svg bundle file path
|
|
* @property {string} menu.normalIcon.name - Menu normal icon svg bundle name
|
|
* @property {string} menu.activeIcon.color - Menu active color for default icon
|
|
* @property {string} menu.activeIcon.path - Menu active icon svg bundle file path
|
|
* @property {string} menu.activeIcon.name - Menu active icon svg bundle name
|
|
* @property {string} menu.disabled.color - Menu disabled color for default icon
|
|
* @property {string} menu.disabled.path - Menu disabled icon svg bundle file path
|
|
* @property {string} menu.disabled.name - Menu disabled icon svg bundle name
|
|
* @property {string} menu.hover.color - Menu default icon hover color
|
|
* @property {string} menu.hover.path - Menu hover icon svg bundle file path
|
|
* @property {string} menu.hover.name - Menu hover icon svg bundle name
|
|
* @property {string} menu.iconSize.width - Menu icon Size Width
|
|
* @property {string} menu.iconSize.height - Menu Icon Size Height
|
|
* @property {string} submenu.backgroundColor - Sub-menu area background color
|
|
* @property {string} submenu.partition.color - Submenu partition line color
|
|
* @property {string} submenu.normalIcon.color - Submenu normal color for default icon
|
|
* @property {string} submenu.normalIcon.path - Submenu default icon svg bundle file path
|
|
* @property {string} submenu.normalIcon.name - Submenu default icon svg bundle name
|
|
* @property {string} submenu.activeIcon.color - Submenu active color for default icon
|
|
* @property {string} submenu.activeIcon.path - Submenu active icon svg bundle file path
|
|
* @property {string} submenu.activeIcon.name - Submenu active icon svg bundle name
|
|
* @property {string} submenu.iconSize.width - Submenu icon Size Width
|
|
* @property {string} submenu.iconSize.height - Submenu Icon Size Height
|
|
* @property {string} submenu.normalLabel.color - Submenu default label color
|
|
* @property {string} submenu.normalLabel.fontWeight - Sub Menu Default Label Font Thickness
|
|
* @property {string} submenu.activeLabel.color - Submenu active label color
|
|
* @property {string} submenu.activeLabel.fontWeight - Submenu active label Font thickness
|
|
* @property {string} checkbox.border - Checkbox border style
|
|
* @property {string} checkbox.backgroundColor - Checkbox background color
|
|
* @property {string} range.pointer.color - range control pointer color
|
|
* @property {string} range.bar.color - range control bar color
|
|
* @property {string} range.subbar.color - range control subbar color
|
|
* @property {string} range.value.color - range number box font color
|
|
* @property {string} range.value.fontWeight - range number box font thickness
|
|
* @property {string} range.value.fontSize - range number box font size
|
|
* @property {string} range.value.border - range number box border style
|
|
* @property {string} range.value.backgroundColor - range number box background color
|
|
* @property {string} range.title.color - range title font color
|
|
* @property {string} range.title.fontWeight - range title font weight
|
|
* @property {string} colorpicker.button.border - colorpicker button border style
|
|
* @property {string} colorpicker.title.color - colorpicker button title font color
|
|
* @example
|
|
// default keys and styles
|
|
var customTheme = {
|
|
'common.bi.image': 'https://uicdn.toast.com/toastui/img/tui-image-editor-bi.png',
|
|
'common.bisize.width': '251px',
|
|
'common.bisize.height': '21px',
|
|
'common.backgroundImage': 'none',
|
|
'common.backgroundColor': '#1e1e1e',
|
|
'common.border': '0px',
|
|
|
|
// header
|
|
'header.backgroundImage': 'none',
|
|
'header.backgroundColor': 'transparent',
|
|
'header.border': '0px',
|
|
|
|
// load button
|
|
'loadButton.backgroundColor': '#fff',
|
|
'loadButton.border': '1px solid #ddd',
|
|
'loadButton.color': '#222',
|
|
'loadButton.fontFamily': 'NotoSans, sans-serif',
|
|
'loadButton.fontSize': '12px',
|
|
|
|
// download button
|
|
'downloadButton.backgroundColor': '#fdba3b',
|
|
'downloadButton.border': '1px solid #fdba3b',
|
|
'downloadButton.color': '#fff',
|
|
'downloadButton.fontFamily': 'NotoSans, sans-serif',
|
|
'downloadButton.fontSize': '12px',
|
|
|
|
// icons default
|
|
'menu.normalIcon.color': '#8a8a8a',
|
|
'menu.activeIcon.color': '#555555',
|
|
'menu.disabledIcon.color': '#434343',
|
|
'menu.hoverIcon.color': '#e9e9e9',
|
|
'submenu.normalIcon.color': '#8a8a8a',
|
|
'submenu.activeIcon.color': '#e9e9e9',
|
|
|
|
'menu.iconSize.width': '24px',
|
|
'menu.iconSize.height': '24px',
|
|
'submenu.iconSize.width': '32px',
|
|
'submenu.iconSize.height': '32px',
|
|
|
|
// submenu primary color
|
|
'submenu.backgroundColor': '#1e1e1e',
|
|
'submenu.partition.color': '#858585',
|
|
|
|
// submenu labels
|
|
'submenu.normalLabel.color': '#858585',
|
|
'submenu.normalLabel.fontWeight': 'lighter',
|
|
'submenu.activeLabel.color': '#fff',
|
|
'submenu.activeLabel.fontWeight': 'lighter',
|
|
|
|
// checkbox style
|
|
'checkbox.border': '1px solid #ccc',
|
|
'checkbox.backgroundColor': '#fff',
|
|
|
|
// rango style
|
|
'range.pointer.color': '#fff',
|
|
'range.bar.color': '#666',
|
|
'range.subbar.color': '#d1d1d1',
|
|
|
|
'range.disabledPointer.color': '#414141',
|
|
'range.disabledBar.color': '#282828',
|
|
'range.disabledSubbar.color': '#414141',
|
|
|
|
'range.value.color': '#fff',
|
|
'range.value.fontWeight': 'lighter',
|
|
'range.value.fontSize': '11px',
|
|
'range.value.border': '1px solid #353535',
|
|
'range.value.backgroundColor': '#151515',
|
|
'range.title.color': '#fff',
|
|
'range.title.fontWeight': 'lighter',
|
|
|
|
// colorpicker style
|
|
'colorpicker.button.border': '1px solid #1e1e1e',
|
|
'colorpicker.title.color': '#fff'
|
|
};
|
|
*/
|
|
/* harmony default export */ var standard = ({
|
|
'common.bi.image': 'https://uicdn.toast.com/toastui/img/tui-image-editor-bi.png',
|
|
'common.bisize.width': '251px',
|
|
'common.bisize.height': '21px',
|
|
'common.backgroundImage': 'none',
|
|
'common.backgroundColor': '#1e1e1e',
|
|
'common.border': '0px',
|
|
// header
|
|
'header.backgroundImage': 'none',
|
|
'header.backgroundColor': 'transparent',
|
|
'header.border': '0px',
|
|
// load button
|
|
'loadButton.backgroundColor': '#fff',
|
|
'loadButton.border': '1px solid #ddd',
|
|
'loadButton.color': '#222',
|
|
'loadButton.fontFamily': "'Noto Sans', sans-serif",
|
|
'loadButton.fontSize': '12px',
|
|
// download button
|
|
'downloadButton.backgroundColor': '#fdba3b',
|
|
'downloadButton.border': '1px solid #fdba3b',
|
|
'downloadButton.color': '#fff',
|
|
'downloadButton.fontFamily': "'Noto Sans', sans-serif",
|
|
'downloadButton.fontSize': '12px',
|
|
// main icons
|
|
'menu.normalIcon.color': '#8a8a8a',
|
|
'menu.activeIcon.color': '#555555',
|
|
'menu.disabledIcon.color': '#434343',
|
|
'menu.hoverIcon.color': '#e9e9e9',
|
|
// submenu icons
|
|
'submenu.normalIcon.color': '#8a8a8a',
|
|
'submenu.activeIcon.color': '#e9e9e9',
|
|
'menu.iconSize.width': '24px',
|
|
'menu.iconSize.height': '24px',
|
|
'submenu.iconSize.width': '32px',
|
|
'submenu.iconSize.height': '32px',
|
|
// submenu primary color
|
|
'submenu.backgroundColor': '#1e1e1e',
|
|
'submenu.partition.color': '#3c3c3c',
|
|
// submenu labels
|
|
'submenu.normalLabel.color': '#8a8a8a',
|
|
'submenu.normalLabel.fontWeight': 'lighter',
|
|
'submenu.activeLabel.color': '#fff',
|
|
'submenu.activeLabel.fontWeight': 'lighter',
|
|
// checkbox style
|
|
'checkbox.border': '0px',
|
|
'checkbox.backgroundColor': '#fff',
|
|
// range style
|
|
'range.pointer.color': '#fff',
|
|
'range.bar.color': '#666',
|
|
'range.subbar.color': '#d1d1d1',
|
|
'range.disabledPointer.color': '#414141',
|
|
'range.disabledBar.color': '#282828',
|
|
'range.disabledSubbar.color': '#414141',
|
|
'range.value.color': '#fff',
|
|
'range.value.fontWeight': 'lighter',
|
|
'range.value.fontSize': '11px',
|
|
'range.value.border': '1px solid #353535',
|
|
'range.value.backgroundColor': '#151515',
|
|
'range.title.color': '#fff',
|
|
'range.title.fontWeight': 'lighter',
|
|
// colorpicker style
|
|
'colorpicker.button.border': '1px solid #1e1e1e',
|
|
'colorpicker.title.color': '#fff'
|
|
});
|
|
// EXTERNAL MODULE: ./src/svg/default.svg
|
|
var svg_default = __webpack_require__(2534);
|
|
;// CONCATENATED MODULE: ./src/js/ui/theme/theme.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Theme manager
|
|
* @class
|
|
* @param {Object} customTheme - custom theme
|
|
* @ignore
|
|
*/
|
|
|
|
var Theme = /*#__PURE__*/function () {
|
|
function Theme(customTheme) {
|
|
_classCallCheck(this, Theme);
|
|
|
|
this.styles = this._changeToObject(extend_default()({}, standard, customTheme));
|
|
styleLoad(this._styleMaker());
|
|
|
|
this._loadDefaultSvgIcon();
|
|
}
|
|
/**
|
|
* Get a Style cssText or StyleObject
|
|
* @param {string} type - style type
|
|
* @returns {string|object} - cssText or StyleObject
|
|
*/
|
|
// eslint-disable-next-line complexity
|
|
|
|
|
|
_createClass(Theme, [{
|
|
key: "getStyle",
|
|
value: function getStyle(type) {
|
|
var result = null;
|
|
var firstProperty = type.replace(/\..+$/, '');
|
|
var option = this.styles[type];
|
|
|
|
switch (type) {
|
|
case 'common.bi':
|
|
result = this.styles[type].image;
|
|
break;
|
|
|
|
case 'menu.icon':
|
|
result = {
|
|
active: this.styles["".concat(firstProperty, ".activeIcon")],
|
|
normal: this.styles["".concat(firstProperty, ".normalIcon")],
|
|
hover: this.styles["".concat(firstProperty, ".hoverIcon")],
|
|
disabled: this.styles["".concat(firstProperty, ".disabledIcon")]
|
|
};
|
|
break;
|
|
|
|
case 'submenu.icon':
|
|
result = {
|
|
active: this.styles["".concat(firstProperty, ".activeIcon")],
|
|
normal: this.styles["".concat(firstProperty, ".normalIcon")]
|
|
};
|
|
break;
|
|
|
|
case 'submenu.label':
|
|
result = {
|
|
active: this._makeCssText(this.styles["".concat(firstProperty, ".activeLabel")]),
|
|
normal: this._makeCssText(this.styles["".concat(firstProperty, ".normalLabel")])
|
|
};
|
|
break;
|
|
|
|
case 'submenu.partition':
|
|
result = {
|
|
vertical: this._makeCssText(extend_default()({}, option, {
|
|
borderLeft: "1px solid ".concat(option.color)
|
|
})),
|
|
horizontal: this._makeCssText(extend_default()({}, option, {
|
|
borderBottom: "1px solid ".concat(option.color)
|
|
}))
|
|
};
|
|
break;
|
|
|
|
case 'range.disabledPointer':
|
|
case 'range.disabledBar':
|
|
case 'range.disabledSubbar':
|
|
case 'range.pointer':
|
|
case 'range.bar':
|
|
case 'range.subbar':
|
|
option.backgroundColor = option.color;
|
|
result = this._makeCssText(option);
|
|
break;
|
|
|
|
default:
|
|
result = this._makeCssText(option);
|
|
break;
|
|
}
|
|
|
|
return result;
|
|
}
|
|
/**
|
|
* Make css resource
|
|
* @returns {string} - serialized css text
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_styleMaker",
|
|
value: function _styleMaker() {
|
|
var submenuLabelStyle = this.getStyle('submenu.label');
|
|
var submenuPartitionStyle = this.getStyle('submenu.partition');
|
|
return style({
|
|
subMenuLabelActive: submenuLabelStyle.active,
|
|
subMenuLabelNormal: submenuLabelStyle.normal,
|
|
submenuPartitionVertical: submenuPartitionStyle.vertical,
|
|
submenuPartitionHorizontal: submenuPartitionStyle.horizontal,
|
|
biSize: this.getStyle('common.bisize'),
|
|
subMenuRangeTitle: this.getStyle('range.title'),
|
|
submenuRangePointer: this.getStyle('range.pointer'),
|
|
submenuRangeBar: this.getStyle('range.bar'),
|
|
submenuRangeSubbar: this.getStyle('range.subbar'),
|
|
submenuDisabledRangePointer: this.getStyle('range.disabledPointer'),
|
|
submenuDisabledRangeBar: this.getStyle('range.disabledBar'),
|
|
submenuDisabledRangeSubbar: this.getStyle('range.disabledSubbar'),
|
|
submenuRangeValue: this.getStyle('range.value'),
|
|
submenuColorpickerTitle: this.getStyle('colorpicker.title'),
|
|
submenuColorpickerButton: this.getStyle('colorpicker.button'),
|
|
submenuCheckbox: this.getStyle('checkbox'),
|
|
menuIconSize: this.getStyle('menu.iconSize'),
|
|
submenuIconSize: this.getStyle('submenu.iconSize'),
|
|
menuIconStyle: this.getStyle('menu.icon'),
|
|
submenuIconStyle: this.getStyle('submenu.icon')
|
|
});
|
|
}
|
|
/**
|
|
* Change to low dimensional object.
|
|
* @param {object} styleOptions - style object of user interface
|
|
* @returns {object} low level object for style apply
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeToObject",
|
|
value: function _changeToObject(styleOptions) {
|
|
var styleObject = {};
|
|
forEach_default()(styleOptions, function (value, key) {
|
|
var keyExplode = key.match(/^(.+)\.([a-z]+)$/i);
|
|
|
|
var _keyExplode = _slicedToArray(keyExplode, 3),
|
|
property = _keyExplode[1],
|
|
subProperty = _keyExplode[2];
|
|
|
|
if (!styleObject[property]) {
|
|
styleObject[property] = {};
|
|
}
|
|
|
|
styleObject[property][subProperty] = value;
|
|
});
|
|
return styleObject;
|
|
}
|
|
/**
|
|
* Style object to Csstext serialize
|
|
* @param {object} styleObject - style object
|
|
* @returns {string} - css text string
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeCssText",
|
|
value: function _makeCssText(styleObject) {
|
|
var _this = this;
|
|
|
|
var converterStack = [];
|
|
forEach_default()(styleObject, function (value, key) {
|
|
var _context, _context2;
|
|
|
|
if (index_of_default()(_context = ['backgroundImage']).call(_context, key) > -1 && value !== 'none') {
|
|
value = "url(".concat(value, ")");
|
|
}
|
|
|
|
converterStack.push(concat_default()(_context2 = "".concat(_this._toUnderScore(key), ": ")).call(_context2, value));
|
|
});
|
|
return converterStack.join(';');
|
|
}
|
|
/**
|
|
* Camel key string to Underscore string
|
|
* @param {string} targetString - change target
|
|
* @returns {string}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_toUnderScore",
|
|
value: function _toUnderScore(targetString) {
|
|
return targetString.replace(/([A-Z])/g, function ($0, $1) {
|
|
return "-".concat($1.toLowerCase());
|
|
});
|
|
}
|
|
/**
|
|
* Load default svg icon
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_loadDefaultSvgIcon",
|
|
value: function _loadDefaultSvgIcon() {
|
|
if (!document.getElementById('tui-image-editor-svg-default-icons')) {
|
|
var parser = new DOMParser();
|
|
var encodedURI = svg_default.replace(/data:image\/svg\+xml;base64,/, '');
|
|
var dom = parser.parseFromString(atob(encodedURI), 'text/xml');
|
|
document.body.appendChild(dom.documentElement);
|
|
}
|
|
}
|
|
/**
|
|
* Make className for svg icon
|
|
* @param {string} iconType - normal' or 'active' or 'hover' or 'disabled
|
|
* @param {boolean} isSubmenu - submenu icon or not.
|
|
* @returns {string}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeIconClassName",
|
|
value: function _makeIconClassName(iconType, isSubmenu) {
|
|
var iconStyleInfo = isSubmenu ? this.getStyle('submenu.icon') : this.getStyle('menu.icon');
|
|
var _iconStyleInfo$iconTy = iconStyleInfo[iconType],
|
|
path = _iconStyleInfo$iconTy.path,
|
|
name = _iconStyleInfo$iconTy.name;
|
|
return path && name ? iconType : "".concat(iconType, " use-default");
|
|
}
|
|
/**
|
|
* Make svg use link path name
|
|
* @param {string} iconType - normal' or 'active' or 'hover' or 'disabled
|
|
* @param {boolean} isSubmenu - submenu icon or not.
|
|
* @returns {string}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeSvgIconPrefix",
|
|
value: function _makeSvgIconPrefix(iconType, isSubmenu) {
|
|
var _context3;
|
|
|
|
var iconStyleInfo = isSubmenu ? this.getStyle('submenu.icon') : this.getStyle('menu.icon');
|
|
var _iconStyleInfo$iconTy2 = iconStyleInfo[iconType],
|
|
path = _iconStyleInfo$iconTy2.path,
|
|
name = _iconStyleInfo$iconTy2.name;
|
|
return path && name ? concat_default()(_context3 = "".concat(path, "#")).call(_context3, name, "-") : '#';
|
|
}
|
|
/**
|
|
* Make svg use link path name
|
|
* @param {Array.<string>} useIconTypes - normal' or 'active' or 'hover' or 'disabled
|
|
* @param {string} menuName - menu name
|
|
* @param {boolean} isSubmenu - submenu icon or not.
|
|
* @returns {string}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeSvgItem",
|
|
value: function _makeSvgItem(useIconTypes, menuName, isSubmenu) {
|
|
var _this2 = this;
|
|
|
|
return map_default()(useIconTypes).call(useIconTypes, function (iconType) {
|
|
var _context4, _context5;
|
|
|
|
var svgIconPrefix = _this2._makeSvgIconPrefix(iconType, isSubmenu);
|
|
|
|
var iconName = _this2._toUnderScore(menuName);
|
|
|
|
var svgIconClassName = _this2._makeIconClassName(iconType, isSubmenu);
|
|
|
|
return concat_default()(_context4 = concat_default()(_context5 = "<use xlink:href=\"".concat(svgIconPrefix, "ic-")).call(_context5, iconName, "\" class=\"")).call(_context4, svgIconClassName, "\"/>");
|
|
}).join('');
|
|
}
|
|
/**
|
|
* Make svg icon set
|
|
* @param {Array.<string>} useIconTypes - normal' or 'active' or 'hover' or 'disabled
|
|
* @param {string} menuName - menu name
|
|
* @param {boolean} isSubmenu - submenu icon or not.
|
|
* @returns {string}
|
|
*/
|
|
|
|
}, {
|
|
key: "makeMenSvgIconSet",
|
|
value: function makeMenSvgIconSet(useIconTypes, menuName) {
|
|
var _context6;
|
|
|
|
var isSubmenu = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false;
|
|
return concat_default()(_context6 = "<svg class=\"svg_ic-".concat(isSubmenu ? 'submenu' : 'menu', "\">")).call(_context6, this._makeSvgItem(useIconTypes, menuName, isSubmenu), "</svg>");
|
|
}
|
|
}]);
|
|
|
|
return Theme;
|
|
}();
|
|
|
|
/* harmony default export */ var theme = (Theme);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/reflect/construct.js
|
|
var construct = __webpack_require__(9146);
|
|
var construct_default = /*#__PURE__*/__webpack_require__.n(construct);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/object/create.js
|
|
var object_create = __webpack_require__(6623);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/object/set-prototype-of.js
|
|
var set_prototype_of = __webpack_require__(4230);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/setPrototypeOf.js
|
|
|
|
function _setPrototypeOf(o, p) {
|
|
_setPrototypeOf = set_prototype_of || function _setPrototypeOf(o, p) {
|
|
o.__proto__ = p;
|
|
return o;
|
|
};
|
|
|
|
return _setPrototypeOf(o, p);
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/inherits.js
|
|
|
|
|
|
function _inherits(subClass, superClass) {
|
|
if (typeof superClass !== "function" && superClass !== null) {
|
|
throw new TypeError("Super expression must either be null or a function");
|
|
}
|
|
|
|
subClass.prototype = object_create(superClass && superClass.prototype, {
|
|
constructor: {
|
|
value: subClass,
|
|
writable: true,
|
|
configurable: true
|
|
}
|
|
});
|
|
if (superClass) _setPrototypeOf(subClass, superClass);
|
|
}
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/symbol/iterator.js
|
|
var iterator = __webpack_require__(3742);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/typeof.js
|
|
|
|
|
|
function _typeof(obj) {
|
|
"@babel/helpers - typeof";
|
|
|
|
if (typeof symbol === "function" && typeof iterator === "symbol") {
|
|
_typeof = function _typeof(obj) {
|
|
return typeof obj;
|
|
};
|
|
} else {
|
|
_typeof = function _typeof(obj) {
|
|
return obj && typeof symbol === "function" && obj.constructor === symbol && obj !== symbol.prototype ? "symbol" : typeof obj;
|
|
};
|
|
}
|
|
|
|
return _typeof(obj);
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/assertThisInitialized.js
|
|
function _assertThisInitialized(self) {
|
|
if (self === void 0) {
|
|
throw new ReferenceError("this hasn't been initialised - super() hasn't been called");
|
|
}
|
|
|
|
return self;
|
|
}
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/possibleConstructorReturn.js
|
|
|
|
|
|
function _possibleConstructorReturn(self, call) {
|
|
if (call && (_typeof(call) === "object" || typeof call === "function")) {
|
|
return call;
|
|
} else if (call !== void 0) {
|
|
throw new TypeError("Derived constructors may only return object or undefined");
|
|
}
|
|
|
|
return _assertThisInitialized(self);
|
|
}
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js/object/get-prototype-of.js
|
|
var get_prototype_of = __webpack_require__(9856);
|
|
;// CONCATENATED MODULE: ../../node_modules/@babel/runtime-corejs3/helpers/esm/getPrototypeOf.js
|
|
|
|
|
|
function _getPrototypeOf(o) {
|
|
_getPrototypeOf = set_prototype_of ? get_prototype_of : function _getPrototypeOf(o) {
|
|
return o.__proto__ || get_prototype_of(o);
|
|
};
|
|
return _getPrototypeOf(o);
|
|
}
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/collection/forEachArray.js
|
|
var forEachArray = __webpack_require__(6092);
|
|
var forEachArray_default = /*#__PURE__*/__webpack_require__.n(forEachArray);
|
|
// EXTERNAL MODULE: external {"commonjs":"tui-color-picker","commonjs2":"tui-color-picker","amd":"tui-color-picker","root":["tui","colorPicker"]}
|
|
var external_commonjs_tui_color_picker_commonjs2_tui_color_picker_amd_tui_color_picker_root_tui_colorPicker_ = __webpack_require__(4858);
|
|
var external_commonjs_tui_color_picker_commonjs2_tui_color_picker_amd_tui_color_picker_root_tui_colorPicker_default = /*#__PURE__*/__webpack_require__.n(external_commonjs_tui_color_picker_commonjs2_tui_color_picker_amd_tui_color_picker_root_tui_colorPicker_);
|
|
;// CONCATENATED MODULE: ./src/js/ui/tools/colorpicker.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var PICKER_COLOR = ['#000000', '#2a2a2a', '#545454', '#7e7e7e', '#a8a8a8', '#d2d2d2', '#ffffff', '', '#ff4040', '#ff6518', '#ffbb3b', '#03bd9e', '#00a9ff', '#515ce6', '#9e5fff', '#ff5583'];
|
|
/**
|
|
* Colorpicker control class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Colorpicker = /*#__PURE__*/function () {
|
|
function Colorpicker(colorpickerElement, _ref) {
|
|
var _ref$defaultColor = _ref.defaultColor,
|
|
defaultColor = _ref$defaultColor === void 0 ? '#7e7e7e' : _ref$defaultColor,
|
|
_ref$toggleDirection = _ref.toggleDirection,
|
|
toggleDirection = _ref$toggleDirection === void 0 ? 'up' : _ref$toggleDirection,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Colorpicker);
|
|
|
|
this.colorpickerElement = colorpickerElement;
|
|
this.usageStatistics = usageStatistics;
|
|
this._show = false;
|
|
this._colorpickerElement = colorpickerElement;
|
|
this._toggleDirection = toggleDirection;
|
|
|
|
this._makePickerButtonElement(defaultColor);
|
|
|
|
this._makePickerLayerElement(colorpickerElement, colorpickerElement.getAttribute('title'));
|
|
|
|
this._color = defaultColor;
|
|
this.picker = external_commonjs_tui_color_picker_commonjs2_tui_color_picker_amd_tui_color_picker_root_tui_colorPicker_default().create({
|
|
container: this.pickerElement,
|
|
preset: PICKER_COLOR,
|
|
color: defaultColor,
|
|
usageStatistics: this.usageStatistics
|
|
});
|
|
|
|
this._addEvent();
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Colorpicker, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
var _this = this;
|
|
|
|
this._removeEvent();
|
|
|
|
this.picker.destroy();
|
|
this.colorpickerElement.innerHTML = '';
|
|
forEach_default()(this, function (value, key) {
|
|
_this[key] = null;
|
|
});
|
|
}
|
|
/**
|
|
* Get color
|
|
* @returns {Number} color value
|
|
*/
|
|
|
|
}, {
|
|
key: "color",
|
|
get: function get() {
|
|
return this._color;
|
|
}
|
|
/**
|
|
* Set color
|
|
* @param {string} color color value
|
|
*/
|
|
,
|
|
set: function set(color) {
|
|
this._color = color;
|
|
|
|
this._changeColorElement(color);
|
|
}
|
|
/**
|
|
* Change color element
|
|
* @param {string} color color value
|
|
* #private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeColorElement",
|
|
value: function _changeColorElement(color) {
|
|
if (color) {
|
|
this.colorElement.classList.remove('transparent');
|
|
this.colorElement.style.backgroundColor = color;
|
|
} else {
|
|
this.colorElement.style.backgroundColor = '#fff';
|
|
this.colorElement.classList.add('transparent');
|
|
}
|
|
}
|
|
/**
|
|
* Make picker button element
|
|
* @param {string} defaultColor color value
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makePickerButtonElement",
|
|
value: function _makePickerButtonElement(defaultColor) {
|
|
this.colorpickerElement.classList.add('tui-image-editor-button');
|
|
this.colorElement = document.createElement('div');
|
|
this.colorElement.className = 'color-picker-value';
|
|
|
|
if (defaultColor) {
|
|
this.colorElement.style.backgroundColor = defaultColor;
|
|
} else {
|
|
this.colorElement.classList.add('transparent');
|
|
}
|
|
}
|
|
/**
|
|
* Make picker layer element
|
|
* @param {HTMLElement} colorpickerElement color picker element
|
|
* @param {string} title picker title
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makePickerLayerElement",
|
|
value: function _makePickerLayerElement(colorpickerElement, title) {
|
|
var label = document.createElement('label');
|
|
var triangle = document.createElement('div');
|
|
this.pickerControl = document.createElement('div');
|
|
this.pickerControl.className = 'color-picker-control';
|
|
this.pickerElement = document.createElement('div');
|
|
this.pickerElement.className = 'color-picker';
|
|
label.innerHTML = title;
|
|
triangle.className = 'triangle';
|
|
this.pickerControl.appendChild(this.pickerElement);
|
|
this.pickerControl.appendChild(triangle);
|
|
colorpickerElement.appendChild(this.pickerControl);
|
|
colorpickerElement.appendChild(this.colorElement);
|
|
colorpickerElement.appendChild(label);
|
|
}
|
|
/**
|
|
* Add event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addEvent",
|
|
value: function _addEvent() {
|
|
var _this2 = this,
|
|
_context;
|
|
|
|
this.picker.on('selectColor', function (value) {
|
|
_this2._changeColorElement(value.color);
|
|
|
|
_this2._color = value.color;
|
|
|
|
_this2.fire('change', value.color);
|
|
});
|
|
this.eventHandler = {
|
|
pickerToggle: bind_default()(_context = this._pickerToggleEventHandler).call(_context, this),
|
|
pickerHide: function pickerHide() {
|
|
return _this2.hide();
|
|
}
|
|
};
|
|
this.colorpickerElement.addEventListener('click', this.eventHandler.pickerToggle);
|
|
document.body.addEventListener('click', this.eventHandler.pickerHide);
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
this.colorpickerElement.removeEventListener('click', this.eventHandler.pickerToggle);
|
|
document.body.removeEventListener('click', this.eventHandler.pickerHide);
|
|
this.picker.off();
|
|
}
|
|
/**
|
|
* Picker toggle event handler
|
|
* @param {object} event - change event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_pickerToggleEventHandler",
|
|
value: function _pickerToggleEventHandler(event) {
|
|
var target = event.target;
|
|
|
|
var isInPickerControl = target && this._isElementInColorPickerControl(target);
|
|
|
|
if (!isInPickerControl || isInPickerControl && this._isPaletteButton(target)) {
|
|
this._show = !this._show;
|
|
this.pickerControl.style.display = this._show ? 'block' : 'none';
|
|
|
|
this._setPickerControlPosition();
|
|
|
|
this.fire('changeShow', this);
|
|
}
|
|
|
|
event.stopPropagation();
|
|
}
|
|
/**
|
|
* Check hex input or not
|
|
* @param {Element} target - Event target element
|
|
* @returns {boolean}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_isPaletteButton",
|
|
value: function _isPaletteButton(target) {
|
|
return target.className === 'tui-colorpicker-palette-button';
|
|
}
|
|
/**
|
|
* Check given element is in pickerControl element
|
|
* @param {Element} element - element to check
|
|
* @returns {boolean}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_isElementInColorPickerControl",
|
|
value: function _isElementInColorPickerControl(element) {
|
|
var parentNode = element;
|
|
|
|
while (parentNode !== document.body) {
|
|
if (!parentNode) {
|
|
break;
|
|
}
|
|
|
|
if (parentNode === this.pickerControl) {
|
|
return true;
|
|
}
|
|
|
|
parentNode = parentNode.parentNode;
|
|
}
|
|
|
|
return false;
|
|
}
|
|
}, {
|
|
key: "hide",
|
|
value: function hide() {
|
|
this._show = false;
|
|
this.pickerControl.style.display = 'none';
|
|
}
|
|
/**
|
|
* Set picker control position
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setPickerControlPosition",
|
|
value: function _setPickerControlPosition() {
|
|
var controlStyle = this.pickerControl.style;
|
|
var halfPickerWidth = this._colorpickerElement.clientWidth / 2 + 2;
|
|
var left = this.pickerControl.offsetWidth / 2 - halfPickerWidth;
|
|
var top = (this.pickerControl.offsetHeight + 10) * -1;
|
|
|
|
if (this._toggleDirection === 'down') {
|
|
top = 30;
|
|
}
|
|
|
|
controlStyle.top = "".concat(top, "px");
|
|
controlStyle.left = "-".concat(left, "px");
|
|
}
|
|
}]);
|
|
|
|
return Colorpicker;
|
|
}();
|
|
|
|
customEvents_default().mixin(Colorpicker);
|
|
/* harmony default export */ var colorpicker = (Colorpicker);
|
|
;// CONCATENATED MODULE: ./src/js/ui/tools/range.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var INPUT_FILTER_REGEXP = /(-?)([0-9]*)[^0-9]*([0-9]*)/g;
|
|
/**
|
|
* Range control class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Range = /*#__PURE__*/function () {
|
|
/**
|
|
* @constructor
|
|
* @extends {View}
|
|
* @param {Object} rangeElements - Html resources for creating sliders
|
|
* @param {HTMLElement} rangeElements.slider - b
|
|
* @param {HTMLElement} [rangeElements.input] - c
|
|
* @param {Object} options - Slider make options
|
|
* @param {number} options.min - min value
|
|
* @param {number} options.max - max value
|
|
* @param {number} options.value - default value
|
|
* @param {number} [options.useDecimal] - Decimal point processing.
|
|
* @param {boolean} [options.realTimeEvent] - Reflect live events.
|
|
*/
|
|
function Range(rangeElements) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7;
|
|
|
|
var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
|
|
|
|
_classCallCheck(this, Range);
|
|
|
|
this._value = options.value || 0;
|
|
this.rangeElement = rangeElements.slider;
|
|
this.rangeInputElement = rangeElements.input;
|
|
|
|
this._drawRangeElement();
|
|
|
|
this.rangeWidth = this._getRangeWidth();
|
|
this._min = options.min || 0;
|
|
this._max = options.max || 100;
|
|
this._useDecimal = options.useDecimal;
|
|
this._absMax = this._min * -1 + this._max;
|
|
this.realTimeEvent = options.realTimeEvent || false;
|
|
this._userInputTimer = null;
|
|
this.eventHandler = {
|
|
startChangingSlide: bind_default()(_context = this._startChangingSlide).call(_context, this),
|
|
stopChangingSlide: bind_default()(_context2 = this._stopChangingSlide).call(_context2, this),
|
|
changeSlide: bind_default()(_context3 = this._changeSlide).call(_context3, this),
|
|
changeSlideFinally: bind_default()(_context4 = this._changeSlideFinally).call(_context4, this),
|
|
changeInput: bind_default()(_context5 = this._changeInput).call(_context5, this),
|
|
changeInputFinally: bind_default()(_context6 = this._changeValueWithInput).call(_context6, this, true),
|
|
changeInputWithArrow: bind_default()(_context7 = this._changeValueWithInputKeyEvent).call(_context7, this)
|
|
};
|
|
|
|
this._addClickEvent();
|
|
|
|
this._addDragEvent();
|
|
|
|
this._addInputEvent();
|
|
|
|
this.value = options.value;
|
|
this.trigger('change');
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Range, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
var _this = this;
|
|
|
|
this._removeClickEvent();
|
|
|
|
this._removeDragEvent();
|
|
|
|
this._removeInputEvent();
|
|
|
|
this.rangeElement.innerHTML = '';
|
|
forEach_default()(this, function (value, key) {
|
|
_this[key] = null;
|
|
});
|
|
}
|
|
}, {
|
|
key: "max",
|
|
get: function get() {
|
|
return this._max;
|
|
}
|
|
/**
|
|
* Set range max value and re position cursor
|
|
* @param {number} maxValue - max value
|
|
*/
|
|
,
|
|
set: function set(maxValue) {
|
|
this._max = maxValue;
|
|
this._absMax = this._min * -1 + this._max;
|
|
this.value = this._value;
|
|
}
|
|
}, {
|
|
key: "min",
|
|
get: function get() {
|
|
return this._min;
|
|
}
|
|
/**
|
|
* Set range min value and re position cursor
|
|
* @param {number} minValue - min value
|
|
*/
|
|
,
|
|
set: function set(minValue) {
|
|
this._min = minValue;
|
|
this.max = this._max;
|
|
}
|
|
/**
|
|
* Get range value
|
|
* @returns {Number} range value
|
|
*/
|
|
|
|
}, {
|
|
key: "value",
|
|
get: function get() {
|
|
return this._value;
|
|
}
|
|
/**
|
|
* Set range value
|
|
* @param {Number} value range value
|
|
*/
|
|
,
|
|
set: function set(value) {
|
|
value = this._useDecimal ? value : toInteger(value);
|
|
var absValue = value - this._min;
|
|
var leftPosition = absValue * this.rangeWidth / this._absMax;
|
|
|
|
if (this.rangeWidth < leftPosition) {
|
|
leftPosition = this.rangeWidth;
|
|
}
|
|
|
|
this.pointer.style.left = "".concat(leftPosition, "px");
|
|
this.subbar.style.right = "".concat(this.rangeWidth - leftPosition, "px");
|
|
this._value = value;
|
|
|
|
if (this.rangeInputElement) {
|
|
this.rangeInputElement.value = value;
|
|
}
|
|
}
|
|
/**
|
|
* event trigger
|
|
* @param {string} type - type
|
|
*/
|
|
|
|
}, {
|
|
key: "trigger",
|
|
value: function trigger(type) {
|
|
this.fire(type, this._value);
|
|
}
|
|
/**
|
|
* Calculate slider width
|
|
* @returns {number} - slider width
|
|
*/
|
|
|
|
}, {
|
|
key: "_getRangeWidth",
|
|
value: function _getRangeWidth() {
|
|
var getElementWidth = function getElementWidth(element) {
|
|
return toInteger(window.getComputedStyle(element, null).width);
|
|
};
|
|
|
|
return getElementWidth(this.rangeElement) - getElementWidth(this.pointer);
|
|
}
|
|
/**
|
|
* Make range element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_drawRangeElement",
|
|
value: function _drawRangeElement() {
|
|
this.rangeElement.classList.add('tui-image-editor-range');
|
|
this.bar = document.createElement('div');
|
|
this.bar.className = 'tui-image-editor-virtual-range-bar';
|
|
this.subbar = document.createElement('div');
|
|
this.subbar.className = 'tui-image-editor-virtual-range-subbar';
|
|
this.pointer = document.createElement('div');
|
|
this.pointer.className = 'tui-image-editor-virtual-range-pointer';
|
|
this.bar.appendChild(this.subbar);
|
|
this.bar.appendChild(this.pointer);
|
|
this.rangeElement.appendChild(this.bar);
|
|
}
|
|
/**
|
|
* Add range input editing event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addInputEvent",
|
|
value: function _addInputEvent() {
|
|
if (this.rangeInputElement) {
|
|
this.rangeInputElement.addEventListener('keydown', this.eventHandler.changeInputWithArrow);
|
|
this.rangeInputElement.addEventListener('keydown', this.eventHandler.changeInput);
|
|
this.rangeInputElement.addEventListener('blur', this.eventHandler.changeInputFinally);
|
|
}
|
|
}
|
|
/**
|
|
* Remove range input editing event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeInputEvent",
|
|
value: function _removeInputEvent() {
|
|
if (this.rangeInputElement) {
|
|
this.rangeInputElement.removeEventListener('keydown', this.eventHandler.changeInputWithArrow);
|
|
this.rangeInputElement.removeEventListener('keydown', this.eventHandler.changeInput);
|
|
this.rangeInputElement.removeEventListener('blur', this.eventHandler.changeInputFinally);
|
|
}
|
|
}
|
|
/**
|
|
* change angle event
|
|
* @param {object} event - key event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeValueWithInputKeyEvent",
|
|
value: function _changeValueWithInputKeyEvent(event) {
|
|
var _context8;
|
|
|
|
var keyCode = event.keyCode,
|
|
target = event.target;
|
|
|
|
if (index_of_default()(_context8 = [keyCodes.ARROW_UP, keyCodes.ARROW_DOWN]).call(_context8, keyCode) < 0) {
|
|
return;
|
|
}
|
|
|
|
var value = Number(target.value);
|
|
value = this._valueUpDownForKeyEvent(value, keyCode);
|
|
var unChanged = value < this._min || value > this._max;
|
|
|
|
if (!unChanged) {
|
|
var clampValue = clamp(value, this._min, this.max);
|
|
this.value = clampValue;
|
|
this.fire('change', clampValue, false);
|
|
}
|
|
}
|
|
/**
|
|
* value up down for input
|
|
* @param {number} value - original value number
|
|
* @param {number} keyCode - input event key code
|
|
* @returns {number} value - changed value
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_valueUpDownForKeyEvent",
|
|
value: function _valueUpDownForKeyEvent(value, keyCode) {
|
|
var step = this._useDecimal ? 0.1 : 1;
|
|
|
|
if (keyCode === keyCodes.ARROW_UP) {
|
|
value += step;
|
|
} else if (keyCode === keyCodes.ARROW_DOWN) {
|
|
value -= step;
|
|
}
|
|
|
|
return value;
|
|
}
|
|
}, {
|
|
key: "_changeInput",
|
|
value: function _changeInput(event) {
|
|
var _this2 = this;
|
|
|
|
clearTimeout(this._userInputTimer);
|
|
var keyCode = event.keyCode;
|
|
|
|
if (keyCode < keyCodes.DIGIT_0 || keyCode > keyCodes.DIGIT_9) {
|
|
event.preventDefault();
|
|
return;
|
|
}
|
|
|
|
this._userInputTimer = set_timeout_default()(function () {
|
|
_this2._inputSetValue(event.target.value);
|
|
}, 350);
|
|
}
|
|
}, {
|
|
key: "_inputSetValue",
|
|
value: function _inputSetValue(stringValue) {
|
|
var value = this._useDecimal ? Number(stringValue) : toInteger(stringValue);
|
|
value = clamp(value, this._min, this.max);
|
|
this.value = value;
|
|
this.fire('change', value, true);
|
|
}
|
|
/**
|
|
* change angle event
|
|
* @param {boolean} isLast - Is last change
|
|
* @param {object} event - key event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeValueWithInput",
|
|
value: function _changeValueWithInput(isLast, event) {
|
|
var _context9;
|
|
|
|
var keyCode = event.keyCode,
|
|
target = event.target;
|
|
|
|
if (index_of_default()(_context9 = [keyCodes.ARROW_UP, keyCodes.ARROW_DOWN]).call(_context9, keyCode) >= 0) {
|
|
return;
|
|
}
|
|
|
|
var stringValue = this._filterForInputText(target.value);
|
|
|
|
var waitForChange = !stringValue || isNaN(stringValue);
|
|
target.value = stringValue;
|
|
|
|
if (!waitForChange) {
|
|
this._inputSetValue(stringValue);
|
|
}
|
|
}
|
|
/**
|
|
* Add Range click event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addClickEvent",
|
|
value: function _addClickEvent() {
|
|
this.rangeElement.addEventListener('click', this.eventHandler.changeSlideFinally);
|
|
}
|
|
/**
|
|
* Remove Range click event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeClickEvent",
|
|
value: function _removeClickEvent() {
|
|
this.rangeElement.removeEventListener('click', this.eventHandler.changeSlideFinally);
|
|
}
|
|
/**
|
|
* Add Range drag event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addDragEvent",
|
|
value: function _addDragEvent() {
|
|
this.pointer.addEventListener('mousedown', this.eventHandler.startChangingSlide);
|
|
}
|
|
/**
|
|
* Remove Range drag event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeDragEvent",
|
|
value: function _removeDragEvent() {
|
|
this.pointer.removeEventListener('mousedown', this.eventHandler.startChangingSlide);
|
|
}
|
|
/**
|
|
* change angle event
|
|
* @param {object} event - change event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeSlide",
|
|
value: function _changeSlide(event) {
|
|
var changePosition = event.screenX;
|
|
var diffPosition = changePosition - this.firstPosition;
|
|
var touchPx = this.firstLeft + diffPosition;
|
|
touchPx = touchPx > this.rangeWidth ? this.rangeWidth : touchPx;
|
|
touchPx = touchPx < 0 ? 0 : touchPx;
|
|
this.pointer.style.left = "".concat(touchPx, "px");
|
|
this.subbar.style.right = "".concat(this.rangeWidth - touchPx, "px");
|
|
var ratio = touchPx / this.rangeWidth;
|
|
var resultValue = this._absMax * ratio + this._min;
|
|
var value = this._useDecimal ? resultValue : toInteger(resultValue);
|
|
var isValueChanged = this.value !== value;
|
|
|
|
if (isValueChanged) {
|
|
this.value = value;
|
|
|
|
if (this.realTimeEvent) {
|
|
this.fire('change', this._value, false);
|
|
}
|
|
}
|
|
}
|
|
}, {
|
|
key: "_changeSlideFinally",
|
|
value: function _changeSlideFinally(event) {
|
|
event.stopPropagation();
|
|
|
|
if (event.target.className !== 'tui-image-editor-range') {
|
|
return;
|
|
}
|
|
|
|
var touchPx = event.offsetX;
|
|
var ratio = touchPx / this.rangeWidth;
|
|
var value = this._absMax * ratio + this._min;
|
|
this.pointer.style.left = "".concat(ratio * this.rangeWidth, "px");
|
|
this.subbar.style.right = "".concat((1 - ratio) * this.rangeWidth, "px");
|
|
this.value = value;
|
|
this.fire('change', value, true);
|
|
}
|
|
}, {
|
|
key: "_startChangingSlide",
|
|
value: function _startChangingSlide(event) {
|
|
this.firstPosition = event.screenX;
|
|
this.firstLeft = toInteger(this.pointer.style.left) || 0;
|
|
document.addEventListener('mousemove', this.eventHandler.changeSlide);
|
|
document.addEventListener('mouseup', this.eventHandler.stopChangingSlide);
|
|
}
|
|
/**
|
|
* stop change angle event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_stopChangingSlide",
|
|
value: function _stopChangingSlide() {
|
|
this.fire('change', this._value, true);
|
|
document.removeEventListener('mousemove', this.eventHandler.changeSlide);
|
|
document.removeEventListener('mouseup', this.eventHandler.stopChangingSlide);
|
|
}
|
|
/**
|
|
* Unnecessary string filtering.
|
|
* @param {string} inputValue - origin string of input
|
|
* @returns {string} filtered string
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_filterForInputText",
|
|
value: function _filterForInputText(inputValue) {
|
|
return inputValue.replace(INPUT_FILTER_REGEXP, '$1$2$3');
|
|
}
|
|
}]);
|
|
|
|
return Range;
|
|
}();
|
|
|
|
customEvents_default().mixin(Range);
|
|
/* harmony default export */ var range = (Range);
|
|
;// CONCATENATED MODULE: ./src/js/ui/submenuBase.js
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Submenu Base Class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Submenu = /*#__PURE__*/function () {
|
|
/**
|
|
* @param {HTMLElement} subMenuElement - submenu dom element
|
|
* @param {Locale} locale - translate text
|
|
* @param {string} name - name of sub menu
|
|
* @param {Object} iconStyle - style of icon
|
|
* @param {string} menuBarPosition - position of menu
|
|
* @param {*} templateHtml - template for SubMenuElement
|
|
* @param {boolean} [usageStatistics=false] - template for SubMenuElement
|
|
*/
|
|
function Submenu(subMenuElement, _ref) {
|
|
var locale = _ref.locale,
|
|
name = _ref.name,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
templateHtml = _ref.templateHtml,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Submenu);
|
|
|
|
this.subMenuElement = subMenuElement;
|
|
this.menuBarPosition = menuBarPosition;
|
|
this.toggleDirection = menuBarPosition === 'top' ? 'down' : 'up';
|
|
this.colorPickerControls = [];
|
|
this.usageStatistics = usageStatistics;
|
|
this.eventHandler = {};
|
|
|
|
this._makeSubMenuElement({
|
|
locale: locale,
|
|
name: name,
|
|
makeSvgIcon: makeSvgIcon,
|
|
templateHtml: templateHtml
|
|
});
|
|
}
|
|
/**
|
|
* editor dom ui query selector
|
|
* @param {string} selectName - query selector string name
|
|
* @returns {HTMLElement}
|
|
*/
|
|
|
|
|
|
_createClass(Submenu, [{
|
|
key: "selector",
|
|
value: function selector(selectName) {
|
|
return this.subMenuElement.querySelector(selectName);
|
|
}
|
|
/**
|
|
* change show state change for colorpicker instance
|
|
* @param {Colorpicker} occurredControl - target Colorpicker Instance
|
|
*/
|
|
|
|
}, {
|
|
key: "colorPickerChangeShow",
|
|
value: function colorPickerChangeShow(occurredControl) {
|
|
var _context;
|
|
|
|
for_each_default()(_context = this.colorPickerControls).call(_context, function (pickerControl) {
|
|
if (occurredControl !== pickerControl) {
|
|
pickerControl.hide();
|
|
}
|
|
});
|
|
}
|
|
/**
|
|
* Get button type
|
|
* @param {HTMLElement} button - event target element
|
|
* @param {array} buttonNames - Array of button names
|
|
* @returns {string} - button type
|
|
*/
|
|
|
|
}, {
|
|
key: "getButtonType",
|
|
value: function getButtonType(button, buttonNames) {
|
|
return button.className.match(RegExp("(".concat(buttonNames.join('|'), ")")))[0];
|
|
}
|
|
/**
|
|
* Get button type
|
|
* @param {HTMLElement} target - event target element
|
|
* @param {string} removeClass - remove class name
|
|
* @param {string} addClass - add class name
|
|
*/
|
|
|
|
}, {
|
|
key: "changeClass",
|
|
value: function changeClass(target, removeClass, addClass) {
|
|
target.classList.remove(removeClass);
|
|
target.classList.add(addClass);
|
|
}
|
|
/**
|
|
* Interface method whose implementation is optional.
|
|
* Returns the menu to its default state.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStandbyMode",
|
|
value: function changeStandbyMode() {}
|
|
/**
|
|
* Interface method whose implementation is optional.
|
|
* Executed when the menu starts.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStartMode",
|
|
value: function changeStartMode() {}
|
|
/**
|
|
* Make submenu dom element
|
|
* @param {Locale} locale - translate text
|
|
* @param {string} name - submenu name
|
|
* @param {Object} iconStyle - icon style
|
|
* @param {*} templateHtml - template for SubMenuElement
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeSubMenuElement",
|
|
value: function _makeSubMenuElement(_ref2) {
|
|
var locale = _ref2.locale,
|
|
name = _ref2.name,
|
|
iconStyle = _ref2.iconStyle,
|
|
makeSvgIcon = _ref2.makeSvgIcon,
|
|
templateHtml = _ref2.templateHtml;
|
|
var iconSubMenu = document.createElement('div');
|
|
iconSubMenu.className = "tui-image-editor-menu-".concat(name);
|
|
iconSubMenu.innerHTML = templateHtml({
|
|
locale: locale,
|
|
iconStyle: iconStyle,
|
|
makeSvgIcon: makeSvgIcon
|
|
});
|
|
this.subMenuElement.appendChild(iconSubMenu);
|
|
}
|
|
}, {
|
|
key: "_onStartEditingInputBox",
|
|
value: function _onStartEditingInputBox() {
|
|
this.fire(eventNames.INPUT_BOX_EDITING_STARTED);
|
|
}
|
|
}, {
|
|
key: "_onStopEditingInputBox",
|
|
value: function _onStopEditingInputBox() {
|
|
this.fire(eventNames.INPUT_BOX_EDITING_STOPPED);
|
|
}
|
|
}]);
|
|
|
|
return Submenu;
|
|
}();
|
|
|
|
customEvents_default().mixin(Submenu);
|
|
/* harmony default export */ var submenuBase = (Submenu);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/shape.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var shape = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = concat_default()(_context7 = concat_default()(_context8 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tie-shape-button\">\n <div class=\"tui-image-editor-button rect\">\n <div>\n ".concat(makeSvgIcon(['normal', 'active'], 'shape-rectangle', true), "\n </div>\n <label> ")).call(_context8, locale.localize('Rectangle'), " </label>\n </div>\n <div class=\"tui-image-editor-button circle\">\n <div>\n ")).call(_context7, makeSvgIcon(['normal', 'active'], 'shape-circle', true), "\n </div>\n <label> ")).call(_context6, locale.localize('Circle'), " </label>\n </div>\n <div class=\"tui-image-editor-button triangle\">\n <div>\n ")).call(_context5, makeSvgIcon(['normal', 'active'], 'shape-triangle', true), "\n </div>\n <label> ")).call(_context4, locale.localize('Triangle'), " </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li class=\"tie-shape-color-button\">\n <div class=\"tie-color-fill\" title=\"")).call(_context3, locale.localize('Fill'), "\"></div>\n <div class=\"tie-color-stroke\" title=\"")).call(_context2, locale.localize('Stroke'), "\"></div>\n </li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-newline tui-image-editor-range-wrap\">\n <label class=\"range\">")).call(_context, locale.localize('Stroke'), "</label>\n <div class=\"tie-stroke-range\"></div>\n <input class=\"tie-stroke-range-value tui-image-editor-range-value\" value=\"0\" />\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/shape.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function _createSuper(Derived) { var hasNativeReflectConstruct = _isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function _isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var SHAPE_DEFAULT_OPTION = {
|
|
stroke: '#ffbb3b',
|
|
fill: '',
|
|
strokeWidth: 3
|
|
};
|
|
/**
|
|
* Shape ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Shape = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Shape, _Submenu);
|
|
|
|
var _super = _createSuper(Shape);
|
|
|
|
function Shape(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Shape);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'shape',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: shape,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this.type = null;
|
|
_this.options = SHAPE_DEFAULT_OPTION;
|
|
_this._els = {
|
|
shapeSelectButton: _this.selector('.tie-shape-button'),
|
|
shapeColorButton: _this.selector('.tie-shape-color-button'),
|
|
strokeRange: new range({
|
|
slider: _this.selector('.tie-stroke-range'),
|
|
input: _this.selector('.tie-stroke-range-value')
|
|
}, defaultShapeStrokeValues),
|
|
fillColorpicker: new colorpicker(_this.selector('.tie-color-fill'), {
|
|
defaultColor: '',
|
|
toggleDirection: _this.toggleDirection,
|
|
usageStatistics: _this.usageStatistics
|
|
}),
|
|
strokeColorpicker: new colorpicker(_this.selector('.tie-color-stroke'), {
|
|
defaultColor: '#ffbb3b',
|
|
toggleDirection: _this.toggleDirection,
|
|
usageStatistics: _this.usageStatistics
|
|
})
|
|
};
|
|
|
|
_this.colorPickerControls.push(_this._els.fillColorpicker);
|
|
|
|
_this.colorPickerControls.push(_this._els.strokeColorpicker);
|
|
|
|
_this.colorPickerInputBoxes = [];
|
|
|
|
_this.colorPickerInputBoxes.push(_this._els.fillColorpicker.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX));
|
|
|
|
_this.colorPickerInputBoxes.push(_this._els.strokeColorpicker.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX));
|
|
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Shape, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
this._els.strokeRange.destroy();
|
|
|
|
this._els.fillColorpicker.destroy();
|
|
|
|
this._els.strokeColorpicker.destroy();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for shape
|
|
* @param {Object} actions - actions for shape
|
|
* @param {Function} actions.changeShape - change shape mode
|
|
* @param {Function} actions.setDrawingShape - set drawing shape
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context,
|
|
_context2,
|
|
_context3,
|
|
_context4,
|
|
_context5,
|
|
_context6,
|
|
_this2 = this;
|
|
|
|
this.eventHandler.shapeTypeSelected = bind_default()(_context = this._changeShapeHandler).call(_context, this);
|
|
this.actions = actions;
|
|
|
|
this._els.shapeSelectButton.addEventListener('click', this.eventHandler.shapeTypeSelected);
|
|
|
|
this._els.strokeRange.on('change', bind_default()(_context2 = this._changeStrokeRangeHandler).call(_context2, this));
|
|
|
|
this._els.fillColorpicker.on('change', bind_default()(_context3 = this._changeFillColorHandler).call(_context3, this));
|
|
|
|
this._els.strokeColorpicker.on('change', bind_default()(_context4 = this._changeStrokeColorHandler).call(_context4, this));
|
|
|
|
this._els.fillColorpicker.on('changeShow', bind_default()(_context5 = this.colorPickerChangeShow).call(_context5, this));
|
|
|
|
this._els.strokeColorpicker.on('changeShow', bind_default()(_context6 = this.colorPickerChangeShow).call(_context6, this));
|
|
|
|
forEachArray_default()(this.colorPickerInputBoxes, function (inputBox) {
|
|
var _context7, _context8;
|
|
|
|
inputBox.addEventListener(eventNames.FOCUS, bind_default()(_context7 = _this2._onStartEditingInputBox).call(_context7, _this2));
|
|
inputBox.addEventListener(eventNames.BLUR, bind_default()(_context8 = _this2._onStopEditingInputBox).call(_context8, _this2));
|
|
}, this);
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
var _this3 = this;
|
|
|
|
this._els.shapeSelectButton.removeEventListener('click', this.eventHandler.shapeTypeSelected);
|
|
|
|
this._els.strokeRange.off();
|
|
|
|
this._els.fillColorpicker.off();
|
|
|
|
this._els.strokeColorpicker.off();
|
|
|
|
forEachArray_default()(this.colorPickerInputBoxes, function (inputBox) {
|
|
var _context9, _context10;
|
|
|
|
inputBox.removeEventListener(eventNames.FOCUS, bind_default()(_context9 = _this3._onStartEditingInputBox).call(_context9, _this3));
|
|
inputBox.removeEventListener(eventNames.BLUR, bind_default()(_context10 = _this3._onStopEditingInputBox).call(_context10, _this3));
|
|
}, this);
|
|
}
|
|
/**
|
|
* Set Shape status
|
|
* @param {Object} options - options of shape status
|
|
* @param {string} strokeWidth - stroke width
|
|
* @param {string} strokeColor - stroke color
|
|
* @param {string} fillColor - fill color
|
|
*/
|
|
|
|
}, {
|
|
key: "setShapeStatus",
|
|
value: function setShapeStatus(_ref2) {
|
|
var strokeWidth = _ref2.strokeWidth,
|
|
strokeColor = _ref2.strokeColor,
|
|
fillColor = _ref2.fillColor;
|
|
this._els.strokeRange.value = strokeWidth;
|
|
this._els.strokeColorpicker.color = strokeColor;
|
|
this._els.fillColorpicker.color = fillColor;
|
|
this.options.stroke = strokeColor;
|
|
this.options.fill = fillColor;
|
|
this.options.strokeWidth = strokeWidth;
|
|
this.actions.setDrawingShape(this.type, {
|
|
strokeWidth: strokeWidth
|
|
});
|
|
}
|
|
/**
|
|
* Executed when the menu starts.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStartMode",
|
|
value: function changeStartMode() {
|
|
this.actions.stopDrawingMode();
|
|
}
|
|
/**
|
|
* Returns the menu to its default state.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStandbyMode",
|
|
value: function changeStandbyMode() {
|
|
this.type = null;
|
|
this.actions.changeSelectableAll(true);
|
|
|
|
this._els.shapeSelectButton.classList.remove('circle');
|
|
|
|
this._els.shapeSelectButton.classList.remove('triangle');
|
|
|
|
this._els.shapeSelectButton.classList.remove('rect');
|
|
}
|
|
/**
|
|
* set range stroke max value
|
|
* @param {number} maxValue - expect max value for change
|
|
*/
|
|
|
|
}, {
|
|
key: "setMaxStrokeValue",
|
|
value: function setMaxStrokeValue(maxValue) {
|
|
var strokeMaxValue = maxValue;
|
|
|
|
if (strokeMaxValue <= 0) {
|
|
strokeMaxValue = defaultShapeStrokeValues.max;
|
|
}
|
|
|
|
this._els.strokeRange.max = strokeMaxValue;
|
|
}
|
|
/**
|
|
* Set stroke value
|
|
* @param {number} value - expect value for strokeRange change
|
|
*/
|
|
|
|
}, {
|
|
key: "setStrokeValue",
|
|
value: function setStrokeValue(value) {
|
|
this._els.strokeRange.value = value;
|
|
|
|
this._els.strokeRange.trigger('change');
|
|
}
|
|
/**
|
|
* Get stroke value
|
|
* @returns {number} - stroke range value
|
|
*/
|
|
|
|
}, {
|
|
key: "getStrokeValue",
|
|
value: function getStrokeValue() {
|
|
return this._els.strokeRange.value;
|
|
}
|
|
/**
|
|
* Change icon color
|
|
* @param {object} event - add button event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeShapeHandler",
|
|
value: function _changeShapeHandler(event) {
|
|
var button = event.target.closest('.tui-image-editor-button');
|
|
|
|
if (button) {
|
|
this.actions.stopDrawingMode();
|
|
this.actions.discardSelection();
|
|
var shapeType = this.getButtonType(button, ['circle', 'triangle', 'rect']);
|
|
|
|
if (this.type === shapeType) {
|
|
this.changeStandbyMode();
|
|
return;
|
|
}
|
|
|
|
this.changeStandbyMode();
|
|
this.type = shapeType;
|
|
event.currentTarget.classList.add(shapeType);
|
|
this.actions.changeSelectableAll(false);
|
|
this.actions.modeChange('shape');
|
|
}
|
|
}
|
|
/**
|
|
* Change stroke range
|
|
* @param {number} value - stroke range value
|
|
* @param {boolean} isLast - Is last change
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeStrokeRangeHandler",
|
|
value: function _changeStrokeRangeHandler(value, isLast) {
|
|
this.options.strokeWidth = toInteger(value);
|
|
this.actions.changeShape({
|
|
strokeWidth: value
|
|
}, !isLast);
|
|
this.actions.setDrawingShape(this.type, this.options);
|
|
}
|
|
/**
|
|
* Change shape color
|
|
* @param {string} color - fill color
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeFillColorHandler",
|
|
value: function _changeFillColorHandler(color) {
|
|
color = color || 'transparent';
|
|
this.options.fill = color;
|
|
this.actions.changeShape({
|
|
fill: color
|
|
});
|
|
}
|
|
/**
|
|
* Change shape stroke color
|
|
* @param {string} color - fill color
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeStrokeColorHandler",
|
|
value: function _changeStrokeColorHandler(color) {
|
|
color = color || 'transparent';
|
|
this.options.stroke = color;
|
|
this.actions.changeShape({
|
|
stroke: color
|
|
});
|
|
}
|
|
}]);
|
|
|
|
return Shape;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_shape = (Shape);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/crop.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var crop = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11, _context12, _context13, _context14, _context15, _context16, _context17;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = concat_default()(_context7 = concat_default()(_context8 = concat_default()(_context9 = concat_default()(_context10 = concat_default()(_context11 = concat_default()(_context12 = concat_default()(_context13 = concat_default()(_context14 = concat_default()(_context15 = concat_default()(_context16 = concat_default()(_context17 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tie-crop-preset-button\">\n <div class=\"tui-image-editor-button preset preset-none active\">\n <div>\n ".concat(makeSvgIcon(['normal', 'active'], 'shape-rectangle', true), "\n </div>\n <label> ")).call(_context17, locale.localize('Custom'), " </label>\n </div>\n <div class=\"tui-image-editor-button preset preset-square\">\n <div>\n ")).call(_context16, makeSvgIcon(['normal', 'active'], 'crop', true), "\n </div>\n <label> ")).call(_context15, locale.localize('Square'), " </label>\n </div>\n <div class=\"tui-image-editor-button preset preset-3-2\">\n <div>\n ")).call(_context14, makeSvgIcon(['normal', 'active'], 'crop', true), "\n </div>\n <label> ")).call(_context13, locale.localize('3:2'), " </label>\n </div>\n <div class=\"tui-image-editor-button preset preset-4-3\">\n <div>\n ")).call(_context12, makeSvgIcon(['normal', 'active'], 'crop', true), "\n </div>\n <label> ")).call(_context11, locale.localize('4:3'), " </label>\n </div>\n <div class=\"tui-image-editor-button preset preset-5-4\">\n <div>\n ")).call(_context10, makeSvgIcon(['normal', 'active'], 'crop', true), "\n </div>\n <label> ")).call(_context9, locale.localize('5:4'), " </label>\n </div>\n <div class=\"tui-image-editor-button preset preset-7-5\">\n <div>\n ")).call(_context8, makeSvgIcon(['normal', 'active'], 'crop', true), "\n </div>\n <label> ")).call(_context7, locale.localize('7:5'), " </label>\n </div>\n <div class=\"tui-image-editor-button preset preset-16-9\">\n <div>\n ")).call(_context6, makeSvgIcon(['normal', 'active'], 'crop', true), "\n </div>\n <label> ")).call(_context5, locale.localize('16:9'), " </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition tui-image-editor-newline\">\n </li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tie-crop-button action\">\n <div class=\"tui-image-editor-button apply\">\n ")).call(_context4, makeSvgIcon(['normal', 'active'], 'apply'), "\n <label>\n ")).call(_context3, locale.localize('Apply'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button cancel\">\n ")).call(_context2, makeSvgIcon(['normal', 'active'], 'cancel'), "\n <label>\n ")).call(_context, locale.localize('Cancel'), "\n </label>\n </div>\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/crop.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function crop_createSuper(Derived) { var hasNativeReflectConstruct = crop_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function crop_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Crop ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Crop = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Crop, _Submenu);
|
|
|
|
var _super = crop_createSuper(Crop);
|
|
|
|
function Crop(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Crop);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'crop',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: crop,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this.status = 'active';
|
|
_this._els = {
|
|
apply: _this.selector('.tie-crop-button .apply'),
|
|
cancel: _this.selector('.tie-crop-button .cancel'),
|
|
preset: _this.selector('.tie-crop-preset-button')
|
|
};
|
|
_this.defaultPresetButton = _this._els.preset.querySelector('.preset-none');
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Crop, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for crop
|
|
* @param {Object} actions - actions for crop
|
|
* @param {Function} actions.crop - crop action
|
|
* @param {Function} actions.cancel - cancel action
|
|
* @param {Function} actions.preset - draw rectzone at a predefined ratio
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context, _context2, _context3;
|
|
|
|
var apply = bind_default()(_context = this._applyEventHandler).call(_context, this);
|
|
|
|
var cancel = bind_default()(_context2 = this._cancelEventHandler).call(_context2, this);
|
|
|
|
var cropzonePreset = bind_default()(_context3 = this._cropzonePresetEventHandler).call(_context3, this);
|
|
|
|
this.eventHandler = {
|
|
apply: apply,
|
|
cancel: cancel,
|
|
cropzonePreset: cropzonePreset
|
|
};
|
|
this.actions = actions;
|
|
|
|
this._els.apply.addEventListener('click', apply);
|
|
|
|
this._els.cancel.addEventListener('click', cancel);
|
|
|
|
this._els.preset.addEventListener('click', cropzonePreset);
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
this._els.apply.removeEventListener('click', this.eventHandler.apply);
|
|
|
|
this._els.cancel.removeEventListener('click', this.eventHandler.cancel);
|
|
|
|
this._els.preset.removeEventListener('click', this.eventHandler.cropzonePreset);
|
|
}
|
|
}, {
|
|
key: "_applyEventHandler",
|
|
value: function _applyEventHandler() {
|
|
this.actions.crop();
|
|
|
|
this._els.apply.classList.remove('active');
|
|
}
|
|
}, {
|
|
key: "_cancelEventHandler",
|
|
value: function _cancelEventHandler() {
|
|
this.actions.cancel();
|
|
|
|
this._els.apply.classList.remove('active');
|
|
}
|
|
}, {
|
|
key: "_cropzonePresetEventHandler",
|
|
value: function _cropzonePresetEventHandler(event) {
|
|
var button = event.target.closest('.tui-image-editor-button.preset');
|
|
|
|
if (button) {
|
|
var _button$className$mat = button.className.match(/preset-[^\s]+/),
|
|
_button$className$mat2 = _slicedToArray(_button$className$mat, 1),
|
|
presetType = _button$className$mat2[0];
|
|
|
|
this._setPresetButtonActive(button);
|
|
|
|
this.actions.preset(presetType);
|
|
}
|
|
}
|
|
/**
|
|
* Executed when the menu starts.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStartMode",
|
|
value: function changeStartMode() {
|
|
this.actions.modeChange('crop');
|
|
}
|
|
/**
|
|
* Returns the menu to its default state.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStandbyMode",
|
|
value: function changeStandbyMode() {
|
|
this.actions.stopDrawingMode();
|
|
|
|
this._setPresetButtonActive();
|
|
}
|
|
/**
|
|
* Change apply button status
|
|
* @param {Boolean} enableStatus - apply button status
|
|
*/
|
|
|
|
}, {
|
|
key: "changeApplyButtonStatus",
|
|
value: function changeApplyButtonStatus(enableStatus) {
|
|
if (enableStatus) {
|
|
this._els.apply.classList.add('active');
|
|
} else {
|
|
this._els.apply.classList.remove('active');
|
|
}
|
|
}
|
|
/**
|
|
* Set preset button to active status
|
|
* @param {HTMLElement} button - event target element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setPresetButtonActive",
|
|
value: function _setPresetButtonActive() {
|
|
var button = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.defaultPresetButton;
|
|
forEach_default()(this._els.preset.querySelectorAll('.preset'), function (presetButton) {
|
|
presetButton.classList.remove('active');
|
|
});
|
|
|
|
if (button) {
|
|
button.classList.add('active');
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Crop;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_crop = (Crop);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/resize.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var resize = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tui-image-editor-submenu-align\">\n <div class=\"tui-image-editor-range-wrap tui-image-editor-newline\">\n <label class=\"range\">".concat(locale.localize('Width'), " </label>\n <div class=\"tie-width-range\"></div>\n <input class=\"tie-width-range-value tui-image-editor-range-value\" value=\"0\" /> <label>px</label>\n <div class=\"tui-image-editor-partition tui-image-editor-newline\"></div>\n <label class=\"range\">")).call(_context6, locale.localize('Height'), "</label>\n <div class=\"tie-height-range\"></div>\n <input class=\"tie-height-range-value tui-image-editor-range-value\" value=\"0\" /> <label>px</label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition tui-image-editor-newline\"></li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-submenu-align\">\n <div class=\"tui-image-editor-checkbox-wrap\">\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-lock-aspect-ratio\">\n <span>")).call(_context5, locale.localize('Lock Aspect Ratio'), "</span>\n </label>\n </div>\n </div>\n </li>\n <li class=\"tui-image-editor-partition tui-image-editor-newline\"></li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-partition tui-image-editor-newline\"></li>\n <li class=\"tie-resize-button action\">\n <div class=\"tui-image-editor-button apply\">\n ")).call(_context4, makeSvgIcon(['normal', 'active'], 'apply'), "\n <label>\n ")).call(_context3, locale.localize('Apply'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button cancel\">\n ")).call(_context2, makeSvgIcon(['normal', 'active'], 'cancel'), "\n <label>\n ")).call(_context, locale.localize('Cancel'), "\n </label>\n </div>\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/resize.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function resize_createSuper(Derived) { var hasNativeReflectConstruct = resize_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function resize_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Resize ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Resize = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Resize, _Submenu);
|
|
|
|
var _super = resize_createSuper(Resize);
|
|
|
|
function Resize(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Resize);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'resize',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: resize,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this.status = 'active';
|
|
_this._lockState = false;
|
|
/**
|
|
* Original dimensions
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._originalDimensions = null;
|
|
_this._els = {
|
|
widthRange: new range({
|
|
slider: _this.selector('.tie-width-range'),
|
|
input: _this.selector('.tie-width-range-value')
|
|
}, defaultResizePixelValues),
|
|
heightRange: new range({
|
|
slider: _this.selector('.tie-height-range'),
|
|
input: _this.selector('.tie-height-range-value')
|
|
}, defaultResizePixelValues),
|
|
lockAspectRatio: _this.selector('.tie-lock-aspect-ratio'),
|
|
apply: _this.selector('.tie-resize-button .apply'),
|
|
cancel: _this.selector('.tie-resize-button .cancel')
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Executed when the menu starts.
|
|
*/
|
|
|
|
|
|
_createClass(Resize, [{
|
|
key: "changeStartMode",
|
|
value: function changeStartMode() {
|
|
this.actions.modeChange('resize');
|
|
var dimensions = this.actions.getCurrentDimensions();
|
|
this._originalDimensions = dimensions;
|
|
this.setWidthValue(dimensions.width);
|
|
this.setHeightValue(dimensions.height);
|
|
}
|
|
/**
|
|
* Returns the menu to its default state.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStandbyMode",
|
|
value: function changeStandbyMode() {
|
|
this.actions.stopDrawingMode();
|
|
this.actions.reset(true);
|
|
}
|
|
/**
|
|
* Set dimension limits
|
|
* @param {object} limits - expect dimension limits for change
|
|
*/
|
|
|
|
}, {
|
|
key: "setLimit",
|
|
value: function setLimit(limits) {
|
|
this._els.widthRange.min = this.calcMinValue(limits.minWidth);
|
|
this._els.heightRange.min = this.calcMinValue(limits.minHeight);
|
|
this._els.widthRange.max = this.calcMaxValue(limits.maxWidth);
|
|
this._els.heightRange.max = this.calcMaxValue(limits.maxHeight);
|
|
}
|
|
/**
|
|
* Calculate max value
|
|
* @param {number} maxValue - max value
|
|
* @returns {number}
|
|
*/
|
|
|
|
}, {
|
|
key: "calcMaxValue",
|
|
value: function calcMaxValue(maxValue) {
|
|
if (maxValue <= 0) {
|
|
maxValue = defaultResizePixelValues.max;
|
|
}
|
|
|
|
return maxValue;
|
|
}
|
|
/**
|
|
* Calculate min value
|
|
* @param {number} minValue - min value
|
|
* @returns {number}
|
|
*/
|
|
|
|
}, {
|
|
key: "calcMinValue",
|
|
value: function calcMinValue(minValue) {
|
|
if (minValue <= 0) {
|
|
minValue = defaultResizePixelValues.min;
|
|
}
|
|
|
|
return minValue;
|
|
}
|
|
/**
|
|
* Set width value
|
|
* @param {number} value - expect value for widthRange change
|
|
* @param {boolean} trigger - fire change event control
|
|
*/
|
|
|
|
}, {
|
|
key: "setWidthValue",
|
|
value: function setWidthValue(value) {
|
|
var trigger = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
|
|
this._els.widthRange.value = value;
|
|
|
|
if (trigger) {
|
|
this._els.widthRange.trigger('change');
|
|
}
|
|
}
|
|
/**
|
|
* Set height value
|
|
* @param {number} value - expect value for heightRange change
|
|
* @param {boolean} trigger - fire change event control
|
|
*/
|
|
|
|
}, {
|
|
key: "setHeightValue",
|
|
value: function setHeightValue(value) {
|
|
var trigger = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
|
|
this._els.heightRange.value = value;
|
|
|
|
if (trigger) {
|
|
this._els.heightRange.trigger('change');
|
|
}
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
}, {
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for resize
|
|
* @param {Object} actions - actions for resize
|
|
* @param {Function} actions.resize - resize action
|
|
* @param {Function} actions.preview - preview action
|
|
* @param {Function} actions.getCurrentDimensions - Get current dimensions action
|
|
* @param {Function} actions.modeChange - change mode
|
|
* @param {Function} actions.stopDrawingMode - stop drawing mode
|
|
* @param {Function} actions.lockAspectRatio - lock aspect ratio
|
|
* @param {Function} actions.reset - reset action
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
this._els.widthRange.on('change', bind_default()(_context = this._changeWidthRangeHandler).call(_context, this));
|
|
|
|
this._els.heightRange.on('change', bind_default()(_context2 = this._changeHeightRangeHandler).call(_context2, this));
|
|
|
|
this._els.lockAspectRatio.addEventListener('change', bind_default()(_context3 = this._changeLockAspectRatio).call(_context3, this));
|
|
|
|
var apply = bind_default()(_context4 = this._applyEventHandler).call(_context4, this);
|
|
|
|
var cancel = bind_default()(_context5 = this._cancelEventHandler).call(_context5, this);
|
|
|
|
this.eventHandler = {
|
|
apply: apply,
|
|
cancel: cancel
|
|
};
|
|
this.actions = actions;
|
|
|
|
this._els.apply.addEventListener('click', apply);
|
|
|
|
this._els.cancel.addEventListener('click', cancel);
|
|
}
|
|
/**
|
|
* Change width
|
|
* @param {number} value - width range value
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeWidthRangeHandler",
|
|
value: function _changeWidthRangeHandler(value) {
|
|
this.actions.preview('width', toInteger(value), this._lockState);
|
|
}
|
|
/**
|
|
* Change height
|
|
* @param {number} value - height range value
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeHeightRangeHandler",
|
|
value: function _changeHeightRangeHandler(value) {
|
|
this.actions.preview('height', toInteger(value), this._lockState);
|
|
}
|
|
/**
|
|
* Change lock aspect ratio state
|
|
* @param {Event} event - aspect ratio check event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeLockAspectRatio",
|
|
value: function _changeLockAspectRatio(event) {
|
|
this._lockState = event.target.checked;
|
|
this.actions.lockAspectRatio(this._lockState, defaultResizePixelValues.min, defaultResizePixelValues.max);
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
this._els.apply.removeEventListener('click', this.eventHandler.apply);
|
|
|
|
this._els.cancel.removeEventListener('click', this.eventHandler.cancel);
|
|
}
|
|
}, {
|
|
key: "_applyEventHandler",
|
|
value: function _applyEventHandler() {
|
|
this.actions.resize();
|
|
|
|
this._els.apply.classList.remove('active');
|
|
}
|
|
}, {
|
|
key: "_cancelEventHandler",
|
|
value: function _cancelEventHandler() {
|
|
this.actions.reset();
|
|
|
|
this._els.cancel.classList.remove('active');
|
|
}
|
|
/**
|
|
* Change apply button status
|
|
* @param {Boolean} enableStatus - apply button status
|
|
*/
|
|
|
|
}, {
|
|
key: "changeApplyButtonStatus",
|
|
value: function changeApplyButtonStatus(enableStatus) {
|
|
if (enableStatus) {
|
|
this._els.apply.classList.add('active');
|
|
} else {
|
|
this._els.apply.classList.remove('active');
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Resize;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_resize = (Resize);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/flip.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var flip = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = "\n <ul class=\"tie-flip-button tui-image-editor-submenu-item\">\n <li>\n <div class=\"tui-image-editor-button flipX\">\n <div>\n ".concat(makeSvgIcon(['normal', 'active'], 'flip-x', true), "\n </div>\n <label>\n ")).call(_context5, locale.localize('Flip X'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button flipY\">\n <div>\n ")).call(_context4, makeSvgIcon(['normal', 'active'], 'flip-y', true), "\n </div>\n <label>\n ")).call(_context3, locale.localize('Flip Y'), "\n </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li>\n <div class=\"tui-image-editor-button resetFlip\">\n <div>\n ")).call(_context2, makeSvgIcon(['normal', 'active'], 'flip-reset', true), "\n </div>\n <label>\n ")).call(_context, locale.localize('Reset'), "\n </label>\n </div>\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/flip.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function flip_createSuper(Derived) { var hasNativeReflectConstruct = flip_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function flip_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Flip ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Flip = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Flip, _Submenu);
|
|
|
|
var _super = flip_createSuper(Flip);
|
|
|
|
function Flip(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Flip);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'flip',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: flip,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this.flipStatus = false;
|
|
_this._els = {
|
|
flipButton: _this.selector('.tie-flip-button')
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Flip, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for flip
|
|
* @param {Object} actions - actions for flip
|
|
* @param {Function} actions.flip - flip action
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context;
|
|
|
|
this.eventHandler.changeFlip = bind_default()(_context = this._changeFlip).call(_context, this);
|
|
this._actions = actions;
|
|
|
|
this._els.flipButton.addEventListener('click', this.eventHandler.changeFlip);
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
this._els.flipButton.removeEventListener('click', this.eventHandler.changeFlip);
|
|
}
|
|
/**
|
|
* change Flip status
|
|
* @param {object} event - change event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeFlip",
|
|
value: function _changeFlip(event) {
|
|
var _this2 = this;
|
|
|
|
var button = event.target.closest('.tui-image-editor-button');
|
|
|
|
if (button) {
|
|
var flipType = this.getButtonType(button, ['flipX', 'flipY', 'resetFlip']);
|
|
|
|
if (!this.flipStatus && flipType === 'resetFlip') {
|
|
return;
|
|
}
|
|
|
|
this._actions.flip(flipType).then(function (flipStatus) {
|
|
var flipClassList = _this2._els.flipButton.classList;
|
|
_this2.flipStatus = false;
|
|
flipClassList.remove('resetFlip');
|
|
forEach_default()(['flipX', 'flipY'], function (type) {
|
|
flipClassList.remove(type);
|
|
|
|
if (flipStatus[type]) {
|
|
flipClassList.add(type);
|
|
flipClassList.add('resetFlip');
|
|
_this2.flipStatus = true;
|
|
}
|
|
});
|
|
});
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Flip;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_flip = (Flip);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/rotate.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var rotate = (function (_ref) {
|
|
var _context, _context2;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tie-rotate-button\">\n <div class=\"tui-image-editor-button clockwise\">\n <div>\n ".concat(makeSvgIcon(['normal', 'active'], 'rotate-clockwise', true), "\n </div>\n <label> 30 </label>\n </div>\n <div class=\"tui-image-editor-button counterclockwise\">\n <div>\n ")).call(_context2, makeSvgIcon(['normal', 'active'], 'rotate-counterclockwise', true), "\n </div>\n <label> -30 </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-newline tui-image-editor-range-wrap\">\n <label class=\"range\">")).call(_context, locale.localize('Range'), "</label>\n <div class=\"tie-rotate-range\"></div>\n <input class=\"tie-rotate-range-value tui-image-editor-range-value\" value=\"0\" />\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/rotate.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function rotate_createSuper(Derived) { var hasNativeReflectConstruct = rotate_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function rotate_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var CLOCKWISE = 30;
|
|
var COUNTERCLOCKWISE = -30;
|
|
/**
|
|
* Rotate ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Rotate = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Rotate, _Submenu);
|
|
|
|
var _super = rotate_createSuper(Rotate);
|
|
|
|
function Rotate(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Rotate);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'rotate',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: rotate,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this._value = 0;
|
|
_this._els = {
|
|
rotateButton: _this.selector('.tie-rotate-button'),
|
|
rotateRange: new range({
|
|
slider: _this.selector('.tie-rotate-range'),
|
|
input: _this.selector('.tie-rotate-range-value')
|
|
}, defaultRotateRangeValues)
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Rotate, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
this._els.rotateRange.destroy();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
}, {
|
|
key: "setRangeBarAngle",
|
|
value: function setRangeBarAngle(type, angle) {
|
|
var resultAngle = angle;
|
|
|
|
if (type === 'rotate') {
|
|
resultAngle = parse_int_default()(this._els.rotateRange.value, 10) + angle;
|
|
}
|
|
|
|
this._setRangeBarRatio(resultAngle);
|
|
}
|
|
}, {
|
|
key: "_setRangeBarRatio",
|
|
value: function _setRangeBarRatio(angle) {
|
|
this._els.rotateRange.value = angle;
|
|
}
|
|
/**
|
|
* Add event for rotate
|
|
* @param {Object} actions - actions for crop
|
|
* @param {Function} actions.rotate - rotate action
|
|
* @param {Function} actions.setAngle - set angle action
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context, _context2;
|
|
|
|
this.eventHandler.rotationAngleChanged = bind_default()(_context = this._changeRotateForButton).call(_context, this); // {rotate, setAngle}
|
|
|
|
this.actions = actions;
|
|
|
|
this._els.rotateButton.addEventListener('click', this.eventHandler.rotationAngleChanged);
|
|
|
|
this._els.rotateRange.on('change', bind_default()(_context2 = this._changeRotateForRange).call(_context2, this));
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
this._els.rotateButton.removeEventListener('click', this.eventHandler.rotationAngleChanged);
|
|
|
|
this._els.rotateRange.off();
|
|
}
|
|
/**
|
|
* Change rotate for range
|
|
* @param {number} value - angle value
|
|
* @param {boolean} isLast - Is last change
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeRotateForRange",
|
|
value: function _changeRotateForRange(value, isLast) {
|
|
var angle = toInteger(value);
|
|
this.actions.setAngle(angle, !isLast);
|
|
this._value = angle;
|
|
}
|
|
/**
|
|
* Change rotate for button
|
|
* @param {object} event - add button event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeRotateForButton",
|
|
value: function _changeRotateForButton(event) {
|
|
var button = event.target.closest('.tui-image-editor-button');
|
|
var angle = this._els.rotateRange.value;
|
|
|
|
if (button) {
|
|
var rotateType = this.getButtonType(button, ['counterclockwise', 'clockwise']);
|
|
var rotateAngle = {
|
|
clockwise: CLOCKWISE,
|
|
counterclockwise: COUNTERCLOCKWISE
|
|
}[rotateType];
|
|
var newAngle = parse_int_default()(angle, 10) + rotateAngle;
|
|
var isRotatable = newAngle >= -360 && newAngle <= 360;
|
|
|
|
if (isRotatable) {
|
|
this.actions.rotate(rotateAngle);
|
|
}
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Rotate;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_rotate = (Rotate);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/text.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var submenu_text = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11, _context12, _context13;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = concat_default()(_context7 = concat_default()(_context8 = concat_default()(_context9 = concat_default()(_context10 = concat_default()(_context11 = concat_default()(_context12 = concat_default()(_context13 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tie-text-effect-button\">\n <div class=\"tui-image-editor-button bold\">\n <div>\n ".concat(makeSvgIcon(['normal', 'active'], 'text-bold', true), "\n </div>\n <label> ")).call(_context13, locale.localize('Bold'), " </label>\n </div>\n <div class=\"tui-image-editor-button italic\">\n <div>\n ")).call(_context12, makeSvgIcon(['normal', 'active'], 'text-italic', true), "\n </div>\n <label> ")).call(_context11, locale.localize('Italic'), " </label>\n </div>\n <div class=\"tui-image-editor-button underline\">\n <div>\n ")).call(_context10, makeSvgIcon(['normal', 'active'], 'text-underline', true), "\n </div>\n <label> ")).call(_context9, locale.localize('Underline'), " </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li class=\"tie-text-align-button\">\n <div class=\"tui-image-editor-button left\">\n <div>\n ")).call(_context8, makeSvgIcon(['normal', 'active'], 'text-align-left', true), "\n </div>\n <label> ")).call(_context7, locale.localize('Left'), " </label>\n </div>\n <div class=\"tui-image-editor-button center\">\n <div>\n ")).call(_context6, makeSvgIcon(['normal', 'active'], 'text-align-center', true), "\n </div>\n <label> ")).call(_context5, locale.localize('Center'), " </label>\n </div>\n <div class=\"tui-image-editor-button right\">\n <div>\n ")).call(_context4, makeSvgIcon(['normal', 'active'], 'text-align-right', true), "\n </div>\n <label> ")).call(_context3, locale.localize('Right'), " </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li>\n <div class=\"tie-text-color\" title=\"")).call(_context2, locale.localize('Color'), "\"></div>\n </li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-newline tui-image-editor-range-wrap\">\n <label class=\"range\">")).call(_context, locale.localize('Text size'), "</label>\n <div class=\"tie-text-range\"></div>\n <input class=\"tie-text-range-value tui-image-editor-range-value\" value=\"0\" />\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/text.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function text_createSuper(Derived) { var hasNativeReflectConstruct = text_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function text_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Crop ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Text = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Text, _Submenu);
|
|
|
|
var _super = text_createSuper(Text);
|
|
|
|
function Text(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Text);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'text',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: submenu_text,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this.effect = {
|
|
bold: false,
|
|
italic: false,
|
|
underline: false
|
|
};
|
|
_this.align = 'tie-text-align-left';
|
|
_this._els = {
|
|
textEffectButton: _this.selector('.tie-text-effect-button'),
|
|
textAlignButton: _this.selector('.tie-text-align-button'),
|
|
textColorpicker: new colorpicker(_this.selector('.tie-text-color'), {
|
|
defaultColor: '#ffbb3b',
|
|
toggleDirection: _this.toggleDirection,
|
|
usageStatistics: _this.usageStatistics
|
|
}),
|
|
textRange: new range({
|
|
slider: _this.selector('.tie-text-range'),
|
|
input: _this.selector('.tie-text-range-value')
|
|
}, defaultTextRangeValues)
|
|
};
|
|
_this.colorPickerInputBox = _this._els.textColorpicker.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX);
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Text, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
this._els.textColorpicker.destroy();
|
|
|
|
this._els.textRange.destroy();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for text
|
|
* @param {Object} actions - actions for text
|
|
* @param {Function} actions.changeTextStyle - change text style
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6;
|
|
|
|
var setTextEffect = bind_default()(_context = this._setTextEffectHandler).call(_context, this);
|
|
|
|
var setTextAlign = bind_default()(_context2 = this._setTextAlignHandler).call(_context2, this);
|
|
|
|
this.eventHandler = {
|
|
setTextEffect: setTextEffect,
|
|
setTextAlign: setTextAlign
|
|
};
|
|
this.actions = actions;
|
|
|
|
this._els.textEffectButton.addEventListener('click', setTextEffect);
|
|
|
|
this._els.textAlignButton.addEventListener('click', setTextAlign);
|
|
|
|
this._els.textRange.on('change', bind_default()(_context3 = this._changeTextRnageHandler).call(_context3, this));
|
|
|
|
this._els.textColorpicker.on('change', bind_default()(_context4 = this._changeColorHandler).call(_context4, this));
|
|
|
|
this.colorPickerInputBox.addEventListener(eventNames.FOCUS, bind_default()(_context5 = this._onStartEditingInputBox).call(_context5, this));
|
|
this.colorPickerInputBox.addEventListener(eventNames.BLUR, bind_default()(_context6 = this._onStopEditingInputBox).call(_context6, this));
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
var _context7, _context8;
|
|
|
|
var _this$eventHandler = this.eventHandler,
|
|
setTextEffect = _this$eventHandler.setTextEffect,
|
|
setTextAlign = _this$eventHandler.setTextAlign;
|
|
|
|
this._els.textEffectButton.removeEventListener('click', setTextEffect);
|
|
|
|
this._els.textAlignButton.removeEventListener('click', setTextAlign);
|
|
|
|
this._els.textRange.off();
|
|
|
|
this._els.textColorpicker.off();
|
|
|
|
this.colorPickerInputBox.removeEventListener(eventNames.FOCUS, bind_default()(_context7 = this._onStartEditingInputBox).call(_context7, this));
|
|
this.colorPickerInputBox.removeEventListener(eventNames.BLUR, bind_default()(_context8 = this._onStopEditingInputBox).call(_context8, this));
|
|
}
|
|
/**
|
|
* Returns the menu to its default state.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStandbyMode",
|
|
value: function changeStandbyMode() {
|
|
this.actions.stopDrawingMode();
|
|
}
|
|
/**
|
|
* Executed when the menu starts.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStartMode",
|
|
value: function changeStartMode() {
|
|
this.actions.modeChange('text');
|
|
}
|
|
/**
|
|
* Get text color
|
|
* @returns {string} - text color
|
|
*/
|
|
|
|
}, {
|
|
key: "textColor",
|
|
get: function get() {
|
|
return this._els.textColorpicker.color;
|
|
},
|
|
set: function set(color) {
|
|
this._els.textColorpicker.color = color;
|
|
}
|
|
/**
|
|
* Get text size
|
|
* @returns {string} - text size
|
|
*/
|
|
|
|
}, {
|
|
key: "fontSize",
|
|
get: function get() {
|
|
return this._els.textRange.value;
|
|
}
|
|
/**
|
|
* Set text size
|
|
* @param {Number} value - text size
|
|
*/
|
|
,
|
|
set: function set(value) {
|
|
this._els.textRange.value = value;
|
|
}
|
|
/**
|
|
* get font style
|
|
* @returns {string} - font style
|
|
*/
|
|
|
|
}, {
|
|
key: "fontStyle",
|
|
get: function get() {
|
|
return this.effect.italic ? 'italic' : 'normal';
|
|
}
|
|
/**
|
|
* get font weight
|
|
* @returns {string} - font weight
|
|
*/
|
|
|
|
}, {
|
|
key: "fontWeight",
|
|
get: function get() {
|
|
return this.effect.bold ? 'bold' : 'normal';
|
|
}
|
|
/**
|
|
* get text underline text underline
|
|
* @returns {boolean} - true or false
|
|
*/
|
|
|
|
}, {
|
|
key: "underline",
|
|
get: function get() {
|
|
return this.effect.underline;
|
|
}
|
|
}, {
|
|
key: "setTextStyleStateOnAction",
|
|
value: function setTextStyleStateOnAction() {
|
|
var textStyle = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
|
|
|
var fill = fill_default()(textStyle),
|
|
fontSize = textStyle.fontSize,
|
|
fontStyle = textStyle.fontStyle,
|
|
fontWeight = textStyle.fontWeight,
|
|
textDecoration = textStyle.textDecoration,
|
|
textAlign = textStyle.textAlign;
|
|
|
|
this.textColor = fill;
|
|
this.fontSize = fontSize;
|
|
this.setEffectState('italic', fontStyle);
|
|
this.setEffectState('bold', fontWeight);
|
|
this.setEffectState('underline', textDecoration);
|
|
this.setAlignState("tie-text-align-".concat(textAlign));
|
|
}
|
|
}, {
|
|
key: "setEffectState",
|
|
value: function setEffectState(effectName, value) {
|
|
var effectValue = value === 'italic' || value === 'bold' || value === 'underline';
|
|
|
|
var button = this._els.textEffectButton.querySelector(".tui-image-editor-button.".concat(effectName));
|
|
|
|
this.effect[effectName] = effectValue;
|
|
button.classList[effectValue ? 'add' : 'remove']('active');
|
|
}
|
|
}, {
|
|
key: "setAlignState",
|
|
value: function setAlignState(value) {
|
|
var button = this._els.textAlignButton;
|
|
button.classList.remove(this.align);
|
|
button.classList.add(value);
|
|
this.align = value;
|
|
}
|
|
/**
|
|
* text effect set handler
|
|
* @param {object} event - add button event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setTextEffectHandler",
|
|
value: function _setTextEffectHandler(event) {
|
|
var button = event.target.closest('.tui-image-editor-button');
|
|
|
|
if (button) {
|
|
var _button$className$mat = button.className.match(/(bold|italic|underline)/),
|
|
_button$className$mat2 = _slicedToArray(_button$className$mat, 1),
|
|
styleType = _button$className$mat2[0];
|
|
|
|
var styleObj = {
|
|
bold: {
|
|
fontWeight: 'bold'
|
|
},
|
|
italic: {
|
|
fontStyle: 'italic'
|
|
},
|
|
underline: {
|
|
textDecoration: 'underline'
|
|
}
|
|
}[styleType];
|
|
this.effect[styleType] = !this.effect[styleType];
|
|
button.classList.toggle('active');
|
|
this.actions.changeTextStyle(styleObj);
|
|
}
|
|
}
|
|
/**
|
|
* text effect set handler
|
|
* @param {object} event - add button event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setTextAlignHandler",
|
|
value: function _setTextAlignHandler(event) {
|
|
var button = event.target.closest('.tui-image-editor-button');
|
|
|
|
if (button) {
|
|
var styleType = this.getButtonType(button, ['left', 'center', 'right']);
|
|
var styleTypeAlias = "tie-text-align-".concat(styleType);
|
|
event.currentTarget.classList.remove(this.align);
|
|
|
|
if (this.align !== styleTypeAlias) {
|
|
event.currentTarget.classList.add(styleTypeAlias);
|
|
}
|
|
|
|
this.actions.changeTextStyle({
|
|
textAlign: styleType
|
|
});
|
|
this.align = styleTypeAlias;
|
|
}
|
|
}
|
|
/**
|
|
* text align set handler
|
|
* @param {number} value - range value
|
|
* @param {boolean} isLast - Is last change
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeTextRnageHandler",
|
|
value: function _changeTextRnageHandler(value, isLast) {
|
|
this.actions.changeTextStyle({
|
|
fontSize: value
|
|
}, !isLast);
|
|
}
|
|
/**
|
|
* change color handler
|
|
* @param {string} color - change color string
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeColorHandler",
|
|
value: function _changeColorHandler(color) {
|
|
color = color || 'transparent';
|
|
this.actions.changeTextStyle({
|
|
fill: color
|
|
});
|
|
}
|
|
}]);
|
|
|
|
return Text;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_text = (Text);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/mask.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var mask = (function (_ref) {
|
|
var _context, _context2, _context3;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li>\n <div class=\"tui-image-editor-button\">\n <div>\n <input type=\"file\" accept=\"image/*\" class=\"tie-mask-image-file\">\n ".concat(makeSvgIcon(['normal', 'active'], 'mask-load', true), "\n </div>\n <label> ")).call(_context3, locale.localize('Load Mask Image'), " </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tie-mask-apply tui-image-editor-newline apply\" style=\"margin-top: 22px;margin-bottom: 5px\">\n <div class=\"tui-image-editor-button apply\">\n ")).call(_context2, makeSvgIcon(['normal', 'active'], 'apply'), "\n <label>\n ")).call(_context, locale.localize('Apply'), "\n </label>\n </div>\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/mask.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function mask_createSuper(Derived) { var hasNativeReflectConstruct = mask_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function mask_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Mask ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Mask = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Mask, _Submenu);
|
|
|
|
var _super = mask_createSuper(Mask);
|
|
|
|
function Mask(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Mask);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'mask',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: mask,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this._els = {
|
|
applyButton: _this.selector('.tie-mask-apply'),
|
|
maskImageButton: _this.selector('.tie-mask-image-file')
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Mask, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for mask
|
|
* @param {Object} actions - actions for crop
|
|
* @param {Function} actions.loadImageFromURL - load image action
|
|
* @param {Function} actions.applyFilter - apply filter action
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context, _context2;
|
|
|
|
var loadMaskFile = bind_default()(_context = this._loadMaskFile).call(_context, this);
|
|
|
|
var applyMask = bind_default()(_context2 = this._applyMask).call(_context2, this);
|
|
|
|
this.eventHandler = {
|
|
loadMaskFile: loadMaskFile,
|
|
applyMask: applyMask
|
|
};
|
|
this.actions = actions;
|
|
|
|
this._els.maskImageButton.addEventListener('change', loadMaskFile);
|
|
|
|
this._els.applyButton.addEventListener('click', applyMask);
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
this._els.maskImageButton.removeEventListener('change', this.eventHandler.loadMaskFile);
|
|
|
|
this._els.applyButton.removeEventListener('click', this.eventHandler.applyMask);
|
|
}
|
|
/**
|
|
* Apply mask
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_applyMask",
|
|
value: function _applyMask() {
|
|
this.actions.applyFilter();
|
|
|
|
this._els.applyButton.classList.remove('active');
|
|
}
|
|
/**
|
|
* Load mask file
|
|
* @param {object} event - File change event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_loadMaskFile",
|
|
value: function _loadMaskFile(event) {
|
|
var imgUrl;
|
|
|
|
if (!isSupportFileApi()) {
|
|
alert('This browser does not support file-api');
|
|
}
|
|
|
|
var _event$target$files = _slicedToArray(event.target.files, 1),
|
|
file = _event$target$files[0];
|
|
|
|
if (file) {
|
|
imgUrl = url_default().createObjectURL(file);
|
|
this.actions.loadImageFromURL(imgUrl, file);
|
|
|
|
this._els.applyButton.classList.add('active');
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Mask;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_mask = (Mask);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/icon.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var icon = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11, _context12, _context13, _context14, _context15, _context16, _context17, _context18, _context19, _context20;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = concat_default()(_context7 = concat_default()(_context8 = concat_default()(_context9 = concat_default()(_context10 = concat_default()(_context11 = concat_default()(_context12 = concat_default()(_context13 = concat_default()(_context14 = concat_default()(_context15 = concat_default()(_context16 = concat_default()(_context17 = concat_default()(_context18 = concat_default()(_context19 = concat_default()(_context20 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tie-icon-add-button\">\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-arrow\">\n <div>\n ".concat(makeSvgIcon(['normal', 'active'], 'icon-arrow', true), "\n </div>\n <label>\n ")).call(_context20, locale.localize('Arrow'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-arrow-2\">\n <div>\n ")).call(_context19, makeSvgIcon(['normal', 'active'], 'icon-arrow-2', true), "\n </div>\n <label>\n ")).call(_context18, locale.localize('Arrow-2'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-arrow-3\">\n <div>\n ")).call(_context17, makeSvgIcon(['normal', 'active'], 'icon-arrow-3', true), "\n </div>\n <label>\n ")).call(_context16, locale.localize('Arrow-3'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-star\">\n <div>\n ")).call(_context15, makeSvgIcon(['normal', 'active'], 'icon-star', true), "\n </div>\n <label>\n ")).call(_context14, locale.localize('Star-1'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-star-2\">\n <div>\n ")).call(_context13, makeSvgIcon(['normal', 'active'], 'icon-star-2', true), "\n </div>\n <label>\n ")).call(_context12, locale.localize('Star-2'), "\n </label>\n </div>\n\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-polygon\">\n <div>\n ")).call(_context11, makeSvgIcon(['normal', 'active'], 'icon-polygon', true), "\n </div>\n <label>\n ")).call(_context10, locale.localize('Polygon'), "\n </label>\n </div>\n\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-location\">\n <div>\n ")).call(_context9, makeSvgIcon(['normal', 'active'], 'icon-location', true), "\n </div>\n <label>\n ")).call(_context8, locale.localize('Location'), "\n </label>\n </div>\n\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-heart\">\n <div>\n ")).call(_context7, makeSvgIcon(['normal', 'active'], 'icon-heart', true), "\n </div>\n <label>\n ")).call(_context6, locale.localize('Heart'), "\n </label>\n </div>\n\n <div class=\"tui-image-editor-button\" data-icontype=\"icon-bubble\">\n <div>\n ")).call(_context5, makeSvgIcon(['normal', 'active'], 'icon-bubble', true), "\n </div>\n <label>\n ")).call(_context4, locale.localize('Bubble'), "\n </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li class=\"tie-icon-add-button\">\n <div class=\"tui-image-editor-button\" style=\"margin:0\">\n <div>\n <input type=\"file\" accept=\"image/*\" class=\"tie-icon-image-file\">\n ")).call(_context3, makeSvgIcon(['normal', 'active'], 'icon-load', true), "\n </div>\n <label>\n ")).call(_context2, locale.localize('Custom icon'), "\n </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li>\n <div class=\"tie-icon-color\" title=\"")).call(_context, locale.localize('Color'), "\"></div>\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/icon.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function icon_createSuper(Derived) { var hasNativeReflectConstruct = icon_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function icon_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Icon ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Icon = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Icon, _Submenu);
|
|
|
|
var _super = icon_createSuper(Icon);
|
|
|
|
function Icon(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Icon);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'icon',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: icon,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this.iconType = null;
|
|
_this._iconMap = {};
|
|
_this._els = {
|
|
registerIconButton: _this.selector('.tie-icon-image-file'),
|
|
addIconButton: _this.selector('.tie-icon-add-button'),
|
|
iconColorpicker: new colorpicker(_this.selector('.tie-icon-color'), {
|
|
defaultColor: '#ffbb3b',
|
|
toggleDirection: _this.toggleDirection,
|
|
usageStatistics: _this.usageStatistics
|
|
})
|
|
};
|
|
_this.colorPickerInputBox = _this._els.iconColorpicker.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX);
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Icon, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
this._els.iconColorpicker.destroy();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for icon
|
|
* @param {Object} actions - actions for icon
|
|
* @param {Function} actions.registerCustomIcon - register icon
|
|
* @param {Function} actions.addIcon - add icon
|
|
* @param {Function} actions.changeColor - change icon color
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
var registerIcon = bind_default()(_context = this._registerIconHandler).call(_context, this);
|
|
|
|
var addIcon = bind_default()(_context2 = this._addIconHandler).call(_context2, this);
|
|
|
|
this.eventHandler = {
|
|
registerIcon: registerIcon,
|
|
addIcon: addIcon
|
|
};
|
|
this.actions = actions;
|
|
|
|
this._els.iconColorpicker.on('change', bind_default()(_context3 = this._changeColorHandler).call(_context3, this));
|
|
|
|
this._els.registerIconButton.addEventListener('change', registerIcon);
|
|
|
|
this._els.addIconButton.addEventListener('click', addIcon);
|
|
|
|
this.colorPickerInputBox.addEventListener(eventNames.FOCUS, bind_default()(_context4 = this._onStartEditingInputBox).call(_context4, this));
|
|
this.colorPickerInputBox.addEventListener(eventNames.BLUR, bind_default()(_context5 = this._onStopEditingInputBox).call(_context5, this));
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
var _context6, _context7;
|
|
|
|
this._els.iconColorpicker.off();
|
|
|
|
this._els.registerIconButton.removeEventListener('change', this.eventHandler.registerIcon);
|
|
|
|
this._els.addIconButton.removeEventListener('click', this.eventHandler.addIcon);
|
|
|
|
this.colorPickerInputBox.removeEventListener(eventNames.FOCUS, bind_default()(_context6 = this._onStartEditingInputBox).call(_context6, this));
|
|
this.colorPickerInputBox.removeEventListener(eventNames.BLUR, bind_default()(_context7 = this._onStopEditingInputBox).call(_context7, this));
|
|
}
|
|
/**
|
|
* Clear icon type
|
|
*/
|
|
|
|
}, {
|
|
key: "clearIconType",
|
|
value: function clearIconType() {
|
|
this._els.addIconButton.classList.remove(this.iconType);
|
|
|
|
this.iconType = null;
|
|
}
|
|
/**
|
|
* Register default icon
|
|
*/
|
|
|
|
}, {
|
|
key: "registerDefaultIcon",
|
|
value: function registerDefaultIcon() {
|
|
var _this2 = this;
|
|
|
|
forEach_default()(defaultIconPath, function (path, type) {
|
|
_this2.actions.registerDefaultIcons(type, path);
|
|
});
|
|
}
|
|
/**
|
|
* Set icon picker color
|
|
* @param {string} iconColor - rgb color string
|
|
*/
|
|
|
|
}, {
|
|
key: "setIconPickerColor",
|
|
value: function setIconPickerColor(iconColor) {
|
|
this._els.iconColorpicker.color = iconColor;
|
|
}
|
|
/**
|
|
* Returns the menu to its default state.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStandbyMode",
|
|
value: function changeStandbyMode() {
|
|
this.clearIconType();
|
|
this.actions.cancelAddIcon();
|
|
}
|
|
/**
|
|
* Change icon color
|
|
* @param {string} color - color for change
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeColorHandler",
|
|
value: function _changeColorHandler(color) {
|
|
color = color || 'transparent';
|
|
this.actions.changeColor(color);
|
|
}
|
|
/**
|
|
* Change icon color
|
|
* @param {object} event - add button event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addIconHandler",
|
|
value: function _addIconHandler(event) {
|
|
var button = event.target.closest('.tui-image-editor-button');
|
|
|
|
if (button) {
|
|
var iconType = button.getAttribute('data-icontype');
|
|
var iconColor = this._els.iconColorpicker.color;
|
|
this.actions.discardSelection();
|
|
this.actions.changeSelectableAll(false);
|
|
|
|
this._els.addIconButton.classList.remove(this.iconType);
|
|
|
|
this._els.addIconButton.classList.add(iconType);
|
|
|
|
if (this.iconType === iconType) {
|
|
this.changeStandbyMode();
|
|
} else {
|
|
this.actions.addIcon(iconType, iconColor);
|
|
this.iconType = iconType;
|
|
}
|
|
}
|
|
}
|
|
/**
|
|
* register icon
|
|
* @param {object} event - file change event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_registerIconHandler",
|
|
value: function _registerIconHandler(event) {
|
|
var imgUrl;
|
|
|
|
if (!isSupportFileApi) {
|
|
alert('This browser does not support file-api');
|
|
}
|
|
|
|
var _event$target$files = _slicedToArray(event.target.files, 1),
|
|
file = _event$target$files[0];
|
|
|
|
if (file) {
|
|
imgUrl = url_default().createObjectURL(file);
|
|
this.actions.registerCustomIcon(imgUrl, file);
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Icon;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_icon = (Icon);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/draw.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var draw = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tie-draw-line-select-button\">\n <div class=\"tui-image-editor-button free\">\n <div>\n ".concat(makeSvgIcon(['normal', 'active'], 'draw-free', true), "\n </div>\n <label>\n ")).call(_context5, locale.localize('Free'), "\n </label>\n </div>\n <div class=\"tui-image-editor-button line\">\n <div>\n ")).call(_context4, makeSvgIcon(['normal', 'active'], 'draw-line', true), "\n </div>\n <label>\n ")).call(_context3, locale.localize('Straight'), "\n </label>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li>\n <div class=\"tie-draw-color\" title=\"")).call(_context2, locale.localize('Color'), "\"></div>\n </li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-newline tui-image-editor-range-wrap\">\n <label class=\"range\">")).call(_context, locale.localize('Range'), "</label>\n <div class=\"tie-draw-range\"></div>\n <input class=\"tie-draw-range-value tui-image-editor-range-value\" value=\"0\" />\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/draw.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function draw_createSuper(Derived) { var hasNativeReflectConstruct = draw_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function draw_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var DRAW_OPACITY = 0.7;
|
|
/**
|
|
* Draw ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Draw = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Draw, _Submenu);
|
|
|
|
var _super = draw_createSuper(Draw);
|
|
|
|
function Draw(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Draw);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'draw',
|
|
makeSvgIcon: makeSvgIcon,
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: draw,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this._els = {
|
|
lineSelectButton: _this.selector('.tie-draw-line-select-button'),
|
|
drawColorPicker: new colorpicker(_this.selector('.tie-draw-color'), {
|
|
defaultColor: '#00a9ff',
|
|
toggleDirection: _this.toggleDirection,
|
|
usageStatistics: _this.usageStatistics
|
|
}),
|
|
drawRange: new range({
|
|
slider: _this.selector('.tie-draw-range'),
|
|
input: _this.selector('.tie-draw-range-value')
|
|
}, defaultDrawRangeValues)
|
|
};
|
|
_this.type = null;
|
|
_this.color = _this._els.drawColorPicker.color;
|
|
_this.width = _this._els.drawRange.value;
|
|
_this.colorPickerInputBox = _this._els.drawColorPicker.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX);
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Draw, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
this._els.drawColorPicker.destroy();
|
|
|
|
this._els.drawRange.destroy();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for draw
|
|
* @param {Object} actions - actions for crop
|
|
* @param {Function} actions.setDrawMode - set draw mode
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
this.eventHandler.changeDrawType = bind_default()(_context = this._changeDrawType).call(_context, this);
|
|
this.actions = actions;
|
|
|
|
this._els.lineSelectButton.addEventListener('click', this.eventHandler.changeDrawType);
|
|
|
|
this._els.drawColorPicker.on('change', bind_default()(_context2 = this._changeDrawColor).call(_context2, this));
|
|
|
|
this._els.drawRange.on('change', bind_default()(_context3 = this._changeDrawRange).call(_context3, this));
|
|
|
|
this.colorPickerInputBox.addEventListener(eventNames.FOCUS, bind_default()(_context4 = this._onStartEditingInputBox).call(_context4, this));
|
|
this.colorPickerInputBox.addEventListener(eventNames.BLUR, bind_default()(_context5 = this._onStopEditingInputBox).call(_context5, this));
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
var _context6, _context7;
|
|
|
|
this._els.lineSelectButton.removeEventListener('click', this.eventHandler.changeDrawType);
|
|
|
|
this._els.drawColorPicker.off();
|
|
|
|
this._els.drawRange.off();
|
|
|
|
this.colorPickerInputBox.removeEventListener(eventNames.FOCUS, bind_default()(_context6 = this._onStartEditingInputBox).call(_context6, this));
|
|
this.colorPickerInputBox.removeEventListener(eventNames.BLUR, bind_default()(_context7 = this._onStopEditingInputBox).call(_context7, this));
|
|
}
|
|
/**
|
|
* set draw mode - action runner
|
|
*/
|
|
|
|
}, {
|
|
key: "setDrawMode",
|
|
value: function setDrawMode() {
|
|
this.actions.setDrawMode(this.type, {
|
|
width: this.width,
|
|
color: getRgb(this.color, DRAW_OPACITY)
|
|
});
|
|
}
|
|
/**
|
|
* Returns the menu to its default state.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStandbyMode",
|
|
value: function changeStandbyMode() {
|
|
this.type = null;
|
|
this.actions.stopDrawingMode();
|
|
this.actions.changeSelectableAll(true);
|
|
|
|
this._els.lineSelectButton.classList.remove('free');
|
|
|
|
this._els.lineSelectButton.classList.remove('line');
|
|
}
|
|
/**
|
|
* Executed when the menu starts.
|
|
*/
|
|
|
|
}, {
|
|
key: "changeStartMode",
|
|
value: function changeStartMode() {
|
|
this.type = 'free';
|
|
|
|
this._els.lineSelectButton.classList.add('free');
|
|
|
|
this.setDrawMode();
|
|
}
|
|
/**
|
|
* Change draw type event
|
|
* @param {object} event - line select event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeDrawType",
|
|
value: function _changeDrawType(event) {
|
|
var button = event.target.closest('.tui-image-editor-button');
|
|
|
|
if (button) {
|
|
var lineType = this.getButtonType(button, ['free', 'line']);
|
|
this.actions.discardSelection();
|
|
|
|
if (this.type === lineType) {
|
|
this.changeStandbyMode();
|
|
return;
|
|
}
|
|
|
|
this.changeStandbyMode();
|
|
this.type = lineType;
|
|
|
|
this._els.lineSelectButton.classList.add(lineType);
|
|
|
|
this.setDrawMode();
|
|
}
|
|
}
|
|
/**
|
|
* Change drawing color
|
|
* @param {string} color - select drawing color
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeDrawColor",
|
|
value: function _changeDrawColor(color) {
|
|
this.color = color || 'transparent';
|
|
|
|
if (!this.type) {
|
|
this.changeStartMode();
|
|
} else {
|
|
this.setDrawMode();
|
|
}
|
|
}
|
|
/**
|
|
* Change drawing Range
|
|
* @param {number} value - select drawing range
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeDrawRange",
|
|
value: function _changeDrawRange(value) {
|
|
this.width = value;
|
|
|
|
if (!this.type) {
|
|
this.changeStartMode();
|
|
} else {
|
|
this.setDrawMode();
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Draw;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_draw = (Draw);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/type/isExisty.js
|
|
var isExisty = __webpack_require__(9886);
|
|
var isExisty_default = /*#__PURE__*/__webpack_require__.n(isExisty);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/filter.js
|
|
|
|
|
|
/**
|
|
* @param {Locale} locale - Translate text
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var filter = (function (_ref) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11, _context12, _context13, _context14, _context15, _context16;
|
|
|
|
var locale = _ref.locale;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = concat_default()(_context4 = concat_default()(_context5 = concat_default()(_context6 = concat_default()(_context7 = concat_default()(_context8 = concat_default()(_context9 = concat_default()(_context10 = concat_default()(_context11 = concat_default()(_context12 = concat_default()(_context13 = concat_default()(_context14 = concat_default()(_context15 = concat_default()(_context16 = "\n <ul class=\"tui-image-editor-submenu-item\">\n <li class=\"tui-image-editor-submenu-align\">\n <div class=\"tui-image-editor-checkbox-wrap fixed-width\">\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-grayscale\">\n <span>".concat(locale.localize('Grayscale'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-invert\">\n <span>")).call(_context16, locale.localize('Invert'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-sepia\">\n <span>")).call(_context15, locale.localize('Sepia'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-vintage\">\n <span>")).call(_context14, locale.localize('Sepia2'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-blur\">\n <span>")).call(_context13, locale.localize('Blur'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-sharpen\">\n <span>")).call(_context12, locale.localize('Sharpen'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-emboss\">\n <span>")).call(_context11, locale.localize('Emboss'), "</span>\n </label>\n </div>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-submenu-align\">\n <div class=\"tui-image-editor-checkbox-group tui-image-editor-disabled\" style=\"margin-bottom: 7px;\">\n <div class=\"tui-image-editor-checkbox-wrap\">\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-remove-white\">\n <span>")).call(_context10, locale.localize('Remove White'), "</span>\n </label>\n </div>\n </div>\n <div class=\"tui-image-editor-newline tui-image-editor-range-wrap short\">\n <label>")).call(_context9, locale.localize('Distance'), "</label>\n <div class=\"tie-removewhite-distance-range\"></div>\n </div>\n </div>\n <div class=\"tui-image-editor-checkbox-group tui-image-editor-disabled\">\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-brightness\">\n <span>")).call(_context8, locale.localize('Brightness'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-range-wrap short\">\n <div class=\"tie-brightness-range\"></div>\n </div>\n </div>\n <div class=\"tui-image-editor-checkbox-group tui-image-editor-disabled\">\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-noise\">\n <span>")).call(_context7, locale.localize('Noise'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-range-wrap short\">\n <div class=\"tie-noise-range\"></div>\n </div>\n </div>\n </li>\n <li class=\"tui-image-editor-partition only-left-right\">\n <div></div>\n </li>\n <li class=\"tui-image-editor-submenu-align\">\n <div class=\"tui-image-editor-checkbox-group tui-image-editor-disabled\">\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-pixelate\">\n <span>")).call(_context6, locale.localize('Pixelate'), "</span>\n </label>\n </div>\n <div class=\"tui-image-editor-range-wrap short\">\n <div class=\"tie-pixelate-range\"></div>\n </div>\n </div>\n <div class=\"tui-image-editor-checkbox-group tui-image-editor-disabled\">\n <div class=\"tui-image-editor-newline tui-image-editor-checkbox-wrap\">\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-color-filter\">\n <span>")).call(_context5, locale.localize('Color Filter'), "</span>\n </label>\n </div>\n </div>\n <div class=\"tui-image-editor-newline tui-image-editor-range-wrap short\">\n <label>")).call(_context4, locale.localize('Threshold'), "</label>\n <div class=\"tie-colorfilter-threshold-range\"></div>\n </div>\n </div>\n </li>\n <li class=\"tui-image-editor-partition\">\n <div></div>\n </li>\n <li>\n <div class=\"filter-color-item\">\n <div class=\"tie-filter-tint-color\" title=\"")).call(_context3, locale.localize('Tint'), "\"></div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-tint\">\n <span></span>\n </label>\n </div>\n </div>\n <div class=\"filter-color-item\">\n <div class=\"tie-filter-multiply-color\" title=\"")).call(_context2, locale.localize('Multiply'), "\"></div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-multiply\">\n <span></span>\n </label>\n </div>\n </div>\n <div class=\"filter-color-item\">\n <div class=\"tie-filter-blend-color\" title=\"")).call(_context, locale.localize('Blend'), "\"></div>\n <div class=\"tui-image-editor-checkbox\">\n <label>\n <input type=\"checkbox\" class=\"tie-blend\">\n <span></span>\n </label>\n </div>\n </div>\n </li>\n </ul>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/filter.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function filter_createSuper(Derived) { var hasNativeReflectConstruct = filter_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function filter_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var PICKER_CONTROL_HEIGHT = '130px';
|
|
var BLEND_OPTIONS = ['add', 'diff', 'subtract', 'multiply', 'screen', 'lighten', 'darken'];
|
|
var FILTER_OPTIONS = ['grayscale', 'invert', 'sepia', 'vintage', 'blur', 'sharpen', 'emboss', 'remove-white', 'brightness', 'noise', 'pixelate', 'color-filter', 'tint', 'multiply', 'blend'];
|
|
var filterNameMap = {
|
|
grayscale: 'grayscale',
|
|
invert: 'invert',
|
|
sepia: 'sepia',
|
|
blur: 'blur',
|
|
sharpen: 'sharpen',
|
|
emboss: 'emboss',
|
|
removeWhite: 'removeColor',
|
|
brightness: 'brightness',
|
|
contrast: 'contrast',
|
|
saturation: 'saturation',
|
|
vintage: 'vintage',
|
|
polaroid: 'polaroid',
|
|
noise: 'noise',
|
|
pixelate: 'pixelate',
|
|
colorFilter: 'removeColor',
|
|
tint: 'blendColor',
|
|
multiply: 'blendColor',
|
|
blend: 'blendColor',
|
|
hue: 'hue',
|
|
gamma: 'gamma'
|
|
};
|
|
var RANGE_INSTANCE_NAMES = ['removewhiteDistanceRange', 'colorfilterThresholdRange', 'pixelateRange', 'noiseRange', 'brightnessRange', 'tintOpacity'];
|
|
var COLORPICKER_INSTANCE_NAMES = ['filterBlendColor', 'filterMultiplyColor', 'filterTintColor'];
|
|
/**
|
|
* Filter ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var Filter = /*#__PURE__*/function (_Submenu) {
|
|
_inherits(Filter, _Submenu);
|
|
|
|
var _super = filter_createSuper(Filter);
|
|
|
|
function Filter(subMenuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
menuBarPosition = _ref.menuBarPosition,
|
|
usageStatistics = _ref.usageStatistics;
|
|
|
|
_classCallCheck(this, Filter);
|
|
|
|
_this = _super.call(this, subMenuElement, {
|
|
locale: locale,
|
|
name: 'filter',
|
|
menuBarPosition: menuBarPosition,
|
|
templateHtml: filter,
|
|
usageStatistics: usageStatistics
|
|
});
|
|
_this.selectBoxShow = false;
|
|
_this.checkedMap = {};
|
|
|
|
_this._makeControlElement();
|
|
|
|
return _this;
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Filter, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeEvent();
|
|
|
|
this._destroyToolInstance();
|
|
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Remove event for filter
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeEvent",
|
|
value: function _removeEvent() {
|
|
var _this2 = this,
|
|
_context;
|
|
|
|
forEach_default()(FILTER_OPTIONS, function (filter) {
|
|
var filterCheckElement = _this2.selector(".tie-".concat(filter));
|
|
|
|
var filterNameCamelCase = toCamelCase(filter);
|
|
filterCheckElement.removeEventListener('change', _this2.eventHandler[filterNameCamelCase]);
|
|
});
|
|
forEach_default()(concat_default()(_context = []).call(_context, RANGE_INSTANCE_NAMES, COLORPICKER_INSTANCE_NAMES), function (instanceName) {
|
|
_this2._els[instanceName].off();
|
|
});
|
|
|
|
this._els.blendType.removeEventListener('change', this.eventHandler.changeBlendFilter);
|
|
|
|
this._els.blendType.removeEventListener('click', this.eventHandler.changeBlendFilter);
|
|
|
|
forEachArray_default()(this.colorPickerInputBoxes, function (inputBox) {
|
|
var _context2, _context3;
|
|
|
|
inputBox.removeEventListener(eventNames.FOCUS, bind_default()(_context2 = _this2._onStartEditingInputBox).call(_context2, _this2));
|
|
inputBox.removeEventListener(eventNames.BLUR, bind_default()(_context3 = _this2._onStopEditingInputBox).call(_context3, _this2));
|
|
}, this);
|
|
}
|
|
}, {
|
|
key: "_destroyToolInstance",
|
|
value: function _destroyToolInstance() {
|
|
var _context4,
|
|
_this3 = this;
|
|
|
|
forEach_default()(concat_default()(_context4 = []).call(_context4, RANGE_INSTANCE_NAMES, COLORPICKER_INSTANCE_NAMES), function (instanceName) {
|
|
_this3._els[instanceName].destroy();
|
|
});
|
|
}
|
|
/**
|
|
* Add event for filter
|
|
* @param {Object} actions - actions for crop
|
|
* @param {Function} actions.applyFilter - apply filter option
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(_ref2) {
|
|
var _this4 = this,
|
|
_context6,
|
|
_context7,
|
|
_context8;
|
|
|
|
var applyFilter = _ref2.applyFilter;
|
|
|
|
var changeFilterState = function changeFilterState(filterName) {
|
|
var _context5;
|
|
|
|
return bind_default()(_context5 = _this4._changeFilterState).call(_context5, _this4, applyFilter, filterName);
|
|
};
|
|
|
|
var changeFilterStateForRange = function changeFilterStateForRange(filterName) {
|
|
return function (value, isLast) {
|
|
return _this4._changeFilterState(applyFilter, filterName, isLast);
|
|
};
|
|
};
|
|
|
|
this.eventHandler = {
|
|
changeBlendFilter: changeFilterState('blend'),
|
|
blandTypeClick: function blandTypeClick(event) {
|
|
return event.stopPropagation();
|
|
}
|
|
};
|
|
forEach_default()(FILTER_OPTIONS, function (filter) {
|
|
var filterCheckElement = _this4.selector(".tie-".concat(filter));
|
|
|
|
var filterNameCamelCase = toCamelCase(filter);
|
|
_this4.checkedMap[filterNameCamelCase] = filterCheckElement;
|
|
_this4.eventHandler[filterNameCamelCase] = changeFilterState(filterNameCamelCase);
|
|
filterCheckElement.addEventListener('change', _this4.eventHandler[filterNameCamelCase]);
|
|
});
|
|
|
|
this._els.removewhiteDistanceRange.on('change', changeFilterStateForRange('removeWhite'));
|
|
|
|
this._els.colorfilterThresholdRange.on('change', changeFilterStateForRange('colorFilter'));
|
|
|
|
this._els.pixelateRange.on('change', changeFilterStateForRange('pixelate'));
|
|
|
|
this._els.noiseRange.on('change', changeFilterStateForRange('noise'));
|
|
|
|
this._els.brightnessRange.on('change', changeFilterStateForRange('brightness'));
|
|
|
|
this._els.filterBlendColor.on('change', this.eventHandler.changeBlendFilter);
|
|
|
|
this._els.filterMultiplyColor.on('change', changeFilterState('multiply'));
|
|
|
|
this._els.filterTintColor.on('change', changeFilterState('tint'));
|
|
|
|
this._els.tintOpacity.on('change', changeFilterStateForRange('tint'));
|
|
|
|
this._els.filterMultiplyColor.on('changeShow', bind_default()(_context6 = this.colorPickerChangeShow).call(_context6, this));
|
|
|
|
this._els.filterTintColor.on('changeShow', bind_default()(_context7 = this.colorPickerChangeShow).call(_context7, this));
|
|
|
|
this._els.filterBlendColor.on('changeShow', bind_default()(_context8 = this.colorPickerChangeShow).call(_context8, this));
|
|
|
|
this._els.blendType.addEventListener('change', this.eventHandler.changeBlendFilter);
|
|
|
|
this._els.blendType.addEventListener('click', this.eventHandler.blandTypeClick);
|
|
|
|
forEachArray_default()(this.colorPickerInputBoxes, function (inputBox) {
|
|
var _context9, _context10;
|
|
|
|
inputBox.addEventListener(eventNames.FOCUS, bind_default()(_context9 = _this4._onStartEditingInputBox).call(_context9, _this4));
|
|
inputBox.addEventListener(eventNames.BLUR, bind_default()(_context10 = _this4._onStopEditingInputBox).call(_context10, _this4));
|
|
}, this);
|
|
}
|
|
/**
|
|
* Set filter for undo changed
|
|
* @param {Object} changedFilterInfos - changed command infos
|
|
* @param {string} type - filter type
|
|
* @param {string} action - add or remove
|
|
* @param {Object} options - filter options
|
|
*/
|
|
|
|
}, {
|
|
key: "setFilterState",
|
|
value: function setFilterState(changedFilterInfos) {
|
|
var type = changedFilterInfos.type,
|
|
options = changedFilterInfos.options,
|
|
action = changedFilterInfos.action;
|
|
|
|
var filterName = this._getFilterNameFromOptions(type, options);
|
|
|
|
var isRemove = action === 'remove';
|
|
|
|
if (!isRemove) {
|
|
this._setFilterState(filterName, options);
|
|
}
|
|
|
|
this.checkedMap[filterName].checked = !isRemove;
|
|
}
|
|
/**
|
|
* Init all filter's checkbox to unchecked state
|
|
*/
|
|
|
|
}, {
|
|
key: "initFilterCheckBoxState",
|
|
value: function initFilterCheckBoxState() {
|
|
forEach_default()(this.checkedMap, function (filter) {
|
|
filter.checked = false;
|
|
}, this);
|
|
}
|
|
/**
|
|
* Set filter for undo changed
|
|
* @param {string} filterName - filter name
|
|
* @param {Object} options - filter options
|
|
* @private
|
|
*/
|
|
// eslint-disable-next-line complexity
|
|
|
|
}, {
|
|
key: "_setFilterState",
|
|
value: function _setFilterState(filterName, options) {
|
|
if (filterName === 'colorFilter') {
|
|
this._els.colorfilterThresholdRange.value = options.distance;
|
|
} else if (filterName === 'removeWhite') {
|
|
this._els.removewhiteDistanceRange.value = options.distance;
|
|
} else if (filterName === 'pixelate') {
|
|
this._els.pixelateRange.value = options.blocksize;
|
|
} else if (filterName === 'brightness') {
|
|
this._els.brightnessRange.value = options.brightness;
|
|
} else if (filterName === 'noise') {
|
|
this._els.noiseRange.value = options.noise;
|
|
} else if (filterName === 'tint') {
|
|
this._els.tintOpacity.value = options.alpha;
|
|
this._els.filterTintColor.color = options.color;
|
|
} else if (filterName === 'blend') {
|
|
this._els.filterBlendColor.color = options.color;
|
|
} else if (filterName === 'multiply') {
|
|
this._els.filterMultiplyColor.color = options.color;
|
|
}
|
|
}
|
|
/**
|
|
* Get filter name
|
|
* @param {string} type - filter type
|
|
* @param {Object} options - filter options
|
|
* @returns {string} filter name
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getFilterNameFromOptions",
|
|
value: function _getFilterNameFromOptions(type, options) {
|
|
var filterName = type;
|
|
|
|
if (type === 'removeColor') {
|
|
filterName = isExisty_default()(options.useAlpha) ? 'removeWhite' : 'colorFilter';
|
|
} else if (type === 'blendColor') {
|
|
filterName = {
|
|
add: 'blend',
|
|
multiply: 'multiply',
|
|
tint: 'tint'
|
|
}[options.mode];
|
|
}
|
|
|
|
return filterName;
|
|
}
|
|
/**
|
|
* Add event for filter
|
|
* @param {Function} applyFilter - actions for firter
|
|
* @param {string} filterName - filter name
|
|
* @param {boolean} [isLast] - Is last change
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeFilterState",
|
|
value: function _changeFilterState(applyFilter, filterName) {
|
|
var isLast = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;
|
|
var apply = this.checkedMap[filterName].checked;
|
|
var type = filterNameMap[filterName];
|
|
var checkboxGroup = this.checkedMap[filterName].closest('.tui-image-editor-checkbox-group');
|
|
|
|
if (checkboxGroup) {
|
|
if (apply) {
|
|
checkboxGroup.classList.remove('tui-image-editor-disabled');
|
|
} else {
|
|
checkboxGroup.classList.add('tui-image-editor-disabled');
|
|
}
|
|
}
|
|
|
|
applyFilter(apply, type, this._getFilterOption(filterName), !isLast);
|
|
}
|
|
/**
|
|
* Get filter option
|
|
* @param {String} type - filter type
|
|
* @returns {Object} filter option object
|
|
* @private
|
|
*/
|
|
// eslint-disable-next-line complexity
|
|
|
|
}, {
|
|
key: "_getFilterOption",
|
|
value: function _getFilterOption(type) {
|
|
var option = {};
|
|
|
|
switch (type) {
|
|
case 'removeWhite':
|
|
option.color = '#FFFFFF';
|
|
option.useAlpha = false;
|
|
option.distance = parse_float_default()(this._els.removewhiteDistanceRange.value);
|
|
break;
|
|
|
|
case 'colorFilter':
|
|
option.color = '#FFFFFF';
|
|
option.distance = parse_float_default()(this._els.colorfilterThresholdRange.value);
|
|
break;
|
|
|
|
case 'pixelate':
|
|
option.blocksize = toInteger(this._els.pixelateRange.value);
|
|
break;
|
|
|
|
case 'noise':
|
|
option.noise = toInteger(this._els.noiseRange.value);
|
|
break;
|
|
|
|
case 'brightness':
|
|
option.brightness = parse_float_default()(this._els.brightnessRange.value);
|
|
break;
|
|
|
|
case 'blend':
|
|
option.mode = 'add';
|
|
option.color = this._els.filterBlendColor.color;
|
|
option.mode = this._els.blendType.value;
|
|
break;
|
|
|
|
case 'multiply':
|
|
option.mode = 'multiply';
|
|
option.color = this._els.filterMultiplyColor.color;
|
|
break;
|
|
|
|
case 'tint':
|
|
option.mode = 'tint';
|
|
option.color = this._els.filterTintColor.color;
|
|
option.alpha = this._els.tintOpacity.value;
|
|
break;
|
|
|
|
case 'blur':
|
|
option.blur = this._els.blurRange.value;
|
|
break;
|
|
|
|
default:
|
|
break;
|
|
}
|
|
|
|
return option;
|
|
}
|
|
/**
|
|
* Make submenu range and colorpicker control
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeControlElement",
|
|
value: function _makeControlElement() {
|
|
this._els = {
|
|
removewhiteDistanceRange: new range({
|
|
slider: this.selector('.tie-removewhite-distance-range')
|
|
}, defaultFilterRangeValues.removewhiteDistanceRange),
|
|
brightnessRange: new range({
|
|
slider: this.selector('.tie-brightness-range')
|
|
}, defaultFilterRangeValues.brightnessRange),
|
|
noiseRange: new range({
|
|
slider: this.selector('.tie-noise-range')
|
|
}, defaultFilterRangeValues.noiseRange),
|
|
pixelateRange: new range({
|
|
slider: this.selector('.tie-pixelate-range')
|
|
}, defaultFilterRangeValues.pixelateRange),
|
|
colorfilterThresholdRange: new range({
|
|
slider: this.selector('.tie-colorfilter-threshold-range')
|
|
}, defaultFilterRangeValues.colorfilterThresholdRange),
|
|
filterTintColor: new colorpicker(this.selector('.tie-filter-tint-color'), {
|
|
defaultColor: '#03bd9e',
|
|
toggleDirection: this.toggleDirection,
|
|
usageStatistics: this.usageStatistics
|
|
}),
|
|
filterMultiplyColor: new colorpicker(this.selector('.tie-filter-multiply-color'), {
|
|
defaultColor: '#515ce6',
|
|
toggleDirection: this.toggleDirection,
|
|
usageStatistics: this.usageStatistics
|
|
}),
|
|
filterBlendColor: new colorpicker(this.selector('.tie-filter-blend-color'), {
|
|
defaultColor: '#ffbb3b',
|
|
toggleDirection: this.toggleDirection,
|
|
usageStatistics: this.usageStatistics
|
|
}),
|
|
blurRange: defaultFilterRangeValues.blurFilterRange
|
|
};
|
|
this._els.tintOpacity = this._pickerWithRange(this._els.filterTintColor.pickerControl);
|
|
this._els.blendType = this._pickerWithSelectbox(this._els.filterBlendColor.pickerControl);
|
|
this.colorPickerControls.push(this._els.filterTintColor);
|
|
this.colorPickerControls.push(this._els.filterMultiplyColor);
|
|
this.colorPickerControls.push(this._els.filterBlendColor);
|
|
this.colorPickerInputBoxes = [];
|
|
this.colorPickerInputBoxes.push(this._els.filterTintColor.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX));
|
|
this.colorPickerInputBoxes.push(this._els.filterMultiplyColor.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX));
|
|
this.colorPickerInputBoxes.push(this._els.filterBlendColor.colorpickerElement.querySelector(selectorNames.COLOR_PICKER_INPUT_BOX));
|
|
}
|
|
/**
|
|
* Make submenu control for picker & range mixin
|
|
* @param {HTMLElement} pickerControl - pickerControl dom element
|
|
* @returns {Range}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_pickerWithRange",
|
|
value: function _pickerWithRange(pickerControl) {
|
|
var rangeWrap = document.createElement('div');
|
|
var rangeLabel = document.createElement('label');
|
|
var slider = document.createElement('div');
|
|
slider.id = 'tie-filter-tint-opacity';
|
|
rangeLabel.innerHTML = 'Opacity';
|
|
rangeWrap.appendChild(rangeLabel);
|
|
rangeWrap.appendChild(slider);
|
|
pickerControl.appendChild(rangeWrap);
|
|
pickerControl.style.height = PICKER_CONTROL_HEIGHT;
|
|
return new range({
|
|
slider: slider
|
|
}, defaultFilterRangeValues.tintOpacityRange);
|
|
}
|
|
/**
|
|
* Make submenu control for picker & selectbox
|
|
* @param {HTMLElement} pickerControl - pickerControl dom element
|
|
* @returns {HTMLElement}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_pickerWithSelectbox",
|
|
value: function _pickerWithSelectbox(pickerControl) {
|
|
var selectlistWrap = document.createElement('div');
|
|
var selectlist = document.createElement('select');
|
|
var optionlist = document.createElement('ul');
|
|
selectlistWrap.className = 'tui-image-editor-selectlist-wrap';
|
|
optionlist.className = 'tui-image-editor-selectlist';
|
|
selectlistWrap.appendChild(selectlist);
|
|
selectlistWrap.appendChild(optionlist);
|
|
|
|
this._makeSelectOptionList(selectlist);
|
|
|
|
pickerControl.appendChild(selectlistWrap);
|
|
pickerControl.style.height = PICKER_CONTROL_HEIGHT;
|
|
|
|
this._drawSelectOptionList(selectlist, optionlist);
|
|
|
|
this._pickerWithSelectboxForAddEvent(selectlist, optionlist);
|
|
|
|
return selectlist;
|
|
}
|
|
/**
|
|
* Make selectbox option list custom style
|
|
* @param {HTMLElement} selectlist - selectbox element
|
|
* @param {HTMLElement} optionlist - custom option list item element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_drawSelectOptionList",
|
|
value: function _drawSelectOptionList(selectlist, optionlist) {
|
|
var options = selectlist.querySelectorAll('option');
|
|
forEach_default()(options, function (option) {
|
|
var optionElement = document.createElement('li');
|
|
optionElement.innerHTML = option.innerHTML;
|
|
optionElement.setAttribute('data-item', option.value);
|
|
optionlist.appendChild(optionElement);
|
|
});
|
|
}
|
|
/**
|
|
* custom selectbox custom event
|
|
* @param {HTMLElement} selectlist - selectbox element
|
|
* @param {HTMLElement} optionlist - custom option list item element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_pickerWithSelectboxForAddEvent",
|
|
value: function _pickerWithSelectboxForAddEvent(selectlist, optionlist) {
|
|
var _this5 = this;
|
|
|
|
optionlist.addEventListener('click', function (event) {
|
|
var optionValue = event.target.getAttribute('data-item');
|
|
var fireEvent = document.createEvent('HTMLEvents');
|
|
selectlist.querySelector("[value=\"".concat(optionValue, "\"]")).selected = true;
|
|
fireEvent.initEvent('change', true, true);
|
|
selectlist.dispatchEvent(fireEvent);
|
|
_this5.selectBoxShow = false;
|
|
optionlist.style.display = 'none';
|
|
});
|
|
selectlist.addEventListener('mousedown', function (event) {
|
|
event.preventDefault();
|
|
_this5.selectBoxShow = !_this5.selectBoxShow;
|
|
optionlist.style.display = _this5.selectBoxShow ? 'block' : 'none';
|
|
optionlist.setAttribute('data-selectitem', selectlist.value);
|
|
optionlist.querySelector("[data-item='".concat(selectlist.value, "']")).classList.add('active');
|
|
});
|
|
}
|
|
/**
|
|
* Make option list for select control
|
|
* @param {HTMLElement} selectlist - blend option select list element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeSelectOptionList",
|
|
value: function _makeSelectOptionList(selectlist) {
|
|
forEach_default()(BLEND_OPTIONS, function (option) {
|
|
var selectOption = document.createElement('option');
|
|
selectOption.setAttribute('value', option);
|
|
selectOption.innerHTML = option.replace(/^[a-z]/, function ($0) {
|
|
return $0.toUpperCase();
|
|
});
|
|
selectlist.appendChild(selectOption);
|
|
});
|
|
}
|
|
}]);
|
|
|
|
return Filter;
|
|
}(submenuBase);
|
|
|
|
/* harmony default export */ var ui_filter = (Filter);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/number/parse-int.js
|
|
var number_parse_int = __webpack_require__(4383);
|
|
var number_parse_int_default = /*#__PURE__*/__webpack_require__.n(number_parse_int);
|
|
;// CONCATENATED MODULE: ./src/js/ui/panelMenu.js
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Menu Panel Class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
var Panel = /*#__PURE__*/function () {
|
|
/**
|
|
* @param {HTMLElement} menuElement - menu dom element
|
|
* @param {Object} options - menu options
|
|
* @param {string} options.name - name of panel menu
|
|
*/
|
|
function Panel(menuElement, _ref) {
|
|
var name = _ref.name;
|
|
|
|
_classCallCheck(this, Panel);
|
|
|
|
this.name = name;
|
|
this.items = [];
|
|
this.panelElement = this._makePanelElement();
|
|
this.listElement = this._makeListElement();
|
|
this.panelElement.appendChild(this.listElement);
|
|
menuElement.appendChild(this.panelElement);
|
|
}
|
|
/**
|
|
* Make Panel element
|
|
* @returns {HTMLElement}
|
|
*/
|
|
|
|
|
|
_createClass(Panel, [{
|
|
key: "_makePanelElement",
|
|
value: function _makePanelElement() {
|
|
var panel = document.createElement('div');
|
|
panel.className = "tie-panel-".concat(this.name);
|
|
return panel;
|
|
}
|
|
/**
|
|
* Make list element
|
|
* @returns {HTMLElement} list element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeListElement",
|
|
value: function _makeListElement() {
|
|
var list = document.createElement('ol');
|
|
list.className = "".concat(this.name, "-list");
|
|
return list;
|
|
}
|
|
/**
|
|
* Make list item element
|
|
* @param {string} html - history list item html
|
|
* @returns {HTMLElement} list item element
|
|
*/
|
|
|
|
}, {
|
|
key: "makeListItemElement",
|
|
value: function makeListItemElement(html) {
|
|
var listItem = document.createElement('li');
|
|
listItem.innerHTML = html;
|
|
listItem.className = "".concat(this.name, "-item");
|
|
listItem.setAttribute('data-index', this.items.length);
|
|
return listItem;
|
|
}
|
|
/**
|
|
* Push list item element
|
|
* @param {HTMLElement} item - list item element to add to the list
|
|
*/
|
|
|
|
}, {
|
|
key: "pushListItemElement",
|
|
value: function pushListItemElement(item) {
|
|
this.listElement.appendChild(item);
|
|
this.listElement.scrollTop += item.offsetHeight;
|
|
this.items.push(item);
|
|
}
|
|
/**
|
|
* Delete list item element
|
|
* @param {number} start - start index to delete
|
|
* @param {number} end - end index to delete
|
|
*/
|
|
|
|
}, {
|
|
key: "deleteListItemElement",
|
|
value: function deleteListItemElement(start, end) {
|
|
var items = this.items;
|
|
|
|
for (var i = start; i < end; i += 1) {
|
|
this.listElement.removeChild(items[i]);
|
|
}
|
|
|
|
splice_default()(items).call(items, start, end - start + 1);
|
|
}
|
|
/**
|
|
* Get list's length
|
|
* @returns {number}
|
|
*/
|
|
|
|
}, {
|
|
key: "getListLength",
|
|
value: function getListLength() {
|
|
return this.items.length;
|
|
}
|
|
/**
|
|
* Add class name of item
|
|
* @param {number} index - index of item
|
|
* @param {string} className - class name to add
|
|
*/
|
|
|
|
}, {
|
|
key: "addClass",
|
|
value: function addClass(index, className) {
|
|
if (this.items[index]) {
|
|
this.items[index].classList.add(className);
|
|
}
|
|
}
|
|
/**
|
|
* Remove class name of item
|
|
* @param {number} index - index of item
|
|
* @param {string} className - class name to remove
|
|
*/
|
|
|
|
}, {
|
|
key: "removeClass",
|
|
value: function removeClass(index, className) {
|
|
if (this.items[index]) {
|
|
this.items[index].classList.remove(className);
|
|
}
|
|
}
|
|
/**
|
|
* Toggle class name of item
|
|
* @param {number} index - index of item
|
|
* @param {string} className - class name to remove
|
|
*/
|
|
|
|
}, {
|
|
key: "toggleClass",
|
|
value: function toggleClass(index, className) {
|
|
if (this.items[index]) {
|
|
this.items[index].classList.toggle(className);
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Panel;
|
|
}();
|
|
|
|
/* harmony default export */ var panelMenu = (Panel);
|
|
;// CONCATENATED MODULE: ./src/js/ui/template/submenu/history.js
|
|
|
|
|
|
/**
|
|
* @param {Object} submenuInfo - submenu info for make template
|
|
* @param {Locale} locale - Translate text
|
|
* @param {Function} makeSvgIcon - svg icon generator
|
|
* @param {string} name - history name
|
|
* @param {string} detail - history detail information
|
|
* @returns {string}
|
|
*/
|
|
/* harmony default export */ var submenu_history = (function (_ref) {
|
|
var _context, _context2, _context3;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon,
|
|
name = _ref.name,
|
|
detail = _ref.detail;
|
|
return concat_default()(_context = concat_default()(_context2 = concat_default()(_context3 = "\n <div class=\"tui-image-editor-history-item history\">\n <div class=\"history-item-icon\">\n ".concat(makeSvgIcon(['normal', 'active'], "history-".concat(name.toLowerCase()), true), "\n </div>\n <span>\n ")).call(_context3, locale.localize(name), "\n ")).call(_context2, detail ? "(".concat(locale.localize(detail), ")") : '', "\n </span>\n <div class=\"history-item-checkbox\">\n ")).call(_context, makeSvgIcon(['normal'], 'history-check', true), "\n </div>\n </div>\n");
|
|
});
|
|
;// CONCATENATED MODULE: ./src/js/ui/history.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function history_createSuper(Derived) { var hasNativeReflectConstruct = history_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function history_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
var historyClassName = 'history-item';
|
|
var selectedClassName = 'selected-item';
|
|
var disabledClassName = 'disabled-item';
|
|
/**
|
|
* History ui class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var History = /*#__PURE__*/function (_Panel) {
|
|
_inherits(History, _Panel);
|
|
|
|
var _super = history_createSuper(History);
|
|
|
|
function History(menuElement, _ref) {
|
|
var _this;
|
|
|
|
var locale = _ref.locale,
|
|
makeSvgIcon = _ref.makeSvgIcon;
|
|
|
|
_classCallCheck(this, History);
|
|
|
|
_this = _super.call(this, menuElement, {
|
|
name: 'history'
|
|
});
|
|
menuElement.classList.add('enabled');
|
|
_this.locale = locale;
|
|
_this.makeSvgIcon = makeSvgIcon;
|
|
_this._eventHandler = {};
|
|
_this._historyIndex = _this.getListLength();
|
|
return _this;
|
|
}
|
|
/**
|
|
* Add history
|
|
* @param {string} name - name of history
|
|
* @param {?string} detail - detail information of history
|
|
*/
|
|
|
|
|
|
_createClass(History, [{
|
|
key: "add",
|
|
value: function add(_ref2) {
|
|
var name = _ref2.name,
|
|
detail = _ref2.detail;
|
|
|
|
if (this._hasDisabledItem()) {
|
|
this.deleteListItemElement(this._historyIndex + 1, this.getListLength());
|
|
}
|
|
|
|
var html = submenu_history({
|
|
locale: this.locale,
|
|
makeSvgIcon: this.makeSvgIcon,
|
|
name: name,
|
|
detail: detail
|
|
});
|
|
var item = this.makeListItemElement(html);
|
|
this.pushListItemElement(item);
|
|
this._historyIndex = this.getListLength() - 1;
|
|
|
|
this._selectItem(this._historyIndex);
|
|
}
|
|
/**
|
|
* Init history
|
|
*/
|
|
|
|
}, {
|
|
key: "init",
|
|
value: function init() {
|
|
this.deleteListItemElement(1, this.getListLength());
|
|
this._historyIndex = 0;
|
|
|
|
this._selectItem(this._historyIndex);
|
|
}
|
|
/**
|
|
* Clear history
|
|
*/
|
|
|
|
}, {
|
|
key: "clear",
|
|
value: function clear() {
|
|
this.deleteListItemElement(0, this.getListLength());
|
|
this._historyIndex = -1;
|
|
}
|
|
/**
|
|
* Select previous history of current selected history
|
|
*/
|
|
|
|
}, {
|
|
key: "prev",
|
|
value: function prev() {
|
|
this._historyIndex -= 1;
|
|
|
|
this._selectItem(this._historyIndex);
|
|
}
|
|
/**
|
|
* Select next history of current selected history
|
|
*/
|
|
|
|
}, {
|
|
key: "next",
|
|
value: function next() {
|
|
this._historyIndex += 1;
|
|
|
|
this._selectItem(this._historyIndex);
|
|
}
|
|
/**
|
|
* Whether history menu has disabled item
|
|
* @returns {boolean}
|
|
*/
|
|
|
|
}, {
|
|
key: "_hasDisabledItem",
|
|
value: function _hasDisabledItem() {
|
|
return this.getListLength() - 1 > this._historyIndex;
|
|
}
|
|
/**
|
|
* Add history menu event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addHistoryEventListener",
|
|
value: function _addHistoryEventListener() {
|
|
var _this2 = this;
|
|
|
|
this._eventHandler.history = function (event) {
|
|
return _this2._clickHistoryItem(event);
|
|
};
|
|
|
|
this.listElement.addEventListener('click', this._eventHandler.history);
|
|
}
|
|
/**
|
|
* Remove history menu event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeHistoryEventListener",
|
|
value: function _removeHistoryEventListener() {
|
|
this.listElement.removeEventListener('click', this._eventHandler.history);
|
|
}
|
|
/**
|
|
* onClick history menu event listener
|
|
* @param {object} event - event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_clickHistoryItem",
|
|
value: function _clickHistoryItem(event) {
|
|
var target = event.target;
|
|
var item = target.closest(".".concat(historyClassName));
|
|
|
|
if (!item) {
|
|
return;
|
|
}
|
|
|
|
var index = number_parse_int_default()(item.getAttribute('data-index'), 10);
|
|
|
|
if (index !== this._historyIndex) {
|
|
var count = Math.abs(index - this._historyIndex);
|
|
|
|
if (index < this._historyIndex) {
|
|
this._actions.undo(count);
|
|
} else {
|
|
this._actions.redo(count);
|
|
}
|
|
}
|
|
}
|
|
/**
|
|
* Change item's state to selected state
|
|
* @param {number} index - index of selected item
|
|
*/
|
|
|
|
}, {
|
|
key: "_selectItem",
|
|
value: function _selectItem(index) {
|
|
for (var i = 0; i < this.getListLength(); i += 1) {
|
|
this.removeClass(i, selectedClassName);
|
|
this.removeClass(i, disabledClassName);
|
|
|
|
if (i > index) {
|
|
this.addClass(i, disabledClassName);
|
|
}
|
|
}
|
|
|
|
this.addClass(index, selectedClassName);
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
}, {
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this.removeEvent();
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Add event for history
|
|
* @param {Object} actions - actions for crop
|
|
* @param {Function} actions.undo - undo action
|
|
* @param {Function} actions.redo - redo action
|
|
*/
|
|
|
|
}, {
|
|
key: "addEvent",
|
|
value: function addEvent(actions) {
|
|
this._actions = actions;
|
|
|
|
this._addHistoryEventListener();
|
|
}
|
|
/**
|
|
* Remove event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "removeEvent",
|
|
value: function removeEvent() {
|
|
this._removeHistoryEventListener();
|
|
}
|
|
}]);
|
|
|
|
return History;
|
|
}(panelMenu);
|
|
|
|
/* harmony default export */ var ui_history = (History);
|
|
;// CONCATENATED MODULE: ./src/js/ui/locale/locale.js
|
|
|
|
|
|
|
|
/**
|
|
* Translate messages
|
|
*/
|
|
var Locale = /*#__PURE__*/function () {
|
|
function Locale(locale) {
|
|
_classCallCheck(this, Locale);
|
|
|
|
this._locale = locale;
|
|
}
|
|
/**
|
|
* localize message
|
|
* @param {string} message - message who will be localized
|
|
* @returns {string}
|
|
*/
|
|
|
|
|
|
_createClass(Locale, [{
|
|
key: "localize",
|
|
value: function localize(message) {
|
|
return this._locale[message] || message;
|
|
}
|
|
}]);
|
|
|
|
return Locale;
|
|
}();
|
|
|
|
/* harmony default export */ var locale = (Locale);
|
|
;// CONCATENATED MODULE: ./src/js/ui.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var SUB_UI_COMPONENT = {
|
|
Shape: ui_shape,
|
|
Crop: ui_crop,
|
|
Resize: ui_resize,
|
|
Flip: ui_flip,
|
|
Rotate: ui_rotate,
|
|
Text: ui_text,
|
|
Mask: ui_mask,
|
|
Icon: ui_icon,
|
|
Draw: ui_draw,
|
|
Filter: ui_filter
|
|
};
|
|
var BI_EXPRESSION_MINSIZE_WHEN_TOP_POSITION = '1300';
|
|
var HISTORY_MENU = 'history';
|
|
var HISTORY_PANEL_CLASS_NAME = 'tie-panel-history';
|
|
var CLASS_NAME_ON = 'on';
|
|
var ZOOM_BUTTON_TYPE = {
|
|
ZOOM_IN: 'zoomIn',
|
|
HAND: 'hand'
|
|
};
|
|
/**
|
|
* Ui class
|
|
* @class
|
|
* @param {string|HTMLElement} element - Wrapper's element or selector
|
|
* @param {Object} [options] - Ui setting options
|
|
* @param {number} options.loadImage - Init default load image
|
|
* @param {number} options.initMenu - Init start menu
|
|
* @param {Boolean} [options.menuBarPosition=bottom] - Let
|
|
* @param {Boolean} [options.applyCropSelectionStyle=false] - Let
|
|
* @param {Boolean} [options.usageStatistics=false] - Use statistics or not
|
|
* @param {Object} [options.uiSize] - ui size of editor
|
|
* @param {string} options.uiSize.width - width of ui
|
|
* @param {string} options.uiSize.height - height of ui
|
|
* @param {Object} actions - ui action instance
|
|
*/
|
|
|
|
var Ui = /*#__PURE__*/function () {
|
|
function Ui(element, options, actions) {
|
|
_classCallCheck(this, Ui);
|
|
|
|
this.options = this._initializeOption(options);
|
|
this._actions = actions;
|
|
this.submenu = false;
|
|
this.imageSize = {};
|
|
this.uiSize = {};
|
|
this._locale = new locale(this.options.locale);
|
|
this.theme = new theme(this.options.theme);
|
|
this.eventHandler = {};
|
|
this._submenuChangeTransection = false;
|
|
this._selectedElement = null;
|
|
this._mainElement = null;
|
|
this._editorElementWrap = null;
|
|
this._editorElement = null;
|
|
this._menuBarElement = null;
|
|
this._subMenuElement = null;
|
|
|
|
this._makeUiElement(element);
|
|
|
|
this._setUiSize();
|
|
|
|
this._initMenuEvent = false;
|
|
|
|
this._makeSubMenu();
|
|
|
|
this._attachHistoryEvent();
|
|
|
|
this._attachZoomEvent();
|
|
}
|
|
/**
|
|
* Destroys the instance.
|
|
*/
|
|
|
|
|
|
_createClass(Ui, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
this._removeUiEvent();
|
|
|
|
this._destroyAllMenu();
|
|
|
|
this._selectedElement.innerHTML = '';
|
|
assignmentForDestroy(this);
|
|
}
|
|
/**
|
|
* Set Default Selection for includeUI
|
|
* @param {Object} option - imageEditor options
|
|
* @returns {Object} - extends selectionStyle option
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "setUiDefaultSelectionStyle",
|
|
value: function setUiDefaultSelectionStyle(option) {
|
|
return extend_default()({
|
|
applyCropSelectionStyle: true,
|
|
applyGroupSelectionStyle: true,
|
|
selectionStyle: {
|
|
cornerStyle: 'circle',
|
|
cornerSize: 16,
|
|
cornerColor: '#fff',
|
|
cornerStrokeColor: '#fff',
|
|
transparentCorners: false,
|
|
lineWidth: 2,
|
|
borderColor: '#fff'
|
|
}
|
|
}, option);
|
|
}
|
|
/**
|
|
* Change editor size
|
|
* @param {Object} resizeInfo - ui & image size info
|
|
* @param {Object} [resizeInfo.uiSize] - image size dimension
|
|
* @param {string} resizeInfo.uiSize.width - ui width
|
|
* @param {string} resizeInfo.uiSize.height - ui height
|
|
* @param {Object} [resizeInfo.imageSize] - image size dimension
|
|
* @param {Number} resizeInfo.imageSize.oldWidth - old width
|
|
* @param {Number} resizeInfo.imageSize.oldHeight - old height
|
|
* @param {Number} resizeInfo.imageSize.newWidth - new width
|
|
* @param {Number} resizeInfo.imageSize.newHeight - new height
|
|
* @example
|
|
* // Change the image size and ui size, and change the affected ui state together.
|
|
* imageEditor.ui.resizeEditor({
|
|
* imageSize: {oldWidth: 100, oldHeight: 100, newWidth: 700, newHeight: 700},
|
|
* uiSize: {width: 1000, height: 1000}
|
|
* });
|
|
* @example
|
|
* // Apply the ui state while preserving the previous attribute (for example, if responsive Ui)
|
|
* imageEditor.ui.resizeEditor();
|
|
*/
|
|
|
|
}, {
|
|
key: "resizeEditor",
|
|
value: function resizeEditor() {
|
|
var _ref = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {},
|
|
uiSize = _ref.uiSize,
|
|
_ref$imageSize = _ref.imageSize,
|
|
imageSize = _ref$imageSize === void 0 ? this.imageSize : _ref$imageSize;
|
|
|
|
if (imageSize !== this.imageSize) {
|
|
this.imageSize = imageSize;
|
|
}
|
|
|
|
if (uiSize) {
|
|
this._setUiSize(uiSize);
|
|
}
|
|
|
|
var _this$_getCanvasMaxDi = this._getCanvasMaxDimension(),
|
|
width = _this$_getCanvasMaxDi.width,
|
|
height = _this$_getCanvasMaxDi.height;
|
|
|
|
var editorElementStyle = this._editorElement.style;
|
|
var menuBarPosition = this.options.menuBarPosition;
|
|
editorElementStyle.height = "".concat(height, "px");
|
|
editorElementStyle.width = "".concat(width, "px");
|
|
|
|
this._setEditorPosition(menuBarPosition);
|
|
|
|
this._editorElementWrap.style.bottom = "0px";
|
|
this._editorElementWrap.style.top = "0px";
|
|
this._editorElementWrap.style.left = "0px";
|
|
this._editorElementWrap.style.width = "100%";
|
|
var selectElementClassList = this._selectedElement.classList;
|
|
|
|
if (menuBarPosition === 'top' && this._selectedElement.offsetWidth < BI_EXPRESSION_MINSIZE_WHEN_TOP_POSITION) {
|
|
selectElementClassList.add('tui-image-editor-top-optimization');
|
|
} else {
|
|
selectElementClassList.remove('tui-image-editor-top-optimization');
|
|
}
|
|
}
|
|
/**
|
|
* Toggle zoom button status
|
|
* @param {string} type - type of zoom button
|
|
*/
|
|
|
|
}, {
|
|
key: "toggleZoomButtonStatus",
|
|
value: function toggleZoomButtonStatus(type) {
|
|
var targetClassList = this._buttonElements[type].classList;
|
|
targetClassList.toggle(CLASS_NAME_ON);
|
|
|
|
if (type === ZOOM_BUTTON_TYPE.ZOOM_IN) {
|
|
this._buttonElements[ZOOM_BUTTON_TYPE.HAND].classList.remove(CLASS_NAME_ON);
|
|
} else {
|
|
this._buttonElements[ZOOM_BUTTON_TYPE.ZOOM_IN].classList.remove(CLASS_NAME_ON);
|
|
}
|
|
}
|
|
/**
|
|
* Turn off zoom-in button status
|
|
*/
|
|
|
|
}, {
|
|
key: "offZoomInButtonStatus",
|
|
value: function offZoomInButtonStatus() {
|
|
var zoomInClassList = this._buttonElements[ZOOM_BUTTON_TYPE.ZOOM_IN].classList;
|
|
zoomInClassList.remove(CLASS_NAME_ON);
|
|
}
|
|
/**
|
|
* Change hand button status
|
|
* @param {boolean} enabled - status to change
|
|
*/
|
|
|
|
}, {
|
|
key: "changeHandButtonStatus",
|
|
value: function changeHandButtonStatus(enabled) {
|
|
var handClassList = this._buttonElements[ZOOM_BUTTON_TYPE.HAND].classList;
|
|
handClassList[enabled ? 'add' : 'remove'](CLASS_NAME_ON);
|
|
}
|
|
/**
|
|
* Change help button status
|
|
* @param {string} buttonType - target button type
|
|
* @param {Boolean} enableStatus - enabled status
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "changeHelpButtonEnabled",
|
|
value: function changeHelpButtonEnabled(buttonType, enableStatus) {
|
|
var buttonClassList = this._buttonElements[buttonType].classList;
|
|
buttonClassList[enableStatus ? 'add' : 'remove']('enabled');
|
|
}
|
|
/**
|
|
* Change delete button status
|
|
* @param {Object} [options] - Ui setting options
|
|
* @param {object} [options.loadImage] - Init default load image
|
|
* @param {string} [options.initMenu] - Init start menu
|
|
* @param {string} [options.menuBarPosition=bottom] - Let
|
|
* @param {boolean} [options.applyCropSelectionStyle=false] - Let
|
|
* @param {boolean} [options.usageStatistics=false] - Send statistics ping or not
|
|
* @returns {Object} initialize option
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_initializeOption",
|
|
value: function _initializeOption(options) {
|
|
return extend_default()({
|
|
loadImage: {
|
|
path: '',
|
|
name: ''
|
|
},
|
|
locale: {},
|
|
menuIconPath: '',
|
|
menu: ['resize', 'crop', 'flip', 'rotate', 'draw', 'shape', 'icon', 'text', 'mask', 'filter'],
|
|
initMenu: '',
|
|
uiSize: {
|
|
width: '100%',
|
|
height: '100%'
|
|
},
|
|
menuBarPosition: 'bottom'
|
|
}, options);
|
|
}
|
|
/**
|
|
* Set ui container size
|
|
* @param {Object} uiSize - ui dimension
|
|
* @param {string} uiSize.width - css width property
|
|
* @param {string} uiSize.height - css height property
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setUiSize",
|
|
value: function _setUiSize() {
|
|
var uiSize = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : this.options.uiSize;
|
|
var elementDimension = this._selectedElement.style;
|
|
elementDimension.width = uiSize.width;
|
|
elementDimension.height = uiSize.height;
|
|
}
|
|
/**
|
|
* Make submenu dom element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeSubMenu",
|
|
value: function _makeSubMenu() {
|
|
var _this = this;
|
|
|
|
forEach_default()(this.options.menu, function (menuName) {
|
|
var _context;
|
|
|
|
var SubComponentClass = SUB_UI_COMPONENT[menuName.replace(/^[a-z]/, function ($0) {
|
|
return $0.toUpperCase();
|
|
})]; // make menu element
|
|
|
|
_this._makeMenuElement(menuName); // menu btn element
|
|
|
|
|
|
_this._buttonElements[menuName] = _this._menuBarElement.querySelector(".tie-btn-".concat(menuName)); // submenu ui instance
|
|
|
|
_this[menuName] = new SubComponentClass(_this._subMenuElement, {
|
|
locale: _this._locale,
|
|
makeSvgIcon: bind_default()(_context = _this.theme.makeMenSvgIconSet).call(_context, _this.theme),
|
|
menuBarPosition: _this.options.menuBarPosition,
|
|
usageStatistics: _this.options.usageStatistics
|
|
});
|
|
});
|
|
}
|
|
/**
|
|
* Attach history event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_attachHistoryEvent",
|
|
value: function _attachHistoryEvent() {
|
|
var _context2, _context3, _context4;
|
|
|
|
this.on(eventNames.EXECUTE_COMMAND, bind_default()(_context2 = this._addHistory).call(_context2, this));
|
|
this.on(eventNames.AFTER_UNDO, bind_default()(_context3 = this._selectPrevHistory).call(_context3, this));
|
|
this.on(eventNames.AFTER_REDO, bind_default()(_context4 = this._selectNextHistory).call(_context4, this));
|
|
}
|
|
/**
|
|
* Attach zoom event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_attachZoomEvent",
|
|
value: function _attachZoomEvent() {
|
|
var _this2 = this;
|
|
|
|
this.on(eventNames.HAND_STARTED, function () {
|
|
_this2.offZoomInButtonStatus();
|
|
|
|
_this2.changeHandButtonStatus(true);
|
|
});
|
|
this.on(eventNames.HAND_STOPPED, function () {
|
|
return _this2.changeHandButtonStatus(false);
|
|
});
|
|
}
|
|
/**
|
|
* Make primary ui dom element
|
|
* @param {string|HTMLElement} element - Wrapper's element or selector
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeUiElement",
|
|
value: function _makeUiElement(element) {
|
|
var _context5;
|
|
|
|
var selectedElement;
|
|
|
|
if (element.nodeType) {
|
|
selectedElement = element;
|
|
} else {
|
|
selectedElement = document.querySelector(element);
|
|
}
|
|
|
|
var selector = getSelector(selectedElement);
|
|
selectedElement.classList.add('tui-image-editor-container');
|
|
selectedElement.innerHTML = controls({
|
|
locale: this._locale,
|
|
biImage: this.theme.getStyle('common.bi'),
|
|
loadButtonStyle: this.theme.getStyle('loadButton'),
|
|
downloadButtonStyle: this.theme.getStyle('downloadButton'),
|
|
menuBarPosition: this.options.menuBarPosition
|
|
}) + mainContainer({
|
|
locale: this._locale,
|
|
biImage: this.theme.getStyle('common.bi'),
|
|
commonStyle: this.theme.getStyle('common'),
|
|
headerStyle: this.theme.getStyle('header'),
|
|
loadButtonStyle: this.theme.getStyle('loadButton'),
|
|
downloadButtonStyle: this.theme.getStyle('downloadButton'),
|
|
submenuStyle: this.theme.getStyle('submenu')
|
|
});
|
|
this._selectedElement = selectedElement;
|
|
|
|
this._selectedElement.classList.add(this.options.menuBarPosition);
|
|
|
|
this._mainElement = selector('.tui-image-editor-main');
|
|
this._editorElementWrap = selector('.tui-image-editor-wrap');
|
|
this._editorElement = selector('.tui-image-editor');
|
|
this._helpMenuBarElement = selector('.tui-image-editor-help-menu');
|
|
this._menuBarElement = selector('.tui-image-editor-menu');
|
|
this._subMenuElement = selector('.tui-image-editor-submenu');
|
|
this._buttonElements = {
|
|
download: this._selectedElement.querySelectorAll('.tui-image-editor-download-btn'),
|
|
load: this._selectedElement.querySelectorAll('.tui-image-editor-load-btn')
|
|
};
|
|
|
|
this._addHelpMenus();
|
|
|
|
this._historyMenu = new ui_history(this._buttonElements[HISTORY_MENU], {
|
|
locale: this._locale,
|
|
makeSvgIcon: bind_default()(_context5 = this.theme.makeMenSvgIconSet).call(_context5, this.theme)
|
|
});
|
|
|
|
this._activateZoomMenus();
|
|
}
|
|
/**
|
|
* Activate help menus for zoom.
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_activateZoomMenus",
|
|
value: function _activateZoomMenus() {
|
|
var _this3 = this;
|
|
|
|
forEach_default()(ZOOM_HELP_MENUS, function (menu) {
|
|
_this3.changeHelpButtonEnabled(menu, true);
|
|
});
|
|
}
|
|
/**
|
|
* make array for help menu output, including partitions.
|
|
* @returns {Array}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeHelpMenuWithPartition",
|
|
value: function _makeHelpMenuWithPartition() {
|
|
var _context6;
|
|
|
|
return concat_default()(_context6 = []).call(_context6, _toConsumableArray(ZOOM_HELP_MENUS), [''], _toConsumableArray(COMMAND_HELP_MENUS), [''], _toConsumableArray(DELETE_HELP_MENUS));
|
|
}
|
|
/**
|
|
* Add help menu
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addHelpMenus",
|
|
value: function _addHelpMenus() {
|
|
var _this4 = this;
|
|
|
|
var helpMenuWithPartition = this._makeHelpMenuWithPartition();
|
|
|
|
forEach_default()(helpMenuWithPartition, function (menuName) {
|
|
if (!menuName) {
|
|
_this4._makeMenuPartitionElement();
|
|
} else {
|
|
_this4._makeMenuElement(menuName, ['normal', 'disabled', 'hover'], 'help');
|
|
|
|
_this4._buttonElements[menuName] = _this4._helpMenuBarElement.querySelector(".tie-btn-".concat(menuName));
|
|
}
|
|
});
|
|
}
|
|
/**
|
|
* Make menu partition element
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeMenuPartitionElement",
|
|
value: function _makeMenuPartitionElement() {
|
|
var partitionElement = document.createElement('li');
|
|
var partitionInnerElement = document.createElement('div');
|
|
partitionElement.className = cls('item');
|
|
partitionInnerElement.className = cls('icpartition');
|
|
partitionElement.appendChild(partitionInnerElement);
|
|
|
|
this._helpMenuBarElement.appendChild(partitionElement);
|
|
}
|
|
/**
|
|
* Make menu button element
|
|
* @param {string} menuName - menu name
|
|
* @param {Array} useIconTypes - Possible values are \['normal', 'active', 'hover', 'disabled'\]
|
|
* @param {string} menuType - 'normal' or 'help'
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_makeMenuElement",
|
|
value: function _makeMenuElement(menuName) {
|
|
var _context7, _context8;
|
|
|
|
var useIconTypes = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : ['normal', 'active', 'hover'];
|
|
var menuType = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : 'normal';
|
|
var btnElement = document.createElement('li');
|
|
var menuItemHtml = this.theme.makeMenSvgIconSet(useIconTypes, menuName);
|
|
|
|
this._addTooltipAttribute(btnElement, menuName);
|
|
|
|
btnElement.className = concat_default()(_context7 = concat_default()(_context8 = "tie-btn-".concat(menuName, " ")).call(_context8, cls('item'), " ")).call(_context7, menuType);
|
|
btnElement.innerHTML = menuItemHtml;
|
|
|
|
if (menuType === 'normal') {
|
|
this._menuBarElement.appendChild(btnElement);
|
|
} else {
|
|
this._helpMenuBarElement.appendChild(btnElement);
|
|
}
|
|
}
|
|
/**
|
|
* Add help action event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addHelpActionEvent",
|
|
value: function _addHelpActionEvent() {
|
|
var _this5 = this;
|
|
|
|
forEach_default()(HELP_MENUS, function (helpName) {
|
|
_this5.eventHandler[helpName] = function (event) {
|
|
return _this5._actions.main[helpName](event);
|
|
};
|
|
|
|
_this5._buttonElements[helpName].addEventListener('click', _this5.eventHandler[helpName]);
|
|
});
|
|
}
|
|
/**
|
|
* Remove help action event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeHelpActionEvent",
|
|
value: function _removeHelpActionEvent() {
|
|
var _this6 = this;
|
|
|
|
forEach_default()(HELP_MENUS, function (helpName) {
|
|
_this6._buttonElements[helpName].removeEventListener('click', _this6.eventHandler[helpName]);
|
|
});
|
|
}
|
|
/**
|
|
* Add history
|
|
* @param {Command|string} command - command or command name
|
|
*/
|
|
|
|
}, {
|
|
key: "_addHistory",
|
|
value: function _addHistory(command) {
|
|
if (!isSilentCommand(command)) {
|
|
var historyTitle = typeof command === 'string' ? {
|
|
name: command
|
|
} : getHistoryTitle(command);
|
|
|
|
this._historyMenu.add(historyTitle);
|
|
}
|
|
}
|
|
/**
|
|
* Init history
|
|
*/
|
|
|
|
}, {
|
|
key: "initHistory",
|
|
value: function initHistory() {
|
|
this._historyMenu.init();
|
|
}
|
|
/**
|
|
* Clear history
|
|
*/
|
|
|
|
}, {
|
|
key: "clearHistory",
|
|
value: function clearHistory() {
|
|
this._historyMenu.clear();
|
|
}
|
|
/**
|
|
* Select prev history
|
|
*/
|
|
|
|
}, {
|
|
key: "_selectPrevHistory",
|
|
value: function _selectPrevHistory() {
|
|
this._historyMenu.prev();
|
|
}
|
|
/**
|
|
* Select next history
|
|
*/
|
|
|
|
}, {
|
|
key: "_selectNextHistory",
|
|
value: function _selectNextHistory() {
|
|
this._historyMenu.next();
|
|
}
|
|
/**
|
|
* Toggle history menu
|
|
* @param {object} event - event object
|
|
*/
|
|
|
|
}, {
|
|
key: "toggleHistoryMenu",
|
|
value: function toggleHistoryMenu(event) {
|
|
var target = event.target;
|
|
var item = target.closest(".".concat(HISTORY_PANEL_CLASS_NAME));
|
|
|
|
if (item) {
|
|
return;
|
|
}
|
|
|
|
var historyButtonClassList = this._buttonElements[HISTORY_MENU].classList;
|
|
historyButtonClassList.toggle('opened');
|
|
}
|
|
/**
|
|
* Add attribute for menu tooltip
|
|
* @param {HTMLElement} element - menu element
|
|
* @param {string} tooltipName - tooltipName
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addTooltipAttribute",
|
|
value: function _addTooltipAttribute(element, tooltipName) {
|
|
element.setAttribute('tooltip-content', this._locale.localize(tooltipName.replace(/^[a-z]/g, function ($0) {
|
|
return $0.toUpperCase();
|
|
})));
|
|
}
|
|
/**
|
|
* Add download event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addDownloadEvent",
|
|
value: function _addDownloadEvent() {
|
|
var _this7 = this;
|
|
|
|
this.eventHandler.download = function () {
|
|
return _this7._actions.main.download();
|
|
};
|
|
|
|
forEach_default()(this._buttonElements.download, function (element) {
|
|
element.addEventListener('click', _this7.eventHandler.download);
|
|
});
|
|
}
|
|
}, {
|
|
key: "_removeDownloadEvent",
|
|
value: function _removeDownloadEvent() {
|
|
var _this8 = this;
|
|
|
|
forEach_default()(this._buttonElements.download, function (element) {
|
|
element.removeEventListener('click', _this8.eventHandler.download);
|
|
});
|
|
}
|
|
/**
|
|
* Add load event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addLoadEvent",
|
|
value: function _addLoadEvent() {
|
|
var _this9 = this;
|
|
|
|
this.eventHandler.loadImage = function (event) {
|
|
return _this9._actions.main.load(event.target.files[0]);
|
|
};
|
|
|
|
forEach_default()(this._buttonElements.load, function (element) {
|
|
element.addEventListener('change', _this9.eventHandler.loadImage);
|
|
});
|
|
}
|
|
/**
|
|
* Remove load event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeLoadEvent",
|
|
value: function _removeLoadEvent() {
|
|
var _this10 = this;
|
|
|
|
forEach_default()(this._buttonElements.load, function (element) {
|
|
element.removeEventListener('change', _this10.eventHandler.loadImage);
|
|
});
|
|
}
|
|
/**
|
|
* Add menu event
|
|
* @param {string} menuName - menu name
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addMainMenuEvent",
|
|
value: function _addMainMenuEvent(menuName) {
|
|
var _this11 = this;
|
|
|
|
this.eventHandler[menuName] = function () {
|
|
return _this11.changeMenu(menuName);
|
|
};
|
|
|
|
this._buttonElements[menuName].addEventListener('click', this.eventHandler[menuName]);
|
|
}
|
|
/**
|
|
* Add menu event
|
|
* @param {string} menuName - menu name
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addSubMenuEvent",
|
|
value: function _addSubMenuEvent(menuName) {
|
|
var _this12 = this;
|
|
|
|
this[menuName].addEvent(this._actions[menuName]);
|
|
this[menuName].on(eventNames.INPUT_BOX_EDITING_STARTED, function () {
|
|
return _this12.fire(eventNames.INPUT_BOX_EDITING_STARTED);
|
|
});
|
|
this[menuName].on(eventNames.INPUT_BOX_EDITING_STOPPED, function () {
|
|
return _this12.fire(eventNames.INPUT_BOX_EDITING_STOPPED);
|
|
});
|
|
}
|
|
/**
|
|
* Add menu event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_addMenuEvent",
|
|
value: function _addMenuEvent() {
|
|
var _this13 = this;
|
|
|
|
forEach_default()(this.options.menu, function (menuName) {
|
|
_this13._addMainMenuEvent(menuName);
|
|
|
|
_this13._addSubMenuEvent(menuName);
|
|
});
|
|
}
|
|
/**
|
|
* Remove menu event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeMainMenuEvent",
|
|
value: function _removeMainMenuEvent() {
|
|
var _this14 = this;
|
|
|
|
forEach_default()(this.options.menu, function (menuName) {
|
|
_this14._buttonElements[menuName].removeEventListener('click', _this14.eventHandler[menuName]);
|
|
|
|
_this14[menuName].off(eventNames.INPUT_BOX_EDITING_STARTED);
|
|
|
|
_this14[menuName].off(eventNames.INPUT_BOX_EDITING_STOPPED);
|
|
});
|
|
}
|
|
/**
|
|
* Get editor area element
|
|
* @returns {HTMLElement} editor area html element
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "getEditorArea",
|
|
value: function getEditorArea() {
|
|
return this._editorElement;
|
|
}
|
|
/**
|
|
* Add event for menu items
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "activeMenuEvent",
|
|
value: function activeMenuEvent() {
|
|
if (this._initMenuEvent) {
|
|
return;
|
|
}
|
|
|
|
this._addHelpActionEvent();
|
|
|
|
this._addDownloadEvent();
|
|
|
|
this._addMenuEvent();
|
|
|
|
this._initMenu();
|
|
|
|
this._historyMenu.addEvent(this._actions.history);
|
|
|
|
this._initMenuEvent = true;
|
|
}
|
|
/**
|
|
* Remove ui event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeUiEvent",
|
|
value: function _removeUiEvent() {
|
|
this._removeHelpActionEvent();
|
|
|
|
this._removeDownloadEvent();
|
|
|
|
this._removeLoadEvent();
|
|
|
|
this._removeMainMenuEvent();
|
|
|
|
this._historyMenu.removeEvent();
|
|
}
|
|
/**
|
|
* Destroy all menu instance
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_destroyAllMenu",
|
|
value: function _destroyAllMenu() {
|
|
var _this15 = this;
|
|
|
|
forEach_default()(this.options.menu, function (menuName) {
|
|
_this15[menuName].destroy();
|
|
});
|
|
|
|
this._historyMenu.destroy();
|
|
}
|
|
/**
|
|
* Init canvas
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "initCanvas",
|
|
value: function initCanvas() {
|
|
var _this16 = this;
|
|
|
|
var loadImageInfo = this._getLoadImage();
|
|
|
|
if (loadImageInfo.path) {
|
|
this._actions.main.initLoadImage(loadImageInfo.path, loadImageInfo.name).then(function () {
|
|
_this16.activeMenuEvent();
|
|
});
|
|
}
|
|
|
|
this._addLoadEvent();
|
|
|
|
var gridVisual = document.createElement('div');
|
|
gridVisual.className = cls('grid-visual');
|
|
var grid = "<table>\n <tr><td class=\"dot left-top\"></td><td></td><td class=\"dot right-top\"></td></tr>\n <tr><td></td><td></td><td></td></tr>\n <tr><td class=\"dot left-bottom\"></td><td></td><td class=\"dot right-bottom\"></td></tr>\n </table>";
|
|
gridVisual.innerHTML = grid;
|
|
this._editorContainerElement = this._editorElement.querySelector('.tui-image-editor-canvas-container');
|
|
|
|
this._editorContainerElement.appendChild(gridVisual);
|
|
}
|
|
/**
|
|
* get editor area element
|
|
* @returns {Object} load image option
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getLoadImage",
|
|
value: function _getLoadImage() {
|
|
return this.options.loadImage;
|
|
}
|
|
/**
|
|
* change menu
|
|
* @param {string} menuName - menu name
|
|
* @param {boolean} toggle - whether toogle or not
|
|
* @param {boolean} discardSelection - discard selection
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "changeMenu",
|
|
value: function changeMenu(menuName) {
|
|
var toggle = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : true;
|
|
var discardSelection = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : true;
|
|
|
|
if (!this._submenuChangeTransection) {
|
|
this._submenuChangeTransection = true;
|
|
|
|
this._changeMenu(menuName, toggle, discardSelection);
|
|
|
|
this._submenuChangeTransection = false;
|
|
}
|
|
}
|
|
/**
|
|
* change menu
|
|
* @param {string} menuName - menu name
|
|
* @param {boolean} toggle - whether toggle or not
|
|
* @param {boolean} discardSelection - discard selection
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeMenu",
|
|
value: function _changeMenu(menuName, toggle, discardSelection) {
|
|
if (this.submenu) {
|
|
this._buttonElements[this.submenu].classList.remove('active');
|
|
|
|
this._mainElement.classList.remove("tui-image-editor-menu-".concat(this.submenu));
|
|
|
|
if (discardSelection) {
|
|
this._actions.main.discardSelection();
|
|
}
|
|
|
|
this._actions.main.changeSelectableAll(true);
|
|
|
|
this[this.submenu].changeStandbyMode();
|
|
}
|
|
|
|
if (this.submenu === menuName && toggle) {
|
|
this.submenu = null;
|
|
} else {
|
|
this._buttonElements[menuName].classList.add('active');
|
|
|
|
this._mainElement.classList.add("tui-image-editor-menu-".concat(menuName));
|
|
|
|
this.submenu = menuName;
|
|
this[this.submenu].changeStartMode();
|
|
}
|
|
|
|
this.resizeEditor();
|
|
}
|
|
/**
|
|
* Init menu
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_initMenu",
|
|
value: function _initMenu() {
|
|
if (this.options.initMenu) {
|
|
var evt = document.createEvent('MouseEvents');
|
|
evt.initEvent('click', true, false);
|
|
|
|
this._buttonElements[this.options.initMenu].dispatchEvent(evt);
|
|
}
|
|
|
|
if (this.icon) {
|
|
this.icon.registerDefaultIcon();
|
|
}
|
|
}
|
|
/**
|
|
* Get canvas max Dimension
|
|
* @returns {Object} - width & height of editor
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getCanvasMaxDimension",
|
|
value: function _getCanvasMaxDimension() {
|
|
var _this$_editorContaine = this._editorContainerElement.style,
|
|
maxWidth = _this$_editorContaine.maxWidth,
|
|
maxHeight = _this$_editorContaine.maxHeight;
|
|
|
|
var width = parse_float_default()(maxWidth);
|
|
|
|
var height = parse_float_default()(maxHeight);
|
|
|
|
return {
|
|
width: width,
|
|
height: height
|
|
};
|
|
}
|
|
/**
|
|
* Set editor position
|
|
* @param {string} menuBarPosition - top or right or bottom or left
|
|
* @private
|
|
*/
|
|
// eslint-disable-next-line complexity
|
|
|
|
}, {
|
|
key: "_setEditorPosition",
|
|
value: function _setEditorPosition(menuBarPosition) {
|
|
var _this$_getCanvasMaxDi2 = this._getCanvasMaxDimension(),
|
|
width = _this$_getCanvasMaxDi2.width,
|
|
height = _this$_getCanvasMaxDi2.height;
|
|
|
|
var editorElementStyle = this._editorElement.style;
|
|
var top = 0;
|
|
var left = 0;
|
|
|
|
if (this.submenu) {
|
|
if (menuBarPosition === 'bottom') {
|
|
if (height > this._editorElementWrap.scrollHeight - 150) {
|
|
top = (height - this._editorElementWrap.scrollHeight) / 2;
|
|
} else {
|
|
top = 150 / 2 * -1;
|
|
}
|
|
} else if (menuBarPosition === 'top') {
|
|
if (height > this._editorElementWrap.offsetHeight - 150) {
|
|
top = 150 / 2 - (height - (this._editorElementWrap.offsetHeight - 150)) / 2;
|
|
} else {
|
|
top = 150 / 2;
|
|
}
|
|
} else if (menuBarPosition === 'left') {
|
|
if (width > this._editorElementWrap.offsetWidth - 248) {
|
|
left = 248 / 2 - (width - (this._editorElementWrap.offsetWidth - 248)) / 2;
|
|
} else {
|
|
left = 248 / 2;
|
|
}
|
|
} else if (menuBarPosition === 'right') {
|
|
if (width > this._editorElementWrap.scrollWidth - 248) {
|
|
left = (width - this._editorElementWrap.scrollWidth) / 2;
|
|
} else {
|
|
left = 248 / 2 * -1;
|
|
}
|
|
}
|
|
}
|
|
|
|
editorElementStyle.top = "".concat(top, "px");
|
|
editorElementStyle.left = "".concat(left, "px");
|
|
}
|
|
}]);
|
|
|
|
return Ui;
|
|
}();
|
|
|
|
customEvents_default().mixin(Ui);
|
|
/* harmony default export */ var ui = (Ui);
|
|
// EXTERNAL MODULE: ../../node_modules/@babel/runtime-corejs3/core-js-stable/instance/filter.js
|
|
var instance_filter = __webpack_require__(381);
|
|
var filter_default = /*#__PURE__*/__webpack_require__.n(instance_filter);
|
|
;// CONCATENATED MODULE: ./src/js/helper/imagetracer.js
|
|
|
|
|
|
|
|
|
|
|
|
/*
|
|
imagetracer.js version 1.2.4
|
|
Simple raster image tracer and vectorizer written in JavaScript.
|
|
andras@jankovics.net
|
|
*/
|
|
|
|
/*
|
|
The Unlicense / PUBLIC DOMAIN
|
|
This is free and unencumbered software released into the public domain.
|
|
Anyone is free to copy, modify, publish, use, compile, sell, or
|
|
distribute this software, either in source code form or as a compiled
|
|
binary, for any purpose, commercial or non-commercial, and by any
|
|
means.
|
|
In jurisdictions that recognize copyright laws, the author or authors
|
|
of this software dedicate any and all copyright interest in the
|
|
software to the public domain. We make this dedication for the benefit
|
|
of the public at large and to the detriment of our heirs and
|
|
successors. We intend this dedication to be an overt act of
|
|
relinquishment in perpetuity of all present and future rights to this
|
|
software under copyright law.
|
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
|
|
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
|
|
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
|
|
IN NO EVENT SHALL THE AUTHORS BE LIABLE FOR ANY CLAIM, DAMAGES OR
|
|
OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
|
|
ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
|
|
OTHER DEALINGS IN THE SOFTWARE.
|
|
For more information, please refer to http://unlicense.org/
|
|
*/
|
|
var ImageTracer = /*#__PURE__*/function () {
|
|
/* eslint-disable */
|
|
function ImageTracer() {
|
|
_classCallCheck(this, ImageTracer);
|
|
|
|
this.versionnumber = '1.2.4';
|
|
this.optionpresets = {
|
|
default: {
|
|
corsenabled: false,
|
|
ltres: 1,
|
|
qtres: 1,
|
|
pathomit: 8,
|
|
rightangleenhance: true,
|
|
colorsampling: 2,
|
|
numberofcolors: 16,
|
|
mincolorratio: 0,
|
|
colorquantcycles: 3,
|
|
layering: 0,
|
|
strokewidth: 1,
|
|
linefilter: false,
|
|
scale: 1,
|
|
roundcoords: 1,
|
|
viewbox: false,
|
|
desc: false,
|
|
lcpr: 0,
|
|
qcpr: 0,
|
|
blurradius: 0,
|
|
blurdelta: 20
|
|
},
|
|
posterized1: {
|
|
colorsampling: 0,
|
|
numberofcolors: 2
|
|
},
|
|
posterized2: {
|
|
numberofcolors: 4,
|
|
blurradius: 5
|
|
},
|
|
curvy: {
|
|
ltres: 0.01,
|
|
linefilter: true,
|
|
rightangleenhance: false
|
|
},
|
|
sharp: {
|
|
qtres: 0.01,
|
|
linefilter: false
|
|
},
|
|
detailed: {
|
|
pathomit: 0,
|
|
roundcoords: 2,
|
|
ltres: 0.5,
|
|
qtres: 0.5,
|
|
numberofcolors: 64
|
|
},
|
|
smoothed: {
|
|
blurradius: 5,
|
|
blurdelta: 64
|
|
},
|
|
grayscale: {
|
|
colorsampling: 0,
|
|
colorquantcycles: 1,
|
|
numberofcolors: 7
|
|
},
|
|
fixedpalette: {
|
|
colorsampling: 0,
|
|
colorquantcycles: 1,
|
|
numberofcolors: 27
|
|
},
|
|
randomsampling1: {
|
|
colorsampling: 1,
|
|
numberofcolors: 8
|
|
},
|
|
randomsampling2: {
|
|
colorsampling: 1,
|
|
numberofcolors: 64
|
|
},
|
|
artistic1: {
|
|
colorsampling: 0,
|
|
colorquantcycles: 1,
|
|
pathomit: 0,
|
|
blurradius: 5,
|
|
blurdelta: 64,
|
|
ltres: 0.01,
|
|
linefilter: true,
|
|
numberofcolors: 16,
|
|
strokewidth: 2
|
|
},
|
|
artistic2: {
|
|
qtres: 0.01,
|
|
colorsampling: 0,
|
|
colorquantcycles: 1,
|
|
numberofcolors: 4,
|
|
strokewidth: 0
|
|
},
|
|
artistic3: {
|
|
qtres: 10,
|
|
ltres: 10,
|
|
numberofcolors: 8
|
|
},
|
|
artistic4: {
|
|
qtres: 10,
|
|
ltres: 10,
|
|
numberofcolors: 64,
|
|
blurradius: 5,
|
|
blurdelta: 256,
|
|
strokewidth: 2
|
|
},
|
|
posterized3: {
|
|
ltres: 1,
|
|
qtres: 1,
|
|
pathomit: 20,
|
|
rightangleenhance: true,
|
|
colorsampling: 0,
|
|
numberofcolors: 3,
|
|
mincolorratio: 0,
|
|
colorquantcycles: 3,
|
|
blurradius: 3,
|
|
blurdelta: 20,
|
|
strokewidth: 0,
|
|
linefilter: false,
|
|
roundcoords: 1,
|
|
pal: [{
|
|
r: 0,
|
|
g: 0,
|
|
b: 100,
|
|
a: 255
|
|
}, {
|
|
r: 255,
|
|
g: 255,
|
|
b: 255,
|
|
a: 255
|
|
}]
|
|
}
|
|
};
|
|
this.pathscan_combined_lookup = [[[-1, -1, -1, -1], [-1, -1, -1, -1], [-1, -1, -1, -1], [-1, -1, -1, -1]], [[0, 1, 0, -1], [-1, -1, -1, -1], [-1, -1, -1, -1], [0, 2, -1, 0]], [[-1, -1, -1, -1], [-1, -1, -1, -1], [0, 1, 0, -1], [0, 0, 1, 0]], [[0, 0, 1, 0], [-1, -1, -1, -1], [0, 2, -1, 0], [-1, -1, -1, -1]], [[-1, -1, -1, -1], [0, 0, 1, 0], [0, 3, 0, 1], [-1, -1, -1, -1]], [[13, 3, 0, 1], [13, 2, -1, 0], [7, 1, 0, -1], [7, 0, 1, 0]], [[-1, -1, -1, -1], [0, 1, 0, -1], [-1, -1, -1, -1], [0, 3, 0, 1]], [[0, 3, 0, 1], [0, 2, -1, 0], [-1, -1, -1, -1], [-1, -1, -1, -1]], [[0, 3, 0, 1], [0, 2, -1, 0], [-1, -1, -1, -1], [-1, -1, -1, -1]], [[-1, -1, -1, -1], [0, 1, 0, -1], [-1, -1, -1, -1], [0, 3, 0, 1]], [[11, 1, 0, -1], [14, 0, 1, 0], [14, 3, 0, 1], [11, 2, -1, 0]], [[-1, -1, -1, -1], [0, 0, 1, 0], [0, 3, 0, 1], [-1, -1, -1, -1]], [[0, 0, 1, 0], [-1, -1, -1, -1], [0, 2, -1, 0], [-1, -1, -1, -1]], [[-1, -1, -1, -1], [-1, -1, -1, -1], [0, 1, 0, -1], [0, 0, 1, 0]], [[0, 1, 0, -1], [-1, -1, -1, -1], [-1, -1, -1, -1], [0, 2, -1, 0]], [[-1, -1, -1, -1], [-1, -1, -1, -1], [-1, -1, -1, -1], [-1, -1, -1, -1]]];
|
|
this.gks = [[0.27901, 0.44198, 0.27901], [0.135336, 0.228569, 0.272192, 0.228569, 0.135336], [0.086776, 0.136394, 0.178908, 0.195843, 0.178908, 0.136394, 0.086776], [0.063327, 0.093095, 0.122589, 0.144599, 0.152781, 0.144599, 0.122589, 0.093095, 0.063327], [0.049692, 0.069304, 0.089767, 0.107988, 0.120651, 0.125194, 0.120651, 0.107988, 0.089767, 0.069304, 0.049692]];
|
|
this.specpalette = [{
|
|
r: 0,
|
|
g: 0,
|
|
b: 0,
|
|
a: 255
|
|
}, {
|
|
r: 128,
|
|
g: 128,
|
|
b: 128,
|
|
a: 255
|
|
}, {
|
|
r: 0,
|
|
g: 0,
|
|
b: 128,
|
|
a: 255
|
|
}, {
|
|
r: 64,
|
|
g: 64,
|
|
b: 128,
|
|
a: 255
|
|
}, {
|
|
r: 192,
|
|
g: 192,
|
|
b: 192,
|
|
a: 255
|
|
}, {
|
|
r: 255,
|
|
g: 255,
|
|
b: 255,
|
|
a: 255
|
|
}, {
|
|
r: 128,
|
|
g: 128,
|
|
b: 192,
|
|
a: 255
|
|
}, {
|
|
r: 0,
|
|
g: 0,
|
|
b: 192,
|
|
a: 255
|
|
}, {
|
|
r: 128,
|
|
g: 0,
|
|
b: 0,
|
|
a: 255
|
|
}, {
|
|
r: 128,
|
|
g: 64,
|
|
b: 64,
|
|
a: 255
|
|
}, {
|
|
r: 128,
|
|
g: 0,
|
|
b: 128,
|
|
a: 255
|
|
}, {
|
|
r: 168,
|
|
g: 168,
|
|
b: 168,
|
|
a: 255
|
|
}, {
|
|
r: 192,
|
|
g: 128,
|
|
b: 128,
|
|
a: 255
|
|
}, {
|
|
r: 192,
|
|
g: 0,
|
|
b: 0,
|
|
a: 255
|
|
}, {
|
|
r: 255,
|
|
g: 255,
|
|
b: 255,
|
|
a: 255
|
|
}, {
|
|
r: 0,
|
|
g: 128,
|
|
b: 0,
|
|
a: 255
|
|
}];
|
|
}
|
|
|
|
_createClass(ImageTracer, [{
|
|
key: "imageToSVG",
|
|
value: function imageToSVG(url, callback, options) {
|
|
var _this = this;
|
|
|
|
options = this.checkoptions(options);
|
|
this.loadImage(url, function (canvas) {
|
|
callback(_this.imagedataToSVG(_this.getImgdata(canvas), options));
|
|
}, options);
|
|
}
|
|
}, {
|
|
key: "imagedataToSVG",
|
|
value: function imagedataToSVG(imgd, options) {
|
|
options = this.checkoptions(options);
|
|
var td = this.imagedataToTracedata(imgd, options);
|
|
return this.getsvgstring(td, options);
|
|
}
|
|
}, {
|
|
key: "imageToTracedata",
|
|
value: function imageToTracedata(url, callback, options) {
|
|
var _this2 = this;
|
|
|
|
options = this.checkoptions(options);
|
|
this.loadImage(url, function (canvas) {
|
|
callback(_this2.imagedataToTracedata(_this2.getImgdata(canvas), options));
|
|
}, options);
|
|
}
|
|
}, {
|
|
key: "imagedataToTracedata",
|
|
value: function imagedataToTracedata(imgd, options) {
|
|
options = this.checkoptions(options);
|
|
var ii = this.colorquantization(imgd, options);
|
|
var tracedata;
|
|
|
|
if (options.layering === 0) {
|
|
tracedata = {
|
|
layers: [],
|
|
palette: ii.palette,
|
|
width: ii.array[0].length - 2,
|
|
height: ii.array.length - 2
|
|
};
|
|
|
|
for (var colornum = 0; colornum < ii.palette.length; colornum += 1) {
|
|
var tracedlayer = this.batchtracepaths(this.internodes(this.pathscan(this.layeringstep(ii, colornum), options.pathomit), options), options.ltres, options.qtres);
|
|
tracedata.layers.push(tracedlayer);
|
|
}
|
|
} else {
|
|
var ls = this.layering(ii);
|
|
|
|
if (options.layercontainerid) {
|
|
this.drawLayers(ls, this.specpalette, options.scale, options.layercontainerid);
|
|
}
|
|
|
|
var bps = this.batchpathscan(ls, options.pathomit);
|
|
var bis = this.batchinternodes(bps, options);
|
|
tracedata = {
|
|
layers: this.batchtracelayers(bis, options.ltres, options.qtres),
|
|
palette: ii.palette,
|
|
width: imgd.width,
|
|
height: imgd.height
|
|
};
|
|
}
|
|
|
|
return tracedata;
|
|
}
|
|
}, {
|
|
key: "checkoptions",
|
|
value: function checkoptions(options) {
|
|
options = options || {};
|
|
|
|
if (typeof options === 'string') {
|
|
options = options.toLowerCase();
|
|
|
|
if (this.optionpresets[options]) {
|
|
options = this.optionpresets[options];
|
|
} else {
|
|
options = {};
|
|
}
|
|
}
|
|
|
|
var ok = keys_default()(this.optionpresets['default']);
|
|
|
|
for (var k = 0; k < ok.length; k += 1) {
|
|
if (!options.hasOwnProperty(ok[k])) {
|
|
options[ok[k]] = this.optionpresets['default'][ok[k]];
|
|
}
|
|
}
|
|
|
|
return options;
|
|
}
|
|
}, {
|
|
key: "colorquantization",
|
|
value: function colorquantization(imgd, options) {
|
|
var arr = [];
|
|
var idx = 0;
|
|
var cd;
|
|
var cdl;
|
|
var ci;
|
|
var paletteacc = [];
|
|
var pixelnum = imgd.width * imgd.height;
|
|
var i;
|
|
var j;
|
|
var k;
|
|
var cnt;
|
|
var palette;
|
|
|
|
for (j = 0; j < imgd.height + 2; j += 1) {
|
|
arr[j] = [];
|
|
|
|
for (i = 0; i < imgd.width + 2; i += 1) {
|
|
arr[j][i] = -1;
|
|
}
|
|
}
|
|
|
|
if (options.pal) {
|
|
palette = options.pal;
|
|
} else if (options.colorsampling === 0) {
|
|
palette = this.generatepalette(options.numberofcolors);
|
|
} else if (options.colorsampling === 1) {
|
|
palette = this.samplepalette(options.numberofcolors, imgd);
|
|
} else {
|
|
palette = this.samplepalette2(options.numberofcolors, imgd);
|
|
}
|
|
|
|
if (options.blurradius > 0) {
|
|
imgd = this.blur(imgd, options.blurradius, options.blurdelta);
|
|
}
|
|
|
|
for (cnt = 0; cnt < options.colorquantcycles; cnt += 1) {
|
|
if (cnt > 0) {
|
|
for (k = 0; k < palette.length; k += 1) {
|
|
if (paletteacc[k].n > 0) {
|
|
palette[k] = {
|
|
r: Math.floor(paletteacc[k].r / paletteacc[k].n),
|
|
g: Math.floor(paletteacc[k].g / paletteacc[k].n),
|
|
b: Math.floor(paletteacc[k].b / paletteacc[k].n),
|
|
a: Math.floor(paletteacc[k].a / paletteacc[k].n)
|
|
};
|
|
}
|
|
|
|
if (paletteacc[k].n / pixelnum < options.mincolorratio && cnt < options.colorquantcycles - 1) {
|
|
palette[k] = {
|
|
r: Math.floor(Math.random() * 255),
|
|
g: Math.floor(Math.random() * 255),
|
|
b: Math.floor(Math.random() * 255),
|
|
a: Math.floor(Math.random() * 255)
|
|
};
|
|
}
|
|
}
|
|
}
|
|
|
|
for (i = 0; i < palette.length; i += 1) {
|
|
paletteacc[i] = {
|
|
r: 0,
|
|
g: 0,
|
|
b: 0,
|
|
a: 0,
|
|
n: 0
|
|
};
|
|
}
|
|
|
|
for (j = 0; j < imgd.height; j += 1) {
|
|
for (i = 0; i < imgd.width; i += 1) {
|
|
idx = (j * imgd.width + i) * 4;
|
|
ci = 0;
|
|
cdl = 1024;
|
|
|
|
for (k = 0; k < palette.length; k += 1) {
|
|
cd = Math.abs(palette[k].r - imgd.data[idx]) + Math.abs(palette[k].g - imgd.data[idx + 1]) + Math.abs(palette[k].b - imgd.data[idx + 2]) + Math.abs(palette[k].a - imgd.data[idx + 3]);
|
|
|
|
if (cd < cdl) {
|
|
cdl = cd;
|
|
ci = k;
|
|
}
|
|
}
|
|
|
|
paletteacc[ci].r += imgd.data[idx];
|
|
paletteacc[ci].g += imgd.data[idx + 1];
|
|
paletteacc[ci].b += imgd.data[idx + 2];
|
|
paletteacc[ci].a += imgd.data[idx + 3];
|
|
paletteacc[ci].n += 1;
|
|
arr[j + 1][i + 1] = ci;
|
|
}
|
|
}
|
|
}
|
|
|
|
return {
|
|
array: arr,
|
|
palette: palette
|
|
};
|
|
}
|
|
}, {
|
|
key: "samplepalette",
|
|
value: function samplepalette(numberofcolors, imgd) {
|
|
var idx;
|
|
var palette = [];
|
|
|
|
for (var i = 0; i < numberofcolors; i += 1) {
|
|
idx = Math.floor(Math.random() * imgd.data.length / 4) * 4;
|
|
palette.push({
|
|
r: imgd.data[idx],
|
|
g: imgd.data[idx + 1],
|
|
b: imgd.data[idx + 2],
|
|
a: imgd.data[idx + 3]
|
|
});
|
|
}
|
|
|
|
return palette;
|
|
}
|
|
}, {
|
|
key: "samplepalette2",
|
|
value: function samplepalette2(numberofcolors, imgd) {
|
|
var idx;
|
|
var palette = [];
|
|
var ni = Math.ceil(Math.sqrt(numberofcolors));
|
|
var nj = Math.ceil(numberofcolors / ni);
|
|
var vx = imgd.width / (ni + 1);
|
|
var vy = imgd.height / (nj + 1);
|
|
|
|
for (var j = 0; j < nj; j += 1) {
|
|
for (var i = 0; i < ni; i += 1) {
|
|
if (palette.length === numberofcolors) {
|
|
break;
|
|
} else {
|
|
idx = Math.floor((j + 1) * vy * imgd.width + (i + 1) * vx) * 4;
|
|
palette.push({
|
|
r: imgd.data[idx],
|
|
g: imgd.data[idx + 1],
|
|
b: imgd.data[idx + 2],
|
|
a: imgd.data[idx + 3]
|
|
});
|
|
}
|
|
}
|
|
}
|
|
|
|
return palette;
|
|
}
|
|
}, {
|
|
key: "generatepalette",
|
|
value: function generatepalette(numberofcolors) {
|
|
var palette = [];
|
|
var rcnt;
|
|
var gcnt;
|
|
var bcnt;
|
|
|
|
if (numberofcolors < 8) {
|
|
var graystep = Math.floor(255 / (numberofcolors - 1));
|
|
|
|
for (var i = 0; i < numberofcolors; i += 1) {
|
|
palette.push({
|
|
r: i * graystep,
|
|
g: i * graystep,
|
|
b: i * graystep,
|
|
a: 255
|
|
});
|
|
}
|
|
} else {
|
|
var colorqnum = Math.floor(Math.pow(numberofcolors, 1 / 3));
|
|
var colorstep = Math.floor(255 / (colorqnum - 1));
|
|
var rndnum = numberofcolors - colorqnum * colorqnum * colorqnum;
|
|
|
|
for (rcnt = 0; rcnt < colorqnum; rcnt += 1) {
|
|
for (gcnt = 0; gcnt < colorqnum; gcnt += 1) {
|
|
for (bcnt = 0; bcnt < colorqnum; bcnt += 1) {
|
|
palette.push({
|
|
r: rcnt * colorstep,
|
|
g: gcnt * colorstep,
|
|
b: bcnt * colorstep,
|
|
a: 255
|
|
});
|
|
}
|
|
}
|
|
}
|
|
|
|
for (rcnt = 0; rcnt < rndnum; rcnt += 1) {
|
|
palette.push({
|
|
r: Math.floor(Math.random() * 255),
|
|
g: Math.floor(Math.random() * 255),
|
|
b: Math.floor(Math.random() * 255),
|
|
a: Math.floor(Math.random() * 255)
|
|
});
|
|
}
|
|
}
|
|
|
|
return palette;
|
|
}
|
|
}, {
|
|
key: "layering",
|
|
value: function layering(ii) {
|
|
var layers = [];
|
|
var val = 0;
|
|
var ah = ii.array.length;
|
|
var aw = ii.array[0].length;
|
|
var n1;
|
|
var n2;
|
|
var n3;
|
|
var n4;
|
|
var n5;
|
|
var n6;
|
|
var n7;
|
|
var n8;
|
|
var i;
|
|
var j;
|
|
var k;
|
|
|
|
for (k = 0; k < ii.palette.length; k += 1) {
|
|
layers[k] = [];
|
|
|
|
for (j = 0; j < ah; j += 1) {
|
|
layers[k][j] = [];
|
|
|
|
for (i = 0; i < aw; i += 1) {
|
|
layers[k][j][i] = 0;
|
|
}
|
|
}
|
|
}
|
|
|
|
for (j = 1; j < ah - 1; j += 1) {
|
|
for (i = 1; i < aw - 1; i += 1) {
|
|
val = ii.array[j][i];
|
|
n1 = ii.array[j - 1][i - 1] === val ? 1 : 0;
|
|
n2 = ii.array[j - 1][i] === val ? 1 : 0;
|
|
n3 = ii.array[j - 1][i + 1] === val ? 1 : 0;
|
|
n4 = ii.array[j][i - 1] === val ? 1 : 0;
|
|
n5 = ii.array[j][i + 1] === val ? 1 : 0;
|
|
n6 = ii.array[j + 1][i - 1] === val ? 1 : 0;
|
|
n7 = ii.array[j + 1][i] === val ? 1 : 0;
|
|
n8 = ii.array[j + 1][i + 1] === val ? 1 : 0;
|
|
layers[val][j + 1][i + 1] = 1 + n5 * 2 + n8 * 4 + n7 * 8;
|
|
|
|
if (!n4) {
|
|
layers[val][j + 1][i] = 0 + 2 + n7 * 4 + n6 * 8;
|
|
}
|
|
|
|
if (!n2) {
|
|
layers[val][j][i + 1] = 0 + n3 * 2 + n5 * 4 + 8;
|
|
}
|
|
|
|
if (!n1) {
|
|
layers[val][j][i] = 0 + n2 * 2 + 4 + n4 * 8;
|
|
}
|
|
}
|
|
}
|
|
|
|
return layers;
|
|
}
|
|
}, {
|
|
key: "layeringstep",
|
|
value: function layeringstep(ii, cnum) {
|
|
var layer = [];
|
|
var ah = ii.array.length;
|
|
var aw = ii.array[0].length;
|
|
var i;
|
|
var j;
|
|
|
|
for (j = 0; j < ah; j += 1) {
|
|
layer[j] = [];
|
|
|
|
for (i = 0; i < aw; i += 1) {
|
|
layer[j][i] = 0;
|
|
}
|
|
}
|
|
|
|
for (j = 1; j < ah; j += 1) {
|
|
for (i = 1; i < aw; i += 1) {
|
|
layer[j][i] = (ii.array[j - 1][i - 1] === cnum ? 1 : 0) + (ii.array[j - 1][i] === cnum ? 2 : 0) + (ii.array[j][i - 1] === cnum ? 8 : 0) + (ii.array[j][i] === cnum ? 4 : 0);
|
|
}
|
|
}
|
|
|
|
return layer;
|
|
}
|
|
}, {
|
|
key: "pathscan",
|
|
value: function pathscan(arr, pathomit) {
|
|
var paths = [];
|
|
var pacnt = 0;
|
|
var pcnt = 0;
|
|
var px = 0;
|
|
var py = 0;
|
|
var w = arr[0].length;
|
|
var h = arr.length;
|
|
var dir = 0;
|
|
var pathfinished = true;
|
|
var holepath = false;
|
|
var lookuprow;
|
|
|
|
for (var j = 0; j < h; j += 1) {
|
|
for (var i = 0; i < w; i += 1) {
|
|
if (arr[j][i] === 4 || arr[j][i] === 11) {
|
|
px = i;
|
|
py = j;
|
|
paths[pacnt] = {};
|
|
paths[pacnt].points = [];
|
|
paths[pacnt].boundingbox = [px, py, px, py];
|
|
paths[pacnt].holechildren = [];
|
|
pathfinished = false;
|
|
pcnt = 0;
|
|
holepath = arr[j][i] === 11;
|
|
dir = 1;
|
|
|
|
while (!pathfinished) {
|
|
paths[pacnt].points[pcnt] = {};
|
|
paths[pacnt].points[pcnt].x = px - 1;
|
|
paths[pacnt].points[pcnt].y = py - 1;
|
|
paths[pacnt].points[pcnt].t = arr[py][px];
|
|
|
|
if (px - 1 < paths[pacnt].boundingbox[0]) {
|
|
paths[pacnt].boundingbox[0] = px - 1;
|
|
}
|
|
|
|
if (px - 1 > paths[pacnt].boundingbox[2]) {
|
|
paths[pacnt].boundingbox[2] = px - 1;
|
|
}
|
|
|
|
if (py - 1 < paths[pacnt].boundingbox[1]) {
|
|
paths[pacnt].boundingbox[1] = py - 1;
|
|
}
|
|
|
|
if (py - 1 > paths[pacnt].boundingbox[3]) {
|
|
paths[pacnt].boundingbox[3] = py - 1;
|
|
}
|
|
|
|
lookuprow = this.pathscan_combined_lookup[arr[py][px]][dir];
|
|
arr[py][px] = lookuprow[0];
|
|
dir = lookuprow[1];
|
|
px += lookuprow[2];
|
|
py += lookuprow[3];
|
|
|
|
if (px - 1 === paths[pacnt].points[0].x && py - 1 === paths[pacnt].points[0].y) {
|
|
pathfinished = true;
|
|
|
|
if (paths[pacnt].points.length < pathomit) {
|
|
paths.pop();
|
|
} else {
|
|
paths[pacnt].isholepath = !!holepath;
|
|
|
|
if (holepath) {
|
|
var parentidx = 0,
|
|
parentbbox = [-1, -1, w + 1, h + 1];
|
|
|
|
for (var parentcnt = 0; parentcnt < pacnt; parentcnt++) {
|
|
if (!paths[parentcnt].isholepath && this.boundingboxincludes(paths[parentcnt].boundingbox, paths[pacnt].boundingbox) && this.boundingboxincludes(parentbbox, paths[parentcnt].boundingbox)) {
|
|
parentidx = parentcnt;
|
|
parentbbox = paths[parentcnt].boundingbox;
|
|
}
|
|
}
|
|
|
|
paths[parentidx].holechildren.push(pacnt);
|
|
}
|
|
|
|
pacnt += 1;
|
|
}
|
|
}
|
|
|
|
pcnt += 1;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return paths;
|
|
}
|
|
}, {
|
|
key: "boundingboxincludes",
|
|
value: function boundingboxincludes(parentbbox, childbbox) {
|
|
return parentbbox[0] < childbbox[0] && parentbbox[1] < childbbox[1] && parentbbox[2] > childbbox[2] && parentbbox[3] > childbbox[3];
|
|
}
|
|
}, {
|
|
key: "batchpathscan",
|
|
value: function batchpathscan(layers, pathomit) {
|
|
var bpaths = [];
|
|
|
|
for (var k in layers) {
|
|
if (!layers.hasOwnProperty(k)) {
|
|
continue;
|
|
}
|
|
|
|
bpaths[k] = this.pathscan(layers[k], pathomit);
|
|
}
|
|
|
|
return bpaths;
|
|
}
|
|
}, {
|
|
key: "internodes",
|
|
value: function internodes(paths, options) {
|
|
var ins = [];
|
|
var palen = 0;
|
|
var nextidx = 0;
|
|
var nextidx2 = 0;
|
|
var previdx = 0;
|
|
var previdx2 = 0;
|
|
var pacnt;
|
|
var pcnt;
|
|
|
|
for (pacnt = 0; pacnt < paths.length; pacnt += 1) {
|
|
ins[pacnt] = {};
|
|
ins[pacnt].points = [];
|
|
ins[pacnt].boundingbox = paths[pacnt].boundingbox;
|
|
ins[pacnt].holechildren = paths[pacnt].holechildren;
|
|
ins[pacnt].isholepath = paths[pacnt].isholepath;
|
|
palen = paths[pacnt].points.length;
|
|
|
|
for (pcnt = 0; pcnt < palen; pcnt += 1) {
|
|
nextidx = (pcnt + 1) % palen;
|
|
nextidx2 = (pcnt + 2) % palen;
|
|
previdx = (pcnt - 1 + palen) % palen;
|
|
previdx2 = (pcnt - 2 + palen) % palen;
|
|
|
|
if (options.rightangleenhance && this.testrightangle(paths[pacnt], previdx2, previdx, pcnt, nextidx, nextidx2)) {
|
|
if (ins[pacnt].points.length > 0) {
|
|
ins[pacnt].points[ins[pacnt].points.length - 1].linesegment = this.getdirection(ins[pacnt].points[ins[pacnt].points.length - 1].x, ins[pacnt].points[ins[pacnt].points.length - 1].y, paths[pacnt].points[pcnt].x, paths[pacnt].points[pcnt].y);
|
|
}
|
|
|
|
ins[pacnt].points.push({
|
|
x: paths[pacnt].points[pcnt].x,
|
|
y: paths[pacnt].points[pcnt].y,
|
|
linesegment: this.getdirection(paths[pacnt].points[pcnt].x, paths[pacnt].points[pcnt].y, (paths[pacnt].points[pcnt].x + paths[pacnt].points[nextidx].x) / 2, (paths[pacnt].points[pcnt].y + paths[pacnt].points[nextidx].y) / 2)
|
|
});
|
|
}
|
|
|
|
ins[pacnt].points.push({
|
|
x: (paths[pacnt].points[pcnt].x + paths[pacnt].points[nextidx].x) / 2,
|
|
y: (paths[pacnt].points[pcnt].y + paths[pacnt].points[nextidx].y) / 2,
|
|
linesegment: this.getdirection((paths[pacnt].points[pcnt].x + paths[pacnt].points[nextidx].x) / 2, (paths[pacnt].points[pcnt].y + paths[pacnt].points[nextidx].y) / 2, (paths[pacnt].points[nextidx].x + paths[pacnt].points[nextidx2].x) / 2, (paths[pacnt].points[nextidx].y + paths[pacnt].points[nextidx2].y) / 2)
|
|
});
|
|
}
|
|
}
|
|
|
|
return ins;
|
|
}
|
|
}, {
|
|
key: "testrightangle",
|
|
value: function testrightangle(path, idx1, idx2, idx3, idx4, idx5) {
|
|
return path.points[idx3].x === path.points[idx1].x && path.points[idx3].x === path.points[idx2].x && path.points[idx3].y === path.points[idx4].y && path.points[idx3].y === path.points[idx5].y || path.points[idx3].y === path.points[idx1].y && path.points[idx3].y === path.points[idx2].y && path.points[idx3].x === path.points[idx4].x && path.points[idx3].x === path.points[idx5].x;
|
|
}
|
|
}, {
|
|
key: "getdirection",
|
|
value: function getdirection(x1, y1, x2, y2) {
|
|
var val = 8;
|
|
|
|
if (x1 < x2) {
|
|
if (y1 < y2) {
|
|
val = 1;
|
|
} else if (y1 > y2) {
|
|
val = 7;
|
|
} else {
|
|
val = 0;
|
|
}
|
|
} else if (x1 > x2) {
|
|
if (y1 < y2) {
|
|
val = 3;
|
|
} else if (y1 > y2) {
|
|
val = 5;
|
|
} else {
|
|
val = 4;
|
|
}
|
|
} else if (y1 < y2) {
|
|
val = 2;
|
|
} else if (y1 > y2) {
|
|
val = 6;
|
|
} else {
|
|
val = 8;
|
|
}
|
|
|
|
return val;
|
|
}
|
|
}, {
|
|
key: "batchinternodes",
|
|
value: function batchinternodes(bpaths, options) {
|
|
var binternodes = [];
|
|
|
|
for (var k in bpaths) {
|
|
if (!bpaths.hasOwnProperty(k)) {
|
|
continue;
|
|
}
|
|
|
|
binternodes[k] = this.internodes(bpaths[k], options);
|
|
}
|
|
|
|
return binternodes;
|
|
}
|
|
}, {
|
|
key: "tracepath",
|
|
value: function tracepath(path, ltres, qtres) {
|
|
var pcnt = 0;
|
|
var segtype1;
|
|
var segtype2;
|
|
var seqend;
|
|
var smp = {};
|
|
smp.segments = [];
|
|
smp.boundingbox = path.boundingbox;
|
|
smp.holechildren = path.holechildren;
|
|
smp.isholepath = path.isholepath;
|
|
|
|
while (pcnt < path.points.length) {
|
|
var _context;
|
|
|
|
segtype1 = path.points[pcnt].linesegment;
|
|
segtype2 = -1;
|
|
seqend = pcnt + 1;
|
|
|
|
while ((path.points[seqend].linesegment === segtype1 || path.points[seqend].linesegment === segtype2 || segtype2 === -1) && seqend < path.points.length - 1) {
|
|
if (path.points[seqend].linesegment !== segtype1 && segtype2 === -1) {
|
|
segtype2 = path.points[seqend].linesegment;
|
|
}
|
|
|
|
seqend += 1;
|
|
}
|
|
|
|
if (seqend === path.points.length - 1) {
|
|
seqend = 0;
|
|
}
|
|
|
|
smp.segments = concat_default()(_context = smp.segments).call(_context, this.fitseq(path, ltres, qtres, pcnt, seqend));
|
|
|
|
if (seqend > 0) {
|
|
pcnt = seqend;
|
|
} else {
|
|
pcnt = path.points.length;
|
|
}
|
|
}
|
|
|
|
return smp;
|
|
}
|
|
}, {
|
|
key: "fitseq",
|
|
value: function fitseq(path, ltres, qtres, seqstart, seqend) {
|
|
var _context2;
|
|
|
|
if (seqend > path.points.length || seqend < 0) {
|
|
return [];
|
|
}
|
|
|
|
var errorpoint = seqstart,
|
|
errorval = 0,
|
|
curvepass = true,
|
|
px,
|
|
py,
|
|
dist2;
|
|
var tl = seqend - seqstart;
|
|
|
|
if (tl < 0) {
|
|
tl += path.points.length;
|
|
}
|
|
|
|
var vx = (path.points[seqend].x - path.points[seqstart].x) / tl,
|
|
vy = (path.points[seqend].y - path.points[seqstart].y) / tl;
|
|
var pcnt = (seqstart + 1) % path.points.length,
|
|
pl;
|
|
|
|
while (pcnt != seqend) {
|
|
pl = pcnt - seqstart;
|
|
|
|
if (pl < 0) {
|
|
pl += path.points.length;
|
|
}
|
|
|
|
px = path.points[seqstart].x + vx * pl;
|
|
py = path.points[seqstart].y + vy * pl;
|
|
dist2 = (path.points[pcnt].x - px) * (path.points[pcnt].x - px) + (path.points[pcnt].y - py) * (path.points[pcnt].y - py);
|
|
|
|
if (dist2 > ltres) {
|
|
curvepass = false;
|
|
}
|
|
|
|
if (dist2 > errorval) {
|
|
errorpoint = pcnt;
|
|
errorval = dist2;
|
|
}
|
|
|
|
pcnt = (pcnt + 1) % path.points.length;
|
|
}
|
|
|
|
if (curvepass) {
|
|
return [{
|
|
type: 'L',
|
|
x1: path.points[seqstart].x,
|
|
y1: path.points[seqstart].y,
|
|
x2: path.points[seqend].x,
|
|
y2: path.points[seqend].y
|
|
}];
|
|
}
|
|
|
|
var fitpoint = errorpoint;
|
|
curvepass = true;
|
|
errorval = 0;
|
|
var t = (fitpoint - seqstart) / tl,
|
|
t1 = (1 - t) * (1 - t),
|
|
t2 = 2 * (1 - t) * t,
|
|
t3 = t * t;
|
|
var cpx = (t1 * path.points[seqstart].x + t3 * path.points[seqend].x - path.points[fitpoint].x) / -t2,
|
|
cpy = (t1 * path.points[seqstart].y + t3 * path.points[seqend].y - path.points[fitpoint].y) / -t2;
|
|
pcnt = seqstart + 1;
|
|
|
|
while (pcnt != seqend) {
|
|
t = (pcnt - seqstart) / tl;
|
|
t1 = (1 - t) * (1 - t);
|
|
t2 = 2 * (1 - t) * t;
|
|
t3 = t * t;
|
|
px = t1 * path.points[seqstart].x + t2 * cpx + t3 * path.points[seqend].x;
|
|
py = t1 * path.points[seqstart].y + t2 * cpy + t3 * path.points[seqend].y;
|
|
dist2 = (path.points[pcnt].x - px) * (path.points[pcnt].x - px) + (path.points[pcnt].y - py) * (path.points[pcnt].y - py);
|
|
|
|
if (dist2 > qtres) {
|
|
curvepass = false;
|
|
}
|
|
|
|
if (dist2 > errorval) {
|
|
errorpoint = pcnt;
|
|
errorval = dist2;
|
|
}
|
|
|
|
pcnt = (pcnt + 1) % path.points.length;
|
|
}
|
|
|
|
if (curvepass) {
|
|
return [{
|
|
type: 'Q',
|
|
x1: path.points[seqstart].x,
|
|
y1: path.points[seqstart].y,
|
|
x2: cpx,
|
|
y2: cpy,
|
|
x3: path.points[seqend].x,
|
|
y3: path.points[seqend].y
|
|
}];
|
|
}
|
|
|
|
var splitpoint = fitpoint;
|
|
return concat_default()(_context2 = this.fitseq(path, ltres, qtres, seqstart, splitpoint)).call(_context2, this.fitseq(path, ltres, qtres, splitpoint, seqend));
|
|
}
|
|
}, {
|
|
key: "batchtracepaths",
|
|
value: function batchtracepaths(internodepaths, ltres, qtres) {
|
|
var btracedpaths = [];
|
|
|
|
for (var k in internodepaths) {
|
|
if (!internodepaths.hasOwnProperty(k)) {
|
|
continue;
|
|
}
|
|
|
|
btracedpaths.push(this.tracepath(internodepaths[k], ltres, qtres));
|
|
}
|
|
|
|
return btracedpaths;
|
|
}
|
|
}, {
|
|
key: "batchtracelayers",
|
|
value: function batchtracelayers(binternodes, ltres, qtres) {
|
|
var btbis = [];
|
|
|
|
for (var k in binternodes) {
|
|
if (!binternodes.hasOwnProperty(k)) {
|
|
continue;
|
|
}
|
|
|
|
btbis[k] = this.batchtracepaths(binternodes[k], ltres, qtres);
|
|
}
|
|
|
|
return btbis;
|
|
}
|
|
}, {
|
|
key: "roundtodec",
|
|
value: function roundtodec(val, places) {
|
|
return Number(val.toFixed(places));
|
|
}
|
|
}, {
|
|
key: "svgpathstring",
|
|
value: function svgpathstring(tracedata, lnum, pathnum, options) {
|
|
var _context3, _context4;
|
|
|
|
var layer = tracedata.layers[lnum],
|
|
smp = layer[pathnum],
|
|
str = '',
|
|
pcnt;
|
|
|
|
if (options.linefilter && smp.segments.length < 3) {
|
|
return str;
|
|
}
|
|
|
|
str = concat_default()(_context3 = "<path ".concat(options.desc ? concat_default()(_context4 = "desc=\"l ".concat(lnum, " p ")).call(_context4, pathnum, "\" ") : '')).call(_context3, this.tosvgcolorstr(tracedata.palette[lnum], options), "d=\"");
|
|
|
|
if (options.roundcoords === -1) {
|
|
var _context5;
|
|
|
|
str += concat_default()(_context5 = "M ".concat(smp.segments[0].x1 * options.scale, " ")).call(_context5, smp.segments[0].y1 * options.scale, " ");
|
|
|
|
for (pcnt = 0; pcnt < smp.segments.length; pcnt++) {
|
|
var _context6, _context7;
|
|
|
|
str += concat_default()(_context6 = concat_default()(_context7 = "".concat(smp.segments[pcnt].type, " ")).call(_context7, smp.segments[pcnt].x2 * options.scale, " ")).call(_context6, smp.segments[pcnt].y2 * options.scale, " ");
|
|
|
|
if (smp.segments[pcnt].hasOwnProperty('x3')) {
|
|
var _context8;
|
|
|
|
str += concat_default()(_context8 = "".concat(smp.segments[pcnt].x3 * options.scale, " ")).call(_context8, smp.segments[pcnt].y3 * options.scale, " ");
|
|
}
|
|
}
|
|
|
|
str += 'Z ';
|
|
} else {
|
|
var _context9;
|
|
|
|
str += concat_default()(_context9 = "M ".concat(this.roundtodec(smp.segments[0].x1 * options.scale, options.roundcoords), " ")).call(_context9, this.roundtodec(smp.segments[0].y1 * options.scale, options.roundcoords), " ");
|
|
|
|
for (pcnt = 0; pcnt < smp.segments.length; pcnt++) {
|
|
var _context10, _context11;
|
|
|
|
str += concat_default()(_context10 = concat_default()(_context11 = "".concat(smp.segments[pcnt].type, " ")).call(_context11, this.roundtodec(smp.segments[pcnt].x2 * options.scale, options.roundcoords), " ")).call(_context10, this.roundtodec(smp.segments[pcnt].y2 * options.scale, options.roundcoords), " ");
|
|
|
|
if (smp.segments[pcnt].hasOwnProperty('x3')) {
|
|
var _context12;
|
|
|
|
str += concat_default()(_context12 = "".concat(this.roundtodec(smp.segments[pcnt].x3 * options.scale, options.roundcoords), " ")).call(_context12, this.roundtodec(smp.segments[pcnt].y3 * options.scale, options.roundcoords), " ");
|
|
}
|
|
}
|
|
|
|
str += 'Z ';
|
|
}
|
|
|
|
for (var hcnt = 0; hcnt < smp.holechildren.length; hcnt++) {
|
|
var hsmp = layer[smp.holechildren[hcnt]];
|
|
|
|
if (options.roundcoords === -1) {
|
|
if (hsmp.segments[hsmp.segments.length - 1].hasOwnProperty('x3')) {
|
|
var _context13;
|
|
|
|
str += concat_default()(_context13 = "M ".concat(hsmp.segments[hsmp.segments.length - 1].x3 * options.scale, " ")).call(_context13, hsmp.segments[hsmp.segments.length - 1].y3 * options.scale, " ");
|
|
} else {
|
|
var _context14;
|
|
|
|
str += concat_default()(_context14 = "M ".concat(hsmp.segments[hsmp.segments.length - 1].x2 * options.scale, " ")).call(_context14, hsmp.segments[hsmp.segments.length - 1].y2 * options.scale, " ");
|
|
}
|
|
|
|
for (pcnt = hsmp.segments.length - 1; pcnt >= 0; pcnt--) {
|
|
var _context16;
|
|
|
|
str += "".concat(hsmp.segments[pcnt].type, " ");
|
|
|
|
if (hsmp.segments[pcnt].hasOwnProperty('x3')) {
|
|
var _context15;
|
|
|
|
str += concat_default()(_context15 = "".concat(hsmp.segments[pcnt].x2 * options.scale, " ")).call(_context15, hsmp.segments[pcnt].y2 * options.scale, " ");
|
|
}
|
|
|
|
str += concat_default()(_context16 = "".concat(hsmp.segments[pcnt].x1 * options.scale, " ")).call(_context16, hsmp.segments[pcnt].y1 * options.scale, " ");
|
|
}
|
|
} else {
|
|
if (hsmp.segments[hsmp.segments.length - 1].hasOwnProperty('x3')) {
|
|
var _context17;
|
|
|
|
str += concat_default()(_context17 = "M ".concat(this.roundtodec(hsmp.segments[hsmp.segments.length - 1].x3 * options.scale), " ")).call(_context17, this.roundtodec(hsmp.segments[hsmp.segments.length - 1].y3 * options.scale), " ");
|
|
} else {
|
|
var _context18;
|
|
|
|
str += concat_default()(_context18 = "M ".concat(this.roundtodec(hsmp.segments[hsmp.segments.length - 1].x2 * options.scale), " ")).call(_context18, this.roundtodec(hsmp.segments[hsmp.segments.length - 1].y2 * options.scale), " ");
|
|
}
|
|
|
|
for (pcnt = hsmp.segments.length - 1; pcnt >= 0; pcnt--) {
|
|
var _context20;
|
|
|
|
str += "".concat(hsmp.segments[pcnt].type, " ");
|
|
|
|
if (hsmp.segments[pcnt].hasOwnProperty('x3')) {
|
|
var _context19;
|
|
|
|
str += concat_default()(_context19 = "".concat(this.roundtodec(hsmp.segments[pcnt].x2 * options.scale), " ")).call(_context19, this.roundtodec(hsmp.segments[pcnt].y2 * options.scale), " ");
|
|
}
|
|
|
|
str += concat_default()(_context20 = "".concat(this.roundtodec(hsmp.segments[pcnt].x1 * options.scale), " ")).call(_context20, this.roundtodec(hsmp.segments[pcnt].y1 * options.scale), " ");
|
|
}
|
|
}
|
|
|
|
str += 'Z ';
|
|
}
|
|
|
|
str += '" />';
|
|
|
|
if (options.lcpr || options.qcpr) {
|
|
for (pcnt = 0; pcnt < smp.segments.length; pcnt++) {
|
|
if (smp.segments[pcnt].hasOwnProperty('x3') && options.qcpr) {
|
|
var _context21, _context22, _context23, _context24, _context25, _context26, _context27, _context28, _context29, _context30, _context31, _context32, _context33, _context34;
|
|
|
|
str += concat_default()(_context21 = concat_default()(_context22 = concat_default()(_context23 = "<circle cx=\"".concat(smp.segments[pcnt].x2 * options.scale, "\" cy=\"")).call(_context23, smp.segments[pcnt].y2 * options.scale, "\" r=\"")).call(_context22, options.qcpr, "\" fill=\"cyan\" stroke-width=\"")).call(_context21, options.qcpr * 0.2, "\" stroke=\"black\" />");
|
|
str += concat_default()(_context24 = concat_default()(_context25 = concat_default()(_context26 = "<circle cx=\"".concat(smp.segments[pcnt].x3 * options.scale, "\" cy=\"")).call(_context26, smp.segments[pcnt].y3 * options.scale, "\" r=\"")).call(_context25, options.qcpr, "\" fill=\"white\" stroke-width=\"")).call(_context24, options.qcpr * 0.2, "\" stroke=\"black\" />");
|
|
str += concat_default()(_context27 = concat_default()(_context28 = concat_default()(_context29 = concat_default()(_context30 = "<line x1=\"".concat(smp.segments[pcnt].x1 * options.scale, "\" y1=\"")).call(_context30, smp.segments[pcnt].y1 * options.scale, "\" x2=\"")).call(_context29, smp.segments[pcnt].x2 * options.scale, "\" y2=\"")).call(_context28, smp.segments[pcnt].y2 * options.scale, "\" stroke-width=\"")).call(_context27, options.qcpr * 0.2, "\" stroke=\"cyan\" />");
|
|
str += concat_default()(_context31 = concat_default()(_context32 = concat_default()(_context33 = concat_default()(_context34 = "<line x1=\"".concat(smp.segments[pcnt].x2 * options.scale, "\" y1=\"")).call(_context34, smp.segments[pcnt].y2 * options.scale, "\" x2=\"")).call(_context33, smp.segments[pcnt].x3 * options.scale, "\" y2=\"")).call(_context32, smp.segments[pcnt].y3 * options.scale, "\" stroke-width=\"")).call(_context31, options.qcpr * 0.2, "\" stroke=\"cyan\" />");
|
|
}
|
|
|
|
if (!smp.segments[pcnt].hasOwnProperty('x3') && options.lcpr) {
|
|
var _context35, _context36, _context37;
|
|
|
|
str += concat_default()(_context35 = concat_default()(_context36 = concat_default()(_context37 = "<circle cx=\"".concat(smp.segments[pcnt].x2 * options.scale, "\" cy=\"")).call(_context37, smp.segments[pcnt].y2 * options.scale, "\" r=\"")).call(_context36, options.lcpr, "\" fill=\"white\" stroke-width=\"")).call(_context35, options.lcpr * 0.2, "\" stroke=\"black\" />");
|
|
}
|
|
}
|
|
|
|
for (var hcnt = 0; hcnt < smp.holechildren.length; hcnt++) {
|
|
var hsmp = layer[smp.holechildren[hcnt]];
|
|
|
|
for (pcnt = 0; pcnt < hsmp.segments.length; pcnt++) {
|
|
if (hsmp.segments[pcnt].hasOwnProperty('x3') && options.qcpr) {
|
|
var _context38, _context39, _context40, _context41, _context42, _context43, _context44, _context45, _context46, _context47, _context48, _context49, _context50, _context51;
|
|
|
|
str += concat_default()(_context38 = concat_default()(_context39 = concat_default()(_context40 = "<circle cx=\"".concat(hsmp.segments[pcnt].x2 * options.scale, "\" cy=\"")).call(_context40, hsmp.segments[pcnt].y2 * options.scale, "\" r=\"")).call(_context39, options.qcpr, "\" fill=\"cyan\" stroke-width=\"")).call(_context38, options.qcpr * 0.2, "\" stroke=\"black\" />");
|
|
str += concat_default()(_context41 = concat_default()(_context42 = concat_default()(_context43 = "<circle cx=\"".concat(hsmp.segments[pcnt].x3 * options.scale, "\" cy=\"")).call(_context43, hsmp.segments[pcnt].y3 * options.scale, "\" r=\"")).call(_context42, options.qcpr, "\" fill=\"white\" stroke-width=\"")).call(_context41, options.qcpr * 0.2, "\" stroke=\"black\" />");
|
|
str += concat_default()(_context44 = concat_default()(_context45 = concat_default()(_context46 = concat_default()(_context47 = "<line x1=\"".concat(hsmp.segments[pcnt].x1 * options.scale, "\" y1=\"")).call(_context47, hsmp.segments[pcnt].y1 * options.scale, "\" x2=\"")).call(_context46, hsmp.segments[pcnt].x2 * options.scale, "\" y2=\"")).call(_context45, hsmp.segments[pcnt].y2 * options.scale, "\" stroke-width=\"")).call(_context44, options.qcpr * 0.2, "\" stroke=\"cyan\" />");
|
|
str += concat_default()(_context48 = concat_default()(_context49 = concat_default()(_context50 = concat_default()(_context51 = "<line x1=\"".concat(hsmp.segments[pcnt].x2 * options.scale, "\" y1=\"")).call(_context51, hsmp.segments[pcnt].y2 * options.scale, "\" x2=\"")).call(_context50, hsmp.segments[pcnt].x3 * options.scale, "\" y2=\"")).call(_context49, hsmp.segments[pcnt].y3 * options.scale, "\" stroke-width=\"")).call(_context48, options.qcpr * 0.2, "\" stroke=\"cyan\" />");
|
|
}
|
|
|
|
if (!hsmp.segments[pcnt].hasOwnProperty('x3') && options.lcpr) {
|
|
var _context52, _context53, _context54;
|
|
|
|
str += concat_default()(_context52 = concat_default()(_context53 = concat_default()(_context54 = "<circle cx=\"".concat(hsmp.segments[pcnt].x2 * options.scale, "\" cy=\"")).call(_context54, hsmp.segments[pcnt].y2 * options.scale, "\" r=\"")).call(_context53, options.lcpr, "\" fill=\"white\" stroke-width=\"")).call(_context52, options.lcpr * 0.2, "\" stroke=\"black\" />");
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return str;
|
|
}
|
|
}, {
|
|
key: "getsvgstring",
|
|
value: function getsvgstring(tracedata, options) {
|
|
var _context55, _context56, _context57;
|
|
|
|
options = this.checkoptions(options);
|
|
var w = tracedata.width * options.scale;
|
|
var h = tracedata.height * options.scale;
|
|
|
|
var svgstr = concat_default()(_context55 = "<svg ".concat(options.viewbox ? concat_default()(_context56 = "viewBox=\"0 0 ".concat(w, " ")).call(_context56, h, "\" ") : concat_default()(_context57 = "width=\"".concat(w, "\" height=\"")).call(_context57, h, "\" "), "version=\"1.1\" xmlns=\"http://www.w3.org/2000/svg\" desc=\"Created with imagetracer.js version ")).call(_context55, this.versionnumber, "\" >");
|
|
|
|
for (var lcnt = 0; lcnt < tracedata.layers.length; lcnt += 1) {
|
|
for (var pcnt = 0; pcnt < tracedata.layers[lcnt].length; pcnt += 1) {
|
|
if (!tracedata.layers[lcnt][pcnt].isholepath) {
|
|
svgstr += this.svgpathstring(tracedata, lcnt, pcnt, options);
|
|
}
|
|
}
|
|
}
|
|
|
|
svgstr += '</svg>';
|
|
return svgstr;
|
|
}
|
|
}, {
|
|
key: "compareNumbers",
|
|
value: function compareNumbers(a, b) {
|
|
return a - b;
|
|
}
|
|
}, {
|
|
key: "torgbastr",
|
|
value: function torgbastr(c) {
|
|
var _context58, _context59, _context60;
|
|
|
|
return concat_default()(_context58 = concat_default()(_context59 = concat_default()(_context60 = "rgba(".concat(c.r, ",")).call(_context60, c.g, ",")).call(_context59, c.b, ",")).call(_context58, c.a, ")");
|
|
}
|
|
}, {
|
|
key: "tosvgcolorstr",
|
|
value: function tosvgcolorstr(c, options) {
|
|
var _context61, _context62, _context63, _context64, _context65, _context66, _context67;
|
|
|
|
return concat_default()(_context61 = concat_default()(_context62 = concat_default()(_context63 = concat_default()(_context64 = concat_default()(_context65 = concat_default()(_context66 = concat_default()(_context67 = "fill=\"rgb(".concat(c.r, ",")).call(_context67, c.g, ",")).call(_context66, c.b, ")\" stroke=\"rgb(")).call(_context65, c.r, ",")).call(_context64, c.g, ",")).call(_context63, c.b, ")\" stroke-width=\"")).call(_context62, options.strokewidth, "\" opacity=\"")).call(_context61, c.a / 255.0, "\" ");
|
|
}
|
|
}, {
|
|
key: "appendSVGString",
|
|
value: function appendSVGString(svgstr, parentid) {
|
|
var div;
|
|
|
|
if (parentid) {
|
|
div = document.getElementById(parentid);
|
|
|
|
if (!div) {
|
|
div = document.createElement('div');
|
|
div.id = parentid;
|
|
document.body.appendChild(div);
|
|
}
|
|
} else {
|
|
div = document.createElement('div');
|
|
document.body.appendChild(div);
|
|
}
|
|
|
|
div.innerHTML += svgstr;
|
|
}
|
|
}, {
|
|
key: "blur",
|
|
value: function blur(imgd, radius, delta) {
|
|
var i, j, k, d, idx, racc, gacc, bacc, aacc, wacc;
|
|
var imgd2 = {
|
|
width: imgd.width,
|
|
height: imgd.height,
|
|
data: []
|
|
};
|
|
radius = Math.floor(radius);
|
|
|
|
if (radius < 1) {
|
|
return imgd;
|
|
}
|
|
|
|
if (radius > 5) {
|
|
radius = 5;
|
|
}
|
|
|
|
delta = Math.abs(delta);
|
|
|
|
if (delta > 1024) {
|
|
delta = 1024;
|
|
}
|
|
|
|
var thisgk = this.gks[radius - 1];
|
|
|
|
for (j = 0; j < imgd.height; j++) {
|
|
for (i = 0; i < imgd.width; i++) {
|
|
racc = 0;
|
|
gacc = 0;
|
|
bacc = 0;
|
|
aacc = 0;
|
|
wacc = 0;
|
|
|
|
for (k = -radius; k < radius + 1; k++) {
|
|
if (i + k > 0 && i + k < imgd.width) {
|
|
idx = (j * imgd.width + i + k) * 4;
|
|
racc += imgd.data[idx] * thisgk[k + radius];
|
|
gacc += imgd.data[idx + 1] * thisgk[k + radius];
|
|
bacc += imgd.data[idx + 2] * thisgk[k + radius];
|
|
aacc += imgd.data[idx + 3] * thisgk[k + radius];
|
|
wacc += thisgk[k + radius];
|
|
}
|
|
}
|
|
|
|
idx = (j * imgd.width + i) * 4;
|
|
imgd2.data[idx] = Math.floor(racc / wacc);
|
|
imgd2.data[idx + 1] = Math.floor(gacc / wacc);
|
|
imgd2.data[idx + 2] = Math.floor(bacc / wacc);
|
|
imgd2.data[idx + 3] = Math.floor(aacc / wacc);
|
|
}
|
|
}
|
|
|
|
var himgd = new Uint8ClampedArray(imgd2.data);
|
|
|
|
for (j = 0; j < imgd.height; j++) {
|
|
for (i = 0; i < imgd.width; i++) {
|
|
racc = 0;
|
|
gacc = 0;
|
|
bacc = 0;
|
|
aacc = 0;
|
|
wacc = 0;
|
|
|
|
for (k = -radius; k < radius + 1; k++) {
|
|
if (j + k > 0 && j + k < imgd.height) {
|
|
idx = ((j + k) * imgd.width + i) * 4;
|
|
racc += himgd[idx] * thisgk[k + radius];
|
|
gacc += himgd[idx + 1] * thisgk[k + radius];
|
|
bacc += himgd[idx + 2] * thisgk[k + radius];
|
|
aacc += himgd[idx + 3] * thisgk[k + radius];
|
|
wacc += thisgk[k + radius];
|
|
}
|
|
}
|
|
|
|
idx = (j * imgd.width + i) * 4;
|
|
imgd2.data[idx] = Math.floor(racc / wacc);
|
|
imgd2.data[idx + 1] = Math.floor(gacc / wacc);
|
|
imgd2.data[idx + 2] = Math.floor(bacc / wacc);
|
|
imgd2.data[idx + 3] = Math.floor(aacc / wacc);
|
|
}
|
|
}
|
|
|
|
for (j = 0; j < imgd.height; j++) {
|
|
for (i = 0; i < imgd.width; i++) {
|
|
idx = (j * imgd.width + i) * 4;
|
|
d = Math.abs(imgd2.data[idx] - imgd.data[idx]) + Math.abs(imgd2.data[idx + 1] - imgd.data[idx + 1]) + Math.abs(imgd2.data[idx + 2] - imgd.data[idx + 2]) + Math.abs(imgd2.data[idx + 3] - imgd.data[idx + 3]);
|
|
|
|
if (d > delta) {
|
|
imgd2.data[idx] = imgd.data[idx];
|
|
imgd2.data[idx + 1] = imgd.data[idx + 1];
|
|
imgd2.data[idx + 2] = imgd.data[idx + 2];
|
|
imgd2.data[idx + 3] = imgd.data[idx + 3];
|
|
}
|
|
}
|
|
}
|
|
|
|
return imgd2;
|
|
}
|
|
}, {
|
|
key: "loadImage",
|
|
value: function loadImage(url, callback, options) {
|
|
var img = new Image();
|
|
|
|
if (options && options.corsenabled) {
|
|
img.crossOrigin = 'Anonymous';
|
|
}
|
|
|
|
img.src = url;
|
|
|
|
img.onload = function () {
|
|
var canvas = document.createElement('canvas');
|
|
canvas.width = img.width;
|
|
canvas.height = img.height;
|
|
var context = canvas.getContext('2d');
|
|
context.drawImage(img, 0, 0);
|
|
callback(canvas);
|
|
};
|
|
}
|
|
}, {
|
|
key: "getImgdata",
|
|
value: function getImgdata(canvas) {
|
|
var context = canvas.getContext('2d');
|
|
return context.getImageData(0, 0, canvas.width, canvas.height);
|
|
}
|
|
}, {
|
|
key: "drawLayers",
|
|
value: function drawLayers(layers, palette, scale, parentid) {
|
|
scale = scale || 1;
|
|
var w, h, i, j, k;
|
|
var div;
|
|
|
|
if (parentid) {
|
|
div = document.getElementById(parentid);
|
|
|
|
if (!div) {
|
|
div = document.createElement('div');
|
|
div.id = parentid;
|
|
document.body.appendChild(div);
|
|
}
|
|
} else {
|
|
div = document.createElement('div');
|
|
document.body.appendChild(div);
|
|
}
|
|
|
|
for (k in layers) {
|
|
if (!layers.hasOwnProperty(k)) {
|
|
continue;
|
|
}
|
|
|
|
w = layers[k][0].length;
|
|
h = layers[k].length;
|
|
var canvas = document.createElement('canvas');
|
|
canvas.width = w * scale;
|
|
canvas.height = h * scale;
|
|
var context = canvas.getContext('2d');
|
|
|
|
for (j = 0; j < h; j += 1) {
|
|
for (i = 0; i < w; i += 1) {
|
|
context.fillStyle = this.torgbastr(palette[layers[k][j][i] % palette.length]);
|
|
context.fillRect(i * scale, j * scale, scale, scale);
|
|
}
|
|
}
|
|
|
|
div.appendChild(canvas);
|
|
}
|
|
}
|
|
}], [{
|
|
key: "tracerDefaultOption",
|
|
value: function tracerDefaultOption() {
|
|
return {
|
|
pathomit: 100,
|
|
ltres: 0.1,
|
|
qtres: 1,
|
|
scale: 1,
|
|
strokewidth: 5,
|
|
viewbox: false,
|
|
linefilter: true,
|
|
desc: false,
|
|
rightangleenhance: false,
|
|
pal: [{
|
|
r: 0,
|
|
g: 0,
|
|
b: 0,
|
|
a: 255
|
|
}, {
|
|
r: 255,
|
|
g: 255,
|
|
b: 255,
|
|
a: 255
|
|
}]
|
|
};
|
|
}
|
|
}]);
|
|
|
|
return ImageTracer;
|
|
}();
|
|
|
|
|
|
;// CONCATENATED MODULE: ./src/js/action.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* harmony default export */ var action = ({
|
|
/**
|
|
* Get ui actions
|
|
* @returns {Object} actions for ui
|
|
* @private
|
|
*/
|
|
getActions: function getActions() {
|
|
return {
|
|
main: this._mainAction(),
|
|
shape: this._shapeAction(),
|
|
crop: this._cropAction(),
|
|
resize: this._resizeAction(),
|
|
flip: this._flipAction(),
|
|
rotate: this._rotateAction(),
|
|
text: this._textAction(),
|
|
mask: this._maskAction(),
|
|
draw: this._drawAction(),
|
|
icon: this._iconAction(),
|
|
filter: this._filterAction(),
|
|
history: this._historyAction()
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Main Action
|
|
* @returns {Object} actions for ui main
|
|
* @private
|
|
*/
|
|
_mainAction: function _mainAction() {
|
|
var _this = this;
|
|
|
|
var exitCropOnAction = function exitCropOnAction() {
|
|
if (_this.ui.submenu === 'crop') {
|
|
_this.stopDrawingMode();
|
|
|
|
_this.ui.changeMenu('crop');
|
|
}
|
|
};
|
|
|
|
var setAngleRangeBarOnAction = function setAngleRangeBarOnAction(angle) {
|
|
if (_this.ui.submenu === 'rotate') {
|
|
_this.ui.rotate.setRangeBarAngle('setAngle', angle);
|
|
}
|
|
};
|
|
|
|
var setFilterStateRangeBarOnAction = function setFilterStateRangeBarOnAction(filterOptions) {
|
|
if (_this.ui.submenu === 'filter') {
|
|
filter_default()(_this.ui).setFilterState(filterOptions);
|
|
}
|
|
};
|
|
|
|
var onEndUndoRedo = function onEndUndoRedo(result) {
|
|
setAngleRangeBarOnAction(result);
|
|
setFilterStateRangeBarOnAction(result);
|
|
return result;
|
|
};
|
|
|
|
var toggleZoomMode = function toggleZoomMode() {
|
|
var zoomMode = _this._graphics.getZoomMode();
|
|
|
|
_this.stopDrawingMode();
|
|
|
|
if (zoomMode !== zoomModes.ZOOM) {
|
|
_this.startDrawingMode(drawingModes.ZOOM);
|
|
|
|
_this._graphics.startZoomInMode();
|
|
} else {
|
|
_this._graphics.endZoomInMode();
|
|
}
|
|
};
|
|
|
|
var toggleHandMode = function toggleHandMode() {
|
|
var zoomMode = _this._graphics.getZoomMode();
|
|
|
|
_this.stopDrawingMode();
|
|
|
|
if (zoomMode !== zoomModes.HAND) {
|
|
_this.startDrawingMode(drawingModes.ZOOM);
|
|
|
|
_this._graphics.startHandMode();
|
|
} else {
|
|
_this._graphics.endHandMode();
|
|
}
|
|
};
|
|
|
|
var initFilterState = function initFilterState() {
|
|
if (filter_default()(_this.ui)) {
|
|
filter_default()(_this.ui).initFilterCheckBoxState();
|
|
}
|
|
};
|
|
|
|
return extend_default()({
|
|
initLoadImage: function initLoadImage(imagePath, imageName) {
|
|
return _this.loadImageFromURL(imagePath, imageName).then(function (sizeValue) {
|
|
exitCropOnAction();
|
|
_this.ui.initializeImgUrl = imagePath;
|
|
|
|
_this.ui.resizeEditor({
|
|
imageSize: sizeValue
|
|
});
|
|
|
|
_this.clearUndoStack();
|
|
|
|
_this._invoker.fire(eventNames.EXECUTE_COMMAND, historyNames.LOAD_IMAGE);
|
|
});
|
|
},
|
|
undo: function undo() {
|
|
if (!_this.isEmptyUndoStack()) {
|
|
exitCropOnAction();
|
|
|
|
_this.deactivateAll();
|
|
|
|
_this.undo().then(onEndUndoRedo);
|
|
}
|
|
},
|
|
redo: function redo() {
|
|
if (!_this.isEmptyRedoStack()) {
|
|
exitCropOnAction();
|
|
|
|
_this.deactivateAll();
|
|
|
|
_this.redo().then(onEndUndoRedo);
|
|
}
|
|
},
|
|
reset: function reset() {
|
|
exitCropOnAction();
|
|
|
|
_this.loadImageFromURL(_this.ui.initializeImgUrl, 'resetImage').then(function (sizeValue) {
|
|
exitCropOnAction();
|
|
initFilterState();
|
|
|
|
_this.ui.resizeEditor({
|
|
imageSize: sizeValue
|
|
});
|
|
|
|
_this.clearUndoStack();
|
|
|
|
_this._initHistory();
|
|
});
|
|
},
|
|
delete: function _delete() {
|
|
_this.ui.changeHelpButtonEnabled('delete', false);
|
|
|
|
exitCropOnAction();
|
|
|
|
_this.removeActiveObject();
|
|
|
|
_this.activeObjectId = null;
|
|
},
|
|
deleteAll: function deleteAll() {
|
|
exitCropOnAction();
|
|
|
|
_this.clearObjects();
|
|
|
|
_this.ui.changeHelpButtonEnabled('delete', false);
|
|
|
|
_this.ui.changeHelpButtonEnabled('deleteAll', false);
|
|
},
|
|
load: function load(file) {
|
|
if (!isSupportFileApi()) {
|
|
alert('This browser does not support file-api');
|
|
}
|
|
|
|
_this.ui.initializeImgUrl = url_default().createObjectURL(file);
|
|
|
|
_this.loadImageFromFile(file).then(function (sizeValue) {
|
|
exitCropOnAction();
|
|
initFilterState();
|
|
|
|
_this.clearUndoStack();
|
|
|
|
_this.ui.activeMenuEvent();
|
|
|
|
_this.ui.resizeEditor({
|
|
imageSize: sizeValue
|
|
});
|
|
|
|
_this._clearHistory();
|
|
|
|
_this._invoker.fire(eventNames.EXECUTE_COMMAND, historyNames.LOAD_IMAGE);
|
|
})['catch'](function (message) {
|
|
return promise_default().reject(message);
|
|
});
|
|
},
|
|
download: function download() {
|
|
var dataURL = _this.toDataURL();
|
|
|
|
var imageName = _this.getImageName();
|
|
|
|
var blob, type, w;
|
|
|
|
if (isSupportFileApi() && window.saveAs) {
|
|
blob = base64ToBlob(dataURL);
|
|
type = blob.type.split('/')[1];
|
|
|
|
if (imageName.split('.').pop() !== type) {
|
|
imageName += ".".concat(type);
|
|
}
|
|
|
|
saveAs(blob, imageName); // eslint-disable-line
|
|
} else {
|
|
w = window.open();
|
|
w.document.body.innerHTML = "<img src='".concat(dataURL, "'>");
|
|
}
|
|
},
|
|
history: function history(event) {
|
|
_this.ui.toggleHistoryMenu(event);
|
|
},
|
|
zoomIn: function zoomIn() {
|
|
_this.ui.toggleZoomButtonStatus('zoomIn');
|
|
|
|
_this.deactivateAll();
|
|
|
|
toggleZoomMode();
|
|
},
|
|
zoomOut: function zoomOut() {
|
|
_this._graphics.zoomOut();
|
|
},
|
|
hand: function hand() {
|
|
_this.ui.offZoomInButtonStatus();
|
|
|
|
_this.ui.toggleZoomButtonStatus('hand');
|
|
|
|
_this.deactivateAll();
|
|
|
|
toggleHandMode();
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Icon Action
|
|
* @returns {Object} actions for ui icon
|
|
* @private
|
|
*/
|
|
_iconAction: function _iconAction() {
|
|
var _this2 = this;
|
|
|
|
return extend_default()({
|
|
changeColor: function changeColor(color) {
|
|
if (_this2.activeObjectId) {
|
|
_this2.changeIconColor(_this2.activeObjectId, color);
|
|
}
|
|
},
|
|
addIcon: function addIcon(iconType, iconColor) {
|
|
_this2.startDrawingMode('ICON');
|
|
|
|
_this2.setDrawingIcon(iconType, iconColor);
|
|
},
|
|
cancelAddIcon: function cancelAddIcon() {
|
|
_this2.ui.icon.clearIconType();
|
|
|
|
_this2.changeSelectableAll(true);
|
|
|
|
_this2.changeCursor('default');
|
|
|
|
_this2.stopDrawingMode();
|
|
},
|
|
registerDefaultIcons: function registerDefaultIcons(type, path) {
|
|
var iconObj = {};
|
|
iconObj[type] = path;
|
|
|
|
_this2.registerIcons(iconObj);
|
|
},
|
|
registerCustomIcon: function registerCustomIcon(imgUrl, file) {
|
|
var imagetracer = new ImageTracer();
|
|
imagetracer.imageToSVG(imgUrl, function (svgstr) {
|
|
var _svgstr$match = svgstr.match(/path[^>]*d="([^"]*)"/),
|
|
_svgstr$match2 = _slicedToArray(_svgstr$match, 2),
|
|
svgPath = _svgstr$match2[1];
|
|
|
|
var iconObj = {};
|
|
iconObj[file.name] = svgPath;
|
|
|
|
_this2.registerIcons(iconObj);
|
|
|
|
_this2.addIcon(file.name, {
|
|
left: 100,
|
|
top: 100
|
|
});
|
|
}, ImageTracer.tracerDefaultOption());
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Draw Action
|
|
* @returns {Object} actions for ui draw
|
|
* @private
|
|
*/
|
|
_drawAction: function _drawAction() {
|
|
var _this3 = this;
|
|
|
|
return extend_default()({
|
|
setDrawMode: function setDrawMode(type, settings) {
|
|
_this3.stopDrawingMode();
|
|
|
|
if (type === 'free') {
|
|
_this3.startDrawingMode('FREE_DRAWING', settings);
|
|
} else {
|
|
_this3.startDrawingMode('LINE_DRAWING', settings);
|
|
}
|
|
},
|
|
setColor: function setColor(color) {
|
|
_this3.setBrush({
|
|
color: color
|
|
});
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Mask Action
|
|
* @returns {Object} actions for ui mask
|
|
* @private
|
|
*/
|
|
_maskAction: function _maskAction() {
|
|
var _this4 = this;
|
|
|
|
return extend_default()({
|
|
loadImageFromURL: function loadImageFromURL(imgUrl, file) {
|
|
return _this4.loadImageFromURL(_this4.toDataURL(), 'FilterImage').then(function () {
|
|
_this4.addImageObject(imgUrl).then(function () {
|
|
url_default().revokeObjectURL(file);
|
|
});
|
|
|
|
_this4._invoker.fire(eventNames.EXECUTE_COMMAND, historyNames.LOAD_MASK_IMAGE);
|
|
});
|
|
},
|
|
applyFilter: function applyFilter() {
|
|
_this4.applyFilter('mask', {
|
|
maskObjId: _this4.activeObjectId
|
|
});
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Text Action
|
|
* @returns {Object} actions for ui text
|
|
* @private
|
|
*/
|
|
_textAction: function _textAction() {
|
|
var _this5 = this;
|
|
|
|
return extend_default()({
|
|
changeTextStyle: function changeTextStyle(styleObj, isSilent) {
|
|
if (_this5.activeObjectId) {
|
|
_this5.changeTextStyle(_this5.activeObjectId, styleObj, isSilent);
|
|
}
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Rotate Action
|
|
* @returns {Object} actions for ui rotate
|
|
* @private
|
|
*/
|
|
_rotateAction: function _rotateAction() {
|
|
var _this6 = this;
|
|
|
|
return extend_default()({
|
|
rotate: function rotate(angle, isSilent) {
|
|
_this6.rotate(angle, isSilent);
|
|
|
|
_this6.ui.resizeEditor();
|
|
|
|
_this6.ui.rotate.setRangeBarAngle('rotate', angle);
|
|
},
|
|
setAngle: function setAngle(angle, isSilent) {
|
|
_this6.setAngle(angle, isSilent);
|
|
|
|
_this6.ui.resizeEditor();
|
|
|
|
_this6.ui.rotate.setRangeBarAngle('setAngle', angle);
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Shape Action
|
|
* @returns {Object} actions for ui shape
|
|
* @private
|
|
*/
|
|
_shapeAction: function _shapeAction() {
|
|
var _this7 = this;
|
|
|
|
return extend_default()({
|
|
changeShape: function changeShape(changeShapeObject, isSilent) {
|
|
if (_this7.activeObjectId) {
|
|
_this7.changeShape(_this7.activeObjectId, changeShapeObject, isSilent);
|
|
}
|
|
},
|
|
setDrawingShape: function setDrawingShape(shapeType) {
|
|
_this7.setDrawingShape(shapeType);
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Crop Action
|
|
* @returns {Object} actions for ui crop
|
|
* @private
|
|
*/
|
|
_cropAction: function _cropAction() {
|
|
var _this8 = this;
|
|
|
|
return extend_default()({
|
|
crop: function crop() {
|
|
var cropRect = _this8.getCropzoneRect();
|
|
|
|
if (cropRect && !isEmptyCropzone(cropRect)) {
|
|
_this8.crop(cropRect).then(function () {
|
|
_this8.stopDrawingMode();
|
|
|
|
_this8.ui.resizeEditor();
|
|
|
|
_this8.ui.changeMenu('crop');
|
|
|
|
_this8._invoker.fire(eventNames.EXECUTE_COMMAND, historyNames.CROP);
|
|
})['catch'](function (message) {
|
|
return promise_default().reject(message);
|
|
});
|
|
}
|
|
},
|
|
cancel: function cancel() {
|
|
_this8.stopDrawingMode();
|
|
|
|
_this8.ui.changeMenu('crop');
|
|
},
|
|
|
|
/* eslint-disable */
|
|
preset: function preset(presetType) {
|
|
switch (presetType) {
|
|
case 'preset-square':
|
|
_this8.setCropzoneRect(1 / 1);
|
|
|
|
break;
|
|
|
|
case 'preset-3-2':
|
|
_this8.setCropzoneRect(3 / 2);
|
|
|
|
break;
|
|
|
|
case 'preset-4-3':
|
|
_this8.setCropzoneRect(4 / 3);
|
|
|
|
break;
|
|
|
|
case 'preset-5-4':
|
|
_this8.setCropzoneRect(5 / 4);
|
|
|
|
break;
|
|
|
|
case 'preset-7-5':
|
|
_this8.setCropzoneRect(7 / 5);
|
|
|
|
break;
|
|
|
|
case 'preset-16-9':
|
|
_this8.setCropzoneRect(16 / 9);
|
|
|
|
break;
|
|
|
|
default:
|
|
_this8.setCropzoneRect();
|
|
|
|
_this8.ui.crop.changeApplyButtonStatus(false);
|
|
|
|
break;
|
|
}
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Resize Action
|
|
* @returns {Object} actions for ui resize
|
|
* @private
|
|
*/
|
|
_resizeAction: function _resizeAction() {
|
|
var _this9 = this;
|
|
|
|
return extend_default()({
|
|
getCurrentDimensions: function getCurrentDimensions() {
|
|
return _this9._graphics.getCurrentDimensions();
|
|
},
|
|
preview: function preview(actor, value, lockState) {
|
|
var currentDimensions = _this9._graphics.getCurrentDimensions();
|
|
|
|
var calcAspectRatio = function calcAspectRatio() {
|
|
return currentDimensions.width / currentDimensions.height;
|
|
};
|
|
|
|
var dimensions = {};
|
|
|
|
switch (actor) {
|
|
case 'width':
|
|
dimensions.width = value;
|
|
|
|
if (lockState) {
|
|
dimensions.height = value / calcAspectRatio();
|
|
} else {
|
|
dimensions.height = currentDimensions.height;
|
|
}
|
|
|
|
break;
|
|
|
|
case 'height':
|
|
dimensions.height = value;
|
|
|
|
if (lockState) {
|
|
dimensions.width = value * calcAspectRatio();
|
|
} else {
|
|
dimensions.width = currentDimensions.width;
|
|
}
|
|
|
|
break;
|
|
|
|
default:
|
|
dimensions = currentDimensions;
|
|
}
|
|
|
|
_this9._graphics.resize(dimensions).then(function () {
|
|
_this9.ui.resizeEditor();
|
|
});
|
|
|
|
if (lockState) {
|
|
_this9.ui.resize.setWidthValue(dimensions.width);
|
|
|
|
_this9.ui.resize.setHeightValue(dimensions.height);
|
|
}
|
|
},
|
|
lockAspectRatio: function lockAspectRatio(lockState, min, max) {
|
|
var _this9$_graphics$getC = _this9._graphics.getCurrentDimensions(),
|
|
width = _this9$_graphics$getC.width,
|
|
height = _this9$_graphics$getC.height;
|
|
|
|
var aspectRatio = width / height;
|
|
|
|
if (lockState) {
|
|
if (width > height) {
|
|
var pMax = max / aspectRatio;
|
|
var pMin = min * aspectRatio;
|
|
|
|
_this9.ui.resize.setLimit({
|
|
minWidth: pMin > min ? pMin : min,
|
|
minHeight: min,
|
|
maxWidth: max,
|
|
maxHeight: pMax < max ? pMax : max
|
|
});
|
|
} else {
|
|
var _pMax = max * aspectRatio;
|
|
|
|
var _pMin = min / aspectRatio;
|
|
|
|
_this9.ui.resize.setLimit({
|
|
minWidth: min,
|
|
minHeight: _pMin > min ? _pMin : min,
|
|
maxWidth: _pMax < max ? _pMax : max,
|
|
maxHeight: max
|
|
});
|
|
}
|
|
} else {
|
|
_this9.ui.resize.setLimit({
|
|
minWidth: min,
|
|
minHeight: min,
|
|
maxWidth: max,
|
|
maxHeight: max
|
|
});
|
|
}
|
|
},
|
|
resize: function resize() {
|
|
var dimensions = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
|
|
|
|
if (!dimensions) {
|
|
dimensions = _this9._graphics.getCurrentDimensions();
|
|
}
|
|
|
|
_this9.resize(dimensions).then(function () {
|
|
_this9._graphics.setOriginalDimensions(dimensions);
|
|
|
|
_this9.stopDrawingMode();
|
|
|
|
_this9.ui.resizeEditor();
|
|
|
|
_this9.ui.changeMenu('resize');
|
|
})['catch'](function (message) {
|
|
return promise_default().reject(message);
|
|
});
|
|
},
|
|
reset: function reset() {
|
|
var standByMode = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : false;
|
|
|
|
var dimensions = _this9._graphics.getOriginalDimensions();
|
|
|
|
_this9.ui.resize.setWidthValue(dimensions.width, true);
|
|
|
|
_this9.ui.resize.setHeightValue(dimensions.height, true);
|
|
|
|
_this9._graphics.resize(dimensions).then(function () {
|
|
if (!standByMode) {
|
|
_this9.stopDrawingMode();
|
|
|
|
_this9.ui.resizeEditor();
|
|
|
|
_this9.ui.changeMenu('resize');
|
|
}
|
|
});
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Flip Action
|
|
* @returns {Object} actions for ui flip
|
|
* @private
|
|
*/
|
|
_flipAction: function _flipAction() {
|
|
var _this10 = this;
|
|
|
|
return extend_default()({
|
|
flip: function flip(flipType) {
|
|
return _this10[flipType]();
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Filter Action
|
|
* @returns {Object} actions for ui filter
|
|
* @private
|
|
*/
|
|
_filterAction: function _filterAction() {
|
|
var _this11 = this;
|
|
|
|
return extend_default()({
|
|
applyFilter: function applyFilter(applying, type, options, isSilent) {
|
|
if (applying) {
|
|
_this11.applyFilter(type, options, isSilent);
|
|
} else if (_this11.hasFilter(type)) {
|
|
_this11.removeFilter(type);
|
|
}
|
|
}
|
|
}, this._commonAction());
|
|
},
|
|
|
|
/**
|
|
* Image Editor Event Observer
|
|
*/
|
|
setReAction: function setReAction() {
|
|
var _this12 = this;
|
|
|
|
this.on({
|
|
undoStackChanged: function undoStackChanged(length) {
|
|
if (length) {
|
|
_this12.ui.changeHelpButtonEnabled('undo', true);
|
|
|
|
_this12.ui.changeHelpButtonEnabled('reset', true);
|
|
} else {
|
|
_this12.ui.changeHelpButtonEnabled('undo', false);
|
|
|
|
_this12.ui.changeHelpButtonEnabled('reset', false);
|
|
}
|
|
|
|
_this12.ui.resizeEditor();
|
|
},
|
|
redoStackChanged: function redoStackChanged(length) {
|
|
if (length) {
|
|
_this12.ui.changeHelpButtonEnabled('redo', true);
|
|
} else {
|
|
_this12.ui.changeHelpButtonEnabled('redo', false);
|
|
}
|
|
|
|
_this12.ui.resizeEditor();
|
|
},
|
|
|
|
/* eslint-disable complexity */
|
|
objectActivated: function objectActivated(obj) {
|
|
var _context, _context2;
|
|
|
|
_this12.activeObjectId = obj.id;
|
|
|
|
_this12.ui.changeHelpButtonEnabled('delete', true);
|
|
|
|
_this12.ui.changeHelpButtonEnabled('deleteAll', true);
|
|
|
|
if (obj.type === 'cropzone') {
|
|
_this12.ui.crop.changeApplyButtonStatus(true);
|
|
} else if (index_of_default()(_context = ['rect', 'circle', 'triangle']).call(_context, obj.type) > -1) {
|
|
_this12.stopDrawingMode();
|
|
|
|
if (_this12.ui.submenu !== 'shape') {
|
|
_this12.ui.changeMenu('shape', false, false);
|
|
}
|
|
|
|
_this12.ui.shape.setShapeStatus({
|
|
strokeColor: obj.stroke,
|
|
strokeWidth: obj.strokeWidth,
|
|
fillColor: fill_default()(obj)
|
|
});
|
|
|
|
_this12.ui.shape.setMaxStrokeValue(Math.min(obj.width, obj.height));
|
|
} else if (obj.type === 'path' || obj.type === 'line') {
|
|
if (_this12.ui.submenu !== 'draw') {
|
|
_this12.ui.changeMenu('draw', false, false);
|
|
|
|
_this12.ui.draw.changeStandbyMode();
|
|
}
|
|
} else if (index_of_default()(_context2 = ['i-text', 'text']).call(_context2, obj.type) > -1) {
|
|
if (_this12.ui.submenu !== 'text') {
|
|
_this12.ui.changeMenu('text', false, false);
|
|
}
|
|
|
|
_this12.ui.text.setTextStyleStateOnAction(obj);
|
|
} else if (obj.type === 'icon') {
|
|
_this12.stopDrawingMode();
|
|
|
|
if (_this12.ui.submenu !== 'icon') {
|
|
_this12.ui.changeMenu('icon', false, false);
|
|
}
|
|
|
|
_this12.ui.icon.setIconPickerColor(fill_default()(obj));
|
|
}
|
|
},
|
|
|
|
/* eslint-enable complexity */
|
|
addText: function addText(pos) {
|
|
var _this12$ui$text = _this12.ui.text,
|
|
fill = _this12$ui$text.textColor,
|
|
fontSize = _this12$ui$text.fontSize,
|
|
fontStyle = _this12$ui$text.fontStyle,
|
|
fontWeight = _this12$ui$text.fontWeight,
|
|
underline = _this12$ui$text.underline;
|
|
var fontFamily = 'Noto Sans';
|
|
|
|
_this12.addText('Double Click', {
|
|
position: pos.originPosition,
|
|
styles: {
|
|
fill: fill,
|
|
fontSize: fontSize,
|
|
fontFamily: fontFamily,
|
|
fontStyle: fontStyle,
|
|
fontWeight: fontWeight,
|
|
underline: underline
|
|
}
|
|
}).then(function () {
|
|
_this12.changeCursor('default');
|
|
});
|
|
},
|
|
addObjectAfter: function addObjectAfter(obj) {
|
|
var _context3;
|
|
|
|
if (obj.type === 'icon') {
|
|
_this12.ui.icon.changeStandbyMode();
|
|
} else if (index_of_default()(_context3 = ['rect', 'circle', 'triangle']).call(_context3, obj.type) > -1) {
|
|
_this12.ui.shape.setMaxStrokeValue(Math.min(obj.width, obj.height));
|
|
|
|
_this12.ui.shape.changeStandbyMode();
|
|
}
|
|
},
|
|
objectScaled: function objectScaled(obj) {
|
|
var _context4, _context5;
|
|
|
|
if (index_of_default()(_context4 = ['i-text', 'text']).call(_context4, obj.type) > -1) {
|
|
_this12.ui.text.fontSize = toInteger(obj.fontSize);
|
|
} else if (index_of_default()(_context5 = ['rect', 'circle', 'triangle']).call(_context5, obj.type) >= 0) {
|
|
var width = obj.width,
|
|
height = obj.height;
|
|
|
|
var strokeValue = _this12.ui.shape.getStrokeValue();
|
|
|
|
if (width < strokeValue) {
|
|
_this12.ui.shape.setStrokeValue(width);
|
|
}
|
|
|
|
if (height < strokeValue) {
|
|
_this12.ui.shape.setStrokeValue(height);
|
|
}
|
|
}
|
|
},
|
|
selectionCleared: function selectionCleared() {
|
|
_this12.activeObjectId = null;
|
|
|
|
if (_this12.ui.submenu === 'text') {
|
|
_this12.changeCursor('text');
|
|
} else if (!includes(['draw', 'crop', 'resize'], _this12.ui.submenu)) {
|
|
_this12.stopDrawingMode();
|
|
}
|
|
}
|
|
});
|
|
},
|
|
|
|
/**
|
|
* History Action
|
|
* @returns {Object} history actions for ui
|
|
* @private
|
|
*/
|
|
_historyAction: function _historyAction() {
|
|
var _this13 = this;
|
|
|
|
return {
|
|
undo: function undo(count) {
|
|
return _this13.undo(count);
|
|
},
|
|
redo: function redo(count) {
|
|
return _this13.redo(count);
|
|
}
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Common Action
|
|
* @returns {Object} common actions for ui
|
|
* @private
|
|
*/
|
|
_commonAction: function _commonAction() {
|
|
var _this14 = this,
|
|
_context6,
|
|
_context7,
|
|
_context8,
|
|
_context9;
|
|
|
|
var TEXT = drawingModes.TEXT,
|
|
CROPPER = drawingModes.CROPPER,
|
|
SHAPE = drawingModes.SHAPE,
|
|
ZOOM = drawingModes.ZOOM,
|
|
RESIZE = drawingModes.RESIZE;
|
|
return {
|
|
modeChange: function modeChange(menu) {
|
|
switch (menu) {
|
|
case drawingMenuNames.TEXT:
|
|
_this14._changeActivateMode(TEXT);
|
|
|
|
break;
|
|
|
|
case drawingMenuNames.CROP:
|
|
_this14.startDrawingMode(CROPPER);
|
|
|
|
break;
|
|
|
|
case drawingMenuNames.SHAPE:
|
|
_this14._changeActivateMode(SHAPE);
|
|
|
|
_this14.setDrawingShape(_this14.ui.shape.type, _this14.ui.shape.options);
|
|
|
|
break;
|
|
|
|
case drawingMenuNames.ZOOM:
|
|
_this14.startDrawingMode(ZOOM);
|
|
|
|
break;
|
|
|
|
case drawingMenuNames.RESIZE:
|
|
_this14.startDrawingMode(RESIZE);
|
|
|
|
break;
|
|
|
|
default:
|
|
break;
|
|
}
|
|
},
|
|
deactivateAll: bind_default()(_context6 = this.deactivateAll).call(_context6, this),
|
|
changeSelectableAll: bind_default()(_context7 = this.changeSelectableAll).call(_context7, this),
|
|
discardSelection: bind_default()(_context8 = this.discardSelection).call(_context8, this),
|
|
stopDrawingMode: bind_default()(_context9 = this.stopDrawingMode).call(_context9, this)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Mixin
|
|
* @param {ImageEditor} ImageEditor instance
|
|
*/
|
|
mixin: function mixin(ImageEditor) {
|
|
extend_default()(ImageEditor.prototype, this);
|
|
}
|
|
});
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/type/isArray.js
|
|
var isArray = __webpack_require__(602);
|
|
var isArray_default = /*#__PURE__*/__webpack_require__.n(isArray);
|
|
// EXTERNAL MODULE: ./node_modules/tui-code-snippet/collection/forEachOwnProperties.js
|
|
var forEachOwnProperties = __webpack_require__(5573);
|
|
var forEachOwnProperties_default = /*#__PURE__*/__webpack_require__.n(forEachOwnProperties);
|
|
;// CONCATENATED MODULE: ./src/js/interface/component.js
|
|
|
|
|
|
|
|
/**
|
|
* Component interface
|
|
* @class
|
|
* @param {string} name - component name
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @ignore
|
|
*/
|
|
var Component = /*#__PURE__*/function () {
|
|
function Component(name, graphics) {
|
|
_classCallCheck(this, Component);
|
|
|
|
/**
|
|
* Component name
|
|
* @type {string}
|
|
*/
|
|
this.name = name;
|
|
/**
|
|
* Graphics instance
|
|
* @type {Graphics}
|
|
*/
|
|
|
|
this.graphics = graphics;
|
|
}
|
|
/**
|
|
* Fire Graphics event
|
|
* @returns {Object} return value
|
|
*/
|
|
|
|
|
|
_createClass(Component, [{
|
|
key: "fire",
|
|
value: function fire() {
|
|
var context = this.graphics;
|
|
|
|
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
|
|
args[_key] = arguments[_key];
|
|
}
|
|
|
|
return this.graphics.fire.apply(context, args);
|
|
}
|
|
/**
|
|
* Save image(background) of canvas
|
|
* @param {string} name - Name of image
|
|
* @param {fabric.Image} oImage - Fabric image instance
|
|
*/
|
|
|
|
}, {
|
|
key: "setCanvasImage",
|
|
value: function setCanvasImage(name, oImage) {
|
|
this.graphics.setCanvasImage(name, oImage);
|
|
}
|
|
/**
|
|
* Returns canvas element of fabric.Canvas[[lower-canvas]]
|
|
* @returns {HTMLCanvasElement}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvasElement",
|
|
value: function getCanvasElement() {
|
|
return this.graphics.getCanvasElement();
|
|
}
|
|
/**
|
|
* Get fabric.Canvas instance
|
|
* @returns {fabric.Canvas}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvas",
|
|
value: function getCanvas() {
|
|
return this.graphics.getCanvas();
|
|
}
|
|
/**
|
|
* Get canvasImage (fabric.Image instance)
|
|
* @returns {fabric.Image}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvasImage",
|
|
value: function getCanvasImage() {
|
|
return this.graphics.getCanvasImage();
|
|
}
|
|
/**
|
|
* Get image name
|
|
* @returns {string}
|
|
*/
|
|
|
|
}, {
|
|
key: "getImageName",
|
|
value: function getImageName() {
|
|
return this.graphics.getImageName();
|
|
}
|
|
/**
|
|
* Get image editor
|
|
* @returns {ImageEditor}
|
|
*/
|
|
|
|
}, {
|
|
key: "getEditor",
|
|
value: function getEditor() {
|
|
return this.graphics.getEditor();
|
|
}
|
|
/**
|
|
* Return component name
|
|
* @returns {string}
|
|
*/
|
|
|
|
}, {
|
|
key: "getName",
|
|
value: function getName() {
|
|
return this.name;
|
|
}
|
|
/**
|
|
* Set image properties
|
|
* @param {Object} setting - Image properties
|
|
* @param {boolean} [withRendering] - If true, The changed image will be reflected in the canvas
|
|
*/
|
|
|
|
}, {
|
|
key: "setImageProperties",
|
|
value: function setImageProperties(setting, withRendering) {
|
|
this.graphics.setImageProperties(setting, withRendering);
|
|
}
|
|
/**
|
|
* Set canvas dimension - css only
|
|
* @param {Object} dimension - Canvas css dimension
|
|
*/
|
|
|
|
}, {
|
|
key: "setCanvasCssDimension",
|
|
value: function setCanvasCssDimension(dimension) {
|
|
this.graphics.setCanvasCssDimension(dimension);
|
|
}
|
|
/**
|
|
* Set canvas dimension - css only
|
|
* @param {Object} dimension - Canvas backstore dimension
|
|
*/
|
|
|
|
}, {
|
|
key: "setCanvasBackstoreDimension",
|
|
value: function setCanvasBackstoreDimension(dimension) {
|
|
this.graphics.setCanvasBackstoreDimension(dimension);
|
|
}
|
|
/**
|
|
* Adjust canvas dimension with scaling image
|
|
*/
|
|
|
|
}, {
|
|
key: "adjustCanvasDimension",
|
|
value: function adjustCanvasDimension() {
|
|
this.graphics.adjustCanvasDimension();
|
|
}
|
|
}, {
|
|
key: "adjustCanvasDimensionBase",
|
|
value: function adjustCanvasDimensionBase() {
|
|
this.graphics.adjustCanvasDimensionBase();
|
|
}
|
|
}]);
|
|
|
|
return Component;
|
|
}();
|
|
|
|
/* harmony default export */ var component = (Component);
|
|
;// CONCATENATED MODULE: ./src/js/component/imageLoader.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function imageLoader_createSuper(Derived) { var hasNativeReflectConstruct = imageLoader_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function imageLoader_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
var imageOption = {
|
|
padding: 0,
|
|
crossOrigin: 'Anonymous'
|
|
};
|
|
/**
|
|
* ImageLoader components
|
|
* @extends {Component}
|
|
* @class ImageLoader
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @ignore
|
|
*/
|
|
|
|
var ImageLoader = /*#__PURE__*/function (_Component) {
|
|
_inherits(ImageLoader, _Component);
|
|
|
|
var _super = imageLoader_createSuper(ImageLoader);
|
|
|
|
function ImageLoader(graphics) {
|
|
_classCallCheck(this, ImageLoader);
|
|
|
|
return _super.call(this, componentNames.IMAGE_LOADER, graphics);
|
|
}
|
|
/**
|
|
* Load image from url
|
|
* @param {?string} imageName - File name
|
|
* @param {?(fabric.Image|string)} img - fabric.Image instance or URL of an image
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
|
|
_createClass(ImageLoader, [{
|
|
key: "load",
|
|
value: function load(imageName, img) {
|
|
var _this = this;
|
|
|
|
var promise;
|
|
|
|
if (!imageName && !img) {
|
|
// Back to the initial state, not error.
|
|
var canvas = this.getCanvas();
|
|
canvas.backgroundImage = null;
|
|
canvas.renderAll();
|
|
promise = new (promise_default())(function (resolve) {
|
|
_this.setCanvasImage('', null);
|
|
|
|
resolve();
|
|
});
|
|
} else {
|
|
promise = this._setBackgroundImage(img).then(function (oImage) {
|
|
_this.setCanvasImage(imageName, oImage);
|
|
|
|
_this.adjustCanvasDimension();
|
|
|
|
return oImage;
|
|
});
|
|
}
|
|
|
|
return promise;
|
|
}
|
|
/**
|
|
* Set background image
|
|
* @param {?(fabric.Image|String)} img fabric.Image instance or URL of an image to set background to
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setBackgroundImage",
|
|
value: function _setBackgroundImage(img) {
|
|
var _this2 = this;
|
|
|
|
if (!img) {
|
|
return promise_default().reject(rejectMessages.loadImage);
|
|
}
|
|
|
|
return new (promise_default())(function (resolve, reject) {
|
|
var canvas = _this2.getCanvas();
|
|
|
|
canvas.setBackgroundImage(img, function () {
|
|
var oImage = canvas.backgroundImage;
|
|
|
|
if (oImage && oImage.getElement()) {
|
|
resolve(oImage);
|
|
} else {
|
|
reject(rejectMessages.loadingImageFailed);
|
|
}
|
|
}, imageOption);
|
|
});
|
|
}
|
|
}]);
|
|
|
|
return ImageLoader;
|
|
}(component);
|
|
|
|
/* harmony default export */ var imageLoader = (ImageLoader);
|
|
;// CONCATENATED MODULE: ./src/js/extension/cropzone.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var CORNER_TYPE_TOP_LEFT = 'tl';
|
|
var CORNER_TYPE_TOP_RIGHT = 'tr';
|
|
var CORNER_TYPE_MIDDLE_TOP = 'mt';
|
|
var CORNER_TYPE_MIDDLE_LEFT = 'ml';
|
|
var CORNER_TYPE_MIDDLE_RIGHT = 'mr';
|
|
var CORNER_TYPE_MIDDLE_BOTTOM = 'mb';
|
|
var CORNER_TYPE_BOTTOM_LEFT = 'bl';
|
|
var CORNER_TYPE_BOTTOM_RIGHT = 'br';
|
|
var CORNER_TYPE_LIST = [CORNER_TYPE_TOP_LEFT, CORNER_TYPE_TOP_RIGHT, CORNER_TYPE_MIDDLE_TOP, CORNER_TYPE_MIDDLE_LEFT, CORNER_TYPE_MIDDLE_RIGHT, CORNER_TYPE_MIDDLE_BOTTOM, CORNER_TYPE_BOTTOM_LEFT, CORNER_TYPE_BOTTOM_RIGHT];
|
|
|
|
var NOOP_FUNCTION = function NOOP_FUNCTION() {};
|
|
/**
|
|
* Align with cropzone ratio
|
|
* @param {string} selectedCorner - selected corner type
|
|
* @returns {{width: number, height: number}}
|
|
* @private
|
|
*/
|
|
|
|
|
|
function cornerTypeValid(selectedCorner) {
|
|
return index_of_default()(CORNER_TYPE_LIST).call(CORNER_TYPE_LIST, selectedCorner) >= 0;
|
|
}
|
|
/**
|
|
* return scale basis type
|
|
* @param {number} diffX - X distance of the cursor and corner.
|
|
* @param {number} diffY - Y distance of the cursor and corner.
|
|
* @returns {string}
|
|
* @private
|
|
*/
|
|
|
|
|
|
function getScaleBasis(diffX, diffY) {
|
|
return diffX > diffY ? 'width' : 'height';
|
|
}
|
|
/**
|
|
* Cropzone object
|
|
* Issue: IE7, 8(with excanvas)
|
|
* - Cropzone is a black zone without transparency.
|
|
* @class Cropzone
|
|
* @extends {fabric.Rect}
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
var Cropzone = fabric.fabric.util.createClass(fabric.fabric.Rect,
|
|
/** @lends Cropzone.prototype */
|
|
{
|
|
/**
|
|
* Constructor
|
|
* @param {Object} canvas canvas
|
|
* @param {Object} options Options object
|
|
* @param {Object} extendsOptions object for extends "options"
|
|
* @override
|
|
*/
|
|
initialize: function initialize(canvas, options, extendsOptions) {
|
|
options = extend_default()(options, extendsOptions);
|
|
options.type = 'cropzone';
|
|
this.callSuper('initialize', options);
|
|
|
|
this._addEventHandler();
|
|
|
|
this.canvas = canvas;
|
|
this.options = options;
|
|
},
|
|
canvasEventDelegation: function canvasEventDelegation(eventName) {
|
|
var _context;
|
|
|
|
var delegationState = 'unregistered';
|
|
var isRegistered = this.canvasEventTrigger[eventName] !== NOOP_FUNCTION;
|
|
|
|
if (isRegistered) {
|
|
delegationState = 'registered';
|
|
} else if (index_of_default()(_context = [eventNames.OBJECT_MOVED, eventNames.OBJECT_SCALED]).call(_context, eventName) < 0) {
|
|
delegationState = 'none';
|
|
}
|
|
|
|
return delegationState;
|
|
},
|
|
canvasEventRegister: function canvasEventRegister(eventName, eventTrigger) {
|
|
this.canvasEventTrigger[eventName] = eventTrigger;
|
|
},
|
|
_addEventHandler: function _addEventHandler() {
|
|
var _this$canvasEventTrig, _context2, _context3, _context4, _context5;
|
|
|
|
this.canvasEventTrigger = (_this$canvasEventTrig = {}, _defineProperty(_this$canvasEventTrig, eventNames.OBJECT_MOVED, NOOP_FUNCTION), _defineProperty(_this$canvasEventTrig, eventNames.OBJECT_SCALED, NOOP_FUNCTION), _this$canvasEventTrig);
|
|
this.on({
|
|
moving: bind_default()(_context2 = this._onMoving).call(_context2, this),
|
|
scaling: bind_default()(_context3 = this._onScaling).call(_context3, this)
|
|
});
|
|
fabric.fabric.util.addListener(document, 'keydown', bind_default()(_context4 = this._onKeyDown).call(_context4, this));
|
|
fabric.fabric.util.addListener(document, 'keyup', bind_default()(_context5 = this._onKeyUp).call(_context5, this));
|
|
},
|
|
_renderCropzone: function _renderCropzone(ctx) {
|
|
var cropzoneDashLineWidth = 7;
|
|
var cropzoneDashLineOffset = 7; // Calc original scale
|
|
|
|
var originalFlipX = this.flipX ? -1 : 1;
|
|
var originalFlipY = this.flipY ? -1 : 1;
|
|
var originalScaleX = originalFlipX / this.scaleX;
|
|
var originalScaleY = originalFlipY / this.scaleY; // Set original scale
|
|
|
|
ctx.scale(originalScaleX, originalScaleY); // Render outer rect
|
|
|
|
this._fillOuterRect(ctx, 'rgba(0, 0, 0, 0.5)');
|
|
|
|
if (this.options.lineWidth) {
|
|
this._fillInnerRect(ctx);
|
|
|
|
this._strokeBorder(ctx, 'rgb(255, 255, 255)', {
|
|
lineWidth: this.options.lineWidth
|
|
});
|
|
} else {
|
|
// Black dash line
|
|
this._strokeBorder(ctx, 'rgb(0, 0, 0)', {
|
|
lineDashWidth: cropzoneDashLineWidth
|
|
}); // White dash line
|
|
|
|
|
|
this._strokeBorder(ctx, 'rgb(255, 255, 255)', {
|
|
lineDashWidth: cropzoneDashLineWidth,
|
|
lineDashOffset: cropzoneDashLineOffset
|
|
});
|
|
} // Reset scale
|
|
|
|
|
|
ctx.scale(1 / originalScaleX, 1 / originalScaleY);
|
|
},
|
|
|
|
/**
|
|
* Render Crop-zone
|
|
* @private
|
|
* @override
|
|
*/
|
|
_render: function _render(ctx) {
|
|
this.callSuper('_render', ctx);
|
|
|
|
this._renderCropzone(ctx);
|
|
},
|
|
|
|
/**
|
|
* Cropzone-coordinates with outer rectangle
|
|
*
|
|
* x0 x1 x2 x3
|
|
* y0 +--------------------------+
|
|
* |///////|//////////|///////| // <--- "Outer-rectangle"
|
|
* |///////|//////////|///////|
|
|
* y1 +-------+----------+-------+
|
|
* |///////| Cropzone |///////| Cropzone is the "Inner-rectangle"
|
|
* |///////| (0, 0) |///////| Center point (0, 0)
|
|
* y2 +-------+----------+-------+
|
|
* |///////|//////////|///////|
|
|
* |///////|//////////|///////|
|
|
* y3 +--------------------------+
|
|
*
|
|
* @typedef {{x: Array<number>, y: Array<number>}} cropzoneCoordinates
|
|
* @ignore
|
|
*/
|
|
|
|
/**
|
|
* Fill outer rectangle
|
|
* @param {CanvasRenderingContext2D} ctx - Context
|
|
* @param {string|CanvasGradient|CanvasPattern} fillStyle - Fill-style
|
|
* @private
|
|
*/
|
|
_fillOuterRect: function _fillOuterRect(ctx, fillStyle) {
|
|
var _this$_getCoordinates = this._getCoordinates(),
|
|
x = _this$_getCoordinates.x,
|
|
y = _this$_getCoordinates.y;
|
|
|
|
ctx.save();
|
|
ctx.fillStyle = fillStyle;
|
|
ctx.beginPath(); // Outer rectangle
|
|
// Numbers are +/-1 so that overlay edges don't get blurry.
|
|
|
|
ctx.moveTo(x[0] - 1, y[0] - 1);
|
|
ctx.lineTo(x[3] + 1, y[0] - 1);
|
|
ctx.lineTo(x[3] + 1, y[3] + 1);
|
|
ctx.lineTo(x[0] - 1, y[3] + 1);
|
|
ctx.lineTo(x[0] - 1, y[0] - 1);
|
|
ctx.closePath(); // Inner rectangle
|
|
|
|
ctx.moveTo(x[1], y[1]);
|
|
ctx.lineTo(x[1], y[2]);
|
|
ctx.lineTo(x[2], y[2]);
|
|
ctx.lineTo(x[2], y[1]);
|
|
ctx.lineTo(x[1], y[1]);
|
|
ctx.closePath();
|
|
|
|
fill_default()(ctx).call(ctx);
|
|
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Draw Inner grid line
|
|
* @param {CanvasRenderingContext2D} ctx - Context
|
|
* @private
|
|
*/
|
|
_fillInnerRect: function _fillInnerRect(ctx) {
|
|
var _this$_getCoordinates2 = this._getCoordinates(),
|
|
outerX = _this$_getCoordinates2.x,
|
|
outerY = _this$_getCoordinates2.y;
|
|
|
|
var x = this._caculateInnerPosition(outerX, (outerX[2] - outerX[1]) / 3);
|
|
|
|
var y = this._caculateInnerPosition(outerY, (outerY[2] - outerY[1]) / 3);
|
|
|
|
ctx.save();
|
|
ctx.strokeStyle = 'rgba(255, 255, 255, 0.7)';
|
|
ctx.lineWidth = this.options.lineWidth;
|
|
ctx.beginPath();
|
|
ctx.moveTo(x[0], y[1]);
|
|
ctx.lineTo(x[3], y[1]);
|
|
ctx.moveTo(x[0], y[2]);
|
|
ctx.lineTo(x[3], y[2]);
|
|
ctx.moveTo(x[1], y[0]);
|
|
ctx.lineTo(x[1], y[3]);
|
|
ctx.moveTo(x[2], y[0]);
|
|
ctx.lineTo(x[2], y[3]);
|
|
ctx.stroke();
|
|
ctx.closePath();
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* Calculate Inner Position
|
|
* @param {Array} outer - outer position
|
|
* @param {number} size - interval for calculate
|
|
* @returns {Array} - inner position
|
|
* @private
|
|
*/
|
|
_caculateInnerPosition: function _caculateInnerPosition(outer, size) {
|
|
var position = [];
|
|
position[0] = outer[1];
|
|
position[1] = outer[1] + size;
|
|
position[2] = outer[1] + size * 2;
|
|
position[3] = outer[2];
|
|
return position;
|
|
},
|
|
|
|
/**
|
|
* Get coordinates
|
|
* @returns {cropzoneCoordinates} - {@link cropzoneCoordinates}
|
|
* @private
|
|
*/
|
|
_getCoordinates: function _getCoordinates() {
|
|
var _context6, _context7;
|
|
|
|
var canvas = this.canvas,
|
|
width = this.width,
|
|
height = this.height,
|
|
left = this.left,
|
|
top = this.top;
|
|
var halfWidth = width / 2;
|
|
var halfHeight = height / 2;
|
|
var canvasHeight = canvas.getHeight(); // fabric object
|
|
|
|
var canvasWidth = canvas.getWidth(); // fabric object
|
|
|
|
return {
|
|
x: map_default()(_context6 = [-(halfWidth + left), // x0
|
|
-halfWidth, // x1
|
|
halfWidth, // x2
|
|
halfWidth + (canvasWidth - left - width) // x3
|
|
]).call(_context6, Math.ceil),
|
|
y: map_default()(_context7 = [-(halfHeight + top), // y0
|
|
-halfHeight, // y1
|
|
halfHeight, // y2
|
|
halfHeight + (canvasHeight - top - height) // y3
|
|
]).call(_context7, Math.ceil)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Stroke border
|
|
* @param {CanvasRenderingContext2D} ctx - Context
|
|
* @param {string|CanvasGradient|CanvasPattern} strokeStyle - Stroke-style
|
|
* @param {number} lineDashWidth - Dash width
|
|
* @param {number} [lineDashOffset] - Dash offset
|
|
* @param {number} [lineWidth] - line width
|
|
* @private
|
|
*/
|
|
_strokeBorder: function _strokeBorder(ctx, strokeStyle, _ref) {
|
|
var lineDashWidth = _ref.lineDashWidth,
|
|
lineDashOffset = _ref.lineDashOffset,
|
|
lineWidth = _ref.lineWidth;
|
|
var halfWidth = this.width / 2;
|
|
var halfHeight = this.height / 2;
|
|
ctx.save();
|
|
ctx.strokeStyle = strokeStyle;
|
|
|
|
if (ctx.setLineDash) {
|
|
ctx.setLineDash([lineDashWidth, lineDashWidth]);
|
|
}
|
|
|
|
if (lineDashOffset) {
|
|
ctx.lineDashOffset = lineDashOffset;
|
|
}
|
|
|
|
if (lineWidth) {
|
|
ctx.lineWidth = lineWidth;
|
|
}
|
|
|
|
ctx.beginPath();
|
|
ctx.moveTo(-halfWidth, -halfHeight);
|
|
ctx.lineTo(halfWidth, -halfHeight);
|
|
ctx.lineTo(halfWidth, halfHeight);
|
|
ctx.lineTo(-halfWidth, halfHeight);
|
|
ctx.lineTo(-halfWidth, -halfHeight);
|
|
ctx.stroke();
|
|
ctx.restore();
|
|
},
|
|
|
|
/**
|
|
* onMoving event listener
|
|
* @private
|
|
*/
|
|
_onMoving: function _onMoving() {
|
|
var height = this.height,
|
|
width = this.width,
|
|
left = this.left,
|
|
top = this.top;
|
|
var maxLeft = this.canvas.getWidth() - width;
|
|
var maxTop = this.canvas.getHeight() - height;
|
|
this.left = clamp(left, 0, maxLeft);
|
|
this.top = clamp(top, 0, maxTop);
|
|
this.canvasEventTrigger[eventNames.OBJECT_MOVED](this);
|
|
},
|
|
|
|
/**
|
|
* onScaling event listener
|
|
* @param {{e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
_onScaling: function _onScaling(fEvent) {
|
|
var selectedCorner = fEvent.transform.corner;
|
|
var pointer = this.canvas.getPointer(fEvent.e);
|
|
|
|
var settings = this._calcScalingSizeFromPointer(pointer, selectedCorner); // On scaling cropzone,
|
|
// change real width and height and fix scaleFactor to 1
|
|
|
|
|
|
this.scale(1).set(settings);
|
|
this.canvasEventTrigger[eventNames.OBJECT_SCALED](this);
|
|
},
|
|
|
|
/**
|
|
* Calc scaled size from mouse pointer with selected corner
|
|
* @param {{x: number, y: number}} pointer - Mouse position
|
|
* @param {string} selectedCorner - selected corner type
|
|
* @returns {Object} Having left or(and) top or(and) width or(and) height.
|
|
* @private
|
|
*/
|
|
_calcScalingSizeFromPointer: function _calcScalingSizeFromPointer(pointer, selectedCorner) {
|
|
var isCornerTypeValid = cornerTypeValid(selectedCorner);
|
|
return isCornerTypeValid && this._resizeCropZone(pointer, selectedCorner);
|
|
},
|
|
|
|
/**
|
|
* Align with cropzone ratio
|
|
* @param {number} width - cropzone width
|
|
* @param {number} height - cropzone height
|
|
* @param {number} maxWidth - limit max width
|
|
* @param {number} maxHeight - limit max height
|
|
* @param {number} scaleTo - cropzone ratio
|
|
* @returns {{width: number, height: number}}
|
|
* @private
|
|
*/
|
|
adjustRatioCropzoneSize: function adjustRatioCropzoneSize(_ref2) {
|
|
var width = _ref2.width,
|
|
height = _ref2.height,
|
|
leftMaker = _ref2.leftMaker,
|
|
topMaker = _ref2.topMaker,
|
|
maxWidth = _ref2.maxWidth,
|
|
maxHeight = _ref2.maxHeight,
|
|
scaleTo = _ref2.scaleTo;
|
|
width = maxWidth ? clamp(width, 1, maxWidth) : width;
|
|
height = maxHeight ? clamp(height, 1, maxHeight) : height;
|
|
|
|
if (!this.presetRatio) {
|
|
if (this._withShiftKey) {
|
|
// make fixed ratio cropzone
|
|
if (width > height) {
|
|
height = width;
|
|
} else if (height > width) {
|
|
width = height;
|
|
}
|
|
}
|
|
|
|
return {
|
|
width: width,
|
|
height: height,
|
|
left: leftMaker(width),
|
|
top: topMaker(height)
|
|
};
|
|
}
|
|
|
|
if (scaleTo === 'width') {
|
|
height = width / this.presetRatio;
|
|
} else {
|
|
width = height * this.presetRatio;
|
|
}
|
|
|
|
var maxScaleFactor = Math.min(maxWidth / width, maxHeight / height);
|
|
|
|
if (maxScaleFactor <= 1) {
|
|
var _context8;
|
|
|
|
var _map = map_default()(_context8 = [width, height]).call(_context8, function (v) {
|
|
return v * maxScaleFactor;
|
|
});
|
|
|
|
var _map2 = _slicedToArray(_map, 2);
|
|
|
|
width = _map2[0];
|
|
height = _map2[1];
|
|
}
|
|
|
|
return {
|
|
width: width,
|
|
height: height,
|
|
left: leftMaker(width),
|
|
top: topMaker(height)
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Get dimension last state cropzone
|
|
* @returns {{rectTop: number, rectLeft: number, rectWidth: number, rectHeight: number}}
|
|
* @private
|
|
*/
|
|
_getCropzoneRectInfo: function _getCropzoneRectInfo() {
|
|
var _this$canvas = this.canvas,
|
|
canvasWidth = _this$canvas.width,
|
|
canvasHeight = _this$canvas.height;
|
|
|
|
var _this$getBoundingRect = this.getBoundingRect(false, true),
|
|
rectTop = _this$getBoundingRect.top,
|
|
rectLeft = _this$getBoundingRect.left,
|
|
rectWidth = _this$getBoundingRect.width,
|
|
rectHeight = _this$getBoundingRect.height;
|
|
|
|
return {
|
|
rectTop: rectTop,
|
|
rectLeft: rectLeft,
|
|
rectWidth: rectWidth,
|
|
rectHeight: rectHeight,
|
|
rectRight: rectLeft + rectWidth,
|
|
rectBottom: rectTop + rectHeight,
|
|
canvasWidth: canvasWidth,
|
|
canvasHeight: canvasHeight
|
|
};
|
|
},
|
|
|
|
/**
|
|
* Calc scaling dimension
|
|
* @param {Object} position - Mouse position
|
|
* @param {string} corner - corner type
|
|
* @returns {{left: number, top: number, width: number, height: number}}
|
|
* @private
|
|
*/
|
|
_resizeCropZone: function _resizeCropZone(_ref3, corner) {
|
|
var x = _ref3.x,
|
|
y = _ref3.y;
|
|
|
|
var _this$_getCropzoneRec = this._getCropzoneRectInfo(),
|
|
rectWidth = _this$_getCropzoneRec.rectWidth,
|
|
rectHeight = _this$_getCropzoneRec.rectHeight,
|
|
rectTop = _this$_getCropzoneRec.rectTop,
|
|
rectLeft = _this$_getCropzoneRec.rectLeft,
|
|
rectBottom = _this$_getCropzoneRec.rectBottom,
|
|
rectRight = _this$_getCropzoneRec.rectRight,
|
|
canvasWidth = _this$_getCropzoneRec.canvasWidth,
|
|
canvasHeight = _this$_getCropzoneRec.canvasHeight;
|
|
|
|
var resizeInfoMap = {
|
|
tl: {
|
|
width: rectRight - x,
|
|
height: rectBottom - y,
|
|
leftMaker: function leftMaker(newWidth) {
|
|
return rectRight - newWidth;
|
|
},
|
|
topMaker: function topMaker(newHeight) {
|
|
return rectBottom - newHeight;
|
|
},
|
|
maxWidth: rectRight,
|
|
maxHeight: rectBottom,
|
|
scaleTo: getScaleBasis(rectLeft - x, rectTop - y)
|
|
},
|
|
tr: {
|
|
width: x - rectLeft,
|
|
height: rectBottom - y,
|
|
leftMaker: function leftMaker() {
|
|
return rectLeft;
|
|
},
|
|
topMaker: function topMaker(newHeight) {
|
|
return rectBottom - newHeight;
|
|
},
|
|
maxWidth: canvasWidth - rectLeft,
|
|
maxHeight: rectBottom,
|
|
scaleTo: getScaleBasis(x - rectRight, rectTop - y)
|
|
},
|
|
mt: {
|
|
width: rectWidth,
|
|
height: rectBottom - y,
|
|
leftMaker: function leftMaker() {
|
|
return rectLeft;
|
|
},
|
|
topMaker: function topMaker(newHeight) {
|
|
return rectBottom - newHeight;
|
|
},
|
|
maxWidth: canvasWidth - rectLeft,
|
|
maxHeight: rectBottom,
|
|
scaleTo: 'height'
|
|
},
|
|
ml: {
|
|
width: rectRight - x,
|
|
height: rectHeight,
|
|
leftMaker: function leftMaker(newWidth) {
|
|
return rectRight - newWidth;
|
|
},
|
|
topMaker: function topMaker() {
|
|
return rectTop;
|
|
},
|
|
maxWidth: rectRight,
|
|
maxHeight: canvasHeight - rectTop,
|
|
scaleTo: 'width'
|
|
},
|
|
mr: {
|
|
width: x - rectLeft,
|
|
height: rectHeight,
|
|
leftMaker: function leftMaker() {
|
|
return rectLeft;
|
|
},
|
|
topMaker: function topMaker() {
|
|
return rectTop;
|
|
},
|
|
maxWidth: canvasWidth - rectLeft,
|
|
maxHeight: canvasHeight - rectTop,
|
|
scaleTo: 'width'
|
|
},
|
|
mb: {
|
|
width: rectWidth,
|
|
height: y - rectTop,
|
|
leftMaker: function leftMaker() {
|
|
return rectLeft;
|
|
},
|
|
topMaker: function topMaker() {
|
|
return rectTop;
|
|
},
|
|
maxWidth: canvasWidth - rectLeft,
|
|
maxHeight: canvasHeight - rectTop,
|
|
scaleTo: 'height'
|
|
},
|
|
bl: {
|
|
width: rectRight - x,
|
|
height: y - rectTop,
|
|
leftMaker: function leftMaker(newWidth) {
|
|
return rectRight - newWidth;
|
|
},
|
|
topMaker: function topMaker() {
|
|
return rectTop;
|
|
},
|
|
maxWidth: rectRight,
|
|
maxHeight: canvasHeight - rectTop,
|
|
scaleTo: getScaleBasis(rectLeft - x, y - rectBottom)
|
|
},
|
|
br: {
|
|
width: x - rectLeft,
|
|
height: y - rectTop,
|
|
leftMaker: function leftMaker() {
|
|
return rectLeft;
|
|
},
|
|
topMaker: function topMaker() {
|
|
return rectTop;
|
|
},
|
|
maxWidth: canvasWidth - rectLeft,
|
|
maxHeight: canvasHeight - rectTop,
|
|
scaleTo: getScaleBasis(x - rectRight, y - rectBottom)
|
|
}
|
|
};
|
|
return this.adjustRatioCropzoneSize(resizeInfoMap[corner]);
|
|
},
|
|
|
|
/**
|
|
* Return the whether this cropzone is valid
|
|
* @returns {boolean}
|
|
*/
|
|
isValid: function isValid() {
|
|
return this.left >= 0 && this.top >= 0 && this.width > 0 && this.height > 0;
|
|
},
|
|
|
|
/**
|
|
* Keydown event handler
|
|
* @param {{number}} keyCode - Event keyCode
|
|
* @private
|
|
*/
|
|
_onKeyDown: function _onKeyDown(_ref4) {
|
|
var keyCode = _ref4.keyCode;
|
|
|
|
if (keyCode === keyCodes.SHIFT) {
|
|
this._withShiftKey = true;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Keyup event handler
|
|
* @param {{number}} keyCode - Event keyCode
|
|
* @private
|
|
*/
|
|
_onKeyUp: function _onKeyUp(_ref5) {
|
|
var keyCode = _ref5.keyCode;
|
|
|
|
if (keyCode === keyCodes.SHIFT) {
|
|
this._withShiftKey = false;
|
|
}
|
|
}
|
|
});
|
|
/* harmony default export */ var cropzone = (Cropzone);
|
|
;// CONCATENATED MODULE: ./src/js/component/cropper.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function cropper_createSuper(Derived) { var hasNativeReflectConstruct = cropper_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function cropper_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var MOUSE_MOVE_THRESHOLD = 10;
|
|
var DEFAULT_OPTION = {
|
|
presetRatio: null,
|
|
top: -10,
|
|
left: -10,
|
|
height: 1,
|
|
width: 1
|
|
};
|
|
/**
|
|
* Cropper components
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @class Cropper
|
|
* @ignore
|
|
*/
|
|
|
|
var Cropper = /*#__PURE__*/function (_Component) {
|
|
_inherits(Cropper, _Component);
|
|
|
|
var _super = cropper_createSuper(Cropper);
|
|
|
|
function Cropper(graphics) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
var _this;
|
|
|
|
_classCallCheck(this, Cropper);
|
|
|
|
_this = _super.call(this, componentNames.CROPPER, graphics);
|
|
/**
|
|
* Cropzone
|
|
* @type {Cropzone}
|
|
* @private
|
|
*/
|
|
|
|
_this._cropzone = null;
|
|
/**
|
|
* StartX of Cropzone
|
|
* @type {number}
|
|
* @private
|
|
*/
|
|
|
|
_this._startX = null;
|
|
/**
|
|
* StartY of Cropzone
|
|
* @type {number}
|
|
* @private
|
|
*/
|
|
|
|
_this._startY = null;
|
|
/**
|
|
* State whether shortcut key is pressed or not
|
|
* @type {boolean}
|
|
* @private
|
|
*/
|
|
|
|
_this._withShiftKey = false;
|
|
/**
|
|
* Listeners
|
|
* @type {object.<string, function>}
|
|
* @private
|
|
*/
|
|
|
|
_this._listeners = {
|
|
keydown: bind_default()(_context = _this._onKeyDown).call(_context, _assertThisInitialized(_this)),
|
|
keyup: bind_default()(_context2 = _this._onKeyUp).call(_context2, _assertThisInitialized(_this)),
|
|
mousedown: bind_default()(_context3 = _this._onFabricMouseDown).call(_context3, _assertThisInitialized(_this)),
|
|
mousemove: bind_default()(_context4 = _this._onFabricMouseMove).call(_context4, _assertThisInitialized(_this)),
|
|
mouseup: bind_default()(_context5 = _this._onFabricMouseUp).call(_context5, _assertThisInitialized(_this))
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Start cropping
|
|
*/
|
|
|
|
|
|
_createClass(Cropper, [{
|
|
key: "start",
|
|
value: function start() {
|
|
if (this._cropzone) {
|
|
return;
|
|
}
|
|
|
|
var canvas = this.getCanvas();
|
|
canvas.forEachObject(function (obj) {
|
|
// {@link http://fabricjs.com/docs/fabric.Object.html#evented}
|
|
obj.evented = false;
|
|
});
|
|
this._cropzone = new cropzone(canvas, extend_default()({
|
|
left: 0,
|
|
top: 0,
|
|
width: 0.5,
|
|
height: 0.5,
|
|
strokeWidth: 0,
|
|
// {@link https://github.com/kangax/fabric.js/issues/2860}
|
|
cornerSize: 10,
|
|
cornerColor: 'black',
|
|
fill: 'transparent'
|
|
}, CROPZONE_DEFAULT_OPTIONS, this.graphics.cropSelectionStyle));
|
|
canvas.discardActiveObject();
|
|
canvas.add(this._cropzone);
|
|
canvas.on('mouse:down', this._listeners.mousedown);
|
|
canvas.selection = false;
|
|
canvas.defaultCursor = 'crosshair';
|
|
fabric.fabric.util.addListener(document, 'keydown', this._listeners.keydown);
|
|
fabric.fabric.util.addListener(document, 'keyup', this._listeners.keyup);
|
|
}
|
|
/**
|
|
* End cropping
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
var canvas = this.getCanvas();
|
|
var cropzone = this._cropzone;
|
|
|
|
if (!cropzone) {
|
|
return;
|
|
}
|
|
|
|
canvas.remove(cropzone);
|
|
canvas.selection = true;
|
|
canvas.defaultCursor = 'default';
|
|
canvas.off('mouse:down', this._listeners.mousedown);
|
|
canvas.forEachObject(function (obj) {
|
|
obj.evented = true;
|
|
});
|
|
this._cropzone = null;
|
|
fabric.fabric.util.removeListener(document, 'keydown', this._listeners.keydown);
|
|
fabric.fabric.util.removeListener(document, 'keyup', this._listeners.keyup);
|
|
}
|
|
/**
|
|
* Change cropzone visible
|
|
* @param {boolean} visible - cropzone visible state
|
|
*/
|
|
|
|
}, {
|
|
key: "changeVisibility",
|
|
value: function changeVisibility(visible) {
|
|
if (this._cropzone) {
|
|
this._cropzone.set({
|
|
visible: visible
|
|
});
|
|
}
|
|
}
|
|
/**
|
|
* onMousedown handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseDown",
|
|
value: function _onFabricMouseDown(fEvent) {
|
|
var canvas = this.getCanvas();
|
|
|
|
if (fEvent.target) {
|
|
return;
|
|
}
|
|
|
|
canvas.selection = false;
|
|
var coord = canvas.getPointer(fEvent.e);
|
|
this._startX = coord.x;
|
|
this._startY = coord.y;
|
|
canvas.on({
|
|
'mouse:move': this._listeners.mousemove,
|
|
'mouse:up': this._listeners.mouseup
|
|
});
|
|
}
|
|
/**
|
|
* onMousemove handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseMove",
|
|
value: function _onFabricMouseMove(fEvent) {
|
|
var canvas = this.getCanvas();
|
|
var pointer = canvas.getPointer(fEvent.e);
|
|
var x = pointer.x,
|
|
y = pointer.y;
|
|
var cropzone = this._cropzone;
|
|
|
|
if (Math.abs(x - this._startX) + Math.abs(y - this._startY) > MOUSE_MOVE_THRESHOLD) {
|
|
canvas.remove(cropzone);
|
|
cropzone.set(this._calcRectDimensionFromPoint(x, y, cropzone.presetRatio));
|
|
canvas.add(cropzone);
|
|
canvas.setActiveObject(cropzone);
|
|
}
|
|
}
|
|
/**
|
|
* Get rect dimension setting from Canvas-Mouse-Position(x, y)
|
|
* @param {number} x - Canvas-Mouse-Position x
|
|
* @param {number} y - Canvas-Mouse-Position Y
|
|
* @param {number|null} presetRatio - fixed aspect ratio (width/height) of the cropzone (null if not set)
|
|
* @returns {{left: number, top: number, width: number, height: number}}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_calcRectDimensionFromPoint",
|
|
value: function _calcRectDimensionFromPoint(x, y) {
|
|
var presetRatio = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : null;
|
|
var canvas = this.getCanvas();
|
|
var canvasWidth = canvas.getWidth();
|
|
var canvasHeight = canvas.getHeight();
|
|
var startX = this._startX;
|
|
var startY = this._startY;
|
|
var left = clamp(x, 0, startX);
|
|
var top = clamp(y, 0, startY);
|
|
var width = clamp(x, startX, canvasWidth) - left; // (startX <= x(mouse) <= canvasWidth) - left
|
|
|
|
var height = clamp(y, startY, canvasHeight) - top; // (startY <= y(mouse) <= canvasHeight) - top
|
|
|
|
if (this._withShiftKey && !presetRatio) {
|
|
// make fixed ratio cropzone
|
|
if (width > height) {
|
|
height = width;
|
|
} else if (height > width) {
|
|
width = height;
|
|
}
|
|
|
|
if (startX >= x) {
|
|
left = startX - width;
|
|
}
|
|
|
|
if (startY >= y) {
|
|
top = startY - height;
|
|
}
|
|
} else if (presetRatio) {
|
|
// Restrict cropzone to given presetRatio
|
|
height = width / presetRatio; // If moving in a direction where the top left corner moves (ie. top-left, bottom-left, top-right)
|
|
// the left and/or top values has to be changed based on the new height/width
|
|
|
|
if (startX >= x) {
|
|
left = clamp(startX - width, 0, canvasWidth);
|
|
}
|
|
|
|
if (startY >= y) {
|
|
top = clamp(startY - height, 0, canvasHeight);
|
|
} // Check if the new height is too large
|
|
|
|
|
|
if (top + height > canvasHeight) {
|
|
height = canvasHeight - top; // Set height to max available height
|
|
|
|
width = height * presetRatio; // Restrict cropzone to given presetRatio based on the new height
|
|
// If moving in a direction where the top left corner moves (ie. top-left, bottom-left, top-right)
|
|
// the left and/or top values has to be changed based on the new height/width
|
|
|
|
if (startX >= x) {
|
|
left = clamp(startX - width, 0, canvasWidth);
|
|
}
|
|
|
|
if (startY >= y) {
|
|
top = clamp(startY - height, 0, canvasHeight);
|
|
}
|
|
}
|
|
}
|
|
|
|
return {
|
|
left: left,
|
|
top: top,
|
|
width: width,
|
|
height: height
|
|
};
|
|
}
|
|
/**
|
|
* onMouseup handler in fabric canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseUp",
|
|
value: function _onFabricMouseUp() {
|
|
var cropzone = this._cropzone;
|
|
var listeners = this._listeners;
|
|
var canvas = this.getCanvas();
|
|
canvas.setActiveObject(cropzone);
|
|
canvas.off({
|
|
'mouse:move': listeners.mousemove,
|
|
'mouse:up': listeners.mouseup
|
|
});
|
|
}
|
|
/**
|
|
* Get cropped image data
|
|
* @param {Object} cropRect cropzone rect
|
|
* @param {Number} cropRect.left left position
|
|
* @param {Number} cropRect.top top position
|
|
* @param {Number} cropRect.width width
|
|
* @param {Number} cropRect.height height
|
|
* @returns {?{imageName: string, url: string}} cropped Image data
|
|
*/
|
|
|
|
}, {
|
|
key: "getCroppedImageData",
|
|
value: function getCroppedImageData(cropRect) {
|
|
var canvas = this.getCanvas();
|
|
var containsCropzone = canvas.contains(this._cropzone);
|
|
|
|
if (!cropRect) {
|
|
return null;
|
|
}
|
|
|
|
if (containsCropzone) {
|
|
canvas.remove(this._cropzone);
|
|
}
|
|
|
|
var imageData = {
|
|
imageName: this.getImageName(),
|
|
url: canvas.toDataURL(cropRect)
|
|
};
|
|
|
|
if (containsCropzone) {
|
|
canvas.add(this._cropzone);
|
|
}
|
|
|
|
return imageData;
|
|
}
|
|
/**
|
|
* Get cropped rect
|
|
* @returns {Object} rect
|
|
*/
|
|
|
|
}, {
|
|
key: "getCropzoneRect",
|
|
value: function getCropzoneRect() {
|
|
var cropzone = this._cropzone;
|
|
|
|
if (!cropzone.isValid()) {
|
|
return null;
|
|
}
|
|
|
|
return {
|
|
left: cropzone.left,
|
|
top: cropzone.top,
|
|
width: cropzone.width,
|
|
height: cropzone.height
|
|
};
|
|
}
|
|
/**
|
|
* Set a cropzone square
|
|
* @param {number} [presetRatio] - preset ratio
|
|
*/
|
|
|
|
}, {
|
|
key: "setCropzoneRect",
|
|
value: function setCropzoneRect(presetRatio) {
|
|
var canvas = this.getCanvas();
|
|
var cropzone = this._cropzone;
|
|
canvas.discardActiveObject();
|
|
canvas.selection = false;
|
|
canvas.remove(cropzone);
|
|
cropzone.set(presetRatio ? this._getPresetPropertiesForCropSize(presetRatio) : DEFAULT_OPTION);
|
|
canvas.add(cropzone);
|
|
canvas.selection = true;
|
|
|
|
if (presetRatio) {
|
|
canvas.setActiveObject(cropzone);
|
|
}
|
|
}
|
|
/**
|
|
* get a cropzone square info
|
|
* @param {number} presetRatio - preset ratio
|
|
* @returns {{presetRatio: number, left: number, top: number, width: number, height: number}}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getPresetPropertiesForCropSize",
|
|
value: function _getPresetPropertiesForCropSize(presetRatio) {
|
|
var _context6, _context7;
|
|
|
|
var canvas = this.getCanvas();
|
|
var originalWidth = canvas.getWidth();
|
|
var originalHeight = canvas.getHeight();
|
|
var standardSize = originalWidth >= originalHeight ? originalWidth : originalHeight;
|
|
|
|
var getScale = function getScale(value, orignalValue) {
|
|
return value > orignalValue ? orignalValue / value : 1;
|
|
};
|
|
|
|
var width = standardSize * presetRatio;
|
|
var height = standardSize;
|
|
var scaleWidth = getScale(width, originalWidth);
|
|
|
|
var _map = map_default()(_context6 = [width, height]).call(_context6, function (sizeValue) {
|
|
return sizeValue * scaleWidth;
|
|
});
|
|
|
|
var _map2 = _slicedToArray(_map, 2);
|
|
|
|
width = _map2[0];
|
|
height = _map2[1];
|
|
var scaleHeight = getScale(height, originalHeight);
|
|
|
|
var _map3 = map_default()(_context7 = [width, height]).call(_context7, function (sizeValue) {
|
|
return fixFloatingPoint(sizeValue * scaleHeight);
|
|
});
|
|
|
|
var _map4 = _slicedToArray(_map3, 2);
|
|
|
|
width = _map4[0];
|
|
height = _map4[1];
|
|
return {
|
|
presetRatio: presetRatio,
|
|
top: (originalHeight - height) / 2,
|
|
left: (originalWidth - width) / 2,
|
|
width: width,
|
|
height: height
|
|
};
|
|
}
|
|
/**
|
|
* Keydown event handler
|
|
* @param {KeyboardEvent} e - Event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onKeyDown",
|
|
value: function _onKeyDown(e) {
|
|
if (e.keyCode === keyCodes.SHIFT) {
|
|
this._withShiftKey = true;
|
|
}
|
|
}
|
|
/**
|
|
* Keyup event handler
|
|
* @param {KeyboardEvent} e - Event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onKeyUp",
|
|
value: function _onKeyUp(e) {
|
|
if (e.keyCode === keyCodes.SHIFT) {
|
|
this._withShiftKey = false;
|
|
}
|
|
}
|
|
}]);
|
|
|
|
return Cropper;
|
|
}(component);
|
|
|
|
/* harmony default export */ var cropper = (Cropper);
|
|
;// CONCATENATED MODULE: ./src/js/component/flip.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function component_flip_createSuper(Derived) { var hasNativeReflectConstruct = component_flip_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function component_flip_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Flip
|
|
* @class Flip
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @ignore
|
|
*/
|
|
|
|
var flip_Flip = /*#__PURE__*/function (_Component) {
|
|
_inherits(Flip, _Component);
|
|
|
|
var _super = component_flip_createSuper(Flip);
|
|
|
|
function Flip(graphics) {
|
|
_classCallCheck(this, Flip);
|
|
|
|
return _super.call(this, componentNames.FLIP, graphics);
|
|
}
|
|
/**
|
|
* Get current flip settings
|
|
* @returns {{flipX: Boolean, flipY: Boolean}}
|
|
*/
|
|
|
|
|
|
_createClass(Flip, [{
|
|
key: "getCurrentSetting",
|
|
value: function getCurrentSetting() {
|
|
var canvasImage = this.getCanvasImage();
|
|
return {
|
|
flipX: canvasImage.flipX,
|
|
flipY: canvasImage.flipY
|
|
};
|
|
}
|
|
/**
|
|
* Set flipX, flipY
|
|
* @param {{flipX: Boolean, flipY: Boolean}} newSetting - Flip setting
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "set",
|
|
value: function set(newSetting) {
|
|
var setting = this.getCurrentSetting();
|
|
var isChangingFlipX = setting.flipX !== newSetting.flipX;
|
|
var isChangingFlipY = setting.flipY !== newSetting.flipY;
|
|
|
|
if (!isChangingFlipX && !isChangingFlipY) {
|
|
return promise_default().reject(rejectMessages.flip);
|
|
}
|
|
|
|
extend_default()(setting, newSetting);
|
|
this.setImageProperties(setting, true);
|
|
|
|
this._invertAngle(isChangingFlipX, isChangingFlipY);
|
|
|
|
this._flipObjects(isChangingFlipX, isChangingFlipY);
|
|
|
|
return promise_default().resolve({
|
|
flipX: setting.flipX,
|
|
flipY: setting.flipY,
|
|
angle: this.getCanvasImage().angle
|
|
});
|
|
}
|
|
/**
|
|
* Invert image angle for flip
|
|
* @param {boolean} isChangingFlipX - Change flipX
|
|
* @param {boolean} isChangingFlipY - Change flipY
|
|
*/
|
|
|
|
}, {
|
|
key: "_invertAngle",
|
|
value: function _invertAngle(isChangingFlipX, isChangingFlipY) {
|
|
var canvasImage = this.getCanvasImage();
|
|
var angle = canvasImage.angle;
|
|
|
|
if (isChangingFlipX) {
|
|
angle *= -1;
|
|
}
|
|
|
|
if (isChangingFlipY) {
|
|
angle *= -1;
|
|
}
|
|
|
|
canvasImage.rotate(parse_float_default()(angle)).setCoords(); // parseFloat for -0 to 0
|
|
}
|
|
/**
|
|
* Flip objects
|
|
* @param {boolean} isChangingFlipX - Change flipX
|
|
* @param {boolean} isChangingFlipY - Change flipY
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_flipObjects",
|
|
value: function _flipObjects(isChangingFlipX, isChangingFlipY) {
|
|
var canvas = this.getCanvas();
|
|
|
|
if (isChangingFlipX) {
|
|
canvas.forEachObject(function (obj) {
|
|
obj.set({
|
|
angle: parse_float_default()(obj.angle * -1),
|
|
// parseFloat for -0 to 0
|
|
flipX: !obj.flipX,
|
|
left: canvas.width - obj.left
|
|
}).setCoords();
|
|
});
|
|
}
|
|
|
|
if (isChangingFlipY) {
|
|
canvas.forEachObject(function (obj) {
|
|
obj.set({
|
|
angle: parse_float_default()(obj.angle * -1),
|
|
// parseFloat for -0 to 0
|
|
flipY: !obj.flipY,
|
|
top: canvas.height - obj.top
|
|
}).setCoords();
|
|
});
|
|
}
|
|
|
|
canvas.renderAll();
|
|
}
|
|
/**
|
|
* Reset flip settings
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "reset",
|
|
value: function reset() {
|
|
return this.set({
|
|
flipX: false,
|
|
flipY: false
|
|
});
|
|
}
|
|
/**
|
|
* Flip x
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "flipX",
|
|
value: function flipX() {
|
|
var current = this.getCurrentSetting();
|
|
return this.set({
|
|
flipX: !current.flipX,
|
|
flipY: current.flipY
|
|
});
|
|
}
|
|
/**
|
|
* Flip y
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "flipY",
|
|
value: function flipY() {
|
|
var current = this.getCurrentSetting();
|
|
return this.set({
|
|
flipX: current.flipX,
|
|
flipY: !current.flipY
|
|
});
|
|
}
|
|
}]);
|
|
|
|
return Flip;
|
|
}(component);
|
|
|
|
/* harmony default export */ var component_flip = (flip_Flip);
|
|
;// CONCATENATED MODULE: ./src/js/component/rotation.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function rotation_createSuper(Derived) { var hasNativeReflectConstruct = rotation_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function rotation_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Image Rotation component
|
|
* @class Rotation
|
|
* @extends {Component}
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @ignore
|
|
*/
|
|
|
|
var Rotation = /*#__PURE__*/function (_Component) {
|
|
_inherits(Rotation, _Component);
|
|
|
|
var _super = rotation_createSuper(Rotation);
|
|
|
|
function Rotation(graphics) {
|
|
_classCallCheck(this, Rotation);
|
|
|
|
return _super.call(this, componentNames.ROTATION, graphics);
|
|
}
|
|
/**
|
|
* Get current angle
|
|
* @returns {Number}
|
|
*/
|
|
|
|
|
|
_createClass(Rotation, [{
|
|
key: "getCurrentAngle",
|
|
value: function getCurrentAngle() {
|
|
return this.getCanvasImage().angle;
|
|
}
|
|
/**
|
|
* Set angle of the image
|
|
*
|
|
* Do not call "this.setImageProperties" for setting angle directly.
|
|
* Before setting angle, The originX,Y of image should be set to center.
|
|
* See "http://fabricjs.com/docs/fabric.Object.html#setAngle"
|
|
*
|
|
* @param {number} angle - Angle value
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "setAngle",
|
|
value: function setAngle(angle) {
|
|
var oldAngle = this.getCurrentAngle() % 360; // The angle is lower than 2*PI(===360 degrees)
|
|
|
|
angle %= 360;
|
|
var canvasImage = this.getCanvasImage();
|
|
var oldImageCenter = canvasImage.getCenterPoint();
|
|
canvasImage.set({
|
|
angle: angle
|
|
}).setCoords();
|
|
this.adjustCanvasDimension();
|
|
var newImageCenter = canvasImage.getCenterPoint();
|
|
|
|
this._rotateForEachObject(oldImageCenter, newImageCenter, angle - oldAngle);
|
|
|
|
return promise_default().resolve(angle);
|
|
}
|
|
/**
|
|
* Rotate for each object
|
|
* @param {fabric.Point} oldImageCenter - Image center point before rotation
|
|
* @param {fabric.Point} newImageCenter - Image center point after rotation
|
|
* @param {number} angleDiff - Image angle difference after rotation
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_rotateForEachObject",
|
|
value: function _rotateForEachObject(oldImageCenter, newImageCenter, angleDiff) {
|
|
var canvas = this.getCanvas();
|
|
var centerDiff = {
|
|
x: oldImageCenter.x - newImageCenter.x,
|
|
y: oldImageCenter.y - newImageCenter.y
|
|
};
|
|
canvas.forEachObject(function (obj) {
|
|
var objCenter = obj.getCenterPoint();
|
|
var radian = fabric.fabric.util.degreesToRadians(angleDiff);
|
|
var newObjCenter = fabric.fabric.util.rotatePoint(objCenter, oldImageCenter, radian);
|
|
obj.set({
|
|
left: newObjCenter.x - centerDiff.x,
|
|
top: newObjCenter.y - centerDiff.y,
|
|
angle: (obj.angle + angleDiff) % 360
|
|
});
|
|
obj.setCoords();
|
|
});
|
|
canvas.renderAll();
|
|
}
|
|
/**
|
|
* Rotate the image
|
|
* @param {number} additionalAngle - Additional angle
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "rotate",
|
|
value: function rotate(additionalAngle) {
|
|
var current = this.getCurrentAngle();
|
|
return this.setAngle(current + additionalAngle);
|
|
}
|
|
}]);
|
|
|
|
return Rotation;
|
|
}(component);
|
|
|
|
/* harmony default export */ var rotation = (Rotation);
|
|
;// CONCATENATED MODULE: ./src/js/component/freeDrawing.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function freeDrawing_createSuper(Derived) { var hasNativeReflectConstruct = freeDrawing_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function freeDrawing_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
/**
|
|
* FreeDrawing
|
|
* @class FreeDrawing
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @ignore
|
|
*/
|
|
|
|
var FreeDrawing = /*#__PURE__*/function (_Component) {
|
|
_inherits(FreeDrawing, _Component);
|
|
|
|
var _super = freeDrawing_createSuper(FreeDrawing);
|
|
|
|
function FreeDrawing(graphics) {
|
|
var _this;
|
|
|
|
_classCallCheck(this, FreeDrawing);
|
|
|
|
_this = _super.call(this, componentNames.FREE_DRAWING, graphics);
|
|
/**
|
|
* Brush width
|
|
* @type {number}
|
|
*/
|
|
|
|
_this.width = 12;
|
|
/**
|
|
* fabric.Color instance for brush color
|
|
* @type {fabric.Color}
|
|
*/
|
|
|
|
_this.oColor = new fabric.fabric.Color('rgba(0, 0, 0, 0.5)');
|
|
return _this;
|
|
}
|
|
/**
|
|
* Start free drawing mode
|
|
* @param {{width: ?number, color: ?string}} [setting] - Brush width & color
|
|
*/
|
|
|
|
|
|
_createClass(FreeDrawing, [{
|
|
key: "start",
|
|
value: function start(setting) {
|
|
var canvas = this.getCanvas();
|
|
canvas.isDrawingMode = true;
|
|
this.setBrush(setting);
|
|
}
|
|
/**
|
|
* Set brush
|
|
* @param {{width: ?number, color: ?string}} [setting] - Brush width & color
|
|
*/
|
|
|
|
}, {
|
|
key: "setBrush",
|
|
value: function setBrush(setting) {
|
|
var brush = this.getCanvas().freeDrawingBrush;
|
|
setting = setting || {};
|
|
this.width = setting.width || this.width;
|
|
|
|
if (setting.color) {
|
|
this.oColor = new fabric.fabric.Color(setting.color);
|
|
}
|
|
|
|
brush.width = this.width;
|
|
brush.color = this.oColor.toRgba();
|
|
}
|
|
/**
|
|
* End free drawing mode
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
var canvas = this.getCanvas();
|
|
canvas.isDrawingMode = false;
|
|
}
|
|
}]);
|
|
|
|
return FreeDrawing;
|
|
}(component);
|
|
|
|
/* harmony default export */ var freeDrawing = (FreeDrawing);
|
|
;// CONCATENATED MODULE: ./src/js/extension/arrowLine.js
|
|
|
|
|
|
|
|
var ARROW_ANGLE = 30;
|
|
var CHEVRON_SIZE_RATIO = 2.7;
|
|
var TRIANGLE_SIZE_RATIO = 1.7;
|
|
var RADIAN_CONVERSION_VALUE = 180;
|
|
var ArrowLine = fabric.fabric.util.createClass(fabric.fabric.Line,
|
|
/** @lends Convolute.prototype */
|
|
{
|
|
/**
|
|
* Line type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'line',
|
|
|
|
/**
|
|
* Constructor
|
|
* @param {Array} [points] Array of points
|
|
* @param {Object} [options] Options object
|
|
* @override
|
|
*/
|
|
initialize: function initialize(points) {
|
|
var options = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {};
|
|
this.callSuper('initialize', points, options);
|
|
this.arrowType = options.arrowType;
|
|
},
|
|
|
|
/**
|
|
* Render ArrowLine
|
|
* @private
|
|
* @override
|
|
*/
|
|
_render: function _render(ctx) {
|
|
var _this$calcLinePoints = this.calcLinePoints(),
|
|
fromX = _this$calcLinePoints.x1,
|
|
fromY = _this$calcLinePoints.y1,
|
|
toX = _this$calcLinePoints.x2,
|
|
toY = _this$calcLinePoints.y2;
|
|
|
|
var linePosition = {
|
|
fromX: fromX,
|
|
fromY: fromY,
|
|
toX: toX,
|
|
toY: toY
|
|
};
|
|
this.ctx = ctx;
|
|
ctx.lineWidth = this.strokeWidth;
|
|
|
|
this._renderBasicLinePath(linePosition);
|
|
|
|
this._drawDecoratorPath(linePosition);
|
|
|
|
this._renderStroke(ctx);
|
|
},
|
|
|
|
/**
|
|
* Render Basic line path
|
|
* @param {Object} linePosition - line position
|
|
* @param {number} option.fromX - line start position x
|
|
* @param {number} option.fromY - line start position y
|
|
* @param {number} option.toX - line end position x
|
|
* @param {number} option.toY - line end position y
|
|
* @private
|
|
*/
|
|
_renderBasicLinePath: function _renderBasicLinePath(_ref) {
|
|
var fromX = _ref.fromX,
|
|
fromY = _ref.fromY,
|
|
toX = _ref.toX,
|
|
toY = _ref.toY;
|
|
this.ctx.beginPath();
|
|
this.ctx.moveTo(fromX, fromY);
|
|
this.ctx.lineTo(toX, toY);
|
|
},
|
|
|
|
/**
|
|
* Render Arrow Head
|
|
* @param {Object} linePosition - line position
|
|
* @param {number} option.fromX - line start position x
|
|
* @param {number} option.fromY - line start position y
|
|
* @param {number} option.toX - line end position x
|
|
* @param {number} option.toY - line end position y
|
|
* @private
|
|
*/
|
|
_drawDecoratorPath: function _drawDecoratorPath(linePosition) {
|
|
this._drawDecoratorPathType('head', linePosition);
|
|
|
|
this._drawDecoratorPathType('tail', linePosition);
|
|
},
|
|
|
|
/**
|
|
* Render Arrow Head
|
|
* @param {string} type - 'head' or 'tail'
|
|
* @param {Object} linePosition - line position
|
|
* @param {number} option.fromX - line start position x
|
|
* @param {number} option.fromY - line start position y
|
|
* @param {number} option.toX - line end position x
|
|
* @param {number} option.toY - line end position y
|
|
* @private
|
|
*/
|
|
_drawDecoratorPathType: function _drawDecoratorPathType(type, linePosition) {
|
|
switch (this.arrowType[type]) {
|
|
case 'triangle':
|
|
this._drawTrianglePath(type, linePosition);
|
|
|
|
break;
|
|
|
|
case 'chevron':
|
|
this._drawChevronPath(type, linePosition);
|
|
|
|
break;
|
|
|
|
default:
|
|
break;
|
|
}
|
|
},
|
|
|
|
/**
|
|
* Render Triangle Head
|
|
* @param {string} type - 'head' or 'tail'
|
|
* @param {Object} linePosition - line position
|
|
* @param {number} option.fromX - line start position x
|
|
* @param {number} option.fromY - line start position y
|
|
* @param {number} option.toX - line end position x
|
|
* @param {number} option.toY - line end position y
|
|
* @private
|
|
*/
|
|
_drawTrianglePath: function _drawTrianglePath(type, linePosition) {
|
|
var decorateSize = this.ctx.lineWidth * TRIANGLE_SIZE_RATIO;
|
|
|
|
this._drawChevronPath(type, linePosition, decorateSize);
|
|
|
|
this.ctx.closePath();
|
|
},
|
|
|
|
/**
|
|
* Render Chevron Head
|
|
* @param {string} type - 'head' or 'tail'
|
|
* @param {Object} linePosition - line position
|
|
* @param {number} option.fromX - line start position x
|
|
* @param {number} option.fromY - line start position y
|
|
* @param {number} option.toX - line end position x
|
|
* @param {number} option.toY - line end position y
|
|
* @param {number} decorateSize - decorate size
|
|
* @private
|
|
*/
|
|
_drawChevronPath: function _drawChevronPath(type, _ref2, decorateSize) {
|
|
var _this = this;
|
|
|
|
var fromX = _ref2.fromX,
|
|
fromY = _ref2.fromY,
|
|
toX = _ref2.toX,
|
|
toY = _ref2.toY;
|
|
var ctx = this.ctx;
|
|
|
|
if (!decorateSize) {
|
|
decorateSize = this.ctx.lineWidth * CHEVRON_SIZE_RATIO;
|
|
}
|
|
|
|
var _ref3 = type === 'head' ? [fromX, fromY] : [toX, toY],
|
|
_ref4 = _slicedToArray(_ref3, 2),
|
|
standardX = _ref4[0],
|
|
standardY = _ref4[1];
|
|
|
|
var _ref5 = type === 'head' ? [toX, toY] : [fromX, fromY],
|
|
_ref6 = _slicedToArray(_ref5, 2),
|
|
compareX = _ref6[0],
|
|
compareY = _ref6[1];
|
|
|
|
var angle = Math.atan2(compareY - standardY, compareX - standardX) * RADIAN_CONVERSION_VALUE / Math.PI;
|
|
|
|
var rotatedPosition = function rotatedPosition(changeAngle) {
|
|
return _this.getRotatePosition(decorateSize, changeAngle, {
|
|
x: standardX,
|
|
y: standardY
|
|
});
|
|
};
|
|
|
|
ctx.moveTo.apply(ctx, _toConsumableArray(rotatedPosition(angle + ARROW_ANGLE)));
|
|
ctx.lineTo(standardX, standardY);
|
|
ctx.lineTo.apply(ctx, _toConsumableArray(rotatedPosition(angle - ARROW_ANGLE)));
|
|
},
|
|
|
|
/**
|
|
* return position from change angle.
|
|
* @param {number} distance - change distance
|
|
* @param {number} angle - change angle
|
|
* @param {Object} referencePosition - reference position
|
|
* @returns {Array}
|
|
* @private
|
|
*/
|
|
getRotatePosition: function getRotatePosition(distance, angle, referencePosition) {
|
|
var radian = angle * Math.PI / RADIAN_CONVERSION_VALUE;
|
|
var x = referencePosition.x,
|
|
y = referencePosition.y;
|
|
return [distance * Math.cos(radian) + x, distance * Math.sin(radian) + y];
|
|
}
|
|
});
|
|
/* harmony default export */ var arrowLine = (ArrowLine);
|
|
;// CONCATENATED MODULE: ./src/js/component/line.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function line_createSuper(Derived) { var hasNativeReflectConstruct = line_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function line_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/**
|
|
* Line
|
|
* @class Line
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @ignore
|
|
*/
|
|
|
|
var Line = /*#__PURE__*/function (_Component) {
|
|
_inherits(Line, _Component);
|
|
|
|
var _super = line_createSuper(Line);
|
|
|
|
function Line(graphics) {
|
|
var _context, _context2, _context3;
|
|
|
|
var _this;
|
|
|
|
_classCallCheck(this, Line);
|
|
|
|
_this = _super.call(this, componentNames.LINE, graphics);
|
|
/**
|
|
* Brush width
|
|
* @type {number}
|
|
* @private
|
|
*/
|
|
|
|
_this._width = 12;
|
|
/**
|
|
* fabric.Color instance for brush color
|
|
* @type {fabric.Color}
|
|
* @private
|
|
*/
|
|
|
|
_this._oColor = new fabric.fabric.Color('rgba(0, 0, 0, 0.5)');
|
|
/**
|
|
* Listeners
|
|
* @type {object.<string, function>}
|
|
* @private
|
|
*/
|
|
|
|
_this._listeners = {
|
|
mousedown: bind_default()(_context = _this._onFabricMouseDown).call(_context, _assertThisInitialized(_this)),
|
|
mousemove: bind_default()(_context2 = _this._onFabricMouseMove).call(_context2, _assertThisInitialized(_this)),
|
|
mouseup: bind_default()(_context3 = _this._onFabricMouseUp).call(_context3, _assertThisInitialized(_this))
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Start drawing line mode
|
|
* @param {{width: ?number, color: ?string}} [setting] - Brush width & color
|
|
*/
|
|
|
|
|
|
_createClass(Line, [{
|
|
key: "setHeadOption",
|
|
value: function setHeadOption(setting) {
|
|
var _setting$arrowType = setting.arrowType,
|
|
arrowType = _setting$arrowType === void 0 ? {
|
|
head: null,
|
|
tail: null
|
|
} : _setting$arrowType;
|
|
this._arrowType = arrowType;
|
|
}
|
|
/**
|
|
* Start drawing line mode
|
|
* @param {{width: ?number, color: ?string}} [setting] - Brush width & color
|
|
*/
|
|
|
|
}, {
|
|
key: "start",
|
|
value: function start() {
|
|
var setting = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : {};
|
|
var canvas = this.getCanvas();
|
|
canvas.defaultCursor = 'crosshair';
|
|
canvas.selection = false;
|
|
this.setHeadOption(setting);
|
|
this.setBrush(setting);
|
|
canvas.forEachObject(function (obj) {
|
|
obj.set({
|
|
evented: false
|
|
});
|
|
});
|
|
canvas.on({
|
|
'mouse:down': this._listeners.mousedown
|
|
});
|
|
}
|
|
/**
|
|
* Set brush
|
|
* @param {{width: ?number, color: ?string}} [setting] - Brush width & color
|
|
*/
|
|
|
|
}, {
|
|
key: "setBrush",
|
|
value: function setBrush(setting) {
|
|
var brush = this.getCanvas().freeDrawingBrush;
|
|
setting = setting || {};
|
|
this._width = setting.width || this._width;
|
|
|
|
if (setting.color) {
|
|
this._oColor = new fabric.fabric.Color(setting.color);
|
|
}
|
|
|
|
brush.width = this._width;
|
|
brush.color = this._oColor.toRgba();
|
|
}
|
|
/**
|
|
* End drawing line mode
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
var canvas = this.getCanvas();
|
|
canvas.defaultCursor = 'default';
|
|
canvas.selection = true;
|
|
canvas.forEachObject(function (obj) {
|
|
obj.set({
|
|
evented: true
|
|
});
|
|
});
|
|
canvas.off('mouse:down', this._listeners.mousedown);
|
|
}
|
|
/**
|
|
* Mousedown event handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseDown",
|
|
value: function _onFabricMouseDown(fEvent) {
|
|
var canvas = this.getCanvas();
|
|
|
|
var _canvas$getPointer = canvas.getPointer(fEvent.e),
|
|
x = _canvas$getPointer.x,
|
|
y = _canvas$getPointer.y;
|
|
|
|
var points = [x, y, x, y];
|
|
this._line = new arrowLine(points, {
|
|
stroke: this._oColor.toRgba(),
|
|
strokeWidth: this._width,
|
|
arrowType: this._arrowType,
|
|
evented: false
|
|
});
|
|
|
|
this._line.set(fObjectOptions.SELECTION_STYLE);
|
|
|
|
canvas.add(this._line);
|
|
canvas.on({
|
|
'mouse:move': this._listeners.mousemove,
|
|
'mouse:up': this._listeners.mouseup
|
|
});
|
|
this.fire(eventNames.ADD_OBJECT, this._createLineEventObjectProperties());
|
|
}
|
|
/**
|
|
* Mousemove event handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseMove",
|
|
value: function _onFabricMouseMove(fEvent) {
|
|
var canvas = this.getCanvas();
|
|
var pointer = canvas.getPointer(fEvent.e);
|
|
|
|
this._line.set({
|
|
x2: pointer.x,
|
|
y2: pointer.y
|
|
});
|
|
|
|
this._line.setCoords();
|
|
|
|
canvas.renderAll();
|
|
}
|
|
/**
|
|
* Mouseup event handler in fabric canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseUp",
|
|
value: function _onFabricMouseUp() {
|
|
var canvas = this.getCanvas();
|
|
this.fire(eventNames.OBJECT_ADDED, this._createLineEventObjectProperties());
|
|
this._line = null;
|
|
canvas.off({
|
|
'mouse:move': this._listeners.mousemove,
|
|
'mouse:up': this._listeners.mouseup
|
|
});
|
|
}
|
|
/**
|
|
* create line event object properties
|
|
* @returns {Object} properties line object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_createLineEventObjectProperties",
|
|
value: function _createLineEventObjectProperties() {
|
|
var params = this.graphics.createObjectProperties(this._line);
|
|
var _this$_line = this._line,
|
|
x1 = _this$_line.x1,
|
|
x2 = _this$_line.x2,
|
|
y1 = _this$_line.y1,
|
|
y2 = _this$_line.y2;
|
|
return extend_default()({}, params, {
|
|
startPosition: {
|
|
x: x1,
|
|
y: y1
|
|
},
|
|
endPosition: {
|
|
x: x2,
|
|
y: y2
|
|
}
|
|
});
|
|
}
|
|
}]);
|
|
|
|
return Line;
|
|
}(component);
|
|
|
|
/* harmony default export */ var line = (Line);
|
|
;// CONCATENATED MODULE: ./src/js/component/text.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function component_text_createSuper(Derived) { var hasNativeReflectConstruct = component_text_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function component_text_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var defaultStyles = {
|
|
fill: '#000000',
|
|
left: 0,
|
|
top: 0
|
|
};
|
|
var resetStyles = {
|
|
fill: '#000000',
|
|
fontStyle: 'normal',
|
|
fontWeight: 'normal',
|
|
textAlign: 'tie-text-align-left',
|
|
underline: false
|
|
};
|
|
var DBCLICK_TIME = 500;
|
|
/**
|
|
* Text
|
|
* @class Text
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @ignore
|
|
*/
|
|
|
|
var text_Text = /*#__PURE__*/function (_Component) {
|
|
_inherits(Text, _Component);
|
|
|
|
var _super = component_text_createSuper(Text);
|
|
|
|
function Text(graphics) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
var _this;
|
|
|
|
_classCallCheck(this, Text);
|
|
|
|
_this = _super.call(this, componentNames.TEXT, graphics);
|
|
/**
|
|
* Default text style
|
|
* @type {Object}
|
|
*/
|
|
|
|
_this._defaultStyles = defaultStyles;
|
|
/**
|
|
* Selected state
|
|
* @type {boolean}
|
|
*/
|
|
|
|
_this._isSelected = false;
|
|
/**
|
|
* Selected text object
|
|
* @type {Object}
|
|
*/
|
|
|
|
_this._selectedObj = {};
|
|
/**
|
|
* Editing text object
|
|
* @type {Object}
|
|
*/
|
|
|
|
_this._editingObj = {};
|
|
/**
|
|
* Listeners for fabric event
|
|
* @type {Object}
|
|
*/
|
|
|
|
_this._listeners = {
|
|
mousedown: bind_default()(_context = _this._onFabricMouseDown).call(_context, _assertThisInitialized(_this)),
|
|
select: bind_default()(_context2 = _this._onFabricSelect).call(_context2, _assertThisInitialized(_this)),
|
|
selectClear: bind_default()(_context3 = _this._onFabricSelectClear).call(_context3, _assertThisInitialized(_this)),
|
|
scaling: bind_default()(_context4 = _this._onFabricScaling).call(_context4, _assertThisInitialized(_this)),
|
|
textChanged: bind_default()(_context5 = _this._onFabricTextChanged).call(_context5, _assertThisInitialized(_this))
|
|
};
|
|
/**
|
|
* Textarea element for editing
|
|
* @type {HTMLElement}
|
|
*/
|
|
|
|
_this._textarea = null;
|
|
/**
|
|
* Ratio of current canvas
|
|
* @type {number}
|
|
*/
|
|
|
|
_this._ratio = 1;
|
|
/**
|
|
* Last click time
|
|
* @type {Date}
|
|
*/
|
|
|
|
_this._lastClickTime = new Date().getTime();
|
|
/**
|
|
* Text object infos before editing
|
|
* @type {Object}
|
|
*/
|
|
|
|
_this._editingObjInfos = {};
|
|
/**
|
|
* Previous state of editing
|
|
* @type {boolean}
|
|
*/
|
|
|
|
_this.isPrevEditing = false;
|
|
return _this;
|
|
}
|
|
/**
|
|
* Start input text mode
|
|
*/
|
|
|
|
|
|
_createClass(Text, [{
|
|
key: "start",
|
|
value: function start() {
|
|
var _this2 = this;
|
|
|
|
var canvas = this.getCanvas();
|
|
canvas.selection = false;
|
|
canvas.defaultCursor = 'text';
|
|
canvas.on({
|
|
'mouse:down': this._listeners.mousedown,
|
|
'selection:created': this._listeners.select,
|
|
'selection:updated': this._listeners.select,
|
|
'before:selection:cleared': this._listeners.selectClear,
|
|
'object:scaling': this._listeners.scaling,
|
|
'text:changed': this._listeners.textChanged
|
|
});
|
|
canvas.forEachObject(function (obj) {
|
|
if (obj.type === 'i-text') {
|
|
_this2.adjustOriginPosition(obj, 'start');
|
|
}
|
|
});
|
|
this.setCanvasRatio();
|
|
}
|
|
/**
|
|
* End input text mode
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
var _this3 = this;
|
|
|
|
var canvas = this.getCanvas();
|
|
canvas.selection = true;
|
|
canvas.defaultCursor = 'default';
|
|
canvas.forEachObject(function (obj) {
|
|
if (obj.type === 'i-text') {
|
|
if (obj.text === '') {
|
|
canvas.remove(obj);
|
|
} else {
|
|
_this3.adjustOriginPosition(obj, 'end');
|
|
}
|
|
}
|
|
});
|
|
canvas.off({
|
|
'mouse:down': this._listeners.mousedown,
|
|
'selection:created': this._listeners.select,
|
|
'selection:updated': this._listeners.select,
|
|
'before:selection:cleared': this._listeners.selectClear,
|
|
'object:selected': this._listeners.select,
|
|
'object:scaling': this._listeners.scaling,
|
|
'text:changed': this._listeners.textChanged
|
|
});
|
|
}
|
|
/**
|
|
* Adjust the origin position
|
|
* @param {fabric.Object} text - text object
|
|
* @param {string} editStatus - 'start' or 'end'
|
|
*/
|
|
|
|
}, {
|
|
key: "adjustOriginPosition",
|
|
value: function adjustOriginPosition(text, editStatus) {
|
|
var originX = 'center',
|
|
originY = 'center';
|
|
|
|
if (editStatus === 'start') {
|
|
originX = 'left';
|
|
originY = 'top';
|
|
}
|
|
|
|
var _text$getPointByOrigi = text.getPointByOrigin(originX, originY),
|
|
left = _text$getPointByOrigi.x,
|
|
top = _text$getPointByOrigi.y;
|
|
|
|
text.set({
|
|
left: left,
|
|
top: top,
|
|
originX: originX,
|
|
originY: originY
|
|
});
|
|
text.setCoords();
|
|
}
|
|
/**
|
|
* Add new text on canvas image
|
|
* @param {string} text - Initial input text
|
|
* @param {Object} options - Options for generating text
|
|
* @param {Object} [options.styles] Initial styles
|
|
* @param {string} [options.styles.fill] Color
|
|
* @param {string} [options.styles.fontFamily] Font type for text
|
|
* @param {number} [options.styles.fontSize] Size
|
|
* @param {string} [options.styles.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [options.styles.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [options.styles.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [options.styles.textDecoration] Type of line (underline / line-through / overline)
|
|
* @param {{x: number, y: number}} [options.position] - Initial position
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "add",
|
|
value: function add(text, options) {
|
|
var _this4 = this;
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
var _context6;
|
|
|
|
var canvas = _this4.getCanvas();
|
|
|
|
var newText = null;
|
|
var selectionStyle = fObjectOptions.SELECTION_STYLE;
|
|
var styles = _this4._defaultStyles;
|
|
|
|
_this4._setInitPos(options.position);
|
|
|
|
if (options.styles) {
|
|
styles = extend_default()(styles, options.styles);
|
|
}
|
|
|
|
if (!isExisty_default()(options.autofocus)) {
|
|
options.autofocus = true;
|
|
}
|
|
|
|
newText = new fabric.fabric.IText(text, styles);
|
|
selectionStyle = extend_default()({}, selectionStyle, {
|
|
originX: 'left',
|
|
originY: 'top'
|
|
});
|
|
newText.set(selectionStyle);
|
|
newText.on({
|
|
mouseup: bind_default()(_context6 = _this4._onFabricMouseUp).call(_context6, _this4)
|
|
});
|
|
canvas.add(newText);
|
|
|
|
if (options.autofocus) {
|
|
newText.enterEditing();
|
|
newText.selectAll();
|
|
}
|
|
|
|
if (!canvas.getActiveObject()) {
|
|
canvas.setActiveObject(newText);
|
|
}
|
|
|
|
_this4.isPrevEditing = true;
|
|
resolve(_this4.graphics.createObjectProperties(newText));
|
|
});
|
|
}
|
|
/**
|
|
* Change text of activate object on canvas image
|
|
* @param {Object} activeObj - Current selected text object
|
|
* @param {string} text - Changed text
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "change",
|
|
value: function change(activeObj, text) {
|
|
var _this5 = this;
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
activeObj.set('text', text);
|
|
|
|
_this5.getCanvas().renderAll();
|
|
|
|
resolve();
|
|
});
|
|
}
|
|
/**
|
|
* Set style
|
|
* @param {Object} activeObj - Current selected text object
|
|
* @param {Object} styleObj - Initial styles
|
|
* @param {string} [styleObj.fill] Color
|
|
* @param {string} [styleObj.fontFamily] Font type for text
|
|
* @param {number} [styleObj.fontSize] Size
|
|
* @param {string} [styleObj.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [styleObj.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [styleObj.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [styleObj.textDecoration] Type of line (underline / line-through / overline)
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "setStyle",
|
|
value: function setStyle(activeObj, styleObj) {
|
|
var _this6 = this;
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
forEach_default()(styleObj, function (val, key) {
|
|
if (activeObj[key] === val && key !== 'fontSize') {
|
|
styleObj[key] = resetStyles[key] || '';
|
|
}
|
|
}, _this6);
|
|
|
|
if ('textDecoration' in styleObj) {
|
|
extend_default()(styleObj, _this6._getTextDecorationAdaptObject(styleObj.textDecoration));
|
|
}
|
|
|
|
activeObj.set(styleObj);
|
|
|
|
_this6.getCanvas().renderAll();
|
|
|
|
resolve();
|
|
});
|
|
}
|
|
/**
|
|
* Get the text
|
|
* @param {Object} activeObj - Current selected text object
|
|
* @returns {String} text
|
|
*/
|
|
|
|
}, {
|
|
key: "getText",
|
|
value: function getText(activeObj) {
|
|
return activeObj.text;
|
|
}
|
|
/**
|
|
* Set infos of the current selected object
|
|
* @param {fabric.Text} obj - Current selected text object
|
|
* @param {boolean} state - State of selecting
|
|
*/
|
|
|
|
}, {
|
|
key: "setSelectedInfo",
|
|
value: function setSelectedInfo(obj, state) {
|
|
this._selectedObj = obj;
|
|
this._isSelected = state;
|
|
}
|
|
/**
|
|
* Whether object is selected or not
|
|
* @returns {boolean} State of selecting
|
|
*/
|
|
|
|
}, {
|
|
key: "isSelected",
|
|
value: function isSelected() {
|
|
return this._isSelected;
|
|
}
|
|
/**
|
|
* Get current selected text object
|
|
* @returns {fabric.Text} Current selected text object
|
|
*/
|
|
|
|
}, {
|
|
key: "getSelectedObj",
|
|
value: function getSelectedObj() {
|
|
return this._selectedObj;
|
|
}
|
|
/**
|
|
* Set ratio value of canvas
|
|
*/
|
|
|
|
}, {
|
|
key: "setCanvasRatio",
|
|
value: function setCanvasRatio() {
|
|
var canvasElement = this.getCanvasElement();
|
|
|
|
var cssWidth = parse_int_default()(canvasElement.style.maxWidth, 10);
|
|
|
|
var originWidth = canvasElement.width;
|
|
this._ratio = originWidth / cssWidth;
|
|
}
|
|
/**
|
|
* Get ratio value of canvas
|
|
* @returns {number} Ratio value
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvasRatio",
|
|
value: function getCanvasRatio() {
|
|
return this._ratio;
|
|
}
|
|
/**
|
|
* Get text decoration adapt object
|
|
* @param {string} textDecoration - text decoration option string
|
|
* @returns {object} adapt object for override
|
|
*/
|
|
|
|
}, {
|
|
key: "_getTextDecorationAdaptObject",
|
|
value: function _getTextDecorationAdaptObject(textDecoration) {
|
|
return {
|
|
underline: textDecoration === 'underline',
|
|
linethrough: textDecoration === 'line-through',
|
|
overline: textDecoration === 'overline'
|
|
};
|
|
}
|
|
/**
|
|
* Set initial position on canvas image
|
|
* @param {{x: number, y: number}} [position] - Selected position
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setInitPos",
|
|
value: function _setInitPos(position) {
|
|
position = position || this.getCanvasImage().getCenterPoint();
|
|
this._defaultStyles.left = position.x;
|
|
this._defaultStyles.top = position.y;
|
|
}
|
|
/**
|
|
* Input event handler
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onInput",
|
|
value: function _onInput() {
|
|
var ratio = this.getCanvasRatio();
|
|
var obj = this._editingObj;
|
|
var textareaStyle = this._textarea.style;
|
|
textareaStyle.width = "".concat(Math.ceil(obj.width / ratio), "px");
|
|
textareaStyle.height = "".concat(Math.ceil(obj.height / ratio), "px");
|
|
}
|
|
/**
|
|
* Keydown event handler
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onKeyDown",
|
|
value: function _onKeyDown() {
|
|
var _this7 = this;
|
|
|
|
var ratio = this.getCanvasRatio();
|
|
var obj = this._editingObj;
|
|
var textareaStyle = this._textarea.style;
|
|
|
|
set_timeout_default()(function () {
|
|
obj.text(_this7._textarea.value);
|
|
textareaStyle.width = "".concat(Math.ceil(obj.width / ratio), "px");
|
|
textareaStyle.height = "".concat(Math.ceil(obj.height / ratio), "px");
|
|
}, 0);
|
|
}
|
|
/**
|
|
* Blur event handler
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onBlur",
|
|
value: function _onBlur() {
|
|
var ratio = this.getCanvasRatio();
|
|
var editingObj = this._editingObj;
|
|
var editingObjInfos = this._editingObjInfos;
|
|
var textContent = this._textarea.value;
|
|
var transWidth = editingObj.width / ratio - editingObjInfos.width / ratio;
|
|
var transHeight = editingObj.height / ratio - editingObjInfos.height / ratio;
|
|
|
|
if (ratio === 1) {
|
|
transWidth /= 2;
|
|
transHeight /= 2;
|
|
}
|
|
|
|
this._textarea.style.display = 'none';
|
|
editingObj.set({
|
|
left: editingObjInfos.left + transWidth,
|
|
top: editingObjInfos.top + transHeight
|
|
});
|
|
|
|
if (textContent.length) {
|
|
this.getCanvas().add(editingObj);
|
|
var params = {
|
|
id: stamp(editingObj),
|
|
type: editingObj.type,
|
|
text: textContent
|
|
};
|
|
this.fire(eventNames.TEXT_CHANGED, params);
|
|
}
|
|
}
|
|
/**
|
|
* Scroll event handler
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onScroll",
|
|
value: function _onScroll() {
|
|
this._textarea.scrollLeft = 0;
|
|
this._textarea.scrollTop = 0;
|
|
}
|
|
/**
|
|
* Fabric scaling event handler
|
|
* @param {fabric.Event} fEvent - Current scaling event on selected object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricScaling",
|
|
value: function _onFabricScaling(fEvent) {
|
|
var obj = fEvent.target;
|
|
obj.fontSize = obj.fontSize * obj.scaleY;
|
|
obj.scaleX = 1;
|
|
obj.scaleY = 1;
|
|
}
|
|
/**
|
|
* textChanged event handler
|
|
* @param {{target: fabric.Object}} props - changed text object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricTextChanged",
|
|
value: function _onFabricTextChanged(props) {
|
|
this.fire(eventNames.TEXT_CHANGED, props.target);
|
|
}
|
|
/**
|
|
* onSelectClear handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricSelectClear",
|
|
value: function _onFabricSelectClear(fEvent) {
|
|
var obj = this.getSelectedObj();
|
|
this.isPrevEditing = true;
|
|
this.setSelectedInfo(fEvent.target, false);
|
|
|
|
if (obj) {
|
|
// obj is empty object at initial time, will be set fabric object
|
|
if (obj.text === '') {
|
|
this.getCanvas().remove(obj);
|
|
}
|
|
}
|
|
}
|
|
/**
|
|
* onSelect handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricSelect",
|
|
value: function _onFabricSelect(fEvent) {
|
|
this.isPrevEditing = true;
|
|
this.setSelectedInfo(fEvent.target, true);
|
|
}
|
|
/**
|
|
* Fabric 'mousedown' event handler
|
|
* @param {fabric.Event} fEvent - Current mousedown event on selected object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseDown",
|
|
value: function _onFabricMouseDown(fEvent) {
|
|
var obj = fEvent.target;
|
|
|
|
if (obj && !obj.isType('text')) {
|
|
return;
|
|
}
|
|
|
|
if (this.isPrevEditing) {
|
|
this.isPrevEditing = false;
|
|
return;
|
|
}
|
|
|
|
this._fireAddText(fEvent);
|
|
}
|
|
/**
|
|
* Fire 'addText' event if object is not selected.
|
|
* @param {fabric.Event} fEvent - Current mousedown event on selected object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_fireAddText",
|
|
value: function _fireAddText(fEvent) {
|
|
var obj = fEvent.target;
|
|
var e = fEvent.e || {};
|
|
var originPointer = this.getCanvas().getPointer(e);
|
|
|
|
if (!obj) {
|
|
this.fire(eventNames.ADD_TEXT, {
|
|
originPosition: {
|
|
x: originPointer.x,
|
|
y: originPointer.y
|
|
},
|
|
clientPosition: {
|
|
x: e.clientX || 0,
|
|
y: e.clientY || 0
|
|
}
|
|
});
|
|
}
|
|
}
|
|
/**
|
|
* Fabric mouseup event handler
|
|
* @param {fabric.Event} fEvent - Current mousedown event on selected object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseUp",
|
|
value: function _onFabricMouseUp(fEvent) {
|
|
var target = fEvent.target;
|
|
var newClickTime = new Date().getTime();
|
|
|
|
if (this._isDoubleClick(newClickTime) && !target.isEditing) {
|
|
target.enterEditing();
|
|
}
|
|
|
|
if (target.isEditing) {
|
|
this.fire(eventNames.TEXT_EDITING); // fire editing text event
|
|
}
|
|
|
|
this._lastClickTime = newClickTime;
|
|
}
|
|
/**
|
|
* Get state of firing double click event
|
|
* @param {Date} newClickTime - Current clicked time
|
|
* @returns {boolean} Whether double clicked or not
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_isDoubleClick",
|
|
value: function _isDoubleClick(newClickTime) {
|
|
return newClickTime - this._lastClickTime < DBCLICK_TIME;
|
|
}
|
|
}]);
|
|
|
|
return Text;
|
|
}(component);
|
|
|
|
/* harmony default export */ var component_text = (text_Text);
|
|
;// CONCATENATED MODULE: ./src/js/component/icon.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function component_icon_createSuper(Derived) { var hasNativeReflectConstruct = component_icon_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function component_icon_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var pathMap = {
|
|
arrow: 'M 0 90 H 105 V 120 L 160 60 L 105 0 V 30 H 0 Z',
|
|
cancel: 'M 0 30 L 30 60 L 0 90 L 30 120 L 60 90 L 90 120 L 120 90 ' + 'L 90 60 L 120 30 L 90 0 L 60 30 L 30 0 Z'
|
|
};
|
|
/**
|
|
* Icon
|
|
* @class Icon
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @ignore
|
|
*/
|
|
|
|
var icon_Icon = /*#__PURE__*/function (_Component) {
|
|
_inherits(Icon, _Component);
|
|
|
|
var _super = component_icon_createSuper(Icon);
|
|
|
|
function Icon(graphics) {
|
|
var _context, _context2, _context3;
|
|
|
|
var _this;
|
|
|
|
_classCallCheck(this, Icon);
|
|
|
|
_this = _super.call(this, componentNames.ICON, graphics);
|
|
/**
|
|
* Default icon color
|
|
* @type {string}
|
|
*/
|
|
|
|
_this._oColor = '#000000';
|
|
/**
|
|
* Path value of each icon type
|
|
* @type {Object}
|
|
*/
|
|
|
|
_this._pathMap = pathMap;
|
|
/**
|
|
* Type of the drawing icon
|
|
* @type {string}
|
|
* @private
|
|
*/
|
|
|
|
_this._type = null;
|
|
/**
|
|
* Color of the drawing icon
|
|
* @type {string}
|
|
* @private
|
|
*/
|
|
|
|
_this._iconColor = null;
|
|
/**
|
|
* Event handler list
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._handlers = {
|
|
mousedown: bind_default()(_context = _this._onFabricMouseDown).call(_context, _assertThisInitialized(_this)),
|
|
mousemove: bind_default()(_context2 = _this._onFabricMouseMove).call(_context2, _assertThisInitialized(_this)),
|
|
mouseup: bind_default()(_context3 = _this._onFabricMouseUp).call(_context3, _assertThisInitialized(_this))
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Set states of the current drawing shape
|
|
* @ignore
|
|
* @param {string} type - Icon type ('arrow', 'cancel', custom icon name)
|
|
* @param {string} iconColor - Icon foreground color
|
|
*/
|
|
|
|
|
|
_createClass(Icon, [{
|
|
key: "setStates",
|
|
value: function setStates(type, iconColor) {
|
|
this._type = type;
|
|
this._iconColor = iconColor;
|
|
}
|
|
/**
|
|
* Start to draw the icon on canvas
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "start",
|
|
value: function start() {
|
|
var canvas = this.getCanvas();
|
|
canvas.selection = false;
|
|
canvas.on('mouse:down', this._handlers.mousedown);
|
|
}
|
|
/**
|
|
* End to draw the icon on canvas
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
var canvas = this.getCanvas();
|
|
canvas.selection = true;
|
|
canvas.off({
|
|
'mouse:down': this._handlers.mousedown
|
|
});
|
|
}
|
|
/**
|
|
* Add icon
|
|
* @param {string} type - Icon type
|
|
* @param {Object} options - Icon options
|
|
* @param {string} [options.fill] - Icon foreground color
|
|
* @param {string} [options.left] - Icon x position
|
|
* @param {string} [options.top] - Icon y position
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "add",
|
|
value: function add(type, options) {
|
|
var _this2 = this;
|
|
|
|
return new (promise_default())(function (resolve, reject) {
|
|
var canvas = _this2.getCanvas();
|
|
|
|
var path = _this2._pathMap[type];
|
|
var selectionStyle = fObjectOptions.SELECTION_STYLE;
|
|
var icon = path ? _this2._createIcon(path) : null;
|
|
_this2._icon = icon;
|
|
|
|
if (!icon) {
|
|
reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
icon.set(extend_default()({
|
|
type: 'icon',
|
|
fill: _this2._oColor
|
|
}, selectionStyle, options, _this2.graphics.controlStyle));
|
|
canvas.add(icon).setActiveObject(icon);
|
|
resolve(_this2.graphics.createObjectProperties(icon));
|
|
});
|
|
}
|
|
/**
|
|
* Register icon paths
|
|
* @param {{key: string, value: string}} pathInfos - Path infos
|
|
*/
|
|
|
|
}, {
|
|
key: "registerPaths",
|
|
value: function registerPaths(pathInfos) {
|
|
var _this3 = this;
|
|
|
|
forEach_default()(pathInfos, function (path, type) {
|
|
_this3._pathMap[type] = path;
|
|
}, this);
|
|
}
|
|
/**
|
|
* Set icon object color
|
|
* @param {string} color - Color to set
|
|
* @param {fabric.Path}[obj] - Current activated path object
|
|
*/
|
|
|
|
}, {
|
|
key: "setColor",
|
|
value: function setColor(color, obj) {
|
|
this._oColor = color;
|
|
|
|
if (obj && obj.get('type') === 'icon') {
|
|
obj.set({
|
|
fill: this._oColor
|
|
});
|
|
this.getCanvas().renderAll();
|
|
}
|
|
}
|
|
/**
|
|
* Get icon color
|
|
* @param {fabric.Path}[obj] - Current activated path object
|
|
* @returns {string} color
|
|
*/
|
|
|
|
}, {
|
|
key: "getColor",
|
|
value: function getColor(obj) {
|
|
return fill_default()(obj);
|
|
}
|
|
/**
|
|
* Create icon object
|
|
* @param {string} path - Path value to create icon
|
|
* @returns {fabric.Path} Path object
|
|
*/
|
|
|
|
}, {
|
|
key: "_createIcon",
|
|
value: function _createIcon(path) {
|
|
return new fabric.fabric.Path(path);
|
|
}
|
|
/**
|
|
* MouseDown event handler on canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseDown",
|
|
value: function _onFabricMouseDown(fEvent) {
|
|
var _this4 = this;
|
|
|
|
var canvas = this.getCanvas();
|
|
this._startPoint = canvas.getPointer(fEvent.e);
|
|
var _this$_startPoint = this._startPoint,
|
|
left = _this$_startPoint.x,
|
|
top = _this$_startPoint.y;
|
|
this.add(this._type, {
|
|
left: left,
|
|
top: top,
|
|
fill: this._iconColor
|
|
}).then(function () {
|
|
_this4.fire(eventNames.ADD_OBJECT, _this4.graphics.createObjectProperties(_this4._icon));
|
|
|
|
canvas.on('mouse:move', _this4._handlers.mousemove);
|
|
canvas.on('mouse:up', _this4._handlers.mouseup);
|
|
});
|
|
}
|
|
/**
|
|
* MouseMove event handler on canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseMove",
|
|
value: function _onFabricMouseMove(fEvent) {
|
|
var canvas = this.getCanvas();
|
|
|
|
if (!this._icon) {
|
|
return;
|
|
}
|
|
|
|
var moveOriginPointer = canvas.getPointer(fEvent.e);
|
|
var scaleX = (moveOriginPointer.x - this._startPoint.x) / this._icon.width;
|
|
var scaleY = (moveOriginPointer.y - this._startPoint.y) / this._icon.height;
|
|
|
|
this._icon.set({
|
|
scaleX: Math.abs(scaleX * 2),
|
|
scaleY: Math.abs(scaleY * 2)
|
|
});
|
|
|
|
this._icon.setCoords();
|
|
|
|
canvas.renderAll();
|
|
}
|
|
/**
|
|
* MouseUp event handler on canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseUp",
|
|
value: function _onFabricMouseUp() {
|
|
var canvas = this.getCanvas();
|
|
this.fire(eventNames.OBJECT_ADDED, this.graphics.createObjectProperties(this._icon));
|
|
this._icon = null;
|
|
canvas.off('mouse:down', this._handlers.mousedown);
|
|
canvas.off('mouse:move', this._handlers.mousemove);
|
|
canvas.off('mouse:up', this._handlers.mouseup);
|
|
}
|
|
}]);
|
|
|
|
return Icon;
|
|
}(component);
|
|
|
|
/* harmony default export */ var component_icon = (icon_Icon);
|
|
;// CONCATENATED MODULE: ./src/js/extension/mask.js
|
|
|
|
/**
|
|
* Mask object
|
|
* @class Mask
|
|
* @extends {fabric.Image.filters.BlendImage}
|
|
* @ignore
|
|
*/
|
|
|
|
var mask_Mask = fabric.fabric.util.createClass(fabric.fabric.Image.filters.BlendImage,
|
|
/** @lends Mask.prototype */
|
|
{
|
|
/**
|
|
* Apply filter to canvas element
|
|
* @param {Object} pipelineState - Canvas element to apply filter
|
|
* @override
|
|
*/
|
|
applyTo: function applyTo(pipelineState) {
|
|
if (!this.mask) {
|
|
return;
|
|
}
|
|
|
|
var canvas = pipelineState.canvasEl;
|
|
var width = canvas.width,
|
|
height = canvas.height;
|
|
|
|
var maskCanvasEl = this._createCanvasOfMask(width, height);
|
|
|
|
var ctx = canvas.getContext('2d');
|
|
var maskCtx = maskCanvasEl.getContext('2d');
|
|
var imageData = ctx.getImageData(0, 0, width, height);
|
|
|
|
this._drawMask(maskCtx, canvas, ctx);
|
|
|
|
this._mapData(maskCtx, imageData, width, height);
|
|
|
|
pipelineState.imageData = imageData;
|
|
},
|
|
|
|
/**
|
|
* Create canvas of mask image
|
|
* @param {number} width - Width of main canvas
|
|
* @param {number} height - Height of main canvas
|
|
* @returns {HTMLElement} Canvas element
|
|
* @private
|
|
*/
|
|
_createCanvasOfMask: function _createCanvasOfMask(width, height) {
|
|
var maskCanvasEl = fabric.fabric.util.createCanvasElement();
|
|
maskCanvasEl.width = width;
|
|
maskCanvasEl.height = height;
|
|
return maskCanvasEl;
|
|
},
|
|
|
|
/**
|
|
* Draw mask image on canvas element
|
|
* @param {Object} maskCtx - Context of mask canvas
|
|
* @private
|
|
*/
|
|
_drawMask: function _drawMask(maskCtx) {
|
|
var mask = this.mask;
|
|
var maskImg = mask.getElement();
|
|
var angle = mask.angle,
|
|
left = mask.left,
|
|
scaleX = mask.scaleX,
|
|
scaleY = mask.scaleY,
|
|
top = mask.top;
|
|
maskCtx.save();
|
|
maskCtx.translate(left, top);
|
|
maskCtx.rotate(angle * Math.PI / 180);
|
|
maskCtx.scale(scaleX, scaleY);
|
|
maskCtx.drawImage(maskImg, -maskImg.width / 2, -maskImg.height / 2);
|
|
maskCtx.restore();
|
|
},
|
|
|
|
/**
|
|
* Map mask image data to source image data
|
|
* @param {Object} maskCtx - Context of mask canvas
|
|
* @param {Object} imageData - Data of source image
|
|
* @param {number} width - Width of main canvas
|
|
* @param {number} height - Height of main canvas
|
|
* @private
|
|
*/
|
|
_mapData: function _mapData(maskCtx, imageData, width, height) {
|
|
var data = imageData.data,
|
|
imgHeight = imageData.height,
|
|
imgWidth = imageData.width;
|
|
var sourceData = data;
|
|
var len = imgWidth * imgHeight * 4;
|
|
var maskData = maskCtx.getImageData(0, 0, width, height).data;
|
|
|
|
for (var i = 0; i < len; i += 4) {
|
|
sourceData[i + 3] = maskData[i]; // adjust value of alpha data
|
|
}
|
|
}
|
|
});
|
|
/* harmony default export */ var extension_mask = (mask_Mask);
|
|
;// CONCATENATED MODULE: ./src/js/extension/sharpen.js
|
|
|
|
/**
|
|
* Sharpen object
|
|
* @class Sharpen
|
|
* @extends {fabric.Image.filters.Convolute}
|
|
* @ignore
|
|
*/
|
|
|
|
var Sharpen = fabric.fabric.util.createClass(fabric.fabric.Image.filters.Convolute,
|
|
/** @lends Convolute.prototype */
|
|
{
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Sharpen',
|
|
|
|
/**
|
|
* constructor
|
|
* @override
|
|
*/
|
|
initialize: function initialize() {
|
|
this.matrix = [0, -1, 0, -1, 5, -1, 0, -1, 0];
|
|
}
|
|
});
|
|
/* harmony default export */ var sharpen = (Sharpen);
|
|
;// CONCATENATED MODULE: ./src/js/extension/emboss.js
|
|
|
|
/**
|
|
* Emboss object
|
|
* @class Emboss
|
|
* @extends {fabric.Image.filters.Convolute}
|
|
* @ignore
|
|
*/
|
|
|
|
var Emboss = fabric.fabric.util.createClass(fabric.fabric.Image.filters.Convolute,
|
|
/** @lends Convolute.prototype */
|
|
{
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'Emboss',
|
|
|
|
/**
|
|
* constructor
|
|
* @override
|
|
*/
|
|
initialize: function initialize() {
|
|
this.matrix = [1, 1, 1, 1, 0.7, -1, -1, -1, -1];
|
|
}
|
|
});
|
|
/* harmony default export */ var emboss = (Emboss);
|
|
;// CONCATENATED MODULE: ./src/js/extension/colorFilter.js
|
|
|
|
/**
|
|
* ColorFilter object
|
|
* @class ColorFilter
|
|
* @extends {fabric.Image.filters.BaseFilter}
|
|
* @ignore
|
|
*/
|
|
|
|
var ColorFilter = fabric.fabric.util.createClass(fabric.fabric.Image.filters.BaseFilter,
|
|
/** @lends BaseFilter.prototype */
|
|
{
|
|
/**
|
|
* Filter type
|
|
* @param {String} type
|
|
* @default
|
|
*/
|
|
type: 'ColorFilter',
|
|
|
|
/**
|
|
* Constructor
|
|
* @member fabric.Image.filters.ColorFilter.prototype
|
|
* @param {Object} [options] Options object
|
|
* @param {Number} [options.color='#FFFFFF'] Value of color (0...255)
|
|
* @param {Number} [options.threshold=45] Value of threshold (0...255)
|
|
* @override
|
|
*/
|
|
initialize: function initialize(options) {
|
|
if (!options) {
|
|
options = {};
|
|
}
|
|
|
|
this.color = options.color || '#FFFFFF';
|
|
this.threshold = options.threshold || 45;
|
|
this.x = options.x || null;
|
|
this.y = options.y || null;
|
|
},
|
|
|
|
/**
|
|
* Applies filter to canvas element
|
|
* @param {Object} canvas Canvas object passed by fabric
|
|
*/
|
|
// eslint-disable-next-line complexity
|
|
applyTo: function applyTo(canvas) {
|
|
var canvasEl = canvas.canvasEl;
|
|
var context = canvasEl.getContext('2d');
|
|
var imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height);
|
|
var data = imageData.data;
|
|
var threshold = this.threshold;
|
|
var filterColor = fabric.fabric.Color.sourceFromHex(this.color);
|
|
var i, len;
|
|
|
|
if (this.x && this.y) {
|
|
filterColor = this._getColor(imageData, this.x, this.y);
|
|
}
|
|
|
|
for (i = 0, len = data.length; i < len; i += 4) {
|
|
if (this._isOutsideThreshold(data[i], filterColor[0], threshold) || this._isOutsideThreshold(data[i + 1], filterColor[1], threshold) || this._isOutsideThreshold(data[i + 2], filterColor[2], threshold)) {
|
|
continue;
|
|
}
|
|
|
|
data[i] = data[i + 1] = data[i + 2] = data[i + 3] = 0;
|
|
}
|
|
|
|
context.putImageData(imageData, 0, 0);
|
|
},
|
|
|
|
/**
|
|
* Check color if it is within threshold
|
|
* @param {Number} color1 source color
|
|
* @param {Number} color2 filtering color
|
|
* @param {Number} threshold threshold
|
|
* @returns {boolean} true if within threshold or false
|
|
*/
|
|
_isOutsideThreshold: function _isOutsideThreshold(color1, color2, threshold) {
|
|
var diff = color1 - color2;
|
|
return Math.abs(diff) > threshold;
|
|
},
|
|
|
|
/**
|
|
* Get color at (x, y)
|
|
* @param {Object} imageData of canvas
|
|
* @param {Number} x left position
|
|
* @param {Number} y top position
|
|
* @returns {Array} color array
|
|
*/
|
|
_getColor: function _getColor(imageData, x, y) {
|
|
var color = [0, 0, 0, 0];
|
|
var data = imageData.data,
|
|
width = imageData.width;
|
|
var bytes = 4;
|
|
var position = (width * y + x) * bytes;
|
|
color[0] = data[position];
|
|
color[1] = data[position + 1];
|
|
color[2] = data[position + 2];
|
|
color[3] = data[position + 3];
|
|
return color;
|
|
}
|
|
});
|
|
/* harmony default export */ var colorFilter = (ColorFilter);
|
|
;// CONCATENATED MODULE: ./src/js/component/filter.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function component_filter_createSuper(Derived) { var hasNativeReflectConstruct = component_filter_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function component_filter_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var filters = fabric.fabric.Image.filters;
|
|
filters.Mask = extension_mask;
|
|
filters.Sharpen = sharpen;
|
|
filters.Emboss = emboss;
|
|
filters.ColorFilter = colorFilter;
|
|
/**
|
|
* Filter
|
|
* @class Filter
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @ignore
|
|
*/
|
|
|
|
var filter_Filter = /*#__PURE__*/function (_Component) {
|
|
_inherits(Filter, _Component);
|
|
|
|
var _super = component_filter_createSuper(Filter);
|
|
|
|
function Filter(graphics) {
|
|
_classCallCheck(this, Filter);
|
|
|
|
return _super.call(this, componentNames.FILTER, graphics);
|
|
}
|
|
/**
|
|
* Add filter to source image (a specific filter is added on fabric.js)
|
|
* @param {string} type - Filter type
|
|
* @param {Object} [options] - Options of filter
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
|
|
_createClass(Filter, [{
|
|
key: "add",
|
|
value: function add(type, options) {
|
|
var _this = this;
|
|
|
|
return new (promise_default())(function (resolve, reject) {
|
|
var sourceImg = _this._getSourceImage();
|
|
|
|
var canvas = _this.getCanvas();
|
|
|
|
var imgFilter = _this._getFilter(sourceImg, type);
|
|
|
|
if (!imgFilter) {
|
|
imgFilter = _this._createFilter(sourceImg, type, options);
|
|
}
|
|
|
|
if (!imgFilter) {
|
|
reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
_this._changeFilterValues(imgFilter, options);
|
|
|
|
_this._apply(sourceImg, function () {
|
|
canvas.renderAll();
|
|
resolve({
|
|
type: type,
|
|
action: 'add',
|
|
options: options
|
|
});
|
|
});
|
|
});
|
|
}
|
|
/**
|
|
* Remove filter to source image
|
|
* @param {string} type - Filter type
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "remove",
|
|
value: function remove(type) {
|
|
var _this2 = this;
|
|
|
|
return new (promise_default())(function (resolve, reject) {
|
|
var sourceImg = _this2._getSourceImage();
|
|
|
|
var canvas = _this2.getCanvas();
|
|
|
|
var options = _this2.getOptions(type);
|
|
|
|
if (!sourceImg.filters.length) {
|
|
reject(rejectMessages.unsupportedOperation);
|
|
}
|
|
|
|
_this2._removeFilter(sourceImg, type);
|
|
|
|
_this2._apply(sourceImg, function () {
|
|
canvas.renderAll();
|
|
resolve({
|
|
type: type,
|
|
action: 'remove',
|
|
options: options
|
|
});
|
|
});
|
|
});
|
|
}
|
|
/**
|
|
* Whether this has the filter or not
|
|
* @param {string} type - Filter type
|
|
* @returns {boolean} true if it has the filter
|
|
*/
|
|
|
|
}, {
|
|
key: "hasFilter",
|
|
value: function hasFilter(type) {
|
|
return !!this._getFilter(this._getSourceImage(), type);
|
|
}
|
|
/**
|
|
* Get a filter options
|
|
* @param {string} type - Filter type
|
|
* @returns {Object} filter options or null if there is no that filter
|
|
*/
|
|
|
|
}, {
|
|
key: "getOptions",
|
|
value: function getOptions(type) {
|
|
var sourceImg = this._getSourceImage();
|
|
|
|
var imgFilter = this._getFilter(sourceImg, type);
|
|
|
|
if (!imgFilter) {
|
|
return null;
|
|
}
|
|
|
|
return extend_default()({}, imgFilter.options);
|
|
}
|
|
/**
|
|
* Change filter values
|
|
* @param {Object} imgFilter object of filter
|
|
* @param {Object} options object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeFilterValues",
|
|
value: function _changeFilterValues(imgFilter, options) {
|
|
forEach_default()(options, function (value, key) {
|
|
if (!isUndefined_default()(imgFilter[key])) {
|
|
imgFilter[key] = value;
|
|
}
|
|
});
|
|
forEach_default()(imgFilter.options, function (value, key) {
|
|
if (!isUndefined_default()(options[key])) {
|
|
imgFilter.options[key] = options[key];
|
|
}
|
|
});
|
|
}
|
|
/**
|
|
* Apply filter
|
|
* @param {fabric.Image} sourceImg - Source image to apply filter
|
|
* @param {function} callback - Executed function after applying filter
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_apply",
|
|
value: function _apply(sourceImg, callback) {
|
|
sourceImg.filters.push();
|
|
var result = sourceImg.applyFilters();
|
|
|
|
if (result) {
|
|
callback();
|
|
}
|
|
}
|
|
/**
|
|
* Get source image on canvas
|
|
* @returns {fabric.Image} Current source image on canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getSourceImage",
|
|
value: function _getSourceImage() {
|
|
return this.getCanvasImage();
|
|
}
|
|
/**
|
|
* Create filter instance
|
|
* @param {fabric.Image} sourceImg - Source image to apply filter
|
|
* @param {string} type - Filter type
|
|
* @param {Object} [options] - Options of filter
|
|
* @returns {Object} Fabric object of filter
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_createFilter",
|
|
value: function _createFilter(sourceImg, type, options) {
|
|
var filterObj; // capitalize first letter for matching with fabric image filter name
|
|
|
|
var fabricType = this._getFabricFilterType(type);
|
|
|
|
var ImageFilter = fabric.fabric.Image.filters[fabricType];
|
|
|
|
if (ImageFilter) {
|
|
filterObj = new ImageFilter(options);
|
|
filterObj.options = options;
|
|
sourceImg.filters.push(filterObj);
|
|
}
|
|
|
|
return filterObj;
|
|
}
|
|
/**
|
|
* Get applied filter instance
|
|
* @param {fabric.Image} sourceImg - Source image to apply filter
|
|
* @param {string} type - Filter type
|
|
* @returns {Object} Fabric object of filter
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getFilter",
|
|
value: function _getFilter(sourceImg, type) {
|
|
var imgFilter = null;
|
|
|
|
if (sourceImg) {
|
|
var fabricType = this._getFabricFilterType(type);
|
|
|
|
var length = sourceImg.filters.length;
|
|
var item, i;
|
|
|
|
for (i = 0; i < length; i += 1) {
|
|
item = sourceImg.filters[i];
|
|
|
|
if (item.type === fabricType) {
|
|
imgFilter = item;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
return imgFilter;
|
|
}
|
|
/**
|
|
* Remove applied filter instance
|
|
* @param {fabric.Image} sourceImg - Source image to apply filter
|
|
* @param {string} type - Filter type
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeFilter",
|
|
value: function _removeFilter(sourceImg, type) {
|
|
var _context;
|
|
|
|
var fabricType = this._getFabricFilterType(type);
|
|
|
|
sourceImg.filters = filter_default()(_context = sourceImg.filters).call(_context, function (value) {
|
|
return value.type !== fabricType;
|
|
});
|
|
}
|
|
/**
|
|
* Change filter class name to fabric's, especially capitalizing first letter
|
|
* @param {string} type - Filter type
|
|
* @example
|
|
* 'grayscale' -> 'Grayscale'
|
|
* @returns {string} Fabric filter class name
|
|
*/
|
|
|
|
}, {
|
|
key: "_getFabricFilterType",
|
|
value: function _getFabricFilterType(type) {
|
|
return type.charAt(0).toUpperCase() + slice_default()(type).call(type, 1);
|
|
}
|
|
}]);
|
|
|
|
return Filter;
|
|
}(component);
|
|
|
|
/* harmony default export */ var component_filter = (filter_Filter);
|
|
// EXTERNAL MODULE: ./src/js/helper/shapeResizeHelper.js
|
|
var shapeResizeHelper = __webpack_require__(1801);
|
|
var shapeResizeHelper_default = /*#__PURE__*/__webpack_require__.n(shapeResizeHelper);
|
|
;// CONCATENATED MODULE: ./src/js/helper/shapeFilterFillHelper.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var FILTER_OPTION_MAP = {
|
|
pixelate: 'blocksize',
|
|
blur: 'blur'
|
|
};
|
|
var POSITION_DIMENSION_MAP = {
|
|
x: 'width',
|
|
y: 'height'
|
|
};
|
|
var FILTER_NAME_VALUE_MAP = flipObject(FILTER_OPTION_MAP);
|
|
/**
|
|
* Cached canvas image element for fill image
|
|
* @type {boolean}
|
|
* @private
|
|
*/
|
|
|
|
var cachedCanvasImageElement = null;
|
|
/**
|
|
* Get background image of fill
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @returns {fabric.Image}
|
|
* @private
|
|
*/
|
|
|
|
function getFillImageFromShape(shapeObj) {
|
|
var _getCustomProperty = getCustomProperty(shapeObj, 'patternSourceCanvas'),
|
|
patternSourceCanvas = _getCustomProperty.patternSourceCanvas;
|
|
|
|
var _patternSourceCanvas$ = patternSourceCanvas.getObjects(),
|
|
_patternSourceCanvas$2 = _slicedToArray(_patternSourceCanvas$, 1),
|
|
fillImage = _patternSourceCanvas$2[0];
|
|
|
|
return fillImage;
|
|
}
|
|
/**
|
|
* Reset the image position in the filter type fill area.
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @private
|
|
*/
|
|
|
|
function rePositionFilterTypeFillImage(shapeObj) {
|
|
var angle = shapeObj.angle,
|
|
flipX = shapeObj.flipX,
|
|
flipY = shapeObj.flipY;
|
|
var fillImage = getFillImageFromShape(shapeObj);
|
|
var rotatedShapeCornerDimension = getRotatedDimension(shapeObj);
|
|
var right = rotatedShapeCornerDimension.right,
|
|
bottom = rotatedShapeCornerDimension.bottom;
|
|
var width = rotatedShapeCornerDimension.width,
|
|
height = rotatedShapeCornerDimension.height;
|
|
var diffLeft = (width - shapeObj.width) / 2;
|
|
var diffTop = (height - shapeObj.height) / 2;
|
|
var cropX = shapeObj.left - shapeObj.width / 2 - diffLeft;
|
|
var cropY = shapeObj.top - shapeObj.height / 2 - diffTop;
|
|
var left = width / 2 - diffLeft;
|
|
var top = height / 2 - diffTop;
|
|
var fillImageMaxSize = Math.max(width, height) + Math.max(diffLeft, diffTop);
|
|
|
|
var _calculateFillImageDi = calculateFillImageDimensionOutsideCanvas({
|
|
shapeObj: shapeObj,
|
|
left: left,
|
|
top: top,
|
|
width: width,
|
|
height: height,
|
|
cropX: cropX,
|
|
cropY: cropY,
|
|
flipX: flipX,
|
|
flipY: flipY,
|
|
right: right,
|
|
bottom: bottom
|
|
});
|
|
|
|
var _calculateFillImageDi2 = _slicedToArray(_calculateFillImageDi, 4);
|
|
|
|
left = _calculateFillImageDi2[0];
|
|
top = _calculateFillImageDi2[1];
|
|
width = _calculateFillImageDi2[2];
|
|
height = _calculateFillImageDi2[3];
|
|
fillImage.set({
|
|
angle: flipX === flipY ? -angle : angle,
|
|
left: left,
|
|
top: top,
|
|
width: width,
|
|
height: height,
|
|
cropX: cropX,
|
|
cropY: cropY,
|
|
flipX: flipX,
|
|
flipY: flipY
|
|
});
|
|
setCustomProperty(fillImage, {
|
|
fillImageMaxSize: fillImageMaxSize
|
|
});
|
|
}
|
|
/**
|
|
* Make filter option from fabric image
|
|
* @param {fabric.Image} imageObject - fabric image object
|
|
* @returns {object}
|
|
*/
|
|
|
|
function makeFilterOptionFromFabricImage(imageObject) {
|
|
var _context;
|
|
|
|
return map_default()(_context = imageObject.filters).call(_context, function (filter) {
|
|
var _Object$keys = keys_default()(filter),
|
|
_Object$keys2 = _slicedToArray(_Object$keys, 1),
|
|
key = _Object$keys2[0];
|
|
|
|
return _defineProperty({}, FILTER_NAME_VALUE_MAP[key], filter[key]);
|
|
});
|
|
}
|
|
/**
|
|
* Calculate fill image position and size for out of Canvas
|
|
* @param {Object} options - options for position dimension calculate
|
|
* @param {fabric.Object} shapeObj - shape object
|
|
* @param {number} left - original left position
|
|
* @param {number} top - original top position
|
|
* @param {number} width - image width
|
|
* @param {number} height - image height
|
|
* @param {number} cropX - image cropX
|
|
* @param {number} cropY - image cropY
|
|
* @param {boolean} flipX - shape flipX
|
|
* @param {boolean} flipY - shape flipY
|
|
* @returns {Object}
|
|
*/
|
|
|
|
function calculateFillImageDimensionOutsideCanvas(_ref2) {
|
|
var shapeObj = _ref2.shapeObj,
|
|
left = _ref2.left,
|
|
top = _ref2.top,
|
|
width = _ref2.width,
|
|
height = _ref2.height,
|
|
cropX = _ref2.cropX,
|
|
cropY = _ref2.cropY,
|
|
flipX = _ref2.flipX,
|
|
flipY = _ref2.flipY,
|
|
right = _ref2.right,
|
|
bottom = _ref2.bottom;
|
|
|
|
var overflowAreaPositionFixer = function overflowAreaPositionFixer(type, outDistance, imageLeft, imageTop) {
|
|
return calculateDistanceOverflowPart({
|
|
type: type,
|
|
outDistance: outDistance,
|
|
shapeObj: shapeObj,
|
|
flipX: flipX,
|
|
flipY: flipY,
|
|
left: imageLeft,
|
|
top: imageTop
|
|
});
|
|
};
|
|
|
|
var originalWidth = width,
|
|
originalHeight = height;
|
|
|
|
var _calculateDimensionLe = calculateDimensionLeftTopEdge(overflowAreaPositionFixer, {
|
|
left: left,
|
|
top: top,
|
|
width: width,
|
|
height: height,
|
|
cropX: cropX,
|
|
cropY: cropY
|
|
});
|
|
|
|
var _calculateDimensionLe2 = _slicedToArray(_calculateDimensionLe, 4);
|
|
|
|
left = _calculateDimensionLe2[0];
|
|
top = _calculateDimensionLe2[1];
|
|
width = _calculateDimensionLe2[2];
|
|
height = _calculateDimensionLe2[3];
|
|
|
|
var _calculateDimensionRi = calculateDimensionRightBottomEdge(overflowAreaPositionFixer, {
|
|
left: left,
|
|
top: top,
|
|
insideCanvasRealImageWidth: width,
|
|
insideCanvasRealImageHeight: height,
|
|
right: right,
|
|
bottom: bottom,
|
|
cropX: cropX,
|
|
cropY: cropY,
|
|
originalWidth: originalWidth,
|
|
originalHeight: originalHeight
|
|
});
|
|
|
|
var _calculateDimensionRi2 = _slicedToArray(_calculateDimensionRi, 4);
|
|
|
|
left = _calculateDimensionRi2[0];
|
|
top = _calculateDimensionRi2[1];
|
|
width = _calculateDimensionRi2[2];
|
|
height = _calculateDimensionRi2[3];
|
|
return [left, top, width, height];
|
|
}
|
|
/**
|
|
* Calculate fill image position and size for for right bottom edge
|
|
* @param {Function} overflowAreaPositionFixer - position fixer
|
|
* @param {Object} options - options for position dimension calculate
|
|
* @param {fabric.Object} shapeObj - shape object
|
|
* @param {number} left - original left position
|
|
* @param {number} top - original top position
|
|
* @param {number} width - image width
|
|
* @param {number} height - image height
|
|
* @param {number} right - image right
|
|
* @param {number} bottom - image bottom
|
|
* @param {number} cropX - image cropX
|
|
* @param {number} cropY - image cropY
|
|
* @param {boolean} originalWidth - image original width
|
|
* @param {boolean} originalHeight - image original height
|
|
* @returns {Object}
|
|
*/
|
|
|
|
|
|
function calculateDimensionRightBottomEdge(overflowAreaPositionFixer, _ref3) {
|
|
var left = _ref3.left,
|
|
top = _ref3.top,
|
|
insideCanvasRealImageWidth = _ref3.insideCanvasRealImageWidth,
|
|
insideCanvasRealImageHeight = _ref3.insideCanvasRealImageHeight,
|
|
right = _ref3.right,
|
|
bottom = _ref3.bottom,
|
|
cropX = _ref3.cropX,
|
|
cropY = _ref3.cropY,
|
|
originalWidth = _ref3.originalWidth,
|
|
originalHeight = _ref3.originalHeight;
|
|
var width = insideCanvasRealImageWidth,
|
|
height = insideCanvasRealImageHeight;
|
|
var _cachedCanvasImageEle = cachedCanvasImageElement,
|
|
canvasWidth = _cachedCanvasImageEle.width,
|
|
canvasHeight = _cachedCanvasImageEle.height;
|
|
|
|
if (right > canvasWidth && cropX > 0) {
|
|
width = originalWidth - Math.abs(right - canvasWidth);
|
|
}
|
|
|
|
if (bottom > canvasHeight && cropY > 0) {
|
|
height = originalHeight - Math.abs(bottom - canvasHeight);
|
|
}
|
|
|
|
var diff = {
|
|
x: (insideCanvasRealImageWidth - width) / 2,
|
|
y: (insideCanvasRealImageHeight - height) / 2
|
|
};
|
|
forEach_default()(['x', 'y'], function (type) {
|
|
var cropDistance2 = diff[type];
|
|
|
|
if (cropDistance2 > 0) {
|
|
var _overflowAreaPosition = overflowAreaPositionFixer(type, cropDistance2, left, top);
|
|
|
|
var _overflowAreaPosition2 = _slicedToArray(_overflowAreaPosition, 2);
|
|
|
|
left = _overflowAreaPosition2[0];
|
|
top = _overflowAreaPosition2[1];
|
|
}
|
|
});
|
|
return [left, top, width, height];
|
|
}
|
|
/**
|
|
* Calculate fill image position and size for for left top
|
|
* @param {Function} overflowAreaPositionFixer - position fixer
|
|
* @param {Object} options - options for position dimension calculate
|
|
* @param {fabric.Object} shapeObj - shape object
|
|
* @param {number} left - original left position
|
|
* @param {number} top - original top position
|
|
* @param {number} width - image width
|
|
* @param {number} height - image height
|
|
* @param {number} cropX - image cropX
|
|
* @param {number} cropY - image cropY
|
|
* @returns {Object}
|
|
*/
|
|
|
|
|
|
function calculateDimensionLeftTopEdge(overflowAreaPositionFixer, _ref4) {
|
|
var left = _ref4.left,
|
|
top = _ref4.top,
|
|
width = _ref4.width,
|
|
height = _ref4.height,
|
|
cropX = _ref4.cropX,
|
|
cropY = _ref4.cropY;
|
|
var dimension = {
|
|
width: width,
|
|
height: height
|
|
};
|
|
forEach_default()(['x', 'y'], function (type) {
|
|
var cropDistance = type === 'x' ? cropX : cropY;
|
|
var compareSize = dimension[POSITION_DIMENSION_MAP[type]];
|
|
var standardSize = cachedCanvasImageElement[POSITION_DIMENSION_MAP[type]];
|
|
|
|
if (compareSize > standardSize) {
|
|
var outDistance = (compareSize - standardSize) / 2;
|
|
dimension[POSITION_DIMENSION_MAP[type]] = standardSize;
|
|
|
|
var _overflowAreaPosition3 = overflowAreaPositionFixer(type, outDistance, left, top);
|
|
|
|
var _overflowAreaPosition4 = _slicedToArray(_overflowAreaPosition3, 2);
|
|
|
|
left = _overflowAreaPosition4[0];
|
|
top = _overflowAreaPosition4[1];
|
|
}
|
|
|
|
if (cropDistance < 0) {
|
|
var _overflowAreaPosition5 = overflowAreaPositionFixer(type, cropDistance, left, top);
|
|
|
|
var _overflowAreaPosition6 = _slicedToArray(_overflowAreaPosition5, 2);
|
|
|
|
left = _overflowAreaPosition6[0];
|
|
top = _overflowAreaPosition6[1];
|
|
}
|
|
});
|
|
return [left, top, dimension.width, dimension.height];
|
|
}
|
|
/**
|
|
* Make fill property of dynamic pattern type
|
|
* @param {fabric.Image} canvasImage - canvas background image
|
|
* @param {Array} filterOption - filter option
|
|
* @param {fabric.StaticCanvas} patternSourceCanvas - fabric static canvas
|
|
* @returns {Object}
|
|
*/
|
|
|
|
|
|
function makeFillPatternForFilter(canvasImage, filterOption, patternSourceCanvas) {
|
|
var copiedCanvasElement = getCachedCanvasImageElement(canvasImage);
|
|
var fillImage = makeFillImage(copiedCanvasElement, canvasImage.angle, filterOption);
|
|
patternSourceCanvas.add(fillImage);
|
|
var fabricProperty = {
|
|
fill: new fabric.fabric.Pattern({
|
|
source: patternSourceCanvas.getElement(),
|
|
repeat: 'no-repeat'
|
|
})
|
|
};
|
|
setCustomProperty(fabricProperty, {
|
|
patternSourceCanvas: patternSourceCanvas
|
|
});
|
|
return fabricProperty;
|
|
}
|
|
/**
|
|
* Reset fill pattern canvas
|
|
* @param {fabric.StaticCanvas} patternSourceCanvas - fabric static canvas
|
|
*/
|
|
|
|
function resetFillPatternCanvas(patternSourceCanvas) {
|
|
var _patternSourceCanvas$3 = patternSourceCanvas.getObjects(),
|
|
_patternSourceCanvas$4 = _slicedToArray(_patternSourceCanvas$3, 1),
|
|
innerImage = _patternSourceCanvas$4[0];
|
|
|
|
var _getCustomProperty2 = getCustomProperty(innerImage, 'fillImageMaxSize'),
|
|
fillImageMaxSize = _getCustomProperty2.fillImageMaxSize;
|
|
|
|
fillImageMaxSize = Math.max(1, fillImageMaxSize);
|
|
patternSourceCanvas.setDimensions({
|
|
width: fillImageMaxSize,
|
|
height: fillImageMaxSize
|
|
});
|
|
patternSourceCanvas.renderAll();
|
|
}
|
|
/**
|
|
* Remake filter pattern image source
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @param {fabric.Image} canvasImage - canvas background image
|
|
*/
|
|
|
|
function reMakePatternImageSource(shapeObj, canvasImage) {
|
|
var _getCustomProperty3 = getCustomProperty(shapeObj, 'patternSourceCanvas'),
|
|
patternSourceCanvas = _getCustomProperty3.patternSourceCanvas;
|
|
|
|
var _patternSourceCanvas$5 = patternSourceCanvas.getObjects(),
|
|
_patternSourceCanvas$6 = _slicedToArray(_patternSourceCanvas$5, 1),
|
|
fillImage = _patternSourceCanvas$6[0];
|
|
|
|
var filterOption = makeFilterOptionFromFabricImage(fillImage);
|
|
patternSourceCanvas.remove(fillImage);
|
|
var copiedCanvasElement = getCachedCanvasImageElement(canvasImage, true);
|
|
var newFillImage = makeFillImage(copiedCanvasElement, canvasImage.angle, filterOption);
|
|
patternSourceCanvas.add(newFillImage);
|
|
}
|
|
/**
|
|
* Calculate a point line outside the canvas.
|
|
* @param {fabric.Image} canvasImage - canvas background image
|
|
* @param {boolean} reset - default is false
|
|
* @returns {HTMLImageElement}
|
|
*/
|
|
|
|
function getCachedCanvasImageElement(canvasImage) {
|
|
var reset = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false;
|
|
|
|
if (!cachedCanvasImageElement || reset) {
|
|
cachedCanvasImageElement = canvasImage.toCanvasElement();
|
|
}
|
|
|
|
return cachedCanvasImageElement;
|
|
}
|
|
/**
|
|
* Calculate fill image position for out of Canvas
|
|
* @param {string} type - 'x' or 'y'
|
|
* @param {fabric.Object} shapeObj - shape object
|
|
* @param {number} outDistance - distance away
|
|
* @param {number} left - original left position
|
|
* @param {number} top - original top position
|
|
* @returns {Array}
|
|
*/
|
|
|
|
function calculateDistanceOverflowPart(_ref5) {
|
|
var type = _ref5.type,
|
|
shapeObj = _ref5.shapeObj,
|
|
outDistance = _ref5.outDistance,
|
|
left = _ref5.left,
|
|
top = _ref5.top,
|
|
flipX = _ref5.flipX,
|
|
flipY = _ref5.flipY;
|
|
var shapePointNavigation = getShapeEdgePoint(shapeObj);
|
|
var shapeNeighborPointNavigation = [[1, 2], [0, 3], [0, 3], [1, 2]];
|
|
var linePointsOutsideCanvas = calculateLinePointsOutsideCanvas(type, shapePointNavigation, shapeNeighborPointNavigation);
|
|
var reatAngles = calculateLineAngleOfOutsideCanvas(type, shapePointNavigation, linePointsOutsideCanvas);
|
|
var startPointIndex = linePointsOutsideCanvas.startPointIndex;
|
|
var diffPosition = getReversePositionForFlip({
|
|
outDistance: outDistance,
|
|
startPointIndex: startPointIndex,
|
|
flipX: flipX,
|
|
flipY: flipY,
|
|
reatAngles: reatAngles
|
|
});
|
|
return [left + diffPosition.left, top + diffPosition.top];
|
|
}
|
|
/**
|
|
* Calculate fill image position for out of Canvas
|
|
* @param {number} outDistance - distance away
|
|
* @param {boolean} flipX - flip x statux
|
|
* @param {boolean} flipY - flip y statux
|
|
* @param {Array} reatAngles - Line angle of the rectangle vertex.
|
|
* @returns {Object} diffPosition
|
|
*/
|
|
|
|
|
|
function getReversePositionForFlip(_ref6) {
|
|
var outDistance = _ref6.outDistance,
|
|
startPointIndex = _ref6.startPointIndex,
|
|
flipX = _ref6.flipX,
|
|
flipY = _ref6.flipY,
|
|
reatAngles = _ref6.reatAngles;
|
|
var rotationChangePoint1 = outDistance * Math.cos(reatAngles[0] * Math.PI / 180);
|
|
var rotationChangePoint2 = outDistance * Math.cos(reatAngles[1] * Math.PI / 180);
|
|
var isForward = startPointIndex === 2 || startPointIndex === 3;
|
|
var diffPosition = {
|
|
top: isForward ? rotationChangePoint1 : rotationChangePoint2,
|
|
left: isForward ? rotationChangePoint2 : rotationChangePoint1
|
|
};
|
|
|
|
if (isReverseLeftPositionForFlip(startPointIndex, flipX, flipY)) {
|
|
diffPosition.left = diffPosition.left * -1;
|
|
}
|
|
|
|
if (isReverseTopPositionForFlip(startPointIndex, flipX, flipY)) {
|
|
diffPosition.top = diffPosition.top * -1;
|
|
}
|
|
|
|
return diffPosition;
|
|
}
|
|
/**
|
|
* Calculate a point line outside the canvas.
|
|
* @param {string} type - 'x' or 'y'
|
|
* @param {Array} shapePointNavigation - shape edge positions
|
|
* @param {Object} shapePointNavigation.lefttop - left top position
|
|
* @param {Object} shapePointNavigation.righttop - right top position
|
|
* @param {Object} shapePointNavigation.leftbottom - lefttop position
|
|
* @param {Object} shapePointNavigation.rightbottom - rightbottom position
|
|
* @param {Array} shapeNeighborPointNavigation - Array to find adjacent edges.
|
|
* @returns {Object}
|
|
*/
|
|
|
|
|
|
function calculateLinePointsOutsideCanvas(type, shapePointNavigation, shapeNeighborPointNavigation) {
|
|
var minimumPoint = 0;
|
|
var minimumPointIndex = 0;
|
|
forEach_default()(shapePointNavigation, function (point, index) {
|
|
if (point[type] < minimumPoint) {
|
|
minimumPoint = point[type];
|
|
minimumPointIndex = index;
|
|
}
|
|
});
|
|
|
|
var _shapeNeighborPointNa = _slicedToArray(shapeNeighborPointNavigation[minimumPointIndex], 2),
|
|
endPointIndex1 = _shapeNeighborPointNa[0],
|
|
endPointIndex2 = _shapeNeighborPointNa[1];
|
|
|
|
return {
|
|
startPointIndex: minimumPointIndex,
|
|
endPointIndex1: endPointIndex1,
|
|
endPointIndex2: endPointIndex2
|
|
};
|
|
}
|
|
/**
|
|
* Calculate a point line outside the canvas.
|
|
* @param {string} type - 'x' or 'y'
|
|
* @param {Array} shapePointNavigation - shape edge positions
|
|
* @param {object} shapePointNavigation.lefttop - left top position
|
|
* @param {object} shapePointNavigation.righttop - right top position
|
|
* @param {object} shapePointNavigation.leftbottom - lefttop position
|
|
* @param {object} shapePointNavigation.rightbottom - rightbottom position
|
|
* @param {Object} linePointsOfOneVertexIndex - Line point of one vertex
|
|
* @param {Object} linePointsOfOneVertexIndex.startPoint - start point index
|
|
* @param {Object} linePointsOfOneVertexIndex.endPointIndex1 - end point index
|
|
* @param {Object} linePointsOfOneVertexIndex.endPointIndex2 - end point index
|
|
* @returns {Object}
|
|
*/
|
|
|
|
|
|
function calculateLineAngleOfOutsideCanvas(type, shapePointNavigation, linePointsOfOneVertexIndex) {
|
|
var _context2;
|
|
|
|
var startPointIndex = linePointsOfOneVertexIndex.startPointIndex,
|
|
endPointIndex1 = linePointsOfOneVertexIndex.endPointIndex1,
|
|
endPointIndex2 = linePointsOfOneVertexIndex.endPointIndex2;
|
|
var horizontalVerticalAngle = type === 'x' ? 180 : 270;
|
|
return map_default()(_context2 = [endPointIndex1, endPointIndex2]).call(_context2, function (pointIndex) {
|
|
var startPoint = shapePointNavigation[startPointIndex];
|
|
var endPoint = shapePointNavigation[pointIndex];
|
|
var diffY = startPoint.y - endPoint.y;
|
|
var diffX = startPoint.x - endPoint.x;
|
|
return Math.atan2(diffY, diffX) * 180 / Math.PI - horizontalVerticalAngle;
|
|
});
|
|
}
|
|
/* eslint-disable complexity */
|
|
|
|
/**
|
|
* Calculate a point line outside the canvas for horizontal.
|
|
* @param {number} startPointIndex - start point index
|
|
* @param {boolean} flipX - flip x statux
|
|
* @param {boolean} flipY - flip y statux
|
|
* @returns {boolean} flipY - flip y statux
|
|
*/
|
|
|
|
|
|
function isReverseLeftPositionForFlip(startPointIndex, flipX, flipY) {
|
|
return (!flipX && flipY || !flipX && !flipY) && startPointIndex === 0 || (flipX && flipY || flipX && !flipY) && startPointIndex === 1 || (!flipX && !flipY || !flipX && flipY) && startPointIndex === 2 || (flipX && !flipY || flipX && flipY) && startPointIndex === 3;
|
|
}
|
|
/* eslint-enable complexity */
|
|
|
|
/* eslint-disable complexity */
|
|
|
|
/**
|
|
* Calculate a point line outside the canvas for vertical.
|
|
* @param {number} startPointIndex - start point index
|
|
* @param {boolean} flipX - flip x statux
|
|
* @param {boolean} flipY - flip y statux
|
|
* @returns {boolean} flipY - flip y statux
|
|
*/
|
|
|
|
|
|
function isReverseTopPositionForFlip(startPointIndex, flipX, flipY) {
|
|
return (flipX && !flipY || !flipX && !flipY) && startPointIndex === 0 || (!flipX && !flipY || flipX && !flipY) && startPointIndex === 1 || (flipX && flipY || !flipX && flipY) && startPointIndex === 2 || (!flipX && flipY || flipX && flipY) && startPointIndex === 3;
|
|
}
|
|
/* eslint-enable complexity */
|
|
|
|
/**
|
|
* Shape edge points
|
|
* @param {fabric.Object} shapeObj - Selected shape object on canvas
|
|
* @returns {Array} shapeEdgePoint - shape edge positions
|
|
*/
|
|
|
|
|
|
function getShapeEdgePoint(shapeObj) {
|
|
return [shapeObj.getPointByOrigin('left', 'top'), shapeObj.getPointByOrigin('right', 'top'), shapeObj.getPointByOrigin('left', 'bottom'), shapeObj.getPointByOrigin('right', 'bottom')];
|
|
}
|
|
/**
|
|
* Rotated shape dimension
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @returns {Object} Rotated shape dimension
|
|
*/
|
|
|
|
|
|
function getRotatedDimension(shapeObj) {
|
|
var _getShapeEdgePoint = getShapeEdgePoint(shapeObj),
|
|
_getShapeEdgePoint2 = _slicedToArray(_getShapeEdgePoint, 4),
|
|
_getShapeEdgePoint2$ = _getShapeEdgePoint2[0],
|
|
ax = _getShapeEdgePoint2$.x,
|
|
ay = _getShapeEdgePoint2$.y,
|
|
_getShapeEdgePoint2$2 = _getShapeEdgePoint2[1],
|
|
bx = _getShapeEdgePoint2$2.x,
|
|
by = _getShapeEdgePoint2$2.y,
|
|
_getShapeEdgePoint2$3 = _getShapeEdgePoint2[2],
|
|
cx = _getShapeEdgePoint2$3.x,
|
|
cy = _getShapeEdgePoint2$3.y,
|
|
_getShapeEdgePoint2$4 = _getShapeEdgePoint2[3],
|
|
dx = _getShapeEdgePoint2$4.x,
|
|
dy = _getShapeEdgePoint2$4.y;
|
|
|
|
var left = Math.min(ax, bx, cx, dx);
|
|
var top = Math.min(ay, by, cy, dy);
|
|
var right = Math.max(ax, bx, cx, dx);
|
|
var bottom = Math.max(ay, by, cy, dy);
|
|
return {
|
|
left: left,
|
|
top: top,
|
|
right: right,
|
|
bottom: bottom,
|
|
width: right - left,
|
|
height: bottom - top
|
|
};
|
|
}
|
|
/**
|
|
* Make fill image
|
|
* @param {HTMLImageElement} copiedCanvasElement - html image element
|
|
* @param {number} currentCanvasImageAngle - current canvas angle
|
|
* @param {Array} filterOption - filter option
|
|
* @returns {fabric.Image}
|
|
* @private
|
|
*/
|
|
|
|
|
|
function makeFillImage(copiedCanvasElement, currentCanvasImageAngle, filterOption) {
|
|
var _context3;
|
|
|
|
var fillImage = new fabric.fabric.Image(copiedCanvasElement);
|
|
forEach_default()(extend_default().apply(void 0, concat_default()(_context3 = [{}]).call(_context3, _toConsumableArray(filterOption))), function (value, key) {
|
|
var fabricFilterClassName = capitalizeString(key);
|
|
var filter = new fabric.fabric.Image.filters[fabricFilterClassName](_defineProperty({}, FILTER_OPTION_MAP[key], value));
|
|
fillImage.filters.push(filter);
|
|
});
|
|
fillImage.applyFilters();
|
|
setCustomProperty(fillImage, {
|
|
originalAngle: currentCanvasImageAngle,
|
|
fillImageMaxSize: Math.max(fillImage.width, fillImage.height)
|
|
});
|
|
shapeResizeHelper_default().adjustOriginToCenter(fillImage);
|
|
return fillImage;
|
|
}
|
|
;// CONCATENATED MODULE: ./src/js/component/shape.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function shape_createSuper(Derived) { var hasNativeReflectConstruct = shape_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function shape_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var SHAPE_INIT_OPTIONS = extend_default()({
|
|
strokeWidth: 1,
|
|
stroke: '#000000',
|
|
fill: '#ffffff',
|
|
width: 1,
|
|
height: 1,
|
|
rx: 0,
|
|
ry: 0
|
|
}, SHAPE_DEFAULT_OPTIONS);
|
|
var DEFAULT_TYPE = 'rect';
|
|
var DEFAULT_WIDTH = 20;
|
|
var DEFAULT_HEIGHT = 20;
|
|
/**
|
|
* Make fill option
|
|
* @param {Object} options - Options to create the shape
|
|
* @param {Object.Image} canvasImage - canvas background image
|
|
* @param {Function} createStaticCanvas - static canvas creater
|
|
* @returns {Object} - shape option
|
|
* @private
|
|
*/
|
|
|
|
function makeFabricFillOption(options, canvasImage, createStaticCanvas) {
|
|
var fillOption = fill_default()(options);
|
|
|
|
var fillType = getFillTypeFromOption(fill_default()(options));
|
|
var fill = fillOption;
|
|
|
|
if (fillOption.color) {
|
|
fill = fillOption.color;
|
|
}
|
|
|
|
var extOption = null;
|
|
|
|
if (fillType === 'filter') {
|
|
var newStaticCanvas = createStaticCanvas();
|
|
extOption = makeFillPatternForFilter(canvasImage, filter_default()(fillOption), newStaticCanvas);
|
|
} else {
|
|
extOption = {
|
|
fill: fill
|
|
};
|
|
}
|
|
|
|
return extend_default()({}, options, extOption);
|
|
}
|
|
/**
|
|
* Shape
|
|
* @class Shape
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
var shape_Shape = /*#__PURE__*/function (_Component) {
|
|
_inherits(Shape, _Component);
|
|
|
|
var _super = shape_createSuper(Shape);
|
|
|
|
function Shape(graphics) {
|
|
var _context, _context2, _context3, _context4, _context5;
|
|
|
|
var _this;
|
|
|
|
_classCallCheck(this, Shape);
|
|
|
|
_this = _super.call(this, componentNames.SHAPE, graphics);
|
|
/**
|
|
* Object of The drawing shape
|
|
* @type {fabric.Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._shapeObj = null;
|
|
/**
|
|
* Type of the drawing shape
|
|
* @type {string}
|
|
* @private
|
|
*/
|
|
|
|
_this._type = DEFAULT_TYPE;
|
|
/**
|
|
* Options to draw the shape
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._options = extend_default()({}, SHAPE_INIT_OPTIONS);
|
|
/**
|
|
* Whether the shape object is selected or not
|
|
* @type {boolean}
|
|
* @private
|
|
*/
|
|
|
|
_this._isSelected = false;
|
|
/**
|
|
* Pointer for drawing shape (x, y)
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._startPoint = {};
|
|
/**
|
|
* Using shortcut on drawing shape
|
|
* @type {boolean}
|
|
* @private
|
|
*/
|
|
|
|
_this._withShiftKey = false;
|
|
/**
|
|
* Event handler list
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._handlers = {
|
|
mousedown: bind_default()(_context = _this._onFabricMouseDown).call(_context, _assertThisInitialized(_this)),
|
|
mousemove: bind_default()(_context2 = _this._onFabricMouseMove).call(_context2, _assertThisInitialized(_this)),
|
|
mouseup: bind_default()(_context3 = _this._onFabricMouseUp).call(_context3, _assertThisInitialized(_this)),
|
|
keydown: bind_default()(_context4 = _this._onKeyDown).call(_context4, _assertThisInitialized(_this)),
|
|
keyup: bind_default()(_context5 = _this._onKeyUp).call(_context5, _assertThisInitialized(_this))
|
|
};
|
|
return _this;
|
|
}
|
|
/**
|
|
* Start to draw the shape on canvas
|
|
* @ignore
|
|
*/
|
|
|
|
|
|
_createClass(Shape, [{
|
|
key: "start",
|
|
value: function start() {
|
|
var canvas = this.getCanvas();
|
|
this._isSelected = false;
|
|
canvas.defaultCursor = 'crosshair';
|
|
canvas.selection = false;
|
|
canvas.uniformScaling = true;
|
|
canvas.on({
|
|
'mouse:down': this._handlers.mousedown
|
|
});
|
|
fabric.fabric.util.addListener(document, 'keydown', this._handlers.keydown);
|
|
fabric.fabric.util.addListener(document, 'keyup', this._handlers.keyup);
|
|
}
|
|
/**
|
|
* End to draw the shape on canvas
|
|
* @ignore
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
var canvas = this.getCanvas();
|
|
this._isSelected = false;
|
|
canvas.defaultCursor = 'default';
|
|
canvas.selection = true;
|
|
canvas.uniformScaling = false;
|
|
canvas.off({
|
|
'mouse:down': this._handlers.mousedown
|
|
});
|
|
fabric.fabric.util.removeListener(document, 'keydown', this._handlers.keydown);
|
|
fabric.fabric.util.removeListener(document, 'keyup', this._handlers.keyup);
|
|
}
|
|
/**
|
|
* Set states of the current drawing shape
|
|
* @ignore
|
|
* @param {string} type - Shape type (ex: 'rect', 'circle')
|
|
* @param {Object} [options] - Shape options
|
|
* @param {(ShapeFillOption | string)} [options.fill] - {@link ShapeFillOption} or
|
|
* Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stoke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
*/
|
|
|
|
}, {
|
|
key: "setStates",
|
|
value: function setStates(type, options) {
|
|
this._type = type;
|
|
|
|
if (options) {
|
|
this._options = extend_default()(this._options, options);
|
|
}
|
|
}
|
|
/**
|
|
* Add the shape
|
|
* @ignore
|
|
* @param {string} type - Shape type (ex: 'rect', 'circle')
|
|
* @param {Object} options - Shape options
|
|
* @param {(ShapeFillOption | string)} [options.fill] - ShapeFillOption or Shape foreground color (ex: '#fff', 'transparent') or ShapeFillOption object
|
|
* @param {string} [options.stroke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.isRegular] - Whether scaling shape has 1:1 ratio or not
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "add",
|
|
value: function add(type, options) {
|
|
var _this2 = this;
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
var canvas = _this2.getCanvas();
|
|
|
|
var extendOption = _this2._extendOptions(options);
|
|
|
|
var shapeObj = _this2._createInstance(type, extendOption);
|
|
|
|
var objectProperties = _this2.graphics.createObjectProperties(shapeObj);
|
|
|
|
_this2._bindEventOnShape(shapeObj);
|
|
|
|
canvas.add(shapeObj).setActiveObject(shapeObj);
|
|
|
|
_this2._resetPositionFillFilter(shapeObj);
|
|
|
|
resolve(objectProperties);
|
|
});
|
|
}
|
|
/**
|
|
* Change the shape
|
|
* @ignore
|
|
* @param {fabric.Object} shapeObj - Selected shape object on canvas
|
|
* @param {Object} options - Shape options
|
|
* @param {(ShapeFillOption | string)} [options.fill] - {@link ShapeFillOption} or
|
|
* Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stroke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.isRegular] - Whether scaling shape has 1:1 ratio or not
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "change",
|
|
value: function change(shapeObj, options) {
|
|
var _this3 = this;
|
|
|
|
return new (promise_default())(function (resolve, reject) {
|
|
if (!isShape(shapeObj)) {
|
|
reject(rejectMessages.unsupportedType);
|
|
}
|
|
|
|
var hasFillOption = getFillTypeFromOption(fill_default()(options)) === 'filter';
|
|
var _this3$graphics = _this3.graphics,
|
|
canvasImage = _this3$graphics.canvasImage,
|
|
createStaticCanvas = _this3$graphics.createStaticCanvas;
|
|
shapeObj.set(hasFillOption ? makeFabricFillOption(options, canvasImage, createStaticCanvas) : options);
|
|
|
|
if (hasFillOption) {
|
|
_this3._resetPositionFillFilter(shapeObj);
|
|
}
|
|
|
|
_this3.getCanvas().renderAll();
|
|
|
|
resolve();
|
|
});
|
|
}
|
|
/**
|
|
* make fill property for user event
|
|
* @param {fabric.Object} shapeObj - fabric object
|
|
* @returns {Object}
|
|
*/
|
|
|
|
}, {
|
|
key: "makeFillPropertyForUserEvent",
|
|
value: function makeFillPropertyForUserEvent(shapeObj) {
|
|
var fillType = getFillTypeFromObject(shapeObj);
|
|
var fillProp = {};
|
|
|
|
if (fillType === SHAPE_FILL_TYPE.FILTER) {
|
|
var fillImage = getFillImageFromShape(shapeObj);
|
|
var filterOption = makeFilterOptionFromFabricImage(fillImage);
|
|
fillProp.type = fillType;
|
|
fillProp.filter = filterOption;
|
|
} else {
|
|
fillProp.type = SHAPE_FILL_TYPE.COLOR;
|
|
fillProp.color = fill_default()(shapeObj) || 'transparent';
|
|
}
|
|
|
|
return fillProp;
|
|
}
|
|
/**
|
|
* Copy object handling.
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @param {fabric.Object} originalShapeObj - Shape object
|
|
*/
|
|
|
|
}, {
|
|
key: "processForCopiedObject",
|
|
value: function processForCopiedObject(shapeObj, originalShapeObj) {
|
|
this._bindEventOnShape(shapeObj);
|
|
|
|
if (getFillTypeFromObject(shapeObj) === 'filter') {
|
|
var fillImage = getFillImageFromShape(originalShapeObj);
|
|
var filterOption = makeFilterOptionFromFabricImage(fillImage);
|
|
var newStaticCanvas = this.graphics.createStaticCanvas();
|
|
shapeObj.set(makeFillPatternForFilter(this.graphics.canvasImage, filterOption, newStaticCanvas));
|
|
|
|
this._resetPositionFillFilter(shapeObj);
|
|
}
|
|
}
|
|
/**
|
|
* Create the instance of shape
|
|
* @param {string} type - Shape type
|
|
* @param {Object} options - Options to creat the shape
|
|
* @returns {fabric.Object} Shape instance
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_createInstance",
|
|
value: function _createInstance(type, options) {
|
|
var instance;
|
|
|
|
switch (type) {
|
|
case 'rect':
|
|
instance = new fabric.fabric.Rect(options);
|
|
break;
|
|
|
|
case 'circle':
|
|
instance = new fabric.fabric.Ellipse(extend_default()({
|
|
type: 'circle'
|
|
}, options));
|
|
break;
|
|
|
|
case 'triangle':
|
|
instance = new fabric.fabric.Triangle(options);
|
|
break;
|
|
|
|
default:
|
|
instance = {};
|
|
}
|
|
|
|
return instance;
|
|
}
|
|
/**
|
|
* Get the options to create the shape
|
|
* @param {Object} options - Options to creat the shape
|
|
* @returns {Object} Shape options
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_extendOptions",
|
|
value: function _extendOptions(options) {
|
|
var selectionStyles = fObjectOptions.SELECTION_STYLE;
|
|
var _this$graphics = this.graphics,
|
|
canvasImage = _this$graphics.canvasImage,
|
|
createStaticCanvas = _this$graphics.createStaticCanvas;
|
|
options = extend_default()({}, SHAPE_INIT_OPTIONS, this._options, selectionStyles, options);
|
|
return makeFabricFillOption(options, canvasImage, createStaticCanvas);
|
|
}
|
|
/**
|
|
* Bind fabric events on the creating shape object
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_bindEventOnShape",
|
|
value: function _bindEventOnShape(shapeObj) {
|
|
var self = this;
|
|
var canvas = this.getCanvas();
|
|
shapeObj.on({
|
|
added: function added() {
|
|
self._shapeObj = this;
|
|
shapeResizeHelper_default().setOrigins(self._shapeObj);
|
|
},
|
|
selected: function selected() {
|
|
self._isSelected = true;
|
|
self._shapeObj = this;
|
|
canvas.uniformScaling = true;
|
|
canvas.defaultCursor = 'default';
|
|
shapeResizeHelper_default().setOrigins(self._shapeObj);
|
|
},
|
|
deselected: function deselected() {
|
|
self._isSelected = false;
|
|
self._shapeObj = null;
|
|
canvas.defaultCursor = 'crosshair';
|
|
canvas.uniformScaling = false;
|
|
},
|
|
modified: function modified() {
|
|
var currentObj = self._shapeObj;
|
|
shapeResizeHelper_default().adjustOriginToCenter(currentObj);
|
|
shapeResizeHelper_default().setOrigins(currentObj);
|
|
},
|
|
modifiedInGroup: function modifiedInGroup(activeSelection) {
|
|
self._fillFilterRePositionInGroupSelection(shapeObj, activeSelection);
|
|
},
|
|
moving: function moving() {
|
|
self._resetPositionFillFilter(this);
|
|
},
|
|
rotating: function rotating() {
|
|
self._resetPositionFillFilter(this);
|
|
},
|
|
scaling: function scaling(fEvent) {
|
|
var pointer = canvas.getPointer(fEvent.e);
|
|
var currentObj = self._shapeObj;
|
|
canvas.setCursor('crosshair');
|
|
shapeResizeHelper_default().resize(currentObj, pointer, true);
|
|
|
|
self._resetPositionFillFilter(this);
|
|
}
|
|
});
|
|
}
|
|
/**
|
|
* MouseDown event handler on canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseDown",
|
|
value: function _onFabricMouseDown(fEvent) {
|
|
if (!fEvent.target) {
|
|
this._isSelected = false;
|
|
this._shapeObj = false;
|
|
}
|
|
|
|
if (!this._isSelected && !this._shapeObj) {
|
|
var canvas = this.getCanvas();
|
|
this._startPoint = canvas.getPointer(fEvent.e);
|
|
canvas.on({
|
|
'mouse:move': this._handlers.mousemove,
|
|
'mouse:up': this._handlers.mouseup
|
|
});
|
|
}
|
|
}
|
|
/**
|
|
* MouseDown event handler on canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseMove",
|
|
value: function _onFabricMouseMove(fEvent) {
|
|
var _this4 = this;
|
|
|
|
var canvas = this.getCanvas();
|
|
var pointer = canvas.getPointer(fEvent.e);
|
|
var startPointX = this._startPoint.x;
|
|
var startPointY = this._startPoint.y;
|
|
var width = startPointX - pointer.x;
|
|
var height = startPointY - pointer.y;
|
|
var shape = this._shapeObj;
|
|
|
|
if (!shape) {
|
|
this.add(this._type, {
|
|
left: startPointX,
|
|
top: startPointY,
|
|
width: width,
|
|
height: height
|
|
}).then(function (objectProps) {
|
|
_this4.fire(eventNames.ADD_OBJECT, objectProps);
|
|
});
|
|
} else {
|
|
this._shapeObj.set({
|
|
isRegular: this._withShiftKey
|
|
});
|
|
|
|
shapeResizeHelper_default().resize(shape, pointer);
|
|
canvas.renderAll();
|
|
|
|
this._resetPositionFillFilter(shape);
|
|
}
|
|
}
|
|
/**
|
|
* MouseUp event handler on canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onFabricMouseUp",
|
|
value: function _onFabricMouseUp() {
|
|
var _this5 = this;
|
|
|
|
var canvas = this.getCanvas();
|
|
var startPointX = this._startPoint.x;
|
|
var startPointY = this._startPoint.y;
|
|
var shape = this._shapeObj;
|
|
|
|
if (!shape) {
|
|
this.add(this._type, {
|
|
left: startPointX,
|
|
top: startPointY,
|
|
width: DEFAULT_WIDTH,
|
|
height: DEFAULT_HEIGHT
|
|
}).then(function (objectProps) {
|
|
_this5.fire(eventNames.ADD_OBJECT, objectProps);
|
|
});
|
|
} else if (shape) {
|
|
shapeResizeHelper_default().adjustOriginToCenter(shape);
|
|
this.fire(eventNames.OBJECT_ADDED, this.graphics.createObjectProperties(shape));
|
|
}
|
|
|
|
canvas.off({
|
|
'mouse:move': this._handlers.mousemove,
|
|
'mouse:up': this._handlers.mouseup
|
|
});
|
|
}
|
|
/**
|
|
* Keydown event handler on document
|
|
* @param {KeyboardEvent} e - Event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onKeyDown",
|
|
value: function _onKeyDown(e) {
|
|
if (e.keyCode === keyCodes.SHIFT) {
|
|
this._withShiftKey = true;
|
|
|
|
if (this._shapeObj) {
|
|
this._shapeObj.isRegular = true;
|
|
}
|
|
}
|
|
}
|
|
/**
|
|
* Keyup event handler on document
|
|
* @param {KeyboardEvent} e - Event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onKeyUp",
|
|
value: function _onKeyUp(e) {
|
|
if (e.keyCode === keyCodes.SHIFT) {
|
|
this._withShiftKey = false;
|
|
|
|
if (this._shapeObj) {
|
|
this._shapeObj.isRegular = false;
|
|
}
|
|
}
|
|
}
|
|
/**
|
|
* Reset shape position and internal proportions in the filter type fill area.
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_resetPositionFillFilter",
|
|
value: function _resetPositionFillFilter(shapeObj) {
|
|
if (getFillTypeFromObject(shapeObj) !== 'filter') {
|
|
return;
|
|
}
|
|
|
|
var _getCustomProperty = getCustomProperty(shapeObj, 'patternSourceCanvas'),
|
|
patternSourceCanvas = _getCustomProperty.patternSourceCanvas;
|
|
|
|
var fillImage = getFillImageFromShape(shapeObj);
|
|
|
|
var _getCustomProperty2 = getCustomProperty(fillImage, 'originalAngle'),
|
|
originalAngle = _getCustomProperty2.originalAngle;
|
|
|
|
if (this.graphics.canvasImage.angle !== originalAngle) {
|
|
reMakePatternImageSource(shapeObj, this.graphics.canvasImage);
|
|
}
|
|
|
|
var originX = shapeObj.originX,
|
|
originY = shapeObj.originY;
|
|
shapeResizeHelper_default().adjustOriginToCenter(shapeObj);
|
|
shapeObj.width *= shapeObj.scaleX;
|
|
shapeObj.height *= shapeObj.scaleY;
|
|
shapeObj.rx *= shapeObj.scaleX;
|
|
shapeObj.ry *= shapeObj.scaleY;
|
|
shapeObj.scaleX = 1;
|
|
shapeObj.scaleY = 1;
|
|
rePositionFilterTypeFillImage(shapeObj);
|
|
changeOrigin(shapeObj, {
|
|
originX: originX,
|
|
originY: originY
|
|
});
|
|
resetFillPatternCanvas(patternSourceCanvas);
|
|
}
|
|
/**
|
|
* Reset filter area position within group selection.
|
|
* @param {fabric.Object} shapeObj - Shape object
|
|
* @param {fabric.ActiveSelection} activeSelection - Shape object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_fillFilterRePositionInGroupSelection",
|
|
value: function _fillFilterRePositionInGroupSelection(shapeObj, activeSelection) {
|
|
if (activeSelection.scaleX !== 1 || activeSelection.scaleY !== 1) {
|
|
// This is necessary because the group's scale transition state affects the relative size of the fill area.
|
|
// The only way to reset the object transformation scale state to neutral.
|
|
// {@link https://github.com/fabricjs/fabric.js/issues/5372}
|
|
activeSelection.addWithUpdate();
|
|
}
|
|
|
|
var angle = shapeObj.angle,
|
|
left = shapeObj.left,
|
|
top = shapeObj.top;
|
|
fabric.fabric.util.addTransformToObject(shapeObj, activeSelection.calcTransformMatrix());
|
|
|
|
this._resetPositionFillFilter(shapeObj);
|
|
|
|
shapeObj.set({
|
|
angle: angle,
|
|
left: left,
|
|
top: top
|
|
});
|
|
}
|
|
}]);
|
|
|
|
return Shape;
|
|
}(component);
|
|
|
|
|
|
;// CONCATENATED MODULE: ./src/js/component/zoom.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function zoom_createSuper(Derived) { var hasNativeReflectConstruct = zoom_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function zoom_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
|
|
|
|
var zoom_MOUSE_MOVE_THRESHOLD = 10;
|
|
var DEFAULT_SCROLL_OPTION = {
|
|
left: 0,
|
|
top: 0,
|
|
width: 0,
|
|
height: 0,
|
|
stroke: '#000000',
|
|
strokeWidth: 0,
|
|
fill: '#000000',
|
|
opacity: 0.4,
|
|
evented: false,
|
|
selectable: false,
|
|
hoverCursor: 'auto'
|
|
};
|
|
var DEFAULT_VERTICAL_SCROLL_RATIO = {
|
|
SIZE: 0.0045,
|
|
MARGIN: 0.003,
|
|
BORDER_RADIUS: 0.003
|
|
};
|
|
var DEFAULT_HORIZONTAL_SCROLL_RATIO = {
|
|
SIZE: 0.0066,
|
|
MARGIN: 0.0044,
|
|
BORDER_RADIUS: 0.003
|
|
};
|
|
var DEFAULT_ZOOM_LEVEL = 1.0;
|
|
var ZOOM_CHANGED = eventNames.ZOOM_CHANGED,
|
|
ADD_TEXT = eventNames.ADD_TEXT,
|
|
TEXT_EDITING = eventNames.TEXT_EDITING,
|
|
OBJECT_MODIFIED = eventNames.OBJECT_MODIFIED,
|
|
KEY_DOWN = eventNames.KEY_DOWN,
|
|
KEY_UP = eventNames.KEY_UP,
|
|
HAND_STARTED = eventNames.HAND_STARTED,
|
|
HAND_STOPPED = eventNames.HAND_STOPPED;
|
|
/**
|
|
* Zoom components
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @class Zoom
|
|
* @ignore
|
|
*/
|
|
|
|
var Zoom = /*#__PURE__*/function (_Component) {
|
|
_inherits(Zoom, _Component);
|
|
|
|
var _super = zoom_createSuper(Zoom);
|
|
|
|
function Zoom(graphics) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11, _context12;
|
|
|
|
var _this;
|
|
|
|
_classCallCheck(this, Zoom);
|
|
|
|
_this = _super.call(this, componentNames.ZOOM, graphics);
|
|
/**
|
|
* zoomArea
|
|
* @type {?fabric.Rect}
|
|
* @private
|
|
*/
|
|
|
|
_this.zoomArea = null;
|
|
/**
|
|
* Start point of zoom area
|
|
* @type {?{x: number, y: number}}
|
|
*/
|
|
|
|
_this._startPoint = null;
|
|
/**
|
|
* Center point of every zoom
|
|
* @type {Array.<{prevZoomLevel: number, zoomLevel: number, x: number, y: number}>}
|
|
*/
|
|
|
|
_this._centerPoints = [];
|
|
/**
|
|
* Zoom level (default: 100%(1.0), max: 400%(4.0))
|
|
* @type {number}
|
|
*/
|
|
|
|
_this.zoomLevel = DEFAULT_ZOOM_LEVEL;
|
|
/**
|
|
* Zoom mode ('normal', 'zoom', 'hand')
|
|
* @type {string}
|
|
*/
|
|
|
|
_this.zoomMode = zoomModes.DEFAULT;
|
|
/**
|
|
* Listeners
|
|
* @type {Object.<string, Function>}
|
|
* @private
|
|
*/
|
|
|
|
_this._listeners = {
|
|
startZoom: bind_default()(_context = _this._onMouseDownWithZoomMode).call(_context, _assertThisInitialized(_this)),
|
|
moveZoom: bind_default()(_context2 = _this._onMouseMoveWithZoomMode).call(_context2, _assertThisInitialized(_this)),
|
|
stopZoom: bind_default()(_context3 = _this._onMouseUpWithZoomMode).call(_context3, _assertThisInitialized(_this)),
|
|
startHand: bind_default()(_context4 = _this._onMouseDownWithHandMode).call(_context4, _assertThisInitialized(_this)),
|
|
moveHand: bind_default()(_context5 = _this._onMouseMoveWithHandMode).call(_context5, _assertThisInitialized(_this)),
|
|
stopHand: bind_default()(_context6 = _this._onMouseUpWithHandMode).call(_context6, _assertThisInitialized(_this)),
|
|
zoomChanged: bind_default()(_context7 = _this._changeScrollState).call(_context7, _assertThisInitialized(_this)),
|
|
keydown: bind_default()(_context8 = _this._startHandModeWithSpaceBar).call(_context8, _assertThisInitialized(_this)),
|
|
keyup: bind_default()(_context9 = _this._endHandModeWithSpaceBar).call(_context9, _assertThisInitialized(_this))
|
|
};
|
|
|
|
var canvas = _this.getCanvas();
|
|
/**
|
|
* Width:Height ratio (ex. width=1.5, height=1 -> aspectRatio=1.5)
|
|
* @private
|
|
*/
|
|
|
|
|
|
_this.aspectRatio = canvas.width / canvas.height;
|
|
/**
|
|
* vertical scroll bar
|
|
* @type {fabric.Rect}
|
|
* @private
|
|
*/
|
|
|
|
_this._verticalScroll = new fabric.fabric.Rect(DEFAULT_SCROLL_OPTION);
|
|
/**
|
|
* horizontal scroll bar
|
|
* @type {fabric.Rect}
|
|
* @private
|
|
*/
|
|
|
|
_this._horizontalScroll = new fabric.fabric.Rect(DEFAULT_SCROLL_OPTION);
|
|
canvas.on(ZOOM_CHANGED, _this._listeners.zoomChanged);
|
|
|
|
_this.graphics.on(ADD_TEXT, bind_default()(_context10 = _this._startTextEditingHandler).call(_context10, _assertThisInitialized(_this)));
|
|
|
|
_this.graphics.on(TEXT_EDITING, bind_default()(_context11 = _this._startTextEditingHandler).call(_context11, _assertThisInitialized(_this)));
|
|
|
|
_this.graphics.on(OBJECT_MODIFIED, bind_default()(_context12 = _this._stopTextEditingHandler).call(_context12, _assertThisInitialized(_this)));
|
|
|
|
return _this;
|
|
}
|
|
/**
|
|
* Attach zoom keyboard events
|
|
*/
|
|
|
|
|
|
_createClass(Zoom, [{
|
|
key: "attachKeyboardZoomEvents",
|
|
value: function attachKeyboardZoomEvents() {
|
|
fabric.fabric.util.addListener(document, KEY_DOWN, this._listeners.keydown);
|
|
fabric.fabric.util.addListener(document, KEY_UP, this._listeners.keyup);
|
|
}
|
|
/**
|
|
* Detach zoom keyboard events
|
|
*/
|
|
|
|
}, {
|
|
key: "detachKeyboardZoomEvents",
|
|
value: function detachKeyboardZoomEvents() {
|
|
fabric.fabric.util.removeListener(document, KEY_DOWN, this._listeners.keydown);
|
|
fabric.fabric.util.removeListener(document, KEY_UP, this._listeners.keyup);
|
|
}
|
|
/**
|
|
* Handler when you started editing text
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_startTextEditingHandler",
|
|
value: function _startTextEditingHandler() {
|
|
this.isTextEditing = true;
|
|
}
|
|
/**
|
|
* Handler when you stopped editing text
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_stopTextEditingHandler",
|
|
value: function _stopTextEditingHandler() {
|
|
this.isTextEditing = false;
|
|
}
|
|
/**
|
|
* Handler who turns on hand mode when the space bar is down
|
|
* @param {KeyboardEvent} e - Event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_startHandModeWithSpaceBar",
|
|
value: function _startHandModeWithSpaceBar(e) {
|
|
if (this.withSpace || this.isTextEditing) {
|
|
return;
|
|
}
|
|
|
|
if (e.keyCode === keyCodes.SPACE) {
|
|
this.withSpace = true;
|
|
this.startHandMode();
|
|
}
|
|
}
|
|
/**
|
|
* Handler who turns off hand mode when space bar is up
|
|
* @param {KeyboardEvent} e - Event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_endHandModeWithSpaceBar",
|
|
value: function _endHandModeWithSpaceBar(e) {
|
|
if (e.keyCode === keyCodes.SPACE) {
|
|
this.withSpace = false;
|
|
this.endHandMode();
|
|
}
|
|
}
|
|
/**
|
|
* Start zoom-in mode
|
|
*/
|
|
|
|
}, {
|
|
key: "startZoomInMode",
|
|
value: function startZoomInMode() {
|
|
if (this.zoomArea) {
|
|
return;
|
|
}
|
|
|
|
this.endHandMode();
|
|
this.zoomMode = zoomModes.ZOOM;
|
|
var canvas = this.getCanvas();
|
|
|
|
this._changeObjectsEventedState(false);
|
|
|
|
this.zoomArea = new fabric.fabric.Rect({
|
|
left: 0,
|
|
top: 0,
|
|
width: 0.5,
|
|
height: 0.5,
|
|
stroke: 'black',
|
|
strokeWidth: 1,
|
|
fill: 'transparent',
|
|
hoverCursor: 'zoom-in'
|
|
});
|
|
canvas.discardActiveObject();
|
|
canvas.add(this.zoomArea);
|
|
canvas.on('mouse:down', this._listeners.startZoom);
|
|
canvas.selection = false;
|
|
canvas.defaultCursor = 'zoom-in';
|
|
}
|
|
/**
|
|
* End zoom-in mode
|
|
*/
|
|
|
|
}, {
|
|
key: "endZoomInMode",
|
|
value: function endZoomInMode() {
|
|
this.zoomMode = zoomModes.DEFAULT;
|
|
var canvas = this.getCanvas();
|
|
var _this$_listeners = this._listeners,
|
|
startZoom = _this$_listeners.startZoom,
|
|
moveZoom = _this$_listeners.moveZoom,
|
|
stopZoom = _this$_listeners.stopZoom;
|
|
canvas.selection = true;
|
|
canvas.defaultCursor = 'auto';
|
|
canvas.off({
|
|
'mouse:down': startZoom,
|
|
'mouse:move': moveZoom,
|
|
'mouse:up': stopZoom
|
|
});
|
|
|
|
this._changeObjectsEventedState(true);
|
|
|
|
canvas.remove(this.zoomArea);
|
|
this.zoomArea = null;
|
|
}
|
|
/**
|
|
* Start zoom drawing mode
|
|
*/
|
|
|
|
}, {
|
|
key: "start",
|
|
value: function start() {
|
|
this.zoomArea = null;
|
|
this._startPoint = null;
|
|
this._startHandPoint = null;
|
|
}
|
|
/**
|
|
* Stop zoom drawing mode
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
this.endZoomInMode();
|
|
this.endHandMode();
|
|
}
|
|
/**
|
|
* Start hand mode
|
|
*/
|
|
|
|
}, {
|
|
key: "startHandMode",
|
|
value: function startHandMode() {
|
|
this.endZoomInMode();
|
|
this.zoomMode = zoomModes.HAND;
|
|
var canvas = this.getCanvas();
|
|
|
|
this._changeObjectsEventedState(false);
|
|
|
|
canvas.discardActiveObject();
|
|
canvas.off('mouse:down', this._listeners.startHand);
|
|
canvas.on('mouse:down', this._listeners.startHand);
|
|
canvas.selection = false;
|
|
canvas.defaultCursor = 'grab';
|
|
canvas.fire(HAND_STARTED);
|
|
}
|
|
/**
|
|
* Stop hand mode
|
|
*/
|
|
|
|
}, {
|
|
key: "endHandMode",
|
|
value: function endHandMode() {
|
|
this.zoomMode = zoomModes.DEFAULT;
|
|
var canvas = this.getCanvas();
|
|
|
|
this._changeObjectsEventedState(true);
|
|
|
|
canvas.off('mouse:down', this._listeners.startHand);
|
|
canvas.selection = true;
|
|
canvas.defaultCursor = 'auto';
|
|
this._startHandPoint = null;
|
|
canvas.fire(HAND_STOPPED);
|
|
}
|
|
/**
|
|
* onMousedown handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseDownWithZoomMode",
|
|
value: function _onMouseDownWithZoomMode(_ref) {
|
|
var target = _ref.target,
|
|
e = _ref.e;
|
|
|
|
if (target) {
|
|
return;
|
|
}
|
|
|
|
var canvas = this.getCanvas();
|
|
canvas.selection = false;
|
|
this._startPoint = canvas.getPointer(e);
|
|
this.zoomArea.set({
|
|
width: 0,
|
|
height: 0
|
|
});
|
|
var _this$_listeners2 = this._listeners,
|
|
moveZoom = _this$_listeners2.moveZoom,
|
|
stopZoom = _this$_listeners2.stopZoom;
|
|
canvas.on({
|
|
'mouse:move': moveZoom,
|
|
'mouse:up': stopZoom
|
|
});
|
|
}
|
|
/**
|
|
* onMousemove handler in fabric canvas
|
|
* @param {{e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseMoveWithZoomMode",
|
|
value: function _onMouseMoveWithZoomMode(_ref2) {
|
|
var e = _ref2.e;
|
|
var canvas = this.getCanvas();
|
|
var pointer = canvas.getPointer(e);
|
|
var x = pointer.x,
|
|
y = pointer.y;
|
|
var zoomArea = this.zoomArea,
|
|
_startPoint = this._startPoint;
|
|
var deltaX = Math.abs(x - _startPoint.x);
|
|
var deltaY = Math.abs(y - _startPoint.y);
|
|
|
|
if (deltaX + deltaY > zoom_MOUSE_MOVE_THRESHOLD) {
|
|
canvas.remove(zoomArea);
|
|
zoomArea.set(this._calcRectDimensionFromPoint(x, y));
|
|
canvas.add(zoomArea);
|
|
}
|
|
}
|
|
/**
|
|
* Get rect dimension setting from Canvas-Mouse-Position(x, y)
|
|
* @param {number} x - Canvas-Mouse-Position x
|
|
* @param {number} y - Canvas-Mouse-Position Y
|
|
* @returns {{left: number, top: number, width: number, height: number}}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_calcRectDimensionFromPoint",
|
|
value: function _calcRectDimensionFromPoint(x, y) {
|
|
var canvas = this.getCanvas();
|
|
var canvasWidth = canvas.getWidth();
|
|
var canvasHeight = canvas.getHeight();
|
|
var _this$_startPoint = this._startPoint,
|
|
startX = _this$_startPoint.x,
|
|
startY = _this$_startPoint.y;
|
|
var min = Math.min;
|
|
var left = min(startX, x);
|
|
var top = min(startY, y);
|
|
var width = clamp(x, startX, canvasWidth) - left; // (startX <= x(mouse) <= canvasWidth) - left
|
|
|
|
var height = clamp(y, startY, canvasHeight) - top; // (startY <= y(mouse) <= canvasHeight) - top
|
|
|
|
return {
|
|
left: left,
|
|
top: top,
|
|
width: width,
|
|
height: height
|
|
};
|
|
}
|
|
/**
|
|
* onMouseup handler in fabric canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseUpWithZoomMode",
|
|
value: function _onMouseUpWithZoomMode() {
|
|
var zoomLevel = this.zoomLevel;
|
|
var zoomArea = this.zoomArea;
|
|
var _this$_listeners3 = this._listeners,
|
|
moveZoom = _this$_listeners3.moveZoom,
|
|
stopZoom = _this$_listeners3.stopZoom;
|
|
var canvas = this.getCanvas();
|
|
|
|
var center = this._getCenterPoint();
|
|
|
|
var x = center.x,
|
|
y = center.y;
|
|
|
|
if (!this._isMaxZoomLevel()) {
|
|
this._centerPoints.push({
|
|
x: x,
|
|
y: y,
|
|
prevZoomLevel: zoomLevel,
|
|
zoomLevel: zoomLevel + 1
|
|
});
|
|
|
|
zoomLevel += 1;
|
|
canvas.zoomToPoint({
|
|
x: x,
|
|
y: y
|
|
}, zoomLevel);
|
|
|
|
this._fireZoomChanged(canvas, zoomLevel);
|
|
|
|
this.zoomLevel = zoomLevel;
|
|
}
|
|
|
|
canvas.off({
|
|
'mouse:move': moveZoom,
|
|
'mouse:up': stopZoom
|
|
});
|
|
canvas.remove(zoomArea);
|
|
this._startPoint = null;
|
|
}
|
|
/**
|
|
* Get center point
|
|
* @returns {{x: number, y: number}}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getCenterPoint",
|
|
value: function _getCenterPoint() {
|
|
var _this$zoomArea = this.zoomArea,
|
|
left = _this$zoomArea.left,
|
|
top = _this$zoomArea.top,
|
|
width = _this$zoomArea.width,
|
|
height = _this$zoomArea.height;
|
|
var _this$_startPoint2 = this._startPoint,
|
|
x = _this$_startPoint2.x,
|
|
y = _this$_startPoint2.y;
|
|
var aspectRatio = this.aspectRatio;
|
|
|
|
if (width < zoom_MOUSE_MOVE_THRESHOLD && height < zoom_MOUSE_MOVE_THRESHOLD) {
|
|
return {
|
|
x: x,
|
|
y: y
|
|
};
|
|
}
|
|
|
|
return width > height ? {
|
|
x: left + aspectRatio * height / 2,
|
|
y: top + height / 2
|
|
} : {
|
|
x: left + width / 2,
|
|
y: top + width / aspectRatio / 2
|
|
};
|
|
}
|
|
/**
|
|
* Zoom the canvas
|
|
* @param {{x: number, y: number}} center - center of zoom
|
|
* @param {?number} zoomLevel - zoom level
|
|
*/
|
|
|
|
}, {
|
|
key: "zoom",
|
|
value: function zoom(_ref3) {
|
|
var x = _ref3.x,
|
|
y = _ref3.y;
|
|
var zoomLevel = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : this.zoomLevel;
|
|
var canvas = this.getCanvas();
|
|
var centerPoints = this._centerPoints;
|
|
|
|
for (var i = centerPoints.length - 1; i >= 0; i -= 1) {
|
|
if (centerPoints[i].zoomLevel < zoomLevel) {
|
|
break;
|
|
}
|
|
|
|
var _centerPoints$pop = centerPoints.pop(),
|
|
prevX = _centerPoints$pop.x,
|
|
prevY = _centerPoints$pop.y,
|
|
prevZoomLevel = _centerPoints$pop.prevZoomLevel;
|
|
|
|
canvas.zoomToPoint({
|
|
x: prevX,
|
|
y: prevY
|
|
}, prevZoomLevel);
|
|
this.zoomLevel = prevZoomLevel;
|
|
}
|
|
|
|
canvas.zoomToPoint({
|
|
x: x,
|
|
y: y
|
|
}, zoomLevel);
|
|
|
|
if (!this._isDefaultZoomLevel(zoomLevel)) {
|
|
this._centerPoints.push({
|
|
x: x,
|
|
y: y,
|
|
zoomLevel: zoomLevel,
|
|
prevZoomLevel: this.zoomLevel
|
|
});
|
|
}
|
|
|
|
this.zoomLevel = zoomLevel;
|
|
|
|
this._fireZoomChanged(canvas, zoomLevel);
|
|
}
|
|
/**
|
|
* Zoom out one step
|
|
*/
|
|
|
|
}, {
|
|
key: "zoomOut",
|
|
value: function zoomOut() {
|
|
var centerPoints = this._centerPoints;
|
|
|
|
if (!centerPoints.length) {
|
|
return;
|
|
}
|
|
|
|
var canvas = this.getCanvas();
|
|
var point = centerPoints.pop();
|
|
var x = point.x,
|
|
y = point.y,
|
|
prevZoomLevel = point.prevZoomLevel;
|
|
|
|
if (this._isDefaultZoomLevel(prevZoomLevel)) {
|
|
canvas.setViewportTransform([1, 0, 0, 1, 0, 0]);
|
|
} else {
|
|
canvas.zoomToPoint({
|
|
x: x,
|
|
y: y
|
|
}, prevZoomLevel);
|
|
}
|
|
|
|
this.zoomLevel = prevZoomLevel;
|
|
|
|
this._fireZoomChanged(canvas, this.zoomLevel);
|
|
}
|
|
/**
|
|
* Zoom reset
|
|
*/
|
|
|
|
}, {
|
|
key: "resetZoom",
|
|
value: function resetZoom() {
|
|
var canvas = this.getCanvas();
|
|
canvas.setViewportTransform([1, 0, 0, 1, 0, 0]);
|
|
this.zoomLevel = DEFAULT_ZOOM_LEVEL;
|
|
this._centerPoints = [];
|
|
|
|
this._fireZoomChanged(canvas, this.zoomLevel);
|
|
}
|
|
/**
|
|
* Whether zoom level is max (5.0)
|
|
* @returns {boolean}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_isMaxZoomLevel",
|
|
value: function _isMaxZoomLevel() {
|
|
return this.zoomLevel >= 5.0;
|
|
}
|
|
/**
|
|
* Move point of zoom
|
|
* @param {{x: number, y: number}} delta - move amount
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_movePointOfZoom",
|
|
value: function _movePointOfZoom(_ref4) {
|
|
var deltaX = _ref4.x,
|
|
deltaY = _ref4.y;
|
|
var centerPoints = this._centerPoints;
|
|
|
|
if (!centerPoints.length) {
|
|
return;
|
|
}
|
|
|
|
var canvas = this.getCanvas();
|
|
var zoomLevel = this.zoomLevel;
|
|
var point = centerPoints.pop();
|
|
var originX = point.x,
|
|
originY = point.y,
|
|
prevZoomLevel = point.prevZoomLevel;
|
|
var x = originX - deltaX;
|
|
var y = originY - deltaY;
|
|
canvas.zoomToPoint({
|
|
x: originX,
|
|
y: originY
|
|
}, prevZoomLevel);
|
|
canvas.zoomToPoint({
|
|
x: x,
|
|
y: y
|
|
}, zoomLevel);
|
|
centerPoints.push({
|
|
x: x,
|
|
y: y,
|
|
prevZoomLevel: prevZoomLevel,
|
|
zoomLevel: zoomLevel
|
|
});
|
|
|
|
this._fireZoomChanged(canvas, zoomLevel);
|
|
}
|
|
/**
|
|
* onMouseDown handler in fabric canvas
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseDownWithHandMode",
|
|
value: function _onMouseDownWithHandMode(_ref5) {
|
|
var target = _ref5.target,
|
|
e = _ref5.e;
|
|
|
|
if (target) {
|
|
return;
|
|
}
|
|
|
|
var canvas = this.getCanvas();
|
|
|
|
if (this.zoomLevel <= DEFAULT_ZOOM_LEVEL) {
|
|
return;
|
|
}
|
|
|
|
canvas.selection = false;
|
|
this._startHandPoint = canvas.getPointer(e);
|
|
var _this$_listeners4 = this._listeners,
|
|
moveHand = _this$_listeners4.moveHand,
|
|
stopHand = _this$_listeners4.stopHand;
|
|
canvas.on({
|
|
'mouse:move': moveHand,
|
|
'mouse:up': stopHand
|
|
});
|
|
}
|
|
/**
|
|
* onMouseMove handler in fabric canvas
|
|
* @param {{e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseMoveWithHandMode",
|
|
value: function _onMouseMoveWithHandMode(_ref6) {
|
|
var e = _ref6.e;
|
|
var canvas = this.getCanvas();
|
|
|
|
var _canvas$getPointer = canvas.getPointer(e),
|
|
x = _canvas$getPointer.x,
|
|
y = _canvas$getPointer.y;
|
|
|
|
var deltaX = x - this._startHandPoint.x;
|
|
var deltaY = y - this._startHandPoint.y;
|
|
|
|
this._movePointOfZoom({
|
|
x: deltaX,
|
|
y: deltaY
|
|
});
|
|
}
|
|
/**
|
|
* onMouseUp handler in fabric canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseUpWithHandMode",
|
|
value: function _onMouseUpWithHandMode() {
|
|
var canvas = this.getCanvas();
|
|
var _this$_listeners5 = this._listeners,
|
|
moveHand = _this$_listeners5.moveHand,
|
|
stopHand = _this$_listeners5.stopHand;
|
|
canvas.off({
|
|
'mouse:move': moveHand,
|
|
'mouse:up': stopHand
|
|
});
|
|
this._startHandPoint = null;
|
|
}
|
|
/**
|
|
* onChangeZoom handler in fabric canvas
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeScrollState",
|
|
value: function _changeScrollState(_ref7) {
|
|
var viewport = _ref7.viewport,
|
|
zoomLevel = _ref7.zoomLevel;
|
|
var canvas = this.getCanvas();
|
|
canvas.remove(this._verticalScroll);
|
|
canvas.remove(this._horizontalScroll);
|
|
|
|
if (this._isDefaultZoomLevel(zoomLevel)) {
|
|
return;
|
|
}
|
|
|
|
var canvasWidth = canvas.width;
|
|
var canvasHeight = canvas.height;
|
|
var tl = viewport.tl,
|
|
tr = viewport.tr,
|
|
bl = viewport.bl;
|
|
var viewportWidth = tr.x - tl.x;
|
|
var viewportHeight = bl.y - tl.y;
|
|
var horizontalScrollWidth = viewportWidth * viewportWidth / canvasWidth;
|
|
var horizontalScrollHeight = viewportHeight * DEFAULT_HORIZONTAL_SCROLL_RATIO.SIZE;
|
|
var horizontalScrollLeft = clamp(tl.x + tl.x / canvasWidth * viewportWidth, tl.x, tr.x - horizontalScrollWidth);
|
|
var horizontalScrollMargin = viewportHeight * DEFAULT_HORIZONTAL_SCROLL_RATIO.MARGIN;
|
|
var horizontalScrollBorderRadius = viewportHeight * DEFAULT_HORIZONTAL_SCROLL_RATIO.BORDER_RADIUS;
|
|
|
|
this._horizontalScroll.set({
|
|
left: horizontalScrollLeft,
|
|
top: bl.y - horizontalScrollHeight - horizontalScrollMargin,
|
|
width: horizontalScrollWidth,
|
|
height: horizontalScrollHeight,
|
|
rx: horizontalScrollBorderRadius,
|
|
ry: horizontalScrollBorderRadius
|
|
});
|
|
|
|
var verticalScrollWidth = viewportWidth * DEFAULT_VERTICAL_SCROLL_RATIO.SIZE;
|
|
var verticalScrollHeight = viewportHeight * viewportHeight / canvasHeight;
|
|
var verticalScrollTop = clamp(tl.y + tl.y / canvasHeight * viewportHeight, tr.y, bl.y - verticalScrollHeight);
|
|
var verticalScrollMargin = viewportWidth * DEFAULT_VERTICAL_SCROLL_RATIO.MARGIN;
|
|
var verticalScrollBorderRadius = viewportWidth * DEFAULT_VERTICAL_SCROLL_RATIO.BORDER_RADIUS;
|
|
|
|
this._verticalScroll.set({
|
|
left: tr.x - verticalScrollWidth - verticalScrollMargin,
|
|
top: verticalScrollTop,
|
|
width: verticalScrollWidth,
|
|
height: verticalScrollHeight,
|
|
rx: verticalScrollBorderRadius,
|
|
ry: verticalScrollBorderRadius
|
|
});
|
|
|
|
this._addScrollBar();
|
|
}
|
|
/**
|
|
* Change objects 'evented' state
|
|
* @param {boolean} [evented=true] - objects 'evented' state
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeObjectsEventedState",
|
|
value: function _changeObjectsEventedState() {
|
|
var evented = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : true;
|
|
var canvas = this.getCanvas();
|
|
canvas.forEachObject(function (obj) {
|
|
// {@link http://fabricjs.com/docs/fabric.Object.html#evented}
|
|
obj.evented = evented;
|
|
});
|
|
}
|
|
/**
|
|
* Add scroll bar and set remove timer
|
|
*/
|
|
|
|
}, {
|
|
key: "_addScrollBar",
|
|
value: function _addScrollBar() {
|
|
var _this2 = this;
|
|
|
|
var canvas = this.getCanvas();
|
|
canvas.add(this._horizontalScroll);
|
|
canvas.add(this._verticalScroll);
|
|
|
|
if (this.scrollBarTid) {
|
|
clearTimeout(this.scrollBarTid);
|
|
}
|
|
|
|
this.scrollBarTid = set_timeout_default()(function () {
|
|
canvas.remove(_this2._horizontalScroll);
|
|
canvas.remove(_this2._verticalScroll);
|
|
}, 3000);
|
|
}
|
|
/**
|
|
* Check zoom level is default zoom level (1.0)
|
|
* @param {number} zoomLevel - zoom level
|
|
* @returns {boolean} - whether zoom level is 1.0
|
|
*/
|
|
|
|
}, {
|
|
key: "_isDefaultZoomLevel",
|
|
value: function _isDefaultZoomLevel(zoomLevel) {
|
|
return zoomLevel === DEFAULT_ZOOM_LEVEL;
|
|
}
|
|
/**
|
|
* Fire 'zoomChanged' event
|
|
* @param {fabric.Canvas} canvas - fabric canvas
|
|
* @param {number} zoomLevel - 'zoomChanged' event params
|
|
*/
|
|
|
|
}, {
|
|
key: "_fireZoomChanged",
|
|
value: function _fireZoomChanged(canvas, zoomLevel) {
|
|
canvas.fire(ZOOM_CHANGED, {
|
|
viewport: canvas.calcViewportBoundaries(),
|
|
zoomLevel: zoomLevel
|
|
});
|
|
}
|
|
/**
|
|
* Get zoom mode
|
|
*/
|
|
|
|
}, {
|
|
key: "mode",
|
|
get: function get() {
|
|
return this.zoomMode;
|
|
}
|
|
}]);
|
|
|
|
return Zoom;
|
|
}(component);
|
|
|
|
/* harmony default export */ var zoom = (Zoom);
|
|
;// CONCATENATED MODULE: ./src/js/interface/drawingMode.js
|
|
|
|
|
|
|
|
var drawingMode_createMessage = errorMessage.create;
|
|
var drawingMode_errorTypes = errorMessage.types;
|
|
/**
|
|
* DrawingMode interface
|
|
* @class
|
|
* @param {string} name - drawing mode name
|
|
* @ignore
|
|
*/
|
|
|
|
var DrawingMode = /*#__PURE__*/function () {
|
|
function DrawingMode(name) {
|
|
_classCallCheck(this, DrawingMode);
|
|
|
|
/**
|
|
* the name of drawing mode
|
|
* @type {string}
|
|
*/
|
|
this.name = name;
|
|
}
|
|
/**
|
|
* Get this drawing mode name;
|
|
* @returns {string} drawing mode name
|
|
*/
|
|
|
|
|
|
_createClass(DrawingMode, [{
|
|
key: "getName",
|
|
value: function getName() {
|
|
return this.name;
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Object} options - drawing mode options
|
|
* @abstract
|
|
*/
|
|
|
|
}, {
|
|
key: "start",
|
|
value: function start() {
|
|
throw new Error(drawingMode_createMessage(drawingMode_errorTypes.UN_IMPLEMENTATION, 'start'));
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @abstract
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {
|
|
throw new Error(drawingMode_createMessage(drawingMode_errorTypes.UN_IMPLEMENTATION, 'stop'));
|
|
}
|
|
}]);
|
|
|
|
return DrawingMode;
|
|
}();
|
|
|
|
/* harmony default export */ var drawingMode = (DrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/cropper.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function drawingMode_cropper_createSuper(Derived) { var hasNativeReflectConstruct = drawingMode_cropper_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function drawingMode_cropper_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* CropperDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var CropperDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(CropperDrawingMode, _DrawingMode);
|
|
|
|
var _super = drawingMode_cropper_createSuper(CropperDrawingMode);
|
|
|
|
function CropperDrawingMode() {
|
|
_classCallCheck(this, CropperDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.CROPPER);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(CropperDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics) {
|
|
var cropper = graphics.getComponent(componentNames.CROPPER);
|
|
cropper.start();
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var cropper = graphics.getComponent(componentNames.CROPPER);
|
|
cropper.end();
|
|
}
|
|
}]);
|
|
|
|
return CropperDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var drawingMode_cropper = (CropperDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/freeDrawing.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function drawingMode_freeDrawing_createSuper(Derived) { var hasNativeReflectConstruct = drawingMode_freeDrawing_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function drawingMode_freeDrawing_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* FreeDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var FreeDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(FreeDrawingMode, _DrawingMode);
|
|
|
|
var _super = drawingMode_freeDrawing_createSuper(FreeDrawingMode);
|
|
|
|
function FreeDrawingMode() {
|
|
_classCallCheck(this, FreeDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.FREE_DRAWING);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {{width: ?number, color: ?string}} [options] - Brush width & color
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(FreeDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics, options) {
|
|
var freeDrawing = graphics.getComponent(componentNames.FREE_DRAWING);
|
|
freeDrawing.start(options);
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var freeDrawing = graphics.getComponent(componentNames.FREE_DRAWING);
|
|
freeDrawing.end();
|
|
}
|
|
}]);
|
|
|
|
return FreeDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var drawingMode_freeDrawing = (FreeDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/lineDrawing.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function lineDrawing_createSuper(Derived) { var hasNativeReflectConstruct = lineDrawing_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function lineDrawing_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* LineDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var LineDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(LineDrawingMode, _DrawingMode);
|
|
|
|
var _super = lineDrawing_createSuper(LineDrawingMode);
|
|
|
|
function LineDrawingMode() {
|
|
_classCallCheck(this, LineDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.LINE_DRAWING);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {{width: ?number, color: ?string}} [options] - Brush width & color
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(LineDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics, options) {
|
|
var lineDrawing = graphics.getComponent(componentNames.LINE);
|
|
lineDrawing.start(options);
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var lineDrawing = graphics.getComponent(componentNames.LINE);
|
|
lineDrawing.end();
|
|
}
|
|
}]);
|
|
|
|
return LineDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var lineDrawing = (LineDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/shape.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function drawingMode_shape_createSuper(Derived) { var hasNativeReflectConstruct = drawingMode_shape_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function drawingMode_shape_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* ShapeDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var ShapeDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(ShapeDrawingMode, _DrawingMode);
|
|
|
|
var _super = drawingMode_shape_createSuper(ShapeDrawingMode);
|
|
|
|
function ShapeDrawingMode() {
|
|
_classCallCheck(this, ShapeDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.SHAPE);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(ShapeDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics) {
|
|
var shape = graphics.getComponent(componentNames.SHAPE);
|
|
shape.start();
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var shape = graphics.getComponent(componentNames.SHAPE);
|
|
shape.end();
|
|
}
|
|
}]);
|
|
|
|
return ShapeDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var drawingMode_shape = (ShapeDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/text.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function drawingMode_text_createSuper(Derived) { var hasNativeReflectConstruct = drawingMode_text_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function drawingMode_text_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* TextDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var TextDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(TextDrawingMode, _DrawingMode);
|
|
|
|
var _super = drawingMode_text_createSuper(TextDrawingMode);
|
|
|
|
function TextDrawingMode() {
|
|
_classCallCheck(this, TextDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.TEXT);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(TextDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics) {
|
|
var text = graphics.getComponent(componentNames.TEXT);
|
|
text.start();
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var text = graphics.getComponent(componentNames.TEXT);
|
|
text.end();
|
|
}
|
|
}]);
|
|
|
|
return TextDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var drawingMode_text = (TextDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/icon.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function drawingMode_icon_createSuper(Derived) { var hasNativeReflectConstruct = drawingMode_icon_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function drawingMode_icon_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* IconDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var IconDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(IconDrawingMode, _DrawingMode);
|
|
|
|
var _super = drawingMode_icon_createSuper(IconDrawingMode);
|
|
|
|
function IconDrawingMode() {
|
|
_classCallCheck(this, IconDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.ICON);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(IconDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics) {
|
|
var icon = graphics.getComponent(componentNames.ICON);
|
|
icon.start();
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var icon = graphics.getComponent(componentNames.ICON);
|
|
icon.end();
|
|
}
|
|
}]);
|
|
|
|
return IconDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var drawingMode_icon = (IconDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/zoom.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function drawingMode_zoom_createSuper(Derived) { var hasNativeReflectConstruct = drawingMode_zoom_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function drawingMode_zoom_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* ZoomDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var ZoomDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(ZoomDrawingMode, _DrawingMode);
|
|
|
|
var _super = drawingMode_zoom_createSuper(ZoomDrawingMode);
|
|
|
|
function ZoomDrawingMode() {
|
|
_classCallCheck(this, ZoomDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.ZOOM);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(ZoomDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics) {
|
|
var zoom = graphics.getComponent(componentNames.ZOOM);
|
|
zoom.start();
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var zoom = graphics.getComponent(componentNames.ZOOM);
|
|
zoom.end();
|
|
}
|
|
}]);
|
|
|
|
return ZoomDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var drawingMode_zoom = (ZoomDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/helper/selectionModifyHelper.js
|
|
|
|
|
|
|
|
/**
|
|
* Cached selection's info
|
|
* @type {Array}
|
|
* @private
|
|
*/
|
|
|
|
var cachedUndoDataForChangeDimension = null;
|
|
/**
|
|
* Set cached undo data
|
|
* @param {Array} undoData - selection object
|
|
* @private
|
|
*/
|
|
|
|
function setCachedUndoDataForDimension(undoData) {
|
|
cachedUndoDataForChangeDimension = undoData;
|
|
}
|
|
/**
|
|
* Get cached undo data
|
|
* @returns {Object} cached undo data
|
|
* @private
|
|
*/
|
|
|
|
function getCachedUndoDataForDimension() {
|
|
return cachedUndoDataForChangeDimension;
|
|
}
|
|
/**
|
|
* Make undo data
|
|
* @param {fabric.Object} obj - selection object
|
|
* @param {Function} undoDatumMaker - make undo datum
|
|
* @returns {Array} undoData
|
|
* @private
|
|
*/
|
|
|
|
function makeSelectionUndoData(obj, undoDatumMaker) {
|
|
var undoData;
|
|
|
|
if (obj.type === 'activeSelection') {
|
|
var _context;
|
|
|
|
undoData = map_default()(_context = obj.getObjects()).call(_context, function (item) {
|
|
var angle = item.angle,
|
|
left = item.left,
|
|
top = item.top,
|
|
scaleX = item.scaleX,
|
|
scaleY = item.scaleY,
|
|
width = item.width,
|
|
height = item.height;
|
|
fabric.fabric.util.addTransformToObject(item, obj.calcTransformMatrix());
|
|
var result = undoDatumMaker(item);
|
|
item.set({
|
|
angle: angle,
|
|
left: left,
|
|
top: top,
|
|
width: width,
|
|
height: height,
|
|
scaleX: scaleX,
|
|
scaleY: scaleY
|
|
});
|
|
return result;
|
|
});
|
|
} else {
|
|
undoData = [undoDatumMaker(obj)];
|
|
}
|
|
|
|
return undoData;
|
|
}
|
|
/**
|
|
* Make undo datum
|
|
* @param {number} id - object id
|
|
* @param {fabric.Object} obj - selection object
|
|
* @param {boolean} isSelection - whether or not object is selection
|
|
* @returns {Object} undo datum
|
|
* @private
|
|
*/
|
|
|
|
function makeSelectionUndoDatum(id, obj, isSelection) {
|
|
return isSelection ? {
|
|
id: id,
|
|
width: obj.width,
|
|
height: obj.height,
|
|
top: obj.top,
|
|
left: obj.left,
|
|
angle: obj.angle,
|
|
scaleX: obj.scaleX,
|
|
scaleY: obj.scaleY
|
|
} : extend_default()({
|
|
id: id
|
|
}, obj);
|
|
}
|
|
;// CONCATENATED MODULE: ./src/js/component/resize.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function component_resize_createSuper(Derived) { var hasNativeReflectConstruct = component_resize_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function component_resize_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* Resize components
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @extends {Component}
|
|
* @class Resize
|
|
* @ignore
|
|
*/
|
|
|
|
var resize_Resize = /*#__PURE__*/function (_Component) {
|
|
_inherits(Resize, _Component);
|
|
|
|
var _super = component_resize_createSuper(Resize);
|
|
|
|
function Resize(graphics) {
|
|
var _this;
|
|
|
|
_classCallCheck(this, Resize);
|
|
|
|
_this = _super.call(this, componentNames.RESIZE, graphics);
|
|
/**
|
|
* Current dimensions
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._dimensions = null;
|
|
/**
|
|
* Original dimensions
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
_this._originalDimensions = null;
|
|
return _this;
|
|
}
|
|
/**
|
|
* Get current dimensions
|
|
* @returns {object}
|
|
*/
|
|
|
|
|
|
_createClass(Resize, [{
|
|
key: "getCurrentDimensions",
|
|
value: function getCurrentDimensions() {
|
|
var canvasImage = this.getCanvasImage();
|
|
|
|
if (!this._dimensions && canvasImage) {
|
|
var width = canvasImage.width,
|
|
height = canvasImage.height;
|
|
this._dimensions = {
|
|
width: width,
|
|
height: height
|
|
};
|
|
}
|
|
|
|
return this._dimensions;
|
|
}
|
|
/**
|
|
* Get original dimensions
|
|
* @returns {object}
|
|
*/
|
|
|
|
}, {
|
|
key: "getOriginalDimensions",
|
|
value: function getOriginalDimensions() {
|
|
return this._originalDimensions;
|
|
}
|
|
/**
|
|
* Set original dimensions
|
|
* @param {object} dimensions - Dimensions
|
|
*/
|
|
|
|
}, {
|
|
key: "setOriginalDimensions",
|
|
value: function setOriginalDimensions(dimensions) {
|
|
this._originalDimensions = dimensions;
|
|
}
|
|
/**
|
|
* Resize Image
|
|
* @param {Object} dimensions - Resize dimensions
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "resize",
|
|
value: function resize(dimensions) {
|
|
var canvasImage = this.getCanvasImage();
|
|
var width = canvasImage.width,
|
|
height = canvasImage.height,
|
|
scaleX = canvasImage.scaleX,
|
|
scaleY = canvasImage.scaleY;
|
|
var dimensionsWidth = dimensions.width,
|
|
dimensionsHeight = dimensions.height;
|
|
var scaleValues = {
|
|
scaleX: dimensionsWidth ? dimensionsWidth / width : scaleX,
|
|
scaleY: dimensionsHeight ? dimensionsHeight / height : scaleY
|
|
};
|
|
|
|
if (scaleX !== scaleValues.scaleX || scaleY !== scaleValues.scaleY) {
|
|
canvasImage.set(scaleValues).setCoords();
|
|
this._dimensions = {
|
|
width: canvasImage.width * canvasImage.scaleX,
|
|
height: canvasImage.height * canvasImage.scaleY
|
|
};
|
|
}
|
|
|
|
this.adjustCanvasDimensionBase();
|
|
return promise_default().resolve();
|
|
}
|
|
/**
|
|
* Start resizing
|
|
*/
|
|
|
|
}, {
|
|
key: "start",
|
|
value: function start() {
|
|
var dimensions = this.getCurrentDimensions();
|
|
this.setOriginalDimensions(dimensions);
|
|
}
|
|
/**
|
|
* End resizing
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end() {}
|
|
}]);
|
|
|
|
return Resize;
|
|
}(component);
|
|
|
|
/* harmony default export */ var component_resize = (resize_Resize);
|
|
;// CONCATENATED MODULE: ./src/js/drawingMode/resize.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
function drawingMode_resize_createSuper(Derived) { var hasNativeReflectConstruct = drawingMode_resize_isNativeReflectConstruct(); return function _createSuperInternal() { var Super = _getPrototypeOf(Derived), result; if (hasNativeReflectConstruct) { var NewTarget = _getPrototypeOf(this).constructor; result = construct_default()(Super, arguments, NewTarget); } else { result = Super.apply(this, arguments); } return _possibleConstructorReturn(this, result); }; }
|
|
|
|
function drawingMode_resize_isNativeReflectConstruct() { if (typeof Reflect === "undefined" || !(construct_default())) return false; if ((construct_default()).sham) return false; if (typeof Proxy === "function") return true; try { Boolean.prototype.valueOf.call(construct_default()(Boolean, [], function () {})); return true; } catch (e) { return false; } }
|
|
|
|
|
|
|
|
/**
|
|
* ResizeDrawingMode class
|
|
* @class
|
|
* @ignore
|
|
*/
|
|
|
|
var ResizeDrawingMode = /*#__PURE__*/function (_DrawingMode) {
|
|
_inherits(ResizeDrawingMode, _DrawingMode);
|
|
|
|
var _super = drawingMode_resize_createSuper(ResizeDrawingMode);
|
|
|
|
function ResizeDrawingMode() {
|
|
_classCallCheck(this, ResizeDrawingMode);
|
|
|
|
return _super.call(this, drawingModes.RESIZE);
|
|
}
|
|
/**
|
|
* start this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
|
|
_createClass(ResizeDrawingMode, [{
|
|
key: "start",
|
|
value: function start(graphics) {
|
|
var resize = graphics.getComponent(componentNames.RESIZE);
|
|
resize.start();
|
|
}
|
|
/**
|
|
* stop this drawing mode
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @override
|
|
*/
|
|
|
|
}, {
|
|
key: "end",
|
|
value: function end(graphics) {
|
|
var resize = graphics.getComponent(componentNames.RESIZE);
|
|
resize.end();
|
|
}
|
|
}]);
|
|
|
|
return ResizeDrawingMode;
|
|
}(drawingMode);
|
|
|
|
/* harmony default export */ var drawingMode_resize = (ResizeDrawingMode);
|
|
;// CONCATENATED MODULE: ./src/js/graphics.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var DEFAULT_CSS_MAX_WIDTH = 1000;
|
|
var DEFAULT_CSS_MAX_HEIGHT = 800;
|
|
var EXTRA_PX_FOR_PASTE = 10;
|
|
var cssOnly = {
|
|
cssOnly: true
|
|
};
|
|
var backstoreOnly = {
|
|
backstoreOnly: true
|
|
};
|
|
/**
|
|
* Graphics class
|
|
* @class
|
|
* @param {string|HTMLElement} wrapper - Wrapper's element or selector
|
|
* @param {Object} [option] - Canvas max width & height of css
|
|
* @param {number} option.cssMaxWidth - Canvas css-max-width
|
|
* @param {number} option.cssMaxHeight - Canvas css-max-height
|
|
* @ignore
|
|
*/
|
|
|
|
var Graphics = /*#__PURE__*/function () {
|
|
function Graphics(element) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11;
|
|
|
|
var _ref = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : {},
|
|
cssMaxWidth = _ref.cssMaxWidth,
|
|
cssMaxHeight = _ref.cssMaxHeight;
|
|
|
|
_classCallCheck(this, Graphics);
|
|
|
|
/**
|
|
* Fabric image instance
|
|
* @type {fabric.Image}
|
|
*/
|
|
this.canvasImage = null;
|
|
/**
|
|
* Max width of canvas elements
|
|
* @type {number}
|
|
*/
|
|
|
|
this.cssMaxWidth = cssMaxWidth || DEFAULT_CSS_MAX_WIDTH;
|
|
/**
|
|
* Max height of canvas elements
|
|
* @type {number}
|
|
*/
|
|
|
|
this.cssMaxHeight = cssMaxHeight || DEFAULT_CSS_MAX_HEIGHT;
|
|
/**
|
|
* cropper Selection Style
|
|
* @type {Object}
|
|
*/
|
|
|
|
this.cropSelectionStyle = {};
|
|
/**
|
|
* target fabric object for copy paste feature
|
|
* @type {fabric.Object}
|
|
* @private
|
|
*/
|
|
|
|
this.targetObjectForCopyPaste = null;
|
|
/**
|
|
* Image name
|
|
* @type {string}
|
|
*/
|
|
|
|
this.imageName = '';
|
|
/**
|
|
* Object Map
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
this._objects = {};
|
|
/**
|
|
* Fabric-Canvas instance
|
|
* @type {fabric.Canvas}
|
|
* @private
|
|
*/
|
|
|
|
this._canvas = null;
|
|
/**
|
|
* Drawing mode
|
|
* @type {string}
|
|
* @private
|
|
*/
|
|
|
|
this._drawingMode = drawingModes.NORMAL;
|
|
/**
|
|
* DrawingMode map
|
|
* @type {Object.<string, DrawingMode>}
|
|
* @private
|
|
*/
|
|
|
|
this._drawingModeMap = {};
|
|
/**
|
|
* Component map
|
|
* @type {Object.<string, Component>}
|
|
* @private
|
|
*/
|
|
|
|
this._componentMap = {};
|
|
/**
|
|
* fabric event handlers
|
|
* @type {Object.<string, function>}
|
|
* @private
|
|
*/
|
|
|
|
this._handler = {
|
|
onMouseDown: bind_default()(_context = this._onMouseDown).call(_context, this),
|
|
onObjectAdded: bind_default()(_context2 = this._onObjectAdded).call(_context2, this),
|
|
onObjectRemoved: bind_default()(_context3 = this._onObjectRemoved).call(_context3, this),
|
|
onObjectMoved: bind_default()(_context4 = this._onObjectMoved).call(_context4, this),
|
|
onObjectScaled: bind_default()(_context5 = this._onObjectScaled).call(_context5, this),
|
|
onObjectModified: bind_default()(_context6 = this._onObjectModified).call(_context6, this),
|
|
onObjectRotated: bind_default()(_context7 = this._onObjectRotated).call(_context7, this),
|
|
onObjectSelected: bind_default()(_context8 = this._onObjectSelected).call(_context8, this),
|
|
onPathCreated: bind_default()(_context9 = this._onPathCreated).call(_context9, this),
|
|
onSelectionCleared: bind_default()(_context10 = this._onSelectionCleared).call(_context10, this),
|
|
onSelectionCreated: bind_default()(_context11 = this._onSelectionCreated).call(_context11, this)
|
|
};
|
|
|
|
this._setObjectCachingToFalse();
|
|
|
|
this._setCanvasElement(element);
|
|
|
|
this._createDrawingModeInstances();
|
|
|
|
this._createComponents();
|
|
|
|
this._attachCanvasEvents();
|
|
|
|
this._attachZoomEvents();
|
|
}
|
|
/**
|
|
* Destroy canvas element
|
|
*/
|
|
|
|
|
|
_createClass(Graphics, [{
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
var wrapperEl = this._canvas.wrapperEl;
|
|
|
|
this._canvas.clear();
|
|
|
|
wrapperEl.parentNode.removeChild(wrapperEl);
|
|
|
|
this._detachZoomEvents();
|
|
}
|
|
/**
|
|
* Attach zoom events
|
|
*/
|
|
|
|
}, {
|
|
key: "_attachZoomEvents",
|
|
value: function _attachZoomEvents() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.attachKeyboardZoomEvents();
|
|
}
|
|
/**
|
|
* Detach zoom events
|
|
*/
|
|
|
|
}, {
|
|
key: "_detachZoomEvents",
|
|
value: function _detachZoomEvents() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.detachKeyboardZoomEvents();
|
|
}
|
|
/**
|
|
* Deactivates all objects on canvas
|
|
* @returns {Graphics} this
|
|
*/
|
|
|
|
}, {
|
|
key: "deactivateAll",
|
|
value: function deactivateAll() {
|
|
this._canvas.discardActiveObject();
|
|
|
|
return this;
|
|
}
|
|
/**
|
|
* Renders all objects on canvas
|
|
* @returns {Graphics} this
|
|
*/
|
|
|
|
}, {
|
|
key: "renderAll",
|
|
value: function renderAll() {
|
|
this._canvas.renderAll();
|
|
|
|
return this;
|
|
}
|
|
/**
|
|
* Adds objects on canvas
|
|
* @param {Object|Array} objects - objects
|
|
*/
|
|
|
|
}, {
|
|
key: "add",
|
|
value: function add(objects) {
|
|
var _this$_canvas;
|
|
|
|
var theArgs = [];
|
|
|
|
if (isArray_default()(objects)) {
|
|
theArgs = objects;
|
|
} else {
|
|
theArgs.push(objects);
|
|
}
|
|
|
|
(_this$_canvas = this._canvas).add.apply(_this$_canvas, _toConsumableArray(theArgs));
|
|
}
|
|
/**
|
|
* Removes the object or group
|
|
* @param {Object} target - graphics object or group
|
|
* @returns {boolean} true if contains or false
|
|
*/
|
|
|
|
}, {
|
|
key: "contains",
|
|
value: function contains(target) {
|
|
return this._canvas.contains(target);
|
|
}
|
|
/**
|
|
* Gets all objects or group
|
|
* @returns {Array} all objects, shallow copy
|
|
*/
|
|
|
|
}, {
|
|
key: "getObjects",
|
|
value: function getObjects() {
|
|
var _context12;
|
|
|
|
return slice_default()(_context12 = this._canvas.getObjects()).call(_context12);
|
|
}
|
|
/**
|
|
* Get an object by id
|
|
* @param {number} id - object id
|
|
* @returns {fabric.Object} object corresponding id
|
|
*/
|
|
|
|
}, {
|
|
key: "getObject",
|
|
value: function getObject(id) {
|
|
return this._objects[id];
|
|
}
|
|
/**
|
|
* Removes the object or group
|
|
* @param {Object} target - graphics object or group
|
|
*/
|
|
|
|
}, {
|
|
key: "remove",
|
|
value: function remove(target) {
|
|
this._canvas.remove(target);
|
|
}
|
|
/**
|
|
* Removes all object or group
|
|
* @param {boolean} includesBackground - remove the background image or not
|
|
* @returns {Array} all objects array which is removed
|
|
*/
|
|
|
|
}, {
|
|
key: "removeAll",
|
|
value: function removeAll(includesBackground) {
|
|
var _context13;
|
|
|
|
var canvas = this._canvas;
|
|
|
|
var objects = slice_default()(_context13 = canvas.getObjects()).call(_context13);
|
|
|
|
canvas.remove.apply(canvas, _toConsumableArray(this._canvas.getObjects()));
|
|
|
|
if (includesBackground) {
|
|
canvas.clear();
|
|
}
|
|
|
|
return objects;
|
|
}
|
|
/**
|
|
* Removes an object or group by id
|
|
* @param {number} id - object id
|
|
* @returns {Array} removed objects
|
|
*/
|
|
|
|
}, {
|
|
key: "removeObjectById",
|
|
value: function removeObjectById(id) {
|
|
var objects = [];
|
|
var canvas = this._canvas;
|
|
var target = this.getObject(id);
|
|
var isValidGroup = target && target.isType('group') && !target.isEmpty();
|
|
|
|
if (isValidGroup) {
|
|
canvas.discardActiveObject(); // restore states for each objects
|
|
|
|
target.forEachObject(function (obj) {
|
|
objects.push(obj);
|
|
canvas.remove(obj);
|
|
});
|
|
} else if (canvas.contains(target)) {
|
|
objects.push(target);
|
|
canvas.remove(target);
|
|
}
|
|
|
|
return objects;
|
|
}
|
|
/**
|
|
* Get an id by object instance
|
|
* @param {fabric.Object} object object
|
|
* @returns {number} object id if it exists or null
|
|
*/
|
|
|
|
}, {
|
|
key: "getObjectId",
|
|
value: function getObjectId(object) {
|
|
var key = null;
|
|
|
|
for (key in this._objects) {
|
|
if (this._objects.hasOwnProperty(key)) {
|
|
if (object === this._objects[key]) {
|
|
return key;
|
|
}
|
|
}
|
|
}
|
|
|
|
return null;
|
|
}
|
|
/**
|
|
* Gets an active object or group
|
|
* @returns {Object} active object or group instance
|
|
*/
|
|
|
|
}, {
|
|
key: "getActiveObject",
|
|
value: function getActiveObject() {
|
|
return this._canvas._activeObject;
|
|
}
|
|
/**
|
|
* Returns the object ID to delete the object.
|
|
* @returns {number} object id for remove
|
|
*/
|
|
|
|
}, {
|
|
key: "getActiveObjectIdForRemove",
|
|
value: function getActiveObjectIdForRemove() {
|
|
var activeObject = this.getActiveObject();
|
|
var type = activeObject.type,
|
|
left = activeObject.left,
|
|
top = activeObject.top;
|
|
var isSelection = type === 'activeSelection';
|
|
|
|
if (isSelection) {
|
|
var group = new fabric.fabric.Group(_toConsumableArray(activeObject.getObjects()), {
|
|
left: left,
|
|
top: top
|
|
});
|
|
return this._addFabricObject(group);
|
|
}
|
|
|
|
return this.getObjectId(activeObject);
|
|
}
|
|
/**
|
|
* Verify that you are ready to erase the object.
|
|
* @returns {boolean} ready for object remove
|
|
*/
|
|
|
|
}, {
|
|
key: "isReadyRemoveObject",
|
|
value: function isReadyRemoveObject() {
|
|
var activeObject = this.getActiveObject();
|
|
return activeObject && !activeObject.isEditing;
|
|
}
|
|
/**
|
|
* Gets an active group object
|
|
* @returns {Object} active group object instance
|
|
*/
|
|
|
|
}, {
|
|
key: "getActiveObjects",
|
|
value: function getActiveObjects() {
|
|
var activeObject = this._canvas._activeObject;
|
|
return activeObject && activeObject.type === 'activeSelection' ? activeObject : null;
|
|
}
|
|
/**
|
|
* Get Active object Selection from object ids
|
|
* @param {Array.<Object>} objects - fabric objects
|
|
* @returns {Object} target - target object group
|
|
*/
|
|
|
|
}, {
|
|
key: "getActiveSelectionFromObjects",
|
|
value: function getActiveSelectionFromObjects(objects) {
|
|
var canvas = this.getCanvas();
|
|
return new fabric.fabric.ActiveSelection(objects, {
|
|
canvas: canvas
|
|
});
|
|
}
|
|
/**
|
|
* Activates an object or group
|
|
* @param {Object} target - target object or group
|
|
*/
|
|
|
|
}, {
|
|
key: "setActiveObject",
|
|
value: function setActiveObject(target) {
|
|
this._canvas.setActiveObject(target);
|
|
}
|
|
/**
|
|
* Set Crop selection style
|
|
* @param {Object} style - Selection styles
|
|
*/
|
|
|
|
}, {
|
|
key: "setCropSelectionStyle",
|
|
value: function setCropSelectionStyle(style) {
|
|
this.cropSelectionStyle = style;
|
|
}
|
|
/**
|
|
* Get component
|
|
* @param {string} name - Component name
|
|
* @returns {Component}
|
|
*/
|
|
|
|
}, {
|
|
key: "getComponent",
|
|
value: function getComponent(name) {
|
|
return this._componentMap[name];
|
|
}
|
|
/**
|
|
* Get current drawing mode
|
|
* @returns {string}
|
|
*/
|
|
|
|
}, {
|
|
key: "getDrawingMode",
|
|
value: function getDrawingMode() {
|
|
return this._drawingMode;
|
|
}
|
|
/**
|
|
* Start a drawing mode. If the current mode is not 'NORMAL', 'stopDrawingMode()' will be called first.
|
|
* @param {String} mode Can be one of <I>'CROPPER', 'FREE_DRAWING', 'LINE', 'TEXT', 'SHAPE'</I>
|
|
* @param {Object} [option] parameters of drawing mode, it's available with 'FREE_DRAWING', 'LINE_DRAWING'
|
|
* @param {Number} [option.width] brush width
|
|
* @param {String} [option.color] brush color
|
|
* @returns {boolean} true if success or false
|
|
*/
|
|
|
|
}, {
|
|
key: "startDrawingMode",
|
|
value: function startDrawingMode(mode, option) {
|
|
if (this._isSameDrawingMode(mode)) {
|
|
return true;
|
|
} // If the current mode is not 'NORMAL', 'stopDrawingMode()' will be called first.
|
|
|
|
|
|
this.stopDrawingMode();
|
|
|
|
var drawingModeInstance = this._getDrawingModeInstance(mode);
|
|
|
|
if (drawingModeInstance && drawingModeInstance.start) {
|
|
drawingModeInstance.start(this, option);
|
|
this._drawingMode = mode;
|
|
}
|
|
|
|
return !!drawingModeInstance;
|
|
}
|
|
/**
|
|
* Stop the current drawing mode and back to the 'NORMAL' mode
|
|
*/
|
|
|
|
}, {
|
|
key: "stopDrawingMode",
|
|
value: function stopDrawingMode() {
|
|
if (this._isSameDrawingMode(drawingModes.NORMAL)) {
|
|
return;
|
|
}
|
|
|
|
var drawingModeInstance = this._getDrawingModeInstance(this.getDrawingMode());
|
|
|
|
if (drawingModeInstance && drawingModeInstance.end) {
|
|
drawingModeInstance.end(this);
|
|
}
|
|
|
|
this._drawingMode = drawingModes.NORMAL;
|
|
}
|
|
/**
|
|
* Change zoom of canvas
|
|
* @param {{x: number, y: number}} center - center of zoom
|
|
* @param {number} zoomLevel - zoom level
|
|
*/
|
|
|
|
}, {
|
|
key: "zoom",
|
|
value: function zoom(_ref2, zoomLevel) {
|
|
var x = _ref2.x,
|
|
y = _ref2.y;
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.zoom({
|
|
x: x,
|
|
y: y
|
|
}, zoomLevel);
|
|
}
|
|
/**
|
|
* Get zoom mode
|
|
* @returns {string}
|
|
*/
|
|
|
|
}, {
|
|
key: "getZoomMode",
|
|
value: function getZoomMode() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
return zoom.mode;
|
|
}
|
|
/**
|
|
* Start zoom-in mode
|
|
*/
|
|
|
|
}, {
|
|
key: "startZoomInMode",
|
|
value: function startZoomInMode() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.startZoomInMode();
|
|
}
|
|
/**
|
|
* Stop zoom-in mode
|
|
*/
|
|
|
|
}, {
|
|
key: "endZoomInMode",
|
|
value: function endZoomInMode() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.endZoomInMode();
|
|
}
|
|
/**
|
|
* Zoom out one step
|
|
*/
|
|
|
|
}, {
|
|
key: "zoomOut",
|
|
value: function zoomOut() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.zoomOut();
|
|
}
|
|
/**
|
|
* Start hand mode
|
|
*/
|
|
|
|
}, {
|
|
key: "startHandMode",
|
|
value: function startHandMode() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.startHandMode();
|
|
}
|
|
/**
|
|
* Stop hand mode
|
|
*/
|
|
|
|
}, {
|
|
key: "endHandMode",
|
|
value: function endHandMode() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.endHandMode();
|
|
}
|
|
/**
|
|
* Zoom reset
|
|
*/
|
|
|
|
}, {
|
|
key: "resetZoom",
|
|
value: function resetZoom() {
|
|
var zoom = this.getComponent(componentNames.ZOOM);
|
|
zoom.resetZoom();
|
|
}
|
|
/**
|
|
* To data url from canvas
|
|
* @param {Object} options - options for toDataURL
|
|
* @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png"
|
|
* @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg.
|
|
* @param {Number} [options.multiplier=1] Multiplier to scale by
|
|
* @param {Number} [options.left] Cropping left offset. Introduced in fabric v1.2.14
|
|
* @param {Number} [options.top] Cropping top offset. Introduced in fabric v1.2.14
|
|
* @param {Number} [options.width] Cropping width. Introduced in fabric v1.2.14
|
|
* @param {Number} [options.height] Cropping height. Introduced in fabric v1.2.14
|
|
* @returns {string} A DOMString containing the requested data URI.
|
|
*/
|
|
|
|
}, {
|
|
key: "toDataURL",
|
|
value: function toDataURL(options) {
|
|
var cropper = this.getComponent(componentNames.CROPPER);
|
|
cropper.changeVisibility(false);
|
|
|
|
var dataUrl = this._canvas && this._canvas.toDataURL(options);
|
|
|
|
cropper.changeVisibility(true);
|
|
return dataUrl;
|
|
}
|
|
/**
|
|
* Save image(background) of canvas
|
|
* @param {string} name - Name of image
|
|
* @param {?fabric.Image} canvasImage - Fabric image instance
|
|
*/
|
|
|
|
}, {
|
|
key: "setCanvasImage",
|
|
value: function setCanvasImage(name, canvasImage) {
|
|
if (canvasImage) {
|
|
stamp(canvasImage);
|
|
}
|
|
|
|
this.imageName = name;
|
|
this.canvasImage = canvasImage;
|
|
}
|
|
/**
|
|
* Set css max dimension
|
|
* @param {{width: number, height: number}} maxDimension - Max width & Max height
|
|
*/
|
|
|
|
}, {
|
|
key: "setCssMaxDimension",
|
|
value: function setCssMaxDimension(maxDimension) {
|
|
this.cssMaxWidth = maxDimension.width || this.cssMaxWidth;
|
|
this.cssMaxHeight = maxDimension.height || this.cssMaxHeight;
|
|
}
|
|
/**
|
|
* Adjust canvas dimension with scaling image
|
|
*/
|
|
|
|
}, {
|
|
key: "adjustCanvasDimension",
|
|
value: function adjustCanvasDimension() {
|
|
this.adjustCanvasDimensionBase(this.canvasImage.scale(1));
|
|
}
|
|
}, {
|
|
key: "adjustCanvasDimensionBase",
|
|
value: function adjustCanvasDimensionBase() {
|
|
var canvasImage = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : null;
|
|
|
|
if (!canvasImage) {
|
|
canvasImage = this.canvasImage;
|
|
}
|
|
|
|
var _canvasImage$getBound = canvasImage.getBoundingRect(),
|
|
width = _canvasImage$getBound.width,
|
|
height = _canvasImage$getBound.height;
|
|
|
|
var maxDimension = this._calcMaxDimension(width, height);
|
|
|
|
this.setCanvasCssDimension({
|
|
width: '100%',
|
|
height: '100%',
|
|
// Set height '' for IE9
|
|
'max-width': "".concat(maxDimension.width, "px"),
|
|
'max-height': "".concat(maxDimension.height, "px")
|
|
});
|
|
this.setCanvasBackstoreDimension({
|
|
width: width,
|
|
height: height
|
|
});
|
|
|
|
this._canvas.centerObject(canvasImage);
|
|
}
|
|
/**
|
|
* Set canvas dimension - css only
|
|
* {@link http://fabricjs.com/docs/fabric.Canvas.html#setDimensions}
|
|
* @param {Object} dimension - Canvas css dimension
|
|
*/
|
|
|
|
}, {
|
|
key: "setCanvasCssDimension",
|
|
value: function setCanvasCssDimension(dimension) {
|
|
this._canvas.setDimensions(dimension, cssOnly);
|
|
}
|
|
/**
|
|
* Set canvas dimension - backstore only
|
|
* {@link http://fabricjs.com/docs/fabric.Canvas.html#setDimensions}
|
|
* @param {Object} dimension - Canvas backstore dimension
|
|
*/
|
|
|
|
}, {
|
|
key: "setCanvasBackstoreDimension",
|
|
value: function setCanvasBackstoreDimension(dimension) {
|
|
this._canvas.setDimensions(dimension, backstoreOnly);
|
|
}
|
|
/**
|
|
* Set image properties
|
|
* {@link http://fabricjs.com/docs/fabric.Image.html#set}
|
|
* @param {Object} setting - Image properties
|
|
* @param {boolean} [withRendering] - If true, The changed image will be reflected in the canvas
|
|
*/
|
|
|
|
}, {
|
|
key: "setImageProperties",
|
|
value: function setImageProperties(setting, withRendering) {
|
|
var canvasImage = this.canvasImage;
|
|
|
|
if (!canvasImage) {
|
|
return;
|
|
}
|
|
|
|
canvasImage.set(setting).setCoords();
|
|
|
|
if (withRendering) {
|
|
this._canvas.renderAll();
|
|
}
|
|
}
|
|
/**
|
|
* Returns canvas element of fabric.Canvas[[lower-canvas]]
|
|
* @returns {HTMLCanvasElement}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvasElement",
|
|
value: function getCanvasElement() {
|
|
return this._canvas.getElement();
|
|
}
|
|
/**
|
|
* Get fabric.Canvas instance
|
|
* @returns {fabric.Canvas}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvas",
|
|
value: function getCanvas() {
|
|
return this._canvas;
|
|
}
|
|
/**
|
|
* Get canvasImage (fabric.Image instance)
|
|
* @returns {fabric.Image}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvasImage",
|
|
value: function getCanvasImage() {
|
|
return this.canvasImage;
|
|
}
|
|
/**
|
|
* Get image name
|
|
* @returns {string}
|
|
*/
|
|
|
|
}, {
|
|
key: "getImageName",
|
|
value: function getImageName() {
|
|
return this.imageName;
|
|
}
|
|
/**
|
|
* Add image object on canvas
|
|
* @param {string} imgUrl - Image url to make object
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "addImageObject",
|
|
value: function addImageObject(imgUrl) {
|
|
var _context14,
|
|
_this = this;
|
|
|
|
var callback = bind_default()(_context14 = this._callbackAfterLoadingImageObject).call(_context14, this);
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
fabric.fabric.Image.fromURL(imgUrl, function (image) {
|
|
callback(image);
|
|
resolve(_this.createObjectProperties(image));
|
|
}, {
|
|
crossOrigin: 'Anonymous'
|
|
});
|
|
});
|
|
}
|
|
/**
|
|
* Get center position of canvas
|
|
* @returns {Object} {left, top}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCenter",
|
|
value: function getCenter() {
|
|
return this._canvas.getCenter();
|
|
}
|
|
/**
|
|
* Get cropped rect
|
|
* @returns {Object} rect
|
|
*/
|
|
|
|
}, {
|
|
key: "getCropzoneRect",
|
|
value: function getCropzoneRect() {
|
|
return this.getComponent(componentNames.CROPPER).getCropzoneRect();
|
|
}
|
|
/**
|
|
* Get cropped rect
|
|
* @param {number} [mode] cropzone rect mode
|
|
*/
|
|
|
|
}, {
|
|
key: "setCropzoneRect",
|
|
value: function setCropzoneRect(mode) {
|
|
this.getComponent(componentNames.CROPPER).setCropzoneRect(mode);
|
|
}
|
|
/**
|
|
* Get cropped image data
|
|
* @param {Object} cropRect cropzone rect
|
|
* @param {Number} cropRect.left left position
|
|
* @param {Number} cropRect.top top position
|
|
* @param {Number} cropRect.width width
|
|
* @param {Number} cropRect.height height
|
|
* @returns {?{imageName: string, url: string}} cropped Image data
|
|
*/
|
|
|
|
}, {
|
|
key: "getCroppedImageData",
|
|
value: function getCroppedImageData(cropRect) {
|
|
return this.getComponent(componentNames.CROPPER).getCroppedImageData(cropRect);
|
|
}
|
|
/**
|
|
* Set brush option
|
|
* @param {Object} option brush option
|
|
* @param {Number} option.width width
|
|
* @param {String} option.color color like 'FFFFFF', 'rgba(0, 0, 0, 0.5)'
|
|
*/
|
|
|
|
}, {
|
|
key: "setBrush",
|
|
value: function setBrush(option) {
|
|
var drawingMode = this._drawingMode;
|
|
var compName = componentNames.FREE_DRAWING;
|
|
|
|
if (drawingMode === drawingModes.LINE_DRAWING) {
|
|
compName = componentNames.LINE;
|
|
}
|
|
|
|
this.getComponent(compName).setBrush(option);
|
|
}
|
|
/**
|
|
* Set states of current drawing shape
|
|
* @param {string} type - Shape type (ex: 'rect', 'circle', 'triangle')
|
|
* @param {Object} [options] - Shape options
|
|
* @param {(ShapeFillOption | string)} [options.fill] - {@link ShapeFillOption} or
|
|
* Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stoke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.isRegular] - Whether resizing shape has 1:1 ratio or not
|
|
*/
|
|
|
|
}, {
|
|
key: "setDrawingShape",
|
|
value: function setDrawingShape(type, options) {
|
|
this.getComponent(componentNames.SHAPE).setStates(type, options);
|
|
}
|
|
/**
|
|
* Set style of current drawing icon
|
|
* @param {string} type - icon type (ex: 'icon-arrow', 'icon-star')
|
|
* @param {Object} [iconColor] - Icon color
|
|
*/
|
|
|
|
}, {
|
|
key: "setIconStyle",
|
|
value: function setIconStyle(type, iconColor) {
|
|
this.getComponent(componentNames.ICON).setStates(type, iconColor);
|
|
}
|
|
/**
|
|
* Register icon paths
|
|
* @param {Object} pathInfos - Path infos
|
|
* @param {string} pathInfos.key - key
|
|
* @param {string} pathInfos.value - value
|
|
*/
|
|
|
|
}, {
|
|
key: "registerPaths",
|
|
value: function registerPaths(pathInfos) {
|
|
this.getComponent(componentNames.ICON).registerPaths(pathInfos);
|
|
}
|
|
/**
|
|
* Change cursor style
|
|
* @param {string} cursorType - cursor type
|
|
*/
|
|
|
|
}, {
|
|
key: "changeCursor",
|
|
value: function changeCursor(cursorType) {
|
|
var canvas = this.getCanvas();
|
|
canvas.defaultCursor = cursorType;
|
|
canvas.renderAll();
|
|
}
|
|
/**
|
|
* Whether it has the filter or not
|
|
* @param {string} type - Filter type
|
|
* @returns {boolean} true if it has the filter
|
|
*/
|
|
|
|
}, {
|
|
key: "hasFilter",
|
|
value: function hasFilter(type) {
|
|
return this.getComponent(componentNames.FILTER).hasFilter(type);
|
|
}
|
|
/**
|
|
* Set selection style of fabric object by init option
|
|
* @param {Object} styles - Selection styles
|
|
*/
|
|
|
|
}, {
|
|
key: "setSelectionStyle",
|
|
value: function setSelectionStyle(styles) {
|
|
extend_default()(fObjectOptions.SELECTION_STYLE, styles);
|
|
}
|
|
/**
|
|
* Set object properties
|
|
* @param {number} id - object id
|
|
* @param {Object} props - props
|
|
* @param {string} [props.fill] Color
|
|
* @param {string} [props.fontFamily] Font type for text
|
|
* @param {number} [props.fontSize] Size
|
|
* @param {string} [props.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [props.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [props.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [props.textDecoration] Type of line (underline / line-through / overline)
|
|
* @returns {Object} applied properties
|
|
*/
|
|
|
|
}, {
|
|
key: "setObjectProperties",
|
|
value: function setObjectProperties(id, props) {
|
|
var object = this.getObject(id);
|
|
var clone = extend_default()({}, props);
|
|
object.set(clone);
|
|
object.setCoords();
|
|
this.getCanvas().renderAll();
|
|
return clone;
|
|
}
|
|
/**
|
|
* Get object properties corresponding key
|
|
* @param {number} id - object id
|
|
* @param {Array<string>|ObjectProps|string} keys - property's key
|
|
* @returns {Object} properties
|
|
*/
|
|
|
|
}, {
|
|
key: "getObjectProperties",
|
|
value: function getObjectProperties(id, keys) {
|
|
var object = this.getObject(id);
|
|
var props = {};
|
|
|
|
if (isString_default()(keys)) {
|
|
props[keys] = object[keys];
|
|
} else if (isArray_default()(keys)) {
|
|
forEachArray_default()(keys, function (value) {
|
|
props[value] = object[value];
|
|
});
|
|
} else {
|
|
forEachOwnProperties_default()(keys, function (value, key) {
|
|
props[key] = object[key];
|
|
});
|
|
}
|
|
|
|
return props;
|
|
}
|
|
/**
|
|
* Get object position by originX, originY
|
|
* @param {number} id - object id
|
|
* @param {string} originX - can be 'left', 'center', 'right'
|
|
* @param {string} originY - can be 'top', 'center', 'bottom'
|
|
* @returns {Object} {{x:number, y: number}} position by origin if id is valid, or null
|
|
*/
|
|
|
|
}, {
|
|
key: "getObjectPosition",
|
|
value: function getObjectPosition(id, originX, originY) {
|
|
var targetObj = this.getObject(id);
|
|
|
|
if (!targetObj) {
|
|
return null;
|
|
}
|
|
|
|
return targetObj.getPointByOrigin(originX, originY);
|
|
}
|
|
/**
|
|
* Set object position by originX, originY
|
|
* @param {number} id - object id
|
|
* @param {Object} posInfo - position object
|
|
* @param {number} posInfo.x - x position
|
|
* @param {number} posInfo.y - y position
|
|
* @param {string} posInfo.originX - can be 'left', 'center', 'right'
|
|
* @param {string} posInfo.originY - can be 'top', 'center', 'bottom'
|
|
* @returns {boolean} true if target id is valid or false
|
|
*/
|
|
|
|
}, {
|
|
key: "setObjectPosition",
|
|
value: function setObjectPosition(id, posInfo) {
|
|
var targetObj = this.getObject(id);
|
|
var x = posInfo.x,
|
|
y = posInfo.y,
|
|
originX = posInfo.originX,
|
|
originY = posInfo.originY;
|
|
|
|
if (!targetObj) {
|
|
return false;
|
|
}
|
|
|
|
var targetOrigin = targetObj.getPointByOrigin(originX, originY);
|
|
var centerOrigin = targetObj.getPointByOrigin('center', 'center');
|
|
var diffX = centerOrigin.x - targetOrigin.x;
|
|
var diffY = centerOrigin.y - targetOrigin.y;
|
|
targetObj.set({
|
|
left: x + diffX,
|
|
top: y + diffY
|
|
});
|
|
targetObj.setCoords();
|
|
return true;
|
|
}
|
|
/**
|
|
* Get the canvas size
|
|
* @returns {Object} {{width: number, height: number}} image size
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvasSize",
|
|
value: function getCanvasSize() {
|
|
var image = this.getCanvasImage();
|
|
return {
|
|
width: image ? image.width : 0,
|
|
height: image ? image.height : 0
|
|
};
|
|
}
|
|
/**
|
|
* Create fabric static canvas
|
|
* @returns {Object} {{width: number, height: number}} image size
|
|
*/
|
|
|
|
}, {
|
|
key: "createStaticCanvas",
|
|
value: function createStaticCanvas() {
|
|
var staticCanvas = new fabric.fabric.StaticCanvas();
|
|
staticCanvas.set({
|
|
enableRetinaScaling: false
|
|
});
|
|
return staticCanvas;
|
|
}
|
|
/**
|
|
* Get a DrawingMode instance
|
|
* @param {string} modeName - DrawingMode Class Name
|
|
* @returns {DrawingMode} DrawingMode instance
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_getDrawingModeInstance",
|
|
value: function _getDrawingModeInstance(modeName) {
|
|
return this._drawingModeMap[modeName];
|
|
}
|
|
/**
|
|
* Set object caching to false. This brought many bugs when draw Shape & cropzone
|
|
* @see http://fabricjs.com/fabric-object-caching
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setObjectCachingToFalse",
|
|
value: function _setObjectCachingToFalse() {
|
|
fabric.fabric.Object.prototype.objectCaching = false;
|
|
}
|
|
/**
|
|
* Set canvas element to fabric.Canvas
|
|
* @param {Element|string} element - Wrapper or canvas element or selector
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setCanvasElement",
|
|
value: function _setCanvasElement(element) {
|
|
var selectedElement;
|
|
var canvasElement;
|
|
|
|
if (element.nodeType) {
|
|
selectedElement = element;
|
|
} else {
|
|
selectedElement = document.querySelector(element);
|
|
}
|
|
|
|
if (selectedElement.nodeName.toUpperCase() !== 'CANVAS') {
|
|
canvasElement = document.createElement('canvas');
|
|
selectedElement.appendChild(canvasElement);
|
|
}
|
|
|
|
this._canvas = new fabric.fabric.Canvas(canvasElement, {
|
|
containerClass: 'tui-image-editor-canvas-container',
|
|
enableRetinaScaling: false
|
|
});
|
|
}
|
|
/**
|
|
* Creates DrawingMode instances
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_createDrawingModeInstances",
|
|
value: function _createDrawingModeInstances() {
|
|
this._register(this._drawingModeMap, new drawingMode_cropper());
|
|
|
|
this._register(this._drawingModeMap, new drawingMode_freeDrawing());
|
|
|
|
this._register(this._drawingModeMap, new lineDrawing());
|
|
|
|
this._register(this._drawingModeMap, new drawingMode_shape());
|
|
|
|
this._register(this._drawingModeMap, new drawingMode_text());
|
|
|
|
this._register(this._drawingModeMap, new drawingMode_icon());
|
|
|
|
this._register(this._drawingModeMap, new drawingMode_zoom());
|
|
|
|
this._register(this._drawingModeMap, new drawingMode_resize());
|
|
}
|
|
/**
|
|
* Create components
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_createComponents",
|
|
value: function _createComponents() {
|
|
this._register(this._componentMap, new imageLoader(this));
|
|
|
|
this._register(this._componentMap, new cropper(this));
|
|
|
|
this._register(this._componentMap, new component_flip(this));
|
|
|
|
this._register(this._componentMap, new rotation(this));
|
|
|
|
this._register(this._componentMap, new freeDrawing(this));
|
|
|
|
this._register(this._componentMap, new line(this));
|
|
|
|
this._register(this._componentMap, new component_text(this));
|
|
|
|
this._register(this._componentMap, new component_icon(this));
|
|
|
|
this._register(this._componentMap, new component_filter(this));
|
|
|
|
this._register(this._componentMap, new shape_Shape(this));
|
|
|
|
this._register(this._componentMap, new zoom(this));
|
|
|
|
this._register(this._componentMap, new component_resize(this));
|
|
}
|
|
/**
|
|
* Register component
|
|
* @param {Object} map - map object
|
|
* @param {Object} module - module which has getName method
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_register",
|
|
value: function _register(map, module) {
|
|
map[module.getName()] = module;
|
|
}
|
|
/**
|
|
* Get the current drawing mode is same with given mode
|
|
* @param {string} mode drawing mode
|
|
* @returns {boolean} true if same or false
|
|
*/
|
|
|
|
}, {
|
|
key: "_isSameDrawingMode",
|
|
value: function _isSameDrawingMode(mode) {
|
|
return this.getDrawingMode() === mode;
|
|
}
|
|
/**
|
|
* Calculate max dimension of canvas
|
|
* The css-max dimension is dynamically decided with maintaining image ratio
|
|
* The css-max dimension is lower than canvas dimension (attribute of canvas, not css)
|
|
* @param {number} width - Canvas width
|
|
* @param {number} height - Canvas height
|
|
* @returns {{width: number, height: number}} - Max width & Max height
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_calcMaxDimension",
|
|
value: function _calcMaxDimension(width, height) {
|
|
var wScaleFactor = this.cssMaxWidth / width;
|
|
var hScaleFactor = this.cssMaxHeight / height;
|
|
var cssMaxWidth = Math.min(width, this.cssMaxWidth);
|
|
var cssMaxHeight = Math.min(height, this.cssMaxHeight);
|
|
|
|
if (wScaleFactor < 1 && wScaleFactor < hScaleFactor) {
|
|
cssMaxWidth = width * wScaleFactor;
|
|
cssMaxHeight = height * wScaleFactor;
|
|
} else if (hScaleFactor < 1 && hScaleFactor < wScaleFactor) {
|
|
cssMaxWidth = width * hScaleFactor;
|
|
cssMaxHeight = height * hScaleFactor;
|
|
}
|
|
|
|
return {
|
|
width: Math.floor(cssMaxWidth),
|
|
height: Math.floor(cssMaxHeight)
|
|
};
|
|
}
|
|
/**
|
|
* Callback function after loading image
|
|
* @param {fabric.Image} obj - Fabric image object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_callbackAfterLoadingImageObject",
|
|
value: function _callbackAfterLoadingImageObject(obj) {
|
|
var centerPos = this.getCanvasImage().getCenterPoint();
|
|
obj.set(fObjectOptions.SELECTION_STYLE);
|
|
obj.set({
|
|
left: centerPos.x,
|
|
top: centerPos.y,
|
|
crossOrigin: 'Anonymous'
|
|
});
|
|
this.getCanvas().add(obj).setActiveObject(obj);
|
|
}
|
|
/**
|
|
* Attach canvas's events
|
|
*/
|
|
|
|
}, {
|
|
key: "_attachCanvasEvents",
|
|
value: function _attachCanvasEvents() {
|
|
var canvas = this._canvas;
|
|
var handler = this._handler;
|
|
canvas.on({
|
|
'mouse:down': handler.onMouseDown,
|
|
'object:added': handler.onObjectAdded,
|
|
'object:removed': handler.onObjectRemoved,
|
|
'object:moving': handler.onObjectMoved,
|
|
'object:scaling': handler.onObjectScaled,
|
|
'object:modified': handler.onObjectModified,
|
|
'object:rotating': handler.onObjectRotated,
|
|
'path:created': handler.onPathCreated,
|
|
'selection:cleared': handler.onSelectionCleared,
|
|
'selection:created': handler.onSelectionCreated,
|
|
'selection:updated': handler.onObjectSelected
|
|
});
|
|
}
|
|
/**
|
|
* "mouse:down" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseDown",
|
|
value: function _onMouseDown(fEvent) {
|
|
var _this2 = this;
|
|
|
|
var event = fEvent.e,
|
|
target = fEvent.target;
|
|
|
|
var originPointer = this._canvas.getPointer(event);
|
|
|
|
if (target) {
|
|
var type = target.type;
|
|
var undoData = makeSelectionUndoData(target, function (item) {
|
|
return makeSelectionUndoDatum(_this2.getObjectId(item), item, type === 'activeSelection');
|
|
});
|
|
setCachedUndoDataForDimension(undoData);
|
|
}
|
|
|
|
this.fire(eventNames.MOUSE_DOWN, event, originPointer);
|
|
}
|
|
/**
|
|
* "object:added" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectAdded",
|
|
value: function _onObjectAdded(fEvent) {
|
|
var obj = fEvent.target;
|
|
|
|
if (obj.isType('cropzone')) {
|
|
return;
|
|
}
|
|
|
|
this._addFabricObject(obj);
|
|
}
|
|
/**
|
|
* "object:removed" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectRemoved",
|
|
value: function _onObjectRemoved(fEvent) {
|
|
var obj = fEvent.target;
|
|
|
|
this._removeFabricObject(stamp(obj));
|
|
}
|
|
/**
|
|
* "object:moving" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectMoved",
|
|
value: function _onObjectMoved(fEvent) {
|
|
var _this3 = this;
|
|
|
|
this._lazyFire(eventNames.OBJECT_MOVED, function (object) {
|
|
return _this3.createObjectProperties(object);
|
|
}, fEvent.target);
|
|
}
|
|
/**
|
|
* "object:scaling" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectScaled",
|
|
value: function _onObjectScaled(fEvent) {
|
|
var _this4 = this;
|
|
|
|
this._lazyFire(eventNames.OBJECT_SCALED, function (object) {
|
|
return _this4.createObjectProperties(object);
|
|
}, fEvent.target);
|
|
}
|
|
/**
|
|
* "object:modified" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectModified",
|
|
value: function _onObjectModified(fEvent) {
|
|
var target = fEvent.target;
|
|
|
|
if (target.type === 'activeSelection') {
|
|
var items = target.getObjects();
|
|
|
|
for_each_default()(items).call(items, function (item) {
|
|
return item.fire('modifiedInGroup', target);
|
|
});
|
|
}
|
|
|
|
this.fire(eventNames.OBJECT_MODIFIED, target, this.getObjectId(target));
|
|
}
|
|
/**
|
|
* "object:rotating" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectRotated",
|
|
value: function _onObjectRotated(fEvent) {
|
|
var _this5 = this;
|
|
|
|
this._lazyFire(eventNames.OBJECT_ROTATED, function (object) {
|
|
return _this5.createObjectProperties(object);
|
|
}, fEvent.target);
|
|
}
|
|
/**
|
|
* Lazy event emitter
|
|
* @param {string} eventName - event name
|
|
* @param {Function} paramsMaker - make param function
|
|
* @param {Object} [target] - Object of the event owner.
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_lazyFire",
|
|
value: function _lazyFire(eventName, paramsMaker, target) {
|
|
var _this6 = this;
|
|
|
|
var existEventDelegation = target && target.canvasEventDelegation;
|
|
var delegationState = existEventDelegation ? target.canvasEventDelegation(eventName) : 'none';
|
|
|
|
if (delegationState === 'unregistered') {
|
|
target.canvasEventRegister(eventName, function (object) {
|
|
_this6.fire(eventName, paramsMaker(object));
|
|
});
|
|
}
|
|
|
|
if (delegationState === 'none') {
|
|
this.fire(eventName, paramsMaker(target));
|
|
}
|
|
}
|
|
/**
|
|
* "object:selected" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectSelected",
|
|
value: function _onObjectSelected(fEvent) {
|
|
var target = fEvent.target;
|
|
var params = this.createObjectProperties(target);
|
|
this.fire(eventNames.OBJECT_ACTIVATED, params);
|
|
}
|
|
/**
|
|
* "path:created" canvas event handler
|
|
* @param {{path: fabric.Path}} obj - Path object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onPathCreated",
|
|
value: function _onPathCreated(obj) {
|
|
var _obj$path$getCenterPo = obj.path.getCenterPoint(),
|
|
left = _obj$path$getCenterPo.x,
|
|
top = _obj$path$getCenterPo.y;
|
|
|
|
obj.path.set(extend_default()({
|
|
left: left,
|
|
top: top
|
|
}, fObjectOptions.SELECTION_STYLE));
|
|
var params = this.createObjectProperties(obj.path);
|
|
this.fire(eventNames.ADD_OBJECT, params);
|
|
}
|
|
/**
|
|
* "selction:cleared" canvas event handler
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onSelectionCleared",
|
|
value: function _onSelectionCleared() {
|
|
this.fire(eventNames.SELECTION_CLEARED);
|
|
}
|
|
/**
|
|
* "selction:created" canvas event handler
|
|
* @param {{target: fabric.Object, e: MouseEvent}} fEvent - Fabric event
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onSelectionCreated",
|
|
value: function _onSelectionCreated(fEvent) {
|
|
var target = fEvent.target;
|
|
var params = this.createObjectProperties(target);
|
|
this.fire(eventNames.OBJECT_ACTIVATED, params);
|
|
this.fire(eventNames.SELECTION_CREATED, fEvent.target);
|
|
}
|
|
/**
|
|
* Canvas discard selection all
|
|
*/
|
|
|
|
}, {
|
|
key: "discardSelection",
|
|
value: function discardSelection() {
|
|
this._canvas.discardActiveObject();
|
|
|
|
this._canvas.renderAll();
|
|
}
|
|
/**
|
|
* Canvas Selectable status change
|
|
* @param {boolean} selectable - expect status
|
|
*/
|
|
|
|
}, {
|
|
key: "changeSelectableAll",
|
|
value: function changeSelectableAll(selectable) {
|
|
this._canvas.forEachObject(function (obj) {
|
|
obj.selectable = selectable;
|
|
obj.hoverCursor = selectable ? 'move' : 'crosshair';
|
|
});
|
|
}
|
|
/**
|
|
* Return object's properties
|
|
* @param {fabric.Object} obj - fabric object
|
|
* @returns {Object} properties object
|
|
*/
|
|
|
|
}, {
|
|
key: "createObjectProperties",
|
|
value: function createObjectProperties(obj) {
|
|
var predefinedKeys = ['left', 'top', 'width', 'height', 'fill', 'stroke', 'strokeWidth', 'opacity', 'angle'];
|
|
var props = {
|
|
id: stamp(obj),
|
|
type: obj.type
|
|
};
|
|
extend_default()(props, getProperties(obj, predefinedKeys));
|
|
|
|
if (includes(['i-text', 'text'], obj.type)) {
|
|
extend_default()(props, this._createTextProperties(obj, props));
|
|
} else if (includes(['rect', 'triangle', 'circle'], obj.type)) {
|
|
var shapeComp = this.getComponent(componentNames.SHAPE);
|
|
extend_default()(props, {
|
|
fill: shapeComp.makeFillPropertyForUserEvent(obj)
|
|
});
|
|
}
|
|
|
|
return props;
|
|
}
|
|
/**
|
|
* Get text object's properties
|
|
* @param {fabric.Object} obj - fabric text object
|
|
* @param {Object} props - properties
|
|
* @returns {Object} properties object
|
|
*/
|
|
|
|
}, {
|
|
key: "_createTextProperties",
|
|
value: function _createTextProperties(obj) {
|
|
var predefinedKeys = ['text', 'fontFamily', 'fontSize', 'fontStyle', 'textAlign', 'textDecoration', 'fontWeight'];
|
|
var props = {};
|
|
extend_default()(props, getProperties(obj, predefinedKeys));
|
|
return props;
|
|
}
|
|
/**
|
|
* Add object array by id
|
|
* @param {fabric.Object} obj - fabric object
|
|
* @returns {number} object id
|
|
*/
|
|
|
|
}, {
|
|
key: "_addFabricObject",
|
|
value: function _addFabricObject(obj) {
|
|
var id = stamp(obj);
|
|
this._objects[id] = obj;
|
|
return id;
|
|
}
|
|
/**
|
|
* Remove an object in array yb id
|
|
* @param {number} id - object id
|
|
*/
|
|
|
|
}, {
|
|
key: "_removeFabricObject",
|
|
value: function _removeFabricObject(id) {
|
|
delete this._objects[id];
|
|
}
|
|
/**
|
|
* Reset targetObjectForCopyPaste value from activeObject
|
|
*/
|
|
|
|
}, {
|
|
key: "resetTargetObjectForCopyPaste",
|
|
value: function resetTargetObjectForCopyPaste() {
|
|
var activeObject = this.getActiveObject();
|
|
|
|
if (activeObject) {
|
|
this.targetObjectForCopyPaste = activeObject;
|
|
}
|
|
}
|
|
/**
|
|
* Paste fabric object
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "pasteObject",
|
|
value: function pasteObject() {
|
|
var _this7 = this;
|
|
|
|
if (!this.targetObjectForCopyPaste) {
|
|
return promise_default().resolve([]);
|
|
}
|
|
|
|
var targetObject = this.targetObjectForCopyPaste;
|
|
var isGroupSelect = targetObject.type === 'activeSelection';
|
|
var targetObjects = isGroupSelect ? targetObject.getObjects() : [targetObject];
|
|
var newTargetObject = null;
|
|
this.discardSelection();
|
|
return this._cloneObject(targetObjects).then(function (addedObjects) {
|
|
if (addedObjects.length > 1) {
|
|
newTargetObject = _this7.getActiveSelectionFromObjects(addedObjects);
|
|
} else {
|
|
var _addedObjects = _slicedToArray(addedObjects, 1);
|
|
|
|
newTargetObject = _addedObjects[0];
|
|
}
|
|
|
|
_this7.targetObjectForCopyPaste = newTargetObject;
|
|
|
|
_this7.setActiveObject(newTargetObject);
|
|
});
|
|
}
|
|
/**
|
|
* Clone object
|
|
* @param {fabric.Object} targetObjects - fabric object
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_cloneObject",
|
|
value: function _cloneObject(targetObjects) {
|
|
var _this8 = this;
|
|
|
|
var addedObjects = map_default()(targetObjects).call(targetObjects, function (targetObject) {
|
|
return _this8._cloneObjectItem(targetObject);
|
|
});
|
|
|
|
return promise_default().all(addedObjects);
|
|
}
|
|
/**
|
|
* Clone object one item
|
|
* @param {fabric.Object} targetObject - fabric object
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_cloneObjectItem",
|
|
value: function _cloneObjectItem(targetObject) {
|
|
var _this9 = this;
|
|
|
|
return this._copyFabricObjectForPaste(targetObject).then(function (clonedObject) {
|
|
var objectProperties = _this9.createObjectProperties(clonedObject);
|
|
|
|
_this9.add(clonedObject);
|
|
|
|
_this9.fire(eventNames.ADD_OBJECT, objectProperties);
|
|
|
|
return clonedObject;
|
|
});
|
|
}
|
|
/**
|
|
* Copy fabric object with Changed position for copy and paste
|
|
* @param {fabric.Object} targetObject - fabric object
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_copyFabricObjectForPaste",
|
|
value: function _copyFabricObjectForPaste(targetObject) {
|
|
var _this10 = this;
|
|
|
|
var addExtraPx = function addExtraPx(value, isReverse) {
|
|
return isReverse ? value - EXTRA_PX_FOR_PASTE : value + EXTRA_PX_FOR_PASTE;
|
|
};
|
|
|
|
return this._copyFabricObject(targetObject).then(function (clonedObject) {
|
|
var left = clonedObject.left,
|
|
top = clonedObject.top,
|
|
width = clonedObject.width,
|
|
height = clonedObject.height;
|
|
|
|
var _this10$getCanvasSize = _this10.getCanvasSize(),
|
|
canvasWidth = _this10$getCanvasSize.width,
|
|
canvasHeight = _this10$getCanvasSize.height;
|
|
|
|
var rightEdge = left + width / 2;
|
|
var bottomEdge = top + height / 2;
|
|
clonedObject.set(extend_default()({
|
|
left: addExtraPx(left, rightEdge + EXTRA_PX_FOR_PASTE > canvasWidth),
|
|
top: addExtraPx(top, bottomEdge + EXTRA_PX_FOR_PASTE > canvasHeight)
|
|
}, fObjectOptions.SELECTION_STYLE));
|
|
return clonedObject;
|
|
});
|
|
}
|
|
/**
|
|
* Copy fabric object
|
|
* @param {fabric.Object} targetObject - fabric object
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_copyFabricObject",
|
|
value: function _copyFabricObject(targetObject) {
|
|
var _this11 = this;
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
targetObject.clone(function (cloned) {
|
|
var shapeComp = _this11.getComponent(componentNames.SHAPE);
|
|
|
|
if (isShape(cloned)) {
|
|
shapeComp.processForCopiedObject(cloned, targetObject);
|
|
}
|
|
|
|
resolve(cloned);
|
|
});
|
|
});
|
|
}
|
|
/**
|
|
* Get current dimensions
|
|
* @returns {object}
|
|
*/
|
|
|
|
}, {
|
|
key: "getCurrentDimensions",
|
|
value: function getCurrentDimensions() {
|
|
var resize = this.getComponent(componentNames.RESIZE);
|
|
return resize.getCurrentDimensions();
|
|
}
|
|
/**
|
|
* Get original dimensions
|
|
* @returns {object}
|
|
*/
|
|
|
|
}, {
|
|
key: "getOriginalDimensions",
|
|
value: function getOriginalDimensions() {
|
|
var resize = this.getComponent(componentNames.RESIZE);
|
|
return resize.getOriginalDimensions();
|
|
}
|
|
/**
|
|
* Set original dimensions
|
|
* @param {object} dimensions - Dimensions
|
|
*/
|
|
|
|
}, {
|
|
key: "setOriginalDimensions",
|
|
value: function setOriginalDimensions(dimensions) {
|
|
var resize = this.getComponent(componentNames.RESIZE);
|
|
resize.setOriginalDimensions(dimensions);
|
|
}
|
|
/**
|
|
* Resize Image
|
|
* @param {Object} dimensions - Resize dimensions
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "resize",
|
|
value: function resize(dimensions) {
|
|
var resize = this.getComponent(componentNames.RESIZE);
|
|
return resize.resize(dimensions);
|
|
}
|
|
}]);
|
|
|
|
return Graphics;
|
|
}();
|
|
|
|
customEvents_default().mixin(Graphics);
|
|
/* harmony default export */ var graphics = (Graphics);
|
|
;// CONCATENATED MODULE: ./src/js/imageEditor.js
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
var MOUSE_DOWN = eventNames.MOUSE_DOWN,
|
|
OBJECT_MOVED = eventNames.OBJECT_MOVED,
|
|
OBJECT_SCALED = eventNames.OBJECT_SCALED,
|
|
OBJECT_ACTIVATED = eventNames.OBJECT_ACTIVATED,
|
|
OBJECT_ROTATED = eventNames.OBJECT_ROTATED,
|
|
OBJECT_ADDED = eventNames.OBJECT_ADDED,
|
|
imageEditor_OBJECT_MODIFIED = eventNames.OBJECT_MODIFIED,
|
|
imageEditor_ADD_TEXT = eventNames.ADD_TEXT,
|
|
ADD_OBJECT = eventNames.ADD_OBJECT,
|
|
imageEditor_TEXT_EDITING = eventNames.TEXT_EDITING,
|
|
TEXT_CHANGED = eventNames.TEXT_CHANGED,
|
|
ICON_CREATE_RESIZE = eventNames.ICON_CREATE_RESIZE,
|
|
ICON_CREATE_END = eventNames.ICON_CREATE_END,
|
|
SELECTION_CLEARED = eventNames.SELECTION_CLEARED,
|
|
SELECTION_CREATED = eventNames.SELECTION_CREATED,
|
|
ADD_OBJECT_AFTER = eventNames.ADD_OBJECT_AFTER;
|
|
/**
|
|
* Image filter result
|
|
* @typedef {object} FilterResult
|
|
* @property {string} type - filter type like 'mask', 'Grayscale' and so on
|
|
* @property {string} action - action type like 'add', 'remove'
|
|
*/
|
|
|
|
/**
|
|
* Flip status
|
|
* @typedef {object} FlipStatus
|
|
* @property {boolean} flipX - x axis
|
|
* @property {boolean} flipY - y axis
|
|
* @property {Number} angle - angle
|
|
*/
|
|
|
|
/**
|
|
* Rotation status
|
|
* @typedef {Number} RotateStatus
|
|
* @property {Number} angle - angle
|
|
*/
|
|
|
|
/**
|
|
* Old and new Size
|
|
* @typedef {object} SizeChange
|
|
* @property {Number} oldWidth - old width
|
|
* @property {Number} oldHeight - old height
|
|
* @property {Number} newWidth - new width
|
|
* @property {Number} newHeight - new height
|
|
*/
|
|
|
|
/**
|
|
* @typedef {string} ErrorMsg - {string} error message
|
|
*/
|
|
|
|
/**
|
|
* @typedef {object} ObjectProps - graphics object properties
|
|
* @property {number} id - object id
|
|
* @property {string} type - object type
|
|
* @property {string} text - text content
|
|
* @property {(string | number)} left - Left
|
|
* @property {(string | number)} top - Top
|
|
* @property {(string | number)} width - Width
|
|
* @property {(string | number)} height - Height
|
|
* @property {string} fill - Color
|
|
* @property {string} stroke - Stroke
|
|
* @property {(string | number)} strokeWidth - StrokeWidth
|
|
* @property {string} fontFamily - Font type for text
|
|
* @property {number} fontSize - Font Size
|
|
* @property {string} fontStyle - Type of inclination (normal / italic)
|
|
* @property {string} fontWeight - Type of thicker or thinner looking (normal / bold)
|
|
* @property {string} textAlign - Type of text align (left / center / right)
|
|
* @property {string} textDecoration - Type of line (underline / line-through / overline)
|
|
*/
|
|
|
|
/**
|
|
* Shape filter option
|
|
* @typedef {object.<string, number>} ShapeFilterOption
|
|
*/
|
|
|
|
/**
|
|
* Shape filter option
|
|
* @typedef {object} ShapeFillOption - fill option of shape
|
|
* @property {string} type - fill type ('color' or 'filter')
|
|
* @property {Array.<ShapeFillFilterOption>} [filter] - {@link ShapeFilterOption} List.
|
|
* only applies to filter types
|
|
* (ex: \[\{pixelate: 20\}, \{blur: 0.3\}\])
|
|
* @property {string} [color] - Shape foreground color (ex: '#fff', 'transparent')
|
|
*/
|
|
|
|
/**
|
|
* Image editor
|
|
* @class
|
|
* @param {string|HTMLElement} wrapper - Wrapper's element or selector
|
|
* @param {Object} [options] - Canvas max width & height of css
|
|
* @param {number} [options.includeUI] - Use the provided UI
|
|
* @param {Object} [options.includeUI.loadImage] - Basic editing image
|
|
* @param {string} options.includeUI.loadImage.path - image path
|
|
* @param {string} options.includeUI.loadImage.name - image name
|
|
* @param {Object} [options.includeUI.theme] - Theme object
|
|
* @param {Array} [options.includeUI.menu] - It can be selected when only specific menu is used, Default values are \['crop', 'flip', 'rotate', 'draw', 'shape', 'icon', 'text', 'mask', 'filter'\].
|
|
* @param {string} [options.includeUI.initMenu] - The first menu to be selected and started.
|
|
* @param {Object} [options.includeUI.uiSize] - ui size of editor
|
|
* @param {string} options.includeUI.uiSize.width - width of ui
|
|
* @param {string} options.includeUI.uiSize.height - height of ui
|
|
* @param {string} [options.includeUI.menuBarPosition=bottom] - Menu bar position('top', 'bottom', 'left', 'right')
|
|
* @param {number} options.cssMaxWidth - Canvas css-max-width
|
|
* @param {number} options.cssMaxHeight - Canvas css-max-height
|
|
* @param {Object} [options.selectionStyle] - selection style
|
|
* @param {string} [options.selectionStyle.cornerStyle] - selection corner style
|
|
* @param {number} [options.selectionStyle.cornerSize] - selection corner size
|
|
* @param {string} [options.selectionStyle.cornerColor] - selection corner color
|
|
* @param {string} [options.selectionStyle.cornerStrokeColor] = selection corner stroke color
|
|
* @param {boolean} [options.selectionStyle.transparentCorners] - selection corner transparent
|
|
* @param {number} [options.selectionStyle.lineWidth] - selection line width
|
|
* @param {string} [options.selectionStyle.borderColor] - selection border color
|
|
* @param {number} [options.selectionStyle.rotatingPointOffset] - selection rotating point length
|
|
* @param {Boolean} [options.usageStatistics=true] - Let us know the hostname. If you don't want to send the hostname, please set to false.
|
|
* @example
|
|
* var ImageEditor = require('tui-image-editor');
|
|
* var blackTheme = require('./js/theme/black-theme.js');
|
|
* var instance = new ImageEditor(document.querySelector('#tui-image-editor'), {
|
|
* includeUI: {
|
|
* loadImage: {
|
|
* path: 'img/sampleImage.jpg',
|
|
* name: 'SampleImage'
|
|
* },
|
|
* theme: blackTheme, // or whiteTheme
|
|
* menu: ['shape', 'filter'],
|
|
* initMenu: 'filter',
|
|
* uiSize: {
|
|
* width: '1000px',
|
|
* height: '700px'
|
|
* },
|
|
* menuBarPosition: 'bottom'
|
|
* },
|
|
* cssMaxWidth: 700,
|
|
* cssMaxHeight: 500,
|
|
* selectionStyle: {
|
|
* cornerSize: 20,
|
|
* rotatingPointOffset: 70
|
|
* }
|
|
* });
|
|
*/
|
|
|
|
var ImageEditor = /*#__PURE__*/function () {
|
|
function ImageEditor(wrapper, options) {
|
|
var _context, _context2, _context3, _context4, _context5, _context6, _context7, _context8, _context9, _context10, _context11, _context12, _context13, _context14, _context15, _context16;
|
|
|
|
_classCallCheck(this, ImageEditor);
|
|
|
|
options = extend_default()({
|
|
includeUI: false,
|
|
usageStatistics: true
|
|
}, options);
|
|
this.mode = null;
|
|
this.activeObjectId = null;
|
|
/**
|
|
* UI instance
|
|
* @type {Ui}
|
|
*/
|
|
|
|
if (options.includeUI) {
|
|
var UIOption = options.includeUI;
|
|
UIOption.usageStatistics = options.usageStatistics;
|
|
this.ui = new ui(wrapper, UIOption, this.getActions());
|
|
options = this.ui.setUiDefaultSelectionStyle(options);
|
|
}
|
|
/**
|
|
* Invoker
|
|
* @type {Invoker}
|
|
* @private
|
|
*/
|
|
|
|
|
|
this._invoker = new invoker();
|
|
/**
|
|
* Graphics instance
|
|
* @type {Graphics}
|
|
* @private
|
|
*/
|
|
|
|
this._graphics = new graphics(this.ui ? this.ui.getEditorArea() : wrapper, {
|
|
cssMaxWidth: options.cssMaxWidth,
|
|
cssMaxHeight: options.cssMaxHeight
|
|
});
|
|
/**
|
|
* Event handler list
|
|
* @type {Object}
|
|
* @private
|
|
*/
|
|
|
|
this._handlers = {
|
|
keydown: bind_default()(_context = this._onKeyDown).call(_context, this),
|
|
mousedown: bind_default()(_context2 = this._onMouseDown).call(_context2, this),
|
|
objectActivated: bind_default()(_context3 = this._onObjectActivated).call(_context3, this),
|
|
objectMoved: bind_default()(_context4 = this._onObjectMoved).call(_context4, this),
|
|
objectScaled: bind_default()(_context5 = this._onObjectScaled).call(_context5, this),
|
|
objectRotated: bind_default()(_context6 = this._onObjectRotated).call(_context6, this),
|
|
objectAdded: bind_default()(_context7 = this._onObjectAdded).call(_context7, this),
|
|
objectModified: bind_default()(_context8 = this._onObjectModified).call(_context8, this),
|
|
createdPath: this._onCreatedPath,
|
|
addText: bind_default()(_context9 = this._onAddText).call(_context9, this),
|
|
addObject: bind_default()(_context10 = this._onAddObject).call(_context10, this),
|
|
textEditing: bind_default()(_context11 = this._onTextEditing).call(_context11, this),
|
|
textChanged: bind_default()(_context12 = this._onTextChanged).call(_context12, this),
|
|
iconCreateResize: bind_default()(_context13 = this._onIconCreateResize).call(_context13, this),
|
|
iconCreateEnd: bind_default()(_context14 = this._onIconCreateEnd).call(_context14, this),
|
|
selectionCleared: bind_default()(_context15 = this._selectionCleared).call(_context15, this),
|
|
selectionCreated: bind_default()(_context16 = this._selectionCreated).call(_context16, this)
|
|
};
|
|
|
|
this._attachInvokerEvents();
|
|
|
|
this._attachGraphicsEvents();
|
|
|
|
this._attachDomEvents();
|
|
|
|
this._setSelectionStyle(options.selectionStyle, {
|
|
applyCropSelectionStyle: options.applyCropSelectionStyle,
|
|
applyGroupSelectionStyle: options.applyGroupSelectionStyle
|
|
});
|
|
|
|
if (options.usageStatistics) {
|
|
sendHostName();
|
|
}
|
|
|
|
if (this.ui) {
|
|
this.ui.initCanvas();
|
|
this.setReAction();
|
|
|
|
this._attachColorPickerInputBoxEvents();
|
|
}
|
|
|
|
fabric.fabric.enableGLFiltering = false;
|
|
}
|
|
|
|
_createClass(ImageEditor, [{
|
|
key: "_attachColorPickerInputBoxEvents",
|
|
value: function _attachColorPickerInputBoxEvents() {
|
|
var _this = this;
|
|
|
|
this.ui.on(eventNames.INPUT_BOX_EDITING_STARTED, function () {
|
|
_this.isColorPickerInputBoxEditing = true;
|
|
});
|
|
this.ui.on(eventNames.INPUT_BOX_EDITING_STOPPED, function () {
|
|
_this.isColorPickerInputBoxEditing = false;
|
|
});
|
|
}
|
|
}, {
|
|
key: "_detachColorPickerInputBoxEvents",
|
|
value: function _detachColorPickerInputBoxEvents() {
|
|
this.ui.off(eventNames.INPUT_BOX_EDITING_STARTED);
|
|
this.ui.off(eventNames.INPUT_BOX_EDITING_STOPPED);
|
|
}
|
|
/**
|
|
* Set selection style by init option
|
|
* @param {Object} selectionStyle - Selection styles
|
|
* @param {Object} applyTargets - Selection apply targets
|
|
* @param {boolean} applyCropSelectionStyle - whether apply with crop selection style or not
|
|
* @param {boolean} applyGroupSelectionStyle - whether apply with group selection style or not
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setSelectionStyle",
|
|
value: function _setSelectionStyle(selectionStyle, _ref) {
|
|
var applyCropSelectionStyle = _ref.applyCropSelectionStyle,
|
|
applyGroupSelectionStyle = _ref.applyGroupSelectionStyle;
|
|
|
|
if (selectionStyle) {
|
|
this._graphics.setSelectionStyle(selectionStyle);
|
|
}
|
|
|
|
if (applyCropSelectionStyle) {
|
|
this._graphics.setCropSelectionStyle(selectionStyle);
|
|
}
|
|
|
|
if (applyGroupSelectionStyle) {
|
|
this.on('selectionCreated', function (eventTarget) {
|
|
if (eventTarget.type === 'activeSelection') {
|
|
eventTarget.set(selectionStyle);
|
|
}
|
|
});
|
|
}
|
|
}
|
|
/**
|
|
* Attach invoker events
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_attachInvokerEvents",
|
|
value: function _attachInvokerEvents() {
|
|
var _context17,
|
|
_context18,
|
|
_this2 = this;
|
|
|
|
var UNDO_STACK_CHANGED = eventNames.UNDO_STACK_CHANGED,
|
|
REDO_STACK_CHANGED = eventNames.REDO_STACK_CHANGED,
|
|
EXECUTE_COMMAND = eventNames.EXECUTE_COMMAND,
|
|
AFTER_UNDO = eventNames.AFTER_UNDO,
|
|
AFTER_REDO = eventNames.AFTER_REDO,
|
|
HAND_STARTED = eventNames.HAND_STARTED,
|
|
HAND_STOPPED = eventNames.HAND_STOPPED;
|
|
/**
|
|
* Undo stack changed event
|
|
* @event ImageEditor#undoStackChanged
|
|
* @param {Number} length - undo stack length
|
|
* @example
|
|
* imageEditor.on('undoStackChanged', function(length) {
|
|
* console.log(length);
|
|
* });
|
|
*/
|
|
|
|
this._invoker.on(UNDO_STACK_CHANGED, bind_default()(_context17 = this.fire).call(_context17, this, UNDO_STACK_CHANGED));
|
|
/**
|
|
* Redo stack changed event
|
|
* @event ImageEditor#redoStackChanged
|
|
* @param {Number} length - redo stack length
|
|
* @example
|
|
* imageEditor.on('redoStackChanged', function(length) {
|
|
* console.log(length);
|
|
* });
|
|
*/
|
|
|
|
|
|
this._invoker.on(REDO_STACK_CHANGED, bind_default()(_context18 = this.fire).call(_context18, this, REDO_STACK_CHANGED));
|
|
|
|
if (this.ui) {
|
|
var canvas = this._graphics.getCanvas();
|
|
|
|
this._invoker.on(EXECUTE_COMMAND, function (command) {
|
|
return _this2.ui.fire(EXECUTE_COMMAND, command);
|
|
});
|
|
|
|
this._invoker.on(AFTER_UNDO, function (command) {
|
|
return _this2.ui.fire(AFTER_UNDO, command);
|
|
});
|
|
|
|
this._invoker.on(AFTER_REDO, function (command) {
|
|
return _this2.ui.fire(AFTER_REDO, command);
|
|
});
|
|
|
|
canvas.on(HAND_STARTED, function () {
|
|
return _this2.ui.fire(HAND_STARTED);
|
|
});
|
|
canvas.on(HAND_STOPPED, function () {
|
|
return _this2.ui.fire(HAND_STOPPED);
|
|
});
|
|
}
|
|
}
|
|
/**
|
|
* Attach canvas events
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_attachGraphicsEvents",
|
|
value: function _attachGraphicsEvents() {
|
|
var _this$_graphics$on;
|
|
|
|
this._graphics.on((_this$_graphics$on = {}, _defineProperty(_this$_graphics$on, MOUSE_DOWN, this._handlers.mousedown), _defineProperty(_this$_graphics$on, OBJECT_MOVED, this._handlers.objectMoved), _defineProperty(_this$_graphics$on, OBJECT_SCALED, this._handlers.objectScaled), _defineProperty(_this$_graphics$on, OBJECT_ROTATED, this._handlers.objectRotated), _defineProperty(_this$_graphics$on, OBJECT_ACTIVATED, this._handlers.objectActivated), _defineProperty(_this$_graphics$on, OBJECT_ADDED, this._handlers.objectAdded), _defineProperty(_this$_graphics$on, imageEditor_OBJECT_MODIFIED, this._handlers.objectModified), _defineProperty(_this$_graphics$on, imageEditor_ADD_TEXT, this._handlers.addText), _defineProperty(_this$_graphics$on, ADD_OBJECT, this._handlers.addObject), _defineProperty(_this$_graphics$on, imageEditor_TEXT_EDITING, this._handlers.textEditing), _defineProperty(_this$_graphics$on, TEXT_CHANGED, this._handlers.textChanged), _defineProperty(_this$_graphics$on, ICON_CREATE_RESIZE, this._handlers.iconCreateResize), _defineProperty(_this$_graphics$on, ICON_CREATE_END, this._handlers.iconCreateEnd), _defineProperty(_this$_graphics$on, SELECTION_CLEARED, this._handlers.selectionCleared), _defineProperty(_this$_graphics$on, SELECTION_CREATED, this._handlers.selectionCreated), _this$_graphics$on));
|
|
}
|
|
/**
|
|
* Attach dom events
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_attachDomEvents",
|
|
value: function _attachDomEvents() {
|
|
// ImageEditor supports IE 9 higher
|
|
document.addEventListener('keydown', this._handlers.keydown);
|
|
}
|
|
/**
|
|
* Detach dom events
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_detachDomEvents",
|
|
value: function _detachDomEvents() {
|
|
// ImageEditor supports IE 9 higher
|
|
document.removeEventListener('keydown', this._handlers.keydown);
|
|
}
|
|
/**
|
|
* Keydown event handler
|
|
* @param {KeyboardEvent} e - Event object
|
|
* @private
|
|
*/
|
|
|
|
/* eslint-disable complexity */
|
|
|
|
}, {
|
|
key: "_onKeyDown",
|
|
value: function _onKeyDown(e) {
|
|
var ctrlKey = e.ctrlKey,
|
|
keyCode = e.keyCode,
|
|
metaKey = e.metaKey;
|
|
var isModifierKey = ctrlKey || metaKey;
|
|
|
|
if (isModifierKey) {
|
|
if (keyCode === keyCodes.C) {
|
|
this._graphics.resetTargetObjectForCopyPaste();
|
|
} else if (keyCode === keyCodes.V) {
|
|
this._graphics.pasteObject();
|
|
|
|
this.clearRedoStack();
|
|
} else if (keyCode === keyCodes.Z) {
|
|
// There is no error message on shortcut when it's empty
|
|
this.undo()['catch'](function () {});
|
|
} else if (keyCode === keyCodes.Y) {
|
|
// There is no error message on shortcut when it's empty
|
|
this.redo()['catch'](function () {});
|
|
}
|
|
}
|
|
|
|
var isDeleteKey = keyCode === keyCodes.BACKSPACE || keyCode === keyCodes.DEL;
|
|
|
|
var isRemoveReady = this._graphics.isReadyRemoveObject();
|
|
|
|
if (!this.isColorPickerInputBoxEditing && isRemoveReady && isDeleteKey) {
|
|
e.preventDefault();
|
|
this.removeActiveObject();
|
|
}
|
|
}
|
|
/**
|
|
* Remove Active Object
|
|
*/
|
|
|
|
}, {
|
|
key: "removeActiveObject",
|
|
value: function removeActiveObject() {
|
|
var activeObjectId = this._graphics.getActiveObjectIdForRemove();
|
|
|
|
this.removeObject(activeObjectId);
|
|
}
|
|
/**
|
|
* mouse down event handler
|
|
* @param {Event} event - mouse down event
|
|
* @param {Object} originPointer - origin pointer
|
|
* @param {Number} originPointer.x x position
|
|
* @param {Number} originPointer.y y position
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onMouseDown",
|
|
value: function _onMouseDown(event, originPointer) {
|
|
/**
|
|
* The mouse down event with position x, y on canvas
|
|
* @event ImageEditor#mousedown
|
|
* @param {Object} event - browser mouse event object
|
|
* @param {Object} originPointer origin pointer
|
|
* @param {Number} originPointer.x x position
|
|
* @param {Number} originPointer.y y position
|
|
* @example
|
|
* imageEditor.on('mousedown', function(event, originPointer) {
|
|
* console.log(event);
|
|
* console.log(originPointer);
|
|
* if (imageEditor.hasFilter('colorFilter')) {
|
|
* imageEditor.applyFilter('colorFilter', {
|
|
* x: parseInt(originPointer.x, 10),
|
|
* y: parseInt(originPointer.y, 10)
|
|
* });
|
|
* }
|
|
* });
|
|
*/
|
|
this.fire(eventNames.MOUSE_DOWN, event, originPointer);
|
|
}
|
|
/**
|
|
* Add a 'addObject' command
|
|
* @param {Object} obj - Fabric object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_pushAddObjectCommand",
|
|
value: function _pushAddObjectCommand(obj) {
|
|
var command = factory_command.create(commandNames.ADD_OBJECT, this._graphics, obj);
|
|
|
|
this._invoker.pushUndoStack(command);
|
|
}
|
|
/**
|
|
* Add a 'changeSelection' command
|
|
* @param {fabric.Object} obj - selection object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_pushModifyObjectCommand",
|
|
value: function _pushModifyObjectCommand(obj) {
|
|
var _this3 = this;
|
|
|
|
var type = obj.type;
|
|
var props = makeSelectionUndoData(obj, function (item) {
|
|
return makeSelectionUndoDatum(_this3._graphics.getObjectId(item), item, type === 'activeSelection');
|
|
});
|
|
var command = factory_command.create(commandNames.CHANGE_SELECTION, this._graphics, props);
|
|
command.execute(this._graphics, props);
|
|
|
|
this._invoker.pushUndoStack(command);
|
|
}
|
|
/**
|
|
* 'objectActivated' event handler
|
|
* @param {ObjectProps} props - object properties
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectActivated",
|
|
value: function _onObjectActivated(props) {
|
|
/**
|
|
* The event when object is selected(aka activated).
|
|
* @event ImageEditor#objectActivated
|
|
* @param {ObjectProps} objectProps - object properties
|
|
* @example
|
|
* imageEditor.on('objectActivated', function(props) {
|
|
* console.log(props);
|
|
* console.log(props.type);
|
|
* console.log(props.id);
|
|
* });
|
|
*/
|
|
this.fire(eventNames.OBJECT_ACTIVATED, props);
|
|
}
|
|
/**
|
|
* 'objectMoved' event handler
|
|
* @param {ObjectProps} props - object properties
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectMoved",
|
|
value: function _onObjectMoved(props) {
|
|
/**
|
|
* The event when object is moved
|
|
* @event ImageEditor#objectMoved
|
|
* @param {ObjectProps} props - object properties
|
|
* @example
|
|
* imageEditor.on('objectMoved', function(props) {
|
|
* console.log(props);
|
|
* console.log(props.type);
|
|
* });
|
|
*/
|
|
this.fire(eventNames.OBJECT_MOVED, props);
|
|
}
|
|
/**
|
|
* 'objectScaled' event handler
|
|
* @param {ObjectProps} props - object properties
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectScaled",
|
|
value: function _onObjectScaled(props) {
|
|
/**
|
|
* The event when scale factor is changed
|
|
* @event ImageEditor#objectScaled
|
|
* @param {ObjectProps} props - object properties
|
|
* @example
|
|
* imageEditor.on('objectScaled', function(props) {
|
|
* console.log(props);
|
|
* console.log(props.type);
|
|
* });
|
|
*/
|
|
this.fire(eventNames.OBJECT_SCALED, props);
|
|
}
|
|
/**
|
|
* 'objectRotated' event handler
|
|
* @param {ObjectProps} props - object properties
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectRotated",
|
|
value: function _onObjectRotated(props) {
|
|
/**
|
|
* The event when object angle is changed
|
|
* @event ImageEditor#objectRotated
|
|
* @param {ObjectProps} props - object properties
|
|
* @example
|
|
* imageEditor.on('objectRotated', function(props) {
|
|
* console.log(props);
|
|
* console.log(props.type);
|
|
* });
|
|
*/
|
|
this.fire(eventNames.OBJECT_ROTATED, props);
|
|
}
|
|
/**
|
|
* Get current drawing mode
|
|
* @returns {string}
|
|
* @example
|
|
* // Image editor drawing mode
|
|
* //
|
|
* // NORMAL: 'NORMAL'
|
|
* // CROPPER: 'CROPPER'
|
|
* // FREE_DRAWING: 'FREE_DRAWING'
|
|
* // LINE_DRAWING: 'LINE_DRAWING'
|
|
* // TEXT: 'TEXT'
|
|
* //
|
|
* if (imageEditor.getDrawingMode() === 'FREE_DRAWING') {
|
|
* imageEditor.stopDrawingMode();
|
|
* }
|
|
*/
|
|
|
|
}, {
|
|
key: "getDrawingMode",
|
|
value: function getDrawingMode() {
|
|
return this._graphics.getDrawingMode();
|
|
}
|
|
/**
|
|
* Clear all objects
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.clearObjects();
|
|
*/
|
|
|
|
}, {
|
|
key: "clearObjects",
|
|
value: function clearObjects() {
|
|
return this.execute(commandNames.CLEAR_OBJECTS);
|
|
}
|
|
/**
|
|
* Deactivate all objects
|
|
* @example
|
|
* imageEditor.deactivateAll();
|
|
*/
|
|
|
|
}, {
|
|
key: "deactivateAll",
|
|
value: function deactivateAll() {
|
|
this._graphics.deactivateAll();
|
|
|
|
this._graphics.renderAll();
|
|
}
|
|
/**
|
|
* discard selction
|
|
* @example
|
|
* imageEditor.discardSelection();
|
|
*/
|
|
|
|
}, {
|
|
key: "discardSelection",
|
|
value: function discardSelection() {
|
|
this._graphics.discardSelection();
|
|
}
|
|
/**
|
|
* selectable status change
|
|
* @param {boolean} selectable - selectable status
|
|
* @example
|
|
* imageEditor.changeSelectableAll(false); // or true
|
|
*/
|
|
|
|
}, {
|
|
key: "changeSelectableAll",
|
|
value: function changeSelectableAll(selectable) {
|
|
this._graphics.changeSelectableAll(selectable);
|
|
}
|
|
/**
|
|
* Init history
|
|
*/
|
|
|
|
}, {
|
|
key: "_initHistory",
|
|
value: function _initHistory() {
|
|
if (this.ui) {
|
|
this.ui.initHistory();
|
|
}
|
|
}
|
|
/**
|
|
* Clear history
|
|
*/
|
|
|
|
}, {
|
|
key: "_clearHistory",
|
|
value: function _clearHistory() {
|
|
if (this.ui) {
|
|
this.ui.clearHistory();
|
|
}
|
|
}
|
|
/**
|
|
* Invoke command
|
|
* @param {String} commandName - Command name
|
|
* @param {...*} args - Arguments for creating command
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "execute",
|
|
value: function execute(commandName) {
|
|
var _context19, _this$_invoker, _context20;
|
|
|
|
for (var _len = arguments.length, args = new Array(_len > 1 ? _len - 1 : 0), _key = 1; _key < _len; _key++) {
|
|
args[_key - 1] = arguments[_key];
|
|
}
|
|
|
|
// Inject an Graphics instance as first parameter
|
|
var theArgs = concat_default()(_context19 = [this._graphics]).call(_context19, args);
|
|
|
|
return (_this$_invoker = this._invoker).execute.apply(_this$_invoker, concat_default()(_context20 = [commandName]).call(_context20, _toConsumableArray(theArgs)));
|
|
}
|
|
/**
|
|
* Invoke command
|
|
* @param {String} commandName - Command name
|
|
* @param {...*} args - Arguments for creating command
|
|
* @returns {Promise}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "executeSilent",
|
|
value: function executeSilent(commandName) {
|
|
var _context21, _this$_invoker2, _context22;
|
|
|
|
for (var _len2 = arguments.length, args = new Array(_len2 > 1 ? _len2 - 1 : 0), _key2 = 1; _key2 < _len2; _key2++) {
|
|
args[_key2 - 1] = arguments[_key2];
|
|
}
|
|
|
|
// Inject an Graphics instance as first parameter
|
|
var theArgs = concat_default()(_context21 = [this._graphics]).call(_context21, args);
|
|
|
|
return (_this$_invoker2 = this._invoker).executeSilent.apply(_this$_invoker2, concat_default()(_context22 = [commandName]).call(_context22, _toConsumableArray(theArgs)));
|
|
}
|
|
/**
|
|
* Undo
|
|
* @param {number} [iterationCount=1] - Iteration count of undo
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.undo();
|
|
*/
|
|
|
|
}, {
|
|
key: "undo",
|
|
value: function undo() {
|
|
var _this4 = this;
|
|
|
|
var iterationCount = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 1;
|
|
|
|
var promise = promise_default().resolve();
|
|
|
|
for (var i = 0; i < iterationCount; i += 1) {
|
|
promise = promise.then(function () {
|
|
return _this4._invoker.undo();
|
|
});
|
|
}
|
|
|
|
return promise;
|
|
}
|
|
/**
|
|
* Redo
|
|
* @param {number} [iterationCount=1] - Iteration count of redo
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.redo();
|
|
*/
|
|
|
|
}, {
|
|
key: "redo",
|
|
value: function redo() {
|
|
var _this5 = this;
|
|
|
|
var iterationCount = arguments.length > 0 && arguments[0] !== undefined ? arguments[0] : 1;
|
|
|
|
var promise = promise_default().resolve();
|
|
|
|
for (var i = 0; i < iterationCount; i += 1) {
|
|
promise = promise.then(function () {
|
|
return _this5._invoker.redo();
|
|
});
|
|
}
|
|
|
|
return promise;
|
|
}
|
|
/**
|
|
* Zoom
|
|
* @param {number} x - x axis of center point for zoom
|
|
* @param {number} y - y axis of center point for zoom
|
|
* @param {number} zoomLevel - level of zoom(1.0 ~ 5.0)
|
|
*/
|
|
|
|
}, {
|
|
key: "zoom",
|
|
value: function zoom(_ref2) {
|
|
var x = _ref2.x,
|
|
y = _ref2.y,
|
|
zoomLevel = _ref2.zoomLevel;
|
|
|
|
this._graphics.zoom({
|
|
x: x,
|
|
y: y
|
|
}, zoomLevel);
|
|
}
|
|
/**
|
|
* Reset zoom. Change zoom level to 1.0
|
|
*/
|
|
|
|
}, {
|
|
key: "resetZoom",
|
|
value: function resetZoom() {
|
|
this._graphics.resetZoom();
|
|
}
|
|
/**
|
|
* Load image from file
|
|
* @param {File} imgFile - Image file
|
|
* @param {string} [imageName] - imageName
|
|
* @returns {Promise<SizeChange, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.loadImageFromFile(file).then(result => {
|
|
* console.log('old : ' + result.oldWidth + ', ' + result.oldHeight);
|
|
* console.log('new : ' + result.newWidth + ', ' + result.newHeight);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "loadImageFromFile",
|
|
value: function loadImageFromFile(imgFile, imageName) {
|
|
if (!imgFile) {
|
|
return promise_default().reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
var imgUrl = url_default().createObjectURL(imgFile);
|
|
|
|
imageName = imageName || imgFile.name;
|
|
return this.loadImageFromURL(imgUrl, imageName).then(function (value) {
|
|
url_default().revokeObjectURL(imgFile);
|
|
|
|
return value;
|
|
});
|
|
}
|
|
/**
|
|
* Load image from url
|
|
* @param {string} url - File url
|
|
* @param {string} imageName - imageName
|
|
* @returns {Promise<SizeChange, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.loadImageFromURL('http://url/testImage.png', 'lena').then(result => {
|
|
* console.log('old : ' + result.oldWidth + ', ' + result.oldHeight);
|
|
* console.log('new : ' + result.newWidth + ', ' + result.newHeight);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "loadImageFromURL",
|
|
value: function loadImageFromURL(url, imageName) {
|
|
if (!imageName || !url) {
|
|
return promise_default().reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
return this.execute(commandNames.LOAD_IMAGE, imageName, url);
|
|
}
|
|
/**
|
|
* Add image object on canvas
|
|
* @param {string} imgUrl - Image url to make object
|
|
* @returns {Promise<ObjectProps, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.addImageObject('path/fileName.jpg').then(objectProps => {
|
|
* console.log(ojectProps.id);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "addImageObject",
|
|
value: function addImageObject(imgUrl) {
|
|
if (!imgUrl) {
|
|
return promise_default().reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
return this.execute(commandNames.ADD_IMAGE_OBJECT, imgUrl);
|
|
}
|
|
/**
|
|
* Start a drawing mode. If the current mode is not 'NORMAL', 'stopDrawingMode()' will be called first.
|
|
* @param {String} mode Can be one of <I>'CROPPER', 'FREE_DRAWING', 'LINE_DRAWING', 'TEXT', 'SHAPE'</I>
|
|
* @param {Object} [option] parameters of drawing mode, it's available with 'FREE_DRAWING', 'LINE_DRAWING'
|
|
* @param {Number} [option.width] brush width
|
|
* @param {String} [option.color] brush color
|
|
* @param {Object} [option.arrowType] arrow decorate
|
|
* @param {string} [option.arrowType.tail] arrow decorate for tail. 'chevron' or 'triangle'
|
|
* @param {string} [option.arrowType.head] arrow decorate for head. 'chevron' or 'triangle'
|
|
* @returns {boolean} true if success or false
|
|
* @example
|
|
* imageEditor.startDrawingMode('FREE_DRAWING', {
|
|
* width: 10,
|
|
* color: 'rgba(255,0,0,0.5)'
|
|
* });
|
|
* imageEditor.startDrawingMode('LINE_DRAWING', {
|
|
* width: 10,
|
|
* color: 'rgba(255,0,0,0.5)',
|
|
* arrowType: {
|
|
* tail: 'chevron' // triangle
|
|
* }
|
|
* });
|
|
*
|
|
*/
|
|
|
|
}, {
|
|
key: "startDrawingMode",
|
|
value: function startDrawingMode(mode, option) {
|
|
return this._graphics.startDrawingMode(mode, option);
|
|
}
|
|
/**
|
|
* Stop the current drawing mode and back to the 'NORMAL' mode
|
|
* @example
|
|
* imageEditor.stopDrawingMode();
|
|
*/
|
|
|
|
}, {
|
|
key: "stopDrawingMode",
|
|
value: function stopDrawingMode() {
|
|
this._graphics.stopDrawingMode();
|
|
}
|
|
/**
|
|
* Crop this image with rect
|
|
* @param {Object} rect crop rect
|
|
* @param {Number} rect.left left position
|
|
* @param {Number} rect.top top position
|
|
* @param {Number} rect.width width
|
|
* @param {Number} rect.height height
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.crop(imageEditor.getCropzoneRect());
|
|
*/
|
|
|
|
}, {
|
|
key: "crop",
|
|
value: function crop(rect) {
|
|
var data = this._graphics.getCroppedImageData(rect);
|
|
|
|
if (!data) {
|
|
return promise_default().reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
return this.loadImageFromURL(data.url, data.imageName);
|
|
}
|
|
/**
|
|
* Get the cropping rect
|
|
* @returns {Object} {{left: number, top: number, width: number, height: number}} rect
|
|
*/
|
|
|
|
}, {
|
|
key: "getCropzoneRect",
|
|
value: function getCropzoneRect() {
|
|
return this._graphics.getCropzoneRect();
|
|
}
|
|
/**
|
|
* Set the cropping rect
|
|
* @param {number} [mode] crop rect mode [1, 1.5, 1.3333333333333333, 1.25, 1.7777777777777777]
|
|
*/
|
|
|
|
}, {
|
|
key: "setCropzoneRect",
|
|
value: function setCropzoneRect(mode) {
|
|
this._graphics.setCropzoneRect(mode);
|
|
}
|
|
/**
|
|
* Flip
|
|
* @returns {Promise}
|
|
* @param {string} type - 'flipX' or 'flipY' or 'reset'
|
|
* @returns {Promise<FlipStatus, ErrorMsg>}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_flip",
|
|
value: function _flip(type) {
|
|
return this.execute(commandNames.FLIP_IMAGE, type);
|
|
}
|
|
/**
|
|
* Flip x
|
|
* @returns {Promise<FlipStatus, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.flipX().then((status => {
|
|
* console.log('flipX: ', status.flipX);
|
|
* console.log('flipY: ', status.flipY);
|
|
* console.log('angle: ', status.angle);
|
|
* }).catch(message => {
|
|
* console.log('error: ', message);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "flipX",
|
|
value: function flipX() {
|
|
return this._flip('flipX');
|
|
}
|
|
/**
|
|
* Flip y
|
|
* @returns {Promise<FlipStatus, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.flipY().then(status => {
|
|
* console.log('flipX: ', status.flipX);
|
|
* console.log('flipY: ', status.flipY);
|
|
* console.log('angle: ', status.angle);
|
|
* }).catch(message => {
|
|
* console.log('error: ', message);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "flipY",
|
|
value: function flipY() {
|
|
return this._flip('flipY');
|
|
}
|
|
/**
|
|
* Reset flip
|
|
* @returns {Promise<FlipStatus, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.resetFlip().then(status => {
|
|
* console.log('flipX: ', status.flipX);
|
|
* console.log('flipY: ', status.flipY);
|
|
* console.log('angle: ', status.angle);
|
|
* }).catch(message => {
|
|
* console.log('error: ', message);
|
|
* });;
|
|
*/
|
|
|
|
}, {
|
|
key: "resetFlip",
|
|
value: function resetFlip() {
|
|
return this._flip('reset');
|
|
}
|
|
/**
|
|
* @param {string} type - 'rotate' or 'setAngle'
|
|
* @param {number} angle - angle value (degree)
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise<RotateStatus, ErrorMsg>}
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_rotate",
|
|
value: function _rotate(type, angle, isSilent) {
|
|
var result = null;
|
|
|
|
if (isSilent) {
|
|
result = this.executeSilent(commandNames.ROTATE_IMAGE, type, angle);
|
|
} else {
|
|
result = this.execute(commandNames.ROTATE_IMAGE, type, angle);
|
|
}
|
|
|
|
return result;
|
|
}
|
|
/**
|
|
* Rotate image
|
|
* @returns {Promise}
|
|
* @param {number} angle - Additional angle to rotate image
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise<RotateStatus, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.rotate(10); // angle = 10
|
|
* imageEditor.rotate(10); // angle = 20
|
|
* imageEditor.rotate(5); // angle = 5
|
|
* imageEditor.rotate(-95); // angle = -90
|
|
* imageEditor.rotate(10).then(status => {
|
|
* console.log('angle: ', status.angle);
|
|
* })).catch(message => {
|
|
* console.log('error: ', message);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "rotate",
|
|
value: function rotate(angle, isSilent) {
|
|
return this._rotate('rotate', angle, isSilent);
|
|
}
|
|
/**
|
|
* Set angle
|
|
* @param {number} angle - Angle of image
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise<RotateStatus, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.setAngle(10); // angle = 10
|
|
* imageEditor.rotate(10); // angle = 20
|
|
* imageEditor.setAngle(5); // angle = 5
|
|
* imageEditor.rotate(50); // angle = 55
|
|
* imageEditor.setAngle(-40); // angle = -40
|
|
* imageEditor.setAngle(10).then(status => {
|
|
* console.log('angle: ', status.angle);
|
|
* })).catch(message => {
|
|
* console.log('error: ', message);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "setAngle",
|
|
value: function setAngle(angle, isSilent) {
|
|
return this._rotate('setAngle', angle, isSilent);
|
|
}
|
|
/**
|
|
* Set drawing brush
|
|
* @param {Object} option brush option
|
|
* @param {Number} option.width width
|
|
* @param {String} option.color color like 'FFFFFF', 'rgba(0, 0, 0, 0.5)'
|
|
* @example
|
|
* imageEditor.startDrawingMode('FREE_DRAWING');
|
|
* imageEditor.setBrush({
|
|
* width: 12,
|
|
* color: 'rgba(0, 0, 0, 0.5)'
|
|
* });
|
|
* imageEditor.setBrush({
|
|
* width: 8,
|
|
* color: 'FFFFFF'
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "setBrush",
|
|
value: function setBrush(option) {
|
|
this._graphics.setBrush(option);
|
|
}
|
|
/**
|
|
* Set states of current drawing shape
|
|
* @param {string} type - Shape type (ex: 'rect', 'circle', 'triangle')
|
|
* @param {Object} [options] - Shape options
|
|
* @param {(ShapeFillOption | string)} [options.fill] - {@link ShapeFillOption} or
|
|
* Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stoke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.isRegular] - Whether resizing shape has 1:1 ratio or not
|
|
* @example
|
|
* imageEditor.setDrawingShape('rect', {
|
|
* fill: 'red',
|
|
* width: 100,
|
|
* height: 200
|
|
* });
|
|
* @example
|
|
* imageEditor.setDrawingShape('rect', {
|
|
* fill: {
|
|
* type: 'filter',
|
|
* filter: [{blur: 0.3}, {pixelate: 20}]
|
|
* },
|
|
* width: 100,
|
|
* height: 200
|
|
* });
|
|
* @example
|
|
* imageEditor.setDrawingShape('circle', {
|
|
* fill: 'transparent',
|
|
* stroke: 'blue',
|
|
* strokeWidth: 3,
|
|
* rx: 10,
|
|
* ry: 100
|
|
* });
|
|
* @example
|
|
* imageEditor.setDrawingShape('triangle', { // When resizing, the shape keep the 1:1 ratio
|
|
* width: 1,
|
|
* height: 1,
|
|
* isRegular: true
|
|
* });
|
|
* @example
|
|
* imageEditor.setDrawingShape('circle', { // When resizing, the shape keep the 1:1 ratio
|
|
* rx: 10,
|
|
* ry: 10,
|
|
* isRegular: true
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "setDrawingShape",
|
|
value: function setDrawingShape(type, options) {
|
|
this._graphics.setDrawingShape(type, options);
|
|
}
|
|
}, {
|
|
key: "setDrawingIcon",
|
|
value: function setDrawingIcon(type, iconColor) {
|
|
this._graphics.setIconStyle(type, iconColor);
|
|
}
|
|
/**
|
|
* Add shape
|
|
* @param {string} type - Shape type (ex: 'rect', 'circle', 'triangle')
|
|
* @param {Object} options - Shape options
|
|
* @param {(ShapeFillOption | string)} [options.fill] - {@link ShapeFillOption} or
|
|
* Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stroke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.left] - Shape x position
|
|
* @param {number} [options.top] - Shape y position
|
|
* @param {boolean} [options.isRegular] - Whether resizing shape has 1:1 ratio or not
|
|
* @returns {Promise<ObjectProps, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.addShape('rect', {
|
|
* fill: 'red',
|
|
* stroke: 'blue',
|
|
* strokeWidth: 3,
|
|
* width: 100,
|
|
* height: 200,
|
|
* left: 10,
|
|
* top: 10,
|
|
* isRegular: true
|
|
* });
|
|
* @example
|
|
* imageEditor.addShape('circle', {
|
|
* fill: 'red',
|
|
* stroke: 'blue',
|
|
* strokeWidth: 3,
|
|
* rx: 10,
|
|
* ry: 100,
|
|
* isRegular: false
|
|
* }).then(objectProps => {
|
|
* console.log(objectProps.id);
|
|
* });
|
|
* @example
|
|
* imageEditor.addShape('rect', {
|
|
* fill: {
|
|
* type: 'filter',
|
|
* filter: [{blur: 0.3}, {pixelate: 20}]
|
|
* },
|
|
* stroke: 'blue',
|
|
* strokeWidth: 3,
|
|
* rx: 10,
|
|
* ry: 100,
|
|
* isRegular: false
|
|
* }).then(objectProps => {
|
|
* console.log(objectProps.id);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "addShape",
|
|
value: function addShape(type, options) {
|
|
options = options || {};
|
|
|
|
this._setPositions(options);
|
|
|
|
return this.execute(commandNames.ADD_SHAPE, type, options);
|
|
}
|
|
/**
|
|
* Change shape
|
|
* @param {number} id - object id
|
|
* @param {Object} options - Shape options
|
|
* @param {(ShapeFillOption | string)} [options.fill] - {@link ShapeFillOption} or
|
|
* Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stroke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {boolean} [options.isRegular] - Whether resizing shape has 1:1 ratio or not
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise}
|
|
* @example
|
|
* // call after selecting shape object on canvas
|
|
* imageEditor.changeShape(id, { // change rectagle or triangle
|
|
* fill: 'red',
|
|
* stroke: 'blue',
|
|
* strokeWidth: 3,
|
|
* width: 100,
|
|
* height: 200
|
|
* });
|
|
* @example
|
|
* // call after selecting shape object on canvas
|
|
* imageEditor.changeShape(id, { // change circle
|
|
* fill: 'red',
|
|
* stroke: 'blue',
|
|
* strokeWidth: 3,
|
|
* rx: 10,
|
|
* ry: 100
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "changeShape",
|
|
value: function changeShape(id, options, isSilent) {
|
|
var executeMethodName = isSilent ? 'executeSilent' : 'execute';
|
|
return this[executeMethodName](commandNames.CHANGE_SHAPE, id, options);
|
|
}
|
|
/**
|
|
* Add text on image
|
|
* @param {string} text - Initial input text
|
|
* @param {Object} [options] Options for generating text
|
|
* @param {Object} [options.styles] Initial styles
|
|
* @param {string} [options.styles.fill] Color
|
|
* @param {string} [options.styles.fontFamily] Font type for text
|
|
* @param {number} [options.styles.fontSize] Size
|
|
* @param {string} [options.styles.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [options.styles.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [options.styles.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [options.styles.textDecoration] Type of line (underline / line-through / overline)
|
|
* @param {{x: number, y: number}} [options.position] - Initial position
|
|
* @param {boolean} [options.autofocus] - text autofocus, default is true
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.addText('init text');
|
|
* @example
|
|
* imageEditor.addText('init text', {
|
|
* styles: {
|
|
* fill: '#000',
|
|
* fontSize: 20,
|
|
* fontWeight: 'bold'
|
|
* },
|
|
* position: {
|
|
* x: 10,
|
|
* y: 10
|
|
* }
|
|
* }).then(objectProps => {
|
|
* console.log(objectProps.id);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "addText",
|
|
value: function addText(text, options) {
|
|
text = text || '';
|
|
options = options || {};
|
|
return this.execute(commandNames.ADD_TEXT, text, options);
|
|
}
|
|
/**
|
|
* Change contents of selected text object on image
|
|
* @param {number} id - object id
|
|
* @param {string} text - Changing text
|
|
* @returns {Promise<ObjectProps, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.changeText(id, 'change text');
|
|
*/
|
|
|
|
}, {
|
|
key: "changeText",
|
|
value: function changeText(id, text) {
|
|
text = text || '';
|
|
return this.execute(commandNames.CHANGE_TEXT, id, text);
|
|
}
|
|
/**
|
|
* Set style
|
|
* @param {number} id - object id
|
|
* @param {Object} styleObj - text styles
|
|
* @param {string} [styleObj.fill] Color
|
|
* @param {string} [styleObj.fontFamily] Font type for text
|
|
* @param {number} [styleObj.fontSize] Size
|
|
* @param {string} [styleObj.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [styleObj.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [styleObj.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [styleObj.textDecoration] Type of line (underline / line-through / overline)
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.changeTextStyle(id, {
|
|
* fontStyle: 'italic'
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "changeTextStyle",
|
|
value: function changeTextStyle(id, styleObj, isSilent) {
|
|
var executeMethodName = isSilent ? 'executeSilent' : 'execute';
|
|
return this[executeMethodName](commandNames.CHANGE_TEXT_STYLE, id, styleObj);
|
|
}
|
|
/**
|
|
* change text mode
|
|
* @param {string} type - change type
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_changeActivateMode",
|
|
value: function _changeActivateMode(type) {
|
|
if (type !== 'ICON' && this.getDrawingMode() !== type) {
|
|
this.startDrawingMode(type);
|
|
}
|
|
}
|
|
/**
|
|
* 'textChanged' event handler
|
|
* @param {Object} target - changed text object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onTextChanged",
|
|
value: function _onTextChanged(target) {
|
|
this.fire(eventNames.TEXT_CHANGED, target);
|
|
}
|
|
/**
|
|
* 'iconCreateResize' event handler
|
|
* @param {Object} originPointer origin pointer
|
|
* @param {Number} originPointer.x x position
|
|
* @param {Number} originPointer.y y position
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onIconCreateResize",
|
|
value: function _onIconCreateResize(originPointer) {
|
|
this.fire(eventNames.ICON_CREATE_RESIZE, originPointer);
|
|
}
|
|
/**
|
|
* 'iconCreateEnd' event handler
|
|
* @param {Object} originPointer origin pointer
|
|
* @param {Number} originPointer.x x position
|
|
* @param {Number} originPointer.y y position
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onIconCreateEnd",
|
|
value: function _onIconCreateEnd(originPointer) {
|
|
this.fire(eventNames.ICON_CREATE_END, originPointer);
|
|
}
|
|
/**
|
|
* 'textEditing' event handler
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onTextEditing",
|
|
value: function _onTextEditing() {
|
|
/**
|
|
* The event which starts to edit text object
|
|
* @event ImageEditor#textEditing
|
|
* @example
|
|
* imageEditor.on('textEditing', function() {
|
|
* console.log('text editing');
|
|
* });
|
|
*/
|
|
this.fire(eventNames.TEXT_EDITING);
|
|
}
|
|
/**
|
|
* Mousedown event handler in case of 'TEXT' drawing mode
|
|
* @param {fabric.Event} event - Current mousedown event object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onAddText",
|
|
value: function _onAddText(event) {
|
|
/**
|
|
* The event when 'TEXT' drawing mode is enabled and click non-object area.
|
|
* @event ImageEditor#addText
|
|
* @param {Object} pos
|
|
* @param {Object} pos.originPosition - Current position on origin canvas
|
|
* @param {Number} pos.originPosition.x - x
|
|
* @param {Number} pos.originPosition.y - y
|
|
* @param {Object} pos.clientPosition - Current position on client area
|
|
* @param {Number} pos.clientPosition.x - x
|
|
* @param {Number} pos.clientPosition.y - y
|
|
* @example
|
|
* imageEditor.on('addText', function(pos) {
|
|
* console.log('text position on canvas: ' + pos.originPosition);
|
|
* console.log('text position on brwoser: ' + pos.clientPosition);
|
|
* });
|
|
*/
|
|
this.fire(eventNames.ADD_TEXT, {
|
|
originPosition: event.originPosition,
|
|
clientPosition: event.clientPosition
|
|
});
|
|
}
|
|
/**
|
|
* 'addObject' event handler
|
|
* @param {Object} objectProps added object properties
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onAddObject",
|
|
value: function _onAddObject(objectProps) {
|
|
var obj = this._graphics.getObject(objectProps.id);
|
|
|
|
this._invoker.fire(eventNames.EXECUTE_COMMAND, getObjectType(obj.type));
|
|
|
|
this._pushAddObjectCommand(obj);
|
|
}
|
|
/**
|
|
* 'objectAdded' event handler
|
|
* @param {Object} objectProps added object properties
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectAdded",
|
|
value: function _onObjectAdded(objectProps) {
|
|
/**
|
|
* The event when object added
|
|
* @event ImageEditor#objectAdded
|
|
* @param {ObjectProps} props - object properties
|
|
* @example
|
|
* imageEditor.on('objectAdded', function(props) {
|
|
* console.log(props);
|
|
* });
|
|
*/
|
|
this.fire(OBJECT_ADDED, objectProps);
|
|
/**
|
|
* The event when object added (deprecated)
|
|
* @event ImageEditor#addObjectAfter
|
|
* @param {ObjectProps} props - object properties
|
|
* @deprecated
|
|
*/
|
|
|
|
this.fire(ADD_OBJECT_AFTER, objectProps);
|
|
}
|
|
/**
|
|
* 'objectModified' event handler
|
|
* @param {fabric.Object} obj - selection object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_onObjectModified",
|
|
value: function _onObjectModified(obj) {
|
|
if (obj.type !== OBJ_TYPE.CROPZONE) {
|
|
this._invoker.fire(eventNames.EXECUTE_COMMAND, getObjectType(obj.type));
|
|
|
|
this._pushModifyObjectCommand(obj);
|
|
}
|
|
}
|
|
/**
|
|
* 'selectionCleared' event handler
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_selectionCleared",
|
|
value: function _selectionCleared() {
|
|
this.fire(SELECTION_CLEARED);
|
|
}
|
|
/**
|
|
* 'selectionCreated' event handler
|
|
* @param {Object} eventTarget - Fabric object
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_selectionCreated",
|
|
value: function _selectionCreated(eventTarget) {
|
|
this.fire(SELECTION_CREATED, eventTarget);
|
|
}
|
|
/**
|
|
* Register custom icons
|
|
* @param {{iconType: string, pathValue: string}} infos - Infos to register icons
|
|
* @example
|
|
* imageEditor.registerIcons({
|
|
* customIcon: 'M 0 0 L 20 20 L 10 10 Z',
|
|
* customArrow: 'M 60 0 L 120 60 H 90 L 75 45 V 180 H 45 V 45 L 30 60 H 0 Z'
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "registerIcons",
|
|
value: function registerIcons(infos) {
|
|
this._graphics.registerPaths(infos);
|
|
}
|
|
/**
|
|
* Change canvas cursor type
|
|
* @param {string} cursorType - cursor type
|
|
* @example
|
|
* imageEditor.changeCursor('crosshair');
|
|
*/
|
|
|
|
}, {
|
|
key: "changeCursor",
|
|
value: function changeCursor(cursorType) {
|
|
this._graphics.changeCursor(cursorType);
|
|
}
|
|
/**
|
|
* Add icon on canvas
|
|
* @param {string} type - Icon type ('arrow', 'cancel', custom icon name)
|
|
* @param {Object} options - Icon options
|
|
* @param {string} [options.fill] - Icon foreground color
|
|
* @param {number} [options.left] - Icon x position
|
|
* @param {number} [options.top] - Icon y position
|
|
* @returns {Promise<ObjectProps, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.addIcon('arrow'); // The position is center on canvas
|
|
* @example
|
|
* imageEditor.addIcon('arrow', {
|
|
* left: 100,
|
|
* top: 100
|
|
* }).then(objectProps => {
|
|
* console.log(objectProps.id);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "addIcon",
|
|
value: function addIcon(type, options) {
|
|
options = options || {};
|
|
|
|
this._setPositions(options);
|
|
|
|
return this.execute(commandNames.ADD_ICON, type, options);
|
|
}
|
|
/**
|
|
* Change icon color
|
|
* @param {number} id - object id
|
|
* @param {string} color - Color for icon
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.changeIconColor(id, '#000000');
|
|
*/
|
|
|
|
}, {
|
|
key: "changeIconColor",
|
|
value: function changeIconColor(id, color) {
|
|
return this.execute(commandNames.CHANGE_ICON_COLOR, id, color);
|
|
}
|
|
/**
|
|
* Remove an object or group by id
|
|
* @param {number} id - object id
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.removeObject(id);
|
|
*/
|
|
|
|
}, {
|
|
key: "removeObject",
|
|
value: function removeObject(id) {
|
|
var _this$_graphics$getOb = this._graphics.getObject(id),
|
|
type = _this$_graphics$getOb.type;
|
|
|
|
return this.execute(commandNames.REMOVE_OBJECT, id, getObjectType(type));
|
|
}
|
|
/**
|
|
* Whether it has the filter or not
|
|
* @param {string} type - Filter type
|
|
* @returns {boolean} true if it has the filter
|
|
*/
|
|
|
|
}, {
|
|
key: "hasFilter",
|
|
value: function hasFilter(type) {
|
|
return this._graphics.hasFilter(type);
|
|
}
|
|
/**
|
|
* Remove filter on canvas image
|
|
* @param {string} type - Filter type
|
|
* @returns {Promise<FilterResult, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.removeFilter('Grayscale').then(obj => {
|
|
* console.log('filterType: ', obj.type);
|
|
* console.log('actType: ', obj.action);
|
|
* }).catch(message => {
|
|
* console.log('error: ', message);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "removeFilter",
|
|
value: function removeFilter(type) {
|
|
return this.execute(commandNames.REMOVE_FILTER, type);
|
|
}
|
|
/**
|
|
* Apply filter on canvas image
|
|
* @param {string} type - Filter type
|
|
* @param {object} options - Options to apply filter
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise<FilterResult, ErrorMsg>}
|
|
* @example
|
|
* imageEditor.applyFilter('Grayscale');
|
|
* @example
|
|
* imageEditor.applyFilter('mask', {maskObjId: id}).then(obj => {
|
|
* console.log('filterType: ', obj.type);
|
|
* console.log('actType: ', obj.action);
|
|
* }).catch(message => {
|
|
* console.log('error: ', message);
|
|
* });;
|
|
*/
|
|
|
|
}, {
|
|
key: "applyFilter",
|
|
value: function applyFilter(type, options, isSilent) {
|
|
var executeMethodName = isSilent ? 'executeSilent' : 'execute';
|
|
return this[executeMethodName](commandNames.APPLY_FILTER, type, options);
|
|
}
|
|
/**
|
|
* Get data url
|
|
* @param {Object} options - options for toDataURL
|
|
* @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png"
|
|
* @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg.
|
|
* @param {Number} [options.multiplier=1] Multiplier to scale by
|
|
* @param {Number} [options.left] Cropping left offset. Introduced in fabric v1.2.14
|
|
* @param {Number} [options.top] Cropping top offset. Introduced in fabric v1.2.14
|
|
* @param {Number} [options.width] Cropping width. Introduced in fabric v1.2.14
|
|
* @param {Number} [options.height] Cropping height. Introduced in fabric v1.2.14
|
|
* @returns {string} A DOMString containing the requested data URI
|
|
* @example
|
|
* imgEl.src = imageEditor.toDataURL();
|
|
*
|
|
* imageEditor.loadImageFromURL(imageEditor.toDataURL(), 'FilterImage').then(() => {
|
|
* imageEditor.addImageObject(imgUrl);
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "toDataURL",
|
|
value: function toDataURL(options) {
|
|
return this._graphics.toDataURL(options);
|
|
}
|
|
/**
|
|
* Get image name
|
|
* @returns {string} image name
|
|
* @example
|
|
* console.log(imageEditor.getImageName());
|
|
*/
|
|
|
|
}, {
|
|
key: "getImageName",
|
|
value: function getImageName() {
|
|
return this._graphics.getImageName();
|
|
}
|
|
/**
|
|
* Clear undoStack
|
|
* @example
|
|
* imageEditor.clearUndoStack();
|
|
*/
|
|
|
|
}, {
|
|
key: "clearUndoStack",
|
|
value: function clearUndoStack() {
|
|
this._invoker.clearUndoStack();
|
|
}
|
|
/**
|
|
* Clear redoStack
|
|
* @example
|
|
* imageEditor.clearRedoStack();
|
|
*/
|
|
|
|
}, {
|
|
key: "clearRedoStack",
|
|
value: function clearRedoStack() {
|
|
this._invoker.clearRedoStack();
|
|
}
|
|
/**
|
|
* Whehter the undo stack is empty or not
|
|
* @returns {boolean}
|
|
* imageEditor.isEmptyUndoStack();
|
|
*/
|
|
|
|
}, {
|
|
key: "isEmptyUndoStack",
|
|
value: function isEmptyUndoStack() {
|
|
return this._invoker.isEmptyUndoStack();
|
|
}
|
|
/**
|
|
* Whehter the redo stack is empty or not
|
|
* @returns {boolean}
|
|
* imageEditor.isEmptyRedoStack();
|
|
*/
|
|
|
|
}, {
|
|
key: "isEmptyRedoStack",
|
|
value: function isEmptyRedoStack() {
|
|
return this._invoker.isEmptyRedoStack();
|
|
}
|
|
/**
|
|
* Resize canvas dimension
|
|
* @param {{width: number, height: number}} dimension - Max width & height
|
|
* @returns {Promise}
|
|
*/
|
|
|
|
}, {
|
|
key: "resizeCanvasDimension",
|
|
value: function resizeCanvasDimension(dimension) {
|
|
if (!dimension) {
|
|
return promise_default().reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
return this.execute(commandNames.RESIZE_CANVAS_DIMENSION, dimension);
|
|
}
|
|
/**
|
|
* Destroy
|
|
*/
|
|
|
|
}, {
|
|
key: "destroy",
|
|
value: function destroy() {
|
|
var _this6 = this;
|
|
|
|
this.stopDrawingMode();
|
|
|
|
this._detachDomEvents();
|
|
|
|
this._graphics.destroy();
|
|
|
|
this._graphics = null;
|
|
|
|
if (this.ui) {
|
|
this._detachColorPickerInputBoxEvents();
|
|
|
|
this.ui.destroy();
|
|
}
|
|
|
|
forEach_default()(this, function (value, key) {
|
|
_this6[key] = null;
|
|
}, this);
|
|
}
|
|
/**
|
|
* Set position
|
|
* @param {Object} options - Position options (left or top)
|
|
* @private
|
|
*/
|
|
|
|
}, {
|
|
key: "_setPositions",
|
|
value: function _setPositions(options) {
|
|
var centerPosition = this._graphics.getCenter();
|
|
|
|
if (isUndefined_default()(options.left)) {
|
|
options.left = centerPosition.left;
|
|
}
|
|
|
|
if (isUndefined_default()(options.top)) {
|
|
options.top = centerPosition.top;
|
|
}
|
|
}
|
|
/**
|
|
* Set properties of active object
|
|
* @param {number} id - object id
|
|
* @param {Object} keyValue - key & value
|
|
* @returns {Promise}
|
|
* @example
|
|
* imageEditor.setObjectProperties(id, {
|
|
* left:100,
|
|
* top:100,
|
|
* width: 200,
|
|
* height: 200,
|
|
* opacity: 0.5
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "setObjectProperties",
|
|
value: function setObjectProperties(id, keyValue) {
|
|
return this.execute(commandNames.SET_OBJECT_PROPERTIES, id, keyValue);
|
|
}
|
|
/**
|
|
* Set properties of active object, Do not leave an invoke history.
|
|
* @param {number} id - object id
|
|
* @param {Object} keyValue - key & value
|
|
* @example
|
|
* imageEditor.setObjectPropertiesQuietly(id, {
|
|
* left:100,
|
|
* top:100,
|
|
* width: 200,
|
|
* height: 200,
|
|
* opacity: 0.5
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "setObjectPropertiesQuietly",
|
|
value: function setObjectPropertiesQuietly(id, keyValue) {
|
|
this._graphics.setObjectProperties(id, keyValue);
|
|
}
|
|
/**
|
|
* Get properties of active object corresponding key
|
|
* @param {number} id - object id
|
|
* @param {Array<string>|ObjectProps|string} keys - property's key
|
|
* @returns {ObjectProps} properties if id is valid or null
|
|
* @example
|
|
* var props = imageEditor.getObjectProperties(id, 'left');
|
|
* console.log(props);
|
|
* @example
|
|
* var props = imageEditor.getObjectProperties(id, ['left', 'top', 'width', 'height']);
|
|
* console.log(props);
|
|
* @example
|
|
* var props = imageEditor.getObjectProperties(id, {
|
|
* left: null,
|
|
* top: null,
|
|
* width: null,
|
|
* height: null,
|
|
* opacity: null
|
|
* });
|
|
* console.log(props);
|
|
*/
|
|
|
|
}, {
|
|
key: "getObjectProperties",
|
|
value: function getObjectProperties(id, keys) {
|
|
var object = this._graphics.getObject(id);
|
|
|
|
if (!object) {
|
|
return null;
|
|
}
|
|
|
|
return this._graphics.getObjectProperties(id, keys);
|
|
}
|
|
/**
|
|
* Get the canvas size
|
|
* @returns {Object} {{width: number, height: number}} canvas size
|
|
* @example
|
|
* var canvasSize = imageEditor.getCanvasSize();
|
|
* console.log(canvasSize.width);
|
|
* console.height(canvasSize.height);
|
|
*/
|
|
|
|
}, {
|
|
key: "getCanvasSize",
|
|
value: function getCanvasSize() {
|
|
return this._graphics.getCanvasSize();
|
|
}
|
|
/**
|
|
* Get object position by originX, originY
|
|
* @param {number} id - object id
|
|
* @param {string} originX - can be 'left', 'center', 'right'
|
|
* @param {string} originY - can be 'top', 'center', 'bottom'
|
|
* @returns {Object} {{x:number, y: number}} position by origin if id is valid, or null
|
|
* @example
|
|
* var position = imageEditor.getObjectPosition(id, 'left', 'top');
|
|
* console.log(position);
|
|
*/
|
|
|
|
}, {
|
|
key: "getObjectPosition",
|
|
value: function getObjectPosition(id, originX, originY) {
|
|
return this._graphics.getObjectPosition(id, originX, originY);
|
|
}
|
|
/**
|
|
* Set object position by originX, originY
|
|
* @param {number} id - object id
|
|
* @param {Object} posInfo - position object
|
|
* @param {number} posInfo.x - x position
|
|
* @param {number} posInfo.y - y position
|
|
* @param {string} posInfo.originX - can be 'left', 'center', 'right'
|
|
* @param {string} posInfo.originY - can be 'top', 'center', 'bottom'
|
|
* @returns {Promise}
|
|
* @example
|
|
* // align the object to 'left', 'top'
|
|
* imageEditor.setObjectPosition(id, {
|
|
* x: 0,
|
|
* y: 0,
|
|
* originX: 'left',
|
|
* originY: 'top'
|
|
* });
|
|
* @example
|
|
* // align the object to 'right', 'top'
|
|
* var canvasSize = imageEditor.getCanvasSize();
|
|
* imageEditor.setObjectPosition(id, {
|
|
* x: canvasSize.width,
|
|
* y: 0,
|
|
* originX: 'right',
|
|
* originY: 'top'
|
|
* });
|
|
* @example
|
|
* // align the object to 'left', 'bottom'
|
|
* var canvasSize = imageEditor.getCanvasSize();
|
|
* imageEditor.setObjectPosition(id, {
|
|
* x: 0,
|
|
* y: canvasSize.height,
|
|
* originX: 'left',
|
|
* originY: 'bottom'
|
|
* });
|
|
* @example
|
|
* // align the object to 'right', 'bottom'
|
|
* var canvasSize = imageEditor.getCanvasSize();
|
|
* imageEditor.setObjectPosition(id, {
|
|
* x: canvasSize.width,
|
|
* y: canvasSize.height,
|
|
* originX: 'right',
|
|
* originY: 'bottom'
|
|
* });
|
|
*/
|
|
|
|
}, {
|
|
key: "setObjectPosition",
|
|
value: function setObjectPosition(id, posInfo) {
|
|
return this.execute(commandNames.SET_OBJECT_POSITION, id, posInfo);
|
|
}
|
|
/**
|
|
* @param {object} dimensions - Image Dimensions
|
|
* @returns {Promise<ErrorMsg>}
|
|
*/
|
|
|
|
}, {
|
|
key: "resize",
|
|
value: function resize(dimensions) {
|
|
return this.execute(commandNames.RESIZE_IMAGE, dimensions);
|
|
}
|
|
}]);
|
|
|
|
return ImageEditor;
|
|
}();
|
|
|
|
action.mixin(ImageEditor);
|
|
customEvents_default().mixin(ImageEditor);
|
|
/* harmony default export */ var imageEditor = (ImageEditor);
|
|
;// CONCATENATED MODULE: ./src/js/command/addIcon.js
|
|
|
|
|
|
|
|
var ICON = componentNames.ICON;
|
|
var addIcon_command = {
|
|
name: commandNames.ADD_ICON,
|
|
|
|
/**
|
|
* Add an icon
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - Icon type ('arrow', 'cancel', custom icon name)
|
|
* @param {Object} options - Icon options
|
|
* @param {string} [options.fill] - Icon foreground color
|
|
* @param {string} [options.left] - Icon x position
|
|
* @param {string} [options.top] - Icon y position
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, type, options) {
|
|
var _this = this;
|
|
|
|
var iconComp = graphics.getComponent(ICON);
|
|
return iconComp.add(type, options).then(function (objectProps) {
|
|
_this.undoData.object = graphics.getObject(objectProps.id);
|
|
return objectProps;
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
graphics.remove(this.undoData.object);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(addIcon_command);
|
|
/* harmony default export */ var addIcon = ((/* unused pure expression or super */ null && (addIcon_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/addImageObject.js
|
|
|
|
|
|
|
|
var addImageObject_command = {
|
|
name: commandNames.ADD_IMAGE_OBJECT,
|
|
|
|
/**
|
|
* Add an image object
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} imgUrl - Image url to make object
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, imgUrl) {
|
|
var _this = this;
|
|
|
|
return graphics.addImageObject(imgUrl).then(function (objectProps) {
|
|
_this.undoData.object = graphics.getObject(objectProps.id);
|
|
return objectProps;
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
graphics.remove(this.undoData.object);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(addImageObject_command);
|
|
/* harmony default export */ var addImageObject = ((/* unused pure expression or super */ null && (addImageObject_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/addObject.js
|
|
|
|
|
|
|
|
var addObject_command = {
|
|
name: commandNames.ADD_OBJECT,
|
|
|
|
/**
|
|
* Add an object
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {Object} object - Fabric object
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, object) {
|
|
return new (promise_default())(function (resolve, reject) {
|
|
if (!graphics.contains(object)) {
|
|
graphics.add(object);
|
|
resolve(object);
|
|
} else {
|
|
reject(rejectMessages.addedObject);
|
|
}
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {Object} object - Fabric object
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics, object) {
|
|
return new (promise_default())(function (resolve, reject) {
|
|
if (graphics.contains(object)) {
|
|
graphics.remove(object);
|
|
resolve(object);
|
|
} else {
|
|
reject(rejectMessages.noObject);
|
|
}
|
|
});
|
|
}
|
|
};
|
|
factory_command.register(addObject_command);
|
|
/* harmony default export */ var addObject = ((/* unused pure expression or super */ null && (addObject_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/addShape.js
|
|
|
|
|
|
|
|
var SHAPE = componentNames.SHAPE;
|
|
var addShape_command = {
|
|
name: commandNames.ADD_SHAPE,
|
|
|
|
/**
|
|
* Add a shape
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - Shape type (ex: 'rect', 'circle', 'triangle')
|
|
* @param {Object} options - Shape options
|
|
* @param {string} [options.fill] - Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stroke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.left] - Shape x position
|
|
* @param {number} [options.top] - Shape y position
|
|
* @param {number} [options.isRegular] - Whether resizing shape has 1:1 ratio or not
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, type, options) {
|
|
var _this = this;
|
|
|
|
var shapeComp = graphics.getComponent(SHAPE);
|
|
return shapeComp.add(type, options).then(function (objectProps) {
|
|
var id = objectProps.id;
|
|
_this.undoData.object = graphics.getObject(id);
|
|
return objectProps;
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
graphics.remove(this.undoData.object);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(addShape_command);
|
|
/* harmony default export */ var addShape = ((/* unused pure expression or super */ null && (addShape_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/addText.js
|
|
|
|
|
|
|
|
|
|
var TEXT = componentNames.TEXT;
|
|
var addText_command = {
|
|
name: commandNames.ADD_TEXT,
|
|
|
|
/**
|
|
* Add a text object
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} text - Initial input text
|
|
* @param {Object} [options] Options for text styles
|
|
* @param {Object} [options.styles] Initial styles
|
|
* @param {string} [options.styles.fill] Color
|
|
* @param {string} [options.styles.fontFamily] Font type for text
|
|
* @param {number} [options.styles.fontSize] Size
|
|
* @param {string} [options.styles.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [options.styles.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [options.styles.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [options.styles.textDecoration] Type of line (underline / line-through / overline)
|
|
* @param {{x: number, y: number}} [options.position] - Initial position
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, text, options) {
|
|
var _this = this;
|
|
|
|
var textComp = graphics.getComponent(TEXT);
|
|
|
|
if (this.undoData.object) {
|
|
var undoObject = this.undoData.object;
|
|
return new (promise_default())(function (resolve, reject) {
|
|
if (!graphics.contains(undoObject)) {
|
|
graphics.add(undoObject);
|
|
resolve(undoObject);
|
|
} else {
|
|
reject(rejectMessages.redo);
|
|
}
|
|
});
|
|
}
|
|
|
|
return textComp.add(text, options).then(function (objectProps) {
|
|
var id = objectProps.id;
|
|
var textObject = graphics.getObject(id);
|
|
_this.undoData.object = textObject;
|
|
setCachedUndoDataForDimension(makeSelectionUndoData(textObject, function () {
|
|
return makeSelectionUndoDatum(id, textObject, false);
|
|
}));
|
|
return objectProps;
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
graphics.remove(this.undoData.object);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(addText_command);
|
|
/* harmony default export */ var addText = ((/* unused pure expression or super */ null && (addText_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/applyFilter.js
|
|
|
|
|
|
|
|
|
|
var FILTER = componentNames.FILTER;
|
|
/**
|
|
* Cached data for undo
|
|
* @type {Object}
|
|
*/
|
|
|
|
var cachedUndoDataForSilent = null;
|
|
/**
|
|
* Make undoData
|
|
* @param {string} type - Filter type
|
|
* @param {Object} prevfilterOption - prev Filter options
|
|
* @param {Object} options - Filter options
|
|
* @returns {object} - undo data
|
|
*/
|
|
|
|
function makeUndoData(type, prevfilterOption, options) {
|
|
var undoData = {};
|
|
|
|
if (type === 'mask') {
|
|
undoData.object = options.mask;
|
|
}
|
|
|
|
undoData.options = prevfilterOption;
|
|
return undoData;
|
|
}
|
|
|
|
var applyFilter_command = {
|
|
name: commandNames.APPLY_FILTER,
|
|
|
|
/**
|
|
* Apply a filter into an image
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - Filter type
|
|
* @param {Object} options - Filter options
|
|
* @param {number} options.maskObjId - masking image object id
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, type, options, isSilent) {
|
|
var filterComp = graphics.getComponent(FILTER);
|
|
|
|
if (type === 'mask') {
|
|
var maskObj = graphics.getObject(options.maskObjId);
|
|
|
|
if (!(maskObj && maskObj.isType('image'))) {
|
|
return promise_default().reject(rejectMessages.invalidParameters);
|
|
}
|
|
|
|
extend_default()(options, {
|
|
mask: maskObj
|
|
});
|
|
graphics.remove(options.mask);
|
|
}
|
|
|
|
if (!this.isRedo) {
|
|
var prevfilterOption = filterComp.getOptions(type);
|
|
var undoData = makeUndoData(type, prevfilterOption, options);
|
|
cachedUndoDataForSilent = this.setUndoData(undoData, cachedUndoDataForSilent, isSilent);
|
|
}
|
|
|
|
return filterComp.add(type, options);
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - Filter type
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics, type) {
|
|
var filterComp = graphics.getComponent(FILTER);
|
|
|
|
if (type === 'mask') {
|
|
var mask = this.undoData.object;
|
|
graphics.add(mask);
|
|
graphics.setActiveObject(mask);
|
|
return filterComp.remove(type);
|
|
} // options changed case
|
|
|
|
|
|
if (this.undoData.options) {
|
|
return filterComp.add(type, this.undoData.options);
|
|
} // filter added case
|
|
|
|
|
|
return filterComp.remove(type);
|
|
}
|
|
};
|
|
factory_command.register(applyFilter_command);
|
|
/* harmony default export */ var applyFilter = ((/* unused pure expression or super */ null && (applyFilter_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/changeIconColor.js
|
|
|
|
|
|
|
|
var changeIconColor_ICON = componentNames.ICON;
|
|
var changeIconColor_command = {
|
|
name: commandNames.CHANGE_ICON_COLOR,
|
|
|
|
/**
|
|
* Change icon color
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @param {string} color - Color for icon
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, id, color) {
|
|
var _this = this;
|
|
|
|
return new (promise_default())(function (resolve, reject) {
|
|
var iconComp = graphics.getComponent(changeIconColor_ICON);
|
|
var targetObj = graphics.getObject(id);
|
|
|
|
if (!targetObj) {
|
|
reject(rejectMessages.noObject);
|
|
}
|
|
|
|
_this.undoData.object = targetObj;
|
|
_this.undoData.color = iconComp.getColor(targetObj);
|
|
iconComp.setColor(color, targetObj);
|
|
resolve();
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var iconComp = graphics.getComponent(changeIconColor_ICON);
|
|
var _this$undoData = this.undoData,
|
|
icon = _this$undoData.object,
|
|
color = _this$undoData.color;
|
|
iconComp.setColor(color, icon);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(changeIconColor_command);
|
|
/* harmony default export */ var changeIconColor = ((/* unused pure expression or super */ null && (changeIconColor_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/changeShape.js
|
|
|
|
|
|
|
|
|
|
var changeShape_SHAPE = componentNames.SHAPE;
|
|
/**
|
|
* Cached data for undo
|
|
* @type {Object}
|
|
*/
|
|
|
|
var changeShape_cachedUndoDataForSilent = null;
|
|
/**
|
|
* Make undoData
|
|
* @param {object} options - shape options
|
|
* @param {Component} targetObj - shape component
|
|
* @returns {object} - undo data
|
|
*/
|
|
|
|
function changeShape_makeUndoData(options, targetObj) {
|
|
var undoData = {
|
|
object: targetObj,
|
|
options: {}
|
|
};
|
|
forEachOwnProperties_default()(options, function (value, key) {
|
|
undoData.options[key] = targetObj[key];
|
|
});
|
|
return undoData;
|
|
}
|
|
|
|
var changeShape_command = {
|
|
name: commandNames.CHANGE_SHAPE,
|
|
|
|
/**
|
|
* Change a shape
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @param {Object} options - Shape options
|
|
* @param {string} [options.fill] - Shape foreground color (ex: '#fff', 'transparent')
|
|
* @param {string} [options.stroke] - Shape outline color
|
|
* @param {number} [options.strokeWidth] - Shape outline width
|
|
* @param {number} [options.width] - Width value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.height] - Height value (When type option is 'rect', this options can use)
|
|
* @param {number} [options.rx] - Radius x value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.ry] - Radius y value (When type option is 'circle', this options can use)
|
|
* @param {number} [options.left] - Shape x position
|
|
* @param {number} [options.top] - Shape y position
|
|
* @param {number} [options.isRegular] - Whether resizing shape has 1:1 ratio or not
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, id, options, isSilent) {
|
|
var shapeComp = graphics.getComponent(changeShape_SHAPE);
|
|
var targetObj = graphics.getObject(id);
|
|
|
|
if (!targetObj) {
|
|
return promise_default().reject(rejectMessages.noObject);
|
|
}
|
|
|
|
if (!this.isRedo) {
|
|
var undoData = changeShape_makeUndoData(options, targetObj);
|
|
changeShape_cachedUndoDataForSilent = this.setUndoData(undoData, changeShape_cachedUndoDataForSilent, isSilent);
|
|
}
|
|
|
|
return shapeComp.change(targetObj, options);
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var shapeComp = graphics.getComponent(changeShape_SHAPE);
|
|
var _this$undoData = this.undoData,
|
|
shape = _this$undoData.object,
|
|
options = _this$undoData.options;
|
|
return shapeComp.change(shape, options);
|
|
}
|
|
};
|
|
factory_command.register(changeShape_command);
|
|
/* harmony default export */ var changeShape = ((/* unused pure expression or super */ null && (changeShape_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/changeText.js
|
|
|
|
|
|
|
|
var changeText_TEXT = componentNames.TEXT;
|
|
var changeText_command = {
|
|
name: commandNames.CHANGE_TEXT,
|
|
|
|
/**
|
|
* Change a text
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @param {string} text - Changing text
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, id, text) {
|
|
var textComp = graphics.getComponent(changeText_TEXT);
|
|
var targetObj = graphics.getObject(id);
|
|
|
|
if (!targetObj) {
|
|
return promise_default().reject(rejectMessages.noObject);
|
|
}
|
|
|
|
this.undoData.object = targetObj;
|
|
this.undoData.text = textComp.getText(targetObj);
|
|
return textComp.change(targetObj, text);
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var textComp = graphics.getComponent(changeText_TEXT);
|
|
var _this$undoData = this.undoData,
|
|
textObj = _this$undoData.object,
|
|
text = _this$undoData.text;
|
|
return textComp.change(textObj, text);
|
|
}
|
|
};
|
|
factory_command.register(changeText_command);
|
|
/* harmony default export */ var changeText = ((/* unused pure expression or super */ null && (changeText_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/changeTextStyle.js
|
|
|
|
|
|
|
|
|
|
var changeTextStyle_TEXT = componentNames.TEXT;
|
|
/**
|
|
* Cached data for undo
|
|
* @type {Object}
|
|
*/
|
|
|
|
var changeTextStyle_cachedUndoDataForSilent = null;
|
|
/**
|
|
* Make undoData
|
|
* @param {object} styles - text styles
|
|
* @param {Component} targetObj - text component
|
|
* @returns {object} - undo data
|
|
*/
|
|
|
|
function changeTextStyle_makeUndoData(styles, targetObj) {
|
|
var undoData = {
|
|
object: targetObj,
|
|
styles: {}
|
|
};
|
|
forEachOwnProperties_default()(styles, function (value, key) {
|
|
var undoValue = targetObj[key];
|
|
undoData.styles[key] = undoValue;
|
|
});
|
|
return undoData;
|
|
}
|
|
|
|
var changeTextStyle_command = {
|
|
name: commandNames.CHANGE_TEXT_STYLE,
|
|
|
|
/**
|
|
* Change text styles
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @param {Object} styles - text styles
|
|
* @param {string} [styles.fill] Color
|
|
* @param {string} [styles.fontFamily] Font type for text
|
|
* @param {number} [styles.fontSize] Size
|
|
* @param {string} [styles.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [styles.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [styles.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [styles.textDecoration] Type of line (underline / line-through / overline)
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, id, styles, isSilent) {
|
|
var textComp = graphics.getComponent(changeTextStyle_TEXT);
|
|
var targetObj = graphics.getObject(id);
|
|
|
|
if (!targetObj) {
|
|
return promise_default().reject(rejectMessages.noObject);
|
|
}
|
|
|
|
if (!this.isRedo) {
|
|
var undoData = changeTextStyle_makeUndoData(styles, targetObj);
|
|
changeTextStyle_cachedUndoDataForSilent = this.setUndoData(undoData, changeTextStyle_cachedUndoDataForSilent, isSilent);
|
|
}
|
|
|
|
return textComp.setStyle(targetObj, styles);
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var textComp = graphics.getComponent(changeTextStyle_TEXT);
|
|
var _this$undoData = this.undoData,
|
|
textObj = _this$undoData.object,
|
|
styles = _this$undoData.styles;
|
|
return textComp.setStyle(textObj, styles);
|
|
}
|
|
};
|
|
factory_command.register(changeTextStyle_command);
|
|
/* harmony default export */ var changeTextStyle = ((/* unused pure expression or super */ null && (changeTextStyle_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/clearObjects.js
|
|
|
|
|
|
|
|
var clearObjects_command = {
|
|
name: commandNames.CLEAR_OBJECTS,
|
|
|
|
/**
|
|
* Clear all objects without background (main) image
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics) {
|
|
var _this = this;
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
_this.undoData.objects = graphics.removeAll();
|
|
resolve();
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
* @ignore
|
|
*/
|
|
undo: function undo(graphics) {
|
|
graphics.add(this.undoData.objects);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(clearObjects_command);
|
|
/* harmony default export */ var clearObjects = ((/* unused pure expression or super */ null && (clearObjects_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/flip.js
|
|
|
|
|
|
var FLIP = componentNames.FLIP;
|
|
var flip_command = {
|
|
name: commandNames.FLIP_IMAGE,
|
|
|
|
/**
|
|
* flip an image
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - 'flipX' or 'flipY' or 'reset'
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, type) {
|
|
var flipComp = graphics.getComponent(FLIP);
|
|
this.undoData.setting = flipComp.getCurrentSetting();
|
|
return flipComp[type]();
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var flipComp = graphics.getComponent(FLIP);
|
|
return flipComp.set(this.undoData.setting);
|
|
}
|
|
};
|
|
factory_command.register(flip_command);
|
|
/* harmony default export */ var command_flip = ((/* unused pure expression or super */ null && (flip_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/loadImage.js
|
|
|
|
|
|
|
|
|
|
var IMAGE_LOADER = componentNames.IMAGE_LOADER;
|
|
var loadImage_command = {
|
|
name: commandNames.LOAD_IMAGE,
|
|
|
|
/**
|
|
* Load a background (main) image
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} imageName - Image name
|
|
* @param {string} imgUrl - Image Url
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, imageName, imgUrl) {
|
|
var _context;
|
|
|
|
var loader = graphics.getComponent(IMAGE_LOADER);
|
|
var prevImage = loader.getCanvasImage();
|
|
var prevImageWidth = prevImage ? prevImage.width : 0;
|
|
var prevImageHeight = prevImage ? prevImage.height : 0;
|
|
|
|
var objects = filter_default()(_context = graphics.removeAll(true)).call(_context, function (objectItem) {
|
|
return objectItem.type !== 'cropzone';
|
|
});
|
|
|
|
for_each_default()(objects).call(objects, function (objectItem) {
|
|
objectItem.evented = true;
|
|
});
|
|
|
|
this.undoData = {
|
|
name: loader.getImageName(),
|
|
image: prevImage,
|
|
objects: objects
|
|
};
|
|
return loader.load(imageName, imgUrl).then(function (newImage) {
|
|
return {
|
|
oldWidth: prevImageWidth,
|
|
oldHeight: prevImageHeight,
|
|
newWidth: newImage.width,
|
|
newHeight: newImage.height
|
|
};
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var loader = graphics.getComponent(IMAGE_LOADER);
|
|
var _this$undoData = this.undoData,
|
|
objects = _this$undoData.objects,
|
|
name = _this$undoData.name,
|
|
image = _this$undoData.image;
|
|
graphics.removeAll(true);
|
|
graphics.add(objects);
|
|
return loader.load(name, image);
|
|
}
|
|
};
|
|
factory_command.register(loadImage_command);
|
|
/* harmony default export */ var loadImage = ((/* unused pure expression or super */ null && (loadImage_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/removeFilter.js
|
|
|
|
|
|
var removeFilter_FILTER = componentNames.FILTER;
|
|
var removeFilter_command = {
|
|
name: commandNames.REMOVE_FILTER,
|
|
|
|
/**
|
|
* Remove a filter from an image
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - Filter type
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, type) {
|
|
var filterComp = graphics.getComponent(removeFilter_FILTER);
|
|
this.undoData.options = filterComp.getOptions(type);
|
|
return filterComp.remove(type);
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - Filter type
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics, type) {
|
|
var filterComp = graphics.getComponent(removeFilter_FILTER);
|
|
var options = this.undoData.options;
|
|
return filterComp.add(type, options);
|
|
}
|
|
};
|
|
factory_command.register(removeFilter_command);
|
|
/* harmony default export */ var removeFilter = ((/* unused pure expression or super */ null && (removeFilter_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/removeObject.js
|
|
|
|
|
|
|
|
var removeObject_command = {
|
|
name: commandNames.REMOVE_OBJECT,
|
|
|
|
/**
|
|
* Remove an object
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, id) {
|
|
var _this = this;
|
|
|
|
return new (promise_default())(function (resolve, reject) {
|
|
_this.undoData.objects = graphics.removeObjectById(id);
|
|
|
|
if (_this.undoData.objects.length) {
|
|
resolve();
|
|
} else {
|
|
reject(rejectMessages.noObject);
|
|
}
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
graphics.add(this.undoData.objects);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(removeObject_command);
|
|
/* harmony default export */ var removeObject = ((/* unused pure expression or super */ null && (removeObject_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/resizeCanvasDimension.js
|
|
|
|
|
|
|
|
var resizeCanvasDimension_command = {
|
|
name: commandNames.RESIZE_CANVAS_DIMENSION,
|
|
|
|
/**
|
|
* resize the canvas with given dimension
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {{width: number, height: number}} dimension - Max width & height
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, dimension) {
|
|
var _this = this;
|
|
|
|
return new (promise_default())(function (resolve) {
|
|
_this.undoData.size = {
|
|
width: graphics.cssMaxWidth,
|
|
height: graphics.cssMaxHeight
|
|
};
|
|
graphics.setCssMaxDimension(dimension);
|
|
graphics.adjustCanvasDimension();
|
|
resolve();
|
|
});
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
graphics.setCssMaxDimension(this.undoData.size);
|
|
graphics.adjustCanvasDimension();
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(resizeCanvasDimension_command);
|
|
/* harmony default export */ var resizeCanvasDimension = ((/* unused pure expression or super */ null && (resizeCanvasDimension_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/rotate.js
|
|
|
|
|
|
|
|
var ROTATION = componentNames.ROTATION;
|
|
/**
|
|
* Cached data for undo
|
|
* @type {Object}
|
|
*/
|
|
|
|
var rotate_cachedUndoDataForSilent = null;
|
|
/**
|
|
* Make undo data
|
|
* @param {Component} rotationComp - rotation component
|
|
* @returns {object} - undodata
|
|
*/
|
|
|
|
function rotate_makeUndoData(rotationComp) {
|
|
return {
|
|
angle: rotationComp.getCurrentAngle()
|
|
};
|
|
}
|
|
|
|
var rotate_command = {
|
|
name: commandNames.ROTATE_IMAGE,
|
|
|
|
/**
|
|
* Rotate an image
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {string} type - 'rotate' or 'setAngle'
|
|
* @param {number} angle - angle value (degree)
|
|
* @param {boolean} isSilent - is silent execution or not
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, type, angle, isSilent) {
|
|
var rotationComp = graphics.getComponent(ROTATION);
|
|
|
|
if (!this.isRedo) {
|
|
var undoData = rotate_makeUndoData(rotationComp);
|
|
rotate_cachedUndoDataForSilent = this.setUndoData(undoData, rotate_cachedUndoDataForSilent, isSilent);
|
|
}
|
|
|
|
return rotationComp[type](angle);
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var rotationComp = graphics.getComponent(ROTATION);
|
|
|
|
var _this$args = _slicedToArray(this.args, 3),
|
|
type = _this$args[1],
|
|
angle = _this$args[2];
|
|
|
|
if (type === 'setAngle') {
|
|
return rotationComp[type](this.undoData.angle);
|
|
}
|
|
|
|
return rotationComp.rotate(-angle);
|
|
}
|
|
};
|
|
factory_command.register(rotate_command);
|
|
/* harmony default export */ var command_rotate = ((/* unused pure expression or super */ null && (rotate_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/setObjectProperties.js
|
|
|
|
|
|
|
|
|
|
var setObjectProperties_command = {
|
|
name: commandNames.SET_OBJECT_PROPERTIES,
|
|
|
|
/**
|
|
* Set object properties
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @param {Object} props - properties
|
|
* @param {string} [props.fill] Color
|
|
* @param {string} [props.fontFamily] Font type for text
|
|
* @param {number} [props.fontSize] Size
|
|
* @param {string} [props.fontStyle] Type of inclination (normal / italic)
|
|
* @param {string} [props.fontWeight] Type of thicker or thinner looking (normal / bold)
|
|
* @param {string} [props.textAlign] Type of text align (left / center / right)
|
|
* @param {string} [props.textDecoration] Type of line (underline / line-through / overline)
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, id, props) {
|
|
var _this = this;
|
|
|
|
var targetObj = graphics.getObject(id);
|
|
|
|
if (!targetObj) {
|
|
return promise_default().reject(rejectMessages.noObject);
|
|
}
|
|
|
|
this.undoData.props = {};
|
|
forEachOwnProperties_default()(props, function (value, key) {
|
|
_this.undoData.props[key] = targetObj[key];
|
|
});
|
|
graphics.setObjectProperties(id, props);
|
|
return promise_default().resolve();
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics, id) {
|
|
var props = this.undoData.props;
|
|
graphics.setObjectProperties(id, props);
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(setObjectProperties_command);
|
|
/* harmony default export */ var setObjectProperties = ((/* unused pure expression or super */ null && (setObjectProperties_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/setObjectPosition.js
|
|
|
|
|
|
|
|
var setObjectPosition_command = {
|
|
name: commandNames.SET_OBJECT_POSITION,
|
|
|
|
/**
|
|
* Set object properties
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {number} id - object id
|
|
* @param {Object} posInfo - position object
|
|
* @param {number} posInfo.x - x position
|
|
* @param {number} posInfo.y - y position
|
|
* @param {string} posInfo.originX - can be 'left', 'center', 'right'
|
|
* @param {string} posInfo.originY - can be 'top', 'center', 'bottom'
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, id, posInfo) {
|
|
var targetObj = graphics.getObject(id);
|
|
|
|
if (!targetObj) {
|
|
return promise_default().reject(rejectMessages.noObject);
|
|
}
|
|
|
|
this.undoData.objectId = id;
|
|
this.undoData.props = graphics.getObjectProperties(id, ['left', 'top']);
|
|
graphics.setObjectPosition(id, posInfo);
|
|
graphics.renderAll();
|
|
return promise_default().resolve();
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var _this$undoData = this.undoData,
|
|
objectId = _this$undoData.objectId,
|
|
props = _this$undoData.props;
|
|
graphics.setObjectProperties(objectId, props);
|
|
graphics.renderAll();
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(setObjectPosition_command);
|
|
/* harmony default export */ var setObjectPosition = ((/* unused pure expression or super */ null && (setObjectPosition_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/changeSelection.js
|
|
|
|
|
|
|
|
|
|
|
|
var changeSelection_command = {
|
|
name: commandNames.CHANGE_SELECTION,
|
|
execute: function execute(graphics, props) {
|
|
if (this.isRedo) {
|
|
for_each_default()(props).call(props, function (prop) {
|
|
graphics.setObjectProperties(prop.id, prop);
|
|
});
|
|
} else {
|
|
this.undoData = getCachedUndoDataForDimension();
|
|
}
|
|
|
|
return promise_default().resolve();
|
|
},
|
|
undo: function undo(graphics) {
|
|
var _context;
|
|
|
|
for_each_default()(_context = this.undoData).call(_context, function (datum) {
|
|
graphics.setObjectProperties(datum.id, datum);
|
|
});
|
|
|
|
return promise_default().resolve();
|
|
}
|
|
};
|
|
factory_command.register(changeSelection_command);
|
|
/* harmony default export */ var changeSelection = ((/* unused pure expression or super */ null && (changeSelection_command)));
|
|
;// CONCATENATED MODULE: ./src/js/command/resize.js
|
|
|
|
|
|
var RESIZE = componentNames.RESIZE;
|
|
var resize_command = {
|
|
name: commandNames.RESIZE_IMAGE,
|
|
|
|
/**
|
|
* Resize an image
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @param {object} dimensions - Image Dimensions
|
|
* @returns {Promise}
|
|
*/
|
|
execute: function execute(graphics, dimensions) {
|
|
var resizeComp = graphics.getComponent(RESIZE);
|
|
var originalDimensions = resizeComp.getOriginalDimensions();
|
|
|
|
if (!originalDimensions) {
|
|
originalDimensions = resizeComp.getCurrentDimensions();
|
|
}
|
|
|
|
this.undoData.dimensions = originalDimensions;
|
|
return resizeComp.resize(dimensions);
|
|
},
|
|
|
|
/**
|
|
* @param {Graphics} graphics - Graphics instance
|
|
* @returns {Promise}
|
|
*/
|
|
undo: function undo(graphics) {
|
|
var resizeComp = graphics.getComponent(RESIZE);
|
|
return resizeComp.resize(this.undoData.dimensions);
|
|
}
|
|
};
|
|
factory_command.register(resize_command);
|
|
/* harmony default export */ var command_resize = ((/* unused pure expression or super */ null && (resize_command)));
|
|
;// CONCATENATED MODULE: ./src/index.js
|
|
|
|
|
|
// commands
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
/* harmony default export */ var src = (imageEditor);
|
|
|
|
}();
|
|
__webpack_exports__ = __webpack_exports__["default"];
|
|
/******/ return __webpack_exports__;
|
|
/******/ })()
|
|
;
|
|
}); |